You are viewing a plain text version of this content. The canonical link for it is here.
Posted to common-commits@hadoop.apache.org by as...@apache.org on 2018/01/30 18:09:43 UTC

[01/50] [abbrv] hadoop git commit: MapFile.fix creates a wrong index file in case of block-compressed data file. Contributed by Grigori Rybkine [Forced Update!]

Repository: hadoop
Updated Branches:
  refs/heads/YARN-6592 621cff97c -> 6ae4cc995 (forced update)


MapFile.fix creates a wrong index file in case of block-compressed data file. Contributed by Grigori Rybkine


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/56872cff
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/56872cff
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/56872cff

Branch: refs/heads/YARN-6592
Commit: 56872cff92f543bf77206a1324968559dceb7bc2
Parents: 8b5b045
Author: Chris Douglas <cd...@apache.org>
Authored: Fri Jan 26 09:06:48 2018 -0800
Committer: Chris Douglas <cd...@apache.org>
Committed: Fri Jan 26 09:18:30 2018 -0800

----------------------------------------------------------------------
 .../main/java/org/apache/hadoop/io/MapFile.java | 35 ++++++++++--
 .../java/org/apache/hadoop/io/TestMapFile.java  | 59 +++++++++++++++++++-
 2 files changed, 88 insertions(+), 6 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/56872cff/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/MapFile.java
----------------------------------------------------------------------
diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/MapFile.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/MapFile.java
index d56822f..51db0b3 100644
--- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/MapFile.java
+++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/MapFile.java
@@ -811,15 +811,40 @@ public class MapFile {
                                     (LongWritable.class));
     }
     try {
-      long pos = 0L;
+      /** What's the position (in bytes) we wrote when we got the last index */
+      long lastIndexPos = -1;
+      /**
+       * What was size when we last wrote an index. Set to MIN_VALUE to ensure
+       * that we have an index at position zero - midKey will throw an exception
+       * if this is not the case
+       */
+      long lastIndexKeyCount = Long.MIN_VALUE;
+      long pos = dataReader.getPosition();
       LongWritable position = new LongWritable();
+      long nextBlock = pos;
+      boolean blockCompressed = dataReader.isBlockCompressed();
       while(dataReader.next(key, value)) {
-        cnt++;
-        if (cnt % indexInterval == 0) {
+        if (blockCompressed) {
+          long curPos = dataReader.getPosition();
+          if (curPos > nextBlock) {
+            pos = nextBlock;                       // current block position
+            nextBlock = curPos;
+          }
+        }
+        // Follow the same logic as in
+        // {@link MapFile.Writer#append(WritableComparable, Writable)}
+        if (cnt >= lastIndexKeyCount + indexInterval && pos > lastIndexPos) {
           position.set(pos);
-          if (!dryrun) indexWriter.append(key, position);
+          if (!dryrun) {
+            indexWriter.append(key, position);
+          }
+          lastIndexPos = pos;
+          lastIndexKeyCount = cnt;
+        }
+        if (!blockCompressed) {
+          pos = dataReader.getPosition();         // next record position
         }
-        pos = dataReader.getPosition();
+        cnt++;
       }
     } catch(Throwable t) {
       // truncated data file. swallow it.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/56872cff/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/TestMapFile.java
----------------------------------------------------------------------
diff --git a/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/TestMapFile.java b/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/TestMapFile.java
index ff8df7c..7ec4227 100644
--- a/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/TestMapFile.java
+++ b/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/TestMapFile.java
@@ -485,6 +485,63 @@ public class TestMapFile {
       IOUtils.cleanup(null, writer);
     }
   }
+
+  /**
+   * test {@link MapFile#fix(FileSystem, Path, Class<? extends Writable>,
+   *                         Class<? extends Writable>, boolean, Configuration)}
+   * method in case of BLOCK compression
+   */
+  @Test
+  public void testFixBlockCompress() throws Exception {
+    final String indexLessMapFile = "testFixBlockCompress.mapfile";
+    final int compressBlocksize = 100;
+    final int indexInterval = 4;
+    final int noBlocks = 4;
+    final String value = "value-";
+    final int size = noBlocks * compressBlocksize / (4 + value.length());
+
+    conf.setInt("io.seqfile.compress.blocksize", compressBlocksize);
+    MapFile.Writer.setIndexInterval(conf, indexInterval);
+    FileSystem fs = FileSystem.getLocal(conf);
+    Path dir = new Path(TEST_DIR, indexLessMapFile);
+    MapFile.Writer writer = null;
+    MapFile.Reader reader = null;
+    try {
+      writer =
+          new MapFile.Writer(conf, dir,
+          MapFile.Writer.keyClass(IntWritable.class),
+          MapFile.Writer.valueClass(Text.class),
+          MapFile.Writer.compression(CompressionType.BLOCK));
+      for (int i = 0; i < size; i++) {
+        writer.append(new IntWritable(i), new Text(value + i));
+      }
+      writer.close();
+      Path index = new Path(dir, MapFile.INDEX_FILE_NAME);
+      fs.rename(index, index.suffix(".orig"));
+
+      assertEquals("No of valid MapFile entries wrong", size,
+                   MapFile.fix(fs, dir, IntWritable.class, Text.class,
+                               false, conf));
+      reader = new MapFile.Reader(dir, conf);
+      IntWritable key;
+      Text val = new Text();
+      int notFound = 0;
+      for (int i = 0; i < size; i++) {
+        key = new IntWritable(i);
+        if (null == reader.get(key, val)) {
+          notFound++;
+        }
+      }
+      assertEquals("With MapFile.fix-ed index, could not get entries # ",
+                   0, notFound);
+    } finally {
+      IOUtils.cleanupWithLogger(null, writer, reader);
+      if (fs.exists(dir)) {
+        fs.delete(dir, true);
+      }
+    }
+  }
+
   /**
    * test all available constructor for {@code MapFile.Writer}
    */
@@ -619,7 +676,7 @@ public class TestMapFile {
     } catch (Exception ex) {
       fail("testMainMethodMapFile error !!!");
     } finally {
-      IOUtils.cleanup(null, writer);
+      IOUtils.cleanupWithLogger(null, writer);
     }
   }
 


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[14/50] [abbrv] hadoop git commit: HADOOP-15186. Allow Azure Data Lake SDK dependency version to be set on the command line. Contributed by Vishwajeet Dusane.

Posted by as...@apache.org.
HADOOP-15186. Allow Azure Data Lake SDK dependency version to be set on the command line.
Contributed by Vishwajeet Dusane.

(cherry picked from commit 95a96b13e2a54e01ea6c6933045d912998477da3)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/7fd287b4
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/7fd287b4
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/7fd287b4

Branch: refs/heads/YARN-6592
Commit: 7fd287b4af5a191f18ea92850b7d904e4b4fb693
Parents: 56feaa4
Author: Steve Loughran <st...@apache.org>
Authored: Mon Jan 29 09:48:14 2018 -0800
Committer: Steve Loughran <st...@apache.org>
Committed: Mon Jan 29 09:48:14 2018 -0800

----------------------------------------------------------------------
 hadoop-tools/hadoop-azure-datalake/pom.xml | 3 ++-
 1 file changed, 2 insertions(+), 1 deletion(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/7fd287b4/hadoop-tools/hadoop-azure-datalake/pom.xml
----------------------------------------------------------------------
diff --git a/hadoop-tools/hadoop-azure-datalake/pom.xml b/hadoop-tools/hadoop-azure-datalake/pom.xml
index 3ac84ff..70c8f6c 100644
--- a/hadoop-tools/hadoop-azure-datalake/pom.xml
+++ b/hadoop-tools/hadoop-azure-datalake/pom.xml
@@ -33,6 +33,7 @@
     <minimalJsonVersion>0.9.1</minimalJsonVersion>
     <file.encoding>UTF-8</file.encoding>
     <downloadSources>true</downloadSources>
+    <azure.data.lake.store.sdk.version>2.2.5</azure.data.lake.store.sdk.version>
   </properties>
   <build>
     <plugins>
@@ -109,7 +110,7 @@
     <dependency>
       <groupId>com.microsoft.azure</groupId>
       <artifactId>azure-data-lake-store-sdk</artifactId>
-      <version>2.2.5</version>
+      <version>${azure.data.lake.store.sdk.version}</version>
     </dependency>
     <!--  ENDS HERE-->
     <dependency>


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[19/50] [abbrv] hadoop git commit: Revert "YARN-2185. Use pipes when localizing archives. Contributed by Miklos Szegedi"

Posted by as...@apache.org.
Revert "YARN-2185. Use pipes when localizing archives. Contributed by Miklos Szegedi"

This reverts commit 1b0f265db1a5bfccf1d870912237ea9618bd9c34.


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/901d15a3
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/901d15a3
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/901d15a3

Branch: refs/heads/YARN-6592
Commit: 901d15a30b9fc6c7015f4e2e2c06e6ee42a39662
Parents: 6463e10
Author: Jason Lowe <jl...@apache.org>
Authored: Tue Jan 30 08:34:39 2018 -0600
Committer: Jason Lowe <jl...@apache.org>
Committed: Tue Jan 30 08:34:39 2018 -0600

----------------------------------------------------------------------
 .../java/org/apache/hadoop/fs/FileUtil.java     | 251 +------------------
 .../java/org/apache/hadoop/util/RunJar.java     |  65 -----
 .../org/apache/hadoop/yarn/util/FSDownload.java | 215 ++++++----------
 .../apache/hadoop/yarn/util/TestFSDownload.java |  30 +--
 4 files changed, 99 insertions(+), 462 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/901d15a3/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java
index bf9b146..4d971aa 100644
--- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java
+++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java
@@ -20,35 +20,27 @@ package org.apache.hadoop.fs;
 
 import java.io.BufferedInputStream;
 import java.io.BufferedOutputStream;
-import java.io.BufferedReader;
 import java.io.File;
 import java.io.FileInputStream;
 import java.io.FileNotFoundException;
 import java.io.FileOutputStream;
 import java.io.IOException;
 import java.io.InputStream;
-import java.io.InputStreamReader;
 import java.io.OutputStream;
 import java.net.InetAddress;
 import java.net.URI;
 import java.net.UnknownHostException;
-import java.nio.charset.Charset;
 import java.nio.file.AccessDeniedException;
 import java.util.ArrayList;
 import java.util.Enumeration;
 import java.util.List;
 import java.util.Map;
-import java.util.concurrent.ExecutionException;
-import java.util.concurrent.ExecutorService;
-import java.util.concurrent.Executors;
-import java.util.concurrent.Future;
 import java.util.jar.Attributes;
 import java.util.jar.JarOutputStream;
 import java.util.jar.Manifest;
 import java.util.zip.GZIPInputStream;
 import java.util.zip.ZipEntry;
 import java.util.zip.ZipFile;
-import java.util.zip.ZipInputStream;
 
 import org.apache.commons.collections.map.CaseInsensitiveMap;
 import org.apache.commons.compress.archivers.tar.TarArchiveEntry;
@@ -83,11 +75,6 @@ public class FileUtil {
   public static final int SYMLINK_NO_PRIVILEGE = 2;
 
   /**
-   * Buffer size for copy the content of compressed file to new file.
-   */
-  private static final int BUFFER_SIZE = 8_192;
-
-  /**
    * convert an array of FileStatus to an array of Path
    *
    * @param stats
@@ -539,22 +526,6 @@ public class FileUtil {
   }
 
   /**
-   * Convert a os-native filename to a path that works for the shell
-   * and avoids script injection attacks.
-   * @param file The filename to convert
-   * @return The unix pathname
-   * @throws IOException on windows, there can be problems with the subprocess
-   */
-  public static String makeSecureShellPath(File file) throws IOException {
-    if (Shell.WINDOWS) {
-      // Currently it is never called, but it might be helpful in the future.
-      throw new UnsupportedOperationException("Not implemented for Windows");
-    } else {
-      return makeShellPath(file, false).replace("'", "'\\''");
-    }
-  }
-
-  /**
    * Convert a os-native filename to a path that works for the shell.
    * @param file The filename to convert
    * @param makeCanonicalPath
@@ -605,48 +576,11 @@ public class FileUtil {
   }
 
   /**
-   * Given a stream input it will unzip the it in the unzip directory.
-   * passed as the second parameter
-   * @param inputStream The zip file as input
-   * @param toDir The unzip directory where to unzip the zip file.
-   * @throws IOException an exception occurred
-   */
-  public static void unZip(InputStream inputStream, File toDir)
-      throws IOException {
-    try (ZipInputStream zip = new ZipInputStream(inputStream)) {
-      int numOfFailedLastModifiedSet = 0;
-      for(ZipEntry entry = zip.getNextEntry();
-          entry != null;
-          entry = zip.getNextEntry()) {
-        if (!entry.isDirectory()) {
-          File file = new File(toDir, entry.getName());
-          File parent = file.getParentFile();
-          if (!parent.mkdirs() &&
-              !parent.isDirectory()) {
-            throw new IOException("Mkdirs failed to create " +
-                parent.getAbsolutePath());
-          }
-          try (OutputStream out = new FileOutputStream(file)) {
-            IOUtils.copyBytes(zip, out, BUFFER_SIZE);
-          }
-          if (!file.setLastModified(entry.getTime())) {
-            numOfFailedLastModifiedSet++;
-          }
-        }
-      }
-      if (numOfFailedLastModifiedSet > 0) {
-        LOG.warn("Could not set last modfied time for {} file(s)",
-            numOfFailedLastModifiedSet);
-      }
-    }
-  }
-
-  /**
-   * Given a File input it will unzip it in the unzip directory.
+   * Given a File input it will unzip the file in a the unzip directory
    * passed as the second parameter
    * @param inFile The zip file as input
    * @param unzipDir The unzip directory where to unzip the zip file.
-   * @throws IOException An I/O exception has occurred
+   * @throws IOException
    */
   public static void unZip(File inFile, File unzipDir) throws IOException {
     Enumeration<? extends ZipEntry> entries;
@@ -687,138 +621,6 @@ public class FileUtil {
   }
 
   /**
-   * Run a command and send the contents of an input stream to it.
-   * @param inputStream Input stream to forward to the shell command
-   * @param command shell command to run
-   * @throws IOException read or write failed
-   * @throws InterruptedException command interrupted
-   * @throws ExecutionException task submit failed
-   */
-  private static void runCommandOnStream(
-      InputStream inputStream, String command)
-      throws IOException, InterruptedException, ExecutionException {
-    ExecutorService executor = null;
-    ProcessBuilder builder = new ProcessBuilder();
-    builder.command(
-        Shell.WINDOWS ? "cmd" : "bash",
-        Shell.WINDOWS ? "/c" : "-c",
-        command);
-    Process process = builder.start();
-    int exitCode;
-    try {
-      // Consume stdout and stderr, to avoid blocking the command
-      executor = Executors.newFixedThreadPool(2);
-      Future output = executor.submit(() -> {
-        try {
-          // Read until the output stream receives an EOF and closed.
-          if (LOG.isDebugEnabled()) {
-            // Log directly to avoid out of memory errors
-            try (BufferedReader reader =
-                     new BufferedReader(
-                         new InputStreamReader(process.getInputStream(),
-                             Charset.forName("UTF-8")))) {
-              String line;
-              while((line = reader.readLine()) != null) {
-                LOG.debug(line);
-              }
-            }
-          } else {
-            org.apache.commons.io.IOUtils.copy(
-                process.getInputStream(),
-                new IOUtils.NullOutputStream());
-          }
-        } catch (IOException e) {
-          LOG.debug(e.getMessage());
-        }
-      });
-      Future error = executor.submit(() -> {
-        try {
-          // Read until the error stream receives an EOF and closed.
-          if (LOG.isDebugEnabled()) {
-            // Log directly to avoid out of memory errors
-            try (BufferedReader reader =
-                     new BufferedReader(
-                         new InputStreamReader(process.getErrorStream(),
-                             Charset.forName("UTF-8")))) {
-              String line;
-              while((line = reader.readLine()) != null) {
-                LOG.debug(line);
-              }
-            }
-          } else {
-            org.apache.commons.io.IOUtils.copy(
-                process.getErrorStream(),
-                new IOUtils.NullOutputStream());
-          }
-        } catch (IOException e) {
-          LOG.debug(e.getMessage());
-        }
-      });
-
-      // Pass the input stream to the command to process
-      try {
-        org.apache.commons.io.IOUtils.copy(
-            inputStream, process.getOutputStream());
-      } finally {
-        process.getOutputStream().close();
-      }
-
-      // Wait for both stdout and stderr futures to finish
-      error.get();
-      output.get();
-    } finally {
-      // Clean up the threads
-      if (executor != null) {
-        executor.shutdown();
-      }
-      // Wait to avoid leaking the child process
-      exitCode = process.waitFor();
-    }
-
-    if (exitCode != 0) {
-      throw new IOException(
-          String.format(
-              "Error executing command. %s " +
-                  "Process exited with exit code %d.",
-              command, exitCode));
-    }
-  }
-
-  /**
-   * Given a Tar File as input it will untar the file in a the untar directory
-   * passed as the second parameter
-   *
-   * This utility will untar ".tar" files and ".tar.gz","tgz" files.
-   *
-   * @param inputStream The tar file as input.
-   * @param untarDir The untar directory where to untar the tar file.
-   * @param gzipped The input stream is gzipped
-   *                TODO Use magic number and PusbackInputStream to identify
-   * @throws IOException an exception occurred
-   * @throws InterruptedException command interrupted
-   * @throws ExecutionException task submit failed
-   */
-  public static void unTar(InputStream inputStream, File untarDir,
-                           boolean gzipped)
-      throws IOException, InterruptedException, ExecutionException {
-    if (!untarDir.mkdirs()) {
-      if (!untarDir.isDirectory()) {
-        throw new IOException("Mkdirs failed to create " + untarDir);
-      }
-    }
-
-    if(Shell.WINDOWS) {
-      // Tar is not native to Windows. Use simple Java based implementation for
-      // tests and simple tar archives
-      unTarUsingJava(inputStream, untarDir, gzipped);
-    } else {
-      // spawn tar utility to untar archive for full fledged unix behavior such
-      // as resolving symlinks in tar archives
-      unTarUsingTar(inputStream, untarDir, gzipped);
-    }
-  }
-
-  /**
    * Given a Tar File as input it will untar the file in a the untar directory
    * passed as the second parameter
    *
@@ -848,41 +650,23 @@ public class FileUtil {
     }
   }
 
-  private static void unTarUsingTar(InputStream inputStream, File untarDir,
-                                    boolean gzipped)
-      throws IOException, InterruptedException, ExecutionException {
-    StringBuilder untarCommand = new StringBuilder();
-    if (gzipped) {
-      untarCommand.append("gzip -dc | (");
-    }
-    untarCommand.append("cd '");
-    untarCommand.append(FileUtil.makeSecureShellPath(untarDir));
-    untarCommand.append("' && ");
-    untarCommand.append("tar -x ");
-
-    if (gzipped) {
-      untarCommand.append(")");
-    }
-    runCommandOnStream(inputStream, untarCommand.toString());
-  }
-
   private static void unTarUsingTar(File inFile, File untarDir,
       boolean gzipped) throws IOException {
     StringBuffer untarCommand = new StringBuffer();
     if (gzipped) {
       untarCommand.append(" gzip -dc '");
-      untarCommand.append(FileUtil.makeSecureShellPath(inFile));
+      untarCommand.append(FileUtil.makeShellPath(inFile));
       untarCommand.append("' | (");
     }
     untarCommand.append("cd '");
-    untarCommand.append(FileUtil.makeSecureShellPath(untarDir));
-    untarCommand.append("' && ");
+    untarCommand.append(FileUtil.makeShellPath(untarDir));
+    untarCommand.append("' ; ");
     untarCommand.append("tar -xf ");
 
     if (gzipped) {
       untarCommand.append(" -)");
     } else {
-      untarCommand.append(FileUtil.makeSecureShellPath(inFile));
+      untarCommand.append(FileUtil.makeShellPath(inFile));
     }
     String[] shellCmd = { "bash", "-c", untarCommand.toString() };
     ShellCommandExecutor shexec = new ShellCommandExecutor(shellCmd);
@@ -917,29 +701,6 @@ public class FileUtil {
     }
   }
 
-  private static void unTarUsingJava(InputStream inputStream, File untarDir,
-                                     boolean gzipped) throws IOException {
-    TarArchiveInputStream tis = null;
-    try {
-      if (gzipped) {
-        inputStream = new BufferedInputStream(new GZIPInputStream(
-            inputStream));
-      } else {
-        inputStream =
-            new BufferedInputStream(inputStream);
-      }
-
-      tis = new TarArchiveInputStream(inputStream);
-
-      for (TarArchiveEntry entry = tis.getNextTarEntry(); entry != null;) {
-        unpackEntries(tis, entry, untarDir);
-        entry = tis.getNextTarEntry();
-      }
-    } finally {
-      IOUtils.cleanupWithLogger(LOG, tis, inputStream);
-    }
-  }
-
   private static void unpackEntries(TarArchiveInputStream tis,
       TarArchiveEntry entry, File outputDir) throws IOException {
     if (entry.isDirectory()) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/901d15a3/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java
----------------------------------------------------------------------
diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java
index 89b7d76..19b51ad 100644
--- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java
+++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java
@@ -34,11 +34,9 @@ import java.util.Enumeration;
 import java.util.List;
 import java.util.jar.JarEntry;
 import java.util.jar.JarFile;
-import java.util.jar.JarInputStream;
 import java.util.jar.Manifest;
 import java.util.regex.Pattern;
 
-import org.apache.commons.io.input.TeeInputStream;
 import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceStability;
 import org.apache.hadoop.fs.FileUtil;
@@ -100,69 +98,6 @@ public class RunJar {
    * Unpack matching files from a jar. Entries inside the jar that do
    * not match the given pattern will be skipped.
    *
-   * @param inputStream the jar stream to unpack
-   * @param toDir the destination directory into which to unpack the jar
-   * @param unpackRegex the pattern to match jar entries against
-   *
-   * @throws IOException if an I/O error has occurred or toDir
-   * cannot be created and does not already exist
-   */
-  public static void unJar(InputStream inputStream, File toDir,
-                           Pattern unpackRegex)
-      throws IOException {
-    try (JarInputStream jar = new JarInputStream(inputStream)) {
-      int numOfFailedLastModifiedSet = 0;
-      for (JarEntry entry = jar.getNextJarEntry();
-           entry != null;
-           entry = jar.getNextJarEntry()) {
-        if (!entry.isDirectory() &&
-            unpackRegex.matcher(entry.getName()).matches()) {
-          File file = new File(toDir, entry.getName());
-          ensureDirectory(file.getParentFile());
-          try (OutputStream out = new FileOutputStream(file)) {
-            IOUtils.copyBytes(jar, out, BUFFER_SIZE);
-          }
-          if (!file.setLastModified(entry.getTime())) {
-            numOfFailedLastModifiedSet++;
-          }
-        }
-      }
-      if (numOfFailedLastModifiedSet > 0) {
-        LOG.warn("Could not set last modfied time for {} file(s)",
-            numOfFailedLastModifiedSet);
-      }
-    }
-  }
-
-  /**
-   * Unpack matching files from a jar. Entries inside the jar that do
-   * not match the given pattern will be skipped. Keep also a copy
-   * of the entire jar in the same directory for backward compatibility.
-   * TODO remove this feature in a new release and do only unJar
-   *
-   * @param inputStream the jar stream to unpack
-   * @param toDir the destination directory into which to unpack the jar
-   * @param unpackRegex the pattern to match jar entries against
-   *
-   * @throws IOException if an I/O error has occurred or toDir
-   * cannot be created and does not already exist
-   */
-  @Deprecated
-  public static void unJarAndSave(InputStream inputStream, File toDir,
-                           String name, Pattern unpackRegex)
-      throws IOException{
-    File file = new File(toDir, name);
-    ensureDirectory(toDir);
-    try (OutputStream jar = new FileOutputStream(file);
-         TeeInputStream teeInputStream = new TeeInputStream(inputStream, jar)) {
-      unJar(teeInputStream, toDir, unpackRegex);
-    }
-  }
-
-  /**
-   * Unpack matching files from a jar. Entries inside the jar that do
-   * not match the given pattern will be skipped.
-   *
    * @param jarFile the .jar file to unpack
    * @param toDir the destination directory into which to unpack the jar
    * @param unpackRegex the pattern to match jar entries against

http://git-wip-us.apache.org/repos/asf/hadoop/blob/901d15a3/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java
index 1a60948..6e59574 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java
@@ -21,8 +21,6 @@ package org.apache.hadoop.yarn.util;
 import java.io.File;
 import java.io.FileNotFoundException;
 import java.io.IOException;
-import java.io.InputStream;
-import java.io.OutputStream;
 import java.net.URISyntaxException;
 import java.security.PrivilegedExceptionAction;
 import java.util.concurrent.Callable;
@@ -31,7 +29,6 @@ import java.util.concurrent.Future;
 import java.util.regex.Pattern;
 
 import org.apache.commons.io.FileUtils;
-import org.apache.commons.io.IOUtils;
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.classification.InterfaceAudience.LimitedPrivate;
@@ -57,7 +54,6 @@ import com.google.common.annotations.VisibleForTesting;
 import com.google.common.cache.CacheLoader;
 import com.google.common.cache.LoadingCache;
 import com.google.common.util.concurrent.Futures;
-import org.apache.hadoop.yarn.exceptions.YarnException;
 
 /**
  * Download a single URL to the local disk.
@@ -251,21 +247,9 @@ public class FSDownload implements Callable<Path> {
     }
   }
 
-  /**
-   * Localize files.
-   * @param destination destination directory
-   * @throws IOException cannot read or write file
-   * @throws YarnException subcommand returned an error
-   */
-  private void verifyAndCopy(Path destination)
-      throws IOException, YarnException {
-    final Path sCopy;
-    try {
-      sCopy = resource.getResource().toPath();
-    } catch (URISyntaxException e) {
-      throw new IOException("Invalid resource", e);
-    }
+  private Path copy(Path sCopy, Path dstdir) throws IOException {
     FileSystem sourceFs = sCopy.getFileSystem(conf);
+    Path dCopy = new Path(dstdir, "tmp_"+sCopy.getName());
     FileStatus sStat = sourceFs.getFileStatus(sCopy);
     if (sStat.getModificationTime() != resource.getTimestamp()) {
       throw new IOException("Resource " + sCopy +
@@ -280,108 +264,82 @@ public class FSDownload implements Callable<Path> {
       }
     }
 
-    downloadAndUnpack(sCopy, destination);
+    FileUtil.copy(sourceFs, sStat, FileSystem.getLocal(conf), dCopy, false,
+        true, conf);
+    return dCopy;
   }
 
-  /**
-   * Copy source path to destination with localization rules.
-   * @param source source path to copy. Typically HDFS
-   * @param destination destination path. Typically local filesystem
-   * @exception YarnException Any error has occurred
-   */
-  private void downloadAndUnpack(Path source, Path destination)
-      throws YarnException {
-    try {
-      FileSystem sourceFileSystem = source.getFileSystem(conf);
-      FileSystem destinationFileSystem = destination.getFileSystem(conf);
-      if (sourceFileSystem.getFileStatus(source).isDirectory()) {
-        FileUtil.copy(
-            sourceFileSystem, source,
-            destinationFileSystem, destination, false,
-            true, conf);
+  private long unpack(File localrsrc, File dst) throws IOException {
+    switch (resource.getType()) {
+    case ARCHIVE: {
+      String lowerDst = StringUtils.toLowerCase(dst.getName());
+      if (lowerDst.endsWith(".jar")) {
+        RunJar.unJar(localrsrc, dst);
+      } else if (lowerDst.endsWith(".zip")) {
+        FileUtil.unZip(localrsrc, dst);
+      } else if (lowerDst.endsWith(".tar.gz") ||
+                 lowerDst.endsWith(".tgz") ||
+                 lowerDst.endsWith(".tar")) {
+        FileUtil.unTar(localrsrc, dst);
       } else {
-        unpack(source, destination, sourceFileSystem, destinationFileSystem);
+        LOG.warn("Cannot unpack " + localrsrc);
+        if (!localrsrc.renameTo(dst)) {
+            throw new IOException("Unable to rename file: [" + localrsrc
+              + "] to [" + dst + "]");
+        }
       }
-    } catch (Exception e) {
-      throw new YarnException("Download and unpack failed", e);
     }
-  }
-
-  /**
-   * Do the localization action on the input stream.
-   * We use the deprecated method RunJar.unJarAndSave for compatibility reasons.
-   * We should use the more efficient RunJar.unJar in the future.
-   * @param source Source path
-   * @param destination Destination pth
-   * @param sourceFileSystem Source filesystem
-   * @param destinationFileSystem Destination filesystem
-   * @throws IOException Could not read or write stream
-   * @throws InterruptedException Operation interrupted by caller
-   * @throws ExecutionException Could not create thread pool execution
-   */
-  @SuppressWarnings("deprecation")
-  private void unpack(Path source, Path destination,
-                      FileSystem sourceFileSystem,
-                      FileSystem destinationFileSystem)
-      throws IOException, InterruptedException, ExecutionException {
-    try (InputStream inputStream = sourceFileSystem.open(source)) {
-      File dst = new File(destination.toUri());
+    break;
+    case PATTERN: {
       String lowerDst = StringUtils.toLowerCase(dst.getName());
-      switch (resource.getType()) {
-      case ARCHIVE:
-        if (lowerDst.endsWith(".jar")) {
-          RunJar.unJar(inputStream, dst, RunJar.MATCH_ANY);
-        } else if (lowerDst.endsWith(".zip")) {
-          FileUtil.unZip(inputStream, dst);
-        } else if (lowerDst.endsWith(".tar.gz") ||
-            lowerDst.endsWith(".tgz") ||
-            lowerDst.endsWith(".tar")) {
-          FileUtil.unTar(inputStream, dst, lowerDst.endsWith("gz"));
-        } else {
-          LOG.warn("Cannot unpack " + source);
-          try (OutputStream outputStream =
-                   destinationFileSystem.create(destination, true)) {
-            IOUtils.copy(inputStream, outputStream);
-          }
+      if (lowerDst.endsWith(".jar")) {
+        String p = resource.getPattern();
+        RunJar.unJar(localrsrc, dst,
+            p == null ? RunJar.MATCH_ANY : Pattern.compile(p));
+        File newDst = new File(dst, dst.getName());
+        if (!dst.exists() && !dst.mkdir()) {
+          throw new IOException("Unable to create directory: [" + dst + "]");
         }
-        break;
-      case PATTERN:
-        if (lowerDst.endsWith(".jar")) {
-          String p = resource.getPattern();
-          if (!dst.exists() && !dst.mkdir()) {
-            throw new IOException("Unable to create directory: [" + dst + "]");
-          }
-          RunJar.unJarAndSave(inputStream, dst, source.getName(),
-              p == null ? RunJar.MATCH_ANY : Pattern.compile(p));
-        } else if (lowerDst.endsWith(".zip")) {
-          LOG.warn("Treating [" + source + "] as an archive even though it " +
-              "was specified as PATTERN");
-          FileUtil.unZip(inputStream, dst);
-        } else if (lowerDst.endsWith(".tar.gz") ||
-            lowerDst.endsWith(".tgz") ||
-            lowerDst.endsWith(".tar")) {
-          LOG.warn("Treating [" + source + "] as an archive even though it " +
-              "was specified as PATTERN");
-          FileUtil.unTar(inputStream, dst, lowerDst.endsWith("gz"));
-        } else {
-          LOG.warn("Cannot unpack " + source);
-          try (OutputStream outputStream =
-                   destinationFileSystem.create(destination, true)) {
-            IOUtils.copy(inputStream, outputStream);
-          }
+        if (!localrsrc.renameTo(newDst)) {
+          throw new IOException("Unable to rename file: [" + localrsrc
+              + "] to [" + newDst + "]");
         }
-        break;
-      case FILE:
-      default:
-        try (OutputStream outputStream =
-                 destinationFileSystem.create(destination, true)) {
-          IOUtils.copy(inputStream, outputStream);
+      } else if (lowerDst.endsWith(".zip")) {
+        LOG.warn("Treating [" + localrsrc + "] as an archive even though it " +
+        		"was specified as PATTERN");
+        FileUtil.unZip(localrsrc, dst);
+      } else if (lowerDst.endsWith(".tar.gz") ||
+                 lowerDst.endsWith(".tgz") ||
+                 lowerDst.endsWith(".tar")) {
+        LOG.warn("Treating [" + localrsrc + "] as an archive even though it " +
+        "was specified as PATTERN");
+        FileUtil.unTar(localrsrc, dst);
+      } else {
+        LOG.warn("Cannot unpack " + localrsrc);
+        if (!localrsrc.renameTo(dst)) {
+          throw new IOException("Unable to rename file: [" + localrsrc
+              + "] to [" + dst + "]");
         }
-        break;
       }
-      // TODO Should calculate here before returning
-      //return FileUtil.getDU(destDir);
     }
+    break;
+    case FILE:
+    default:
+      if (!localrsrc.renameTo(dst)) {
+        throw new IOException("Unable to rename file: [" + localrsrc
+          + "] to [" + dst + "]");
+      }
+      break;
+    }
+    if(localrsrc.isFile()){
+      try {
+        files.delete(new Path(localrsrc.toString()), false);
+      } catch (IOException ignore) {
+      }
+    }
+    return 0;
+    // TODO Should calculate here before returning
+    //return FileUtil.getDU(destDir);
   }
 
   @Override
@@ -394,34 +352,27 @@ public class FSDownload implements Callable<Path> {
     }
 
     if (LOG.isDebugEnabled()) {
-      LOG.debug(String.format("Starting to download %s %s %s",
-          sCopy,
-          resource.getType(),
-          resource.getPattern()));
+      LOG.debug("Starting to download " + sCopy);
     }
 
-    final Path destinationTmp = new Path(destDirPath + "_tmp");
-    createDir(destinationTmp, PRIVATE_DIR_PERMS);
-    Path dFinal =
-        files.makeQualified(new Path(destinationTmp, sCopy.getName()));
+    createDir(destDirPath, cachePerms);
+    final Path dst_work = new Path(destDirPath + "_tmp");
+    createDir(dst_work, cachePerms);
+    Path dFinal = files.makeQualified(new Path(dst_work, sCopy.getName()));
     try {
-      if (userUgi == null) {
-        verifyAndCopy(dFinal);
-      } else {
-        userUgi.doAs(new PrivilegedExceptionAction<Void>() {
-          @Override
-          public Void run() throws Exception {
-            verifyAndCopy(dFinal);
-            return null;
-          }
-        });
-      }
+      Path dTmp = null == userUgi ? files.makeQualified(copy(sCopy, dst_work))
+          : userUgi.doAs(new PrivilegedExceptionAction<Path>() {
+            public Path run() throws Exception {
+              return files.makeQualified(copy(sCopy, dst_work));
+            };
+          });
+      unpack(new File(dTmp.toUri()), new File(dFinal.toUri()));
       changePermissions(dFinal.getFileSystem(conf), dFinal);
-      files.rename(destinationTmp, destDirPath, Rename.OVERWRITE);
+      files.rename(dst_work, destDirPath, Rename.OVERWRITE);
 
       if (LOG.isDebugEnabled()) {
-        LOG.debug(String.format("File has been downloaded to %s from %s",
-            new Path(destDirPath, sCopy.getName()), sCopy));
+        LOG.debug("File has been downloaded to " +
+            new Path(destDirPath, sCopy.getName()));
       }
     } catch (Exception e) {
       try {
@@ -431,7 +382,7 @@ public class FSDownload implements Callable<Path> {
       throw e;
     } finally {
       try {
-        files.delete(destinationTmp, true);
+        files.delete(dst_work, true);
       } catch (FileNotFoundException ignore) {
       }
       conf = null;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/901d15a3/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java
index fa8c039..877dd08 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java
@@ -82,9 +82,6 @@ import com.google.common.cache.CacheBuilder;
 import com.google.common.cache.CacheLoader;
 import com.google.common.cache.LoadingCache;
 
-/**
- * Unit test for the FSDownload class.
- */
 public class TestFSDownload {
 
   private static final Log LOG = LogFactory.getLog(TestFSDownload.class);
@@ -93,8 +90,7 @@ public class TestFSDownload {
   private enum TEST_FILE_TYPE {
     TAR, JAR, ZIP, TGZ
   };
-  private Configuration conf = new Configuration();
-
+  
   @AfterClass
   public static void deleteTestDir() throws IOException {
     FileContext fs = FileContext.getLocalFSFileContext();
@@ -136,18 +132,6 @@ public class TestFSDownload {
     FileOutputStream stream = new FileOutputStream(jarFile);
     LOG.info("Create jar out stream ");
     JarOutputStream out = new JarOutputStream(stream, new Manifest());
-    ZipEntry entry = new ZipEntry("classes/1.class");
-    out.putNextEntry(entry);
-    out.write(1);
-    out.write(2);
-    out.write(3);
-    out.closeEntry();
-    ZipEntry entry2 = new ZipEntry("classes/2.class");
-    out.putNextEntry(entry2);
-    out.write(1);
-    out.write(2);
-    out.write(3);
-    out.closeEntry();
     LOG.info("Done writing jar stream ");
     out.close();
     LocalResource ret = recordFactory.newRecordInstance(LocalResource.class);
@@ -272,6 +256,7 @@ public class TestFSDownload {
   @Test (timeout=10000)
   public void testDownloadBadPublic() throws IOException, URISyntaxException,
       InterruptedException {
+    Configuration conf = new Configuration();
     conf.set(CommonConfigurationKeys.FS_PERMISSIONS_UMASK_KEY, "077");
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
@@ -322,6 +307,7 @@ public class TestFSDownload {
   @Test (timeout=60000)
   public void testDownloadPublicWithStatCache() throws IOException,
       URISyntaxException, InterruptedException, ExecutionException {
+    final Configuration conf = new Configuration();
     FileContext files = FileContext.getLocalFSFileContext(conf);
     Path basedir = files.makeQualified(new Path("target",
       TestFSDownload.class.getSimpleName()));
@@ -396,6 +382,7 @@ public class TestFSDownload {
   @Test (timeout=10000)
   public void testDownload() throws IOException, URISyntaxException,
       InterruptedException {
+    Configuration conf = new Configuration();
     conf.set(CommonConfigurationKeys.FS_PERMISSIONS_UMASK_KEY, "077");
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
@@ -451,7 +438,7 @@ public class TestFSDownload {
         FileStatus status = files.getFileStatus(localized.getParent());
         FsPermission perm = status.getPermission();
         assertEquals("Cache directory permissions are incorrect",
-            new FsPermission((short)0700), perm);
+            new FsPermission((short)0755), perm);
 
         status = files.getFileStatus(localized);
         perm = status.getPermission();
@@ -468,6 +455,7 @@ public class TestFSDownload {
 
   private void downloadWithFileType(TEST_FILE_TYPE fileType) throws IOException, 
       URISyntaxException, InterruptedException{
+    Configuration conf = new Configuration();
     conf.set(CommonConfigurationKeys.FS_PERMISSIONS_UMASK_KEY, "077");
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
@@ -542,7 +530,7 @@ public class TestFSDownload {
     }
   }
 
-  @Test (timeout=10000)
+  @Test (timeout=10000) 
   public void testDownloadArchive() throws IOException, URISyntaxException,
       InterruptedException {
     downloadWithFileType(TEST_FILE_TYPE.TAR);
@@ -554,7 +542,7 @@ public class TestFSDownload {
     downloadWithFileType(TEST_FILE_TYPE.JAR);
   }
 
-  @Test (timeout=10000)
+  @Test (timeout=10000) 
   public void testDownloadArchiveZip() throws IOException, URISyntaxException,
       InterruptedException {
     downloadWithFileType(TEST_FILE_TYPE.ZIP);
@@ -615,6 +603,7 @@ public class TestFSDownload {
 
   @Test (timeout=10000)
   public void testDirDownload() throws IOException, InterruptedException {
+    Configuration conf = new Configuration();
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
       TestFSDownload.class.getSimpleName()));
@@ -679,6 +668,7 @@ public class TestFSDownload {
 
   @Test (timeout=10000)
   public void testUniqueDestinationPath() throws Exception {
+    Configuration conf = new Configuration();
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
         TestFSDownload.class.getSimpleName()));


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[09/50] [abbrv] hadoop git commit: HDFS-13065. TestErasureCodingMultipleRacks#testSkewedRack3 is failing. Contributed by Gabor Bota.

Posted by as...@apache.org.
HDFS-13065. TestErasureCodingMultipleRacks#testSkewedRack3 is failing. Contributed by Gabor Bota.


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/6bc2f7f4
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/6bc2f7f4
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/6bc2f7f4

Branch: refs/heads/YARN-6592
Commit: 6bc2f7f4b4b8d4c36e92764d4c975c17f9fdd63b
Parents: 443523f
Author: Xiao Chen <xi...@apache.org>
Authored: Sun Jan 28 22:11:08 2018 -0800
Committer: Xiao Chen <xi...@apache.org>
Committed: Sun Jan 28 22:12:05 2018 -0800

----------------------------------------------------------------------
 .../apache/hadoop/hdfs/TestErasureCodingMultipleRacks.java   | 8 +++++++-
 1 file changed, 7 insertions(+), 1 deletion(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/6bc2f7f4/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestErasureCodingMultipleRacks.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestErasureCodingMultipleRacks.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestErasureCodingMultipleRacks.java
index 0689665d..3e87253 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestErasureCodingMultipleRacks.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestErasureCodingMultipleRacks.java
@@ -21,6 +21,7 @@ import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.fs.BlockLocation;
 import org.apache.hadoop.fs.Path;
 import org.apache.hadoop.hdfs.protocol.ErasureCodingPolicy;
+import org.apache.hadoop.hdfs.protocol.ExtendedBlock;
 import org.apache.hadoop.hdfs.server.blockmanagement.BlockPlacementPolicy;
 import org.apache.hadoop.hdfs.server.blockmanagement.BlockPlacementPolicyDefault;
 import org.apache.hadoop.hdfs.server.blockmanagement.BlockPlacementPolicyRackFaultTolerant;
@@ -163,7 +164,8 @@ public class TestErasureCodingMultipleRacks {
     // Create enough extra DNs on the 2 racks to test even placement.
     // Desired placement is parityUnits replicas on the 2 racks, and 1 replica
     // on the rest of the racks (which only have 1 DN)
-    setupCluster(dataUnits + parityUnits * 4, dataUnits - parityUnits + 2,
+    int numRacks = dataUnits - parityUnits + 2;
+    setupCluster(dataUnits + parityUnits * 4, numRacks,
         dataUnits - parityUnits);
 
     final int filesize = ecPolicy.getNumDataUnits() * ecPolicy.getCellSize();
@@ -173,6 +175,10 @@ public class TestErasureCodingMultipleRacks {
       final Path path = new Path("/testfile" + i);
       LOG.info("Writing file " + path);
       DFSTestUtil.writeFile(dfs, path, contents);
+      ExtendedBlock extendedBlock = DFSTestUtil.getFirstBlock(dfs, path);
+      // Wait for replication to finish before testing
+      DFSTestUtil.waitForReplication(cluster, extendedBlock, numRacks,
+          ecPolicy.getNumDataUnits() + ecPolicy.getNumParityUnits(), 0);
       BlockLocation[] blocks =
           dfs.getFileBlockLocations(path, 0, Long.MAX_VALUE);
       assertEquals(ecPolicy.getNumDataUnits() + ecPolicy.getNumParityUnits(),


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[17/50] [abbrv] hadoop git commit: YARN-5148. [UI2] Add page to new YARN UI to view server side configurations/logs/JVM-metrics. (Kai Sasaki/Sunil G via wangda)

Posted by as...@apache.org.
YARN-5148. [UI2] Add page to new YARN UI to view server side configurations/logs/JVM-metrics. (Kai Sasaki/Sunil G via wangda)

Change-Id: I5de88ce9850c0bc337dcb2c7d25ee9ad52016925


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/f666e7c4
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/f666e7c4
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/f666e7c4

Branch: refs/heads/YARN-6592
Commit: f666e7c43d797c1a9a9ff90adcaa70843f4755d6
Parents: dbb9dde
Author: Wangda Tan <wa...@apache.org>
Authored: Tue Jan 30 15:45:06 2018 +0800
Committer: Wangda Tan <wa...@apache.org>
Committed: Tue Jan 30 15:45:06 2018 +0800

----------------------------------------------------------------------
 .../hadoop-yarn/hadoop-yarn-ui/pom.xml          |   4 +-
 .../src/main/webapp/app/adapters/yarn-conf.js   |  79 ++++++++++++++
 .../main/webapp/app/adapters/yarn-metrics.js    |  76 +++++++++++++
 .../src/main/webapp/app/adapters/yarn-rm-log.js |  76 +++++++++++++
 .../main/webapp/app/controllers/yarn-tools.js   |  29 +++++
 .../app/controllers/yarn-tools/yarn-conf.js     |  48 +++++++++
 .../app/controllers/yarn-tools/yarn-rm-log.js   |  24 +++++
 .../src/main/webapp/app/helpers/json-pretty.js  |  25 +++++
 .../src/main/webapp/app/models/yarn-conf.js     |  25 +++++
 .../src/main/webapp/app/models/yarn-metrics.js  |  23 ++++
 .../src/main/webapp/app/models/yarn-rm-log.js   |  23 ++++
 .../src/main/webapp/app/router.js               |   6 ++
 .../src/main/webapp/app/routes/yarn-tools.js    |  22 ++++
 .../webapp/app/routes/yarn-tools/yarn-conf.js   |  22 ++++
 .../app/routes/yarn-tools/yarn-metrics.js       |  43 ++++++++
 .../webapp/app/routes/yarn-tools/yarn-rm-log.js |  36 +++++++
 .../main/webapp/app/serializers/yarn-conf.js    |  43 ++++++++
 .../main/webapp/app/serializers/yarn-metrics.js |  33 ++++++
 .../main/webapp/app/serializers/yarn-rm-log.js  |  45 ++++++++
 .../src/main/webapp/app/styles/app.scss         |   6 ++
 .../main/webapp/app/templates/application.hbs   |   5 +
 .../main/webapp/app/templates/yarn-tools.hbs    | 108 +++++++++++++++++++
 .../app/templates/yarn-tools/yarn-conf.hbs      |  28 +++++
 .../app/templates/yarn-tools/yarn-metrics.hbs   |  33 ++++++
 .../app/templates/yarn-tools/yarn-rm-log.hbs    |  42 ++++++++
 .../hadoop-yarn-ui/src/main/webapp/bower.json   |   3 +-
 .../src/main/webapp/ember-cli-build.js          |   1 +
 .../tests/unit/adapters/yarn-conf-test.js       |  29 +++++
 .../tests/unit/adapters/yarn-metrics-test.js    |  30 ++++++
 .../tests/unit/adapters/yarn-rm-log-test.js     |  30 ++++++
 .../tests/unit/controllers/yarn-conf-test.js    |  29 +++++
 .../tests/unit/controllers/yarn-rm-log-test.js  |  30 ++++++
 .../tests/unit/controllers/yarn-tools-test.js   |  30 ++++++
 .../tests/unit/helpers/json-pretty-test.js      |  28 +++++
 .../webapp/tests/unit/models/yarn-conf-test.js  |  29 +++++
 .../tests/unit/models/yarn-metrics-test.js      |  30 ++++++
 .../tests/unit/models/yarn-rm-log-test.js       |  30 ++++++
 .../webapp/tests/unit/routes/yarn-conf-test.js  |  28 +++++
 .../tests/unit/routes/yarn-metrics-test.js      |  28 +++++
 .../tests/unit/routes/yarn-rm-log-test.js       |  28 +++++
 .../webapp/tests/unit/routes/yarn-tools-test.js |  28 +++++
 .../tests/unit/serializers/yarn-conf-test.js    |  32 ++++++
 .../tests/unit/serializers/yarn-metrics-test.js |  33 ++++++
 .../tests/unit/serializers/yarn-rm-log-test.js  |  33 ++++++
 44 files changed, 1409 insertions(+), 4 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/pom.xml
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/pom.xml b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/pom.xml
index b552f35..1fafe77 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/pom.xml
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/pom.xml
@@ -30,11 +30,9 @@
 
   <properties>
     <packagingType>pom</packagingType>
-
     <webappDir>${basedir}/target/webapp</webappDir>
     <nodeExecutable>${basedir}/target/webapp/node/node</nodeExecutable>
     <packageManagerScript>node/yarn/dist/bin/yarn.js</packageManagerScript>
-
     <keepUIBuildCache>false</keepUIBuildCache>
   </properties>
 
@@ -178,7 +176,7 @@
             <artifactId>exec-maven-plugin</artifactId>
             <executions>
 
-              <!-- Build -->
+              <!-- Ember Build -->
               <execution>
                 <id>ember build</id>
                 <phase>generate-resources</phase>

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-conf.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-conf.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-conf.js
new file mode 100644
index 0000000..6621972
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-conf.js
@@ -0,0 +1,79 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+ import DS from 'ember-data';
+ import Ember from 'ember';
+ import Converter from 'yarn-ui/utils/converter';
+ import AbstractAdapter from './abstract';
+
+ export default AbstractAdapter.extend({
+
+   address: 'rmWebAddress',
+
+   headers: {
+     Accept: 'text/plain'
+   },
+
+   host: Ember.computed("address", function () {
+     let address = this.get("address");
+     return this.get(`hosts.${address}`);
+   }),
+
+   pathForType(type) {
+     return  'conf';
+   },
+
+   urlForFindRecord(id, modelName, snapshot) {
+     var extension = this.get("host").split('/').pop();
+     if (extension != id) {
+       this.host = this.get("host") + id;
+     }
+     var url = this._buildURL();
+     return url;
+   },
+
+   ajax(url, method, hash) {
+     hash = hash || {};
+     hash.crossDomain = true;
+     hash.xhrFields = {withCredentials: true};
+     hash.targetServer = "RM";
+     return this._super(url, method, hash);
+   },
+
+   /**
+    * Override options so that result is not expected to be JSON
+    */
+   ajaxOptions: function (url, type, options) {
+     var hash = options || {};
+     hash.url = url;
+     hash.type = type;
+     // Make sure jQuery does not try to convert response to JSON.
+     hash.dataType = 'text';
+     hash.context = this;
+
+     var headers = Ember.get(this, 'headers');
+     if (headers != undefined) {
+       hash.beforeSend = function (xhr) {
+         Object.keys(headers).forEach(function (key) {
+           return xhr.setRequestHeader(key, headers[key]);
+         });
+       };
+     }
+     return hash;
+   },
+ });

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-metrics.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-metrics.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-metrics.js
new file mode 100644
index 0000000..d26de28
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-metrics.js
@@ -0,0 +1,76 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import DS from 'ember-data';
+import Ember from 'ember';
+import Converter from 'yarn-ui/utils/converter';
+
+export default DS.RESTAdapter.extend({
+  address: 'rmWebAddress',
+
+  headers: {
+    Accept: 'text/plain'
+  },
+
+  host: Ember.computed("address", function() {
+    let address = this.get("address");
+    return this.get(`hosts.${address}`);
+  }),
+
+  pathForType(type) {
+    return  'jmx';
+  },
+
+  urlForFindRecord(id, modelName, snapshot) {
+    var extension = this.get("host").split('/').pop();
+    if (extension != id) {
+      this.host = this.get("host") + id;
+    }
+    var url = this._buildURL();
+    return url;
+  },
+
+  ajax(url, method, hash) {
+    hash = hash || {};
+    hash.crossDomain = true;
+    hash.xhrFields = {withCredentials: true};
+    hash.targetServer = "RM";
+    return this._super(url, method, hash);
+  },
+
+  /**
+   * Override options so that result is not expected to be JSON
+   */
+  ajaxOptions: function (url, type, options) {
+    var hash = options || {};
+    hash.url = url;
+    hash.type = type;
+    // Make sure jQuery does not try to convert response to JSON.
+    hash.dataType = 'text';
+    hash.context = this;
+    var headers = Ember.get(this, 'headers');
+    if (headers != undefined) {
+      hash.beforeSend = function (xhr) {
+        Object.keys(headers).forEach(function (key) {
+          return xhr.setRequestHeader(key, headers[key]);
+        });
+      };
+    }
+    return hash;
+  },
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-rm-log.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-rm-log.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-rm-log.js
new file mode 100644
index 0000000..a912ffe
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/adapters/yarn-rm-log.js
@@ -0,0 +1,76 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import DS from 'ember-data';
+import Ember from 'ember';
+import Converter from 'yarn-ui/utils/converter';
+
+export default DS.RESTAdapter.extend({
+  address: 'rmWebAddress',
+  headers: {
+    Accept: 'text/plain'
+  },
+
+  host: Ember.computed("address", function() {
+    let address = this.get("address");
+    return this.get(`hosts.${address}`);
+  }),
+
+  pathForType(type) {
+    return  'logs';
+  },
+
+  buildURL (modelName, id, snapshot, requestType, query) {
+    return this._super(modelName, id, snapshot, requestType, query) + '/';
+  },
+
+  urlForFindRecord(id, modelName, snapshot) {
+    this.host = this.get('host');
+    let url = this.host + id;
+    return url;
+  },
+
+  ajax(url, method, hash) {
+    hash = hash || {};
+    hash.crossDomain = true;
+    hash.xhrFields = {withCredentials: true};
+    hash.targetServer = "RM";
+    return this._super(url, method, hash);
+  },
+
+  /**
+   * Override options so that result is not expected to be JSON
+   */
+  ajaxOptions: function (url, type, options) {
+    var hash = options || {};
+    hash.url = url;
+    hash.type = type;
+    // Make sure jQuery does not try to convert response to JSON.
+    hash.dataType = 'text';
+    hash.context = this;
+    var headers = Ember.get(this, 'headers');
+    if (headers != undefined) {
+      hash.beforeSend = function (xhr) {
+        Object.keys(headers).forEach(function (key) {
+          return xhr.setRequestHeader(key, headers[key]);
+        });
+      };
+    }
+    return hash;
+  },
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools.js
new file mode 100644
index 0000000..b36098b
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools.js
@@ -0,0 +1,29 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import Ember from 'ember';
+
+export default Ember.Controller.extend({
+  breadcrumbs: [{
+    text: "Home",
+    routeName: 'application'
+  }, {
+    text: "Yarn Tools",
+    routeName: 'yarn-tools',
+  }],
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools/yarn-conf.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools/yarn-conf.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools/yarn-conf.js
new file mode 100644
index 0000000..86b4177
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools/yarn-conf.js
@@ -0,0 +1,48 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import Ember from 'ember';
+
+import TableDef from 'em-table/utils/table-definition';
+import ColumnDef from 'em-table/utils/column-definition';
+
+import YarnConf from '../../models/yarn-conf';
+
+export default Ember.Controller.extend({
+  init: function () {
+    var that = this;
+    this.get('store').query('yarn-conf', {})
+      .then(function(conf) {
+        let coreProps = conf.filter(function(o) {
+          return o.get('source') == 'core-default.xml';
+        });
+        that.set('rowsForCoreColumnsFromModel', coreProps);
+        let mapredProps = conf.filter(function(o) {
+          return o.get('source') == 'mapred-default.xml';
+        });
+        that.set('rowsForMapredColumnsFromModel', mapredProps);
+        let yarnProps = conf.filter(function(o) {
+          return o.get('source') == 'yarn-default.xml';
+        });
+        that.set('rowsForYarnColumnsFromModel', yarnProps);
+      });
+  },
+
+  columnsFromModel: ColumnDef.makeFromModel(YarnConf),
+
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools/yarn-rm-log.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools/yarn-rm-log.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools/yarn-rm-log.js
new file mode 100644
index 0000000..a5e0eb5
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/controllers/yarn-tools/yarn-rm-log.js
@@ -0,0 +1,24 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import Ember from 'ember';
+
+export default Ember.Controller.extend({
+  queryParams: ['filename'],
+  filename: null
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/helpers/json-pretty.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/helpers/json-pretty.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/helpers/json-pretty.js
new file mode 100644
index 0000000..a820c38
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/helpers/json-pretty.js
@@ -0,0 +1,25 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import Ember from 'ember';
+
+export function jsonPretty(params/*, hash*/) {
+  let j = params[0];
+  return j;
+}
+
+export default Ember.Helper.helper(jsonPretty);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-conf.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-conf.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-conf.js
new file mode 100644
index 0000000..9846ea1
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-conf.js
@@ -0,0 +1,25 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import DS from 'ember-data';
+
+export default DS.Model.extend({
+  name: DS.attr(),
+  source: DS.attr(),
+  value: DS.attr()
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-metrics.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-metrics.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-metrics.js
new file mode 100644
index 0000000..5ed217d
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-metrics.js
@@ -0,0 +1,23 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import DS from 'ember-data';
+
+export default DS.Model.extend({
+  metrics: DS.attr()
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-rm-log.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-rm-log.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-rm-log.js
new file mode 100644
index 0000000..2b6febf
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/models/yarn-rm-log.js
@@ -0,0 +1,23 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import DS from 'ember-data';
+
+export default DS.Model.extend({
+  logfileName: DS.attr()
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/router.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/router.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/router.js
index bd7af21..3322a87 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/router.js
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/router.js
@@ -73,6 +73,12 @@ Router.map(function() {
   this.route('error');
   this.route('notfound', { path: '*:' });
   this.route('yarn-queues', { path: '/yarn-queues/:queue_name' });
+  this.route('yarn-queue-apps', { path: '/yarn-queue-apps/:queue_name' });
+  this.route('yarn-tools', function() {
+    this.route('yarn-conf');
+    this.route('yarn-metrics');
+    this.route('yarn-rm-log');
+  });
 
   this.route('yarn-flow-activity');
   this.route('yarn-flow', { path: '/yarn-flow/:flow_uid'}, function() {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools.js
new file mode 100644
index 0000000..8719170
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools.js
@@ -0,0 +1,22 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import Ember from 'ember';
+
+export default Ember.Route.extend({
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-conf.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-conf.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-conf.js
new file mode 100644
index 0000000..8719170
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-conf.js
@@ -0,0 +1,22 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import Ember from 'ember';
+
+export default Ember.Route.extend({
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-metrics.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-metrics.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-metrics.js
new file mode 100644
index 0000000..cca2a53
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-metrics.js
@@ -0,0 +1,43 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+ import Ember from 'ember';
+ import Constants from 'yarn-ui/constants';
+
+ import AbstractRoute from '../abstract';
+
+ export default AbstractRoute.extend({
+   model() {
+     return Ember.RSVP.hash({jmx: this.store.findAll('yarn-metrics')});
+   },
+
+   afterModel(model) {
+     // Handle errors and redirect if promise is rejected.
+     if (model.errors && model.errors[0]) {
+       if (model.errors[0].status == 404) {
+         this.replaceWith('/notfound');
+       } else {
+         this.replaceWith('/error');
+       }
+     }
+   },
+
+   unloadAll() {
+     this.store.unloadAll('yarn-metrics');
+   }
+ });

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-rm-log.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-rm-log.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-rm-log.js
new file mode 100644
index 0000000..a12c280
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/routes/yarn-tools/yarn-rm-log.js
@@ -0,0 +1,36 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import Ember from 'ember';
+
+export default Ember.Route.extend({
+  queryParams: {
+    filename: {
+      refreshModel: true
+    }
+  },
+
+  model(param) {
+    if (param.filename == null) {
+      return Ember.RSVP.hash({logs: this.store.findAll('yarn-rm-log')});
+    } else {
+      // TODO: Loading log file is disallowed for cross-origin requests that require preflight
+      window.open(this.get('hosts.rmWebAddress') + param.filename);
+    }
+  }
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-conf.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-conf.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-conf.js
new file mode 100644
index 0000000..dc9c64f
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-conf.js
@@ -0,0 +1,43 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import Ember from 'ember';
+import DS from 'ember-data';
+import Converter from 'yarn-ui/utils/converter';
+
+export default DS.JSONAPISerializer.extend({
+  normalizeResponse(store, primaryModelClass, payload, id, requestType) {
+    var x2js = new X2JS();
+    let props = x2js.xml_str2json(payload);
+    let properties = props.configuration.property;
+    var convertedPayload = [];
+    for (var i = 0; i < properties.length; i++) {
+      var row = {
+        id: i,
+        type: primaryModelClass.modelName,
+        attributes: {
+          name: properties[i].name,
+          source: properties[i].source,
+          value: properties[i].value
+        }
+      };
+      convertedPayload.push(row);
+    }
+    return { data: convertedPayload };
+  },
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-metrics.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-metrics.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-metrics.js
new file mode 100644
index 0000000..70c9ca0
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-metrics.js
@@ -0,0 +1,33 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import DS from 'ember-data';
+
+export default DS.JSONAPISerializer.extend({
+  normalizeResponse(store, primaryModelClass, payload, id, requestType) {
+    var ret =
+      {
+        id: 0,
+        type: primaryModelClass.modelName,
+        attributes: {
+          metrics: payload
+        }
+      };
+    return { data : ret };
+  },
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-rm-log.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-rm-log.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-rm-log.js
new file mode 100644
index 0000000..da834f1
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/serializers/yarn-rm-log.js
@@ -0,0 +1,45 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import DS from 'ember-data';
+
+export default DS.JSONAPISerializer.extend({
+  normalizeResponse(store, primaryModelClass, payload, id, requestType) {
+    const pattern = new RegExp('<A HREF="/logs/.+">', 'g');
+    let fileNames = payload.match(pattern);
+
+    if (fileNames == null) {
+      return {data : []};
+    }
+
+    let logfileNames = [];
+    for (var i = 0; i < fileNames.length; i++) {
+      var fileName = fileNames[i].match(/<A HREF="(\/logs\/.+)">/);
+        if (fileName.length != null) {
+          logfileNames.push({
+            id: i,
+            type: primaryModelClass.modelName,
+            attributes: {
+              logfileName: fileName[1]
+            }
+          });
+        }
+    }
+    return { data : logfileNames };
+  },
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/styles/app.scss
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/styles/app.scss b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/styles/app.scss
index 5d99d8e..a85e0eb 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/styles/app.scss
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/styles/app.scss
@@ -722,3 +722,9 @@ div.service-action-mask img {
     margin-top: 0;
   }
 }
+
+.yarn-metrics-json {
+  white-space: pre-wrap;
+  word-wrap: nowrap;
+  overflow: scroll;
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/application.hbs
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/application.hbs b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/application.hbs
index 5bc675d..56fef26 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/application.hbs
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/application.hbs
@@ -66,6 +66,11 @@
               <span class="sr-only">(current)</span>
             {{/link-to}}
           {{/link-to}}
+          {{#link-to 'yarn-tools.yarn-conf' tagName="li"}}
+            {{#link-to 'yarn-tools.yarn-conf' class="navigation-link"}}Tools
+              <span class="sr-only">(current)</span>
+            {{/link-to}}
+          {{/link-to}}
         </ul>
       </div><!-- /.navbar-collapse -->
     </div><!-- /.container-fluid -->

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools.hbs
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools.hbs b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools.hbs
new file mode 100644
index 0000000..2f618fd
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools.hbs
@@ -0,0 +1,108 @@
+{{!--
+  Licensed to the Apache Software Foundation (ASF) under one
+  or more contributor license agreements.  See the NOTICE file
+  distributed with this work for additional information
+  regarding copyright ownership.  The ASF licenses this file
+  to you under the Apache License, Version 2.0 (the
+  "License"); you may not use this file except in compliance
+  with the License.  You may obtain a copy of the License at
+
+      http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing, software
+  distributed under the License is distributed on an "AS IS" BASIS,
+  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+  See the License for the specific language governing permissions and
+  limitations under the License.
+--}}
+
+{{!
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+}}
+
+{{breadcrumb-bar breadcrumbs=breadcrumbs}}
+
+<div class="col-md-12 container-fluid">
+  <div class="row">
+
+    <div class="col-md-2 container-fluid">
+      <div class="panel panel-default">
+        <div class="panel-heading">
+          <h4>Tools</h4>
+        </div>
+        <div class="panel-body">
+          <ul class="nav nav-pills nav-stacked" id="stacked-menu">
+            <ul class="nav nav-pills nav-stacked collapse in">
+              {{#link-to 'yarn-tools.yarn-conf' tagName="li"}}
+                {{#link-to 'yarn-tools.yarn-conf'}}YARN Configuration
+                {{/link-to}}
+              {{/link-to}}
+              {{#link-to 'yarn-tools.yarn-rm-log' tagName="li"}}
+                {{#link-to 'yarn-tools.yarn-rm-log'}}YARN Daemon logs
+                {{/link-to}}
+              {{/link-to}}
+            </ul>
+          </ul>
+        </div>
+      </div>
+    </div>
+
+    <div class="col-md-10 container-fluid">
+      {{#if model.clusterMetrics}}
+        <div class="row">
+          <div class="col-lg-4 container-fluid">
+            <div class="panel panel-default">
+              <div class="panel-heading">
+                Finished Apps
+              </div>
+              <div class="container-fluid" id="finishedapps-donut-chart">
+                {{donut-chart data=model.clusterMetrics.firstObject.getFinishedAppsDataForDonutChart
+                showLabels=true
+                parentId="finishedapps-donut-chart"
+                ratio=0.6
+                maxHeight=350
+                colorTargets="good warn error"
+                }}
+              </div>
+            </div>
+          </div>
+
+          <div class="col-lg-4 container-fluid">
+            <div class="panel panel-default">
+              <div class="panel-heading">
+                Running Apps
+              </div>
+              <div class="container-fluid" id="runningapps-donut-chart">
+                {{donut-chart data=model.clusterMetrics.firstObject.getRunningAppsDataForDonutChart
+                showLabels=true
+                parentId="runningapps-donut-chart"
+                ratio=0.6
+                maxHeight=350
+                colorTargets="warn good"
+                }}
+              </div>
+            </div>
+          </div>
+        </div>
+      {{/if}}
+
+      <div class="row">
+        {{outlet}}
+      </div>
+    </div>
+  </div>
+</div>

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-conf.hbs
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-conf.hbs b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-conf.hbs
new file mode 100644
index 0000000..f4c799d
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-conf.hbs
@@ -0,0 +1,28 @@
+{{!
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+}}
+
+<h1>Core Configuration</h1>
+{{em-table columns=columnsFromModel rows=rowsForCoreColumnsFromModel rowCount=10}}
+
+<h1>YARN Configuration</h1>
+{{em-table columns=columnsFromModel rows=rowsForYarnColumnsFromModel rowCount=10}}
+
+<h1>MapReduce Configuration</h1>
+{{em-table columns=columnsFromModel rows=rowsForMapredColumnsFromModel rowCount=10}}
+
+{{outlet}}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-metrics.hbs
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-metrics.hbs b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-metrics.hbs
new file mode 100644
index 0000000..b11171a
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-metrics.hbs
@@ -0,0 +1,33 @@
+{{!
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+}}
+
+<div class="col-md-12 container-fluid">
+  <div class="col-md-10">
+    <div class="panel panel-default">
+      <div class="panel-body">
+          <div class="yarn-metrics-json">
+        {{#each model.jmx as |jmx|}}
+            {{json-pretty jmx.metrics}}
+        {{/each}}
+          </div>
+      </div>
+    </div>
+  </div>
+</div>
+
+{{outlet}}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-rm-log.hbs
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-rm-log.hbs b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-rm-log.hbs
new file mode 100644
index 0000000..3cf536d
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/app/templates/yarn-tools/yarn-rm-log.hbs
@@ -0,0 +1,42 @@
+{{!
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+}}
+
+<h1>YARN Daemon Logs</h1>
+<div class="col-md-12 container-fluid">
+  <div class="col-md-10">
+    <div class="panel panel-default">
+      <ul class="list-group">
+      {{#if model.logs}}
+        {{#each model.logs as |log|}}
+        <li class=list-group-item>
+          {{#link-to 'yarn-tools.yarn-rm-log' (query-params filename=log.logfileName)}}
+            {{log.logfileName}}
+          {{/link-to}}
+        </li>
+        {{/each}}
+      {{else}}
+        <div class="panel-body">
+          No logs were found.
+        </div>
+      {{/if}}
+      </ul>
+    </div>
+  </div>
+</div>
+
+{{outlet}}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/bower.json
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/bower.json b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/bower.json
index 11fae3e..b7591a5 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/bower.json
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/bower.json
@@ -22,6 +22,7 @@
     "momentjs": "~2.10.6",
     "select2": "4.0.0",
     "snippet-ss": "~1.11.0",
-    "alasql": "^0.4.3"
+    "alasql": "^0.4.3",
+    "abdmob/x2js": "1.2.0"
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/ember-cli-build.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/ember-cli-build.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/ember-cli-build.js
index db09ae3..309c53b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/ember-cli-build.js
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/ember-cli-build.js
@@ -51,6 +51,7 @@ module.exports = function(defaults) {
   app.import('bower_components/bootstrap/dist/css/bootstrap-theme.css');
   app.import('bower_components/bootstrap/dist/js/bootstrap.min.js');
   app.import('bower_components/alasql/dist/alasql.js');
+  app.import('bower_components/abdmob/x2js/xml2json.js');
 
   // Use `app.import` to add additional libraries to the generated
   // output files.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-conf-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-conf-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-conf-test.js
new file mode 100644
index 0000000..c892933
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-conf-test.js
@@ -0,0 +1,29 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('adapter:yarn-conf', 'Unit | Adapter | yarn conf', {
+  // Specify the other units that are required for this test.
+  // needs: ['serializer:foo']
+});
+
+// Replace this with your real tests.
+test('it exists', function(assert) {
+  let adapter = this.subject();
+  assert.ok(adapter);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-metrics-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-metrics-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-metrics-test.js
new file mode 100644
index 0000000..10941d2
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-metrics-test.js
@@ -0,0 +1,30 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('adapter:yarn-metrics', 'Unit | Adapter | yarn metrics', {
+  // Specify the other units that are required for this test.
+  // needs: ['serializer:foo']
+});
+
+// Replace this with your real tests.
+test('it exists', function(assert) {
+  let adapter = this.subject();
+  assert.ok(adapter);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-rm-log-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-rm-log-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-rm-log-test.js
new file mode 100644
index 0000000..b736957
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/adapters/yarn-rm-log-test.js
@@ -0,0 +1,30 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('adapter:yarn-rm-log', 'Unit | Adapter | yarn rm log', {
+  // Specify the other units that are required for this test.
+  // needs: ['serializer:foo']
+});
+
+// Replace this with your real tests.
+test('it exists', function(assert) {
+  let adapter = this.subject();
+  assert.ok(adapter);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-conf-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-conf-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-conf-test.js
new file mode 100644
index 0000000..adec93b
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-conf-test.js
@@ -0,0 +1,29 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('controller:yarn-conf', 'Unit | Controller | yarn conf', {
+  // Specify the other units that are required for this test.
+  // needs: ['controller:foo']
+});
+
+// Replace this with your real tests.
+test('it exists', function(assert) {
+  let controller = this.subject();
+  assert.ok(controller);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-rm-log-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-rm-log-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-rm-log-test.js
new file mode 100644
index 0000000..6f847bf
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-rm-log-test.js
@@ -0,0 +1,30 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('controller:yarn-rm-log', 'Unit | Controller | yarn rm log', {
+  // Specify the other units that are required for this test.
+  // needs: ['controller:foo']
+});
+
+// Replace this with your real tests.
+test('it exists', function(assert) {
+  let controller = this.subject();
+  assert.ok(controller);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-tools-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-tools-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-tools-test.js
new file mode 100644
index 0000000..a92ee59
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/controllers/yarn-tools-test.js
@@ -0,0 +1,30 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('controller:yarn-tools', 'Unit | Controller | yarn tools', {
+  // Specify the other units that are required for this test.
+  // needs: ['controller:foo']
+});
+
+// Replace this with your real tests.
+test('it exists', function(assert) {
+  let controller = this.subject();
+  assert.ok(controller);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/helpers/json-pretty-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/helpers/json-pretty-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/helpers/json-pretty-test.js
new file mode 100644
index 0000000..a6bc7c2
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/helpers/json-pretty-test.js
@@ -0,0 +1,28 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { jsonPretty } from '../../../helpers/json-pretty';
+import { module, test } from 'qunit';
+
+module('Unit | Helper | json pretty');
+
+// Replace this with your real tests.
+test('it works', function(assert) {
+  let result = jsonPretty(42);
+  assert.ok(result);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-conf-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-conf-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-conf-test.js
new file mode 100644
index 0000000..68ea891
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-conf-test.js
@@ -0,0 +1,29 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { moduleForModel, test } from 'ember-qunit';
+
+moduleForModel('yarn-conf', 'Unit | Model | yarn conf', {
+  // Specify the other units that are required for this test.
+  needs: []
+});
+
+test('it exists', function(assert) {
+  let model = this.subject();
+  // let store = this.store();
+  assert.ok(!!model);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-metrics-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-metrics-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-metrics-test.js
new file mode 100644
index 0000000..2068dc8
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-metrics-test.js
@@ -0,0 +1,30 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { moduleForModel, test } from 'ember-qunit';
+
+moduleForModel('yarn-metrics', 'Unit | Model | yarn metrics', {
+  // Specify the other units that are required for this test.
+  needs: []
+});
+
+test('it exists', function(assert) {
+  let model = this.subject();
+  // let store = this.store();
+  assert.ok(!!model);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-rm-log-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-rm-log-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-rm-log-test.js
new file mode 100644
index 0000000..6adf3d9
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/models/yarn-rm-log-test.js
@@ -0,0 +1,30 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { moduleForModel, test } from 'ember-qunit';
+
+moduleForModel('yarn-rm-log', 'Unit | Model | yarn rm log', {
+  // Specify the other units that are required for this test.
+  needs: []
+});
+
+test('it exists', function(assert) {
+  let model = this.subject();
+  // let store = this.store();
+  assert.ok(!!model);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-conf-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-conf-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-conf-test.js
new file mode 100644
index 0000000..306fa93
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-conf-test.js
@@ -0,0 +1,28 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('route:yarn-conf', 'Unit | Route | yarn conf', {
+  // Specify the other units that are required for this test.
+  // needs: ['controller:foo']
+});
+
+test('it exists', function(assert) {
+  let route = this.subject();
+  assert.ok(route);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-metrics-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-metrics-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-metrics-test.js
new file mode 100644
index 0000000..13d109b
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-metrics-test.js
@@ -0,0 +1,28 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('route:yarn-metric', 'Unit | Route | yarn metric', {
+  // Specify the other units that are required for this test.
+  // needs: ['controller:foo']
+});
+
+test('it exists', function(assert) {
+  let route = this.subject();
+  assert.ok(route);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-rm-log-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-rm-log-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-rm-log-test.js
new file mode 100644
index 0000000..6d696c8
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-rm-log-test.js
@@ -0,0 +1,28 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('route:yarn-rm-log', 'Unit | Route | yarn rm log', {
+  // Specify the other units that are required for this test.
+  // needs: ['controller:foo']
+});
+
+test('it exists', function(assert) {
+  let route = this.subject();
+  assert.ok(route);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-tools-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-tools-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-tools-test.js
new file mode 100644
index 0000000..2950fd4
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/routes/yarn-tools-test.js
@@ -0,0 +1,28 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { moduleFor, test } from 'ember-qunit';
+
+moduleFor('route:yarn-tools', 'Unit | Route | yarn tools', {
+  // Specify the other units that are required for this test.
+  // needs: ['controller:foo']
+});
+
+test('it exists', function(assert) {
+  let route = this.subject();
+  assert.ok(route);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-conf-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-conf-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-conf-test.js
new file mode 100644
index 0000000..36576fd
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-conf-test.js
@@ -0,0 +1,32 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+import { moduleForModel, test } from 'ember-qunit';
+
+moduleForModel('yarn-conf', 'Unit | Serializer | yarn conf', {
+  // Specify the other units that are required for this test.
+  needs: ['serializer:yarn-conf']
+});
+
+// Replace this with your real tests.
+test('it serializes records', function(assert) {
+  let record = this.subject();
+
+  let serializedRecord = record.serialize();
+
+  assert.ok(serializedRecord);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-metrics-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-metrics-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-metrics-test.js
new file mode 100644
index 0000000..7cab348
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-metrics-test.js
@@ -0,0 +1,33 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { moduleForModel, test } from 'ember-qunit';
+
+moduleForModel('yarn-metrics', 'Unit | Serializer | yarn metrics', {
+  // Specify the other units that are required for this test.
+  needs: ['serializer:yarn-metrics']
+});
+
+// Replace this with your real tests.
+test('it serializes records', function(assert) {
+  let record = this.subject();
+
+  let serializedRecord = record.serialize();
+
+  assert.ok(serializedRecord);
+});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f666e7c4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-rm-log-test.js
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-rm-log-test.js b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-rm-log-test.js
new file mode 100644
index 0000000..fa049b3
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-ui/src/main/webapp/tests/unit/serializers/yarn-rm-log-test.js
@@ -0,0 +1,33 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+import { moduleForModel, test } from 'ember-qunit';
+
+moduleForModel('yarn-rm-log', 'Unit | Serializer | yarn rm log', {
+  // Specify the other units that are required for this test.
+  needs: ['serializer:yarn-rm-log']
+});
+
+// Replace this with your real tests.
+test('it serializes records', function(assert) {
+  let record = this.subject();
+
+  let serializedRecord = record.serialize();
+
+  assert.ok(serializedRecord);
+});


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[10/50] [abbrv] hadoop git commit: HDFS-12974. Exception message is not printed when creating an encryption zone fails with AuthorizationException. Contributed by fang zhenyi.

Posted by as...@apache.org.
HDFS-12974. Exception message is not printed when creating an encryption zone fails with AuthorizationException. Contributed by fang zhenyi.


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/b63dcd58
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/b63dcd58
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/b63dcd58

Branch: refs/heads/YARN-6592
Commit: b63dcd583f0b98e785831004f41bd7c7de8b3c18
Parents: 6bc2f7f
Author: Xiao Chen <xi...@apache.org>
Authored: Sun Jan 28 22:15:58 2018 -0800
Committer: Xiao Chen <xi...@apache.org>
Committed: Sun Jan 28 22:19:49 2018 -0800

----------------------------------------------------------------------
 .../authorize/AuthorizationException.java       |  6 ++--
 .../namenode/EncryptionFaultInjector.java       |  3 ++
 .../server/namenode/FSDirEncryptionZoneOp.java  |  1 +
 .../apache/hadoop/hdfs/TestEncryptionZones.java | 31 +++++++++++++++++++-
 4 files changed, 38 insertions(+), 3 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/b63dcd58/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/authorize/AuthorizationException.java
----------------------------------------------------------------------
diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/authorize/AuthorizationException.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/authorize/AuthorizationException.java
index 03f4d99..79c7d18 100644
--- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/authorize/AuthorizationException.java
+++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/authorize/AuthorizationException.java
@@ -64,17 +64,19 @@ public class AuthorizationException extends AccessControlException {
 
   @Override
   public void printStackTrace() {
-    // Do not provide the stack-trace
+    printStackTrace(System.err);
   }
 
   @Override
   public void printStackTrace(PrintStream s) {
     // Do not provide the stack-trace
+    s.println(this);
   }
 
   @Override
   public void printStackTrace(PrintWriter s) {
     // Do not provide the stack-trace
+    s.println(this);
   }
-  
+
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/b63dcd58/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/EncryptionFaultInjector.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/EncryptionFaultInjector.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/EncryptionFaultInjector.java
index e4a035e..938eacd 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/EncryptionFaultInjector.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/EncryptionFaultInjector.java
@@ -51,4 +51,7 @@ public class EncryptionFaultInjector {
 
   @VisibleForTesting
   public void reencryptUpdaterProcessCheckpoint() throws IOException {}
+
+  @VisibleForTesting
+  public void ensureKeyIsInitialized() throws IOException {}
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/b63dcd58/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirEncryptionZoneOp.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirEncryptionZoneOp.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirEncryptionZoneOp.java
index 7dcb8ab..943e60d 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirEncryptionZoneOp.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirEncryptionZoneOp.java
@@ -121,6 +121,7 @@ final class FSDirEncryptionZoneOp {
       throw new IOException("Must specify a key name when creating an "
           + "encryption zone");
     }
+    EncryptionFaultInjector.getInstance().ensureKeyIsInitialized();
     KeyProvider.Metadata metadata = provider.getMetadata(keyName);
     if (metadata == null) {
       /*

http://git-wip-us.apache.org/repos/asf/hadoop/blob/b63dcd58/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java
index 4497e23..ea867a8 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java
@@ -80,9 +80,11 @@ import org.apache.hadoop.hdfs.web.WebHdfsConstants;
 import org.apache.hadoop.hdfs.web.WebHdfsFileSystem;
 import org.apache.hadoop.hdfs.web.WebHdfsTestUtil;
 import org.apache.hadoop.io.EnumSetWritable;
+import org.apache.hadoop.ipc.RemoteException;
 import org.apache.hadoop.security.AccessControlException;
 import org.apache.hadoop.security.Credentials;
 import org.apache.hadoop.security.UserGroupInformation;
+import org.apache.hadoop.security.authorize.AuthorizationException;
 import org.apache.hadoop.security.token.Token;
 import org.apache.hadoop.util.DataChecksum;
 import org.apache.hadoop.util.ToolRunner;
@@ -149,6 +151,9 @@ public class TestEncryptionZones {
   private File testRootDir;
   protected final String TEST_KEY = "test_key";
   private static final String NS_METRICS = "FSNamesystem";
+  private static final String  AUTHORIZATION_EXCEPTION_MESSAGE =
+      "User [root] is not authorized to perform [READ] on key " +
+          "with ACL name [key2]!!";
 
   protected FileSystemTestWrapper fsWrapper;
   protected FileContextTestWrapper fcWrapper;
@@ -447,7 +452,6 @@ public class TestEncryptionZones {
     dfsAdmin.createEncryptionZone(zone2, myKeyName, NO_TRASH);
     assertNumZones(++numZones);
     assertZonePresent(myKeyName, zone2.toString());
-
     /* Test failure of create encryption zones as a non super user. */
     final UserGroupInformation user = UserGroupInformation.
         createUserForTesting("user", new String[] { "mygroup" });
@@ -1057,6 +1061,31 @@ public class TestEncryptionZones {
     }
   }
 
+  private class AuthorizationExceptionInjector extends EncryptionFaultInjector {
+    @Override
+    public void ensureKeyIsInitialized() throws IOException {
+      throw new AuthorizationException(AUTHORIZATION_EXCEPTION_MESSAGE);
+    }
+  }
+
+  @Test
+  public void testExceptionInformationReturn() {
+    /* Test exception information can be returned when
+    creating transparent encryption zone.*/
+    final Path zone1 = new Path("/zone1");
+    EncryptionFaultInjector.instance = new AuthorizationExceptionInjector();
+    try {
+      dfsAdmin.createEncryptionZone(zone1, TEST_KEY, NO_TRASH);
+      fail("exception information can be returned when creating " +
+          "transparent encryption zone");
+    } catch (IOException e) {
+      assertTrue(e instanceof RemoteException);
+      assertTrue(((RemoteException) e).unwrapRemoteException()
+          instanceof AuthorizationException);
+      assertExceptionContains(AUTHORIZATION_EXCEPTION_MESSAGE, e);
+    }
+  }
+
   private class MyInjector extends EncryptionFaultInjector {
     volatile int generateCount;
     CountDownLatch ready;


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[11/50] [abbrv] hadoop git commit: YARN-7698. A misleading variable's name in ApplicationAttemptEventDispatcher

Posted by as...@apache.org.
YARN-7698. A misleading variable's name in ApplicationAttemptEventDispatcher

Signed-off-by: Akira Ajisaka <aa...@apache.org>


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/3400d0c5
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/3400d0c5
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/3400d0c5

Branch: refs/heads/YARN-6592
Commit: 3400d0c535aeb151c3f283cc41111b15d66990e5
Parents: b63dcd5
Author: Jinjiang Ling <li...@zte.com.cn>
Authored: Tue Jan 30 00:00:57 2018 +0900
Committer: Akira Ajisaka <aa...@apache.org>
Committed: Tue Jan 30 00:00:57 2018 +0900

----------------------------------------------------------------------
 .../hadoop/yarn/server/resourcemanager/ResourceManager.java  | 8 ++++----
 1 file changed, 4 insertions(+), 4 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/3400d0c5/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
index 7bbf4aa..32c4b0a 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
@@ -947,11 +947,11 @@ public class ResourceManager extends CompositeService implements Recoverable {
 
     @Override
     public void handle(RMAppAttemptEvent event) {
-      ApplicationAttemptId appAttemptID = event.getApplicationAttemptId();
-      ApplicationId appAttemptId = appAttemptID.getApplicationId();
-      RMApp rmApp = this.rmContext.getRMApps().get(appAttemptId);
+      ApplicationAttemptId appAttemptId = event.getApplicationAttemptId();
+      ApplicationId appId = appAttemptId.getApplicationId();
+      RMApp rmApp = this.rmContext.getRMApps().get(appId);
       if (rmApp != null) {
-        RMAppAttempt rmAppAttempt = rmApp.getRMAppAttempt(appAttemptID);
+        RMAppAttempt rmAppAttempt = rmApp.getRMAppAttempt(appAttemptId);
         if (rmAppAttempt != null) {
           try {
             rmAppAttempt.handle(event);


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[34/50] [abbrv] hadoop git commit: YARN-7669. API and interface modifications for placement constraint processor. (asuresh)

Posted by as...@apache.org.
http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmOutput.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmOutput.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmOutput.java
new file mode 100644
index 0000000..9571f0e
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmOutput.java
@@ -0,0 +1,58 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api;
+
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+
+import java.util.ArrayList;
+import java.util.List;
+
+/**
+ * Encapsulates the output of the ConstraintPlacementAlgorithm. The Algorithm
+ * is free to produce multiple of output objects at the end of each run and it
+ * must use the provided ConstraintPlacementAlgorithmOutputCollector to
+ * aggregate/collect this output. Similar to the MapReduce Mapper/Reducer
+ * which is provided a collector to collect output.
+ */
+public class ConstraintPlacementAlgorithmOutput {
+
+  private final ApplicationId applicationId;
+
+  public ConstraintPlacementAlgorithmOutput(ApplicationId applicationId) {
+    this.applicationId = applicationId;
+  }
+
+  private final List<PlacedSchedulingRequest> placedRequests =
+      new ArrayList<>();
+
+  private final List<SchedulingRequest> rejectedRequests =
+      new ArrayList<>();
+
+  public List<PlacedSchedulingRequest> getPlacedRequests() {
+    return placedRequests;
+  }
+
+  public List<SchedulingRequest> getRejectedRequests() {
+    return rejectedRequests;
+  }
+
+  public ApplicationId getApplicationId() {
+    return applicationId;
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmOutputCollector.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmOutputCollector.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmOutputCollector.java
new file mode 100644
index 0000000..131fd42
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmOutputCollector.java
@@ -0,0 +1,32 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api;
+
+/**
+ * The ConstraintPlacementAlgorithm uses the
+ * ConstraintPlacementAlgorithmOutputCollector to collect any output it
+ * spits out.
+ */
+public interface ConstraintPlacementAlgorithmOutputCollector {
+
+  /**
+   * Collect an ConstraintPlacementAlgorithm output.
+   * @param algorithmOutput ConstraintPlacementAlgorithm Output.
+   */
+  void collect(ConstraintPlacementAlgorithmOutput algorithmOutput);
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/PlacedSchedulingRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/PlacedSchedulingRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/PlacedSchedulingRequest.java
new file mode 100644
index 0000000..2cd90d6
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/PlacedSchedulingRequest.java
@@ -0,0 +1,79 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api;
+
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+
+import java.util.ArrayList;
+import java.util.List;
+
+/**
+ * Class to encapsulate a Placed scheduling Request.
+ * It has the original Scheduling Request and a list of SchedulerNodes (one
+ * for each 'numAllocation' field in the corresponding ResourceSizing object.
+ *
+ * NOTE: Clients of this class SHOULD NOT rely on the value of
+ *       resourceSizing.numAllocations and instead should use the
+ *       size of collection returned by getNodes() instead.
+ */
+public class PlacedSchedulingRequest {
+
+  // The number of times the Algorithm tried to place the SchedulingRequest
+  // after it was rejected by the commit phase of the Scheduler (due to some
+  // transient state of the cluster. For eg: no space on Node / user limit etc.)
+  // The Algorithm can then try to probably place on a different node.
+  private int placementAttempt = 0;
+  private final SchedulingRequest request;
+  // One Node per numContainers in the SchedulingRequest;
+  private final List<SchedulerNode> nodes = new ArrayList<>();
+
+  public PlacedSchedulingRequest(SchedulingRequest request) {
+    this.request = request;
+  }
+
+  public SchedulingRequest getSchedulingRequest() {
+    return request;
+  }
+
+  /**
+   * List of Node locations on which this Scheduling Request can be placed.
+   * The size of this list = schedulingRequest.resourceSizing.numAllocations.
+   * @return List of Scheduler nodes.
+   */
+  public List<SchedulerNode> getNodes() {
+    return nodes;
+  }
+
+  public int getPlacementAttempt() {
+    return placementAttempt;
+  }
+
+  public void setPlacementAttempt(int attempt) {
+    this.placementAttempt = attempt;
+  }
+
+  @Override
+  public String toString() {
+    return "PlacedSchedulingRequest{" +
+        "placementAttempt=" + placementAttempt +
+        ", request=" + request +
+        ", nodes=" + nodes +
+        '}';
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/SchedulingResponse.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/SchedulingResponse.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/SchedulingResponse.java
new file mode 100644
index 0000000..6c65d84
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/SchedulingResponse.java
@@ -0,0 +1,70 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api;
+
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+
+/**
+ * This class encapsulates the response received from the ResourceScheduler's
+ * attemptAllocateOnNode method.
+ */
+public class SchedulingResponse {
+
+  private final boolean isSuccess;
+  private final ApplicationId applicationId;
+  private final SchedulingRequest schedulingRequest;
+
+  /**
+   * Create a SchedulingResponse.
+   * @param isSuccess did scheduler accept.
+   * @param applicationId Application Id.
+   * @param schedulingRequest Scheduling Request.
+   */
+  public SchedulingResponse(boolean isSuccess, ApplicationId applicationId,
+      SchedulingRequest schedulingRequest) {
+    this.isSuccess = isSuccess;
+    this.applicationId = applicationId;
+    this.schedulingRequest = schedulingRequest;
+  }
+
+  /**
+   * Returns true if Scheduler was able to accept and commit this request.
+   * @return isSuccessful.
+   */
+  public boolean isSuccess() {
+    return this.isSuccess;
+  }
+
+  /**
+   * Get Application Id.
+   * @return Application Id.
+   */
+  public ApplicationId getApplicationId() {
+    return this.applicationId;
+  }
+
+  /**
+   * Get Scheduling Request.
+   * @return Scheduling Request.
+   */
+  public SchedulingRequest getSchedulingRequest() {
+    return this.schedulingRequest;
+  }
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/package-info.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/package-info.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/package-info.java
new file mode 100644
index 0000000..01ed713
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/package-info.java
@@ -0,0 +1,28 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * This Package contains classes related to constrained placement of
+ * Requests.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/TestAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/TestAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/TestAllocationTagsManager.java
deleted file mode 100644
index 0358792..0000000
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/TestAllocationTagsManager.java
+++ /dev/null
@@ -1,328 +0,0 @@
-/*
- * *
- *  Licensed to the Apache Software Foundation (ASF) under one
- *  or more contributor license agreements.  See the NOTICE file
- *  distributed with this work for additional information
- *  regarding copyright ownership.  The ASF licenses this file
- *  to you under the Apache License, Version 2.0 (the
- *  "License"); you may not use this file except in compliance
- *  with the License.  You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- *  Unless required by applicable law or agreed to in writing, software
- *  distributed under the License is distributed on an "AS IS" BASIS,
- *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- *  See the License for the specific language governing permissions and
- *  limitations under the License.
- * /
- */
-
-package org.apache.hadoop.yarn.server.resourcemanager.constraint;
-
-import com.google.common.collect.ImmutableSet;
-import org.apache.hadoop.yarn.api.records.NodeId;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.TestUtils;
-import org.junit.Assert;
-import org.junit.Test;
-
-/**
- * Test functionality of AllocationTagsManager.
- */
-public class TestAllocationTagsManager {
-  @Test
-  public void testAllocationTagsManagerSimpleCases()
-      throws InvalidAllocationTagsQueryException {
-    AllocationTagsManager atm = new AllocationTagsManager();
-
-    /**
-     * Construct test case:
-     * Node1:
-     *    container_1_1 (mapper/reducer/app_1)
-     *    container_1_3 (service/app_1)
-     *
-     * Node2:
-     *    container_1_2 (mapper/reducer/app_1)
-     *    container_1_4 (reducer/app_1)
-     *    container_2_1 (service/app_2)
-     */
-
-    // 3 Containers from app1
-    atm.addContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.addContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
-
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
-
-    // 1 Container from app2
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
-
-    // Get Cardinality of app1 on node1, with tag "mapper"
-    Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node1:1234"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
-            Long::max));
-
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=min
-    Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            ImmutableSet.of("mapper", "reducer"), Long::min));
-
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=max
-    Assert.assertEquals(2,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            ImmutableSet.of("mapper", "reducer"), Long::max));
-
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
-    Assert.assertEquals(3,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            ImmutableSet.of("mapper", "reducer"), Long::sum));
-
-    // Get Cardinality by passing single tag.
-    Assert.assertEquals(1,
-        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1), "mapper"));
-
-    Assert.assertEquals(2,
-        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1), "reducer"));
-
-    // Get Cardinality of app1 on node2, with tag "no_existed/reducer", op=min
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            ImmutableSet.of("no_existed", "reducer"), Long::min));
-
-    // Get Cardinality of app1 on node2, with tag "<applicationId>", op=max
-    // (Expect this returns #containers from app1 on node2)
-    Assert.assertEquals(2,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1), ImmutableSet
-                .of(AllocationTagsNamespaces.APP_ID + TestUtils
-                    .getMockApplicationId(1).toString()), Long::max));
-
-    // Get Cardinality of app1 on node2, with empty tag set, op=max
-    Assert.assertEquals(2,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
-
-    // Get Cardinality of all apps on node2, with empty tag set, op=sum
-    Assert.assertEquals(7,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"), null,
-            ImmutableSet.of(), Long::sum));
-
-    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
-    Assert.assertEquals(5,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
-
-    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
-    Assert.assertEquals(2,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
-
-    // Finish all containers:
-    atm.removeContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.removeContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.removeContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
-
-    atm.removeContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
-
-    atm.removeContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
-
-    // Expect all cardinality to be 0
-    // Get Cardinality of app1 on node1, with tag "mapper"
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node1:1234"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
-            Long::max));
-
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=min
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            ImmutableSet.of("mapper", "reducer"), Long::min));
-
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=max
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            ImmutableSet.of("mapper", "reducer"), Long::max));
-
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            ImmutableSet.of("mapper", "reducer"), Long::sum));
-
-    // Get Cardinality of app1 on node2, with tag "<applicationId>", op=max
-    // (Expect this returns #containers from app1 on node2)
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            ImmutableSet.of(TestUtils.getMockApplicationId(1).toString()),
-            Long::max));
-
-    Assert.assertEquals(0,
-        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1),
-            TestUtils.getMockApplicationId(1).toString()));
-
-    // Get Cardinality of app1 on node2, with empty tag set, op=max
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
-
-    // Get Cardinality of all apps on node2, with empty tag set, op=sum
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"), null,
-            ImmutableSet.of(), Long::sum));
-
-    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
-
-    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
-  }
-
-  @Test
-  public void testAllocationTagsManagerMemoryAfterCleanup()
-      throws InvalidAllocationTagsQueryException {
-    /**
-     * Make sure YARN cleans up all memory once container/app finishes.
-     */
-
-    AllocationTagsManager atm = new AllocationTagsManager();
-
-    // Add a bunch of containers
-    atm.addContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.addContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
-
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
-
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
-
-    // Remove all these containers
-    atm.removeContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.removeContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.removeContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
-
-    atm.removeContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
-
-    atm.removeContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
-
-    // Check internal data structure
-    Assert.assertEquals(0,
-        atm.getGlobalMapping().getNodeToTagsWithCount().size());
-    Assert.assertEquals(0, atm.getPerAppMappings().size());
-  }
-
-  @Test
-  public void testQueryCardinalityWithIllegalParameters()
-      throws InvalidAllocationTagsQueryException {
-    /**
-     * Make sure YARN cleans up all memory once container/app finishes.
-     */
-
-    AllocationTagsManager atm = new AllocationTagsManager();
-
-    // Add a bunch of containers
-    atm.addContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.addContainer(NodeId.fromString("node1:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
-
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
-
-    atm.addContainer(NodeId.fromString("node2:1234"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
-
-    // No node-id
-    boolean caughtException = false;
-    try {
-      atm.getNodeCardinalityByOp(null, TestUtils.getMockApplicationId(2),
-          ImmutableSet.of("mapper"), Long::min);
-    } catch (InvalidAllocationTagsQueryException e) {
-      caughtException = true;
-    }
-    Assert.assertTrue("should fail because of nodeId specified",
-        caughtException);
-
-    // No op
-    caughtException = false;
-    try {
-      atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-          TestUtils.getMockApplicationId(2), ImmutableSet.of("mapper"), null);
-    } catch (InvalidAllocationTagsQueryException e) {
-      caughtException = true;
-    }
-    Assert.assertTrue("should fail because of nodeId specified",
-        caughtException);
-  }
-}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
index 27ff311..538d128 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
@@ -54,7 +54,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWriter;
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
-import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptEventType;
@@ -62,6 +61,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.event.RMAppAt
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNodeEventType;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerUtils;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
 import org.apache.hadoop.yarn.server.utils.BuilderUtils;
 import org.junit.Assert;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
index 61a5555..e8734cc 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
@@ -42,12 +42,12 @@ import org.apache.hadoop.yarn.server.resourcemanager.RMContextImpl;
 import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWriter;
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
-import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.ContainerAllocationExpirer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.fica.FiCaSchedulerApp;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.fica.FiCaSchedulerNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.AMRMTokenSecretManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.ClientToAMTokenSecretManagerInRM;
 import org.apache.hadoop.yarn.server.resourcemanager.security.NMTokenSecretManagerInRM;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
new file mode 100644
index 0000000..4bb2a18
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
@@ -0,0 +1,328 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import com.google.common.collect.ImmutableSet;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.TestUtils;
+import org.junit.Assert;
+import org.junit.Test;
+
+/**
+ * Test functionality of AllocationTagsManager.
+ */
+public class TestAllocationTagsManager {
+  @Test
+  public void testAllocationTagsManagerSimpleCases()
+      throws InvalidAllocationTagsQueryException {
+    AllocationTagsManager atm = new AllocationTagsManager();
+
+    /**
+     * Construct test case:
+     * Node1:
+     *    container_1_1 (mapper/reducer/app_1)
+     *    container_1_3 (service/app_1)
+     *
+     * Node2:
+     *    container_1_2 (mapper/reducer/app_1)
+     *    container_1_4 (reducer/app_1)
+     *    container_2_1 (service/app_2)
+     */
+
+    // 3 Containers from app1
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    // 1 Container from app2
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Get Cardinality of app1 on node1, with tag "mapper"
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node1:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::max));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=min
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::min));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=max
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::max));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
+    Assert.assertEquals(3,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::sum));
+
+    // Get Cardinality by passing single tag.
+    Assert.assertEquals(1,
+        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), "mapper"));
+
+    Assert.assertEquals(2,
+        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), "reducer"));
+
+    // Get Cardinality of app1 on node2, with tag "no_existed/reducer", op=min
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("no_existed", "reducer"), Long::min));
+
+    // Get Cardinality of app1 on node2, with tag "<applicationId>", op=max
+    // (Expect this returns #containers from app1 on node2)
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet
+                .of(AllocationTagsNamespaces.APP_ID + TestUtils
+                    .getMockApplicationId(1).toString()), Long::max));
+
+    // Get Cardinality of app1 on node2, with empty tag set, op=max
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
+
+    // Get Cardinality of all apps on node2, with empty tag set, op=sum
+    Assert.assertEquals(7,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"), null,
+            ImmutableSet.of(), Long::sum));
+
+    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    Assert.assertEquals(5,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
+
+    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
+
+    // Finish all containers:
+    atm.removeContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.removeContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Expect all cardinality to be 0
+    // Get Cardinality of app1 on node1, with tag "mapper"
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node1:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::max));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=min
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::min));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=max
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::max));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::sum));
+
+    // Get Cardinality of app1 on node2, with tag "<applicationId>", op=max
+    // (Expect this returns #containers from app1 on node2)
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of(TestUtils.getMockApplicationId(1).toString()),
+            Long::max));
+
+    Assert.assertEquals(0,
+        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            TestUtils.getMockApplicationId(1).toString()));
+
+    // Get Cardinality of app1 on node2, with empty tag set, op=max
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
+
+    // Get Cardinality of all apps on node2, with empty tag set, op=sum
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"), null,
+            ImmutableSet.of(), Long::sum));
+
+    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
+
+    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
+  }
+
+  @Test
+  public void testAllocationTagsManagerMemoryAfterCleanup()
+      throws InvalidAllocationTagsQueryException {
+    /**
+     * Make sure YARN cleans up all memory once container/app finishes.
+     */
+
+    AllocationTagsManager atm = new AllocationTagsManager();
+
+    // Add a bunch of containers
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Remove all these containers
+    atm.removeContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.removeContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Check internal data structure
+    Assert.assertEquals(0,
+        atm.getGlobalMapping().getNodeToTagsWithCount().size());
+    Assert.assertEquals(0, atm.getPerAppMappings().size());
+  }
+
+  @Test
+  public void testQueryCardinalityWithIllegalParameters()
+      throws InvalidAllocationTagsQueryException {
+    /**
+     * Make sure YARN cleans up all memory once container/app finishes.
+     */
+
+    AllocationTagsManager atm = new AllocationTagsManager();
+
+    // Add a bunch of containers
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // No node-id
+    boolean caughtException = false;
+    try {
+      atm.getNodeCardinalityByOp(null, TestUtils.getMockApplicationId(2),
+          ImmutableSet.of("mapper"), Long::min);
+    } catch (InvalidAllocationTagsQueryException e) {
+      caughtException = true;
+    }
+    Assert.assertTrue("should fail because of nodeId specified",
+        caughtException);
+
+    // No op
+    caughtException = false;
+    try {
+      atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+          TestUtils.getMockApplicationId(2), ImmutableSet.of("mapper"), null);
+    } catch (InvalidAllocationTagsQueryException e) {
+      caughtException = true;
+    }
+    Assert.assertTrue("should fail because of nodeId specified",
+        caughtException);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
index 4b902a7..db749ac 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
@@ -74,7 +74,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWri
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.NullRMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
-import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMAppImpl;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttempt;
@@ -93,6 +92,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNodeReport;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.TestSchedulerUtils;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacitySchedulerConfiguration;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAddedSchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptAddedSchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.NodeAddedSchedulerEvent;


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[43/50] [abbrv] hadoop git commit: YARN-7774. Miscellaneous fixes to the PlacementProcessor. (asuresh)

Posted by as...@apache.org.
YARN-7774. Miscellaneous fixes to the PlacementProcessor. (asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/7445139f
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/7445139f
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/7445139f

Branch: refs/heads/YARN-6592
Commit: 7445139fdf3a78ea244fa4057640630ed0cc8537
Parents: 77200ae
Author: Arun Suresh <as...@apache.org>
Authored: Thu Jan 18 11:01:36 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../scheduler/SchedulerNode.java                | 16 +++-
 .../scheduler/capacity/CapacityScheduler.java   |  4 +
 .../constraint/PlacementConstraintsUtil.java    |  5 +-
 .../constraint/algorithm/CircularIterator.java  | 86 ++++++++++++++++++++
 .../algorithm/DefaultPlacementAlgorithm.java    | 50 ++++++++++--
 .../constraint/processor/BatchedRequests.java   |  8 ++
 .../SingleConstraintAppPlacementAllocator.java  |  2 +-
 .../yarn/server/resourcemanager/MockAM.java     |  4 +-
 .../constraint/TestPlacementProcessor.java      | 24 +++---
 .../algorithm/TestCircularIterator.java         | 84 +++++++++++++++++++
 ...stSingleConstraintAppPlacementAllocator.java | 28 +++----
 11 files changed, 271 insertions(+), 40 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
index 89f748d..96a8e34 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
@@ -469,6 +469,20 @@ public abstract class SchedulerNode {
     this.lastHeartbeatMonotonicTime = Time.monotonicNow();
   }
 
+  @Override
+  public boolean equals(Object o) {
+    if (this == o) return true;
+    if (!(o instanceof SchedulerNode)) return false;
+
+    SchedulerNode that = (SchedulerNode) o;
+
+    return getNodeID().equals(that.getNodeID());
+  }
+
+  @Override
+  public int hashCode() {
+    return getNodeID().hashCode();
+  }
 
   private static class ContainerInfo {
     private final RMContainer container;
@@ -479,4 +493,4 @@ public abstract class SchedulerNode {
       this.launchedOnNode = launchedOnNode;
     }
   }
-}
\ No newline at end of file
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
index c713036..429f9f3 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
@@ -2610,6 +2610,10 @@ public class CapacityScheduler extends
             " but only 1 will be attempted !!");
       }
       if (!appAttempt.isStopped()) {
+        Resource resource =
+            schedulingRequest.getResourceSizing().getResources();
+        schedulingRequest.getResourceSizing().setResources(
+            getNormalizedResource(resource));
         ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode>
             resourceCommitRequest = createResourceCommitRequest(
             appAttempt, schedulingRequest, schedulerNode);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
index 24c5a5e..ff5cb67 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
@@ -99,14 +99,11 @@ public final class PlacementConstraintsUtil {
             targetApplicationId, te.getTargetValues(), Long::min);
       }
     }
-    // Make sure Anti-affinity satisfies hard upper limit
-    maxScopeCardinality = desiredMaxCardinality == 0 ? maxScopeCardinality - 1
-        : maxScopeCardinality;
 
     return (desiredMinCardinality <= 0
         || minScopeCardinality >= desiredMinCardinality) && (
         desiredMaxCardinality == Integer.MAX_VALUE
-            || maxScopeCardinality < desiredMaxCardinality);
+            || maxScopeCardinality <= desiredMaxCardinality);
   }
 
   private static boolean canSatisfyNodePartitionConstraintExpresssion(

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/CircularIterator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/CircularIterator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/CircularIterator.java
new file mode 100644
index 0000000..bf9503b
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/CircularIterator.java
@@ -0,0 +1,86 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm;
+
+import java.util.Iterator;
+
+/**
+ * Iterator that can take current state of an existing iterator
+ * and circularly iterate to that point.
+ */
+class CircularIterator<T> {
+  private Iterator<T> iterator = null;
+  private final Iterable<T> iterable;
+
+  private T startElem = null;
+  private T nextElem = null;
+
+  // if not null, This overrides the starting Element.
+  private T firstElem = null;
+
+  // Can't handle empty or null lists.
+  CircularIterator(T first, Iterator<T> iter,
+      Iterable<T> iterable) {
+    this.firstElem = first;
+    this.iterable = iterable;
+    if (!iter.hasNext()) {
+      this.iterator = this.iterable.iterator();
+    } else {
+      this.iterator = iter;
+    }
+    this.startElem = this.iterator.next();
+    this.nextElem = this.startElem;
+  }
+
+  boolean hasNext() {
+    if (this.nextElem != null || this.firstElem != null) {
+      return true;
+    } else {
+      if (this.iterator.hasNext()) {
+        T next = this.iterator.next();
+        if (this.startElem.equals(next)) {
+          return false;
+        } else {
+          this.nextElem = next;
+          return true;
+        }
+      } else {
+        this.iterator = this.iterable.iterator();
+        this.nextElem = this.iterator.next();
+        if (this.startElem.equals(this.nextElem)) {
+          return false;
+        }
+        return true;
+      }
+    }
+  }
+
+  T next() {
+    T retVal;
+    if (this.firstElem != null) {
+      retVal = this.firstElem;
+      this.firstElem = null;
+    } else if (this.nextElem != null) {
+      retVal = this.nextElem;
+      this.nextElem = null;
+    } else {
+      retVal = this.iterator.next();
+    }
+    return retVal;
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
index eb3fe88..a0749f5 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
@@ -17,6 +17,7 @@
  */
 package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm;
 
+import java.util.ArrayList;
 import java.util.Iterator;
 import java.util.List;
 
@@ -49,6 +50,9 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
   private static final Logger LOG =
       LoggerFactory.getLogger(DefaultPlacementAlgorithm.class);
 
+  // Number of times to re-attempt placing a single scheduling request.
+  private static final int RE_ATTEMPT_COUNT = 2;
+
   private AllocationTagsManager tagsManager;
   private PlacementConstraintManager constraintManager;
   private NodeCandidateSelector nodeSelector;
@@ -85,16 +89,50 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
         new ConstraintPlacementAlgorithmOutput(requests.getApplicationId());
     List<SchedulerNode> allNodes = nodeSelector.selectNodes(null);
 
+    List<SchedulingRequest> rejectedRequests = new ArrayList<>();
+    int rePlacementCount = RE_ATTEMPT_COUNT;
+    while (rePlacementCount > 0) {
+      doPlacement(requests, resp, allNodes, rejectedRequests);
+      if (rejectedRequests.size() == 0 || rePlacementCount == 1) {
+        break;
+      }
+      requests = new BatchedRequests(requests.getIteratorType(),
+          requests.getApplicationId(), rejectedRequests,
+          requests.getPlacementAttempt());
+      rejectedRequests = new ArrayList<>();
+      rePlacementCount--;
+    }
+
+    resp.getRejectedRequests().addAll(rejectedRequests);
+    collector.collect(resp);
+    // Clean current temp-container tags
+    this.tagsManager.cleanTempContainers(requests.getApplicationId());
+  }
+
+  private void doPlacement(BatchedRequests requests,
+      ConstraintPlacementAlgorithmOutput resp,
+      List<SchedulerNode> allNodes,
+      List<SchedulingRequest> rejectedRequests) {
     Iterator<SchedulingRequest> requestIterator = requests.iterator();
+    Iterator<SchedulerNode> nIter = allNodes.iterator();
+    SchedulerNode lastSatisfiedNode = null;
     while (requestIterator.hasNext()) {
+      if (allNodes.isEmpty()) {
+        LOG.warn("No nodes available for placement at the moment !!");
+        break;
+      }
       SchedulingRequest schedulingRequest = requestIterator.next();
-      Iterator<SchedulerNode> nodeIter = allNodes.iterator();
+      CircularIterator<SchedulerNode> nodeIter =
+          new CircularIterator(lastSatisfiedNode, nIter, allNodes);
       int numAllocs = schedulingRequest.getResourceSizing().getNumAllocations();
       while (nodeIter.hasNext() && numAllocs > 0) {
         SchedulerNode node = nodeIter.next();
         try {
-          if (attemptPlacementOnNode(requests.getApplicationId(),
-              schedulingRequest, node)) {
+          String tag = schedulingRequest.getAllocationTags() == null ? "" :
+              schedulingRequest.getAllocationTags().iterator().next();
+          if (!requests.getBlacklist(tag).contains(node.getNodeID()) &&
+              attemptPlacementOnNode(
+                  requests.getApplicationId(), schedulingRequest, node)) {
             schedulingRequest.getResourceSizing()
                 .setNumAllocations(--numAllocs);
             PlacedSchedulingRequest placedReq =
@@ -108,6 +146,7 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
             this.tagsManager.addTempContainer(node.getNodeID(),
                 requests.getApplicationId(),
                 schedulingRequest.getAllocationTags());
+            lastSatisfiedNode = node;
           }
         } catch (InvalidAllocationTagsQueryException e) {
           LOG.warn("Got exception from TagManager !", e);
@@ -117,9 +156,6 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
     // Add all requests whose numAllocations still > 0 to rejected list.
     requests.getSchedulingRequests().stream()
         .filter(sReq -> sReq.getResourceSizing().getNumAllocations() > 0)
-        .forEach(rejReq -> resp.getRejectedRequests().add(rejReq));
-    collector.collect(resp);
-    // Clean current temp-container tags
-    this.tagsManager.cleanTempContainers(requests.getApplicationId());
+        .forEach(rejReq -> rejectedRequests.add(rejReq));
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
index 8b04860..8e39b63 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
@@ -133,4 +133,12 @@ public class BatchedRequests
   public Set<NodeId> getBlacklist(String tag) {
     return blacklist.getOrDefault(tag, Collections.EMPTY_SET);
   }
+
+  /**
+   * Get Iterator type.
+   * @return Iterator type.
+   */
+  public IteratorType getIteratorType() {
+    return iteratorType;
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
index f8f758c..dd30b61 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
@@ -263,7 +263,7 @@ public class SingleConstraintAppPlacementAllocator<N extends SchedulerNode>
     }
 
     if (singleConstraint.getMinCardinality() != 0
-        || singleConstraint.getMaxCardinality() != 1) {
+        || singleConstraint.getMaxCardinality() != 0) {
       throwExceptionWithMetaInfo(
           "Only support anti-affinity, which is: minCardinality=0, "
               + "maxCardinality=1");

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
index 9fa2c40..2ed201c 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
@@ -311,7 +311,7 @@ public class MockAM {
             .allocationRequestId(allocationId).priority(priority)
             .allocationTags(allocationTags).placementConstraintExpression(
                 PlacementConstraints
-                    .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                    .targetNotIn(PlacementConstraints.NODE,
                         PlacementConstraints.PlacementTargets
                             .allocationTagToIntraApp(targetTags)).build())
             .resourceSizing(resourceSizing).build()), null);
@@ -325,7 +325,7 @@ public class MockAM {
             ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
             .allocationRequestId(allocationId).priority(priority)
             .placementConstraintExpression(PlacementConstraints
-                .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                .targetNotIn(PlacementConstraints.NODE,
                     PlacementConstraints.PlacementTargets
                         .allocationTagToIntraApp(tags),
                     PlacementConstraints.PlacementTargets

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
index c260fe0..65daeb8 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
@@ -153,13 +153,13 @@ public class TestPlacementProcessor {
   @Test(timeout = 300000)
   public void testCardinalityPlacement() throws Exception {
     HashMap<NodeId, MockNM> nodes = new HashMap<>();
-    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    MockNM nm1 = new MockNM("h1:1234", 8192, rm.getResourceTrackerService());
     nodes.put(nm1.getNodeId(), nm1);
-    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    MockNM nm2 = new MockNM("h2:1234", 8192, rm.getResourceTrackerService());
     nodes.put(nm2.getNodeId(), nm2);
-    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    MockNM nm3 = new MockNM("h3:1234", 8192, rm.getResourceTrackerService());
     nodes.put(nm3.getNodeId(), nm3);
-    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    MockNM nm4 = new MockNM("h4:1234", 8192, rm.getResourceTrackerService());
     nodes.put(nm4.getNodeId(), nm4);
     nm1.registerNode();
     nm2.registerNode();
@@ -171,7 +171,7 @@ public class TestPlacementProcessor {
     MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
         Collections.singletonMap(Collections.singleton("foo"),
             PlacementConstraints.build(PlacementConstraints
-                .targetCardinality(NODE, 0, 4, allocationTag("foo")))));
+                .targetCardinality(NODE, 0, 3, allocationTag("foo")))));
     am1.addSchedulingRequest(
         Arrays.asList(schedulingRequest(1, 1, 1, 512, "foo"),
             schedulingRequest(1, 2, 1, 512, "foo"),
@@ -201,13 +201,13 @@ public class TestPlacementProcessor {
   @Test(timeout = 300000)
   public void testAffinityPlacement() throws Exception {
     HashMap<NodeId, MockNM> nodes = new HashMap<>();
-    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    MockNM nm1 = new MockNM("h1:1234", 8192, rm.getResourceTrackerService());
     nodes.put(nm1.getNodeId(), nm1);
-    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    MockNM nm2 = new MockNM("h2:1234", 8192, rm.getResourceTrackerService());
     nodes.put(nm2.getNodeId(), nm2);
-    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    MockNM nm3 = new MockNM("h3:1234", 8192, rm.getResourceTrackerService());
     nodes.put(nm3.getNodeId(), nm3);
-    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    MockNM nm4 = new MockNM("h4:1234", 8192, rm.getResourceTrackerService());
     nodes.put(nm4.getNodeId(), nm4);
     nm1.registerNode();
     nm2.registerNode();
@@ -267,7 +267,7 @@ public class TestPlacementProcessor {
         PlacementConstraints.build(targetIn(NODE, allocationTag("bar"))));
     // Containers with allocationTag 'foo' should not exceed 2 per NODE
     constraintMap.put(Collections.singleton("foo"), PlacementConstraints
-        .build(targetCardinality(NODE, 0, 2, allocationTag("foo"))));
+        .build(targetCardinality(NODE, 0, 1, allocationTag("foo"))));
     MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2, constraintMap);
     am1.addSchedulingRequest(
         Arrays.asList(schedulingRequest(1, 1, 1, 512, "bar"),
@@ -513,7 +513,8 @@ public class TestPlacementProcessor {
   private static void waitForContainerAllocation(Collection<MockNM> nodes,
       MockAM am, List<Container> allocatedContainers, int containerNum)
       throws Exception {
-    while (allocatedContainers.size() < containerNum) {
+    int attemptCount = 10;
+    while (allocatedContainers.size() < containerNum && attemptCount > 0) {
       for (MockNM node : nodes) {
         node.nodeHeartbeat(true);
       }
@@ -522,6 +523,7 @@ public class TestPlacementProcessor {
       sleep(1000);
       AllocateResponse allocResponse = am.schedule();
       allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+      attemptCount--;
     }
   }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/TestCircularIterator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/TestCircularIterator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/TestCircularIterator.java
new file mode 100644
index 0000000..5ce76b0
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/TestCircularIterator.java
@@ -0,0 +1,84 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm;
+
+import org.junit.Assert;
+import org.junit.Test;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.Iterator;
+import java.util.List;
+
+/**
+ * Simple test case to test the Circular Iterator.
+ */
+public class TestCircularIterator {
+
+  @Test
+  public void testIteration() throws Exception {
+    List<String> list = Arrays.asList("a", "b", "c", "d");
+    CircularIterator<String> ci =
+        new CircularIterator<>(null, list.iterator(), list);
+    StringBuffer sb = new StringBuffer("");
+    while (ci.hasNext()) {
+      sb.append(ci.next());
+    }
+    Assert.assertEquals("abcd", sb.toString());
+
+    Iterator<String> lIter = list.iterator();
+    lIter.next();
+    lIter.next();
+    sb = new StringBuffer("");
+    ci = new CircularIterator<>(null, lIter, list);
+    while (ci.hasNext()) {
+      sb.append(ci.next());
+    }
+    Assert.assertEquals("cdab", sb.toString());
+
+    lIter = list.iterator();
+    lIter.next();
+    lIter.next();
+    lIter.next();
+    sb = new StringBuffer("");
+    ci = new CircularIterator<>("x", lIter, list);
+    while (ci.hasNext()) {
+      sb.append(ci.next());
+    }
+    Assert.assertEquals("xdabc", sb.toString());
+
+    list = Arrays.asList("a");
+    lIter = list.iterator();
+    lIter.next();
+    sb = new StringBuffer("");
+    ci = new CircularIterator<>("y", lIter, list);
+    while (ci.hasNext()) {
+      sb.append(ci.next());
+    }
+    Assert.assertEquals("ya", sb.toString());
+
+    try {
+      list = new ArrayList<>();
+      lIter = list.iterator();
+      new CircularIterator<>("y", lIter, list);
+      Assert.fail("Should fail..");
+    } catch (Exception e) {
+      // foo bar
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7445139f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java
index 479d2c1..3485ea8 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java
@@ -118,7 +118,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer"),
                 PlacementConstraints.PlacementTargets.nodePartition(""))
@@ -134,7 +134,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer"),
                 PlacementConstraints.PlacementTargets.nodePartition("x"))
@@ -150,7 +150,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer")).build())
         .resourceSizing(
@@ -165,7 +165,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer")).build())
         .resourceSizing(
@@ -181,7 +181,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer")).build())
         .build(), true);
@@ -191,7 +191,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1).build())
+            .targetNotIn(PlacementConstraints.NODE).build())
         .build(), true);
 
     // Invalid (with multiple allocation tags expression specified)
@@ -199,7 +199,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper"),
                 PlacementConstraints.PlacementTargets
@@ -214,7 +214,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper"),
                 PlacementConstraints.PlacementTargets
@@ -255,7 +255,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.RACK, 0, 1,
+            .targetNotIn(PlacementConstraints.RACK,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer"),
                 PlacementConstraints.PlacementTargets.nodePartition(""))
@@ -268,7 +268,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.OPPORTUNISTIC))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer"),
                 PlacementConstraints.PlacementTargets.nodePartition(""))
@@ -284,7 +284,7 @@ public class TestSingleConstraintAppPlacementAllocator {
             ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
             .allocationRequestId(10L).priority(Priority.newInstance(1))
             .placementConstraintExpression(PlacementConstraints
-                .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                .targetNotIn(PlacementConstraints.NODE,
                     PlacementConstraints.PlacementTargets
                         .allocationTagToIntraApp("mapper", "reducer"),
                     PlacementConstraints.PlacementTargets.nodePartition(""))
@@ -330,7 +330,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer"),
                 PlacementConstraints.PlacementTargets.nodePartition(""))
@@ -350,7 +350,7 @@ public class TestSingleConstraintAppPlacementAllocator {
             ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
             .allocationRequestId(10L).priority(Priority.newInstance(1))
             .placementConstraintExpression(PlacementConstraints
-                .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                .targetNotIn(PlacementConstraints.NODE,
                     PlacementConstraints.PlacementTargets
                         .allocationTagToIntraApp("mapper", "reducer"),
                     PlacementConstraints.PlacementTargets.nodePartition(""))
@@ -372,7 +372,7 @@ public class TestSingleConstraintAppPlacementAllocator {
         ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
         .allocationRequestId(10L).priority(Priority.newInstance(1))
         .placementConstraintExpression(PlacementConstraints
-            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+            .targetNotIn(PlacementConstraints.NODE,
                 PlacementConstraints.PlacementTargets
                     .allocationTagToIntraApp("mapper", "reducer"),
                 PlacementConstraints.PlacementTargets.nodePartition("x"))


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[12/50] [abbrv] hadoop git commit: YARN-7790. Improve Capacity Scheduler Async Scheduling to better handle node failures. Contributed by Wangda Tan.

Posted by as...@apache.org.
YARN-7790. Improve Capacity Scheduler Async Scheduling to better handle node failures. Contributed by Wangda Tan.


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/e9c72d04
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/e9c72d04
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/e9c72d04

Branch: refs/heads/YARN-6592
Commit: e9c72d04beddfe0252d2e81123a9fe66bdf04078
Parents: 3400d0c
Author: Sunil G <su...@apache.org>
Authored: Mon Jan 29 20:43:08 2018 +0530
Committer: Sunil G <su...@apache.org>
Committed: Mon Jan 29 20:44:38 2018 +0530

----------------------------------------------------------------------
 .../scheduler/AbstractYarnScheduler.java        |  51 +++---
 .../scheduler/SchedulerNode.java                |  16 ++
 .../scheduler/capacity/CapacityScheduler.java   |  49 +++++-
 .../TestRMHAForAsyncScheduler.java              |  38 ++++-
 .../TestCapacitySchedulerAsyncScheduling.java   | 159 ++++++++++++++++++-
 5 files changed, 276 insertions(+), 37 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/e9c72d04/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
index c94c379..4b76327 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
@@ -980,11 +980,11 @@ public abstract class AbstractYarnScheduler
   /**
    * Get lists of new containers from NodeManager and process them.
    * @param nm The RMNode corresponding to the NodeManager
+   * @param schedulerNode schedulerNode
    * @return list of completed containers
    */
-  protected List<ContainerStatus> updateNewContainerInfo(RMNode nm) {
-    SchedulerNode node = getNode(nm.getNodeID());
-
+  private List<ContainerStatus> updateNewContainerInfo(RMNode nm,
+      SchedulerNode schedulerNode) {
     List<UpdatedContainerInfo> containerInfoList = nm.pullContainerUpdates();
     List<ContainerStatus> newlyLaunchedContainers =
         new ArrayList<>();
@@ -999,14 +999,15 @@ public abstract class AbstractYarnScheduler
 
     // Processing the newly launched containers
     for (ContainerStatus launchedContainer : newlyLaunchedContainers) {
-      containerLaunchedOnNode(launchedContainer.getContainerId(), node);
+      containerLaunchedOnNode(launchedContainer.getContainerId(),
+          schedulerNode);
     }
 
     // Processing the newly increased containers
     List<Container> newlyIncreasedContainers =
         nm.pullNewlyIncreasedContainers();
     for (Container container : newlyIncreasedContainers) {
-      containerIncreasedOnNode(container.getId(), node, container);
+      containerIncreasedOnNode(container.getId(), schedulerNode, container);
     }
 
     return completedContainers;
@@ -1017,12 +1018,12 @@ public abstract class AbstractYarnScheduler
    * @param completedContainers Extracted list of completed containers
    * @param releasedResources Reference resource object for completed containers
    * @param nodeId NodeId corresponding to the NodeManager
+   * @param schedulerNode schedulerNode
    * @return The total number of released containers
    */
-  protected int updateCompletedContainers(List<ContainerStatus>
-      completedContainers, Resource releasedResources, NodeId nodeId) {
+  private int updateCompletedContainers(List<ContainerStatus> completedContainers,
+      Resource releasedResources, NodeId nodeId, SchedulerNode schedulerNode) {
     int releasedContainers = 0;
-    SchedulerNode node = getNode(nodeId);
     List<ContainerId> untrackedContainerIdList = new ArrayList<ContainerId>();
     for (ContainerStatus completedContainer : completedContainers) {
       ContainerId containerId = completedContainer.getContainerId();
@@ -1030,8 +1031,8 @@ public abstract class AbstractYarnScheduler
       RMContainer container = getRMContainer(containerId);
       completedContainer(container,
           completedContainer, RMContainerEventType.FINISHED);
-      if (node != null) {
-        node.releaseContainer(containerId, true);
+      if (schedulerNode != null) {
+        schedulerNode.releaseContainer(containerId, true);
       }
 
       if (container != null) {
@@ -1076,14 +1077,14 @@ public abstract class AbstractYarnScheduler
   /**
    * Update container and utilization information on the NodeManager.
    * @param nm The NodeManager to update
+   * @param schedulerNode schedulerNode
    */
-  protected void updateNodeResourceUtilization(RMNode nm) {
-    SchedulerNode node = getNode(nm.getNodeID());
+  protected void updateNodeResourceUtilization(RMNode nm,
+      SchedulerNode schedulerNode) {
     // Updating node resource utilization
-    node.setAggregatedContainersUtilization(
+    schedulerNode.setAggregatedContainersUtilization(
         nm.getAggregatedContainersUtilization());
-    node.setNodeUtilization(nm.getNodeUtilization());
-
+    schedulerNode.setNodeUtilization(nm.getNodeUtilization());
   }
 
   /**
@@ -1097,12 +1098,17 @@ public abstract class AbstractYarnScheduler
     }
 
     // Process new container information
-    List<ContainerStatus> completedContainers = updateNewContainerInfo(nm);
+    SchedulerNode schedulerNode = getNode(nm.getNodeID());
+    List<ContainerStatus> completedContainers = updateNewContainerInfo(nm,
+        schedulerNode);
+
+    // Notify Scheduler Node updated.
+    schedulerNode.notifyNodeUpdate();
 
     // Process completed containers
     Resource releasedResources = Resource.newInstance(0, 0);
     int releasedContainers = updateCompletedContainers(completedContainers,
-        releasedResources, nm.getNodeID());
+        releasedResources, nm.getNodeID(), schedulerNode);
 
     // If the node is decommissioning, send an update to have the total
     // resource equal to the used resource, so no available resource to
@@ -1115,18 +1121,17 @@ public abstract class AbstractYarnScheduler
           .getEventHandler()
           .handle(
               new RMNodeResourceUpdateEvent(nm.getNodeID(), ResourceOption
-                  .newInstance(getSchedulerNode(nm.getNodeID())
-                      .getAllocatedResource(), 0)));
+                  .newInstance(schedulerNode.getAllocatedResource(), 0)));
     }
 
     updateSchedulerHealthInformation(releasedResources, releasedContainers);
-    updateNodeResourceUtilization(nm);
+    updateNodeResourceUtilization(nm, schedulerNode);
 
     // Now node data structures are up-to-date and ready for scheduling.
     if(LOG.isDebugEnabled()) {
-      SchedulerNode node = getNode(nm.getNodeID());
-      LOG.debug("Node being looked for scheduling " + nm +
-          " availableResource: " + node.getUnallocatedResource());
+      LOG.debug(
+          "Node being looked for scheduling " + nm + " availableResource: "
+              + schedulerNode.getUnallocatedResource());
     }
   }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e9c72d04/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
index 05dbf1e..89f748d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
@@ -30,6 +30,7 @@ import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.classification.InterfaceAudience.Private;
 import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.util.Time;
 import org.apache.hadoop.yarn.api.records.Container;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.ExecutionType;
@@ -76,6 +77,9 @@ public abstract class SchedulerNode {
 
   private volatile Set<String> labels = null;
 
+  // Last updated time
+  private volatile long lastHeartbeatMonotonicTime;
+
   public SchedulerNode(RMNode node, boolean usePortForNodeName,
       Set<String> labels) {
     this.rmNode = node;
@@ -87,6 +91,7 @@ public abstract class SchedulerNode {
       nodeName = rmNode.getHostName();
     }
     this.labels = ImmutableSet.copyOf(labels);
+    this.lastHeartbeatMonotonicTime = Time.monotonicNow();
   }
 
   public SchedulerNode(RMNode node, boolean usePortForNodeName) {
@@ -453,6 +458,17 @@ public abstract class SchedulerNode {
     return this.nodeUtilization;
   }
 
+  public long getLastHeartbeatMonotonicTime() {
+    return lastHeartbeatMonotonicTime;
+  }
+
+  /**
+   * This will be called for each node heartbeat.
+   */
+  public void notifyNodeUpdate() {
+    this.lastHeartbeatMonotonicTime = Time.monotonicNow();
+  }
+
 
   private static class ContainerInfo {
     private final RMContainer container;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e9c72d04/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
index 99f4456..03ca507 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
@@ -142,7 +142,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.SimpleC
 import org.apache.hadoop.yarn.server.resourcemanager.security.AppPriorityACLsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.RMContainerTokenSecretManager;
 import org.apache.hadoop.yarn.server.utils.Lock;
-import org.apache.hadoop.yarn.util.Clock;
 import org.apache.hadoop.yarn.util.resource.DefaultResourceCalculator;
 import org.apache.hadoop.yarn.util.resource.ResourceCalculator;
 import org.apache.hadoop.yarn.util.resource.ResourceUtils;
@@ -181,8 +180,6 @@ public class CapacityScheduler extends
 
   private CSConfigurationProvider csConfProvider;
 
-  protected Clock monotonicClock;
-
   @Override
   public void setConf(Configuration conf) {
       yarnConf = conf;
@@ -243,6 +240,8 @@ public class CapacityScheduler extends
   private RMNodeLabelsManager labelManager;
   private AppPriorityACLsManager appPriorityACLManager;
 
+  private static boolean printedVerboseLoggingForAsyncScheduling = false;
+
   /**
    * EXPERT
    */
@@ -471,6 +470,22 @@ public class CapacityScheduler extends
 
   private final static Random random = new Random(System.currentTimeMillis());
 
+  private static boolean shouldSkipNodeSchedule(FiCaSchedulerNode node,
+      CapacityScheduler cs, boolean printVerboseLog) {
+    // Skip node which missed 2 heartbeats since the node might be dead and
+    // we should not continue allocate containers on that.
+    long timeElapsedFromLastHeartbeat =
+        Time.monotonicNow() - node.getLastHeartbeatMonotonicTime();
+    if (timeElapsedFromLastHeartbeat > cs.nmHeartbeatInterval * 2) {
+      if (printVerboseLog && LOG.isDebugEnabled()) {
+        LOG.debug("Skip scheduling on node because it haven't heartbeated for "
+            + timeElapsedFromLastHeartbeat / 1000.0f + " secs");
+      }
+      return true;
+    }
+    return false;
+  }
+
   /**
    * Schedule on all nodes by starting at a random point.
    * @param cs
@@ -481,16 +496,42 @@ public class CapacityScheduler extends
     Collection<FiCaSchedulerNode> nodes = cs.nodeTracker.getAllNodes();
     int start = random.nextInt(nodes.size());
 
+    // To avoid too verbose DEBUG logging, only print debug log once for
+    // every 10 secs.
+    boolean printSkipedNodeLogging = false;
+    if (Time.monotonicNow() / 1000 % 10 == 0) {
+      printSkipedNodeLogging = (!printedVerboseLoggingForAsyncScheduling);
+    } else {
+      printedVerboseLoggingForAsyncScheduling = false;
+    }
+
+    // Allocate containers of node [start, end)
     for (FiCaSchedulerNode node : nodes) {
       if (current++ >= start) {
+        if (shouldSkipNodeSchedule(node, cs, printSkipedNodeLogging)) {
+          continue;
+        }
         cs.allocateContainersToNode(node.getNodeID(), false);
       }
     }
-    // Now, just get everyone to be safe
+
+    current = 0;
+
+    // Allocate containers of node [0, start)
     for (FiCaSchedulerNode node : nodes) {
+      if (current++ > start) {
+        break;
+      }
+      if (shouldSkipNodeSchedule(node, cs, printSkipedNodeLogging)) {
+        continue;
+      }
       cs.allocateContainersToNode(node.getNodeID(), false);
     }
 
+    if (printSkipedNodeLogging) {
+      printedVerboseLoggingForAsyncScheduling = true;
+    }
+
     Thread.sleep(cs.getAsyncScheduleInterval());
   }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e9c72d04/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/TestRMHAForAsyncScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/TestRMHAForAsyncScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/TestRMHAForAsyncScheduler.java
index 46d5cda..36f1762 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/TestRMHAForAsyncScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/TestRMHAForAsyncScheduler.java
@@ -28,13 +28,19 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptS
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacityScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacitySchedulerConfiguration;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.TestCapacitySchedulerAsyncScheduling;
 import org.apache.hadoop.yarn.util.resource.DominantResourceCalculator;
 import org.apache.hadoop.yarn.util.resource.ResourceCalculator;
 import org.junit.Assert;
 import org.junit.Before;
 import org.junit.Test;
 
+import java.util.Arrays;
+import java.util.List;
+
 public class TestRMHAForAsyncScheduler extends RMHATestBase {
+  private TestCapacitySchedulerAsyncScheduling.NMHeartbeatThread
+      nmHeartbeatThread = null;
 
   @Before
   @Override
@@ -57,26 +63,49 @@ public class TestRMHAForAsyncScheduler extends RMHATestBase {
         CapacitySchedulerConfiguration.SCHEDULE_ASYNCHRONOUSLY_ENABLE, true);
   }
 
+  private void keepNMHeartbeat(List<MockNM> mockNMs, int interval) {
+    if (nmHeartbeatThread != null) {
+      nmHeartbeatThread.setShouldStop();
+      nmHeartbeatThread = null;
+    }
+    nmHeartbeatThread =
+        new TestCapacitySchedulerAsyncScheduling.NMHeartbeatThread(mockNMs,
+            interval);
+    nmHeartbeatThread.start();
+  }
+
+  private void pauseNMHeartbeat() {
+    if (nmHeartbeatThread != null) {
+      nmHeartbeatThread.setShouldStop();
+      nmHeartbeatThread = null;
+    }
+  }
+
   @Test(timeout = 60000)
   public void testAsyncScheduleThreadStateAfterRMHATransit() throws Exception {
     // start two RMs, and transit rm1 to active, rm2 to standby
     startRMs();
     // register NM
-    rm1.registerNode("h1:1234", 8192, 8);
+    MockNM nm = rm1.registerNode("192.1.1.1:1234", 8192, 8);
     // submit app1 and check
     RMApp app1 = submitAppAndCheckLaunched(rm1);
+    keepNMHeartbeat(Arrays.asList(nm), 1000);
 
     // failover RM1 to RM2
     explicitFailover();
     checkAsyncSchedulerThreads(Thread.currentThread());
+    pauseNMHeartbeat();
 
     // register NM, kill app1
-    rm2.registerNode("h1:1234", 8192, 8);
+    nm = rm2.registerNode("192.1.1.1:1234", 8192, 8);
+    keepNMHeartbeat(Arrays.asList(nm), 1000);
+
     rm2.waitForState(app1.getCurrentAppAttempt().getAppAttemptId(),
         RMAppAttemptState.LAUNCHED);
     rm2.killApp(app1.getApplicationId());
     // submit app3 and check
     RMApp app2 = submitAppAndCheckLaunched(rm2);
+    pauseNMHeartbeat();
 
     // failover RM2 to RM1
     HAServiceProtocol.StateChangeRequestInfo requestInfo =
@@ -92,12 +121,15 @@ public class TestRMHAForAsyncScheduler extends RMHATestBase {
     checkAsyncSchedulerThreads(Thread.currentThread());
 
     // register NM, kill app2
-    rm1.registerNode("h1:1234", 8192, 8);
+    nm = rm1.registerNode("192.1.1.1:1234", 8192, 8);
+    keepNMHeartbeat(Arrays.asList(nm), 1000);
+
     rm1.waitForState(app2.getCurrentAppAttempt().getAppAttemptId(),
         RMAppAttemptState.LAUNCHED);
     rm1.killApp(app2.getApplicationId());
     // submit app3 and check
     submitAppAndCheckLaunched(rm1);
+    pauseNMHeartbeat();
 
     rm1.stop();
     rm2.stop();

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e9c72d04/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
index 77596e2..548b909 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
@@ -34,6 +34,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.NullRMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttempt;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptState;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainerEvent;
@@ -72,6 +73,8 @@ public class TestCapacitySchedulerAsyncScheduling {
 
   RMNodeLabelsManager mgr;
 
+  private NMHeartbeatThread nmHeartbeatThread = null;
+
   @Before
   public void setUp() throws Exception {
     conf = new YarnConfiguration();
@@ -122,9 +125,11 @@ public class TestCapacitySchedulerAsyncScheduling {
     List<MockNM> nms = new ArrayList<>();
     // Add 10 nodes to the cluster, in the cluster we have 200 GB resource
     for (int i = 0; i < 10; i++) {
-      nms.add(rm.registerNode("h-" + i + ":1234", 20 * GB));
+      nms.add(rm.registerNode("127.0.0." + i + ":1234", 20 * GB));
     }
 
+    keepNMHeartbeat(nms, 1000);
+
     List<MockAM> ams = new ArrayList<>();
     // Add 3 applications to the cluster, one app in one queue
     // the i-th app ask (20 * i) containers. So in total we will have
@@ -185,8 +190,8 @@ public class TestCapacitySchedulerAsyncScheduling {
     // init RM & NMs & Nodes
     final MockRM rm = new MockRM(disableAsyncConf);
     rm.start();
-    final MockNM nm1 = rm.registerNode("h1:1234", 9 * GB);
-    final MockNM nm2 = rm.registerNode("h2:2234", 9 * GB);
+    final MockNM nm1 = rm.registerNode("192.168.0.1:1234", 9 * GB);
+    final MockNM nm2 = rm.registerNode("192.168.0.2:2234", 9 * GB);
     List<MockNM> nmLst = new ArrayList<>();
     nmLst.add(nm1);
     nmLst.add(nm2);
@@ -277,8 +282,8 @@ public class TestCapacitySchedulerAsyncScheduling {
     // init RM & NMs & Nodes
     final MockRM rm = new MockRM(disableAsyncConf);
     rm.start();
-    final MockNM nm1 = rm.registerNode("h1:1234", 9 * GB);
-    final MockNM nm2 = rm.registerNode("h2:2234", 9 * GB);
+    final MockNM nm1 = rm.registerNode("127.0.0.1:1234", 9 * GB);
+    final MockNM nm2 = rm.registerNode("127.0.0.2:2234", 9 * GB);
 
     // init scheduler nodes
     int waitTime = 1000;
@@ -416,8 +421,8 @@ public class TestCapacitySchedulerAsyncScheduling {
     // init RM & NMs & Nodes
     final MockRM rm = new MockRM(disableAsyncConf);
     rm.start();
-    final MockNM nm1 = rm.registerNode("h1:1234", 9 * GB);
-    final MockNM nm2 = rm.registerNode("h2:1234", 9 * GB);
+    final MockNM nm1 = rm.registerNode("127.0.0.1:1234", 9 * GB);
+    final MockNM nm2 = rm.registerNode("127.0.0.2:1234", 9 * GB);
     List<MockNM> nmLst = new ArrayList<>();
     nmLst.add(nm1);
     nmLst.add(nm2);
@@ -476,6 +481,146 @@ public class TestCapacitySchedulerAsyncScheduling {
     rm.stop();
   }
 
+  /**
+   * Make sure scheduler skips NMs which haven't heartbeat for a while.
+   * @throws Exception
+   */
+  @Test
+  public void testAsyncSchedulerSkipNoHeartbeatNMs() throws Exception {
+    int heartbeatInterval = 100;
+    conf.setInt(
+        CapacitySchedulerConfiguration.SCHEDULE_ASYNCHRONOUSLY_MAXIMUM_THREAD,
+        1);
+    conf.setInt(CapacitySchedulerConfiguration.SCHEDULE_ASYNCHRONOUSLY_PREFIX
+        + ".scheduling-interval-ms", 100);
+    // Heartbeat interval is 100 ms.
+    conf.setInt(YarnConfiguration.RM_NM_HEARTBEAT_INTERVAL_MS, heartbeatInterval);
+
+    final RMNodeLabelsManager mgr = new NullRMNodeLabelsManager();
+    mgr.init(conf);
+
+    // inject node label manager
+    MockRM rm = new MockRM(TestUtils.getConfigurationWithMultipleQueues(conf)) {
+      @Override
+      public RMNodeLabelsManager createNodeLabelManager() {
+        return mgr;
+      }
+    };
+
+    CapacityScheduler cs = (CapacityScheduler) rm.getResourceScheduler();
+
+    rm.getRMContext().setNodeLabelManager(mgr);
+    rm.start();
+
+    List<MockNM> nms = new ArrayList<>();
+    // Add 10 nodes to the cluster, in the cluster we have 200 GB resource
+    for (int i = 0; i < 10; i++) {
+      nms.add(rm.registerNode("127.0.0." + i + ":1234", 20 * GB));
+    }
+
+    List<MockAM> ams = new ArrayList<>();
+
+    keepNMHeartbeat(nms, heartbeatInterval);
+
+    for (int i = 0; i < 3; i++) {
+      RMApp rmApp = rm.submitApp(1024, "app", "user", null, false,
+          Character.toString((char) (i % 34 + 97)), 1, null, null, false);
+      MockAM am = MockRM.launchAMWhenAsyncSchedulingEnabled(rmApp, rm);
+      am.registerAppAttempt();
+      ams.add(am);
+    }
+
+    pauseNMHeartbeat();
+
+    Thread.sleep(heartbeatInterval * 3);
+
+    // Applications request containers.
+    for (int i = 0; i < 3; i++) {
+      ams.get(i).allocate("*", 1024, 20 * (i + 1), new ArrayList<>());
+    }
+
+    for (int i = 0; i < 5; i++) {
+      // Do heartbeat for NM 0-4
+      nms.get(i).nodeHeartbeat(true);
+    }
+
+    // Wait for 2000 ms.
+    Thread.sleep(2000);
+
+    // Make sure that NM5-9 don't have non-AM containers.
+    for (int i = 0; i < 9; i++) {
+      if (i < 5) {
+        Assert.assertTrue(checkNumNonAMContainersOnNode(cs, nms.get(i)) > 0);
+      } else {
+        Assert.assertTrue(checkNumNonAMContainersOnNode(cs, nms.get(i)) == 0);
+      }
+    }
+
+    rm.close();
+  }
+
+  public static class NMHeartbeatThread extends Thread {
+    private List<MockNM> mockNMS;
+    private int interval;
+    private volatile boolean shouldStop = false;
+
+    public NMHeartbeatThread(List<MockNM> mockNMs, int interval) {
+      this.mockNMS = mockNMs;
+      this.interval = interval;
+    }
+
+    public void run() {
+      while (true) {
+        if (shouldStop) {
+          break;
+        }
+        for (MockNM nm : mockNMS) {
+          try {
+            nm.nodeHeartbeat(true);
+          } catch (Exception e) {
+            e.printStackTrace();
+          }
+        }
+        try {
+          Thread.sleep(interval);
+        } catch (InterruptedException e) {
+          e.printStackTrace();
+        }
+      }
+    }
+
+    public void setShouldStop() {
+      shouldStop = true;
+    }
+  }
+
+  private void keepNMHeartbeat(List<MockNM> mockNMs, int interval) {
+    if (nmHeartbeatThread != null) {
+      nmHeartbeatThread.setShouldStop();
+      nmHeartbeatThread = null;
+    }
+    nmHeartbeatThread = new NMHeartbeatThread(mockNMs, interval);
+    nmHeartbeatThread.start();
+  }
+
+  private void pauseNMHeartbeat() {
+    if (nmHeartbeatThread != null) {
+      nmHeartbeatThread.setShouldStop();
+      nmHeartbeatThread = null;
+    }
+  }
+
+  private int checkNumNonAMContainersOnNode(CapacityScheduler cs, MockNM nm) {
+    SchedulerNode node = cs.getNode(nm.getNodeId());
+    int nonAMContainer = 0;
+    for (RMContainer c : node.getCopiedListOfRunningContainers()) {
+      if (!c.isAMContainer()) {
+         nonAMContainer++;
+      }
+    }
+    return nonAMContainer;
+  }
+
   private void allocateAndLaunchContainers(MockAM am, MockNM nm, MockRM rm,
       int nContainer, Resource resource, int priority, int startContainerId)
       throws Exception {


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[41/50] [abbrv] hadoop git commit: YARN-7779. Display allocation tags in RM web UI and expose same through REST API. Contributed by Weiwei Yang.

Posted by as...@apache.org.
YARN-7779. Display allocation tags in RM web UI and expose same through REST API. Contributed by Weiwei Yang.


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/416f2aa6
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/416f2aa6
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/416f2aa6

Branch: refs/heads/YARN-6592
Commit: 416f2aa6d8f7150cf16e05416fcf35efdeb5ad88
Parents: fca7371
Author: Sunil G <su...@apache.org>
Authored: Tue Jan 23 17:09:58 2018 +0530
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../hadoop/yarn/sls/nodemanager/NodeInfo.java   |  6 ++
 .../yarn/sls/scheduler/RMNodeWrapper.java       |  6 ++
 .../server/resourcemanager/rmnode/RMNode.java   |  7 ++
 .../resourcemanager/rmnode/RMNodeImpl.java      |  6 ++
 .../constraint/AllocationTagsManager.java       | 11 +++
 .../resourcemanager/webapp/NodesPage.java       |  3 +
 .../webapp/dao/AllocationTagInfo.java           | 56 ++++++++++++++
 .../webapp/dao/AllocationTagsInfo.java          | 59 +++++++++++++++
 .../resourcemanager/webapp/dao/NodeInfo.java    | 15 ++++
 .../yarn/server/resourcemanager/MockNodes.java  |  6 ++
 .../resourcemanager/webapp/TestNodesPage.java   |  4 +-
 .../webapp/TestRMWebServicesNodes.java          | 77 +++++++++++++++++++-
 12 files changed, 253 insertions(+), 3 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/nodemanager/NodeInfo.java
----------------------------------------------------------------------
diff --git a/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/nodemanager/NodeInfo.java b/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/nodemanager/NodeInfo.java
index 1016ce1..0c99139 100644
--- a/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/nodemanager/NodeInfo.java
+++ b/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/nodemanager/NodeInfo.java
@@ -20,6 +20,7 @@ package org.apache.hadoop.yarn.sls.nodemanager;
 
 import java.util.ArrayList;
 import java.util.List;
+import java.util.Map;
 import java.util.Set;
 
 import org.apache.hadoop.classification.InterfaceAudience.Private;
@@ -213,6 +214,11 @@ public class NodeInfo {
     }
 
     @Override
+    public Map<String, Long> getAllocationTagsWithCount() {
+      return null;
+    }
+
+    @Override
     public Resource getPhysicalResource() {
       return null;
     }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/RMNodeWrapper.java
----------------------------------------------------------------------
diff --git a/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/RMNodeWrapper.java b/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/RMNodeWrapper.java
index fdad826..92f9b0f 100644
--- a/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/RMNodeWrapper.java
+++ b/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/RMNodeWrapper.java
@@ -37,6 +37,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmnode
 
 import java.util.Collections;
 import java.util.List;
+import java.util.Map;
 import java.util.Set;
 
 @Private
@@ -203,6 +204,11 @@ public class RMNodeWrapper implements RMNode {
   }
 
   @Override
+  public Map<String, Long> getAllocationTagsWithCount() {
+    return node.getAllocationTagsWithCount();
+  }
+
+  @Override
   public Resource getPhysicalResource() {
     return null;
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNode.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNode.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNode.java
index a5615ef..872f2a6 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNode.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNode.java
@@ -20,6 +20,7 @@ package org.apache.hadoop.yarn.server.resourcemanager.rmnode;
 
 
 import java.util.List;
+import java.util.Map;
 import java.util.Set;
 
 import org.apache.hadoop.net.Node;
@@ -182,4 +183,10 @@ public interface RMNode {
    * @return the decommissioning timeout in second.
    */
   Integer getDecommissioningTimeout();
+
+  /**
+   * Get the allocation tags and their counts associated with this node.
+   * @return a map of each allocation tag and its count.
+   */
+  Map<String, Long> getAllocationTagsWithCount();
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNodeImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNodeImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNodeImpl.java
index da54eb9..4fc2d8a 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNodeImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmnode/RMNodeImpl.java
@@ -1529,4 +1529,10 @@ public class RMNodeImpl implements RMNode, EventHandler<RMNodeEvent> {
   public Integer getDecommissioningTimeout() {
     return decommissioningTimeout;
   }
+
+  @Override
+  public Map<String, Long> getAllocationTagsWithCount() {
+    return context.getAllocationTagsManager()
+        .getAllocationTagsWithCount(getNodeID());
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
index 7ad5e8c..42a78c9 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
@@ -548,4 +548,15 @@ public class AllocationTagsManager {
       readLock.unlock();
     }
   }
+
+  /**
+   * Returns a map whose key is the allocation tag and value is the
+   * count of allocations with this tag.
+   *
+   * @param nodeId
+   * @return allocation tag to count mapping
+   */
+  public Map<String, Long> getAllocationTagsWithCount(NodeId nodeId) {
+    return globalNodeMapping.getTypeToTagsWithCount().get(nodeId);
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/NodesPage.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/NodesPage.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/NodesPage.java
index d0e384d..3e78cf4 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/NodesPage.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/NodesPage.java
@@ -81,12 +81,14 @@ class NodesPage extends RmView {
 
       if (!this.opportunisticContainersEnabled) {
         trbody.th(".containers", "Containers")
+            .th(".allocationTags", "Allocation Tags")
             .th(".mem", "Mem Used")
             .th(".mem", "Mem Avail")
             .th(".vcores", "VCores Used")
             .th(".vcores", "VCores Avail");
       } else {
         trbody.th(".containers", "Running Containers (G)")
+            .th(".allocationTags", "Allocation Tags")
             .th(".mem", "Mem Used (G)")
             .th(".mem", "Mem Avail (G)")
             .th(".vcores", "VCores Used (G)")
@@ -167,6 +169,7 @@ class NodesPage extends RmView {
             .append(Times.format(info.getLastHealthUpdate())).append("\",\"")
             .append(info.getHealthReport()).append("\",\"")
             .append(String.valueOf(info.getNumContainers())).append("\",\"")
+            .append(info.getAllocationTagsSummary()).append("\",\"")
             .append("<br title='").append(String.valueOf(usedMemory))
             .append("'>").append(StringUtils.byteDesc(usedMemory * BYTES_IN_MB))
             .append("\",\"").append("<br title='")

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/AllocationTagInfo.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/AllocationTagInfo.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/AllocationTagInfo.java
new file mode 100644
index 0000000..97f9e90
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/AllocationTagInfo.java
@@ -0,0 +1,56 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.webapp.dao;
+
+import javax.xml.bind.annotation.XmlAccessType;
+import javax.xml.bind.annotation.XmlAccessorType;
+import javax.xml.bind.annotation.XmlRootElement;
+
+/**
+ * DAO object to display node allocation tag.
+ */
+@XmlRootElement(name = "allocationTagInfo")
+@XmlAccessorType(XmlAccessType.FIELD)
+public class AllocationTagInfo {
+
+  private String allocationTag;
+  private long allocationsCount;
+
+  public AllocationTagInfo() {
+    // JAXB needs this
+  }
+
+  public AllocationTagInfo(String tag, long count) {
+    this.allocationTag = tag;
+    this.allocationsCount = count;
+  }
+
+  public String getAllocationTag() {
+    return this.allocationTag;
+  }
+
+  public long getAllocationsCount() {
+    return this.allocationsCount;
+  }
+
+  @Override
+  public String toString() {
+    return allocationTag + "(" + allocationsCount + ")";
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/AllocationTagsInfo.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/AllocationTagsInfo.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/AllocationTagsInfo.java
new file mode 100644
index 0000000..ee09aa2
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/AllocationTagsInfo.java
@@ -0,0 +1,59 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.webapp.dao;
+
+import org.apache.hadoop.util.StringUtils;
+
+import javax.xml.bind.annotation.XmlAccessType;
+import javax.xml.bind.annotation.XmlAccessorType;
+import javax.xml.bind.annotation.XmlRootElement;
+import java.util.ArrayList;
+import java.util.Iterator;
+
+/**
+ * DAO object to display node allocation tags.
+ */
+@XmlRootElement(name = "allocationTagsInfo")
+@XmlAccessorType(XmlAccessType.FIELD)
+public class AllocationTagsInfo {
+
+  private ArrayList<AllocationTagInfo> allocationTagInfo;
+
+  public AllocationTagsInfo() {
+    allocationTagInfo = new ArrayList<>();
+  }
+
+  public void addAllocationTag(AllocationTagInfo info) {
+    allocationTagInfo.add(info);
+  }
+
+  @Override
+  public String toString() {
+    StringBuffer sb = new StringBuffer();
+    Iterator<AllocationTagInfo> it = allocationTagInfo.iterator();
+    while (it.hasNext()) {
+      AllocationTagInfo current = it.next();
+      sb.append(current.toString());
+      if (it.hasNext()) {
+        sb.append(StringUtils.COMMA);
+      }
+    }
+    return sb.toString();
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/NodeInfo.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/NodeInfo.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/NodeInfo.java
index 3cec215..46a6e60 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/NodeInfo.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/dao/NodeInfo.java
@@ -20,6 +20,7 @@ package org.apache.hadoop.yarn.server.resourcemanager.webapp.dao;
 
 import java.util.ArrayList;
 import java.util.Collections;
+import java.util.Map;
 import java.util.Set;
 
 import javax.xml.bind.annotation.XmlAccessType;
@@ -57,6 +58,7 @@ public class NodeInfo {
   private long usedVirtualCoresOpport;
   private int numQueuedContainers;
   protected ArrayList<String> nodeLabels = new ArrayList<String>();
+  private AllocationTagsInfo allocationTags;
   protected ResourceUtilizationInfo resourceUtilization;
   protected ResourceInfo usedResource;
   protected ResourceInfo availableResource;
@@ -111,6 +113,14 @@ public class NodeInfo {
       Collections.sort(nodeLabels);
     }
 
+    // add allocation tags
+    allocationTags = new AllocationTagsInfo();
+    Map<String, Long> allocationTagsInfo = ni.getAllocationTagsWithCount();
+    if (allocationTagsInfo != null) {
+      allocationTagsInfo.forEach((tag, count) ->
+          allocationTags.addAllocationTag(new AllocationTagInfo(tag, count)));
+    }
+
     // update node and containers resource utilization
     this.resourceUtilization = new ResourceUtilizationInfo(ni);
   }
@@ -207,6 +217,11 @@ public class NodeInfo {
     return this.resourceUtilization;
   }
 
+  public String getAllocationTagsSummary() {
+    return this.allocationTags == null ? "" :
+        this.allocationTags.toString();
+  }
+
   @VisibleForTesting
   public void setId(String id) {
     this.id = id;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockNodes.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockNodes.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockNodes.java
index d6549b9..84105d9 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockNodes.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockNodes.java
@@ -22,6 +22,7 @@ import java.util.ArrayList;
 import java.util.Collections;
 import java.util.List;
 import java.util.Set;
+import java.util.Map;
 
 import org.apache.hadoop.net.Node;
 import org.apache.hadoop.yarn.api.records.ApplicationId;
@@ -280,6 +281,11 @@ public class MockNodes {
     }
 
     @Override
+    public Map<String, Long> getAllocationTagsWithCount() {
+      return null;
+    }
+
+    @Override
     public Resource getPhysicalResource() {
       return this.physicalResource;
     }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestNodesPage.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestNodesPage.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestNodesPage.java
index cc97674..26e8c2a 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestNodesPage.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestNodesPage.java
@@ -48,8 +48,8 @@ public class TestNodesPage {
 
   // Number of Actual Table Headers for NodesPage.NodesBlock might change in
   // future. In that case this value should be adjusted to the new value.
-  final int numberOfThInMetricsTable = 23;
-  final int numberOfActualTableHeaders = 13;
+  private final int numberOfThInMetricsTable = 23;
+  private final int numberOfActualTableHeaders = 14;
   private final int numberOfThForOpportunisticContainers = 4;
 
   private Injector injector;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/416f2aa6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestRMWebServicesNodes.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestRMWebServicesNodes.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestRMWebServicesNodes.java
index fb597fc..7ea7e81 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestRMWebServicesNodes.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/webapp/TestRMWebServicesNodes.java
@@ -22,10 +22,15 @@ import static org.apache.hadoop.yarn.webapp.WebServicesTestUtils.assertResponseS
 import static org.junit.Assert.assertEquals;
 import static org.junit.Assert.assertTrue;
 import static org.junit.Assert.fail;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.when;
 
 import java.io.StringReader;
 import java.util.ArrayList;
 import java.util.EnumSet;
+import java.util.Map;
+import java.util.TreeMap;
+import java.util.Iterator;
 
 import javax.ws.rs.core.MediaType;
 import javax.xml.parsers.DocumentBuilder;
@@ -51,6 +56,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNodeStartedEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNodeStatusEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNodeReport;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.util.RackResolver;
 import org.apache.hadoop.yarn.util.YarnVersionInfo;
 import org.apache.hadoop.yarn.webapp.GenericExceptionHandler;
@@ -734,7 +740,7 @@ public class TestRMWebServicesNodes extends JerseyTestBase {
 
   public void verifyNodeInfo(JSONObject nodeInfo, RMNode nm)
       throws JSONException, Exception {
-    assertEquals("incorrect number of elements", 18, nodeInfo.length());
+    assertEquals("incorrect number of elements", 19, nodeInfo.length());
 
     JSONObject resourceInfo = nodeInfo.getJSONObject("resourceUtilization");
     verifyNodeInfoGeneric(nm, nodeInfo.getString("state"),
@@ -837,4 +843,73 @@ public class TestRMWebServicesNodes extends JerseyTestBase {
     }
   }
 
+  @Test
+  public void testNodesAllocationTags() throws Exception {
+    NodeId nm1 = NodeId.newInstance("host1", 1234);
+    NodeId nm2 = NodeId.newInstance("host2", 2345);
+    AllocationTagsManager atm = mock(AllocationTagsManager.class);
+
+    Map<String, Map<String, Long>> expectedAllocationTags = new TreeMap<>();
+    Map<String, Long> nm1Tags = new TreeMap<>();
+    nm1Tags.put("A", 1L);
+    nm1Tags.put("B", 2L);
+    Map<String, Long> nm2Tags = new TreeMap<>();
+    nm2Tags.put("C", 1L);
+    nm2Tags.put("D", 2L);
+    expectedAllocationTags.put(nm1.toString(), nm1Tags);
+    expectedAllocationTags.put(nm2.toString(), nm2Tags);
+
+    when(atm.getAllocationTagsWithCount(nm1)).thenReturn(nm1Tags);
+    when(atm.getAllocationTagsWithCount(nm2)).thenReturn(nm2Tags);
+    rm.getRMContext().setAllocationTagsManager(atm);
+
+    rm.start();
+
+    rm.registerNode(nm1.toString(), 1024);
+    rm.registerNode(nm2.toString(), 1024);
+
+    WebResource r = resource();
+    ClientResponse response = r.path("ws").path("v1").path("cluster")
+        .path("nodes").accept("application/json").get(ClientResponse.class);
+    assertEquals(MediaType.APPLICATION_JSON + "; " + JettyUtils.UTF_8,
+        response.getType().toString());
+    JSONObject nodesInfoJson = response.getEntity(JSONObject.class);
+    verifyNodeAllocationTag(nodesInfoJson, expectedAllocationTags);
+
+    rm.stop();
+  }
+
+  private void verifyNodeAllocationTag(JSONObject json,
+      Map<String, Map<String, Long>> expectedAllocationTags)
+      throws JSONException {
+    JSONArray nodes = json.getJSONObject("nodes").getJSONArray("node");
+    assertEquals(expectedAllocationTags.size(), nodes.length());
+    for (int i=0; i<nodes.length(); i++) {
+      JSONObject nodeJson = nodes.getJSONObject(i);
+      String nodeId = nodeJson.getString("id");
+
+      // Ensure the response contains all nodes info
+      assertTrue("Nodes info should have expected node IDs",
+          expectedAllocationTags.containsKey(nodeId));
+
+      Map<String, Long> expectedTags = expectedAllocationTags.get(nodeId);
+      JSONArray tagsInfo = nodeJson.getJSONObject("allocationTags")
+          .getJSONArray("allocationTagInfo");
+
+      // Ensure number of tags are expected.
+      assertEquals(expectedTags.size(), tagsInfo.length());
+
+      // Iterate expected tags and make sure the actual
+      // tags/counts are matched.
+      Iterator<String> it = expectedTags.keySet().iterator();
+      for (int j=0; j<tagsInfo.length(); j++) {
+        JSONObject tagInfo = tagsInfo.getJSONObject(j);
+        String expectedTag = it.next();
+        assertEquals(tagInfo.getString("allocationTag"), expectedTag);
+        assertEquals(tagInfo.getLong("allocationsCount"),
+            expectedTags.get(expectedTag).longValue());
+      }
+    }
+  }
+
 }


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[15/50] [abbrv] hadoop git commit: HDFS-12574. Add CryptoInputStream to WebHdfsFileSystem read call. Contributed by Rushabh S Shah

Posted by as...@apache.org.
HDFS-12574. Add CryptoInputStream to WebHdfsFileSystem read call. Contributed by Rushabh S Shah


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/fde95d46
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/fde95d46
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/fde95d46

Branch: refs/heads/YARN-6592
Commit: fde95d463c3123b315b3d07cb5b7b7dc19f7cb73
Parents: 7fd287b
Author: Kihwal Lee <ki...@apache.org>
Authored: Mon Jan 29 17:22:29 2018 -0600
Committer: Kihwal Lee <ki...@apache.org>
Committed: Mon Jan 29 17:23:29 2018 -0600

----------------------------------------------------------------------
 .../java/org/apache/hadoop/hdfs/DFSClient.java  |  48 ++---
 .../org/apache/hadoop/hdfs/HdfsKMSUtil.java     |  41 ++++
 .../hadoop/hdfs/web/WebHdfsFileSystem.java      | 101 ++++++++--
 .../hdfs/web/TestWebHdfsContentLength.java      |   2 +
 .../web/resources/NamenodeWebHdfsMethods.java   |  85 ++++++---
 .../apache/hadoop/hdfs/TestEncryptionZones.java | 188 +++++++++++++++++++
 .../web/resources/TestWebHdfsDataLocality.java  |  23 ++-
 .../org/apache/hadoop/hdfs/web/TestWebHDFS.java |   1 -
 .../hadoop/hdfs/web/TestWebHdfsTokens.java      |   4 +-
 9 files changed, 403 insertions(+), 90 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java
index 92bb99e..2497c40 100644
--- a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java
+++ b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java
@@ -38,7 +38,6 @@ import java.net.Socket;
 import java.net.SocketAddress;
 import java.net.URI;
 import java.net.UnknownHostException;
-import java.security.GeneralSecurityException;
 import java.util.ArrayList;
 import java.util.EnumSet;
 import java.util.HashMap;
@@ -62,8 +61,6 @@ import org.apache.hadoop.crypto.CryptoInputStream;
 import org.apache.hadoop.crypto.CryptoOutputStream;
 import org.apache.hadoop.crypto.key.KeyProvider;
 import org.apache.hadoop.crypto.key.KeyProvider.KeyVersion;
-import org.apache.hadoop.crypto.key.KeyProviderCryptoExtension;
-import org.apache.hadoop.crypto.key.KeyProviderCryptoExtension.EncryptedKeyVersion;
 import org.apache.hadoop.fs.BlockLocation;
 import org.apache.hadoop.fs.CacheFlag;
 import org.apache.hadoop.fs.ContentSummary;
@@ -911,45 +908,18 @@ public class DFSClient implements java.io.Closeable, RemotePeerFactory,
   }
 
   /**
-   * Decrypts a EDEK by consulting the KeyProvider.
-   */
-  private KeyVersion decryptEncryptedDataEncryptionKey(FileEncryptionInfo
-      feInfo) throws IOException {
-    try (TraceScope ignored = tracer.newScope("decryptEDEK")) {
-      KeyProvider provider = getKeyProvider();
-      if (provider == null) {
-        throw new IOException("No KeyProvider is configured, cannot access" +
-            " an encrypted file");
-      }
-      EncryptedKeyVersion ekv = EncryptedKeyVersion.createForDecryption(
-          feInfo.getKeyName(), feInfo.getEzKeyVersionName(), feInfo.getIV(),
-          feInfo.getEncryptedDataEncryptionKey());
-      try {
-        KeyProviderCryptoExtension cryptoProvider = KeyProviderCryptoExtension
-            .createKeyProviderCryptoExtension(provider);
-        return cryptoProvider.decryptEncryptedKey(ekv);
-      } catch (GeneralSecurityException e) {
-        throw new IOException(e);
-      }
-    }
-  }
-
-  /**
    * Wraps the stream in a CryptoInputStream if the underlying file is
    * encrypted.
    */
   public HdfsDataInputStream createWrappedInputStream(DFSInputStream dfsis)
       throws IOException {
-    final FileEncryptionInfo feInfo = dfsis.getFileEncryptionInfo();
+    FileEncryptionInfo feInfo = dfsis.getFileEncryptionInfo();
     if (feInfo != null) {
-      // File is encrypted, wrap the stream in a crypto stream.
-      // Currently only one version, so no special logic based on the version #
-      HdfsKMSUtil.getCryptoProtocolVersion(feInfo);
-      final CryptoCodec codec = HdfsKMSUtil.getCryptoCodec(conf, feInfo);
-      final KeyVersion decrypted = decryptEncryptedDataEncryptionKey(feInfo);
-      final CryptoInputStream cryptoIn =
-          new CryptoInputStream(dfsis, codec, decrypted.getMaterial(),
-              feInfo.getIV());
+      CryptoInputStream cryptoIn;
+      try (TraceScope ignored = getTracer().newScope("decryptEDEK")) {
+        cryptoIn = HdfsKMSUtil.createWrappedInputStream(dfsis,
+            getKeyProvider(), feInfo, getConfiguration());
+      }
       return new HdfsDataInputStream(cryptoIn);
     } else {
       // No FileEncryptionInfo so no encryption.
@@ -978,7 +948,11 @@ public class DFSClient implements java.io.Closeable, RemotePeerFactory,
       // Currently only one version, so no special logic based on the version #
       HdfsKMSUtil.getCryptoProtocolVersion(feInfo);
       final CryptoCodec codec = HdfsKMSUtil.getCryptoCodec(conf, feInfo);
-      KeyVersion decrypted = decryptEncryptedDataEncryptionKey(feInfo);
+      KeyVersion decrypted;
+      try (TraceScope ignored = tracer.newScope("decryptEDEK")) {
+        decrypted = HdfsKMSUtil.decryptEncryptedDataEncryptionKey(feInfo,
+          getKeyProvider());
+      }
       final CryptoOutputStream cryptoOut =
           new CryptoOutputStream(dfsos, codec,
               decrypted.getMaterial(), feInfo.getIV(), startPos);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/HdfsKMSUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/HdfsKMSUtil.java b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/HdfsKMSUtil.java
index 71d2972..de27f7e 100644
--- a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/HdfsKMSUtil.java
+++ b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/HdfsKMSUtil.java
@@ -20,15 +20,21 @@ package org.apache.hadoop.hdfs;
 import static org.apache.hadoop.fs.CommonConfigurationKeysPublic.HADOOP_SECURITY_CRYPTO_CODEC_CLASSES_KEY_PREFIX;
 
 import java.io.IOException;
+import java.io.InputStream;
 import java.net.URI;
+import java.security.GeneralSecurityException;
 
 import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceStability;
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.crypto.CipherSuite;
 import org.apache.hadoop.crypto.CryptoCodec;
+import org.apache.hadoop.crypto.CryptoInputStream;
 import org.apache.hadoop.crypto.CryptoProtocolVersion;
 import org.apache.hadoop.crypto.key.KeyProvider;
+import org.apache.hadoop.crypto.key.KeyProvider.KeyVersion;
+import org.apache.hadoop.crypto.key.KeyProviderCryptoExtension;
+import org.apache.hadoop.crypto.key.KeyProviderCryptoExtension.EncryptedKeyVersion;
 import org.apache.hadoop.crypto.key.KeyProviderDelegationTokenExtension;
 import org.apache.hadoop.crypto.key.KeyProviderTokenIssuer;
 import org.apache.hadoop.fs.CommonConfigurationKeysPublic;
@@ -187,4 +193,39 @@ public final class HdfsKMSUtil {
     return new Text(DFS_KMS_PREFIX + namenodeUri.getScheme()
         +"://" + namenodeUri.getAuthority());
   }
+
+  public static CryptoInputStream createWrappedInputStream(InputStream is,
+      KeyProvider keyProvider, FileEncryptionInfo fileEncryptionInfo,
+      Configuration conf) throws IOException {
+    // File is encrypted, wrap the stream in a crypto stream.
+    // Currently only one version, so no special logic based on the version#
+    HdfsKMSUtil.getCryptoProtocolVersion(fileEncryptionInfo);
+    final CryptoCodec codec = HdfsKMSUtil.getCryptoCodec(
+        conf, fileEncryptionInfo);
+    final KeyVersion decrypted =
+        decryptEncryptedDataEncryptionKey(fileEncryptionInfo, keyProvider);
+    return new CryptoInputStream(is, codec, decrypted.getMaterial(),
+        fileEncryptionInfo.getIV());
+  }
+
+  /**
+   * Decrypts a EDEK by consulting the KeyProvider.
+   */
+  static KeyVersion decryptEncryptedDataEncryptionKey(FileEncryptionInfo
+      feInfo, KeyProvider keyProvider) throws IOException {
+    if (keyProvider == null) {
+      throw new IOException("No KeyProvider is configured, cannot access" +
+          " an encrypted file");
+    }
+    EncryptedKeyVersion ekv = EncryptedKeyVersion.createForDecryption(
+        feInfo.getKeyName(), feInfo.getEzKeyVersionName(), feInfo.getIV(),
+        feInfo.getEncryptedDataEncryptionKey());
+    try {
+      KeyProviderCryptoExtension cryptoProvider = KeyProviderCryptoExtension
+          .createKeyProviderCryptoExtension(keyProvider);
+      return cryptoProvider.decryptEncryptedKey(ekv);
+    } catch (GeneralSecurityException e) {
+      throw new IOException(e);
+    }
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/web/WebHdfsFileSystem.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/web/WebHdfsFileSystem.java b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/web/WebHdfsFileSystem.java
index 2ab7a83..b006495 100644
--- a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/web/WebHdfsFileSystem.java
+++ b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/web/WebHdfsFileSystem.java
@@ -37,8 +37,11 @@ import java.net.InetSocketAddress;
 import java.net.MalformedURLException;
 import java.net.URI;
 import java.net.URL;
+import java.nio.charset.StandardCharsets;
 import java.security.PrivilegedExceptionAction;
 import java.util.ArrayList;
+import java.util.Base64;
+import java.util.Base64.Decoder;
 import java.util.Collection;
 import java.util.EnumSet;
 import java.util.HashSet;
@@ -66,6 +69,7 @@ import org.apache.hadoop.fs.DelegationTokenRenewer;
 import org.apache.hadoop.fs.FSDataInputStream;
 import org.apache.hadoop.fs.FSDataOutputStream;
 import org.apache.hadoop.fs.FSInputStream;
+import org.apache.hadoop.fs.FileEncryptionInfo;
 import org.apache.hadoop.fs.FileStatus;
 import org.apache.hadoop.fs.FileSystem;
 import org.apache.hadoop.fs.FsServerDefaults;
@@ -92,6 +96,8 @@ import org.apache.hadoop.hdfs.protocol.BlockStoragePolicy;
 import org.apache.hadoop.hdfs.protocol.DirectoryListing;
 import org.apache.hadoop.hdfs.protocol.HdfsConstants;
 import org.apache.hadoop.hdfs.protocol.HdfsFileStatus;
+import org.apache.hadoop.hdfs.protocol.proto.HdfsProtos.FileEncryptionInfoProto;
+import org.apache.hadoop.hdfs.protocolPB.PBHelperClient;
 import org.apache.hadoop.hdfs.security.token.delegation.DelegationTokenIdentifier;
 import org.apache.hadoop.hdfs.web.resources.*;
 import org.apache.hadoop.hdfs.web.resources.HttpOpParam.Op;
@@ -133,6 +139,8 @@ public class WebHdfsFileSystem extends FileSystem
   /** Http URI: http://namenode:port/{PATH_PREFIX}/path/to/file */
   public static final String PATH_PREFIX = "/" + WebHdfsConstants.WEBHDFS_SCHEME
       + "/v" + VERSION;
+  public static final String EZ_HEADER = "X-Hadoop-Accept-EZ";
+  public static final String FEFINFO_HEADER = "X-Hadoop-feInfo";
 
   /**
    * Default connection factory may be overridden in tests to use smaller
@@ -613,12 +621,19 @@ public class WebHdfsFileSystem extends FileSystem
 
     private boolean checkRetry;
     private String redirectHost;
+    private boolean followRedirect = true;
 
     protected AbstractRunner(final HttpOpParam.Op op, boolean redirected) {
       this.op = op;
       this.redirected = redirected;
     }
 
+    protected AbstractRunner(final HttpOpParam.Op op, boolean redirected,
+        boolean followRedirect) {
+      this(op, redirected);
+      this.followRedirect = followRedirect;
+    }
+
     T run() throws IOException {
       UserGroupInformation connectUgi = ugi.getRealUser();
       if (connectUgi == null) {
@@ -685,9 +700,17 @@ public class WebHdfsFileSystem extends FileSystem
           // See http://tinyurl.com/java7-http-keepalive
           conn.disconnect();
         }
+        if (!followRedirect) {
+          return conn;
+        }
       }
       try {
-        return connect(op, url);
+        final HttpURLConnection conn = connect(op, url);
+        // output streams will validate on close
+        if (!op.getDoOutput()) {
+          validateResponse(op, conn, false);
+        }
+        return conn;
       } catch (IOException ioe) {
         if (redirectHost != null) {
           if (excludeDatanodes.getValue() != null) {
@@ -713,6 +736,7 @@ public class WebHdfsFileSystem extends FileSystem
         // The value of the header is unimportant.  Only its presence matters.
         conn.setRequestProperty(restCsrfCustomHeader, "\"\"");
       }
+      conn.setRequestProperty(EZ_HEADER, "true");
       switch (op.getType()) {
       // if not sending a message body for a POST or PUT operation, need
       // to ensure the server/proxy knows this
@@ -760,10 +784,6 @@ public class WebHdfsFileSystem extends FileSystem
         final URL url = getUrl();
         try {
           final HttpURLConnection conn = connect(url);
-          // output streams will validate on close
-          if (!op.getDoOutput()) {
-            validateResponse(op, conn, false);
-          }
           return getResponse(conn);
         } catch (AccessControlException ace) {
           // no retries for auth failures
@@ -809,7 +829,6 @@ public class WebHdfsFileSystem extends FileSystem
               a.action == RetryPolicy.RetryAction.RetryDecision.RETRY;
           boolean isFailoverAndRetry =
               a.action == RetryPolicy.RetryAction.RetryDecision.FAILOVER_AND_RETRY;
-
           if (isRetry || isFailoverAndRetry) {
             LOG.info("Retrying connect to namenode: {}. Already retried {}"
                     + " time(s); retry policy is {}, delay {}ms.",
@@ -990,16 +1009,16 @@ public class WebHdfsFileSystem extends FileSystem
   /**
    * Used by open() which tracks the resolved url itself
    */
-  final class URLRunner extends AbstractRunner<HttpURLConnection> {
+  class URLRunner extends AbstractRunner<HttpURLConnection> {
     private final URL url;
     @Override
-    protected URL getUrl() {
+    protected URL getUrl() throws IOException {
       return url;
     }
 
     protected URLRunner(final HttpOpParam.Op op, final URL url,
-        boolean redirected) {
-      super(op, redirected);
+        boolean redirected, boolean followRedirect) {
+      super(op, redirected, followRedirect);
       this.url = url;
     }
 
@@ -1412,12 +1431,20 @@ public class WebHdfsFileSystem extends FileSystem
     ).run();
   }
 
+  @SuppressWarnings("resource")
   @Override
   public FSDataInputStream open(final Path f, final int bufferSize
   ) throws IOException {
     statistics.incrementReadOps(1);
     storageStatistics.incrementOpCounter(OpType.OPEN);
-    return new FSDataInputStream(new WebHdfsInputStream(f, bufferSize));
+    WebHdfsInputStream webfsInputStream =
+        new WebHdfsInputStream(f, bufferSize);
+    if (webfsInputStream.getFileEncryptionInfo() == null) {
+      return new FSDataInputStream(webfsInputStream);
+    } else {
+      return new FSDataInputStream(
+          webfsInputStream.createWrappedInputStream());
+    }
   }
 
   @Override
@@ -1462,7 +1489,8 @@ public class WebHdfsFileSystem extends FileSystem
         final boolean resolved) throws IOException {
       final URL offsetUrl = offset == 0L? url
           : new URL(url + "&" + new OffsetParam(offset));
-      return new URLRunner(GetOpParam.Op.OPEN, offsetUrl, resolved).run();
+      return new URLRunner(GetOpParam.Op.OPEN, offsetUrl, resolved,
+          true).run();
     }
   }
 
@@ -1928,6 +1956,15 @@ public class WebHdfsFileSystem extends FileSystem
     void setReadRunner(ReadRunner rr) {
       this.readRunner = rr;
     }
+
+    FileEncryptionInfo getFileEncryptionInfo() {
+      return readRunner.getFileEncryptionInfo();
+    }
+
+    InputStream createWrappedInputStream() throws IOException {
+      return HdfsKMSUtil.createWrappedInputStream(
+          this, getKeyProvider(), getFileEncryptionInfo(), getConf());
+    }
   }
 
   enum RunnerState {
@@ -1964,7 +2001,7 @@ public class WebHdfsFileSystem extends FileSystem
     private byte[] readBuffer;
     private int readOffset;
     private int readLength;
-    private RunnerState runnerState = RunnerState.DISCONNECTED;
+    private RunnerState runnerState = RunnerState.SEEK;
     private URL originalUrl = null;
     private URL resolvedUrl = null;
 
@@ -1972,6 +2009,7 @@ public class WebHdfsFileSystem extends FileSystem
     private final int bufferSize;
     private long pos = 0;
     private long fileLength = 0;
+    private FileEncryptionInfo feInfo = null;
 
     /* The following methods are WebHdfsInputStream helpers. */
 
@@ -1979,6 +2017,36 @@ public class WebHdfsFileSystem extends FileSystem
       super(GetOpParam.Op.OPEN, p, new BufferSizeParam(bs));
       this.path = p;
       this.bufferSize = bs;
+      getRedirectedUrl();
+    }
+
+    private void getRedirectedUrl() throws IOException {
+      URLRunner urlRunner = new URLRunner(GetOpParam.Op.OPEN, null, false,
+          false) {
+        @Override
+        protected URL getUrl() throws IOException {
+          return toUrl(op, path, new BufferSizeParam(bufferSize));
+        }
+      };
+      HttpURLConnection conn = urlRunner.run();
+      String feInfoStr = conn.getHeaderField(FEFINFO_HEADER);
+      if (feInfoStr != null) {
+        Decoder decoder = Base64.getDecoder();
+        byte[] decodedBytes = decoder.decode(
+            feInfoStr.getBytes(StandardCharsets.UTF_8));
+        feInfo = PBHelperClient
+            .convert(FileEncryptionInfoProto.parseFrom(decodedBytes));
+      }
+      String location = conn.getHeaderField("Location");
+      if (location != null) {
+        // This saves the location for datanode where redirect was issued.
+        // Need to remove offset because seek can be called after open.
+        resolvedUrl = removeOffsetParam(new URL(location));
+      } else {
+        // This is cached for proxies like httpfsfilesystem.
+        cachedConnection = conn;
+      }
+      originalUrl = super.getUrl();
     }
 
     int read(byte[] b, int off, int len) throws IOException {
@@ -2011,7 +2079,8 @@ public class WebHdfsFileSystem extends FileSystem
       if (runnerState == RunnerState.SEEK) {
         try {
           final URL rurl = new URL(resolvedUrl + "&" + new OffsetParam(pos));
-          cachedConnection = new URLRunner(GetOpParam.Op.OPEN, rurl, true).run();
+          cachedConnection = new URLRunner(GetOpParam.Op.OPEN, rurl, true,
+              false).run();
         } catch (IOException ioe) {
           closeInputStream(RunnerState.DISCONNECTED);
         }
@@ -2195,5 +2264,9 @@ public class WebHdfsFileSystem extends FileSystem
     long getPos() {
       return pos;
     }
+
+    protected FileEncryptionInfo getFileEncryptionInfo() {
+      return feInfo;
+    }
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs-client/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsContentLength.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs-client/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsContentLength.java b/hadoop-hdfs-project/hadoop-hdfs-client/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsContentLength.java
index 19f18b0..6ee8858 100644
--- a/hadoop-hdfs-project/hadoop-hdfs-client/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsContentLength.java
+++ b/hadoop-hdfs-project/hadoop-hdfs-client/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsContentLength.java
@@ -102,12 +102,14 @@ public class TestWebHdfsContentLength {
   public void testGetOpWithRedirect() {
     Future<String> future1 = contentLengthFuture(redirectResponse);
     Future<String> future2 = contentLengthFuture(errResponse);
+    Future<String> future3 = contentLengthFuture(errResponse);
     try {
       fs.open(p).read();
       Assert.fail();
     } catch (IOException ioe) {} // expected
     Assert.assertEquals(null, getContentLength(future1));
     Assert.assertEquals(null, getContentLength(future2));
+    Assert.assertEquals(null, getContentLength(future3));
   }
   
   @Test

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/web/resources/NamenodeWebHdfsMethods.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/web/resources/NamenodeWebHdfsMethods.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/web/resources/NamenodeWebHdfsMethods.java
index e2ba510..d1f16a3 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/web/resources/NamenodeWebHdfsMethods.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/web/resources/NamenodeWebHdfsMethods.java
@@ -28,6 +28,8 @@ import java.net.URISyntaxException;
 import java.net.UnknownHostException;
 import java.security.Principal;
 import java.security.PrivilegedExceptionAction;
+import java.util.Base64;
+import java.util.Base64.Encoder;
 import java.util.EnumSet;
 import java.util.HashSet;
 import java.util.List;
@@ -50,11 +52,14 @@ import javax.ws.rs.core.Context;
 import javax.ws.rs.core.MediaType;
 import javax.ws.rs.core.Response;
 import javax.ws.rs.core.StreamingOutput;
+import javax.ws.rs.core.Response.ResponseBuilder;
+import javax.ws.rs.core.Response.Status;
 
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.fs.ContentSummary;
+import org.apache.hadoop.fs.FileEncryptionInfo;
 import org.apache.hadoop.fs.FileStatus;
 import org.apache.hadoop.fs.FileSystem;
 import org.apache.hadoop.fs.FsServerDefaults;
@@ -73,6 +78,7 @@ import org.apache.hadoop.hdfs.protocol.DatanodeInfo;
 import org.apache.hadoop.hdfs.protocol.DirectoryListing;
 import org.apache.hadoop.hdfs.protocol.HdfsFileStatus;
 import org.apache.hadoop.hdfs.protocol.LocatedBlocks;
+import org.apache.hadoop.hdfs.protocolPB.PBHelperClient;
 import org.apache.hadoop.hdfs.security.token.delegation.DelegationTokenIdentifier;
 import org.apache.hadoop.hdfs.security.token.delegation.DelegationTokenSecretManager;
 import org.apache.hadoop.hdfs.server.blockmanagement.BlockManager;
@@ -117,9 +123,9 @@ public class NamenodeWebHdfsMethods {
   private Principal userPrincipal;
   private String remoteAddr;
 
-  private static volatile String serverDefaultsResponse = null;
   private @Context ServletContext context;
   private @Context HttpServletResponse response;
+  private boolean supportEZ;
 
   public NamenodeWebHdfsMethods(@Context HttpServletRequest request) {
     // the request object is a proxy to thread-locals so we have to extract
@@ -130,6 +136,8 @@ public class NamenodeWebHdfsMethods {
     // get the remote address, if coming in via a trusted proxy server then
     // the address with be that of the proxied client
     remoteAddr = JspHelper.getRemoteAddr(request);
+    supportEZ =
+        Boolean.valueOf(request.getHeader(WebHdfsFileSystem.EZ_HEADER));
   }
 
   private void init(final UserGroupInformation ugi,
@@ -228,7 +236,7 @@ public class NamenodeWebHdfsMethods {
   static DatanodeInfo chooseDatanode(final NameNode namenode,
       final String path, final HttpOpParam.Op op, final long openOffset,
       final long blocksize, final String excludeDatanodes,
-      final String remoteAddr) throws IOException {
+      final String remoteAddr, final HdfsFileStatus status) throws IOException {
     FSNamesystem fsn = namenode.getNamesystem();
     if (fsn == null) {
       throw new IOException("Namesystem has not been intialized yet.");
@@ -265,7 +273,6 @@ public class NamenodeWebHdfsMethods {
         || op == PostOpParam.Op.APPEND) {
       //choose a datanode containing a replica 
       final NamenodeProtocols np = getRPCServer(namenode);
-      final HdfsFileStatus status = np.getFileInfo(path);
       if (status == null) {
         throw new FileNotFoundException("File " + path + " not found.");
       }
@@ -285,7 +292,7 @@ public class NamenodeWebHdfsMethods {
           return bestNode(locations.get(0).getLocations(), excludes);
         }
       }
-    } 
+    }
 
     return (DatanodeDescriptor)bm.getDatanodeManager().getNetworkTopology(
         ).chooseRandom(NodeBase.ROOT, excludes);
@@ -322,15 +329,22 @@ public class NamenodeWebHdfsMethods {
     return t;
   }
 
-  private URI redirectURI(final NameNode namenode,
+  private URI redirectURI(ResponseBuilder rb, final NameNode namenode,
       final UserGroupInformation ugi, final DelegationParam delegation,
       final UserParam username, final DoAsParam doAsUser,
       final String path, final HttpOpParam.Op op, final long openOffset,
       final long blocksize, final String excludeDatanodes,
       final Param<?, ?>... parameters) throws URISyntaxException, IOException {
     final DatanodeInfo dn;
+    final NamenodeProtocols np = getRPCServer(namenode);
+    HdfsFileStatus status = null;
+    if (op == GetOpParam.Op.OPEN
+        || op == GetOpParam.Op.GETFILECHECKSUM
+        || op == PostOpParam.Op.APPEND) {
+      status = np.getFileInfo(path);
+    }
     dn = chooseDatanode(namenode, path, op, openOffset, blocksize,
-        excludeDatanodes, remoteAddr);
+        excludeDatanodes, remoteAddr, status);
     if (dn == null) {
       throw new IOException("Failed to find datanode, suggest to check cluster"
           + " health. excludeDatanodes=" + excludeDatanodes);
@@ -349,15 +363,27 @@ public class NamenodeWebHdfsMethods {
           namenode, ugi, null);
       delegationQuery = "&" + new DelegationParam(t.encodeToUrlString());
     }
-    final String query = op.toQueryString() + delegationQuery
-        + "&" + new NamenodeAddressParam(namenode)
-        + Param.toSortedString("&", parameters);
-    final String uripath = WebHdfsFileSystem.PATH_PREFIX + path;
+
+    StringBuilder queryBuilder = new StringBuilder();
+    queryBuilder.append(op.toQueryString());
+    queryBuilder.append(delegationQuery);
+    queryBuilder.append("&").append(new NamenodeAddressParam(namenode));
+    queryBuilder.append(Param.toSortedString("&", parameters));
+
+    boolean prependReservedRawPath  = false;
+    if (op == GetOpParam.Op.OPEN && supportEZ
+        && status.getFileEncryptionInfo() != null) {
+      prependReservedRawPath = true;
+      rb.header(WebHdfsFileSystem.FEFINFO_HEADER,
+          encodeFeInfo(status.getFileEncryptionInfo()));
+    }
+    final String uripath = WebHdfsFileSystem.PATH_PREFIX +
+        (prependReservedRawPath ? "/.reserved/raw" + path : path);
 
     int port = "http".equals(scheme) ? dn.getInfoPort() : dn
         .getInfoSecurePort();
     final URI uri = new URI(scheme, null, dn.getHostName(), port, uripath,
-        query, null);
+        queryBuilder.toString(), null);
 
     if (LOG.isTraceEnabled()) {
       LOG.trace("redirectURI=" + uri);
@@ -581,7 +607,7 @@ public class NamenodeWebHdfsMethods {
     switch(op.getValue()) {
     case CREATE:
     {
-      final URI uri = redirectURI(namenode, ugi, delegation, username,
+      final URI uri = redirectURI(null, namenode, ugi, delegation, username,
           doAsUser, fullpath, op.getValue(), -1L, blockSize.getValue(conf),
           exclDatanodes.getValue(), permission, unmaskedPermission,
           overwrite, bufferSize, replication, blockSize, createParent,
@@ -830,7 +856,7 @@ public class NamenodeWebHdfsMethods {
     case APPEND:
     {
       final NameNode namenode = (NameNode)context.getAttribute("name.node");
-      final URI uri = redirectURI(namenode, ugi, delegation, username,
+      final URI uri = redirectURI(null, namenode, ugi, delegation, username,
           doAsUser, fullpath, op.getValue(), -1L, -1L,
           excludeDatanodes.getValue(), bufferSize);
       if(!noredirectParam.getValue()) {
@@ -967,6 +993,13 @@ public class NamenodeWebHdfsMethods {
     });
   }
 
+  private static String encodeFeInfo(FileEncryptionInfo feInfo) {
+    Encoder encoder = Base64.getEncoder();
+    String encodedValue = encoder
+        .encodeToString(PBHelperClient.convert(feInfo).toByteArray());
+    return encodedValue;
+  }
+
   private Response get(
       final UserGroupInformation ugi,
       final DelegationParam delegation,
@@ -995,15 +1028,17 @@ public class NamenodeWebHdfsMethods {
     case OPEN:
     {
       final NameNode namenode = (NameNode)context.getAttribute("name.node");
-      final URI uri = redirectURI(namenode, ugi, delegation, username,
+      ResponseBuilder rb = Response.noContent();
+      final URI uri = redirectURI(rb, namenode, ugi, delegation, username,
           doAsUser, fullpath, op.getValue(), offset.getValue(), -1L,
           excludeDatanodes.getValue(), offset, length, bufferSize);
       if(!noredirectParam.getValue()) {
-        return Response.temporaryRedirect(uri)
-          .type(MediaType.APPLICATION_OCTET_STREAM).build();
+        return rb.status(Status.TEMPORARY_REDIRECT).location(uri)
+            .type(MediaType.APPLICATION_OCTET_STREAM).build();
       } else {
         final String js = JsonUtil.toJsonString("Location", uri);
-        return Response.ok(js).type(MediaType.APPLICATION_JSON).build();
+        return rb.status(Status.OK).entity(js).type(MediaType.APPLICATION_JSON)
+            .build();
       }
     }
     case GET_BLOCK_LOCATIONS:
@@ -1039,8 +1074,8 @@ public class NamenodeWebHdfsMethods {
     case GETFILECHECKSUM:
     {
       final NameNode namenode = (NameNode)context.getAttribute("name.node");
-      final URI uri = redirectURI(namenode, ugi, delegation, username, doAsUser,
-          fullpath, op.getValue(), -1L, -1L, null);
+      final URI uri = redirectURI(null, namenode, ugi, delegation, username,
+          doAsUser, fullpath, op.getValue(), -1L, -1L, null);
       if(!noredirectParam.getValue()) {
         return Response.temporaryRedirect(uri)
           .type(MediaType.APPLICATION_OCTET_STREAM).build();
@@ -1140,9 +1175,12 @@ public class NamenodeWebHdfsMethods {
     case GETSERVERDEFAULTS: {
       // Since none of the server defaults values are hot reloaded, we can
       // cache the output of serverDefaults.
+      String serverDefaultsResponse =
+          (String) context.getAttribute("serverDefaults");
       if (serverDefaultsResponse == null) {
         FsServerDefaults serverDefaults = cp.getServerDefaults();
         serverDefaultsResponse = JsonUtil.toJsonString(serverDefaults);
+        context.setAttribute("serverDefaults", serverDefaultsResponse);
       }
       return Response.ok(serverDefaultsResponse)
           .type(MediaType.APPLICATION_JSON).build();
@@ -1152,15 +1190,6 @@ public class NamenodeWebHdfsMethods {
     }
   }
 
-  /*
-   * This is used only and only for testing.
-   * Please don't use it otherwise.
-   */
-  @VisibleForTesting
-  public static void resetServerDefaultsResponse() {
-    serverDefaultsResponse = null;
-  }
-
   private static String getTrashRoot(String fullPath,
       Configuration conf) throws IOException {
     FileSystem fs = FileSystem.get(conf != null ? conf : new Configuration());

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java
index ea867a8..cf13057 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestEncryptionZones.java
@@ -20,10 +20,14 @@ package org.apache.hadoop.hdfs;
 import java.io.ByteArrayOutputStream;
 import java.io.File;
 import java.io.IOException;
+import java.io.InputStream;
 import java.io.PrintStream;
 import java.io.RandomAccessFile;
 import java.io.StringReader;
+import java.net.HttpURLConnection;
+import java.net.InetSocketAddress;
 import java.net.URI;
+import java.net.URL;
 import java.security.PrivilegedExceptionAction;
 import java.util.ArrayList;
 import java.util.Arrays;
@@ -41,12 +45,14 @@ import com.google.common.collect.Lists;
 
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.crypto.CipherSuite;
+import org.apache.hadoop.crypto.CryptoInputStream;
 import org.apache.hadoop.crypto.CryptoProtocolVersion;
 import org.apache.hadoop.crypto.key.JavaKeyStoreProvider;
 import org.apache.hadoop.crypto.key.KeyProvider;
 import org.apache.hadoop.crypto.key.KeyProviderFactory;
 import org.apache.hadoop.fs.CommonConfigurationKeysPublic;
 import org.apache.hadoop.fs.CreateFlag;
+import org.apache.hadoop.fs.FSDataInputStream;
 import org.apache.hadoop.fs.FSDataOutputStream;
 import org.apache.hadoop.fs.FSTestWrapper;
 import org.apache.hadoop.fs.FileContext;
@@ -80,6 +86,7 @@ import org.apache.hadoop.hdfs.web.WebHdfsConstants;
 import org.apache.hadoop.hdfs.web.WebHdfsFileSystem;
 import org.apache.hadoop.hdfs.web.WebHdfsTestUtil;
 import org.apache.hadoop.io.EnumSetWritable;
+import org.apache.hadoop.io.IOUtils;
 import org.apache.hadoop.ipc.RemoteException;
 import org.apache.hadoop.security.AccessControlException;
 import org.apache.hadoop.security.Credentials;
@@ -1985,4 +1992,185 @@ public class TestEncryptionZones {
     Assert.assertEquals(tokens[1], testToken);
     Assert.assertEquals(1, creds.numberOfTokens());
   }
+
+  /**
+   * Creates a file with stable {@link DistributedFileSystem}.
+   * Tests the following 2 scenarios.
+   * 1. The decrypted data using {@link WebHdfsFileSystem} should be same as
+   * input data.
+   * 2. Gets the underlying raw encrypted stream and verifies that the
+   * encrypted data is different than input data.
+   * @throws Exception
+   */
+  @Test
+  public void testWebhdfsRead() throws Exception {
+    Path zonePath = new Path("/TestEncryptionZone");
+    fsWrapper.mkdir(zonePath, FsPermission.getDirDefault(), false);
+    dfsAdmin.createEncryptionZone(zonePath, TEST_KEY, NO_TRASH);
+    final Path encryptedFilePath =
+        new Path("/TestEncryptionZone/encryptedFile.txt");
+    final Path rawPath = 
+        new Path("/.reserved/raw/TestEncryptionZone/encryptedFile.txt");
+    final String content = "hello world";
+
+    // Create a file using DistributedFileSystem.
+    DFSTestUtil.writeFile(fs, encryptedFilePath, content);
+    final FileSystem webhdfs = WebHdfsTestUtil.getWebHdfsFileSystem(conf,
+        WebHdfsConstants.WEBHDFS_SCHEME);
+    // Verify whether decrypted input stream data is same as content.
+    InputStream decryptedIputStream  = webhdfs.open(encryptedFilePath);
+    verifyStreamsSame(content, decryptedIputStream);
+
+    // Get the underlying stream from CryptoInputStream which should be
+    // raw encrypted bytes.
+    InputStream cryptoStream =
+        webhdfs.open(encryptedFilePath).getWrappedStream();
+    Assert.assertTrue("cryptoStream should be an instance of "
+        + "CryptoInputStream", (cryptoStream instanceof CryptoInputStream));
+    InputStream encryptedStream =
+        ((CryptoInputStream)cryptoStream).getWrappedStream();
+    // Verify that the data read from the raw input stream is different
+    // from the original content. Also check it is identical to the raw
+    // encrypted data from dfs.
+    verifyRaw(content, encryptedStream, fs.open(rawPath));
+  }
+
+  private void verifyStreamsSame(String content, InputStream is)
+      throws IOException {
+    byte[] streamBytes;
+    try (ByteArrayOutputStream os = new ByteArrayOutputStream()) {
+      IOUtils.copyBytes(is, os, 1024, true);
+      streamBytes = os.toByteArray();
+    }
+    Assert.assertArrayEquals(content.getBytes(), streamBytes);
+  }
+
+  private void verifyRaw(String content, InputStream is, InputStream rawIs)
+      throws IOException {
+    byte[] streamBytes, rawBytes;
+    try (ByteArrayOutputStream os = new ByteArrayOutputStream()) {
+      IOUtils.copyBytes(is, os, 1024, true);
+      streamBytes = os.toByteArray();
+    }
+    Assert.assertFalse(Arrays.equals(content.getBytes(), streamBytes));
+
+    // webhdfs raw bytes should match the raw bytes from dfs.
+    try (ByteArrayOutputStream os = new ByteArrayOutputStream()) {
+      IOUtils.copyBytes(rawIs, os, 1024, true);
+      rawBytes = os.toByteArray();
+    }
+    Assert.assertArrayEquals(rawBytes, streamBytes);
+  }
+
+  /* Tests that if client is old and namenode is new then the
+   * data will be decrypted by datanode.
+   * @throws Exception
+   */
+  @Test
+  public void testWebhdfsReadOldBehavior() throws Exception {
+    Path zonePath = new Path("/TestEncryptionZone");
+    fsWrapper.mkdir(zonePath, FsPermission.getDirDefault(), false);
+    dfsAdmin.createEncryptionZone(zonePath, TEST_KEY, NO_TRASH);
+    final Path encryptedFilePath = new Path("/TestEncryptionZone/foo");
+    final String content = "hello world";
+    // Create a file using DistributedFileSystem.
+    DFSTestUtil.writeFile(fs, encryptedFilePath, content);
+
+    InetSocketAddress addr = cluster.getNameNode().getHttpAddress();
+    URL url = new URL("http", addr.getHostString(), addr.getPort(),
+        WebHdfsFileSystem.PATH_PREFIX + encryptedFilePath.toString()
+        + "?op=OPEN");
+    // Return a connection with client not supporting EZ.
+    HttpURLConnection namenodeConnection = returnConnection(url, "GET", false);
+    String location = namenodeConnection.getHeaderField("Location");
+    URL datanodeURL = new URL(location);
+    String path = datanodeURL.getPath();
+    Assert.assertEquals(
+        WebHdfsFileSystem.PATH_PREFIX + encryptedFilePath.toString(), path);
+    HttpURLConnection datanodeConnection = returnConnection(datanodeURL,
+        "GET", false);
+    InputStream in = datanodeConnection.getInputStream();
+    // Comparing with the original contents
+    // and making sure they are decrypted.
+    verifyStreamsSame(content, in);
+  }
+
+  /* Tests namenode returns path starting with /.reserved/raw if client
+   * supports EZ and not if otherwise
+   * @throws Exception
+   */
+  @Test
+  public void testWebhfsEZRedirectLocation()
+      throws Exception {
+    Path zonePath = new Path("/TestEncryptionZone");
+    fsWrapper.mkdir(zonePath, FsPermission.getDirDefault(), false);
+    dfsAdmin.createEncryptionZone(zonePath, TEST_KEY, NO_TRASH);
+    final Path encryptedFilePath =
+        new Path("/TestEncryptionZone/foo");
+    final String content = "hello world";
+    // Create a file using DistributedFileSystem.
+    DFSTestUtil.writeFile(fs, encryptedFilePath, content);
+
+    InetSocketAddress addr = cluster.getNameNode().getHttpAddress();
+    URL url = new URL("http", addr.getHostString(), addr.getPort(),
+        WebHdfsFileSystem.PATH_PREFIX + encryptedFilePath.toString()
+        + "?op=OPEN");
+    // Return a connection with client not supporting EZ.
+    HttpURLConnection namenodeConnection =
+        returnConnection(url, "GET", false);
+    Assert.assertNotNull(namenodeConnection.getHeaderField("Location"));
+    URL datanodeUrl = new URL(namenodeConnection.getHeaderField("Location"));
+    Assert.assertNotNull(datanodeUrl);
+    String path = datanodeUrl.getPath();
+    Assert.assertEquals(
+        WebHdfsFileSystem.PATH_PREFIX + encryptedFilePath.toString(), path);
+
+    url = new URL("http", addr.getHostString(), addr.getPort(),
+        WebHdfsFileSystem.PATH_PREFIX + encryptedFilePath.toString()
+        + "?op=OPEN");
+    // Return a connection with client supporting EZ.
+    namenodeConnection = returnConnection(url, "GET", true);
+    Assert.assertNotNull(namenodeConnection.getHeaderField("Location"));
+    datanodeUrl = new URL(namenodeConnection.getHeaderField("Location"));
+    Assert.assertNotNull(datanodeUrl);
+    path = datanodeUrl.getPath();
+    Assert.assertEquals(WebHdfsFileSystem.PATH_PREFIX
+        + "/.reserved/raw" + encryptedFilePath.toString(), path);
+  }
+
+  private static HttpURLConnection returnConnection(URL url,
+      String httpRequestType, boolean supportEZ) throws Exception {
+    HttpURLConnection conn = null;
+    conn = (HttpURLConnection) url.openConnection();
+    conn.setRequestMethod(httpRequestType);
+    conn.setDoOutput(true);
+    conn.setInstanceFollowRedirects(false);
+    if (supportEZ) {
+      conn.setRequestProperty(WebHdfsFileSystem.EZ_HEADER, "true");
+    }
+    return conn;
+  }
+
+  /*
+   * Test seek behavior of the webhdfs input stream which reads data from
+   * encryption zone.
+   */
+  @Test
+  public void testPread() throws Exception {
+    Path zonePath = new Path("/TestEncryptionZone");
+    fsWrapper.mkdir(zonePath, FsPermission.getDirDefault(), false);
+    dfsAdmin.createEncryptionZone(zonePath, TEST_KEY, NO_TRASH);
+    final Path encryptedFilePath =
+        new Path("/TestEncryptionZone/foo");
+    // Create a file using DistributedFileSystem.
+    WebHdfsFileSystem webfs = WebHdfsTestUtil.getWebHdfsFileSystem(conf,
+        WebHdfsConstants.WEBHDFS_SCHEME);
+    DFSTestUtil.createFile(webfs, encryptedFilePath, 1024, (short)1, 0xFEED);
+    byte[] data = DFSTestUtil.readFileAsBytes(fs, encryptedFilePath);
+    FSDataInputStream in = webfs.open(encryptedFilePath);
+    for (int i = 0; i < 1024; i++) {
+      in.seek(i);
+      Assert.assertEquals((data[i] & 0XFF), in.read());
+    }
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/web/resources/TestWebHdfsDataLocality.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/web/resources/TestWebHdfsDataLocality.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/web/resources/TestWebHdfsDataLocality.java
index 604bf79..759719d 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/web/resources/TestWebHdfsDataLocality.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/web/resources/TestWebHdfsDataLocality.java
@@ -34,6 +34,7 @@ import org.apache.hadoop.hdfs.DFSTestUtil;
 import org.apache.hadoop.hdfs.DistributedFileSystem;
 import org.apache.hadoop.hdfs.MiniDFSCluster;
 import org.apache.hadoop.hdfs.protocol.DatanodeInfo;
+import org.apache.hadoop.hdfs.protocol.HdfsFileStatus;
 import org.apache.hadoop.hdfs.protocol.LocatedBlock;
 import org.apache.hadoop.hdfs.protocol.LocatedBlocks;
 import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeManager;
@@ -101,7 +102,7 @@ public class TestWebHdfsDataLocality {
           //The chosen datanode must be the same as the client address
           final DatanodeInfo chosen = NamenodeWebHdfsMethods.chooseDatanode(
               namenode, f, PutOpParam.Op.CREATE, -1L, blocksize, null,
-              LOCALHOST);
+              LOCALHOST, null);
           Assert.assertEquals(ipAddr, chosen.getIpAddr());
         }
       }
@@ -125,23 +126,26 @@ public class TestWebHdfsDataLocality {
       //the chosen datanode must be the same as the replica location.
 
       { //test GETFILECHECKSUM
+        final HdfsFileStatus status = dfs.getClient().getFileInfo(f);
         final DatanodeInfo chosen = NamenodeWebHdfsMethods.chooseDatanode(
             namenode, f, GetOpParam.Op.GETFILECHECKSUM, -1L, blocksize, null,
-            LOCALHOST);
+            LOCALHOST, status);
         Assert.assertEquals(expected, chosen);
       }
   
       { //test OPEN
+        final HdfsFileStatus status = dfs.getClient().getFileInfo(f);
         final DatanodeInfo chosen = NamenodeWebHdfsMethods.chooseDatanode(
             namenode, f, GetOpParam.Op.OPEN, 0, blocksize, null,
-            LOCALHOST);
+            LOCALHOST, status);
         Assert.assertEquals(expected, chosen);
       }
 
       { //test APPEND
+        final HdfsFileStatus status = dfs.getClient().getFileInfo(f);
         final DatanodeInfo chosen = NamenodeWebHdfsMethods.chooseDatanode(
             namenode, f, PostOpParam.Op.APPEND, -1L, blocksize, null,
-            LOCALHOST);
+            LOCALHOST, status);
         Assert.assertEquals(expected, chosen);
       }
     } finally {
@@ -195,9 +199,10 @@ public class TestWebHdfsDataLocality {
       for (int i = 0; i < 2; i++) {
         sb.append(locations[i].getXferAddr());
         { // test GETFILECHECKSUM
+          final HdfsFileStatus status = dfs.getClient().getFileInfo(f);
           final DatanodeInfo chosen = NamenodeWebHdfsMethods.chooseDatanode(
               namenode, f, GetOpParam.Op.GETFILECHECKSUM, -1L, blocksize,
-              sb.toString(), LOCALHOST);
+              sb.toString(), LOCALHOST, status);
           for (int j = 0; j <= i; j++) {
             Assert.assertNotEquals(locations[j].getHostName(),
                 chosen.getHostName());
@@ -205,9 +210,10 @@ public class TestWebHdfsDataLocality {
         }
 
         { // test OPEN
+          final HdfsFileStatus status = dfs.getClient().getFileInfo(f);
           final DatanodeInfo chosen = NamenodeWebHdfsMethods.chooseDatanode(
               namenode, f, GetOpParam.Op.OPEN, 0, blocksize, sb.toString(),
-              LOCALHOST);
+              LOCALHOST, status);
           for (int j = 0; j <= i; j++) {
             Assert.assertNotEquals(locations[j].getHostName(),
                 chosen.getHostName());
@@ -215,9 +221,10 @@ public class TestWebHdfsDataLocality {
         }
   
         { // test APPEND
+          final HdfsFileStatus status = dfs.getClient().getFileInfo(f);
           final DatanodeInfo chosen = NamenodeWebHdfsMethods
               .chooseDatanode(namenode, f, PostOpParam.Op.APPEND, -1L,
-                  blocksize, sb.toString(), LOCALHOST);
+                  blocksize, sb.toString(), LOCALHOST, status);
           for (int j = 0; j <= i; j++) {
             Assert.assertNotEquals(locations[j].getHostName(),
                 chosen.getHostName());
@@ -238,6 +245,6 @@ public class TestWebHdfsDataLocality {
     exception.expect(IOException.class);
     exception.expectMessage("Namesystem has not been intialized yet.");
     NamenodeWebHdfsMethods.chooseDatanode(nn, "/path", PutOpParam.Op.CREATE, 0,
-        DFSConfigKeys.DFS_BLOCK_SIZE_DEFAULT, null, LOCALHOST);
+        DFSConfigKeys.DFS_BLOCK_SIZE_DEFAULT, null, LOCALHOST, null);
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHDFS.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHDFS.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHDFS.java
index 500ec0a..9a8c9fc 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHDFS.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHDFS.java
@@ -1435,7 +1435,6 @@ public class TestWebHDFS {
       cluster = new MiniDFSCluster.Builder(conf).numDataNodes(0).build();
       final WebHdfsFileSystem webfs = WebHdfsTestUtil.getWebHdfsFileSystem(
           conf, WebHdfsConstants.WEBHDFS_SCHEME);
-      NamenodeWebHdfsMethods.resetServerDefaultsResponse();
       FSNamesystem fsnSpy =
           NameNodeAdapter.spyOnNamesystem(cluster.getNameNode());
       Mockito.when(fsnSpy.getServerDefaults()).

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fde95d46/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsTokens.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsTokens.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsTokens.java
index 1862f76..153bd47 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsTokens.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/web/TestWebHdfsTokens.java
@@ -385,7 +385,7 @@ public class TestWebHdfsTokens {
     InputStream is = fs.open(p);
     is.read();
     is.close();
-    verify(fs, times(2)).getDelegationToken(); // first bad, then good
+    verify(fs, times(3)).getDelegationToken(); // first bad, then good
     verify(fs, times(1)).replaceExpiredDelegationToken();
     verify(fs, times(1)).getDelegationToken(null);
     verify(fs, times(1)).setDelegationToken(any());
@@ -402,7 +402,7 @@ public class TestWebHdfsTokens {
     is = fs.open(p);
     is.read();
     is.close();
-    verify(fs, times(2)).getDelegationToken(); // first bad, then good
+    verify(fs, times(3)).getDelegationToken(); // first bad, then good
     verify(fs, times(1)).replaceExpiredDelegationToken();
     verify(fs, times(1)).getDelegationToken(null);
     verify(fs, times(1)).setDelegationToken(any());


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[24/50] [abbrv] hadoop git commit: YARN-6599. Support anti-affinity constraint via AppPlacementAllocator. (Wangda Tan via asuresh)

Posted by as...@apache.org.
YARN-6599. Support anti-affinity constraint via AppPlacementAllocator. (Wangda Tan via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/0b9dffa1
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/0b9dffa1
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/0b9dffa1

Branch: refs/heads/YARN-6592
Commit: 0b9dffa1174fd6c9c031840610e586216e3a73e0
Parents: 3ece7a5
Author: Arun Suresh <as...@apache.org>
Authored: Thu Jan 18 14:10:30 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../v2/app/rm/TestRMContainerAllocator.java     |  15 +-
 .../sls/scheduler/SLSCapacityScheduler.java     |  15 +-
 .../yarn/sls/scheduler/SLSFairScheduler.java    |  12 +-
 .../dev-support/findbugs-exclude.xml            |   8 +
 .../yarn/api/resource/PlacementConstraints.java |  43 +-
 .../hadoop/yarn/conf/YarnConfiguration.java     |   2 +-
 ...SchedulerInvalidResoureRequestException.java |  47 ++
 .../api/impl/TestAMRMClientOnRMRestart.java     |   9 +-
 .../impl/pb/AllocateRequestPBImpl.java          |   1 +
 .../server/scheduler/SchedulerRequestKey.java   |  11 +
 .../resourcemanager/DefaultAMSProcessor.java    |  13 +-
 .../rmapp/attempt/RMAppAttemptImpl.java         |   5 +-
 .../scheduler/AbstractYarnScheduler.java        |   3 +-
 .../scheduler/AppSchedulingInfo.java            | 205 +++++--
 .../ApplicationPlacementAllocatorFactory.java   |  68 +++
 .../scheduler/ApplicationPlacementFactory.java  |  63 ---
 .../scheduler/ContainerUpdateContext.java       |   4 +-
 .../scheduler/SchedulerApplicationAttempt.java  |  20 +-
 .../scheduler/YarnScheduler.java                |  15 +-
 .../scheduler/capacity/CapacityScheduler.java   |  54 +-
 .../CapacitySchedulerConfiguration.java         |   5 +
 .../allocator/RegularContainerAllocator.java    |   3 +-
 .../scheduler/common/ContainerRequest.java      |  12 +
 .../scheduler/common/PendingAsk.java            |   6 +
 .../scheduler/common/fica/FiCaSchedulerApp.java |   6 +
 .../constraint/AllocationTagsManager.java       |  71 +--
 .../constraint/AllocationTagsNamespaces.java    |  31 --
 .../constraint/PlacementConstraintsUtil.java    | 165 ++++--
 .../algorithm/DefaultPlacementAlgorithm.java    |   2 +-
 .../processor/PlacementProcessor.java           |   8 +-
 .../scheduler/fair/FairScheduler.java           |  12 +-
 .../scheduler/fifo/FifoScheduler.java           |   7 +-
 .../placement/AppPlacementAllocator.java        |  66 ++-
 .../LocalityAppPlacementAllocator.java          |  35 +-
 .../SingleConstraintAppPlacementAllocator.java  | 531 +++++++++++++++++++
 .../server/resourcemanager/Application.java     |   9 +-
 .../yarn/server/resourcemanager/MockAM.java     |  51 ++
 .../attempt/TestRMAppAttemptTransitions.java    |  10 +-
 .../rmcontainer/TestRMContainerImpl.java        |   6 +-
 .../scheduler/TestAppSchedulingInfo.java        |   4 +-
 .../capacity/CapacitySchedulerTestBase.java     |  79 +++
 .../capacity/TestCapacityScheduler.java         |  90 +---
 .../TestCapacitySchedulerAsyncScheduling.java   |   2 +-
 .../TestCapacitySchedulerAutoQueueCreation.java |   2 +-
 ...apacitySchedulerSchedulingRequestUpdate.java | 260 +++++++++
 .../capacity/TestIncreaseAllocationExpirer.java |   2 +-
 ...estSchedulingRequestContainerAllocation.java | 277 ++++++++++
 ...hedulingRequestContainerAllocationAsync.java | 139 +++++
 .../scheduler/capacity/TestUtils.java           |   2 +
 .../constraint/TestAllocationTagsManager.java   |  30 +-
 .../TestPlacementConstraintsUtil.java           |  36 +-
 .../scheduler/fair/FairSchedulerTestBase.java   |   6 +-
 .../fair/TestContinuousScheduling.java          |  10 +-
 .../scheduler/fair/TestFairScheduler.java       |  30 +-
 .../scheduler/fifo/TestFifoScheduler.java       |  28 +-
 ...stSingleConstraintAppPlacementAllocator.java | 403 ++++++++++++++
 56 files changed, 2557 insertions(+), 492 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/rm/TestRMContainerAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/rm/TestRMContainerAllocator.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/rm/TestRMContainerAllocator.java
index 85e4181..7875917 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/rm/TestRMContainerAllocator.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/rm/TestRMContainerAllocator.java
@@ -111,6 +111,7 @@ import org.apache.hadoop.yarn.api.records.NodeReport;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.client.api.TimelineV2Client;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.event.Dispatcher;
@@ -1751,6 +1752,7 @@ public class TestRMContainerAllocator {
       super();
       try {
         Configuration conf = new Configuration();
+        init(conf);
         reinitialize(conf, rmContext);
       } catch (IOException ie) {
         LOG.info("add application failed with ", ie);
@@ -1769,8 +1771,8 @@ public class TestRMContainerAllocator {
     @Override
     public synchronized Allocation allocate(
         ApplicationAttemptId applicationAttemptId, List<ResourceRequest> ask,
-        List<ContainerId> release, List<String> blacklistAdditions,
-        List<String> blacklistRemovals,
+        List<SchedulingRequest> schedulingRequests, List<ContainerId> release,
+        List<String> blacklistAdditions, List<String> blacklistRemovals,
         ContainerUpdates updateRequests) {
       List<ResourceRequest> askCopy = new ArrayList<ResourceRequest>();
       for (ResourceRequest req : ask) {
@@ -1785,7 +1787,7 @@ public class TestRMContainerAllocator {
       lastBlacklistAdditions = blacklistAdditions;
       lastBlacklistRemovals = blacklistRemovals;
       Allocation allocation = super.allocate(
-          applicationAttemptId, askCopy, release, blacklistAdditions,
+          applicationAttemptId, askCopy, schedulingRequests, release, blacklistAdditions,
           blacklistRemovals, updateRequests);
       if (forceResourceLimit != null) {
         // Test wants to force the non-default resource limit
@@ -1805,6 +1807,7 @@ public class TestRMContainerAllocator {
       super();
       try {
         Configuration conf = new Configuration();
+        init(conf);
         reinitialize(conf, rmContext);
       } catch (IOException ie) {
         LOG.info("add application failed with ", ie);
@@ -1815,8 +1818,8 @@ public class TestRMContainerAllocator {
     @Override
     public synchronized Allocation allocate(
         ApplicationAttemptId applicationAttemptId, List<ResourceRequest> ask,
-        List<ContainerId> release, List<String> blacklistAdditions,
-        List<String> blacklistRemovals,
+        List<SchedulingRequest> schedulingRequests, List<ContainerId> release,
+        List<String> blacklistAdditions, List<String> blacklistRemovals,
         ContainerUpdates updateRequests) {
       List<ResourceRequest> askCopy = new ArrayList<ResourceRequest>();
       for (ResourceRequest req : ask) {
@@ -1827,7 +1830,7 @@ public class TestRMContainerAllocator {
       }
       SecurityUtil.setTokenServiceUseIp(false);
       Allocation normalAlloc = super.allocate(
-          applicationAttemptId, askCopy, release,
+          applicationAttemptId, askCopy, schedulingRequests, release,
           blacklistAdditions, blacklistRemovals, updateRequests);
       List<Container> containers = normalAlloc.getContainers();
       if(containers.size() > 0) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSCapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSCapacityScheduler.java b/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSCapacityScheduler.java
index 6848b22..35f3ed1 100644
--- a/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSCapacityScheduler.java
+++ b/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSCapacityScheduler.java
@@ -35,6 +35,7 @@ import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.ContainerStatus;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.UpdatedContainerInfo;
@@ -42,9 +43,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.Allocation;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ContainerUpdates;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerAppReport;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerApplication;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CSQueue;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacityScheduler;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.LeafQueue;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptAddedSchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptRemovedSchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.NodeUpdateSchedulerEvent;
@@ -100,16 +99,17 @@ public class SLSCapacityScheduler extends CapacityScheduler implements
 
   @Override
   public Allocation allocate(ApplicationAttemptId attemptId,
-      List<ResourceRequest> resourceRequests, List<ContainerId> containerIds,
-      List<String> strings, List<String> strings2,
-      ContainerUpdates updateRequests) {
+      List<ResourceRequest> resourceRequests,
+      List<SchedulingRequest> schedulingRequests, List<ContainerId> containerIds,
+      List<String> strings, List<String> strings2, ContainerUpdates updateRequests) {
     if (metricsON) {
       final Timer.Context context = schedulerMetrics.getSchedulerAllocateTimer()
           .time();
       Allocation allocation = null;
       try {
         allocation = super
-            .allocate(attemptId, resourceRequests, containerIds, strings,
+            .allocate(attemptId, resourceRequests, schedulingRequests,
+                containerIds, strings,
                 strings2, updateRequests);
         return allocation;
       } finally {
@@ -123,7 +123,8 @@ public class SLSCapacityScheduler extends CapacityScheduler implements
         }
       }
     } else {
-      return super.allocate(attemptId, resourceRequests, containerIds, strings,
+      return super.allocate(attemptId, resourceRequests, schedulingRequests,
+          containerIds, strings,
           strings2, updateRequests);
     }
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSFairScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSFairScheduler.java b/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSFairScheduler.java
index 8e49c51..c27ab3e 100644
--- a/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSFairScheduler.java
+++ b/hadoop-tools/hadoop-sls/src/main/java/org/apache/hadoop/yarn/sls/scheduler/SLSFairScheduler.java
@@ -29,6 +29,7 @@ import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.ContainerStatus;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.UpdatedContainerInfo;
@@ -39,8 +40,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptR
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.NodeUpdateSchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.SchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.SchedulerEventType;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.fair.FSLeafQueue;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.fair.FSQueue;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.fair.FairScheduler;
 import org.apache.hadoop.yarn.sls.SLSRunner;
 import org.apache.hadoop.yarn.sls.conf.SLSConfiguration;
@@ -94,7 +93,8 @@ public class SLSFairScheduler extends FairScheduler
 
   @Override
   public Allocation allocate(ApplicationAttemptId attemptId,
-      List<ResourceRequest> resourceRequests, List<ContainerId> containerIds,
+      List<ResourceRequest> resourceRequests,
+      List<SchedulingRequest> schedulingRequests, List<ContainerId> containerIds,
       List<String> blacklistAdditions, List<String> blacklistRemovals,
       ContainerUpdates updateRequests) {
     if (metricsON) {
@@ -102,7 +102,8 @@ public class SLSFairScheduler extends FairScheduler
           .time();
       Allocation allocation = null;
       try {
-        allocation = super.allocate(attemptId, resourceRequests, containerIds,
+        allocation = super.allocate(attemptId, resourceRequests,
+            schedulingRequests, containerIds,
             blacklistAdditions, blacklistRemovals, updateRequests);
         return allocation;
       } finally {
@@ -116,7 +117,8 @@ public class SLSFairScheduler extends FairScheduler
         }
       }
     } else {
-      return super.allocate(attemptId, resourceRequests, containerIds,
+      return super.allocate(attemptId, resourceRequests, schedulingRequests,
+          containerIds,
           blacklistAdditions, blacklistRemovals, updateRequests);
     }
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/dev-support/findbugs-exclude.xml
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/dev-support/findbugs-exclude.xml b/hadoop-yarn-project/hadoop-yarn/dev-support/findbugs-exclude.xml
index 6a10312..81b8825 100644
--- a/hadoop-yarn-project/hadoop-yarn/dev-support/findbugs-exclude.xml
+++ b/hadoop-yarn-project/hadoop-yarn/dev-support/findbugs-exclude.xml
@@ -650,4 +650,12 @@
     <Method name="equals" />
     <Bug pattern="EQ_OVERRIDING_EQUALS_NOT_SYMMETRIC" />
   </Match>
+
+  <!-- Null pointer exception needs to be ignored here as Findbugs doesn't properly detect code logic -->
+  <Match>
+    <Class name="org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.SingleConstraintAppPlacementAllocator" />
+    <Method name="validateAndSetSchedulingRequest" />
+    <Bug pattern="NP_NULL_ON_SOME_PATH" />
+  </Match>
+
 </FindBugsFilter>

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
index c8991cb..ba1beae 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
@@ -20,8 +20,12 @@ package org.apache.hadoop.yarn.api.resource;
 
 import java.util.concurrent.TimeUnit;
 
+import org.apache.commons.logging.Log;
+import org.apache.commons.logging.LogFactory;
+import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceAudience.Public;
 import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.And;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.DelayedOr;
@@ -47,6 +51,14 @@ public final class PlacementConstraints {
 
   public static final String NODE = PlacementConstraint.NODE_SCOPE;
   public static final String RACK = PlacementConstraint.RACK_SCOPE;
+  public static final String NODE_PARTITION = "yarn_node_partition/";
+
+  private static final String APPLICATION_LABEL_PREFIX =
+      "yarn_application_label/";
+
+  @InterfaceAudience.Private
+  public static final String APPLICATION_LABEL_INTRA_APPLICATION =
+      APPLICATION_LABEL_PREFIX + "%intra_app%";
 
   /**
    * Creates a constraint that requires allocations to be placed on nodes that
@@ -187,6 +199,20 @@ public final class PlacementConstraints {
     }
 
     /**
+     * Constructs a target expression on a node partition. It is satisfied if
+     * the specified node partition has one of the specified nodePartitions
+     *
+     * @param nodePartitions the set of values that the attribute should take
+     *          values from
+     * @return the resulting expression on the node attribute
+     */
+    public static TargetExpression nodePartition(
+        String... nodePartitions) {
+      return new TargetExpression(TargetType.NODE_ATTRIBUTE, NODE_PARTITION,
+          nodePartitions);
+    }
+
+    /**
      * Constructs a target expression on an allocation tag. It is satisfied if
      * the there are allocations with one of the given tags.
      *
@@ -198,6 +224,22 @@ public final class PlacementConstraints {
       return new TargetExpression(TargetType.ALLOCATION_TAG, null,
           allocationTags);
     }
+
+    /**
+     * Constructs a target expression on an allocation tag. It is satisfied if
+     * the there are allocations with one of the given tags. Comparing to
+     * {@link PlacementTargets#allocationTag(String...)}, this only check tags
+     * within the application.
+     *
+     * @param allocationTags the set of tags that the attribute should take
+     *          values from
+     * @return the resulting expression on the allocation tags
+     */
+    public static TargetExpression allocationTagToIntraApp(
+        String... allocationTags) {
+      return new TargetExpression(TargetType.ALLOCATION_TAG,
+          APPLICATION_LABEL_INTRA_APPLICATION, allocationTags);
+    }
   }
 
   // Creation of compound constraints.
@@ -277,5 +319,4 @@ public final class PlacementConstraints {
   public static PlacementConstraint build(AbstractConstraint constraintExpr) {
     return constraintExpr.build();
   }
-
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
index 367b1ae..f5bb2c7 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
@@ -543,7 +543,7 @@ public class YarnConfiguration extends Configuration {
   public static final String RM_PLACEMENT_CONSTRAINTS_ENABLED =
       RM_PREFIX + "placement-constraints.enabled";
 
-  public static final boolean DEFAULT_RM_PLACEMENT_CONSTRAINTS_ENABLED = true;
+  public static final boolean DEFAULT_RM_PLACEMENT_CONSTRAINTS_ENABLED = false;
 
   public static final String RM_PLACEMENT_CONSTRAINTS_RETRY_ATTEMPTS =
       RM_PREFIX + "placement-constraints.retry-attempts";

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/exceptions/SchedulerInvalidResoureRequestException.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/exceptions/SchedulerInvalidResoureRequestException.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/exceptions/SchedulerInvalidResoureRequestException.java
new file mode 100644
index 0000000..f55ad83
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/exceptions/SchedulerInvalidResoureRequestException.java
@@ -0,0 +1,47 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.exceptions;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+
+/**
+ * This exception is thrown when any issue inside scheduler to handle a new or
+ * updated {@link org.apache.hadoop.yarn.api.records.SchedulingRequest}/
+ * {@link org.apache.hadoop.yarn.api.records.ResourceRequest} add to the
+ * scheduler.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+public class SchedulerInvalidResoureRequestException extends YarnRuntimeException {
+  private static final long serialVersionUID = 10081123982L;
+
+  public SchedulerInvalidResoureRequestException(String message) {
+    super(message);
+  }
+
+  public SchedulerInvalidResoureRequestException(Throwable cause) {
+    super(cause);
+  }
+
+  public SchedulerInvalidResoureRequestException(String message,
+      Throwable cause) {
+    super(message, cause);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientOnRMRestart.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientOnRMRestart.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientOnRMRestart.java
index 337d7d4..11d703d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientOnRMRestart.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientOnRMRestart.java
@@ -44,6 +44,7 @@ import org.apache.hadoop.yarn.api.records.FinalApplicationStatus;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.client.api.AMRMClient;
 import org.apache.hadoop.yarn.client.api.AMRMClient.ContainerRequest;
@@ -545,6 +546,7 @@ public class TestAMRMClientOnRMRestart {
       super();
       try {
         Configuration conf = new Configuration();
+        init(conf);
         reinitialize(conf, rmContext);
       } catch (IOException ie) {
         assert (false);
@@ -563,8 +565,8 @@ public class TestAMRMClientOnRMRestart {
     @Override
     public synchronized Allocation allocate(
         ApplicationAttemptId applicationAttemptId, List<ResourceRequest> ask,
-        List<ContainerId> release, List<String> blacklistAdditions,
-        List<String> blacklistRemovals,
+        List<SchedulingRequest> schedulingRequests, List<ContainerId> release,
+        List<String> blacklistAdditions, List<String> blacklistRemovals,
         ContainerUpdates updateRequests) {
       List<ResourceRequest> askCopy = new ArrayList<ResourceRequest>();
       for (ResourceRequest req : ask) {
@@ -580,7 +582,8 @@ public class TestAMRMClientOnRMRestart {
       lastDecrease = updateRequests.getDecreaseRequests();
       lastBlacklistAdditions = blacklistAdditions;
       lastBlacklistRemovals = blacklistRemovals;
-      return super.allocate(applicationAttemptId, askCopy, release,
+      return super.allocate(applicationAttemptId, askCopy, schedulingRequests,
+          release,
           blacklistAdditions, blacklistRemovals, updateRequests);
     }
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java
index b460044..50672a3 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java
@@ -194,6 +194,7 @@ public class AllocateRequestPBImpl extends AllocateRequest {
   public void setSchedulingRequests(
       List<SchedulingRequest> schedulingRequests) {
     if (schedulingRequests == null) {
+      builder.clearSchedulingRequests();
       return;
     }
     initSchedulingRequests();

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/scheduler/SchedulerRequestKey.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/scheduler/SchedulerRequestKey.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/scheduler/SchedulerRequestKey.java
index c4f37f6..0fce083 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/scheduler/SchedulerRequestKey.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/scheduler/SchedulerRequestKey.java
@@ -22,6 +22,7 @@ import org.apache.hadoop.yarn.api.records.Container;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 
 /**
@@ -45,6 +46,16 @@ public final class SchedulerRequestKey implements
         req.getAllocationRequestId(), null);
   }
 
+  /**
+   * Factory method to generate a SchedulerRequestKey from a SchedulingRequest.
+   * @param req SchedulingRequest
+   * @return SchedulerRequestKey
+   */
+  public static SchedulerRequestKey create(SchedulingRequest req) {
+    return new SchedulerRequestKey(req.getPriority(),
+        req.getAllocationRequestId(), null);
+  }
+
   public static SchedulerRequestKey create(UpdateContainerRequest req,
       SchedulerRequestKey schedulerRequestKey) {
     return new SchedulerRequestKey(schedulerRequestKey.getPriority(),

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/DefaultAMSProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/DefaultAMSProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/DefaultAMSProcessor.java
index 713947f..18ab473 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/DefaultAMSProcessor.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/DefaultAMSProcessor.java
@@ -53,6 +53,7 @@ import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.exceptions.InvalidContainerReleaseException;
 import org.apache.hadoop.yarn.exceptions.InvalidResourceBlacklistRequestException;
 import org.apache.hadoop.yarn.exceptions.InvalidResourceRequestException;
+import org.apache.hadoop.yarn.exceptions.SchedulerInvalidResoureRequestException;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.factories.RecordFactory;
 import org.apache.hadoop.yarn.factory.providers.RecordFactoryProvider;
@@ -273,10 +274,14 @@ final class DefaultAMSProcessor implements ApplicationMasterServiceProcessor {
           " state, ignore container allocate request.");
       allocation = EMPTY_ALLOCATION;
     } else {
-      allocation =
-          getScheduler().allocate(appAttemptId, ask, release,
-              blacklistAdditions, blacklistRemovals,
-              containerUpdateRequests);
+      try {
+        allocation = getScheduler().allocate(appAttemptId, ask,
+            request.getSchedulingRequests(), release,
+            blacklistAdditions, blacklistRemovals, containerUpdateRequests);
+      } catch (SchedulerInvalidResoureRequestException e) {
+        LOG.warn("Exceptions caught when scheduler handling requests");
+        throw new YarnException(e);
+      }
     }
 
     if (!blacklistAdditions.isEmpty() || !blacklistRemovals.isEmpty()) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/RMAppAttemptImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/RMAppAttemptImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/RMAppAttemptImpl.java
index cf10be4..8c2f4e4 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/RMAppAttemptImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/RMAppAttemptImpl.java
@@ -1113,8 +1113,7 @@ public class RMAppAttemptImpl implements RMAppAttempt, Recoverable {
         Allocation amContainerAllocation =
             appAttempt.scheduler.allocate(
                 appAttempt.applicationAttemptId,
-                appAttempt.amReqs,
-                EMPTY_CONTAINER_RELEASE_LIST,
+                appAttempt.amReqs, null, EMPTY_CONTAINER_RELEASE_LIST,
                 amBlacklist.getBlacklistAdditions(),
                 amBlacklist.getBlacklistRemovals(),
                 new ContainerUpdates());
@@ -1140,7 +1139,7 @@ public class RMAppAttemptImpl implements RMAppAttempt, Recoverable {
       // Acquire the AM container from the scheduler.
       Allocation amContainerAllocation =
           appAttempt.scheduler.allocate(appAttempt.applicationAttemptId,
-            EMPTY_CONTAINER_REQUEST_LIST, EMPTY_CONTAINER_RELEASE_LIST, null,
+            EMPTY_CONTAINER_REQUEST_LIST, null, EMPTY_CONTAINER_RELEASE_LIST, null,
             null, new ContainerUpdates());
       // There must be at least one container allocated, because a
       // CONTAINER_ALLOCATED is emitted after an RMContainer is constructed,

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
index 72376df..7f81f00 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
@@ -53,6 +53,7 @@ import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceOption;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerError;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
@@ -1155,7 +1156,7 @@ public abstract class AbstractYarnScheduler
    *
    * @param asks resource requests
    */
-  protected void normalizeRequests(List<ResourceRequest> asks) {
+  protected void normalizeResourceRequests(List<ResourceRequest> asks) {
     for (ResourceRequest ask: asks) {
       ask.setCapability(getNormalizedResource(ask.getCapability()));
     }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
index 8858d3b..7d6f233 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
@@ -41,6 +41,8 @@ import org.apache.hadoop.yarn.api.records.Container;
 import org.apache.hadoop.yarn.api.records.ExecutionType;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.hadoop.yarn.server.resourcemanager.ResourceManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainerState;
@@ -49,7 +51,9 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.Applicatio
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.ContainerRequest;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.PendingAsk;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.AppPlacementAllocator;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.LocalityAppPlacementAllocator;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.PendingAskUpdateResult;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.SingleConstraintAppPlacementAllocator;
 import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
 import org.apache.hadoop.yarn.util.resource.Resources;
 /**
@@ -91,11 +95,12 @@ public class AppSchedulingInfo {
 
   public final ContainerUpdateContext updateContext;
   public final Map<String, String> applicationSchedulingEnvs = new HashMap<>();
+  private final RMContext rmContext;
 
   public AppSchedulingInfo(ApplicationAttemptId appAttemptId, String user,
       Queue queue, AbstractUsersManager abstractUsersManager, long epoch,
       ResourceUsage appResourceUsage,
-      Map<String, String> applicationSchedulingEnvs) {
+      Map<String, String> applicationSchedulingEnvs, RMContext rmContext) {
     this.applicationAttemptId = appAttemptId;
     this.applicationId = appAttemptId.getApplicationId();
     this.queue = queue;
@@ -105,6 +110,7 @@ public class AppSchedulingInfo {
         epoch << ResourceManager.EPOCH_BIT_SHIFT);
     this.appResourceUsage = appResourceUsage;
     this.applicationSchedulingEnvs.putAll(applicationSchedulingEnvs);
+    this.rmContext = rmContext;
 
     ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
     updateContext = new ContainerUpdateContext(this);
@@ -163,74 +169,153 @@ public class AppSchedulingInfo {
    * application, by asking for more resources and releasing resources acquired
    * by the application.
    *
-   * @param requests
-   *          resources to be acquired
+   * @param resourceRequests resource requests to be allocated
    * @param recoverPreemptedRequestForAContainer
-   *          recover ResourceRequest on preemption
+   *          recover ResourceRequest/SchedulingRequest on preemption
    * @return true if any resource was updated, false otherwise
    */
-  public boolean updateResourceRequests(List<ResourceRequest> requests,
+  public boolean updateResourceRequests(List<ResourceRequest> resourceRequests,
       boolean recoverPreemptedRequestForAContainer) {
-    if (null == requests || requests.isEmpty()) {
-      return false;
+    // Flag to track if any incoming requests update "ANY" requests
+    boolean offswitchResourcesUpdated;
+
+    writeLock.lock();
+    try {
+      // Update AppPlacementAllocator by requests
+      offswitchResourcesUpdated = internalAddResourceRequests(
+          recoverPreemptedRequestForAContainer, resourceRequests);
+    } finally {
+      writeLock.unlock();
     }
 
+    return offswitchResourcesUpdated;
+  }
+
+  /**
+   * The ApplicationMaster is updating resource requirements for the
+   * application, by asking for more resources and releasing resources acquired
+   * by the application.
+   *
+   * @param dedupRequests (dedup) resource requests to be allocated
+   * @param recoverPreemptedRequestForAContainer
+   *          recover ResourceRequest/SchedulingRequest on preemption
+   * @return true if any resource was updated, false otherwise
+   */
+  public boolean updateResourceRequests(
+      Map<SchedulerRequestKey, Map<String, ResourceRequest>> dedupRequests,
+      boolean recoverPreemptedRequestForAContainer) {
     // Flag to track if any incoming requests update "ANY" requests
-    boolean offswitchResourcesUpdated = false;
+    boolean offswitchResourcesUpdated;
 
+    writeLock.lock();
     try {
-      this.writeLock.lock();
-
-      // A map to group resource requests and dedup
-      Map<SchedulerRequestKey, Map<String, ResourceRequest>> dedupRequests =
-          new HashMap<>();
+      // Update AppPlacementAllocator by requests
+      offswitchResourcesUpdated = internalAddResourceRequests(
+          recoverPreemptedRequestForAContainer, dedupRequests);
+    } finally {
+      writeLock.unlock();
+    }
 
-      // Group resource request by schedulerRequestKey and resourceName
-      for (ResourceRequest request : requests) {
-        SchedulerRequestKey schedulerKey = SchedulerRequestKey.create(request);
-        if (!dedupRequests.containsKey(schedulerKey)) {
-          dedupRequests.put(schedulerKey, new HashMap<>());
-        }
-        dedupRequests.get(schedulerKey).put(request.getResourceName(), request);
-      }
+    return offswitchResourcesUpdated;
+  }
 
-      // Update AppPlacementAllocator by dedup requests.
-      offswitchResourcesUpdated =
-          addRequestToAppPlacement(
-              recoverPreemptedRequestForAContainer, dedupRequests);
+  /**
+   * The ApplicationMaster is updating resource requirements for the
+   * application, by asking for more resources and releasing resources acquired
+   * by the application.
+   *
+   * @param schedulingRequests resource requests to be allocated
+   * @param recoverPreemptedRequestForAContainer
+   *          recover ResourceRequest/SchedulingRequest on preemption
+   * @return true if any resource was updated, false otherwise
+   */
+  public boolean updateSchedulingRequests(
+      List<SchedulingRequest> schedulingRequests,
+      boolean recoverPreemptedRequestForAContainer) {
+    // Flag to track if any incoming requests update "ANY" requests
+    boolean offswitchResourcesUpdated;
 
-      return offswitchResourcesUpdated;
+    writeLock.lock();
+    try {
+      // Update AppPlacementAllocator by requests
+      offswitchResourcesUpdated = addSchedulingRequests(
+          recoverPreemptedRequestForAContainer, schedulingRequests);
     } finally {
-      this.writeLock.unlock();
+      writeLock.unlock();
     }
+
+    return offswitchResourcesUpdated;
   }
 
   public void removeAppPlacement(SchedulerRequestKey schedulerRequestKey) {
     schedulerKeyToAppPlacementAllocator.remove(schedulerRequestKey);
   }
 
-  boolean addRequestToAppPlacement(
+  private boolean addSchedulingRequests(
+      boolean recoverPreemptedRequestForAContainer,
+      List<SchedulingRequest> schedulingRequests) {
+    // Do we need to update pending resource for app/queue, etc.?
+    boolean requireUpdatePendingResource = false;
+
+    for (SchedulingRequest request : schedulingRequests) {
+      SchedulerRequestKey schedulerRequestKey = SchedulerRequestKey.create(
+          request);
+
+      AppPlacementAllocator appPlacementAllocator =
+          getAndAddAppPlacementAllocatorIfNotExist(schedulerRequestKey,
+              SingleConstraintAppPlacementAllocator.class.getCanonicalName());
+
+      // Update AppPlacementAllocator
+      PendingAskUpdateResult pendingAmountChanges =
+          appPlacementAllocator.updatePendingAsk(schedulerRequestKey,
+              request, recoverPreemptedRequestForAContainer);
+
+      if (null != pendingAmountChanges) {
+        updatePendingResources(pendingAmountChanges, schedulerRequestKey,
+            queue.getMetrics());
+        requireUpdatePendingResource = true;
+      }
+    }
+
+    return requireUpdatePendingResource;
+  }
+
+  /**
+   * Get and insert AppPlacementAllocator if it doesn't exist, this should be
+   * protected by write lock.
+   * @param schedulerRequestKey schedulerRequestKey
+   * @param placementTypeClass placementTypeClass
+   * @return AppPlacementAllocator
+   */
+  private AppPlacementAllocator<SchedulerNode> getAndAddAppPlacementAllocatorIfNotExist(
+      SchedulerRequestKey schedulerRequestKey, String placementTypeClass) {
+    AppPlacementAllocator<SchedulerNode> appPlacementAllocator;
+    if ((appPlacementAllocator = schedulerKeyToAppPlacementAllocator.get(
+        schedulerRequestKey)) == null) {
+      appPlacementAllocator =
+          ApplicationPlacementAllocatorFactory.getAppPlacementAllocator(
+              placementTypeClass, this, schedulerRequestKey, rmContext);
+      schedulerKeyToAppPlacementAllocator.put(schedulerRequestKey,
+          appPlacementAllocator);
+    }
+    return appPlacementAllocator;
+  }
+
+  private boolean internalAddResourceRequests(
       boolean recoverPreemptedRequestForAContainer,
       Map<SchedulerRequestKey, Map<String, ResourceRequest>> dedupRequests) {
     boolean offswitchResourcesUpdated = false;
     for (Map.Entry<SchedulerRequestKey, Map<String, ResourceRequest>> entry :
     dedupRequests.entrySet()) {
       SchedulerRequestKey schedulerRequestKey = entry.getKey();
-
-      if (!schedulerKeyToAppPlacementAllocator
-          .containsKey(schedulerRequestKey)) {
-        AppPlacementAllocator<SchedulerNode> placementAllocatorInstance = ApplicationPlacementFactory
-            .getAppPlacementAllocator(applicationSchedulingEnvs
-                .get(ApplicationSchedulingConfig.ENV_APPLICATION_PLACEMENT_TYPE_CLASS));
-        placementAllocatorInstance.setAppSchedulingInfo(this);
-
-        schedulerKeyToAppPlacementAllocator.put(schedulerRequestKey,
-            placementAllocatorInstance);
-      }
+      AppPlacementAllocator<SchedulerNode> appPlacementAllocator =
+          getAndAddAppPlacementAllocatorIfNotExist(schedulerRequestKey,
+              applicationSchedulingEnvs.get(
+                  ApplicationSchedulingConfig.ENV_APPLICATION_PLACEMENT_TYPE_CLASS));
 
       // Update AppPlacementAllocator
-      PendingAskUpdateResult pendingAmountChanges = schedulerKeyToAppPlacementAllocator
-          .get(schedulerRequestKey).updatePendingAsk(entry.getValue().values(),
+      PendingAskUpdateResult pendingAmountChanges =
+          appPlacementAllocator.updatePendingAsk(entry.getValue().values(),
               recoverPreemptedRequestForAContainer);
 
       if (null != pendingAmountChanges) {
@@ -242,6 +327,29 @@ public class AppSchedulingInfo {
     return offswitchResourcesUpdated;
   }
 
+  private boolean internalAddResourceRequests(boolean recoverPreemptedRequestForAContainer,
+      List<ResourceRequest> resourceRequests) {
+    if (null == resourceRequests || resourceRequests.isEmpty()) {
+      return false;
+    }
+
+    // A map to group resource requests and dedup
+    Map<SchedulerRequestKey, Map<String, ResourceRequest>> dedupRequests =
+        new HashMap<>();
+
+    // Group resource request by schedulerRequestKey and resourceName
+    for (ResourceRequest request : resourceRequests) {
+      SchedulerRequestKey schedulerKey = SchedulerRequestKey.create(request);
+      if (!dedupRequests.containsKey(schedulerKey)) {
+        dedupRequests.put(schedulerKey, new HashMap<>());
+      }
+      dedupRequests.get(schedulerKey).put(request.getResourceName(), request);
+    }
+
+    return internalAddResourceRequests(recoverPreemptedRequestForAContainer,
+        dedupRequests);
+  }
+
   private void updatePendingResources(PendingAskUpdateResult updateResult,
       SchedulerRequestKey schedulerKey, QueueMetrics metrics) {
 
@@ -629,13 +737,22 @@ public class AppSchedulingInfo {
     }
   }
 
-  public boolean acceptNodePartition(SchedulerRequestKey schedulerKey,
-      String nodePartition, SchedulingMode schedulingMode) {
+  /**
+   * Pre-check node to see if it satisfy the given schedulerKey and
+   * scheduler mode
+   *
+   * @param schedulerKey schedulerKey
+   * @param schedulerNode schedulerNode
+   * @param schedulingMode schedulingMode
+   * @return can use the node or not.
+   */
+  public boolean precheckNode(SchedulerRequestKey schedulerKey,
+      SchedulerNode schedulerNode, SchedulingMode schedulingMode) {
     try {
       this.readLock.lock();
       AppPlacementAllocator ap =
           schedulerKeyToAppPlacementAllocator.get(schedulerKey);
-      return (ap != null) && ap.acceptNodePartition(nodePartition,
+      return (ap != null) && ap.precheckNode(schedulerNode,
           schedulingMode);
     } finally {
       this.readLock.unlock();

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ApplicationPlacementAllocatorFactory.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ApplicationPlacementAllocatorFactory.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ApplicationPlacementAllocatorFactory.java
new file mode 100644
index 0000000..a4e5484
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ApplicationPlacementAllocatorFactory.java
@@ -0,0 +1,68 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler;
+
+import org.apache.hadoop.classification.InterfaceAudience.Public;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.util.ReflectionUtils;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.ApplicationSchedulingConfig;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.AppPlacementAllocator;
+import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
+
+/**
+ * Factory class to build various application placement policies.
+ */
+@Public
+@Unstable
+public class ApplicationPlacementAllocatorFactory {
+
+  /**
+   * Get AppPlacementAllocator related to the placement type requested.
+   *
+   * @param appPlacementAllocatorName
+   *          allocator class name.
+   * @return Specific AppPlacementAllocator instance based on type
+   */
+  public static AppPlacementAllocator<SchedulerNode> getAppPlacementAllocator(
+      String appPlacementAllocatorName, AppSchedulingInfo appSchedulingInfo,
+      SchedulerRequestKey schedulerRequestKey, RMContext rmContext) {
+    Class<?> policyClass;
+    try {
+      if (appPlacementAllocatorName == null) {
+        policyClass = ApplicationSchedulingConfig.DEFAULT_APPLICATION_PLACEMENT_TYPE_CLASS;
+      } else {
+        policyClass = Class.forName(appPlacementAllocatorName);
+      }
+    } catch (ClassNotFoundException e) {
+      policyClass = ApplicationSchedulingConfig.DEFAULT_APPLICATION_PLACEMENT_TYPE_CLASS;
+    }
+
+    if (!AppPlacementAllocator.class.isAssignableFrom(policyClass)) {
+      policyClass = ApplicationSchedulingConfig.DEFAULT_APPLICATION_PLACEMENT_TYPE_CLASS;
+    }
+
+    @SuppressWarnings("unchecked")
+    AppPlacementAllocator<SchedulerNode> placementAllocatorInstance = (AppPlacementAllocator<SchedulerNode>) ReflectionUtils
+        .newInstance(policyClass, null);
+    placementAllocatorInstance.initialize(appSchedulingInfo,
+        schedulerRequestKey, rmContext);
+    return placementAllocatorInstance;
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ApplicationPlacementFactory.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ApplicationPlacementFactory.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ApplicationPlacementFactory.java
deleted file mode 100644
index 40c8d05..0000000
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ApplicationPlacementFactory.java
+++ /dev/null
@@ -1,63 +0,0 @@
-/**
- * Licensed to the Apache Software Foundation (ASF) under one
- * or more contributor license agreements.  See the NOTICE file
- * distributed with this work for additional information
- * regarding copyright ownership.  The ASF licenses this file
- * to you under the Apache License, Version 2.0 (the
- * "License"); you may not use this file except in compliance
- * with the License.  You may obtain a copy of the License at
- *
- *     http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-package org.apache.hadoop.yarn.server.resourcemanager.scheduler;
-
-import org.apache.hadoop.classification.InterfaceAudience.Public;
-import org.apache.hadoop.classification.InterfaceStability.Unstable;
-import org.apache.hadoop.util.ReflectionUtils;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.ApplicationSchedulingConfig;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.AppPlacementAllocator;
-
-/**
- * Factory class to build various application placement policies.
- */
-@Public
-@Unstable
-public class ApplicationPlacementFactory {
-
-  /**
-   * Get AppPlacementAllocator related to the placement type requested.
-   *
-   * @param appPlacementAllocatorName
-   *          allocator class name.
-   * @return Specific AppPlacementAllocator instance based on type
-   */
-  public static AppPlacementAllocator<SchedulerNode> getAppPlacementAllocator(
-      String appPlacementAllocatorName) {
-    Class<?> policyClass;
-    try {
-      if (appPlacementAllocatorName == null) {
-        policyClass = ApplicationSchedulingConfig.DEFAULT_APPLICATION_PLACEMENT_TYPE_CLASS;
-      } else {
-        policyClass = Class.forName(appPlacementAllocatorName);
-      }
-    } catch (ClassNotFoundException e) {
-      policyClass = ApplicationSchedulingConfig.DEFAULT_APPLICATION_PLACEMENT_TYPE_CLASS;
-    }
-
-    if (!AppPlacementAllocator.class.isAssignableFrom(policyClass)) {
-      policyClass = ApplicationSchedulingConfig.DEFAULT_APPLICATION_PLACEMENT_TYPE_CLASS;
-    }
-
-    @SuppressWarnings("unchecked")
-    AppPlacementAllocator<SchedulerNode> placementAllocatorInstance = (AppPlacementAllocator<SchedulerNode>) ReflectionUtils
-        .newInstance(policyClass, null);
-    return placementAllocatorInstance;
-  }
-}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ContainerUpdateContext.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ContainerUpdateContext.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ContainerUpdateContext.java
index f410db1..491a9ce 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ContainerUpdateContext.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ContainerUpdateContext.java
@@ -146,7 +146,7 @@ public class ContainerUpdateContext {
           createResourceRequests(rmContainer, schedulerNode,
               schedulerKey, resToIncrease);
       updateResReqs.put(schedulerKey, resMap);
-      appSchedulingInfo.addRequestToAppPlacement(false, updateResReqs);
+      appSchedulingInfo.updateResourceRequests(updateResReqs, false);
     }
     return true;
   }
@@ -290,7 +290,7 @@ public class ContainerUpdateContext {
           (rmContainer, node, schedulerKey,
           rmContainer.getContainer().getResource());
       reqsToUpdate.put(schedulerKey, resMap);
-      appSchedulingInfo.addRequestToAppPlacement(true, reqsToUpdate);
+      appSchedulingInfo.updateResourceRequests(reqsToUpdate, true);
       return UNDEFINED;
     }
     return retVal;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
index 3930a35..753c2b8 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
@@ -56,6 +56,7 @@ import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceInformation;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerError;
 import org.apache.hadoop.yarn.nodelabels.CommonNodeLabelsManager;
 import org.apache.hadoop.yarn.server.api.ContainerType;
@@ -231,7 +232,7 @@ public class SchedulerApplicationAttempt implements SchedulableEntity {
 
     this.appSchedulingInfo = new AppSchedulingInfo(applicationAttemptId, user,
         queue, abstractUsersManager, rmContext.getEpoch(), attemptResourceUsage,
-        applicationSchedulingEnvs);
+        applicationSchedulingEnvs, rmContext);
     ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
     readLock = lock.readLock();
     writeLock = lock.writeLock();
@@ -451,6 +452,23 @@ public class SchedulerApplicationAttempt implements SchedulableEntity {
       writeLock.unlock();
     }
   }
+
+  public boolean updateSchedulingRequests(
+      List<SchedulingRequest> requests) {
+    if (requests == null) {
+      return false;
+    }
+
+    try {
+      writeLock.lock();
+      if (!isStopped) {
+        return appSchedulingInfo.updateSchedulingRequests(requests, false);
+      }
+      return false;
+    } finally {
+      writeLock.unlock();
+    }
+  }
   
   public void recoverResourceRequestsForContainer(
       ContainerRequest containerRequest) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/YarnScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/YarnScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/YarnScheduler.java
index 93ca7c2..43d55c4 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/YarnScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/YarnScheduler.java
@@ -42,6 +42,7 @@ import org.apache.hadoop.yarn.api.records.QueueInfo;
 import org.apache.hadoop.yarn.api.records.QueueUserACLInfo;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.event.EventHandler;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainer;
 import org.apache.hadoop.yarn.exceptions.YarnException;
@@ -132,18 +133,18 @@ public interface YarnScheduler extends EventHandler<SchedulerEvent> {
    * 
    * @param appAttemptId
    * @param ask
+   * @param schedulingRequests
    * @param release
-   * @param blacklistAdditions 
-   * @param blacklistRemovals 
-   * @param updateRequests
-   * @return the {@link Allocation} for the application
+   * @param blacklistAdditions
+   * @param blacklistRemovals
+   * @param updateRequests     @return the {@link Allocation} for the application
    */
   @Public
   @Stable
   Allocation allocate(ApplicationAttemptId appAttemptId,
-      List<ResourceRequest> ask, List<ContainerId> release,
-      List<String> blacklistAdditions, List<String> blacklistRemovals,
-      ContainerUpdates updateRequests);
+      List<ResourceRequest> ask, List<SchedulingRequest> schedulingRequests,
+      List<ContainerId> release, List<String> blacklistAdditions,
+      List<String> blacklistRemovals, ContainerUpdates updateRequests);
 
   /**
    * Get node resource usage report.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
index d2713c8..c713036 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
@@ -60,8 +60,11 @@ import org.apache.hadoop.yarn.api.records.ReservationId;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceOption;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.apache.hadoop.yarn.exceptions.InvalidResourceRequestException;
+import org.apache.hadoop.yarn.exceptions.SchedulerInvalidResoureRequestException;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
 import org.apache.hadoop.yarn.proto.YarnServiceProtos.SchedulerResourceTypes;
@@ -1058,12 +1061,29 @@ public class CapacityScheduler extends
     }
   }
 
+  /**
+   * Normalize a list of SchedulingRequest
+   *
+   * @param asks scheduling request
+   */
+  private void normalizeSchedulingRequests(List<SchedulingRequest> asks) {
+    if (asks == null) {
+      return;
+    }
+    for (SchedulingRequest ask: asks) {
+      ResourceSizing sizing = ask.getResourceSizing();
+      if (sizing != null && sizing.getResources() != null) {
+        sizing.setResources(getNormalizedResource(sizing.getResources()));
+      }
+    }
+  }
+
   @Override
   @Lock(Lock.NoLock.class)
   public Allocation allocate(ApplicationAttemptId applicationAttemptId,
-      List<ResourceRequest> ask, List<ContainerId> release,
-      List<String> blacklistAdditions, List<String> blacklistRemovals,
-      ContainerUpdates updateRequests) {
+      List<ResourceRequest> ask, List<SchedulingRequest> schedulingRequests,
+      List<ContainerId> release, List<String> blacklistAdditions,
+      List<String> blacklistRemovals, ContainerUpdates updateRequests) {
     FiCaSchedulerApp application = getApplicationAttempt(applicationAttemptId);
     if (application == null) {
       LOG.error("Calling allocate on removed or non existent application " +
@@ -1071,6 +1091,18 @@ public class CapacityScheduler extends
       return EMPTY_ALLOCATION;
     }
 
+    if ((!getConfiguration().getBoolean(
+        CapacitySchedulerConfiguration.SCHEDULING_REQUEST_ALLOWED,
+        CapacitySchedulerConfiguration.DEFAULT_SCHEDULING_REQUEST_ALLOWED))
+        && schedulingRequests != null && (!schedulingRequests.isEmpty())) {
+      throw new SchedulerInvalidResoureRequestException(
+          "Application attempt:" + applicationAttemptId
+              + " is using SchedulingRequest, which is disabled. Please update "
+              + CapacitySchedulerConfiguration.SCHEDULING_REQUEST_ALLOWED
+              + " to true in capacity-scheduler.xml in order to use this "
+              + "feature.");
+    }
+
     // The allocate may be the leftover from previous attempt, and it will
     // impact current attempt, such as confuse the request and allocation for
     // current attempt's AM container.
@@ -1091,7 +1123,10 @@ public class CapacityScheduler extends
     LeafQueue updateDemandForQueue = null;
 
     // Sanity check for new allocation requests
-    normalizeRequests(ask);
+    normalizeResourceRequests(ask);
+
+    // Normalize scheduling requests
+    normalizeSchedulingRequests(schedulingRequests);
 
     Allocation allocation;
 
@@ -1104,7 +1139,8 @@ public class CapacityScheduler extends
       }
 
       // Process resource requests
-      if (!ask.isEmpty()) {
+      if (!ask.isEmpty() || (schedulingRequests != null && !schedulingRequests
+          .isEmpty())) {
         if (LOG.isDebugEnabled()) {
           LOG.debug(
               "allocate: pre-update " + applicationAttemptId + " ask size ="
@@ -1113,7 +1149,8 @@ public class CapacityScheduler extends
         }
 
         // Update application requests
-        if (application.updateResourceRequests(ask)) {
+        if (application.updateResourceRequests(ask) || application
+            .updateSchedulingRequests(schedulingRequests)) {
           updateDemandForQueue = (LeafQueue) application.getQueue();
         }
 
@@ -2580,10 +2617,9 @@ public class CapacityScheduler extends
         // Validate placement constraint is satisfied before
         // committing the request.
         try {
-          if (!PlacementConstraintsUtil.canSatisfyConstraints(
+          if (!PlacementConstraintsUtil.canSatisfySingleConstraint(
               appAttempt.getApplicationId(),
-              schedulingRequest.getAllocationTags(),
-              schedulerNode,
+              schedulingRequest.getAllocationTags(), schedulerNode,
               rmContext.getPlacementConstraintManager(),
               rmContext.getAllocationTagsManager())) {
             LOG.debug("Failed to allocate container for application "

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerConfiguration.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerConfiguration.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerConfiguration.java
index e609be9..00733a1 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerConfiguration.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerConfiguration.java
@@ -77,6 +77,11 @@ public class CapacitySchedulerConfiguration extends ReservationSchedulerConfigur
   
   @Private
   public static final String PREFIX = "yarn.scheduler.capacity.";
+
+  @Private
+  public static final String SCHEDULING_REQUEST_ALLOWED =
+      PREFIX + "scheduling-request.allowed";
+  public static final boolean DEFAULT_SCHEDULING_REQUEST_ALLOWED = false;
   
   @Private
   public static final String DOT = ".";

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/allocator/RegularContainerAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/allocator/RegularContainerAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/allocator/RegularContainerAllocator.java
index 2642532..afa468b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/allocator/RegularContainerAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/allocator/RegularContainerAllocator.java
@@ -143,8 +143,7 @@ public class RegularContainerAllocator extends AbstractContainerAllocator {
 
     // Is the nodePartition of pending request matches the node's partition
     // If not match, jump to next priority.
-    if (!appInfo.acceptNodePartition(schedulerKey, node.getPartition(),
-        schedulingMode)) {
+    if (!appInfo.precheckNode(schedulerKey, node, schedulingMode)) {
       ActivitiesLogger.APP.recordSkippedAppActivityWithoutAllocation(
           activitiesManager, node, application, priority,
           ActivityDiagnosticConstant.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ContainerRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ContainerRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ContainerRequest.java
index 075db79..cad15a0 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ContainerRequest.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ContainerRequest.java
@@ -19,6 +19,7 @@
 package org.apache.hadoop.yarn.server.resourcemanager.scheduler.common;
 
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 
 import java.util.List;
 
@@ -43,12 +44,23 @@ import java.util.List;
  */
 public class ContainerRequest {
   private List<ResourceRequest> requests;
+  private SchedulingRequest schedulingRequest;
 
   public ContainerRequest(List<ResourceRequest> requests) {
     this.requests = requests;
+    schedulingRequest = null;
+  }
+
+  public ContainerRequest(SchedulingRequest schedulingRequest) {
+    this.schedulingRequest = schedulingRequest;
+    this.requests = null;
   }
 
   public List<ResourceRequest> getResourceRequests() {
     return requests;
   }
+
+  public SchedulingRequest getSchedulingRequest() {
+    return schedulingRequest;
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/PendingAsk.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/PendingAsk.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/PendingAsk.java
index 85d8715..2ed3e83 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/PendingAsk.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/PendingAsk.java
@@ -19,6 +19,7 @@
 package org.apache.hadoop.yarn.server.resourcemanager.scheduler.common;
 
 import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.util.resource.Resources;
 
 /**
@@ -31,6 +32,11 @@ public class PendingAsk {
   private final int count;
   public final static PendingAsk ZERO = new PendingAsk(Resources.none(), 0);
 
+  public PendingAsk(ResourceSizing sizing) {
+    this.perAllocationResource = sizing.getResources();
+    this.count = sizing.getNumAllocations();
+  }
+
   public PendingAsk(Resource res, int num) {
     this.perAllocationResource = res;
     this.count = num;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
index 4ea0347..7eb1e31 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
@@ -542,6 +542,12 @@ public class FiCaSchedulerApp extends SchedulerApplicationAttempt {
                 schedulerContainer.getRmContainer().getContainer());
             ((RMContainerImpl) rmContainer).setContainerRequest(
                 containerRequest);
+
+            // If this is from a SchedulingRequest, set allocation tags.
+            if (containerRequest.getSchedulingRequest() != null) {
+              ((RMContainerImpl) rmContainer).setAllocationTags(
+                  containerRequest.getSchedulingRequest().getAllocationTags());
+            }
           }
 
           attemptResourceUsage.incUsed(schedulerContainer.getNodePartition(),

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
index 4bb3e79..962e548 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
@@ -29,6 +29,7 @@ import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.log4j.Logger;
 
@@ -287,21 +288,15 @@ public class AllocationTagsManager {
    *                       {@link SchedulingRequest#getAllocationTags()}
    *                       application_id will be added to allocationTags.
    */
+  @SuppressWarnings("unchecked")
   public void addContainer(NodeId nodeId, ContainerId containerId,
       Set<String> allocationTags) {
+    // Do nothing for empty allocation tags.
+    if (allocationTags == null || allocationTags.isEmpty()) {
+      return;
+    }
     ApplicationId applicationId =
         containerId.getApplicationAttemptId().getApplicationId();
-    String applicationIdTag =
-        AllocationTagsNamespaces.APP_ID + applicationId.toString();
-
-    boolean useSet = false;
-    if (allocationTags != null && !allocationTags.isEmpty()) {
-      // Copy before edit it.
-      allocationTags = new HashSet<>(allocationTags);
-      allocationTags.add(applicationIdTag);
-      useSet = true;
-    }
-
     writeLock.lock();
     try {
       TypeToCountedTags perAppTagsMapping = perAppNodeMappings
@@ -311,19 +306,12 @@ public class AllocationTagsManager {
       // Covering test-cases where context is mocked
       String nodeRack = (rmContext.getRMNodes() != null
           && rmContext.getRMNodes().get(nodeId) != null)
-              ? rmContext.getRMNodes().get(nodeId).getRackName()
-              : "default-rack";
-      if (useSet) {
-        perAppTagsMapping.addTags(nodeId, allocationTags);
-        perAppRackTagsMapping.addTags(nodeRack, allocationTags);
-        globalNodeMapping.addTags(nodeId, allocationTags);
-        globalRackMapping.addTags(nodeRack, allocationTags);
-      } else {
-        perAppTagsMapping.addTag(nodeId, applicationIdTag);
-        perAppRackTagsMapping.addTag(nodeRack, applicationIdTag);
-        globalNodeMapping.addTag(nodeId, applicationIdTag);
-        globalRackMapping.addTag(nodeRack, applicationIdTag);
-      }
+              ? rmContext.getRMNodes().get(nodeId).getRackName() :
+          "default-rack";
+      perAppTagsMapping.addTags(nodeId, allocationTags);
+      perAppRackTagsMapping.addTags(nodeRack, allocationTags);
+      globalNodeMapping.addTags(nodeId, allocationTags);
+      globalRackMapping.addTags(nodeRack, allocationTags);
 
       if (LOG.isDebugEnabled()) {
         LOG.debug("Added container=" + containerId + " with tags=["
@@ -341,20 +329,15 @@ public class AllocationTagsManager {
    * @param containerId    containerId.
    * @param allocationTags allocation tags for given container
    */
+  @SuppressWarnings("unchecked")
   public void removeContainer(NodeId nodeId,
       ContainerId containerId, Set<String> allocationTags) {
+    // Do nothing for empty allocation tags.
+    if (allocationTags == null || allocationTags.isEmpty()) {
+      return;
+    }
     ApplicationId applicationId =
         containerId.getApplicationAttemptId().getApplicationId();
-    String applicationIdTag =
-        AllocationTagsNamespaces.APP_ID + applicationId.toString();
-    boolean useSet = false;
-
-    if (allocationTags != null && !allocationTags.isEmpty()) {
-      // Copy before edit it.
-      allocationTags = new HashSet<>(allocationTags);
-      allocationTags.add(applicationIdTag);
-      useSet = true;
-    }
 
     writeLock.lock();
     try {
@@ -368,19 +351,12 @@ public class AllocationTagsManager {
       // Covering test-cases where context is mocked
       String nodeRack = (rmContext.getRMNodes() != null
           && rmContext.getRMNodes().get(nodeId) != null)
-              ? rmContext.getRMNodes().get(nodeId).getRackName()
-              : "default-rack";
-      if (useSet) {
-        perAppTagsMapping.removeTags(nodeId, allocationTags);
-        perAppRackTagsMapping.removeTags(nodeRack, allocationTags);
-        globalNodeMapping.removeTags(nodeId, allocationTags);
-        globalRackMapping.removeTags(nodeRack, allocationTags);
-      } else {
-        perAppTagsMapping.removeTag(nodeId, applicationIdTag);
-        perAppRackTagsMapping.removeTag(nodeRack, applicationIdTag);
-        globalNodeMapping.removeTag(nodeId, applicationIdTag);
-        globalRackMapping.removeTag(nodeRack, applicationIdTag);
-      }
+              ? rmContext.getRMNodes().get(nodeId).getRackName() :
+          "default-rack";
+      perAppTagsMapping.removeTags(nodeId, allocationTags);
+      perAppRackTagsMapping.removeTags(nodeRack, allocationTags);
+      globalNodeMapping.removeTags(nodeId, allocationTags);
+      globalRackMapping.removeTags(nodeRack, allocationTags);
 
       if (perAppTagsMapping.isEmpty()) {
         perAppNodeMappings.remove(applicationId);
@@ -602,6 +578,7 @@ public class AllocationTagsManager {
    * @throws InvalidAllocationTagsQueryException when illegal query
    *                                            parameter specified
    */
+  @SuppressWarnings("unchecked")
   public long getRackCardinalityByOp(String rack, ApplicationId applicationId,
       Set<String> tags, LongBinaryOperator op)
       throws InvalidAllocationTagsQueryException {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsNamespaces.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsNamespaces.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsNamespaces.java
deleted file mode 100644
index 43fcfe5..0000000
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsNamespaces.java
+++ /dev/null
@@ -1,31 +0,0 @@
-/*
- * *
- *  Licensed to the Apache Software Foundation (ASF) under one
- *  or more contributor license agreements.  See the NOTICE file
- *  distributed with this work for additional information
- *  regarding copyright ownership.  The ASF licenses this file
- *  to you under the Apache License, Version 2.0 (the
- *  "License"); you may not use this file except in compliance
- *  with the License.  You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- *  Unless required by applicable law or agreed to in writing, software
- *  distributed under the License is distributed on an "AS IS" BASIS,
- *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- *  See the License for the specific language governing permissions and
- *  limitations under the License.
- * /
- */
-
-package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
-
-/**
- * Predefined namespaces for tags
- *
- * Same as namespace  of resource types. Namespaces of placement tags are start
- * with alphabets and ended with "/"
- */
-public class AllocationTagsNamespaces {
-  public static final String APP_ID = "yarn_app_id/";
-}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[40/50] [abbrv] hadoop git commit: YARN-7681. Double-check placement constraints in scheduling phase before actual allocation is made. (Weiwei Yang via asuresh)

Posted by as...@apache.org.
YARN-7681. Double-check placement constraints in scheduling phase before actual allocation is made. (Weiwei Yang via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/30b8d4fc
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/30b8d4fc
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/30b8d4fc

Branch: refs/heads/YARN-6592
Commit: 30b8d4fc57bf9d25ef9093bb6c7ef5b2868c3602
Parents: 5df2556
Author: Arun Suresh <as...@apache.org>
Authored: Wed Jan 10 09:04:30 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../scheduler/capacity/CapacityScheduler.java   | 23 ++++++++++++++++++++
 1 file changed, 23 insertions(+)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/30b8d4fc/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
index e682d0f..d2713c8 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
@@ -124,6 +124,8 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.ResourceCo
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.SchedulerContainer;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.fica.FiCaSchedulerApp;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.fica.FiCaSchedulerNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintsUtil;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAddedSchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptAddedSchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptRemovedSchedulerEvent;
@@ -2574,6 +2576,27 @@ public class CapacityScheduler extends
         ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode>
             resourceCommitRequest = createResourceCommitRequest(
             appAttempt, schedulingRequest, schedulerNode);
+
+        // Validate placement constraint is satisfied before
+        // committing the request.
+        try {
+          if (!PlacementConstraintsUtil.canSatisfyConstraints(
+              appAttempt.getApplicationId(),
+              schedulingRequest.getAllocationTags(),
+              schedulerNode,
+              rmContext.getPlacementConstraintManager(),
+              rmContext.getAllocationTagsManager())) {
+            LOG.debug("Failed to allocate container for application "
+                + appAttempt.getApplicationId() + " on node "
+                + schedulerNode.getNodeName()
+                + " because this allocation violates the"
+                + " placement constraint.");
+            return false;
+          }
+        } catch (InvalidAllocationTagsQueryException e) {
+          LOG.warn("Unable to allocate container", e);
+          return false;
+        }
         return tryCommit(getClusterResource(), resourceCommitRequest, false);
       }
     }


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[26/50] [abbrv] hadoop git commit: YARN-6619. AMRMClient Changes to use the PlacementConstraint and SchcedulingRequest objects. (Arun Suresh via wangda)

Posted by as...@apache.org.
YARN-6619. AMRMClient Changes to use the PlacementConstraint and SchcedulingRequest objects. (Arun Suresh via wangda)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/0098677e
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/0098677e
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/0098677e

Branch: refs/heads/YARN-6592
Commit: 0098677eb947a022ac9240bc5c1355fad8aa3d2c
Parents: 126eb8d
Author: Wangda Tan <wa...@apache.org>
Authored: Wed Jan 17 11:36:26 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../hadoop/yarn/client/api/AMRMClient.java      |  38 +++-
 .../yarn/client/api/async/AMRMClientAsync.java  |  48 +++++
 .../api/async/impl/AMRMClientAsyncImpl.java     |  49 ++++-
 .../yarn/client/api/impl/AMRMClientImpl.java    | 142 ++++++++++++-
 .../client/api/impl/BaseAMRMClientTest.java     | 212 +++++++++++++++++++
 .../yarn/client/api/impl/TestAMRMClient.java    | 156 +-------------
 .../TestAMRMClientPlacementConstraints.java     | 204 ++++++++++++++++++
 .../rmcontainer/RMContainerImpl.java            |   3 +
 .../scheduler/AbstractYarnScheduler.java        |   1 +
 .../scheduler/SchedulerApplicationAttempt.java  |   1 +
 .../constraint/PlacementConstraintsUtil.java    |   4 +-
 11 files changed, 700 insertions(+), 158 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/AMRMClient.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/AMRMClient.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/AMRMClient.java
index d3d1974..914a146 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/AMRMClient.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/AMRMClient.java
@@ -20,6 +20,8 @@ package org.apache.hadoop.yarn.client.api;
 
 import java.io.IOException;
 import java.util.Collection;
+import java.util.Map;
+import java.util.Set;
 import java.util.function.Supplier;
 import java.util.List;
 
@@ -39,7 +41,9 @@ import org.apache.hadoop.yarn.api.records.FinalApplicationStatus;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.ProfileCapability;
 import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.client.api.impl.AMRMClientImpl;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.util.resource.Resources;
@@ -554,6 +558,18 @@ public abstract class AMRMClient<T extends AMRMClient.ContainerRequest> extends
   }
 
   /**
+   * Add a Collection of SchedulingRequests. The AMRMClient will ensure that
+   * all requests in the same batch are sent in the same allocate call.
+   * @param schedulingRequests Collection of Scheduling Requests.
+   */
+  @Public
+  @InterfaceStability.Unstable
+  public void addSchedulingRequests(
+      Collection<SchedulingRequest> schedulingRequests) {
+
+  }
+
+  /**
    * Register the application master. This must be called before any 
    * other interaction
    * @param appHostName Name of the host on which master is running
@@ -568,7 +584,27 @@ public abstract class AMRMClient<T extends AMRMClient.ContainerRequest> extends
                                          int appHostPort,
                                          String appTrackingUrl) 
                throws YarnException, IOException;
-  
+
+  /**
+   * Register the application master. This must be called before any
+   * other interaction
+   * @param appHostName Name of the host on which master is running
+   * @param appHostPort Port master is listening on
+   * @param appTrackingUrl URL at which the master info can be seen
+   * @param placementConstraints Placement Constraints mappings.
+   * @return <code>RegisterApplicationMasterResponse</code>
+   * @throws YarnException
+   * @throws IOException
+   */
+  @Public
+  @InterfaceStability.Unstable
+  public RegisterApplicationMasterResponse registerApplicationMaster(
+      String appHostName, int appHostPort, String appTrackingUrl,
+      Map<Set<String>, PlacementConstraint> placementConstraints)
+      throws YarnException, IOException {
+    throw new YarnException("Not supported");
+  }
+
   /**
    * Request additional containers and receive new container allocations.
    * Requests made via <code>addContainerRequest</code> are sent to the

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/AMRMClientAsync.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/AMRMClientAsync.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/AMRMClientAsync.java
index 2b82ad6..0af687b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/AMRMClientAsync.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/AMRMClientAsync.java
@@ -21,6 +21,8 @@ package org.apache.hadoop.yarn.client.api.async;
 import java.io.IOException;
 import java.util.Collection;
 import java.util.List;
+import java.util.Map;
+import java.util.Set;
 import java.util.concurrent.atomic.AtomicInteger;
 import java.util.function.Supplier;
 
@@ -38,9 +40,12 @@ import org.apache.hadoop.yarn.api.records.ExecutionType;
 import org.apache.hadoop.yarn.api.records.FinalApplicationStatus;
 import org.apache.hadoop.yarn.api.records.NodeReport;
 import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
 import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.api.records.UpdatedContainer;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.client.api.AMRMClient;
 import org.apache.hadoop.yarn.client.api.AMRMClient.ContainerRequest;
 import org.apache.hadoop.yarn.client.api.TimelineV2Client;
@@ -206,6 +211,19 @@ extends AbstractService {
                                                    Resource capability);
 
   /**
+   * Add a Collection of SchedulingRequests. The AMRMClient will ensure that
+   * all requests in the same batch are sent in the same allocate call.
+   * @param schedulingRequests Collection of Scheduling Requests.
+   */
+  @Public
+  @Unstable
+  public void addSchedulingRequests(
+      Collection<SchedulingRequest> schedulingRequests) {
+
+  }
+
+
+  /**
    * Returns all matching ContainerRequests that match the given Priority,
    * ResourceName, ExecutionType and Capability.
    *
@@ -250,6 +268,26 @@ extends AbstractService {
       throws YarnException, IOException;
 
   /**
+   * Register the application master. This must be called before any
+   * other interaction
+   * @param appHostName Name of the host on which master is running
+   * @param appHostPort Port master is listening on
+   * @param appTrackingUrl URL at which the master info can be seen
+   * @param placementConstraints Placement Constraints mappings.
+   * @return <code>RegisterApplicationMasterResponse</code>
+   * @throws YarnException
+   * @throws IOException
+   */
+  @Public
+  @Unstable
+  public RegisterApplicationMasterResponse registerApplicationMaster(
+      String appHostName, int appHostPort, String appTrackingUrl,
+      Map<Set<String>, PlacementConstraint> placementConstraints)
+      throws YarnException, IOException {
+    throw new YarnException("Not supported");
+  }
+
+  /**
    * Unregister the application master. This must be called in the end.
    * @param appStatus Success/Failure status of the master
    * @param appMessage Diagnostics message on failure
@@ -494,6 +532,16 @@ extends AbstractService {
     public void onContainersReceivedFromPreviousAttempts(
         List<Container> containers) {
     }
+
+    /**
+     * Called when the RM has rejected Scheduling Requests.
+     * @param rejectedSchedulingRequests Rejected Scheduling Requests.
+     */
+    @Public
+    @Unstable
+    public void onRequestsRejected(
+        List<RejectedSchedulingRequest> rejectedSchedulingRequests) {
+    }
   }
 
   /**

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/impl/AMRMClientAsyncImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/impl/AMRMClientAsyncImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/impl/AMRMClientAsyncImpl.java
index 33b0aba..4f04b66 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/impl/AMRMClientAsyncImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/async/impl/AMRMClientAsyncImpl.java
@@ -22,6 +22,8 @@ import java.io.IOException;
 import java.util.ArrayList;
 import java.util.Collection;
 import java.util.List;
+import java.util.Map;
+import java.util.Set;
 import java.util.concurrent.BlockingQueue;
 import java.util.concurrent.LinkedBlockingQueue;
 
@@ -36,9 +38,12 @@ import org.apache.hadoop.yarn.api.records.ContainerStatus;
 import org.apache.hadoop.yarn.api.records.FinalApplicationStatus;
 import org.apache.hadoop.yarn.api.records.NodeReport;
 import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
 import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.api.records.UpdatedContainer;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.client.api.AMRMClient;
 import org.apache.hadoop.yarn.client.api.AMRMClient.ContainerRequest;
 import org.apache.hadoop.yarn.client.api.TimelineV2Client;
@@ -150,18 +155,50 @@ extends AMRMClientAsync<T> {
                                                    Resource capability) {
     return client.getMatchingRequests(priority, resourceName, capability);
   }
-  
+
+  @Override
+  public void addSchedulingRequests(
+      Collection<SchedulingRequest> schedulingRequests) {
+    client.addSchedulingRequests(schedulingRequests);
+  }
+
   /**
    * Registers this application master with the resource manager. On successful
    * registration, starts the heartbeating thread.
+   *
+   * @param appHostName Name of the host on which master is running
+   * @param appHostPort Port master is listening on
+   * @param appTrackingUrl URL at which the master info can be seen
+   * @return Register AM Response.
    * @throws YarnException
    * @throws IOException
    */
   public RegisterApplicationMasterResponse registerApplicationMaster(
       String appHostName, int appHostPort, String appTrackingUrl)
       throws YarnException, IOException {
+    return registerApplicationMaster(
+        appHostName, appHostPort, appTrackingUrl, null);
+  }
+
+  /**
+   * Registers this application master with the resource manager. On successful
+   * registration, starts the heartbeating thread.
+   *
+   * @param appHostName Name of the host on which master is running
+   * @param appHostPort Port master is listening on
+   * @param appTrackingUrl URL at which the master info can be seen
+   * @param placementConstraintsMap Placement Constraints Mapping.
+   * @return Register AM Response.
+   * @throws YarnException
+   * @throws IOException
+   */
+  public RegisterApplicationMasterResponse registerApplicationMaster(
+      String appHostName, int appHostPort, String appTrackingUrl,
+      Map<Set<String>, PlacementConstraint> placementConstraintsMap)
+      throws YarnException, IOException {
     RegisterApplicationMasterResponse response = client
-        .registerApplicationMaster(appHostName, appHostPort, appTrackingUrl);
+        .registerApplicationMaster(appHostName, appHostPort,
+            appTrackingUrl, placementConstraintsMap);
     heartbeatThread.start();
     return response;
   }
@@ -366,6 +403,14 @@ extends AMRMClientAsync<T> {
                       response.getContainersFromPreviousAttempts());
             }
           }
+          List<RejectedSchedulingRequest> rejectedSchedulingRequests =
+              response.getRejectedSchedulingRequests();
+          if (!rejectedSchedulingRequests.isEmpty()) {
+            if (handler instanceof AMRMClientAsync.AbstractCallbackHandler) {
+              ((AMRMClientAsync.AbstractCallbackHandler) handler)
+                  .onRequestsRejected(rejectedSchedulingRequests);
+            }
+          }
           progress = handler.getProgress();
         } catch (Throwable ex) {
           handler.onError(ex);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/impl/AMRMClientImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/impl/AMRMClientImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/impl/AMRMClientImpl.java
index 5507c07..8e2336f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/impl/AMRMClientImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/main/java/org/apache/hadoop/yarn/client/api/impl/AMRMClientImpl.java
@@ -30,9 +30,11 @@ import java.util.LinkedHashSet;
 import java.util.LinkedList;
 import java.util.List;
 import java.util.Map;
+import java.util.Queue;
 import java.util.Set;
 import java.util.TreeSet;
 import java.util.AbstractMap.SimpleEntry;
+import java.util.concurrent.ConcurrentHashMap;
 
 import org.apache.hadoop.classification.InterfaceAudience.Private;
 import org.apache.hadoop.classification.InterfaceStability.Unstable;
@@ -60,9 +62,11 @@ import org.apache.hadoop.yarn.api.records.ProfileCapability;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceBlacklistRequest;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.Token;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.api.records.UpdatedContainer;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.client.ClientRMProxy;
 import org.apache.hadoop.yarn.client.api.AMRMClient;
 import org.apache.hadoop.yarn.client.api.AMRMClient.ContainerRequest;
@@ -106,6 +110,12 @@ public class AMRMClientImpl<T extends ContainerRequest> extends AMRMClient<T> {
   protected final Set<String> blacklistedNodes = new HashSet<String>();
   protected final Set<String> blacklistAdditions = new HashSet<String>();
   protected final Set<String> blacklistRemovals = new HashSet<String>();
+  private Map<Set<String>, PlacementConstraint> placementConstraints =
+      new HashMap<>();
+  private Queue<Collection<SchedulingRequest>> batchedSchedulingRequests =
+      new LinkedList<>();
+  private Map<Set<String>, List<SchedulingRequest>> outstandingSchedRequests =
+      new ConcurrentHashMap<>();
 
   protected Map<String, Resource> resourceProfilesMap;
   
@@ -218,14 +228,26 @@ public class AMRMClientImpl<T extends ContainerRequest> extends AMRMClient<T> {
     }
     super.serviceStop();
   }
-  
+
   @Override
   public RegisterApplicationMasterResponse registerApplicationMaster(
       String appHostName, int appHostPort, String appTrackingUrl)
       throws YarnException, IOException {
+    return registerApplicationMaster(appHostName, appHostPort, appTrackingUrl,
+        null);
+  }
+
+  @Override
+  public RegisterApplicationMasterResponse registerApplicationMaster(
+      String appHostName, int appHostPort, String appTrackingUrl,
+      Map<Set<String>, PlacementConstraint> placementConstraintsMap)
+      throws YarnException, IOException {
     this.appHostName = appHostName;
     this.appHostPort = appHostPort;
     this.appTrackingUrl = appTrackingUrl;
+    if (placementConstraintsMap != null && !placementConstraintsMap.isEmpty()) {
+      this.placementConstraints.putAll(placementConstraintsMap);
+    }
     Preconditions.checkArgument(appHostName != null,
         "The host name should not be null");
     Preconditions.checkArgument(appHostPort >= -1, "Port number of the host"
@@ -240,6 +262,9 @@ public class AMRMClientImpl<T extends ContainerRequest> extends AMRMClient<T> {
     RegisterApplicationMasterRequest request =
         RegisterApplicationMasterRequest.newInstance(this.appHostName,
             this.appHostPort, this.appTrackingUrl);
+    if (!this.placementConstraints.isEmpty()) {
+      request.setPlacementConstraints(this.placementConstraints);
+    }
     RegisterApplicationMasterResponse response =
         rmClient.registerApplicationMaster(request);
     synchronized (this) {
@@ -248,11 +273,23 @@ public class AMRMClientImpl<T extends ContainerRequest> extends AMRMClient<T> {
         populateNMTokens(response.getNMTokensFromPreviousAttempts());
       }
       this.resourceProfilesMap = response.getResourceProfiles();
+      List<Container> prevContainers =
+          response.getContainersFromPreviousAttempts();
+      removeFromOutstandingSchedulingRequests(prevContainers);
+      recreateSchedulingRequestBatch();
     }
     return response;
   }
 
   @Override
+  public void addSchedulingRequests(
+      Collection<SchedulingRequest> schedulingRequests) {
+    synchronized (this.batchedSchedulingRequests) {
+      this.batchedSchedulingRequests.add(schedulingRequests);
+    }
+  }
+
+  @Override
   public AllocateResponse allocate(float progressIndicator) 
       throws YarnException, IOException {
     Preconditions.checkArgument(progressIndicator >= 0,
@@ -288,6 +325,7 @@ public class AMRMClientImpl<T extends ContainerRequest> extends AMRMClient<T> {
             .responseId(lastResponseId).progress(progressIndicator)
             .askList(askList).resourceBlacklistRequest(blacklistRequest)
             .releaseList(releaseList).updateRequests(updateList).build();
+        populateSchedulingRequests(allocateRequest);
         // clear blacklistAdditions and blacklistRemovals before
         // unsynchronized part
         blacklistAdditions.clear();
@@ -296,6 +334,10 @@ public class AMRMClientImpl<T extends ContainerRequest> extends AMRMClient<T> {
 
       try {
         allocateResponse = rmClient.allocate(allocateRequest);
+        removeFromOutstandingSchedulingRequests(
+            allocateResponse.getAllocatedContainers());
+        removeFromOutstandingSchedulingRequests(
+            allocateResponse.getContainersFromPreviousAttempts());
       } catch (ApplicationMasterNotRegisteredException e) {
         LOG.warn("ApplicationMaster is out of sync with ResourceManager,"
             + " hence resyncing.");
@@ -397,6 +439,104 @@ public class AMRMClientImpl<T extends ContainerRequest> extends AMRMClient<T> {
     return allocateResponse;
   }
 
+  private void populateSchedulingRequests(AllocateRequest allocateRequest) {
+    synchronized (this.batchedSchedulingRequests) {
+      if (!this.batchedSchedulingRequests.isEmpty()) {
+        List<SchedulingRequest> newReqs = new LinkedList<>();
+        Iterator<Collection<SchedulingRequest>> iter =
+            this.batchedSchedulingRequests.iterator();
+        while (iter.hasNext()) {
+          Collection<SchedulingRequest> requests = iter.next();
+          newReqs.addAll(requests);
+          addToOutstandingSchedulingRequests(requests);
+          iter.remove();
+        }
+        allocateRequest.setSchedulingRequests(newReqs);
+      }
+    }
+  }
+
+  private void recreateSchedulingRequestBatch() {
+    List<SchedulingRequest> batched = new ArrayList<>();
+    synchronized (this.outstandingSchedRequests) {
+      for (List<SchedulingRequest> schedReqs :
+          this.outstandingSchedRequests.values()) {
+        batched.addAll(schedReqs);
+      }
+    }
+    synchronized (this.batchedSchedulingRequests) {
+      this.batchedSchedulingRequests.add(batched);
+    }
+  }
+
+  private void addToOutstandingSchedulingRequests(
+      Collection<SchedulingRequest> requests) {
+    for (SchedulingRequest req : requests) {
+      List<SchedulingRequest> schedulingRequests =
+          this.outstandingSchedRequests.computeIfAbsent(
+              req.getAllocationTags(), x -> new LinkedList<>());
+      SchedulingRequest matchingReq = null;
+      synchronized (schedulingRequests) {
+        for (SchedulingRequest schedReq : schedulingRequests) {
+          if (isMatching(req, schedReq)) {
+            matchingReq = schedReq;
+            break;
+          }
+        }
+        if (matchingReq != null) {
+          matchingReq.getResourceSizing().setNumAllocations(
+              req.getResourceSizing().getNumAllocations());
+        } else {
+          schedulingRequests.add(req);
+        }
+      }
+    }
+  }
+
+  private boolean isMatching(SchedulingRequest schedReq1,
+      SchedulingRequest schedReq2) {
+    return schedReq1.getPriority().equals(schedReq2.getPriority()) &&
+        schedReq1.getExecutionType().getExecutionType().equals(
+            schedReq1.getExecutionType().getExecutionType()) &&
+        schedReq1.getAllocationRequestId() ==
+            schedReq2.getAllocationRequestId();
+  }
+
+  private void removeFromOutstandingSchedulingRequests(
+      Collection<Container> containers) {
+    if (containers == null || containers.isEmpty()) {
+      return;
+    }
+    for (Container container : containers) {
+      if (container.getAllocationTags() != null &&
+          !container.getAllocationTags().isEmpty()) {
+        List<SchedulingRequest> schedReqs =
+            this.outstandingSchedRequests.get(container.getAllocationTags());
+        if (schedReqs != null && !schedReqs.isEmpty()) {
+          synchronized (schedReqs) {
+            Iterator<SchedulingRequest> iter = schedReqs.iterator();
+            while (iter.hasNext()) {
+              SchedulingRequest schedReq = iter.next();
+              if (schedReq.getPriority().equals(container.getPriority()) &&
+                  schedReq.getAllocationRequestId() ==
+                      container.getAllocationRequestId()) {
+                int numAllocations =
+                    schedReq.getResourceSizing().getNumAllocations();
+                numAllocations--;
+                if (numAllocations == 0) {
+                  iter.remove();
+                } else {
+                  schedReq.getResourceSizing()
+                      .setNumAllocations(numAllocations);
+                }
+              }
+            }
+          }
+        }
+      }
+    }
+  }
+
   private List<UpdateContainerRequest> createUpdateList() {
     List<UpdateContainerRequest> updateList = new ArrayList<>();
     for (Map.Entry<ContainerId, SimpleEntry<Container,

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/BaseAMRMClientTest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/BaseAMRMClientTest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/BaseAMRMClientTest.java
new file mode 100644
index 0000000..d18652f
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/BaseAMRMClientTest.java
@@ -0,0 +1,212 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.client.api.impl;
+
+import org.apache.hadoop.conf.Configuration;
+import org.apache.hadoop.security.UserGroupInformation;
+import org.apache.hadoop.service.Service;
+import org.apache.hadoop.yarn.api.protocolrecords.SubmitApplicationRequest;
+import org.apache.hadoop.yarn.api.records.ApplicationAccessType;
+import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.ApplicationReport;
+import org.apache.hadoop.yarn.api.records.ApplicationSubmissionContext;
+import org.apache.hadoop.yarn.api.records.ContainerLaunchContext;
+import org.apache.hadoop.yarn.api.records.LocalResource;
+import org.apache.hadoop.yarn.api.records.NodeReport;
+import org.apache.hadoop.yarn.api.records.NodeState;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.YarnApplicationState;
+import org.apache.hadoop.yarn.client.ClientRMProxy;
+import org.apache.hadoop.yarn.client.api.YarnClient;
+import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.apache.hadoop.yarn.exceptions.YarnException;
+import org.apache.hadoop.yarn.server.MiniYARNCluster;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttempt;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptState;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacityScheduler;
+import org.apache.hadoop.yarn.server.utils.BuilderUtils;
+import org.apache.hadoop.yarn.util.Records;
+import org.junit.After;
+import org.junit.Before;
+
+import java.io.IOException;
+import java.nio.ByteBuffer;
+import java.util.Arrays;
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.List;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertTrue;
+
+/**
+ * Base class for testing AMRMClient.
+ */
+public class BaseAMRMClientTest {
+
+  protected Configuration conf = null;
+  protected MiniYARNCluster yarnCluster = null;
+  protected YarnClient yarnClient = null;
+  protected List<NodeReport> nodeReports = null;
+  protected ApplicationAttemptId attemptId = null;
+
+  protected String schedulerName = CapacityScheduler.class.getName();
+  protected boolean autoUpdate = false;
+
+  protected int nodeCount = 3;
+  protected long amExpireMs = 4000;
+  protected int rollingIntervalSec = 13;
+
+
+  protected Resource capability;
+  protected Priority priority;
+  protected Priority priority2;
+  protected String node;
+  protected String rack;
+  protected String[] nodes;
+  protected String[] racks;
+
+  @Before
+  public void setup() throws Exception {
+    conf = new YarnConfiguration();
+    createClusterAndStartApplication(conf);
+  }
+
+  protected void createClusterAndStartApplication(Configuration conf)
+      throws Exception {
+    // start minicluster
+    this.conf = conf;
+    if (autoUpdate) {
+      conf.setBoolean(YarnConfiguration.RM_AUTO_UPDATE_CONTAINERS, true);
+    }
+    conf.set(YarnConfiguration.RM_SCHEDULER, schedulerName);
+    conf.setLong(
+        YarnConfiguration.RM_AMRM_TOKEN_MASTER_KEY_ROLLING_INTERVAL_SECS,
+        rollingIntervalSec);
+    conf.setLong(YarnConfiguration.RM_AM_EXPIRY_INTERVAL_MS, amExpireMs);
+    conf.setInt(YarnConfiguration.RM_NM_HEARTBEAT_INTERVAL_MS, 100);
+    // set the minimum allocation so that resource decrease can go under 1024
+    conf.setInt(YarnConfiguration.RM_SCHEDULER_MINIMUM_ALLOCATION_MB, 512);
+    conf.setLong(YarnConfiguration.NM_LOG_RETAIN_SECONDS, 1);
+    conf.setBoolean(
+        YarnConfiguration.OPPORTUNISTIC_CONTAINER_ALLOCATION_ENABLED, true);
+    conf.setInt(
+        YarnConfiguration.NM_OPPORTUNISTIC_CONTAINERS_MAX_QUEUE_LENGTH, 10);
+    yarnCluster = new MiniYARNCluster(
+        TestAMRMClient.class.getName(), nodeCount, 1, 1);
+    yarnCluster.init(conf);
+    yarnCluster.start();
+
+    // start rm client
+    yarnClient = YarnClient.createYarnClient();
+    yarnClient.init(conf);
+    yarnClient.start();
+
+    // get node info
+    assertTrue("All node managers did not connect to the RM within the "
+            + "allotted 5-second timeout",
+        yarnCluster.waitForNodeManagersToConnect(5000L));
+    nodeReports = yarnClient.getNodeReports(NodeState.RUNNING);
+    assertEquals("Not all node managers were reported running",
+        nodeCount, nodeReports.size());
+
+    priority = Priority.newInstance(1);
+    priority2 = Priority.newInstance(2);
+    capability = Resource.newInstance(1024, 1);
+
+    node = nodeReports.get(0).getNodeId().getHost();
+    rack = nodeReports.get(0).getRackName();
+    nodes = new String[]{ node };
+    racks = new String[]{ rack };
+
+    // submit new app
+    ApplicationSubmissionContext appContext =
+        yarnClient.createApplication().getApplicationSubmissionContext();
+    ApplicationId appId = appContext.getApplicationId();
+    // set the application name
+    appContext.setApplicationName("Test");
+    // Set the priority for the application master
+    Priority pri = Records.newRecord(Priority.class);
+    pri.setPriority(0);
+    appContext.setPriority(pri);
+    // Set the queue to which this application is to be submitted in the RM
+    appContext.setQueue("default");
+    // Set up the container launch context for the application master
+    ContainerLaunchContext amContainer =
+        BuilderUtils.newContainerLaunchContext(
+            Collections.<String, LocalResource> emptyMap(),
+            new HashMap<String, String>(), Arrays.asList("sleep", "100"),
+            new HashMap<String, ByteBuffer>(), null,
+            new HashMap<ApplicationAccessType, String>());
+    appContext.setAMContainerSpec(amContainer);
+    appContext.setResource(Resource.newInstance(1024, 1));
+    // Create the request to send to the applications manager
+    SubmitApplicationRequest appRequest = Records
+        .newRecord(SubmitApplicationRequest.class);
+    appRequest.setApplicationSubmissionContext(appContext);
+    // Submit the application to the applications manager
+    yarnClient.submitApplication(appContext);
+
+    // wait for app to start
+    RMAppAttempt appAttempt = null;
+    while (true) {
+      ApplicationReport appReport = yarnClient.getApplicationReport(appId);
+      if (appReport.getYarnApplicationState() ==
+          YarnApplicationState.ACCEPTED) {
+        attemptId = appReport.getCurrentApplicationAttemptId();
+        appAttempt =
+            yarnCluster.getResourceManager().getRMContext().getRMApps()
+                .get(attemptId.getApplicationId()).getCurrentAppAttempt();
+        while (true) {
+          if (appAttempt.getAppAttemptState() == RMAppAttemptState.LAUNCHED) {
+            break;
+          }
+        }
+        break;
+      }
+    }
+    // Just dig into the ResourceManager and get the AMRMToken just for the sake
+    // of testing.
+    UserGroupInformation.setLoginUser(UserGroupInformation
+        .createRemoteUser(UserGroupInformation.getCurrentUser().getUserName()));
+
+    // emulate RM setup of AMRM token in credentials by adding the token
+    // *before* setting the token service
+    UserGroupInformation.getCurrentUser().addToken(appAttempt.getAMRMToken());
+    appAttempt.getAMRMToken().setService(
+        ClientRMProxy.getAMRMTokenService(conf));
+  }
+
+  @After
+  public void teardown() throws YarnException, IOException {
+    yarnClient.killApplication(attemptId.getApplicationId());
+    attemptId = null;
+
+    if (yarnClient != null &&
+        yarnClient.getServiceState() == Service.STATE.STARTED) {
+      yarnClient.stop();
+    }
+    if (yarnCluster != null &&
+        yarnCluster.getServiceState() == Service.STATE.STARTED) {
+      yarnCluster.stop();
+    }
+  }
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClient.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClient.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClient.java
index 3ecc5cd..b059118 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClient.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClient.java
@@ -43,7 +43,6 @@ import java.util.Map;
 import java.util.Set;
 import java.util.TreeSet;
 
-import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.fs.CommonConfigurationKeysPublic;
 import org.apache.hadoop.io.DataOutputBuffer;
 import org.apache.hadoop.io.Text;
@@ -56,24 +55,18 @@ import org.apache.hadoop.test.GenericTestUtils;
 import org.apache.hadoop.yarn.api.ApplicationMasterProtocol;
 import org.apache.hadoop.yarn.api.protocolrecords.AllocateRequest;
 import org.apache.hadoop.yarn.api.protocolrecords.AllocateResponse;
-import org.apache.hadoop.yarn.api.protocolrecords.SubmitApplicationRequest;
 import org.apache.hadoop.yarn.api.records.*;
-import org.apache.hadoop.yarn.client.ClientRMProxy;
 import org.apache.hadoop.yarn.client.api.AMRMClient;
 import org.apache.hadoop.yarn.client.api.AMRMClient.ContainerRequest;
 import org.apache.hadoop.yarn.client.api.InvalidContainerRequestException;
 import org.apache.hadoop.yarn.client.api.NMClient;
 import org.apache.hadoop.yarn.client.api.NMTokenCache;
-import org.apache.hadoop.yarn.client.api.YarnClient;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.ipc.YarnRPC;
 import org.apache.hadoop.yarn.security.AMRMTokenIdentifier;
-import org.apache.hadoop.yarn.server.MiniYARNCluster;
 import org.apache.hadoop.yarn.server.nodemanager.NodeManager;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
-import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttempt;
-import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptState;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacityScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.NodeUpdateSchedulerEvent;
@@ -81,10 +74,8 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.fair.FairSchedule
 import org.apache.hadoop.yarn.server.resourcemanager.security.AMRMTokenSecretManager;
 import org.apache.hadoop.yarn.server.utils.BuilderUtils;
 import org.apache.hadoop.yarn.util.Records;
-import org.junit.After;
 import org.junit.Assert;
 import org.junit.Assume;
-import org.junit.Before;
 import org.junit.Test;
 import org.junit.runner.RunWith;
 import org.junit.runners.Parameterized;
@@ -97,26 +88,8 @@ import org.eclipse.jetty.util.log.Log;
  * Test application master client class to resource manager.
  */
 @RunWith(value = Parameterized.class)
-public class TestAMRMClient {
-  private String schedulerName = null;
-  private boolean autoUpdate = false;
-  private Configuration conf = null;
-  private MiniYARNCluster yarnCluster = null;
-  private YarnClient yarnClient = null;
-  private List<NodeReport> nodeReports = null;
-  private ApplicationAttemptId attemptId = null;
-  private int nodeCount = 3;
-  
-  static final int rolling_interval_sec = 13;
-  static final long am_expire_ms = 4000;
-
-  private Resource capability;
-  private Priority priority;
-  private Priority priority2;
-  private String node;
-  private String rack;
-  private String[] nodes;
-  private String[] racks;
+public class TestAMRMClient extends BaseAMRMClientTest{
+
   private final static int DEFAULT_ITERATION = 3;
 
   public TestAMRMClient(String schedulerName, boolean autoUpdate) {
@@ -134,127 +107,6 @@ public class TestAMRMClient {
     });
   }
 
-  @Before
-  public void setup() throws Exception {
-    conf = new YarnConfiguration();
-    createClusterAndStartApplication(conf);
-  }
-
-  private void createClusterAndStartApplication(Configuration conf)
-      throws Exception {
-    // start minicluster
-    this.conf = conf;
-    if (autoUpdate) {
-      conf.setBoolean(YarnConfiguration.RM_AUTO_UPDATE_CONTAINERS, true);
-    }
-    conf.set(YarnConfiguration.RM_SCHEDULER, schedulerName);
-    conf.setLong(
-      YarnConfiguration.RM_AMRM_TOKEN_MASTER_KEY_ROLLING_INTERVAL_SECS,
-      rolling_interval_sec);
-    conf.setLong(YarnConfiguration.RM_AM_EXPIRY_INTERVAL_MS, am_expire_ms);
-    conf.setInt(YarnConfiguration.RM_NM_HEARTBEAT_INTERVAL_MS, 100);
-    // set the minimum allocation so that resource decrease can go under 1024
-    conf.setInt(YarnConfiguration.RM_SCHEDULER_MINIMUM_ALLOCATION_MB, 512);
-    conf.setLong(YarnConfiguration.NM_LOG_RETAIN_SECONDS, 1);
-    conf.setBoolean(
-        YarnConfiguration.OPPORTUNISTIC_CONTAINER_ALLOCATION_ENABLED, true);
-    conf.setInt(
-        YarnConfiguration.NM_OPPORTUNISTIC_CONTAINERS_MAX_QUEUE_LENGTH, 10);
-    yarnCluster = new MiniYARNCluster(TestAMRMClient.class.getName(), nodeCount, 1, 1);
-    yarnCluster.init(conf);
-    yarnCluster.start();
-
-    // start rm client
-    yarnClient = YarnClient.createYarnClient();
-    yarnClient.init(conf);
-    yarnClient.start();
-
-    // get node info
-    assertTrue("All node managers did not connect to the RM within the "
-        + "allotted 5-second timeout",
-        yarnCluster.waitForNodeManagersToConnect(5000L));
-    nodeReports = yarnClient.getNodeReports(NodeState.RUNNING);
-    assertEquals("Not all node managers were reported running",
-        nodeCount, nodeReports.size());
-
-    priority = Priority.newInstance(1);
-    priority2 = Priority.newInstance(2);
-    capability = Resource.newInstance(1024, 1);
-
-    node = nodeReports.get(0).getNodeId().getHost();
-    rack = nodeReports.get(0).getRackName();
-    nodes = new String[]{ node };
-    racks = new String[]{ rack };
-
-    // submit new app
-    ApplicationSubmissionContext appContext = 
-        yarnClient.createApplication().getApplicationSubmissionContext();
-    ApplicationId appId = appContext.getApplicationId();
-    // set the application name
-    appContext.setApplicationName("Test");
-    // Set the priority for the application master
-    Priority pri = Records.newRecord(Priority.class);
-    pri.setPriority(0);
-    appContext.setPriority(pri);
-    // Set the queue to which this application is to be submitted in the RM
-    appContext.setQueue("default");
-    // Set up the container launch context for the application master
-    ContainerLaunchContext amContainer =
-        BuilderUtils.newContainerLaunchContext(
-          Collections.<String, LocalResource> emptyMap(),
-          new HashMap<String, String>(), Arrays.asList("sleep", "100"),
-          new HashMap<String, ByteBuffer>(), null,
-          new HashMap<ApplicationAccessType, String>());
-    appContext.setAMContainerSpec(amContainer);
-    appContext.setResource(Resource.newInstance(1024, 1));
-    // Create the request to send to the applications manager
-    SubmitApplicationRequest appRequest = Records
-        .newRecord(SubmitApplicationRequest.class);
-    appRequest.setApplicationSubmissionContext(appContext);
-    // Submit the application to the applications manager
-    yarnClient.submitApplication(appContext);
-
-    // wait for app to start
-    RMAppAttempt appAttempt = null;
-    while (true) {
-      ApplicationReport appReport = yarnClient.getApplicationReport(appId);
-      if (appReport.getYarnApplicationState() == YarnApplicationState.ACCEPTED) {
-        attemptId = appReport.getCurrentApplicationAttemptId();
-        appAttempt =
-            yarnCluster.getResourceManager().getRMContext().getRMApps()
-              .get(attemptId.getApplicationId()).getCurrentAppAttempt();
-        while (true) {
-          if (appAttempt.getAppAttemptState() == RMAppAttemptState.LAUNCHED) {
-            break;
-          }
-        }
-        break;
-      }
-    }
-    // Just dig into the ResourceManager and get the AMRMToken just for the sake
-    // of testing.
-    UserGroupInformation.setLoginUser(UserGroupInformation
-      .createRemoteUser(UserGroupInformation.getCurrentUser().getUserName()));
-
-    // emulate RM setup of AMRM token in credentials by adding the token
-    // *before* setting the token service
-    UserGroupInformation.getCurrentUser().addToken(appAttempt.getAMRMToken());
-    appAttempt.getAMRMToken().setService(ClientRMProxy.getAMRMTokenService(conf));
-  }
-  
-  @After
-  public void teardown() throws YarnException, IOException {
-    yarnClient.killApplication(attemptId.getApplicationId());
-    attemptId = null;
-
-    if (yarnClient != null && yarnClient.getServiceState() == STATE.STARTED) {
-      yarnClient.stop();
-    }
-    if (yarnCluster != null && yarnCluster.getServiceState() == STATE.STARTED) {
-      yarnCluster.stop();
-    }
-  }
-
   @Test (timeout = 60000)
   public void testAMRMClientNoMatchingRequests()
       throws IOException, YarnException {
@@ -905,7 +757,7 @@ public class TestAMRMClient {
     initAMRMClientAndTest(false);
   }
 
-  private void initAMRMClientAndTest(boolean useAllocReqId)
+  protected void initAMRMClientAndTest(boolean useAllocReqId)
       throws YarnException, IOException {
     AMRMClient<ContainerRequest> amClient = null;
     try {
@@ -1946,7 +1798,7 @@ public class TestAMRMClient {
       // Wait for enough time and make sure the roll_over happens
       // At mean time, the old AMRMToken should continue to work
       while (System.currentTimeMillis() - startTime <
-          rolling_interval_sec * 1000) {
+          rollingIntervalSec * 1000) {
         amClient.allocate(0.1f);
         sleep(1000);
       }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientPlacementConstraints.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientPlacementConstraints.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientPlacementConstraints.java
new file mode 100644
index 0000000..fdc8d58
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-client/src/test/java/org/apache/hadoop/yarn/client/api/impl/TestAMRMClientPlacementConstraints.java
@@ -0,0 +1,204 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.client.api.impl;
+
+import org.apache.hadoop.yarn.api.records.Container;
+import org.apache.hadoop.yarn.api.records.ContainerStatus;
+import org.apache.hadoop.yarn.api.records.ExecutionType;
+import org.apache.hadoop.yarn.api.records.ExecutionTypeRequest;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.NodeReport;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.records.UpdatedContainer;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.client.api.AMRMClient;
+import org.apache.hadoop.yarn.client.api.NMTokenCache;
+import org.apache.hadoop.yarn.client.api.async.AMRMClientAsync;
+import org.apache.hadoop.yarn.client.api.async.impl.AMRMClientAsyncImpl;
+import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.junit.Assert;
+import org.junit.Test;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.List;
+import java.util.Map;
+import java.util.Set;
+import java.util.stream.Collectors;
+
+import static java.lang.Thread.sleep;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.allocationTag;
+
+/**
+ * Test Placement Constraints and Scheduling Requests.
+ */
+public class TestAMRMClientPlacementConstraints extends BaseAMRMClientTest {
+
+  @Test(timeout=60000)
+  public void testAMRMClientWithPlacementConstraints()
+      throws Exception {
+    // we have to create a new instance of MiniYARNCluster to avoid SASL qop
+    // mismatches between client and server
+    teardown();
+    conf = new YarnConfiguration();
+    conf.setBoolean(YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_ENABLED, true);
+    createClusterAndStartApplication(conf);
+
+    AMRMClient<AMRMClient.ContainerRequest> amClient =
+        AMRMClient.<AMRMClient.ContainerRequest>createAMRMClient();
+    amClient.setNMTokenCache(new NMTokenCache());
+    //asserting we are not using the singleton instance cache
+    Assert.assertNotSame(NMTokenCache.getSingleton(),
+        amClient.getNMTokenCache());
+
+    final List<Container> allocatedContainers = new ArrayList<>();
+    final List<RejectedSchedulingRequest> rejectedSchedulingRequests =
+        new ArrayList<>();
+    AMRMClientAsync asyncClient = new AMRMClientAsyncImpl<>(amClient, 1000,
+        new AMRMClientAsync.AbstractCallbackHandler() {
+          @Override
+          public void onContainersAllocated(List<Container> containers) {
+            allocatedContainers.addAll(containers);
+          }
+
+          @Override
+          public void onRequestsRejected(
+              List<RejectedSchedulingRequest> rejReqs) {
+            rejectedSchedulingRequests.addAll(rejReqs);
+          }
+
+          @Override
+          public void onContainersCompleted(List<ContainerStatus> statuses) {}
+          @Override
+          public void onContainersUpdated(List<UpdatedContainer> containers) {}
+          @Override
+          public void onShutdownRequest() {}
+          @Override
+          public void onNodesUpdated(List<NodeReport> updatedNodes) {}
+          @Override
+          public void onError(Throwable e) {}
+
+          @Override
+          public float getProgress() {
+            return 0.1f;
+          }
+        });
+
+    asyncClient.init(conf);
+    asyncClient.start();
+    Map<Set<String>, PlacementConstraint> pcMapping = new HashMap<>();
+    pcMapping.put(Collections.singleton("foo"),
+        PlacementConstraints.build(
+            PlacementConstraints.targetNotIn(NODE, allocationTag("foo"))));
+    pcMapping.put(Collections.singleton("bar"),
+        PlacementConstraints.build(
+            PlacementConstraints.targetNotIn(NODE, allocationTag("bar"))));
+    asyncClient.registerApplicationMaster("Host", 10000, "", pcMapping);
+
+    // Send two types of requests - 4 with source tag "foo" have numAlloc = 1
+    // and 1 with source tag "bar" and has numAlloc = 4. Both should be
+    // handled similarly. i.e: Since there are only 3 nodes,
+    // 2 schedulingRequests - 1 with source tag "foo" on one with source
+    // tag "bar" should get rejected.
+    asyncClient.addSchedulingRequests(
+        Arrays.asList(
+            // 4 reqs with numAlloc = 1
+            schedulingRequest(1, 1, 1, 1, 512, "foo"),
+            schedulingRequest(1, 1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 1, 3, 1, 512, "foo"),
+            schedulingRequest(1, 1, 4, 1, 512, "foo"),
+            // 1 req with numAlloc = 4
+            schedulingRequest(4, 1, 5, 1, 512, "bar")));
+
+    // kick the scheduler
+    waitForContainerAllocation(allocatedContainers,
+        rejectedSchedulingRequests, 6, 2);
+
+    Assert.assertEquals(6, allocatedContainers.size());
+    Map<NodeId, List<Container>> containersPerNode =
+        allocatedContainers.stream().collect(
+            Collectors.groupingBy(Container::getNodeId));
+
+    // Ensure 2 containers allocated per node.
+    // Each node should have a "foo" and a "bar" container.
+    Assert.assertEquals(3, containersPerNode.entrySet().size());
+    HashSet<String> srcTags = new HashSet<>(Arrays.asList("foo", "bar"));
+    containersPerNode.entrySet().forEach(
+        x ->
+          Assert.assertEquals(
+              srcTags,
+              x.getValue()
+                  .stream()
+                  .map(y -> y.getAllocationTags().iterator().next())
+                  .collect(Collectors.toSet()))
+    );
+
+    // Ensure 2 rejected requests - 1 of "foo" and 1 of "bar"
+    Assert.assertEquals(2, rejectedSchedulingRequests.size());
+    Assert.assertEquals(srcTags,
+        rejectedSchedulingRequests
+            .stream()
+            .map(x -> x.getRequest().getAllocationTags().iterator().next())
+            .collect(Collectors.toSet()));
+
+    asyncClient.stop();
+  }
+
+  private static void waitForContainerAllocation(
+      List<Container> allocatedContainers,
+      List<RejectedSchedulingRequest> rejectedRequests,
+      int containerNum, int rejNum) throws Exception {
+
+    int maxCount = 10;
+    while (maxCount >= 0 &&
+        (allocatedContainers.size() < containerNum ||
+            rejectedRequests.size() < rejNum)) {
+      maxCount--;
+      sleep(1000);
+    }
+  }
+
+  private static SchedulingRequest schedulingRequest(int numAllocations,
+      int priority, long allocReqId, int cores, int mem, String... tags) {
+    return schedulingRequest(numAllocations, priority, allocReqId, cores, mem,
+        ExecutionType.GUARANTEED, tags);
+  }
+
+  private static SchedulingRequest schedulingRequest(int numAllocations,
+      int priority, long allocReqId, int cores, int mem,
+      ExecutionType execType, String... tags) {
+    return SchedulingRequest.newBuilder()
+        .priority(Priority.newInstance(priority))
+        .allocationRequestId(allocReqId)
+        .allocationTags(new HashSet<>(Arrays.asList(tags)))
+        .executionType(ExecutionTypeRequest.newInstance(execType, true))
+        .resourceSizing(
+            ResourceSizing.newInstance(numAllocations,
+                Resource.newInstance(mem, cores)))
+        .build();
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
index 563df0d..a504221 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
@@ -262,6 +262,9 @@ public class RMContainerImpl implements RMContainer {
       rmContext.getSystemMetricsPublisher().containerCreated(
           this, this.creationTime);
     }
+    if (this.container != null) {
+      this.allocationTags = this.container.getAllocationTags();
+    }
   }
 
   @Override

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
index 213d784..72376df 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
@@ -589,6 +589,7 @@ public abstract class AbstractYarnScheduler
     container.setVersion(status.getVersion());
     container.setExecutionType(status.getExecutionType());
     container.setAllocationRequestId(status.getAllocationRequestId());
+    container.setAllocationTags(status.getAllocationTags());
     ApplicationAttemptId attemptId =
         container.getId().getApplicationAttemptId();
     RMContainer rmContainer = new RMContainerImpl(container,

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
index 88a9049..3930a35 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
@@ -672,6 +672,7 @@ public class SchedulerApplicationAttempt implements SchedulableEntity {
               containerType, container.getExecutionType(),
               container.getAllocationRequestId(),
               rmContainer.getAllocationTags()));
+      container.setAllocationTags(rmContainer.getAllocationTags());
       updateNMToken(container);
     } catch (IllegalArgumentException e) {
       // DNS might be down, skip returning this container.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0098677e/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
index 956a3c9..c4b82e8 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
@@ -64,12 +64,12 @@ public final class PlacementConstraintsUtil {
       throws InvalidAllocationTagsQueryException {
     long minScopeCardinality = 0;
     long maxScopeCardinality = 0;
-    if (sc.getScope() == PlacementConstraints.NODE) {
+    if (sc.getScope().equals(PlacementConstraints.NODE)) {
       minScopeCardinality = tm.getNodeCardinalityByOp(node.getNodeID(), appId,
           te.getTargetValues(), Long::max);
       maxScopeCardinality = tm.getNodeCardinalityByOp(node.getNodeID(), appId,
           te.getTargetValues(), Long::min);
-    } else if (sc.getScope() == PlacementConstraints.RACK) {
+    } else if (sc.getScope().equals(PlacementConstraints.RACK)) {
       minScopeCardinality = tm.getRackCardinalityByOp(node.getRackName(), appId,
           te.getTargetValues(), Long::max);
       maxScopeCardinality = tm.getRackCardinalityByOp(node.getRackName(), appId,


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[30/50] [abbrv] hadoop git commit: YARN-7709. Remove SELF from TargetExpression type. (Konstantinos Karanasos via asuresh)

Posted by as...@apache.org.
YARN-7709. Remove SELF from TargetExpression type. (Konstantinos Karanasos via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/3ece7a52
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/3ece7a52
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/3ece7a52

Branch: refs/heads/YARN-6592
Commit: 3ece7a52c199977ccdf1b1cda4b725bdd7328f61
Parents: 0098677
Author: Arun Suresh <as...@apache.org>
Authored: Thu Jan 18 04:29:57 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../yarn/api/resource/PlacementConstraint.java  | 32 ++++++++++++++----
 .../yarn/api/resource/PlacementConstraints.java | 35 +++++++++-----------
 .../api/resource/TestPlacementConstraints.java  |  3 +-
 .../PlacementConstraintTransformations.java     | 19 +++--------
 .../TestPlacementConstraintTransformations.java | 35 +++++---------------
 .../constraint/PlacementConstraintsUtil.java    | 10 ++++--
 6 files changed, 64 insertions(+), 70 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/3ece7a52/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
index b6e851a..4d998ac 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
@@ -242,7 +242,7 @@ public class PlacementConstraint {
      * Enum specifying the type of the target expression.
      */
     public enum TargetType {
-      NODE_ATTRIBUTE, ALLOCATION_TAG, SELF
+      NODE_ATTRIBUTE, ALLOCATION_TAG
     }
 
     private TargetType targetType;
@@ -418,23 +418,25 @@ public class PlacementConstraint {
   }
 
   /**
-   * Class that represents a cardinality constraint. Such a constraint the
-   * number of allocations within a given scope to some minimum and maximum
-   * values.
+   * Class that represents a cardinality constraint. Such a constraint allows
+   * the number of allocations with a specific set of tags and within a given
+   * scope to be between some minimum and maximum values.
    *
    * It is a specialized version of the {@link SingleConstraint}, where the
-   * target is self (i.e., the allocation to which the constraint is attached).
+   * target is a set of allocation tags.
    */
   public static class CardinalityConstraint extends AbstractConstraint {
     private String scope;
     private int minCardinality;
     private int maxCardinality;
+    private Set<String> allocationTags;
 
     public CardinalityConstraint(String scope, int minCardinality,
-        int maxCardinality) {
+        int maxCardinality, Set<String> allocationTags) {
       this.scope = scope;
       this.minCardinality = minCardinality;
       this.maxCardinality = maxCardinality;
+      this.allocationTags = allocationTags;
     }
 
     /**
@@ -464,11 +466,21 @@ public class PlacementConstraint {
       return maxCardinality;
     }
 
+    /**
+     * Get the allocation tags of the constraint.
+     *
+     * @return the allocation tags of the constraint
+     */
+    public Set<String> getAllocationTags() {
+      return allocationTags;
+    }
+
     @Override
     public <T> T accept(Visitor<T> visitor) {
       return visitor.visit(this);
     }
 
+
     @Override
     public boolean equals(Object o) {
       if (this == o) {
@@ -486,7 +498,11 @@ public class PlacementConstraint {
       if (maxCardinality != that.maxCardinality) {
         return false;
       }
-      return scope != null ? scope.equals(that.scope) : that.scope == null;
+      if (scope != null ? !scope.equals(that.scope) : that.scope != null) {
+        return false;
+      }
+      return allocationTags != null ? allocationTags.equals(that.allocationTags)
+          : that.allocationTags == null;
     }
 
     @Override
@@ -494,6 +510,8 @@ public class PlacementConstraint {
       int result = scope != null ? scope.hashCode() : 0;
       result = 31 * result + minCardinality;
       result = 31 * result + maxCardinality;
+      result = 31 * result
+          + (allocationTags != null ? allocationTags.hashCode() : 0);
       return result;
     }
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3ece7a52/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
index 8e84280..c8991cb 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
@@ -95,40 +95,45 @@ public final class PlacementConstraints {
    *          the scope
    * @param maxCardinality determines the maximum number of allocations within
    *          the scope
+   * @param allocationTags the constraint targets allocations with these tags
    * @return the resulting placement constraint
    */
   public static AbstractConstraint cardinality(String scope, int minCardinality,
-      int maxCardinality) {
+      int maxCardinality, String... allocationTags) {
     return new SingleConstraint(scope, minCardinality, maxCardinality,
-        PlacementTargets.self());
+        PlacementTargets.allocationTag(allocationTags));
   }
 
   /**
-   * Similar to {@link #cardinality(String, int, int)}, but determines only the
-   * minimum cardinality (the maximum cardinality is unbound).
+   * Similar to {@link #cardinality(String, int, int, String...)}, but
+   * determines only the minimum cardinality (the maximum cardinality is
+   * unbound).
    *
    * @param scope the scope of the constraint
    * @param minCardinality determines the minimum number of allocations within
    *          the scope
+   * @param allocationTags the constraint targets allocations with these tags
    * @return the resulting placement constraint
    */
   public static AbstractConstraint minCardinality(String scope,
-      int minCardinality) {
-    return cardinality(scope, minCardinality, Integer.MAX_VALUE);
+      int minCardinality, String... allocationTags) {
+    return cardinality(scope, minCardinality, Integer.MAX_VALUE,
+        allocationTags);
   }
 
   /**
-   * Similar to {@link #cardinality(String, int, int)}, but determines only the
-   * maximum cardinality (the minimum can be as low as 0).
+   * Similar to {@link #cardinality(String, int, int, String...)}, but
+   * determines only the maximum cardinality (the minimum can be as low as 0).
    *
    * @param scope the scope of the constraint
    * @param maxCardinality determines the maximum number of allocations within
    *          the scope
+   * @param allocationTags the constraint targets allocations with these tags
    * @return the resulting placement constraint
    */
   public static AbstractConstraint maxCardinality(String scope,
-      int maxCardinality) {
-    return cardinality(scope, 0, maxCardinality);
+      int maxCardinality, String... allocationTags) {
+    return cardinality(scope, 0, maxCardinality, allocationTags);
   }
 
   /**
@@ -193,16 +198,6 @@ public final class PlacementConstraints {
       return new TargetExpression(TargetType.ALLOCATION_TAG, null,
           allocationTags);
     }
-
-    /**
-     * The default target expression that uses as target the allocation that
-     * specifies the constraint.
-     *
-     * @return the self-target
-     */
-    public static TargetExpression self() {
-      return new TargetExpression(TargetType.SELF);
-    }
   }
 
   // Creation of compound constraints.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3ece7a52/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java
index e25d477..2f8cc62 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java
@@ -86,7 +86,8 @@ public class TestPlacementConstraints {
   @Test
   public void testAndConstraint() {
     AbstractConstraint constraintExpr =
-        and(targetIn(RACK, allocationTag("spark")), maxCardinality(NODE, 3),
+        and(targetIn(RACK, allocationTag("spark")),
+            maxCardinality(NODE, 3, "spark"),
             targetCardinality(RACK, 2, 10, allocationTag("zk")));
 
     And andExpr = (And) constraintExpr;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3ece7a52/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java
index e9eda6f..c5d21af 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java
@@ -162,15 +162,16 @@ public class PlacementConstraintTransformations {
     public AbstractConstraint visit(CardinalityConstraint constraint) {
       return new SingleConstraint(constraint.getScope(),
           constraint.getMinCardinality(), constraint.getMaxCardinality(),
-          new TargetExpression(TargetExpression.TargetType.SELF));
+          new TargetExpression(TargetExpression.TargetType.ALLOCATION_TAG, null,
+              constraint.getAllocationTags()));
     }
   }
 
   /**
    * Visits a {@link PlacementConstraint} tree and, whenever possible,
-   * substitutes each {@link SingleConstraint} with a {@link TargetConstraint}
-   * or a {@link CardinalityConstraint}. When such a substitution is not
-   * possible, we keep the original {@link SingleConstraint}.
+   * substitutes each {@link SingleConstraint} with a {@link TargetConstraint}.
+   * When such a substitution is not possible, we keep the original
+   * {@link SingleConstraint}.
    */
   public static class SpecializedConstraintTransformer
       extends AbstractTransformer {
@@ -182,16 +183,6 @@ public class PlacementConstraintTransformations {
     @Override
     public AbstractConstraint visit(SingleConstraint constraint) {
       AbstractConstraint transformedConstraint = constraint;
-      // Check if it is a cardinality constraint.
-      if (constraint.getTargetExpressions().size() == 1) {
-        TargetExpression targetExpr =
-            constraint.getTargetExpressions().iterator().next();
-        if (targetExpr.getTargetType() == TargetExpression.TargetType.SELF) {
-          transformedConstraint = new CardinalityConstraint(
-              constraint.getScope(), constraint.getMinCardinality(),
-              constraint.getMaxCardinality());
-        }
-      }
       // Check if it is a target constraint.
       if (constraint.getMinCardinality() == 1
           && constraint.getMaxCardinality() == Integer.MAX_VALUE) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3ece7a52/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java
index 1763735..62da092 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java
@@ -20,7 +20,6 @@ package org.apache.hadoop.yarn.api.resource;
 
 import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
 import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.RACK;
-import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.cardinality;
 import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.maxCardinality;
 import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.or;
 import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetCardinality;
@@ -89,42 +88,26 @@ public class TestPlacementConstraintTransformations {
 
   @Test
   public void testCardinalityConstraint() {
-    AbstractConstraint sConstraintExpr = cardinality(RACK, 3, 10);
-    Assert.assertTrue(sConstraintExpr instanceof SingleConstraint);
-    PlacementConstraint sConstraint =
-        PlacementConstraints.build(sConstraintExpr);
-
-    // Transform from SimpleConstraint to specialized CardinalityConstraint
-    SpecializedConstraintTransformer specTransformer =
-        new SpecializedConstraintTransformer(sConstraint);
-    PlacementConstraint cConstraint = specTransformer.transform();
-
-    AbstractConstraint cConstraintExpr = cConstraint.getConstraintExpr();
-    Assert.assertTrue(cConstraintExpr instanceof CardinalityConstraint);
-
-    SingleConstraint single = (SingleConstraint) sConstraintExpr;
-    CardinalityConstraint cardinality = (CardinalityConstraint) cConstraintExpr;
-    Assert.assertEquals(single.getScope(), cardinality.getScope());
-    Assert.assertEquals(single.getMinCardinality(),
-        cardinality.getMinCardinality());
-    Assert.assertEquals(single.getMaxCardinality(),
-        cardinality.getMaxCardinality());
+    CardinalityConstraint cardinality = new CardinalityConstraint(RACK, 3, 10,
+        new HashSet<>(Arrays.asList("hb")));
+    PlacementConstraint cConstraint = PlacementConstraints.build(cardinality);
 
     // Transform from specialized CardinalityConstraint to SimpleConstraint
     SingleConstraintTransformer singleTransformer =
         new SingleConstraintTransformer(cConstraint);
-    sConstraint = singleTransformer.transform();
+    PlacementConstraint sConstraint = singleTransformer.transform();
 
-    sConstraintExpr = sConstraint.getConstraintExpr();
+    AbstractConstraint sConstraintExpr = sConstraint.getConstraintExpr();
     Assert.assertTrue(sConstraintExpr instanceof SingleConstraint);
 
-    single = (SingleConstraint) sConstraintExpr;
+    SingleConstraint single = (SingleConstraint) sConstraintExpr;
     Assert.assertEquals(cardinality.getScope(), single.getScope());
     Assert.assertEquals(cardinality.getMinCardinality(),
         single.getMinCardinality());
     Assert.assertEquals(cardinality.getMaxCardinality(),
         single.getMaxCardinality());
-    Assert.assertEquals(new HashSet<>(Arrays.asList(PlacementTargets.self())),
+    Assert.assertEquals(
+        new HashSet<>(Arrays.asList(PlacementTargets.allocationTag("hb"))),
         single.getTargetExpressions());
   }
 
@@ -166,7 +149,7 @@ public class TestPlacementConstraintTransformations {
     List<AbstractConstraint> specChildren = specOrExpr.getChildren();
     Assert.assertEquals(3, specChildren.size());
     Assert.assertTrue(specChildren.get(0) instanceof TargetConstraint);
-    Assert.assertTrue(specChildren.get(1) instanceof CardinalityConstraint);
+    Assert.assertTrue(specChildren.get(1) instanceof SingleConstraint);
     Assert.assertTrue(specChildren.get(2) instanceof SingleConstraint);
 
     // Transform from specialized TargetConstraint to SimpleConstraint

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3ece7a52/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
index c4b82e8..73b4f9e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
@@ -24,10 +24,10 @@ import org.apache.hadoop.classification.InterfaceAudience.Public;
 import org.apache.hadoop.classification.InterfaceStability.Unstable;
 import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression.TargetType;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression.TargetType;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations.SingleConstraintTransformer;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
@@ -118,6 +118,12 @@ public final class PlacementConstraintsUtil {
       TargetExpression currentExp = expIt.next();
       // Supporting AllocationTag Expressions for now
       if (currentExp.getTargetType().equals(TargetType.ALLOCATION_TAG)) {
+        // If source and tag allocation tags are the same, we do not enforce
+        // constraints with minimum cardinality.
+        if (currentExp.getTargetValues().equals(allocationTags)
+            && single.getMinCardinality() > 0) {
+          return true;
+        }
         // Check if conditions are met
         if (!canSatisfySingleConstraintExpression(appId, single, currentExp,
             node, tagsManager)) {


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[13/50] [abbrv] hadoop git commit: MAPREDUCE-7036. ASF License warning in hadoop-mapreduce-client

Posted by as...@apache.org.
MAPREDUCE-7036. ASF License warning in hadoop-mapreduce-client

Signed-off-by: Akira Ajisaka <aa...@apache.org>


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/56feaa40
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/56feaa40
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/56feaa40

Branch: refs/heads/YARN-6592
Commit: 56feaa40bb94fcaa96ae668eebfabec4611928c0
Parents: e9c72d0
Author: Takanobu Asanuma <ta...@yahoo-corp.jp>
Authored: Tue Jan 30 00:36:33 2018 +0900
Committer: Akira Ajisaka <aa...@apache.org>
Committed: Tue Jan 30 00:39:39 2018 +0900

----------------------------------------------------------------------
 .../apache/hadoop/mapred/pipes/Application.java  |  5 +++--
 .../hadoop/mapred/pipes/TestPipeApplication.java | 19 +++++++++++--------
 2 files changed, 14 insertions(+), 10 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/56feaa40/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/pipes/Application.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/pipes/Application.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/pipes/Application.java
index 83d2509..5c8aab9 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/pipes/Application.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/pipes/Application.java
@@ -45,6 +45,7 @@ import org.apache.hadoop.mapred.RecordReader;
 import org.apache.hadoop.mapred.Reporter;
 import org.apache.hadoop.mapred.TaskAttemptID;
 import org.apache.hadoop.mapred.TaskLog;
+import org.apache.hadoop.mapreduce.MRConfig;
 import org.apache.hadoop.mapreduce.MRJobConfig;
 import org.apache.hadoop.mapreduce.filecache.DistributedCache;
 import org.apache.hadoop.mapreduce.security.SecureShuffleUtils;
@@ -103,8 +104,8 @@ class Application<K1 extends WritableComparable, V1 extends Writable,
     // This password is used as shared secret key between this application and
     // child pipes process
     byte[]  password = jobToken.getPassword();
-    String localPasswordFile = new File(".") + Path.SEPARATOR
-        + "jobTokenPassword";
+    String localPasswordFile = new File(conf.get(MRConfig.LOCAL_DIR))
+        + Path.SEPARATOR + "jobTokenPassword";
     writePasswordToLocalFile(localPasswordFile, password, conf);
     env.put("hadoop.pipes.shared.secret.location", localPasswordFile);
  

http://git-wip-us.apache.org/repos/asf/hadoop/blob/56feaa40/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/pipes/TestPipeApplication.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/pipes/TestPipeApplication.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/pipes/TestPipeApplication.java
index 88d8f95..13597e0 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/pipes/TestPipeApplication.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/pipes/TestPipeApplication.java
@@ -47,6 +47,7 @@ import org.apache.hadoop.io.NullWritable;
 import org.apache.hadoop.io.Writable;
 import org.apache.hadoop.io.WritableComparable;
 import org.apache.hadoop.mapred.IFile.Writer;
+import org.apache.hadoop.mapreduce.MRConfig;
 import org.apache.hadoop.mapreduce.MRJobConfig;
 import org.apache.hadoop.mapreduce.security.TokenCache;
 import org.apache.hadoop.mapred.Counters;
@@ -83,10 +84,10 @@ public class TestPipeApplication {
   public void testRunner() throws Exception {
 
     // clean old password files
-    File[] psw = cleanTokenPasswordFile();
+    JobConf conf = new JobConf();
+    File[] psw = cleanTokenPasswordFile(conf);
     try {
       RecordReader<FloatWritable, NullWritable> rReader = new ReaderPipesMapRunner();
-      JobConf conf = new JobConf();
       conf.set(Submitter.IS_JAVA_RR, "true");
       // for stdour and stderror
 
@@ -162,7 +163,7 @@ public class TestPipeApplication {
 
     TestTaskReporter reporter = new TestTaskReporter();
 
-    File[] psw = cleanTokenPasswordFile();
+    File[] psw = cleanTokenPasswordFile(conf);
     try {
 
       conf.set(MRJobConfig.TASK_ATTEMPT_ID, taskName);
@@ -247,7 +248,7 @@ public class TestPipeApplication {
 
     JobConf conf = new JobConf();
 
-    File[] psw = cleanTokenPasswordFile();
+    File[] psw = cleanTokenPasswordFile(conf);
 
     System.setProperty("test.build.data",
             "target/tmp/build/TEST_SUBMITTER_MAPPER/data");
@@ -388,8 +389,8 @@ public class TestPipeApplication {
   @Test
   public void testPipesReduser() throws Exception {
 
-    File[] psw = cleanTokenPasswordFile();
     JobConf conf = new JobConf();
+    File[] psw = cleanTokenPasswordFile(conf);
     try {
       Token<AMRMTokenIdentifier> token = new Token<AMRMTokenIdentifier>(
               "user".getBytes(), "password".getBytes(), new Text("kind"), new Text(
@@ -506,14 +507,16 @@ public class TestPipeApplication {
 
   }
 
-  private File[] cleanTokenPasswordFile() throws Exception {
+  private File[] cleanTokenPasswordFile(JobConf conf) throws Exception {
     File[] result = new File[2];
-    result[0] = new File("./jobTokenPassword");
+    result[0] = new File(conf.get(MRConfig.LOCAL_DIR) + Path.SEPARATOR
+        + "jobTokenPassword");
     if (result[0].exists()) {
       FileUtil.chmod(result[0].getAbsolutePath(), "700");
       assertTrue(result[0].delete());
     }
-    result[1] = new File("./.jobTokenPassword.crc");
+    result[1] = new File(conf.get(MRConfig.LOCAL_DIR) + Path.SEPARATOR
+        + ".jobTokenPassword.crc");
     if (result[1].exists()) {
       FileUtil.chmod(result[1].getAbsolutePath(), "700");
       result[1].delete();


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[06/50] [abbrv] hadoop git commit: MAPREDUCE-7020. Task timeout in uber mode can crash AM. Contributed by Peter Bacsko

Posted by as...@apache.org.
MAPREDUCE-7020. Task timeout in uber mode can crash AM. Contributed by Peter Bacsko


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/6eef3d7f
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/6eef3d7f
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/6eef3d7f

Branch: refs/heads/YARN-6592
Commit: 6eef3d7f1a1e5e3f27fb3bf7596663640d786181
Parents: e990904
Author: Jason Lowe <jl...@apache.org>
Authored: Fri Jan 26 15:31:43 2018 -0600
Committer: Jason Lowe <jl...@apache.org>
Committed: Fri Jan 26 15:31:43 2018 -0600

----------------------------------------------------------------------
 .../apache/hadoop/mapred/TaskAttemptListenerImpl.java |  8 +++++---
 .../hadoop/mapred/TestTaskAttemptListenerImpl.java    |  6 ++++--
 .../src/main/java/org/apache/hadoop/mapred/Task.java  | 14 +++++++++++---
 3 files changed, 20 insertions(+), 8 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/6eef3d7f/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java
index b155af22..668d8ed 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java
@@ -369,14 +369,16 @@ public class TaskAttemptListenerImpl extends CompositeService
     org.apache.hadoop.mapreduce.v2.api.records.TaskAttemptId yarnAttemptID =
         TypeConverter.toYarn(taskAttemptID);
 
+    AMFeedback feedback = new AMFeedback();
     AtomicReference<TaskAttemptStatus> lastStatusRef =
         attemptIdToStatus.get(yarnAttemptID);
     if (lastStatusRef == null) {
-      throw new IllegalStateException("Status update was called"
-          + " with illegal TaskAttemptId: " + yarnAttemptID);
+      LOG.error("Status update was called with illegal TaskAttemptId: "
+          + yarnAttemptID);
+      feedback.setTaskFound(false);
+      return feedback;
     }
 
-    AMFeedback feedback = new AMFeedback();
     feedback.setTaskFound(true);
 
     // Propagating preemption to the task if TASK_PREEMPTION is enabled

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6eef3d7f/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapred/TestTaskAttemptListenerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapred/TestTaskAttemptListenerImpl.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapred/TestTaskAttemptListenerImpl.java
index 4ff6fb2..da7421b 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapred/TestTaskAttemptListenerImpl.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapred/TestTaskAttemptListenerImpl.java
@@ -487,13 +487,15 @@ public class TestTaskAttemptListenerImpl {
     assertEquals(Phase.REDUCE, status.phase);
   }
 
-  @Test(expected = IllegalStateException.class)
+  @Test
   public void testStatusUpdateFromUnregisteredTask()
       throws IOException, InterruptedException{
     configureMocks();
     startListener(false);
 
-    listener.statusUpdate(attemptID, firstReduceStatus);
+    AMFeedback feedback = listener.statusUpdate(attemptID, firstReduceStatus);
+
+    assertFalse(feedback.getTaskFound());
   }
 
   private void configureMocks() {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6eef3d7f/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java
index 87c9e16..5b98b35 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java
@@ -855,6 +855,9 @@ abstract public class Task implements Writable, Configurable {
       long taskProgressInterval = MRJobConfUtil.
           getTaskProgressReportInterval(conf);
 
+      boolean uberized = conf.getBoolean("mapreduce.task.uberized",
+          false);
+
       while (!taskDone.get()) {
         synchronized (lock) {
           done = false;
@@ -893,9 +896,14 @@ abstract public class Task implements Writable, Configurable {
           // if Task Tracker is not aware of our task ID (probably because it died and 
           // came back up), kill ourselves
           if (!taskFound) {
-            LOG.warn("Parent died.  Exiting "+taskId);
-            resetDoneFlag();
-            System.exit(66);
+            if (uberized) {
+              taskDone.set(true);
+              break;
+            } else {
+              LOG.warn("Parent died.  Exiting "+taskId);
+              resetDoneFlag();
+              System.exit(66);
+            }
           }
 
           // Set a flag that says we should preempt this is read by


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[38/50] [abbrv] hadoop git commit: YARN-7613. Implement Basic algorithm for constraint based placement. (Panagiotis Garefalakis via asuresh)

Posted by as...@apache.org.
YARN-7613. Implement Basic algorithm for constraint based placement. (Panagiotis Garefalakis via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/13500943
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/13500943
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/13500943

Branch: refs/heads/YARN-6592
Commit: 135009436d3b4f8d4d8fd88f42beb5b162c502ce
Parents: f7d01a2
Author: Arun Suresh <as...@apache.org>
Authored: Wed Dec 27 22:59:22 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../hadoop/yarn/conf/YarnConfiguration.java     |   4 +
 .../src/main/resources/yarn-default.xml         |   8 +-
 .../rmcontainer/RMContainerImpl.java            |  10 +-
 .../constraint/AllocationTagsManager.java       | 121 ++++++++++---
 .../algorithm/DefaultPlacementAlgorithm.java    | 172 +++++++++++++++++++
 .../iterators/PopularTagsIterator.java          |  71 ++++++++
 .../algorithm/iterators/SerialIterator.java     |  53 ++++++
 .../algorithm/iterators/package-info.java       |  29 ++++
 .../constraint/algorithm/package-info.java      |  29 ++++
 .../constraint/processor/BatchedRequests.java   |  45 ++++-
 .../processor/PlacementProcessor.java           |  32 ++--
 .../processor/SamplePlacementAlgorithm.java     | 144 ----------------
 .../constraint/TestAllocationTagsManager.java   | 156 ++++++++++++-----
 .../TestBatchedRequestsIterators.java           |  82 +++++++++
 .../constraint/TestPlacementProcessor.java      |   4 +-
 15 files changed, 721 insertions(+), 239 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
index 8fb3c2e..367b1ae 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
@@ -536,6 +536,10 @@ public class YarnConfiguration extends Configuration {
   public static final String RM_PLACEMENT_CONSTRAINTS_ALGORITHM_CLASS =
       RM_PREFIX + "placement-constraints.algorithm.class";
 
+  /** Used for BasicPlacementAlgorithm - default SERIAL. **/
+  public static final String RM_PLACEMENT_CONSTRAINTS_ALGORITHM_ITERATOR =
+      RM_PREFIX + "placement-constraints.algorithm.iterator";
+
   public static final String RM_PLACEMENT_CONSTRAINTS_ENABLED =
       RM_PREFIX + "placement-constraints.enabled";
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
index 6d52ace..509a040 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
@@ -145,7 +145,13 @@
   <property>
     <description>Constraint Placement Algorithm to be used.</description>
     <name>yarn.resourcemanager.placement-constraints.algorithm.class</name>
-    <value>org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor.SamplePlacementAlgorithm</value>
+    <value>org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.DefaultPlacementAlgorithm</value>
+  </property>
+
+  <property>
+    <description>Placement Algorithm Requests Iterator to be used.</description>
+    <name>yarn.resourcemanager.placement-constraints.algorithm.iterator</name>
+    <value>SERIAL</value>
   </property>
 
   <property>

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
index c873509..2c4ef7b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
@@ -579,9 +579,8 @@ public class RMContainerImpl implements RMContainer {
     public void transition(RMContainerImpl container, RMContainerEvent event) {
       // Notify placementManager
       container.rmContext.getAllocationTagsManager().addContainer(
-          container.getNodeId(),
-          container.getApplicationAttemptId().getApplicationId(),
-          container.getContainerId(), container.getAllocationTags());
+          container.getNodeId(), container.getContainerId(),
+          container.getAllocationTags());
 
       container.eventHandler.handle(new RMAppAttemptEvent(
           container.appAttemptId, RMAppAttemptEventType.CONTAINER_ALLOCATED));
@@ -696,9 +695,8 @@ public class RMContainerImpl implements RMContainer {
     public void transition(RMContainerImpl container, RMContainerEvent event) {
       // Notify placementManager
       container.rmContext.getAllocationTagsManager().removeContainer(
-          container.getNodeId(),
-          container.getApplicationAttemptId().getApplicationId(),
-          container.getContainerId(), container.getAllocationTags());
+          container.getNodeId(), container.getContainerId(),
+          container.getAllocationTags());
 
       RMContainerFinishedEvent finishedEvent = (RMContainerFinishedEvent) event;
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
index 7b0b959..4bb3e79 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
@@ -24,6 +24,7 @@ import com.google.common.annotations.VisibleForTesting;
 import org.apache.commons.lang.StringUtils;
 import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
 import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.NodeId;
@@ -54,24 +55,27 @@ public class AllocationTagsManager {
   private final RMContext rmContext;
 
   // Application's tags to Node
-  private Map<ApplicationId, NodeToCountedTags> perAppNodeMappings =
+  private Map<ApplicationId, TypeToCountedTags> perAppNodeMappings =
       new HashMap<>();
   // Application's tags to Rack
-  private Map<ApplicationId, NodeToCountedTags> perAppRackMappings =
+  private Map<ApplicationId, TypeToCountedTags> perAppRackMappings =
       new HashMap<>();
+  // Application's Temporary containers mapping
+  private Map<ApplicationId, Map<NodeId, Map<ContainerId, Set<String>>>>
+      appTempMappings = new HashMap<>();
 
   // Global tags to node mapping (used to fast return aggregated tags
   // cardinality across apps)
-  private NodeToCountedTags<NodeId> globalNodeMapping = new NodeToCountedTags();
+  private TypeToCountedTags<NodeId> globalNodeMapping = new TypeToCountedTags();
   // Global tags to Rack mapping
-  private NodeToCountedTags<String> globalRackMapping = new NodeToCountedTags();
+  private TypeToCountedTags<String> globalRackMapping = new TypeToCountedTags();
 
   /**
    * Generic store mapping type <T> to counted tags.
    * Currently used both for NodeId to Tag, Count and Rack to Tag, Count
    */
   @VisibleForTesting
-  static class NodeToCountedTags<T> {
+  static class TypeToCountedTags<T> {
     // Map<Type, Map<Tag, Count>>
     private Map<T, Map<String, Long>> typeToTagsWithCount = new HashMap<>();
 
@@ -209,25 +213,31 @@ public class AllocationTagsManager {
   }
 
   @VisibleForTesting
-  Map<ApplicationId, NodeToCountedTags> getPerAppNodeMappings() {
+  Map<ApplicationId, TypeToCountedTags> getPerAppNodeMappings() {
     return perAppNodeMappings;
   }
 
   @VisibleForTesting
-  Map<ApplicationId, NodeToCountedTags> getPerAppRackMappings() {
+  Map<ApplicationId, TypeToCountedTags> getPerAppRackMappings() {
     return perAppRackMappings;
   }
 
   @VisibleForTesting
-  NodeToCountedTags getGlobalNodeMapping() {
+  TypeToCountedTags getGlobalNodeMapping() {
     return globalNodeMapping;
   }
 
   @VisibleForTesting
-  NodeToCountedTags getGlobalRackMapping() {
+  TypeToCountedTags getGlobalRackMapping() {
     return globalRackMapping;
   }
 
+  @VisibleForTesting
+  public Map<NodeId, Map<ContainerId, Set<String>>> getAppTempMappings(
+      ApplicationId applicationId) {
+    return appTempMappings.get(applicationId);
+  }
+
   public AllocationTagsManager(RMContext context) {
     ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
     readLock = lock.readLock();
@@ -235,18 +245,52 @@ public class AllocationTagsManager {
     rmContext = context;
   }
 
+  //
+
+  /**
+   * Method adds a temporary fake-container tag to Node mapping.
+   * Used by the constrained placement algorithm to keep track of containers
+   * that are currently placed on nodes but are not yet allocated.
+   * @param nodeId
+   * @param applicationId
+   * @param allocationTags
+   */
+  public void addTempContainer(NodeId nodeId, ApplicationId applicationId,
+      Set<String> allocationTags) {
+    ContainerId tmpContainer = ContainerId.newContainerId(
+        ApplicationAttemptId.newInstance(applicationId, 1), System.nanoTime());
+
+    writeLock.lock();
+    try {
+      Map<NodeId, Map<ContainerId, Set<String>>> appTempMapping =
+          appTempMappings.computeIfAbsent(applicationId, k -> new HashMap<>());
+      Map<ContainerId, Set<String>> containerTempMapping =
+          appTempMapping.computeIfAbsent(nodeId, k -> new HashMap<>());
+      containerTempMapping.put(tmpContainer, allocationTags);
+      if (LOG.isDebugEnabled()) {
+        LOG.debug("Added TEMP container=" + tmpContainer + " with tags=["
+            + StringUtils.join(allocationTags, ",") + "]");
+      }
+    } finally {
+      writeLock.unlock();
+    }
+
+    addContainer(nodeId, tmpContainer, allocationTags);
+  }
+
   /**
    * Notify container allocated on a node.
    *
    * @param nodeId         allocated node.
-   * @param applicationId  applicationId
    * @param containerId    container id.
    * @param allocationTags allocation tags, see
    *                       {@link SchedulingRequest#getAllocationTags()}
    *                       application_id will be added to allocationTags.
    */
-  public void addContainer(NodeId nodeId, ApplicationId applicationId,
-      ContainerId containerId, Set<String> allocationTags) {
+  public void addContainer(NodeId nodeId, ContainerId containerId,
+      Set<String> allocationTags) {
+    ApplicationId applicationId =
+        containerId.getApplicationAttemptId().getApplicationId();
     String applicationIdTag =
         AllocationTagsNamespaces.APP_ID + applicationId.toString();
 
@@ -260,10 +304,10 @@ public class AllocationTagsManager {
 
     writeLock.lock();
     try {
-      NodeToCountedTags perAppTagsMapping = perAppNodeMappings
-          .computeIfAbsent(applicationId, k -> new NodeToCountedTags());
-      NodeToCountedTags perAppRackTagsMapping = perAppRackMappings
-          .computeIfAbsent(applicationId, k -> new NodeToCountedTags());
+      TypeToCountedTags perAppTagsMapping = perAppNodeMappings
+          .computeIfAbsent(applicationId, k -> new TypeToCountedTags());
+      TypeToCountedTags perAppRackTagsMapping = perAppRackMappings
+          .computeIfAbsent(applicationId, k -> new TypeToCountedTags());
       // Covering test-cases where context is mocked
       String nodeRack = (rmContext.getRMNodes() != null
           && rmContext.getRMNodes().get(nodeId) != null)
@@ -294,12 +338,13 @@ public class AllocationTagsManager {
    * Notify container removed.
    *
    * @param nodeId         nodeId
-   * @param applicationId  applicationId
    * @param containerId    containerId.
    * @param allocationTags allocation tags for given container
    */
-  public void removeContainer(NodeId nodeId, ApplicationId applicationId,
+  public void removeContainer(NodeId nodeId,
       ContainerId containerId, Set<String> allocationTags) {
+    ApplicationId applicationId =
+        containerId.getApplicationAttemptId().getApplicationId();
     String applicationIdTag =
         AllocationTagsNamespaces.APP_ID + applicationId.toString();
     boolean useSet = false;
@@ -313,9 +358,9 @@ public class AllocationTagsManager {
 
     writeLock.lock();
     try {
-      NodeToCountedTags perAppTagsMapping =
+      TypeToCountedTags perAppTagsMapping =
           perAppNodeMappings.get(applicationId);
-      NodeToCountedTags perAppRackTagsMapping =
+      TypeToCountedTags perAppRackTagsMapping =
           perAppRackMappings.get(applicationId);
       if (perAppTagsMapping == null) {
         return;
@@ -354,6 +399,34 @@ public class AllocationTagsManager {
   }
 
   /**
+   * Method removes temporary containers associated with an application
+   * Used by the placement algorithm to clean temporary tags at the end of
+   * a placement cycle.
+   * @param applicationId Application Id.
+   */
+  public void cleanTempContainers(ApplicationId applicationId) {
+
+    if (!appTempMappings.get(applicationId).isEmpty()) {
+      appTempMappings.get(applicationId).entrySet().stream().forEach(nodeE -> {
+        nodeE.getValue().entrySet().stream().forEach(containerE -> {
+          removeContainer(nodeE.getKey(), containerE.getKey(),
+              containerE.getValue());
+        });
+      });
+      writeLock.lock();
+      try {
+        appTempMappings.remove(applicationId);
+        if (LOG.isDebugEnabled()) {
+          LOG.debug("Removed TEMP containers of app=" + applicationId);
+        }
+      } finally {
+        writeLock.unlock();
+      }
+    }
+  }
+
+
+  /**
    * Get Node cardinality for a specific tag.
    * When applicationId is null, method returns aggregated cardinality
    *
@@ -378,7 +451,7 @@ public class AllocationTagsManager {
             "Must specify nodeId/tag to query cardinality");
       }
 
-      NodeToCountedTags mapping;
+      TypeToCountedTags mapping;
       if (applicationId != null) {
         mapping = perAppNodeMappings.get(applicationId);
       } else {
@@ -419,7 +492,7 @@ public class AllocationTagsManager {
             "Must specify rack/tag to query cardinality");
       }
 
-      NodeToCountedTags mapping;
+      TypeToCountedTags mapping;
       if (applicationId != null) {
         mapping = perAppRackMappings.get(applicationId);
       } else {
@@ -492,7 +565,7 @@ public class AllocationTagsManager {
             "Must specify nodeId/tags/op to query cardinality");
       }
 
-      NodeToCountedTags mapping;
+      TypeToCountedTags mapping;
       if (applicationId != null) {
         mapping = perAppNodeMappings.get(applicationId);
       } else {
@@ -540,7 +613,7 @@ public class AllocationTagsManager {
             "Must specify rack/tags/op to query cardinality");
       }
 
-      NodeToCountedTags mapping;
+      TypeToCountedTags mapping;
       if (applicationId != null) {
         mapping = perAppRackMappings.get(applicationId);
       } else {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
new file mode 100644
index 0000000..395c156
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
@@ -0,0 +1,172 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm;
+
+import java.util.Iterator;
+import java.util.List;
+import java.util.Set;
+
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractYarnScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithm;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmInput;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutput;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutputCollector;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.PlacedSchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor.BatchedRequests;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor.NodeCandidateSelector;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+/**
+ * Basic placement algorithm.
+ * Supports different Iterators at SchedulingRequest level including:
+ * Serial, PopularTags
+ */
+public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
+
+  private static final Logger LOG =
+      LoggerFactory.getLogger(DefaultPlacementAlgorithm.class);
+
+  private AllocationTagsManager tagsManager;
+  private PlacementConstraintManager constraintManager;
+  private NodeCandidateSelector nodeSelector;
+
+  @Override
+  public void init(RMContext rmContext) {
+    this.tagsManager = rmContext.getAllocationTagsManager();
+    this.constraintManager = rmContext.getPlacementConstraintManager();
+    this.nodeSelector =
+        filter -> ((AbstractYarnScheduler) (rmContext).getScheduler())
+            .getNodes(filter);
+  }
+
+  /**
+   * TODO: Method will be moved to PlacementConstraintsUtil class (YARN-7682)
+   * @param applicationId
+   * @param allocationTags
+   * @param nodeId
+   * @param tagsManager
+   * @return boolean
+   * @throws InvalidAllocationTagsQueryException
+   */
+  public boolean canAssign(ApplicationId applicationId,
+      Set<String> allocationTags, NodeId nodeId,
+      AllocationTagsManager tagsManager)
+      throws InvalidAllocationTagsQueryException {
+    PlacementConstraint constraint =
+        constraintManager.getConstraint(applicationId, allocationTags);
+    if (constraint == null) {
+      return true;
+    }
+    // TODO: proper transformations
+    // Currently works only for simple anti-affinity
+    // NODE scope target expressions
+    PlacementConstraintTransformations.SpecializedConstraintTransformer transformer =
+        new PlacementConstraintTransformations.SpecializedConstraintTransformer(
+            constraint);
+    PlacementConstraint transform = transformer.transform();
+    PlacementConstraint.TargetConstraint targetConstraint =
+        (PlacementConstraint.TargetConstraint) transform.getConstraintExpr();
+    // Assume a single target expression tag;
+    // The Sample Algorithm assumes a constraint will always be a simple
+    // Target Constraint with a single entry in the target set.
+    // As mentioned in the class javadoc - This algorithm should be
+    // used mostly for testing and validating end-2-end workflow.
+    String targetTag = targetConstraint.getTargetExpressions().iterator().next()
+        .getTargetValues().iterator().next();
+    // TODO: Assuming anti-affinity constraint
+    long nodeCardinality =
+        tagsManager.getNodeCardinality(nodeId, applicationId, targetTag);
+    if (nodeCardinality != 0) {
+      return false;
+    }
+    // return true if it is a valid placement
+    return true;
+  }
+
+  public boolean attemptPlacementOnNode(ApplicationId appId,
+      SchedulingRequest schedulingRequest, SchedulerNode schedulerNode)
+      throws InvalidAllocationTagsQueryException {
+    int numAllocs = schedulingRequest.getResourceSizing().getNumAllocations();
+    if (numAllocs > 0) {
+      if (canAssign(appId,
+          schedulingRequest.getAllocationTags(), schedulerNode.getNodeID(),
+          tagsManager)) {
+        return true;
+      }
+    }
+    return false;
+  }
+
+
+  @Override
+  public void place(ConstraintPlacementAlgorithmInput input,
+      ConstraintPlacementAlgorithmOutputCollector collector) {
+    BatchedRequests requests = (BatchedRequests) input;
+    ConstraintPlacementAlgorithmOutput resp =
+        new ConstraintPlacementAlgorithmOutput(requests.getApplicationId());
+    List<SchedulerNode> allNodes = nodeSelector.selectNodes(null);
+
+    Iterator<SchedulingRequest> requestIterator = requests.iterator();
+    while (requestIterator.hasNext()) {
+      SchedulingRequest schedulingRequest = requestIterator.next();
+      Iterator<SchedulerNode> nodeIter = allNodes.iterator();
+      int numAllocs = schedulingRequest.getResourceSizing().getNumAllocations();
+      while (nodeIter.hasNext() && numAllocs > 0) {
+        SchedulerNode node = nodeIter.next();
+        try {
+          if (attemptPlacementOnNode(requests.getApplicationId(),
+              schedulingRequest, node)) {
+            schedulingRequest.getResourceSizing()
+                .setNumAllocations(--numAllocs);
+            PlacedSchedulingRequest placedReq =
+                new PlacedSchedulingRequest(schedulingRequest);
+            placedReq.setPlacementAttempt(requests.getPlacementAttempt());
+            placedReq.getNodes().add(node);
+            resp.getPlacedRequests().add(placedReq);
+            numAllocs =
+                schedulingRequest.getResourceSizing().getNumAllocations();
+            // Add temp-container tags for current placement cycle
+            this.tagsManager.addTempContainer(node.getNodeID(),
+                requests.getApplicationId(),
+                schedulingRequest.getAllocationTags());
+          }
+        } catch (InvalidAllocationTagsQueryException e) {
+          LOG.warn("Got exception from TagManager !", e);
+        }
+      }
+    }
+    // Add all requests whose numAllocations still > 0 to rejected list.
+    requests.getSchedulingRequests().stream()
+        .filter(sReq -> sReq.getResourceSizing().getNumAllocations() > 0)
+        .forEach(rejReq -> resp.getRejectedRequests().add(rejReq));
+    collector.collect(resp);
+    // Clean current temp-container tags
+    this.tagsManager.cleanTempContainers(requests.getApplicationId());
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/PopularTagsIterator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/PopularTagsIterator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/PopularTagsIterator.java
new file mode 100644
index 0000000..ca3e351
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/PopularTagsIterator.java
@@ -0,0 +1,71 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.iterators;
+
+import java.util.ArrayList;
+import java.util.Collection;
+import java.util.Collections;
+import java.util.Iterator;
+import java.util.List;
+import java.util.NoSuchElementException;
+
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+
+/**
+ * Traverse Scheduling requests with the most popular tags (count) first.
+ * Currently the count is per Batch but could use TagManager for global count.
+ */
+public class PopularTagsIterator implements Iterator<SchedulingRequest> {
+
+  private final List<SchedulingRequest> schedulingRequestList;
+  private int cursor;
+
+  public PopularTagsIterator(Collection<SchedulingRequest> schedulingRequests) {
+    this.schedulingRequestList = new ArrayList<>(schedulingRequests);
+    // Most popular First
+    Collections.sort(schedulingRequestList,
+        (o1, o2) -> (int) getTagPopularity(o2) - (int) getTagPopularity(o1));
+
+    this.cursor = 0;
+  }
+
+  private long getTagPopularity(SchedulingRequest o1) {
+    long max = 0;
+    for (String tag : o1.getAllocationTags()) {
+      long count = schedulingRequestList.stream()
+          .filter(req -> req.getAllocationTags().contains(tag)).count();
+      if (count > max) {
+        max = count;
+      }
+    }
+    return max;
+  }
+
+  @Override
+  public boolean hasNext() {
+    return (cursor < schedulingRequestList.size());
+  }
+
+  @Override
+  public SchedulingRequest next() {
+    if (hasNext()) {
+      return schedulingRequestList.get(cursor++);
+    }
+    throw new NoSuchElementException();
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/SerialIterator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/SerialIterator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/SerialIterator.java
new file mode 100644
index 0000000..68733a2
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/SerialIterator.java
@@ -0,0 +1,53 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.iterators;
+
+import java.util.ArrayList;
+import java.util.Collection;
+import java.util.Iterator;
+import java.util.List;
+import java.util.NoSuchElementException;
+
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+
+/**
+ * Traverse Scheduling Requests in the same order as they arrive
+ */
+public class SerialIterator implements Iterator<SchedulingRequest> {
+
+  private final List<SchedulingRequest> schedulingRequestList;
+  private int cursor;
+
+  public SerialIterator(Collection<SchedulingRequest> schedulingRequests) {
+    this.schedulingRequestList = new ArrayList<>(schedulingRequests);
+    this.cursor = 0;
+  }
+
+  @Override
+  public boolean hasNext() {
+    return (cursor < schedulingRequestList.size());
+  }
+
+  @Override
+  public SchedulingRequest next() {
+    if (hasNext()) {
+      return schedulingRequestList.get(cursor++);
+    }
+    throw new NoSuchElementException();
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/package-info.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/package-info.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/package-info.java
new file mode 100644
index 0000000..c84671e
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/iterators/package-info.java
@@ -0,0 +1,29 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * Package org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement
+ * contains classes related to scheduling containers using placement
+ * constraints.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.iterators;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/package-info.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/package-info.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/package-info.java
new file mode 100644
index 0000000..bb82077
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/package-info.java
@@ -0,0 +1,29 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * Package org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement
+ * contains classes related to scheduling containers using placement
+ * constraints.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
index fe92d2f..8b04860 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
@@ -21,12 +21,15 @@ import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.iterators.PopularTagsIterator;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.iterators.SerialIterator;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmInput;
 
 import java.util.Collection;
 import java.util.Collections;
 import java.util.HashMap;
 import java.util.HashSet;
+import java.util.Iterator;
 import java.util.Map;
 import java.util.Set;
 
@@ -35,7 +38,8 @@ import java.util.Set;
  * to place as a batch. The placement algorithm tends to give more optimal
  * placements if more requests are batched together.
  */
-class BatchedRequests implements ConstraintPlacementAlgorithmInput {
+public class BatchedRequests
+    implements ConstraintPlacementAlgorithmInput, Iterable<SchedulingRequest> {
 
   // PlacementAlgorithmOutput attempt - the number of times the requests in this
   // batch has been placed but was rejected by the scheduler.
@@ -44,19 +48,46 @@ class BatchedRequests implements ConstraintPlacementAlgorithmInput {
   private final ApplicationId applicationId;
   private final Collection<SchedulingRequest> requests;
   private final Map<String, Set<NodeId>> blacklist = new HashMap<>();
+  private IteratorType iteratorType;
 
-  BatchedRequests(ApplicationId applicationId,
+  /**
+   * Iterator Type.
+   */
+  public enum IteratorType {
+    SERIAL,
+    POPULAR_TAGS
+  }
+
+  public BatchedRequests(IteratorType type, ApplicationId applicationId,
       Collection<SchedulingRequest> requests, int attempt) {
+    this.iteratorType = type;
     this.applicationId = applicationId;
     this.requests = requests;
     this.placementAttempt = attempt;
   }
 
   /**
+   * Exposes SchedulingRequest Iterator interface which can be used
+   * to traverse requests using different heuristics i.e. Tag Popularity
+   * @return SchedulingRequest Iterator.
+   */
+  @Override
+  public Iterator<SchedulingRequest> iterator() {
+    switch (this.iteratorType) {
+    case SERIAL:
+      return new SerialIterator(requests);
+    case POPULAR_TAGS:
+      return new PopularTagsIterator(requests);
+    default:
+      return null;
+    }
+  }
+
+  /**
    * Get Application Id.
    * @return Application Id.
    */
-  ApplicationId getApplicationId() {
+  public ApplicationId getApplicationId() {
     return applicationId;
   }
 
@@ -73,11 +104,11 @@ class BatchedRequests implements ConstraintPlacementAlgorithmInput {
    * Add a Scheduling request to the batch.
    * @param req Scheduling Request.
    */
-  void addToBatch(SchedulingRequest req) {
+  public void addToBatch(SchedulingRequest req) {
     requests.add(req);
   }
 
-  void addToBlacklist(Set<String> tags, SchedulerNode node) {
+  public void addToBlacklist(Set<String> tags, SchedulerNode node) {
     if (tags != null && !tags.isEmpty()) {
       // We are currently assuming a single allocation tag
       // per scheduler request currently.
@@ -90,7 +121,7 @@ class BatchedRequests implements ConstraintPlacementAlgorithmInput {
    * Get placement attempt.
    * @return PlacementAlgorithmOutput placement Attempt.
    */
-  int getPlacementAttempt() {
+  public int getPlacementAttempt() {
     return placementAttempt;
   }
 
@@ -99,7 +130,7 @@ class BatchedRequests implements ConstraintPlacementAlgorithmInput {
    * @param tag Tag.
    * @return Set of blacklisted Nodes.
    */
-  Set<NodeId> getBlacklist(String tag) {
+  public Set<NodeId> getBlacklist(String tag) {
     return blacklist.getOrDefault(tag, Collections.EMPTY_SET);
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
index d613d4e..8e9c79c 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
@@ -35,8 +35,10 @@ import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.exceptions.YarnException;
+import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContextImpl;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.DefaultPlacementAlgorithm;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithm;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.PlacedSchedulingRequest;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.SchedulingResponse;
@@ -98,6 +100,7 @@ public class PlacementProcessor implements ApplicationMasterServiceProcessor {
   private Map<ApplicationId, List<SchedulingRequest>> requestsToReject =
       new ConcurrentHashMap<>();
 
+  private BatchedRequests.IteratorType iteratorType;
   private PlacementDispatcher placementDispatcher;
 
 
@@ -122,9 +125,20 @@ public class PlacementProcessor implements ApplicationMasterServiceProcessor {
     if (instances != null && !instances.isEmpty()) {
       algorithm = instances.get(0);
     } else {
-      algorithm = new SamplePlacementAlgorithm();
+      algorithm = new DefaultPlacementAlgorithm();
+    }
+    LOG.info("Placement Algorithm [{}]", algorithm.getClass().getName());
+
+    String iteratorName = ((RMContextImpl) amsContext).getYarnConfiguration()
+        .get(YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_ALGORITHM_ITERATOR,
+            BatchedRequests.IteratorType.SERIAL.name());
+    LOG.info("Placement Algorithm Iterator[{}]", iteratorName);
+    try {
+      iteratorType = BatchedRequests.IteratorType.valueOf(iteratorName);
+    } catch (IllegalArgumentException e) {
+      throw new YarnRuntimeException(
+          "Could not instantiate Placement Algorithm Iterator: ", e);
     }
-    LOG.info("Planning Algorithm [{}]", algorithm.getClass().getName());
 
     int algoPSize = ((RMContextImpl) amsContext).getYarnConfiguration().getInt(
         YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_ALGORITHM_POOL_SIZE,
@@ -188,9 +202,8 @@ public class PlacementProcessor implements ApplicationMasterServiceProcessor {
   private void dispatchRequestsForPlacement(ApplicationAttemptId appAttemptId,
       List<SchedulingRequest> schedulingRequests) {
     if (schedulingRequests != null && !schedulingRequests.isEmpty()) {
-      this.placementDispatcher.dispatch(
-          new BatchedRequests(appAttemptId.getApplicationId(),
-              schedulingRequests, 1));
+      this.placementDispatcher.dispatch(new BatchedRequests(iteratorType,
+          appAttemptId.getApplicationId(), schedulingRequests, 1));
     }
   }
 
@@ -329,11 +342,10 @@ public class PlacementProcessor implements ApplicationMasterServiceProcessor {
       }
     }
     if (!isAdded) {
-      BatchedRequests br =
-          new BatchedRequests(schedulerResponse.getApplicationId(),
-              Collections.singleton(
-                  schedulerResponse.getSchedulingRequest()),
-              placementAttempt + 1);
+      BatchedRequests br = new BatchedRequests(iteratorType,
+          schedulerResponse.getApplicationId(),
+          Collections.singleton(schedulerResponse.getSchedulingRequest()),
+          placementAttempt + 1);
       reqsToRetry.add(br);
       br.addToBlacklist(
           schedulerResponse.getSchedulingRequest().getAllocationTags(),

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/SamplePlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/SamplePlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/SamplePlacementAlgorithm.java
deleted file mode 100644
index 8d49801..0000000
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/SamplePlacementAlgorithm.java
+++ /dev/null
@@ -1,144 +0,0 @@
-/**
- * Licensed to the Apache Software Foundation (ASF) under one
- * or more contributor license agreements.  See the NOTICE file
- * distributed with this work for additional information
- * regarding copyright ownership.  The ASF licenses this file
- * to you under the Apache License, Version 2.0 (the
- * "License"); you may not use this file except in compliance
- * with the License.  You may obtain a copy of the License at
- * <p>
- * http://www.apache.org/licenses/LICENSE-2.0
- * <p>
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor;
-
-import org.apache.hadoop.yarn.api.records.SchedulingRequest;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetConstraint;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations.SpecializedConstraintTransformer;
-import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithm;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmInput;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutput;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutputCollector;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.PlacedSchedulingRequest;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractYarnScheduler;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
-import org.slf4j.Logger;
-import org.slf4j.LoggerFactory;
-
-import java.util.ArrayList;
-import java.util.Collections;
-import java.util.HashMap;
-import java.util.Iterator;
-import java.util.List;
-import java.util.Map;
-
-/**
- * Sample Test algorithm. Assumes anti-affinity always
- * It also assumes the numAllocations in resource sizing is always = 1
- *
- * NOTE: This is just a sample implementation. Not be actually used
- */
-public class SamplePlacementAlgorithm implements ConstraintPlacementAlgorithm {
-
-  private static final Logger LOG =
-      LoggerFactory.getLogger(SamplePlacementAlgorithm.class);
-
-  private AllocationTagsManager tagsManager;
-  private PlacementConstraintManager constraintManager;
-  private NodeCandidateSelector nodeSelector;
-
-  @Override
-  public void init(RMContext rmContext) {
-    this.tagsManager = rmContext.getAllocationTagsManager();
-    this.constraintManager = rmContext.getPlacementConstraintManager();
-    this.nodeSelector =
-        filter -> ((AbstractYarnScheduler)(rmContext)
-            .getScheduler()).getNodes(filter);
-  }
-
-  @Override
-  public void place(ConstraintPlacementAlgorithmInput input,
-      ConstraintPlacementAlgorithmOutputCollector collector) {
-    BatchedRequests requests = (BatchedRequests)input;
-    ConstraintPlacementAlgorithmOutput resp =
-        new ConstraintPlacementAlgorithmOutput(requests.getApplicationId());
-    List<SchedulerNode> allNodes = nodeSelector.selectNodes(null);
-    Map<String, List<SchedulingRequest>> tagIndexedRequests = new HashMap<>();
-    requests.getSchedulingRequests()
-        .stream()
-        .filter(r -> r.getAllocationTags() != null)
-        .forEach(
-            req -> req.getAllocationTags().forEach(
-                tag -> tagIndexedRequests.computeIfAbsent(tag,
-                    k -> new ArrayList<>()).add(req))
-        );
-    for (Map.Entry<String, List<SchedulingRequest>> entry :
-        tagIndexedRequests.entrySet()) {
-      String tag = entry.getKey();
-      PlacementConstraint constraint =
-          constraintManager.getConstraint(requests.getApplicationId(),
-              Collections.singleton(tag));
-      if (constraint != null) {
-        // Currently works only for simple anti-affinity
-        // NODE scope target expressions
-        SpecializedConstraintTransformer transformer =
-            new SpecializedConstraintTransformer(constraint);
-        PlacementConstraint transform = transformer.transform();
-        TargetConstraint targetConstraint =
-            (TargetConstraint) transform.getConstraintExpr();
-        // Assume a single target expression tag;
-        // The Sample Algorithm assumes a constraint will always be a simple
-        // Target Constraint with a single entry in the target set.
-        // As mentioned in the class javadoc - This algorithm should be
-        // used mostly for testing and validating end-2-end workflow.
-        String targetTag =
-            targetConstraint.getTargetExpressions().iterator().next()
-            .getTargetValues().iterator().next();
-        // iterate over all nodes
-        Iterator<SchedulerNode> nodeIter = allNodes.iterator();
-        List<SchedulingRequest> schedulingRequests = entry.getValue();
-        Iterator<SchedulingRequest> reqIter = schedulingRequests.iterator();
-        while (reqIter.hasNext()) {
-          SchedulingRequest sReq = reqIter.next();
-          int numAllocs = sReq.getResourceSizing().getNumAllocations();
-          while (numAllocs > 0 && nodeIter.hasNext()) {
-            SchedulerNode node = nodeIter.next();
-            long nodeCardinality = 0;
-            try {
-              nodeCardinality = tagsManager.getNodeCardinality(
-                  node.getNodeID(), requests.getApplicationId(),
-                  targetTag);
-              if (nodeCardinality == 0 &&
-                  !requests.getBlacklist(tag).contains(node.getNodeID())) {
-                numAllocs--;
-                sReq.getResourceSizing().setNumAllocations(numAllocs);
-                PlacedSchedulingRequest placedReq =
-                    new PlacedSchedulingRequest(sReq);
-                placedReq.setPlacementAttempt(requests.getPlacementAttempt());
-                placedReq.getNodes().add(node);
-                resp.getPlacedRequests().add(placedReq);
-              }
-            } catch (InvalidAllocationTagsQueryException e) {
-              LOG.warn("Got exception from TagManager !", e);
-            }
-          }
-        }
-      }
-    }
-    // Add all requests whose numAllocations still > 0 to rejected list.
-    requests.getSchedulingRequests().stream()
-        .filter(sReq -> sReq.getResourceSizing().getNumAllocations() > 0)
-        .forEach(rejReq -> resp.getRejectedRequests().add(rejReq));
-    collector.collect(resp);
-  }
-}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
index 0ce1614..f1d5663 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
@@ -75,24 +75,24 @@ public class TestAllocationTagsManager {
 
     // 3 Containers from app1
     atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        TestUtils.getMockContainerId(1, 3),
         ImmutableSet.of("service"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        TestUtils.getMockContainerId(1, 4),
         ImmutableSet.of("reducer"));
 
     // 1 Container from app2
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        TestUtils.getMockContainerId(2, 3),
         ImmutableSet.of("service"));
 
     // Get Node Cardinality of app1 on node1, with tag "mapper"
@@ -170,24 +170,21 @@ public class TestAllocationTagsManager {
 
     // Finish all containers:
     atm.removeContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.removeContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.removeContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(1, 3), ImmutableSet.of("service"));
 
     atm.removeContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
+        TestUtils.getMockContainerId(1, 4), ImmutableSet.of("reducer"));
 
     atm.removeContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(2, 3), ImmutableSet.of("service"));
 
     // Expect all cardinality to be 0
     // Get Cardinality of app1 on node1, with tag "mapper"
@@ -270,25 +267,22 @@ public class TestAllocationTagsManager {
 
     // 3 Containers from app1
     atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 2),
+        TestUtils.getMockContainerId(2, 2),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 4),
-        ImmutableSet.of("reducer"));
+        TestUtils.getMockContainerId(2, 4), ImmutableSet.of("reducer"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(1, 3), ImmutableSet.of("service"));
 
     // 1 Container from app2
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(2, 3), ImmutableSet.of("service"));
 
     // Get Rack Cardinality of app1 on rack0, with tag "mapper"
     Assert.assertEquals(1, atm.getRackCardinality("rack0",
@@ -325,45 +319,39 @@ public class TestAllocationTagsManager {
 
     // Add a bunch of containers
     atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(1, 3), ImmutableSet.of("service"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
+        TestUtils.getMockContainerId(1, 4), ImmutableSet.of("reducer"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(2, 3), ImmutableSet.of("service"));
 
     // Remove all these containers
     atm.removeContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.removeContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.removeContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(1, 3), ImmutableSet.of("service"));
 
     atm.removeContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
+        TestUtils.getMockContainerId(1, 4), ImmutableSet.of("reducer"));
 
     atm.removeContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(2, 3), ImmutableSet.of("service"));
 
     // Check internal data structure
     Assert.assertEquals(0,
@@ -375,6 +363,87 @@ public class TestAllocationTagsManager {
   }
 
   @Test
+  public void testTempContainerAllocations()
+      throws InvalidAllocationTagsQueryException {
+    /**
+     * Construct both TEMP and normal containers: Node1: TEMP container_1_1
+     * (mapper/reducer/app_1) container_1_2 (service/app_1)
+     *
+     * Node2: container_1_3 (reducer/app_1) TEMP container_2_1 (service/app_2)
+     */
+
+    AllocationTagsManager atm = new AllocationTagsManager(rmContext);
+
+    // 3 Containers from app1
+    atm.addTempContainer(NodeId.fromString("host1:123"),
+        TestUtils.getMockApplicationId(1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("host1:123"),
+        TestUtils.getMockContainerId(1, 2), ImmutableSet.of("service"));
+
+    atm.addContainer(NodeId.fromString("host2:123"),
+        TestUtils.getMockContainerId(1, 3), ImmutableSet.of("reducer"));
+
+    // 1 Container from app2
+    atm.addTempContainer(NodeId.fromString("host2:123"),
+        TestUtils.getMockApplicationId(2), ImmutableSet.of("service"));
+
+    // Expect tag mappings to be present including temp Tags
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::sum));
+
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("service"),
+            Long::sum));
+
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
+            Long::sum));
+
+    // Do a temp Tag cleanup on app2
+    atm.cleanTempContainers(TestUtils.getMockApplicationId(2));
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
+            Long::sum));
+    // Expect app1 to be unaffected
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::sum));
+    // Do a cleanup on app1 as well
+    atm.cleanTempContainers(TestUtils.getMockApplicationId(1));
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::sum));
+
+    // Non temp-tags should be unaffected
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("service"),
+            Long::sum));
+
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
+            Long::sum));
+
+    // Expect app2 with no containers, and app1 with 2 containers across 2 nodes
+    Assert.assertEquals(2,
+        atm.getPerAppNodeMappings().get(TestUtils.getMockApplicationId(1))
+            .getTypeToTagsWithCount().size());
+
+    Assert.assertNull(
+        atm.getPerAppNodeMappings().get(TestUtils.getMockApplicationId(2)));
+  }
+
+  @Test
   public void testQueryCardinalityWithIllegalParameters()
       throws InvalidAllocationTagsQueryException {
     /**
@@ -385,24 +454,21 @@ public class TestAllocationTagsManager {
 
     // Add a bunch of containers
     atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
     atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(1, 3), ImmutableSet.of("service"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
-        ImmutableSet.of("reducer"));
+        TestUtils.getMockContainerId(1, 4), ImmutableSet.of("reducer"));
 
     atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
-        ImmutableSet.of("service"));
+        TestUtils.getMockContainerId(2, 3), ImmutableSet.of("service"));
 
     // No node-id
     boolean caughtException = false;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestBatchedRequestsIterators.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestBatchedRequestsIterators.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestBatchedRequestsIterators.java
new file mode 100644
index 0000000..0e7b715
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestBatchedRequestsIterators.java
@@ -0,0 +1,82 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import static org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.TestPlacementProcessor.schedulingRequest;
+
+import java.util.Arrays;
+import java.util.Iterator;
+import java.util.List;
+
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor.BatchedRequests;
+import org.junit.Assert;
+import org.junit.Test;
+
+/**
+ * Test Request Iterator.
+ */
+public class TestBatchedRequestsIterators {
+
+  @Test
+  public void testSerialIterator() throws Exception {
+    List<SchedulingRequest> schedulingRequestList =
+        Arrays.asList(schedulingRequest(1, 1, 1, 512, "foo"),
+            schedulingRequest(1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            schedulingRequest(1, 4, 1, 512, "foo"));
+
+    BatchedRequests batchedRequests = new BatchedRequests(
+        BatchedRequests.IteratorType.SERIAL, null, schedulingRequestList, 1);
+
+    Iterator<SchedulingRequest> requestIterator = batchedRequests.iterator();
+    long prevAllocId = 0;
+    while (requestIterator.hasNext()) {
+      SchedulingRequest request = requestIterator.next();
+      Assert.assertTrue(request.getAllocationRequestId() > prevAllocId);
+      prevAllocId = request.getAllocationRequestId();
+    }
+  }
+
+  @Test
+  public void testPopularTagsIterator() throws Exception {
+    List<SchedulingRequest> schedulingRequestList =
+        Arrays.asList(schedulingRequest(1, 1, 1, 512, "pri", "foo"),
+            schedulingRequest(1, 2, 1, 512, "bar"),
+            schedulingRequest(1, 3, 1, 512, "foo", "pri"),
+            schedulingRequest(1, 4, 1, 512, "test"),
+            schedulingRequest(1, 5, 1, 512, "pri", "bar"));
+
+    BatchedRequests batchedRequests =
+        new BatchedRequests(BatchedRequests.IteratorType.POPULAR_TAGS, null,
+            schedulingRequestList, 1);
+
+    Iterator<SchedulingRequest> requestIterator = batchedRequests.iterator();
+    long recCcount = 0;
+    while (requestIterator.hasNext()) {
+      SchedulingRequest request = requestIterator.next();
+      if (recCcount < 3) {
+        Assert.assertTrue(request.getAllocationTags().contains("pri"));
+      } else {
+        Assert.assertTrue(request.getAllocationTags().contains("bar")
+            || request.getAllocationTags().contains("test"));
+      }
+      recCcount++;
+    }
+  }
+}
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/hadoop/blob/13500943/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
index db8ae15..87dd5b7 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
@@ -373,13 +373,13 @@ public class TestPlacementProcessor {
         rej.getReason());
   }
 
-  private static SchedulingRequest schedulingRequest(
+  protected static SchedulingRequest schedulingRequest(
       int priority, long allocReqId, int cores, int mem, String... tags) {
     return schedulingRequest(priority, allocReqId, cores, mem,
         ExecutionType.GUARANTEED, tags);
   }
 
-  private static SchedulingRequest schedulingRequest(
+  protected static SchedulingRequest schedulingRequest(
       int priority, long allocReqId, int cores, int mem,
       ExecutionType execType, String... tags) {
     return SchedulingRequest.newBuilder()


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[21/50] [abbrv] hadoop git commit: YARN-7696. Add container tags to ContainerTokenIdentifier, api.Container and NMContainerStatus to handle all recovery cases. (asuresh)

Posted by as...@apache.org.
YARN-7696. Add container tags to ContainerTokenIdentifier, api.Container and NMContainerStatus to handle all recovery cases. (asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/126eb8d7
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/126eb8d7
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/126eb8d7

Branch: refs/heads/YARN-6592
Commit: 126eb8d7abfb5b97a50fa9a1be3d0e630bc6259e
Parents: 30b8d4f
Author: Arun Suresh <as...@apache.org>
Authored: Fri Jan 12 14:37:06 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../hadoop/yarn/api/records/Container.java      | 15 +++++
 .../src/main/proto/yarn_protos.proto            |  1 +
 .../api/records/impl/pb/ContainerPBImpl.java    | 31 +++++++++
 .../yarn/security/ContainerTokenIdentifier.java | 69 +++++++++++++++++++-
 .../src/main/proto/yarn_security_token.proto    |  1 +
 .../api/protocolrecords/NMContainerStatus.java  | 14 ++++
 .../impl/pb/NMContainerStatusPBImpl.java        | 33 ++++++++++
 .../yarn_server_common_service_protos.proto     |  1 +
 .../containermanager/ContainerManagerImpl.java  |  3 +-
 .../container/ContainerImpl.java                | 19 +++---
 .../rmcontainer/RMContainerImpl.java            | 10 ++-
 .../scheduler/SchedulerApplicationAttempt.java  |  3 +-
 .../security/RMContainerTokenSecretManager.java | 21 ++----
 .../capacity/TestContainerAllocation.java       |  5 +-
 14 files changed, 194 insertions(+), 32 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/Container.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/Container.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/Container.java
index 4fdc803..b9ca3f9 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/Container.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/Container.java
@@ -27,6 +27,9 @@ import org.apache.hadoop.yarn.api.ApplicationMasterProtocol;
 import org.apache.hadoop.yarn.api.ContainerManagementProtocol;
 import org.apache.hadoop.yarn.util.Records;
 
+import java.util.Collections;
+import java.util.Set;
+
 /**
  * {@code Container} represents an allocated resource in the cluster.
  * <p>
@@ -256,4 +259,16 @@ public abstract class Container implements Comparable<Container> {
   public void setVersion(int version) {
     throw new UnsupportedOperationException();
   }
+
+  @Private
+  @Unstable
+  public Set<String> getAllocationTags() {
+    return Collections.EMPTY_SET;
+  }
+
+  @Private
+  @Unstable
+  public void setAllocationTags(Set<String> allocationTags) {
+
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
index 5cb1177..25c8569 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
@@ -152,6 +152,7 @@ message ContainerProto {
   optional ExecutionTypeProto execution_type = 7 [default = GUARANTEED];
   optional int64 allocation_request_id = 8 [default = -1];
   optional int32 version = 9 [default = 0];
+  repeated string allocation_tags = 10;
 }
 
 message ContainerReportProto {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ContainerPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ContainerPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ContainerPBImpl.java
index be84938..47be2f0 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ContainerPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ContainerPBImpl.java
@@ -36,6 +36,9 @@ import org.apache.hadoop.yarn.proto.YarnProtos.PriorityProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ExecutionTypeProto;
 
+import java.util.HashSet;
+import java.util.Set;
+
 @Private
 @Unstable
 public class ContainerPBImpl extends Container {
@@ -49,6 +52,7 @@ public class ContainerPBImpl extends Container {
   private Resource resource = null;
   private Priority priority = null;
   private Token containerToken = null;
+  private Set<String> allocationTags = null;
 
   public ContainerPBImpl() {
     builder = ContainerProto.newBuilder();
@@ -106,6 +110,10 @@ public class ContainerPBImpl extends Container {
             builder.getContainerToken())) {
       builder.setContainerToken(convertToProtoFormat(this.containerToken));
     }
+    if (this.allocationTags != null) {
+      builder.clearAllocationTags();
+      builder.addAllAllocationTags(this.allocationTags);
+    }
   }
 
   private void mergeLocalToProto() {
@@ -284,6 +292,29 @@ public class ContainerPBImpl extends Container {
     builder.setVersion(version);
   }
 
+  private void initAllocationTags() {
+    if (this.allocationTags != null) {
+      return;
+    }
+    ContainerProtoOrBuilder p = viaProto ? proto : builder;
+    this.allocationTags = new HashSet<>();
+    this.allocationTags.addAll(p.getAllocationTagsList());
+  }
+
+  @Override
+  public Set<String> getAllocationTags() {
+    initAllocationTags();
+    return this.allocationTags;
+  }
+
+  @Override
+  public void setAllocationTags(Set<String> allocationTags) {
+    maybeInitBuilder();
+    builder.clearAllocationTags();
+    this.allocationTags = allocationTags;
+  }
+
+
   private ContainerIdPBImpl convertFromProtoFormat(ContainerIdProto p) {
     return new ContainerIdPBImpl(p);
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/security/ContainerTokenIdentifier.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/security/ContainerTokenIdentifier.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/security/ContainerTokenIdentifier.java
index 9e7d132..70935cb 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/security/ContainerTokenIdentifier.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/security/ContainerTokenIdentifier.java
@@ -22,6 +22,9 @@ import java.io.DataInput;
 import java.io.DataInputStream;
 import java.io.DataOutput;
 import java.io.IOException;
+import java.util.Collections;
+import java.util.HashSet;
+import java.util.Set;
 
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
@@ -115,7 +118,7 @@ public class ContainerTokenIdentifier extends TokenIdentifier {
     this(containerID, 0, hostName, appSubmitter, r, expiryTimeStamp,
         masterKeyId, rmIdentifier, priority, creationTime,
         logAggregationContext, nodeLabelExpression, containerType,
-        ExecutionType.GUARANTEED, -1);
+        ExecutionType.GUARANTEED, -1, null);
   }
 
   public ContainerTokenIdentifier(ContainerId containerID, int containerVersion,
@@ -127,15 +130,66 @@ public class ContainerTokenIdentifier extends TokenIdentifier {
     this(containerID, containerVersion, hostName, appSubmitter, r,
         expiryTimeStamp, masterKeyId, rmIdentifier, priority, creationTime,
         logAggregationContext, nodeLabelExpression, containerType,
-        executionType, -1);
+        executionType, -1, null);
   }
 
+  /**
+   * Convenience Constructor for existing clients.
+   *
+   * @param containerID containerID
+   * @param containerVersion containerVersion
+   * @param hostName hostName
+   * @param appSubmitter appSubmitter
+   * @param r resource
+   * @param expiryTimeStamp expiryTimeStamp
+   * @param masterKeyId masterKeyId
+   * @param rmIdentifier rmIdentifier
+   * @param priority priority
+   * @param creationTime creationTime
+   * @param logAggregationContext logAggregationContext
+   * @param nodeLabelExpression nodeLabelExpression
+   * @param containerType containerType
+   * @param executionType executionType
+   * @param allocationRequestId allocationRequestId
+   */
   public ContainerTokenIdentifier(ContainerId containerID, int containerVersion,
       String hostName, String appSubmitter, Resource r, long expiryTimeStamp,
       int masterKeyId, long rmIdentifier, Priority priority, long creationTime,
       LogAggregationContext logAggregationContext, String nodeLabelExpression,
       ContainerType containerType, ExecutionType executionType,
       long allocationRequestId) {
+    this(containerID, containerVersion, hostName, appSubmitter, r,
+        expiryTimeStamp, masterKeyId, rmIdentifier, priority, creationTime,
+        logAggregationContext, nodeLabelExpression, containerType,
+        executionType, allocationRequestId, null);
+  }
+
+  /**
+   * Create a Container Token Identifier.
+   *
+   * @param containerID containerID
+   * @param containerVersion containerVersion
+   * @param hostName hostName
+   * @param appSubmitter appSubmitter
+   * @param r resource
+   * @param expiryTimeStamp expiryTimeStamp
+   * @param masterKeyId masterKeyId
+   * @param rmIdentifier rmIdentifier
+   * @param priority priority
+   * @param creationTime creationTime
+   * @param logAggregationContext logAggregationContext
+   * @param nodeLabelExpression nodeLabelExpression
+   * @param containerType containerType
+   * @param executionType executionType
+   * @param allocationRequestId allocationRequestId
+   * @param allocationTags Set of allocation Tags.
+   */
+  public ContainerTokenIdentifier(ContainerId containerID, int containerVersion,
+      String hostName, String appSubmitter, Resource r, long expiryTimeStamp,
+      int masterKeyId, long rmIdentifier, Priority priority, long creationTime,
+      LogAggregationContext logAggregationContext, String nodeLabelExpression,
+      ContainerType containerType, ExecutionType executionType,
+      long allocationRequestId, Set<String> allocationTags) {
     ContainerTokenIdentifierProto.Builder builder =
         ContainerTokenIdentifierProto.newBuilder();
     if (containerID != null) {
@@ -166,7 +220,9 @@ public class ContainerTokenIdentifier extends TokenIdentifier {
     builder.setContainerType(convertToProtoFormat(containerType));
     builder.setExecutionType(convertToProtoFormat(executionType));
     builder.setAllocationRequestId(allocationRequestId);
-
+    if (allocationTags != null) {
+      builder.addAllAllocationTags(allocationTags);
+    }
     proto = builder.build();
   }
 
@@ -308,6 +364,13 @@ public class ContainerTokenIdentifier extends TokenIdentifier {
     return CommonNodeLabelsManager.NO_LABEL;
   }
 
+  public Set<String> getAllcationTags() {
+    if (proto.getAllocationTagsList() != null) {
+      return new HashSet<>(proto.getAllocationTagsList());
+    }
+    return Collections.EMPTY_SET;
+  }
+
   // TODO: Needed?
   @InterfaceAudience.Private
   public static class Renewer extends Token.TrivialRenewer {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/proto/yarn_security_token.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/proto/yarn_security_token.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/proto/yarn_security_token.proto
index d8288ac..9aabd48 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/proto/yarn_security_token.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/proto/yarn_security_token.proto
@@ -54,6 +54,7 @@ message ContainerTokenIdentifierProto {
   optional ExecutionTypeProto executionType = 13 [default = GUARANTEED];
   optional int32 version = 14 [default = 0];
   optional int64 allocation_request_id = 15 [default = -1];
+  repeated string allocation_tags = 16;
 }
 
 message ClientToAMTokenIdentifierProto {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/NMContainerStatus.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/NMContainerStatus.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/NMContainerStatus.java
index 1a095f2..77b3df6 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/NMContainerStatus.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/NMContainerStatus.java
@@ -27,6 +27,9 @@ import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.nodelabels.CommonNodeLabelsManager;
 import org.apache.hadoop.yarn.util.Records;
 
+import java.util.Collections;
+import java.util.Set;
+
 /**
  * NMContainerStatus includes the current information of a container. This
  * record is used by YARN only, whereas {@link ContainerStatus} is used both
@@ -161,4 +164,15 @@ public abstract class NMContainerStatus {
   }
 
   public void setExecutionType(ExecutionType executionType) { }
+
+  /**
+   * Get and set the Allocation tags associated with the container.
+   */
+  public Set<String> getAllocationTags() {
+    return Collections.EMPTY_SET;
+  }
+
+  public void setAllocationTags(Set<String> allocationTags) {
+
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/impl/pb/NMContainerStatusPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/impl/pb/NMContainerStatusPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/impl/pb/NMContainerStatusPBImpl.java
index 8ed02fa..14f2241 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/impl/pb/NMContainerStatusPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/java/org/apache/hadoop/yarn/server/api/protocolrecords/impl/pb/NMContainerStatusPBImpl.java
@@ -37,6 +37,9 @@ import org.apache.hadoop.yarn.proto.YarnServerCommonServiceProtos.NMContainerSta
 import org.apache.hadoop.yarn.proto.YarnServerCommonServiceProtos.NMContainerStatusProtoOrBuilder;
 import org.apache.hadoop.yarn.server.api.protocolrecords.NMContainerStatus;
 
+import java.util.HashSet;
+import java.util.Set;
+
 public class NMContainerStatusPBImpl extends NMContainerStatus {
 
   NMContainerStatusProto proto = NMContainerStatusProto
@@ -47,6 +50,7 @@ public class NMContainerStatusPBImpl extends NMContainerStatus {
   private ContainerId containerId = null;
   private Resource resource = null;
   private Priority priority = null;
+  private Set<String> allocationTags = null;
 
   public NMContainerStatusPBImpl() {
     builder = NMContainerStatusProto.newBuilder();
@@ -91,8 +95,11 @@ public class NMContainerStatusPBImpl extends NMContainerStatus {
         .append("Diagnostics: ").append(getDiagnostics()).append(", ")
         .append("ExitStatus: ").append(getContainerExitStatus()).append(", ")
         .append("NodeLabelExpression: ").append(getNodeLabelExpression())
+        .append(", ")
         .append("Priority: ").append(getPriority()).append(", ")
         .append("AllocationRequestId: ").append(getAllocationRequestId())
+        .append(", ")
+        .append("AllocationTags: ").append(getAllocationTags()).append(", ")
         .append("]");
     return sb.toString();
   }
@@ -283,6 +290,28 @@ public class NMContainerStatusPBImpl extends NMContainerStatus {
     builder.setAllocationRequestId(allocationRequestId);
   }
 
+  private void initAllocationTags() {
+    if (this.allocationTags != null) {
+      return;
+    }
+    NMContainerStatusProtoOrBuilder p = viaProto ? proto : builder;
+    this.allocationTags = new HashSet<>();
+    this.allocationTags.addAll(p.getAllocationTagsList());
+  }
+
+  @Override
+  public Set<String> getAllocationTags() {
+    initAllocationTags();
+    return this.allocationTags;
+  }
+
+  @Override
+  public void setAllocationTags(Set<String> allocationTags) {
+    maybeInitBuilder();
+    builder.clearAllocationTags();
+    this.allocationTags = allocationTags;
+  }
+
   private void mergeLocalToBuilder() {
     if (this.containerId != null
         && !((ContainerIdPBImpl) containerId).getProto().equals(
@@ -297,6 +326,10 @@ public class NMContainerStatusPBImpl extends NMContainerStatus {
     if (this.priority != null) {
       builder.setPriority(convertToProtoFormat(this.priority));
     }
+    if (this.allocationTags != null) {
+      builder.clearAllocationTags();
+      builder.addAllAllocationTags(this.allocationTags);
+    }
   }
 
   private void mergeLocalToProto() {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/proto/yarn_server_common_service_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/proto/yarn_server_common_service_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/proto/yarn_server_common_service_protos.proto
index 8c4fc69..e782cc2 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/proto/yarn_server_common_service_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-common/src/main/proto/yarn_server_common_service_protos.proto
@@ -177,6 +177,7 @@ message NMContainerStatusProto {
   optional int32 version = 9;
   optional ExecutionTypeProto executionType = 10 [default = GUARANTEED];
   optional int64 allocation_request_id = 11 [default = -1];
+  repeated string allocation_tags = 12;
 }
 
 message SCMUploaderNotifyRequestProto {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/ContainerManagerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/ContainerManagerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/ContainerManagerImpl.java
index 44bfc68..6b4d517 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/ContainerManagerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/ContainerManagerImpl.java
@@ -451,7 +451,8 @@ public class ContainerManagerImpl extends CompositeService implements
           originalToken.getLogAggregationContext(),
           originalToken.getNodeLabelExpression(),
           originalToken.getContainerType(), originalToken.getExecutionType(),
-          originalToken.getAllocationRequestId());
+          originalToken.getAllocationRequestId(),
+          originalToken.getAllcationTags());
 
     } else {
       token = BuilderUtils.newContainerTokenIdentifier(req.getContainerToken());

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/container/ContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/container/ContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/container/ContainerImpl.java
index 34be6c9..751beff 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/container/ContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/container/ContainerImpl.java
@@ -849,14 +849,17 @@ public class ContainerImpl implements Container {
   public NMContainerStatus getNMContainerStatus() {
     this.readLock.lock();
     try {
-      return NMContainerStatus.newInstance(this.containerId,
-          this.version, getCurrentState(), getResource(),
-          diagnostics.toString(), exitCode,
-          containerTokenIdentifier.getPriority(),
-          containerTokenIdentifier.getCreationTime(),
-          containerTokenIdentifier.getNodeLabelExpression(),
-          containerTokenIdentifier.getExecutionType(),
-          containerTokenIdentifier.getAllocationRequestId());
+      NMContainerStatus status =
+          NMContainerStatus.newInstance(this.containerId,
+              this.version, getCurrentState(), getResource(),
+              diagnostics.toString(), exitCode,
+              containerTokenIdentifier.getPriority(),
+              containerTokenIdentifier.getCreationTime(),
+              containerTokenIdentifier.getNodeLabelExpression(),
+              containerTokenIdentifier.getExecutionType(),
+              containerTokenIdentifier.getAllocationRequestId());
+      status.setAllocationTags(containerTokenIdentifier.getAllcationTags());
+      return status;
     } finally {
       this.readLock.unlock();
     }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
index 2c4ef7b..563df0d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
@@ -530,12 +530,18 @@ public class RMContainerImpl implements RMContainer {
         RMContainerEvent event) {
       NMContainerStatus report =
           ((RMContainerRecoverEvent) event).getContainerReport();
+      // Set the allocation tags from the
+      container.setAllocationTags(report.getAllocationTags());
+      // Notify AllocationTagsManager
+      container.rmContext.getAllocationTagsManager().addContainer(
+          container.getNodeId(), container.getContainerId(),
+          container.getAllocationTags());
+
       if (report.getContainerState().equals(ContainerState.COMPLETE)) {
         ContainerStatus status =
             ContainerStatus.newInstance(report.getContainerId(),
               report.getContainerState(), report.getDiagnostics(),
               report.getContainerExitStatus());
-
         new FinishedTransition().transition(container,
           new RMContainerFinishedEvent(container.getContainerId(), status,
             RMContainerEventType.FINISHED));
@@ -577,7 +583,7 @@ public class RMContainerImpl implements RMContainer {
 
     @Override
     public void transition(RMContainerImpl container, RMContainerEvent event) {
-      // Notify placementManager
+      // Notify AllocationTagsManager
       container.rmContext.getAllocationTagsManager().addContainer(
           container.getNodeId(), container.getContainerId(),
           container.getAllocationTags());

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
index f02f113..88a9049 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerApplicationAttempt.java
@@ -670,7 +670,8 @@ public class SchedulerApplicationAttempt implements SchedulableEntity {
               container.getPriority(), rmContainer.getCreationTime(),
               this.logAggregationContext, rmContainer.getNodeLabelExpression(),
               containerType, container.getExecutionType(),
-              container.getAllocationRequestId()));
+              container.getAllocationRequestId(),
+              rmContainer.getAllocationTags()));
       updateNMToken(container);
     } catch (IllegalArgumentException e) {
       // DNS might be down, skip returning this container.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/security/RMContainerTokenSecretManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/security/RMContainerTokenSecretManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/security/RMContainerTokenSecretManager.java
index 191900b..945d89e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/security/RMContainerTokenSecretManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/security/RMContainerTokenSecretManager.java
@@ -18,9 +18,11 @@
 
 package org.apache.hadoop.yarn.server.resourcemanager.security;
 
+import java.util.Set;
 import java.util.Timer;
 import java.util.TimerTask;
 
+import com.google.common.annotations.VisibleForTesting;
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.classification.InterfaceAudience.Private;
@@ -166,25 +168,14 @@ public class RMContainerTokenSecretManager extends
     }
   }
 
-  /**
-   * Helper function for creating ContainerTokens.
-   *
-   * @param containerId Container Id
-   * @param containerVersion Container Version
-   * @param nodeId Node Id
-   * @param appSubmitter App Submitter
-   * @param capability Capability
-   * @param priority Priority
-   * @param createTime Create Time
-   * @return the container-token
-   */
+  @VisibleForTesting
   public Token createContainerToken(ContainerId containerId,
       int containerVersion, NodeId nodeId, String appSubmitter,
       Resource capability, Priority priority, long createTime) {
     return createContainerToken(containerId, containerVersion, nodeId,
         appSubmitter, capability, priority, createTime,
         null, null, ContainerType.TASK,
-        ExecutionType.GUARANTEED, -1);
+        ExecutionType.GUARANTEED, -1, null);
   }
 
   /**
@@ -209,7 +200,7 @@ public class RMContainerTokenSecretManager extends
       Resource capability, Priority priority, long createTime,
       LogAggregationContext logAggregationContext, String nodeLabelExpression,
       ContainerType containerType, ExecutionType execType,
-      long allocationRequestId) {
+      long allocationRequestId, Set<String> allocationTags) {
     byte[] password;
     ContainerTokenIdentifier tokenIdentifier;
     long expiryTimeStamp =
@@ -224,7 +215,7 @@ public class RMContainerTokenSecretManager extends
               this.currentMasterKey.getMasterKey().getKeyId(),
               ResourceManager.getClusterTimeStamp(), priority, createTime,
               logAggregationContext, nodeLabelExpression, containerType,
-              execType, allocationRequestId);
+              execType, allocationRequestId, allocationTags);
       password = this.createPassword(tokenIdentifier);
 
     } finally {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/126eb8d7/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestContainerAllocation.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestContainerAllocation.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestContainerAllocation.java
index 6f54d47..25e535a 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestContainerAllocation.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestContainerAllocation.java
@@ -20,6 +20,7 @@ package org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity;
 
 import java.util.ArrayList;
 import java.util.List;
+import java.util.Set;
 
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
@@ -296,12 +297,12 @@ public class TestContainerAllocation {
             Resource capability, Priority priority, long createTime,
             LogAggregationContext logAggregationContext, String nodeLabelExp,
             ContainerType containerType, ExecutionType executionType,
-            long allocationRequestId) {
+            long allocationRequestId, Set<String> allocationTags) {
           numRetries++;
           return super.createContainerToken(containerId, containerVersion,
               nodeId, appSubmitter, capability, priority, createTime,
               logAggregationContext, nodeLabelExp, containerType,
-              executionType, allocationRequestId);
+              executionType, allocationRequestId, allocationTags);
         }
       };
     }


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[25/50] [abbrv] hadoop git commit: YARN-6593. [API] Introduce Placement Constraint object. (Konstantinos Karanasos via wangda)

Posted by as...@apache.org.
YARN-6593. [API] Introduce Placement Constraint object. (Konstantinos Karanasos via wangda)

Change-Id: Id00edb7185fdf01cce6e40f920cac3585f8cbe9c


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/50cfc788
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/50cfc788
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/50cfc788

Branch: refs/heads/YARN-6592
Commit: 50cfc788ac223ef02754b0bab6bd84ee7713ac70
Parents: 901d15a
Author: Wangda Tan <wa...@apache.org>
Authored: Thu Aug 3 14:03:55 2017 -0700
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../yarn/api/resource/PlacementConstraint.java  | 567 +++++++++++++++++++
 .../yarn/api/resource/PlacementConstraints.java | 286 ++++++++++
 .../hadoop/yarn/api/resource/package-info.java  |  23 +
 .../src/main/proto/yarn_protos.proto            |  55 ++
 .../api/resource/TestPlacementConstraints.java  | 106 ++++
 .../PlacementConstraintFromProtoConverter.java  | 116 ++++
 .../pb/PlacementConstraintToProtoConverter.java | 174 ++++++
 .../apache/hadoop/yarn/api/pb/package-info.java |  23 +
 .../yarn/api/records/impl/pb/ProtoUtils.java    |  27 +
 .../PlacementConstraintTransformations.java     | 209 +++++++
 .../hadoop/yarn/api/resource/package-info.java  |  23 +
 .../TestPlacementConstraintPBConversion.java    | 195 +++++++
 .../TestPlacementConstraintTransformations.java | 183 ++++++
 13 files changed, 1987 insertions(+)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
new file mode 100644
index 0000000..f0e3982
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
@@ -0,0 +1,567 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.resource;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.HashSet;
+import java.util.List;
+import java.util.Set;
+
+import org.apache.hadoop.classification.InterfaceAudience.Private;
+import org.apache.hadoop.classification.InterfaceAudience.Public;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
+
+/**
+ * {@code PlacementConstraint} represents a placement constraint for a resource
+ * allocation.
+ */
+@Public
+@Unstable
+public class PlacementConstraint {
+
+  /**
+   * The constraint expression tree.
+   */
+  private AbstractConstraint constraintExpr;
+
+  public PlacementConstraint(AbstractConstraint constraintExpr) {
+    this.constraintExpr = constraintExpr;
+  }
+
+  /**
+   * Get the constraint expression of the placement constraint.
+   *
+   * @return the constraint expression
+   */
+  public AbstractConstraint getConstraintExpr() {
+    return constraintExpr;
+  }
+
+  /**
+   * Interface used to enable the elements of the constraint tree to be visited.
+   */
+  @Private
+  public interface Visitable {
+    /**
+     * Visitor pattern.
+     *
+     * @param visitor visitor to be used
+     * @param <T> defines the type that the visitor will use and the return type
+     *          of the accept.
+     * @return the result of visiting a given object.
+     */
+    <T> T accept(Visitor<T> visitor);
+
+  }
+
+  /**
+   * Visitor API for a constraint tree.
+   *
+   * @param <T> determines the return type of the visit methods.
+   */
+  @Private
+  public interface Visitor<T> {
+    T visit(SingleConstraint constraint);
+
+    T visit(TargetExpression target);
+
+    T visit(TargetConstraint constraint);
+
+    T visit(CardinalityConstraint constraint);
+
+    T visit(And constraint);
+
+    T visit(Or constraint);
+
+    T visit(DelayedOr constraint);
+
+    T visit(TimedPlacementConstraint constraint);
+  }
+
+  /**
+   * Abstract class that acts as the superclass of all placement constraint
+   * classes.
+   */
+  public abstract static class AbstractConstraint implements Visitable {
+    public PlacementConstraint build() {
+      return new PlacementConstraint(this);
+    }
+  }
+
+  static final String NODE_SCOPE = "node";
+  static final String RACK_SCOPE = "rack";
+
+  /**
+   * Consider a set of nodes N that belongs to the scope specified in the
+   * constraint. If the target expressions are satisfied at least minCardinality
+   * times and at most max-cardinality times in the node set N, then the
+   * constraint is satisfied.
+   *
+   * For example, a constraint of the form {@code {RACK, 2, 10,
+   * allocationTag("zk")}}, requires an allocation to be placed within a rack
+   * that has at least 2 and at most 10 other allocations with tag "zk".
+   */
+  public static class SingleConstraint extends AbstractConstraint {
+    private String scope;
+    private int minCardinality;
+    private int maxCardinality;
+    private Set<TargetExpression> targetExpressions;
+
+    public SingleConstraint(String scope, int minCardinality,
+        int maxCardinality, Set<TargetExpression> targetExpressions) {
+      this.scope = scope;
+      this.minCardinality = minCardinality;
+      this.maxCardinality = maxCardinality;
+      this.targetExpressions = targetExpressions;
+    }
+
+    public SingleConstraint(String scope, int minC, int maxC,
+        TargetExpression... targetExpressions) {
+      this(scope, minC, maxC, new HashSet<>(Arrays.asList(targetExpressions)));
+    }
+
+    /**
+     * Get the scope of the constraint.
+     *
+     * @return the scope of the constraint
+     */
+    public String getScope() {
+      return scope;
+    }
+
+    /**
+     * Get the minimum cardinality of the constraint.
+     *
+     * @return the minimum cardinality of the constraint
+     */
+    public int getMinCardinality() {
+      return minCardinality;
+    }
+
+    /**
+     * Get the maximum cardinality of the constraint.
+     *
+     * @return the maximum cardinality of the constraint
+     */
+    public int getMaxCardinality() {
+      return maxCardinality;
+    }
+
+    /**
+     * Get the target expressions of the constraint.
+     *
+     * @return the set of target expressions
+     */
+    public Set<TargetExpression> getTargetExpressions() {
+      return targetExpressions;
+    }
+
+    @Override
+    public <T> T accept(Visitor<T> visitor) {
+      return visitor.visit(this);
+    }
+  }
+
+  /**
+   * Class representing the target expressions that are used in placement
+   * constraints. They might refer to expressions on node attributes, allocation
+   * tags, or be self-targets (referring to the allocation to which the
+   * constraint is attached).
+   */
+  public static class TargetExpression implements Visitable {
+    /**
+     * Enum specifying the type of the target expression.
+     */
+    public enum TargetType {
+      NODE_ATTRIBUTE, ALLOCATION_TAG, SELF
+    }
+
+    private TargetType targetType;
+    private String targetKey;
+    private Set<String> targetValues;
+
+    public TargetExpression(TargetType targetType, String targetKey,
+        Set<String> targetValues) {
+      this.targetType = targetType;
+      this.targetKey = targetKey;
+      this.targetValues = targetValues;
+    }
+
+    public TargetExpression(TargetType targetType) {
+      this(targetType, null, new HashSet<>());
+    }
+
+    public TargetExpression(TargetType targetType, String targetKey,
+        String... targetValues) {
+      this(targetType, targetKey, new HashSet<>(Arrays.asList(targetValues)));
+    }
+
+    /**
+     * Get the type of the target expression.
+     *
+     * @return the type of the target expression
+     */
+    public TargetType getTargetType() {
+      return targetType;
+    }
+
+    /**
+     * Get the key of the target expression.
+     *
+     * @return the key of the target expression
+     */
+    public String getTargetKey() {
+      return targetKey;
+    }
+
+    /**
+     * Get the set of values of the target expression.
+     *
+     * @return the set of values of the target expression
+     */
+    public Set<String> getTargetValues() {
+      return targetValues;
+    }
+
+    @Override
+    public int hashCode() {
+      int result = targetType != null ? targetType.hashCode() : 0;
+      result = 31 * result + (targetKey != null ? targetKey.hashCode() : 0);
+      result =
+          31 * result + (targetValues != null ? targetValues.hashCode() : 0);
+      return result;
+    }
+
+    @Override
+    public boolean equals(Object o) {
+      if (this == o) {
+        return true;
+      }
+      if (o == null) {
+        return false;
+      }
+      if (!(o instanceof TargetExpression)) {
+        return false;
+      }
+
+      TargetExpression that = (TargetExpression) o;
+      if (targetType != that.targetType) {
+        return false;
+      }
+      if (targetKey != null ? !targetKey.equals(that.targetKey)
+          : that.targetKey != null) {
+        return false;
+      }
+      return targetValues != null ? targetValues.equals(that.targetValues)
+          : that.targetValues == null;
+    }
+
+    @Override
+    public <T> T accept(Visitor<T> visitor) {
+      return visitor.visit(this);
+    }
+  }
+
+  /**
+   * Class that represents a target constraint. Such a constraint requires an
+   * allocation to be placed within a scope that satisfies some specified
+   * expressions on node attributes and allocation tags.
+   *
+   * It is a specialized version of the {@link SingleConstraint}, where the
+   * minimum and the maximum cardinalities take specific values based on the
+   * {@link TargetOperator} used.
+   */
+  public static class TargetConstraint extends AbstractConstraint {
+    enum TargetOperator {
+      IN, NOT_IN
+    }
+
+    private TargetOperator op;
+    private String scope;
+    private Set<TargetExpression> targetExpressions;
+
+    public TargetConstraint(TargetOperator op, String scope,
+        Set<TargetExpression> targetExpressions) {
+      this.op = op;
+      this.scope = scope;
+      this.targetExpressions = targetExpressions;
+    }
+
+    /**
+     * Get the target operator of the constraint.
+     *
+     * @return the target operator
+     */
+    public TargetOperator getOp() {
+      return op;
+    }
+
+    /**
+     * Get the scope of the constraint.
+     *
+     * @return the scope of the constraint
+     */
+    public String getScope() {
+      return scope;
+    }
+
+    /**
+     * Get the set of target expressions.
+     *
+     * @return the set of target expressions
+     */
+    public Set<TargetExpression> getTargetExpressions() {
+      return targetExpressions;
+    }
+
+    @Override
+    public <T> T accept(Visitor<T> visitor) {
+      return visitor.visit(this);
+    }
+  }
+
+  /**
+   * Class that represents a cardinality constraint. Such a constraint the
+   * number of allocations within a given scope to some minimum and maximum
+   * values.
+   *
+   * It is a specialized version of the {@link SingleConstraint}, where the
+   * target is self (i.e., the allocation to which the constraint is attached).
+   */
+  public static class CardinalityConstraint extends AbstractConstraint {
+    private String scope;
+    private int minCardinality;
+    private int maxCardinality;
+
+    public CardinalityConstraint(String scope, int minCardinality,
+        int maxCardinality) {
+      this.scope = scope;
+      this.minCardinality = minCardinality;
+      this.maxCardinality = maxCardinality;
+    }
+
+    /**
+     * Get the scope of the constraint.
+     *
+     * @return the scope of the constraint
+     */
+    public String getScope() {
+      return scope;
+    }
+
+    /**
+     * Get the minimum cardinality of the constraint.
+     *
+     * @return the minimum cardinality of the constraint
+     */
+    public int getMinCardinality() {
+      return minCardinality;
+    }
+
+    /**
+     * Get the maximum cardinality of the constraint.
+     *
+     * @return the maximum cardinality of the constraint
+     */
+    public int getMaxCardinality() {
+      return maxCardinality;
+    }
+
+    @Override
+    public <T> T accept(Visitor<T> visitor) {
+      return visitor.visit(this);
+    }
+  }
+
+  /**
+   * Class that represents composite constraints, which comprise other
+   * constraints, forming a constraint tree.
+   *
+   * @param <R> the type of constraints that are used as children of the
+   *          specific composite constraint
+   */
+  public abstract static class CompositeConstraint<R extends Visitable>
+      extends AbstractConstraint {
+
+    /**
+     * Get the children of this composite constraint.
+     *
+     * @return the children of the composite constraint
+     */
+    public abstract List<R> getChildren();
+  }
+
+  /**
+   * Class that represents a composite constraint that is a conjunction of other
+   * constraints.
+   */
+  public static class And extends CompositeConstraint<AbstractConstraint> {
+    private List<AbstractConstraint> children;
+
+    public And(List<AbstractConstraint> children) {
+      this.children = children;
+    }
+
+    public And(AbstractConstraint... children) {
+      this(Arrays.asList(children));
+    }
+
+    @Override
+    public List<AbstractConstraint> getChildren() {
+      return children;
+    }
+
+    @Override
+    public <T> T accept(Visitor<T> visitor) {
+      return visitor.visit(this);
+    }
+  }
+
+  /**
+   * Class that represents a composite constraint that is a disjunction of other
+   * constraints.
+   */
+  public static class Or extends CompositeConstraint<AbstractConstraint> {
+    private List<AbstractConstraint> children;
+
+    public Or(List<AbstractConstraint> children) {
+      this.children = children;
+    }
+
+    public Or(AbstractConstraint... children) {
+      this(Arrays.asList(children));
+    }
+
+    @Override
+    public List<AbstractConstraint> getChildren() {
+      return children;
+    }
+
+    @Override
+    public <T> T accept(Visitor<T> visitor) {
+      return visitor.visit(this);
+    }
+  }
+
+  /**
+   * Class that represents a composite constraint that comprises a list of timed
+   * placement constraints (see {@link TimedPlacementConstraint}). The scheduler
+   * should try to satisfy first the first timed child constraint within the
+   * specified time window. If this is not possible, it should attempt to
+   * satisfy the second, and so on.
+   */
+  public static class DelayedOr
+      extends CompositeConstraint<TimedPlacementConstraint> {
+    private List<TimedPlacementConstraint> children = new ArrayList<>();
+
+    public DelayedOr(List<TimedPlacementConstraint> children) {
+      this.children = children;
+    }
+
+    public DelayedOr(TimedPlacementConstraint... children) {
+      this(Arrays.asList(children));
+    }
+
+    @Override
+    public List<TimedPlacementConstraint> getChildren() {
+      return children;
+    }
+
+    @Override
+    public <T> T accept(Visitor<T> visitor) {
+      return visitor.visit(this);
+    }
+  }
+
+  /**
+   * Represents a timed placement constraint that has to be satisfied within a
+   * time window.
+   */
+  public static class TimedPlacementConstraint implements Visitable {
+    /**
+     * The unit of scheduling delay.
+     */
+    public enum DelayUnit {
+      MILLISECONDS, OPPORTUNITIES
+    }
+
+    private AbstractConstraint constraint;
+    private long schedulingDelay;
+    private DelayUnit delayUnit;
+
+    public TimedPlacementConstraint(AbstractConstraint constraint,
+        long schedulingDelay, DelayUnit delayUnit) {
+      this.constraint = constraint;
+      this.schedulingDelay = schedulingDelay;
+      this.delayUnit = delayUnit;
+    }
+
+    public TimedPlacementConstraint(AbstractConstraint constraint,
+        long schedulingDelay) {
+      this(constraint, schedulingDelay, DelayUnit.MILLISECONDS);
+    }
+
+    public TimedPlacementConstraint(AbstractConstraint constraint) {
+      this(constraint, Long.MAX_VALUE, DelayUnit.MILLISECONDS);
+    }
+
+    /**
+     * Get the constraint that has to be satisfied within the time window.
+     *
+     * @return the constraint to be satisfied
+     */
+    public AbstractConstraint getConstraint() {
+      return constraint;
+    }
+
+    /**
+     * Sets the constraint that has to be satisfied within the time window.
+     *
+     * @param constraint the constraint to be satisfied
+     */
+    public void setConstraint(AbstractConstraint constraint) {
+      this.constraint = constraint;
+    }
+
+    /**
+     * Get the scheduling delay value that determines the time window within
+     * which the constraint has to be satisfied.
+     *
+     * @return the value of the scheduling delay
+     */
+    public long getSchedulingDelay() {
+      return schedulingDelay;
+    }
+
+    /**
+     * The unit of the scheduling delay.
+     *
+     * @return the unit of the delay
+     */
+    public DelayUnit getDelayUnit() {
+      return delayUnit;
+    }
+
+    @Override
+    public <T> T accept(Visitor<T> visitor) {
+      return visitor.visit(this);
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
new file mode 100644
index 0000000..8e84280
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
@@ -0,0 +1,286 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.resource;
+
+import java.util.concurrent.TimeUnit;
+
+import org.apache.hadoop.classification.InterfaceAudience.Public;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.And;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.DelayedOr;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.Or;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression.TargetType;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TimedPlacementConstraint;
+
+/**
+ * This class contains various static methods for the applications to create
+ * placement constraints (see also {@link PlacementConstraint}).
+ */
+@Public
+@Unstable
+public final class PlacementConstraints {
+
+  // Suppresses default constructor, ensuring non-instantiability.
+  private PlacementConstraints() {
+  }
+
+  // Creation of simple constraints.
+
+  public static final String NODE = PlacementConstraint.NODE_SCOPE;
+  public static final String RACK = PlacementConstraint.RACK_SCOPE;
+
+  /**
+   * Creates a constraint that requires allocations to be placed on nodes that
+   * satisfy all target expressions within the given scope (e.g., node or rack).
+   *
+   * For example, {@code targetIn(RACK, allocationTag("hbase-m"))}, allows
+   * allocations on nodes that belong to a rack that has at least one tag with
+   * value "hbase-m".
+   *
+   * @param scope the scope within which the target expressions should be
+   *          satisfied
+   * @param targetExpressions the expressions that need to be satisfied within
+   *          the scope
+   * @return the resulting placement constraint
+   */
+  public static AbstractConstraint targetIn(String scope,
+      TargetExpression... targetExpressions) {
+    return new SingleConstraint(scope, 1, Integer.MAX_VALUE, targetExpressions);
+  }
+
+  /**
+   * Creates a constraint that requires allocations to be placed on nodes that
+   * belong to a scope (e.g., node or rack) that does not satisfy any of the
+   * target expressions.
+   *
+   * @param scope the scope within which the target expressions should not be
+   *          true
+   * @param targetExpressions the expressions that need to not be true within
+   *          the scope
+   * @return the resulting placement constraint
+   */
+  public static AbstractConstraint targetNotIn(String scope,
+      TargetExpression... targetExpressions) {
+    return new SingleConstraint(scope, 0, 0, targetExpressions);
+  }
+
+  /**
+   * Creates a constraint that restricts the number of allocations within a
+   * given scope (e.g., node or rack).
+   *
+   * For example, {@code cardinality(NODE, 3, 10)}, restricts the number of
+   * allocations per node to be no less than 3 and no more than 10.
+   *
+   * @param scope the scope of the constraint
+   * @param minCardinality determines the minimum number of allocations within
+   *          the scope
+   * @param maxCardinality determines the maximum number of allocations within
+   *          the scope
+   * @return the resulting placement constraint
+   */
+  public static AbstractConstraint cardinality(String scope, int minCardinality,
+      int maxCardinality) {
+    return new SingleConstraint(scope, minCardinality, maxCardinality,
+        PlacementTargets.self());
+  }
+
+  /**
+   * Similar to {@link #cardinality(String, int, int)}, but determines only the
+   * minimum cardinality (the maximum cardinality is unbound).
+   *
+   * @param scope the scope of the constraint
+   * @param minCardinality determines the minimum number of allocations within
+   *          the scope
+   * @return the resulting placement constraint
+   */
+  public static AbstractConstraint minCardinality(String scope,
+      int minCardinality) {
+    return cardinality(scope, minCardinality, Integer.MAX_VALUE);
+  }
+
+  /**
+   * Similar to {@link #cardinality(String, int, int)}, but determines only the
+   * maximum cardinality (the minimum can be as low as 0).
+   *
+   * @param scope the scope of the constraint
+   * @param maxCardinality determines the maximum number of allocations within
+   *          the scope
+   * @return the resulting placement constraint
+   */
+  public static AbstractConstraint maxCardinality(String scope,
+      int maxCardinality) {
+    return cardinality(scope, 0, maxCardinality);
+  }
+
+  /**
+   * This constraint generalizes the cardinality and target constraints.
+   *
+   * Consider a set of nodes N that belongs to the scope specified in the
+   * constraint. If the target expressions are satisfied at least minCardinality
+   * times and at most max-cardinality times in the node set N, then the
+   * constraint is satisfied.
+   *
+   * For example, {@code targetCardinality(RACK, 2, 10, allocationTag("zk"))},
+   * requires an allocation to be placed within a rack that has at least 2 and
+   * at most 10 other allocations with tag "zk".
+   *
+   * @param scope the scope of the constraint
+   * @param minCardinality the minimum number of times the target expressions
+   *          have to be satisfied with the given scope
+   * @param maxCardinality the maximum number of times the target expressions
+   *          have to be satisfied with the given scope
+   * @param targetExpressions the target expressions
+   * @return the resulting placement constraint
+   */
+  public static AbstractConstraint targetCardinality(String scope,
+      int minCardinality, int maxCardinality,
+      TargetExpression... targetExpressions) {
+    return new SingleConstraint(scope, minCardinality, maxCardinality,
+        targetExpressions);
+  }
+
+  // Creation of target expressions to be used in simple constraints.
+
+  /**
+   * Class with static methods for constructing target expressions to be used in
+   * placement constraints.
+   */
+  public static class PlacementTargets {
+
+    /**
+     * Constructs a target expression on a node attribute. It is satisfied if
+     * the specified node attribute has one of the specified values.
+     *
+     * @param attributeKey the name of the node attribute
+     * @param attributeValues the set of values that the attribute should take
+     *          values from
+     * @return the resulting expression on the node attribute
+     */
+    public static TargetExpression nodeAttribute(String attributeKey,
+        String... attributeValues) {
+      return new TargetExpression(TargetType.NODE_ATTRIBUTE, attributeKey,
+          attributeValues);
+    }
+
+    /**
+     * Constructs a target expression on an allocation tag. It is satisfied if
+     * the there are allocations with one of the given tags.
+     *
+     * @param allocationTags the set of tags that the attribute should take
+     *          values from
+     * @return the resulting expression on the allocation tags
+     */
+    public static TargetExpression allocationTag(String... allocationTags) {
+      return new TargetExpression(TargetType.ALLOCATION_TAG, null,
+          allocationTags);
+    }
+
+    /**
+     * The default target expression that uses as target the allocation that
+     * specifies the constraint.
+     *
+     * @return the self-target
+     */
+    public static TargetExpression self() {
+      return new TargetExpression(TargetType.SELF);
+    }
+  }
+
+  // Creation of compound constraints.
+
+  /**
+   * A conjunction of constraints.
+   *
+   * @param children the children constraints that should all be satisfied
+   * @return the resulting placement constraint
+   */
+  public static And and(AbstractConstraint... children) {
+    return new And(children);
+  }
+
+  /**
+   * A disjunction of constraints.
+   *
+   * @param children the children constraints, one of which should be satisfied
+   * @return the resulting placement constraint
+   */
+  public static Or or(AbstractConstraint... children) {
+    return new Or(children);
+  }
+
+  /**
+   * Creates a composite constraint that includes a list of timed placement
+   * constraints. The scheduler should try to satisfy first the first timed
+   * child constraint within the specified time window. If this is not possible,
+   * it should attempt to satisfy the second, and so on.
+   *
+   * @param children the timed children constraints
+   * @return the resulting composite constraint
+   */
+  public static DelayedOr delayedOr(TimedPlacementConstraint... children) {
+    return new DelayedOr(children);
+  }
+
+  // Creation of timed constraints to be used in a DELAYED_OR constraint.
+
+  /**
+   * Creates a placement constraint that has to be satisfied within a time
+   * window.
+   *
+   * @param constraint the placement constraint
+   * @param delay the length of the time window within which the constraint has
+   *          to be satisfied
+   * @param timeUnit the unit of time of the time window
+   * @return the resulting timed placement constraint
+   */
+  public static TimedPlacementConstraint timedClockConstraint(
+      AbstractConstraint constraint, long delay, TimeUnit timeUnit) {
+    return new TimedPlacementConstraint(constraint, timeUnit.toMillis(delay),
+        TimedPlacementConstraint.DelayUnit.MILLISECONDS);
+  }
+
+  /**
+   * Creates a placement constraint that has to be satisfied within a number of
+   * placement opportunities (invocations of the scheduler).
+   *
+   * @param constraint the placement constraint
+   * @param delay the number of scheduling opportunities within which the
+   *          constraint has to be satisfied
+   * @return the resulting timed placement constraint
+   */
+  public static TimedPlacementConstraint timedOpportunitiesConstraint(
+      AbstractConstraint constraint, long delay) {
+    return new TimedPlacementConstraint(constraint, delay,
+        TimedPlacementConstraint.DelayUnit.OPPORTUNITIES);
+  }
+
+  /**
+   * Creates a {@link PlacementConstraint} given a constraint expression.
+   *
+   * @param constraintExpr the constraint expression
+   * @return the placement constraint
+   */
+  public static PlacementConstraint build(AbstractConstraint constraintExpr) {
+    return constraintExpr.build();
+  }
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/package-info.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/package-info.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/package-info.java
new file mode 100644
index 0000000..660dc02
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/package-info.java
@@ -0,0 +1,23 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+/**
+ * API related to resources.
+ */
+@InterfaceAudience.Private
+package org.apache.hadoop.yarn.api.resource;
+import org.apache.hadoop.classification.InterfaceAudience;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
index b6ea5f9..ff0d54b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
@@ -579,6 +579,61 @@ enum SignalContainerCommandProto {
   FORCEFUL_SHUTDOWN = 3;
 }
 
+////////////////////////////////////////////////////////////////////////
+////// Placement constraints ///////////////////////////////////////////
+////////////////////////////////////////////////////////////////////////
+
+message PlacementConstraintProto {
+  optional SimplePlacementConstraintProto simpleConstraint = 1;
+  optional CompositePlacementConstraintProto compositeConstraint = 2;
+}
+
+message SimplePlacementConstraintProto {
+  required string scope = 1;
+  repeated PlacementConstraintTargetProto targetExpressions = 2;
+  optional int32 minCardinality = 3;
+  optional int32 maxCardinality = 4;
+}
+
+message PlacementConstraintTargetProto {
+  enum TargetType {
+    NODE_ATTRIBUTE = 1;
+    ALLOCATION_TAG = 2;
+    SELF = 3;
+  }
+
+  required TargetType targetType = 1;
+  optional string targetKey = 2;
+  repeated string targetValues = 3;
+}
+
+message TimedPlacementConstraintProto {
+  enum DelayUnit {
+    MILLISECONDS = 1;
+    OPPORTUNITIES = 2;
+  }
+
+  required PlacementConstraintProto placementConstraint = 1;
+  required int64 schedulingDelay = 2;
+  optional DelayUnit delayUnit = 3 [ default = MILLISECONDS ];
+}
+
+message CompositePlacementConstraintProto {
+  enum CompositeType {
+    // All children constraints have to be satisfied.
+    AND = 1;
+    // One of the children constraints has to be satisfied.
+    OR = 2;
+    // Attempt to satisfy the first child constraint for delays[0] units (e.g.,
+    // millisec or heartbeats). If this fails, try to satisfy the second child
+    // constraint for delays[1] units and so on.
+    DELAYED_OR = 3;
+  }
+
+  required CompositeType compositeType = 1;
+  repeated PlacementConstraintProto childConstraints = 2;
+  repeated TimedPlacementConstraintProto timedChildConstraints = 3;
+}
 
 ////////////////////////////////////////////////////////////////////////
 ////// From reservation_protocol /////////////////////////////////////

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java
new file mode 100644
index 0000000..e25d477
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraints.java
@@ -0,0 +1,106 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.resource;
+
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.RACK;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.and;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.maxCardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetCardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetNotIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.allocationTag;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.nodeAttribute;
+
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.And;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression.TargetType;
+import org.junit.Assert;
+import org.junit.Test;
+
+/**
+ * Test class for the various static methods in
+ * {@link org.apache.hadoop.yarn.api.resource.PlacementConstraints}.
+ */
+public class TestPlacementConstraints {
+
+  @Test
+  public void testNodeAffinityToTag() {
+    AbstractConstraint constraintExpr =
+        targetIn(NODE, allocationTag("hbase-m"));
+
+    SingleConstraint sConstraint = (SingleConstraint) constraintExpr;
+    Assert.assertEquals(NODE, sConstraint.getScope());
+    Assert.assertEquals(1, sConstraint.getMinCardinality());
+    Assert.assertEquals(Integer.MAX_VALUE, sConstraint.getMaxCardinality());
+
+    Assert.assertEquals(1, sConstraint.getTargetExpressions().size());
+    TargetExpression tExpr =
+        sConstraint.getTargetExpressions().iterator().next();
+    Assert.assertNull(tExpr.getTargetKey());
+    Assert.assertEquals(TargetType.ALLOCATION_TAG, tExpr.getTargetType());
+    Assert.assertEquals(1, tExpr.getTargetValues().size());
+    Assert.assertEquals("hbase-m", tExpr.getTargetValues().iterator().next());
+
+    PlacementConstraint constraint = PlacementConstraints.build(constraintExpr);
+    Assert.assertNotNull(constraint.getConstraintExpr());
+  }
+
+  @Test
+  public void testNodeAntiAffinityToAttribute() {
+    AbstractConstraint constraintExpr =
+        targetNotIn(NODE, nodeAttribute("java", "1.8"));
+
+    SingleConstraint sConstraint = (SingleConstraint) constraintExpr;
+    Assert.assertEquals(NODE, sConstraint.getScope());
+    Assert.assertEquals(0, sConstraint.getMinCardinality());
+    Assert.assertEquals(0, sConstraint.getMaxCardinality());
+
+    Assert.assertEquals(1, sConstraint.getTargetExpressions().size());
+    TargetExpression tExpr =
+        sConstraint.getTargetExpressions().iterator().next();
+    Assert.assertEquals("java", tExpr.getTargetKey());
+    Assert.assertEquals(TargetType.NODE_ATTRIBUTE, tExpr.getTargetType());
+    Assert.assertEquals(1, tExpr.getTargetValues().size());
+    Assert.assertEquals("1.8", tExpr.getTargetValues().iterator().next());
+  }
+
+  @Test
+  public void testAndConstraint() {
+    AbstractConstraint constraintExpr =
+        and(targetIn(RACK, allocationTag("spark")), maxCardinality(NODE, 3),
+            targetCardinality(RACK, 2, 10, allocationTag("zk")));
+
+    And andExpr = (And) constraintExpr;
+    Assert.assertEquals(3, andExpr.getChildren().size());
+    SingleConstraint sConstr = (SingleConstraint) andExpr.getChildren().get(0);
+    TargetExpression tExpr = sConstr.getTargetExpressions().iterator().next();
+    Assert.assertEquals("spark", tExpr.getTargetValues().iterator().next());
+
+    sConstr = (SingleConstraint) andExpr.getChildren().get(1);
+    Assert.assertEquals(0, sConstr.getMinCardinality());
+    Assert.assertEquals(3, sConstr.getMaxCardinality());
+
+    sConstr = (SingleConstraint) andExpr.getChildren().get(2);
+    Assert.assertEquals(2, sConstr.getMinCardinality());
+    Assert.assertEquals(10, sConstr.getMaxCardinality());
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/PlacementConstraintFromProtoConverter.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/PlacementConstraintFromProtoConverter.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/PlacementConstraintFromProtoConverter.java
new file mode 100644
index 0000000..926b6fa
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/PlacementConstraintFromProtoConverter.java
@@ -0,0 +1,116 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.pb;
+
+import static org.apache.hadoop.yarn.proto.YarnProtos.CompositePlacementConstraintProto.CompositeType.AND;
+
+import java.util.ArrayList;
+import java.util.HashSet;
+import java.util.List;
+import java.util.Set;
+
+import org.apache.hadoop.classification.InterfaceAudience.Private;
+import org.apache.hadoop.yarn.api.records.impl.pb.ProtoUtils;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.And;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.DelayedOr;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.Or;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TimedPlacementConstraint;
+import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
+import org.apache.hadoop.yarn.proto.YarnProtos.CompositePlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.PlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.PlacementConstraintTargetProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.SimplePlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.TimedPlacementConstraintProto;
+
+/**
+ * {@code PlacementConstraintFromProtoConverter} generates an
+ * {@link PlacementConstraint.AbstractConstraint} given a
+ * {@link PlacementConstraintProto}.
+ */
+@Private
+public class PlacementConstraintFromProtoConverter {
+
+  private PlacementConstraintProto constraintProto;
+
+  public PlacementConstraintFromProtoConverter(
+      PlacementConstraintProto constraintProto) {
+    this.constraintProto = constraintProto;
+  }
+
+  public PlacementConstraint convert() {
+    return new PlacementConstraint(convert(constraintProto));
+  }
+
+  private AbstractConstraint convert(PlacementConstraintProto proto) {
+    return proto.hasSimpleConstraint() ? convert(proto.getSimpleConstraint())
+        : convert(proto.getCompositeConstraint());
+  }
+
+  private SingleConstraint convert(SimplePlacementConstraintProto proto) {
+    Set<TargetExpression> targets = new HashSet<>();
+    for (PlacementConstraintTargetProto tp : proto.getTargetExpressionsList()) {
+      targets.add(convert(tp));
+    }
+
+    return new SingleConstraint(proto.getScope(), proto.getMinCardinality(),
+        proto.getMaxCardinality(), targets);
+  }
+
+  private TargetExpression convert(PlacementConstraintTargetProto proto) {
+    return new TargetExpression(
+        ProtoUtils.convertFromProtoFormat(proto.getTargetType()),
+        proto.hasTargetKey() ? proto.getTargetKey() : null,
+        new HashSet<>(proto.getTargetValuesList()));
+  }
+
+  private AbstractConstraint convert(CompositePlacementConstraintProto proto) {
+    switch (proto.getCompositeType()) {
+    case AND:
+    case OR:
+      List<AbstractConstraint> children = new ArrayList<>();
+      for (PlacementConstraintProto cp : proto.getChildConstraintsList()) {
+        children.add(convert(cp));
+      }
+      return (proto.getCompositeType() == AND) ? new And(children)
+          : new Or(children);
+    case DELAYED_OR:
+      List<TimedPlacementConstraint> tChildren = new ArrayList<>();
+      for (TimedPlacementConstraintProto cp : proto
+          .getTimedChildConstraintsList()) {
+        tChildren.add(convert(cp));
+      }
+      return new DelayedOr(tChildren);
+    default:
+      throw new YarnRuntimeException(
+          "Encountered unexpected type of composite constraint.");
+    }
+  }
+
+  private TimedPlacementConstraint convert(
+      TimedPlacementConstraintProto proto) {
+    AbstractConstraint pConstraint = convert(proto.getPlacementConstraint());
+
+    return new TimedPlacementConstraint(pConstraint, proto.getSchedulingDelay(),
+        ProtoUtils.convertFromProtoFormat(proto.getDelayUnit()));
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/PlacementConstraintToProtoConverter.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/PlacementConstraintToProtoConverter.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/PlacementConstraintToProtoConverter.java
new file mode 100644
index 0000000..7816e18
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/PlacementConstraintToProtoConverter.java
@@ -0,0 +1,174 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.pb;
+
+import org.apache.hadoop.classification.InterfaceAudience.Private;
+import org.apache.hadoop.yarn.api.records.impl.pb.ProtoUtils;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.And;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.CardinalityConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.CompositeConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.DelayedOr;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.Or;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TimedPlacementConstraint;
+import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
+import org.apache.hadoop.yarn.proto.YarnProtos.CompositePlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.CompositePlacementConstraintProto.CompositeType;
+import org.apache.hadoop.yarn.proto.YarnProtos.PlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.PlacementConstraintTargetProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.SimplePlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.TimedPlacementConstraintProto;
+
+import com.google.protobuf.GeneratedMessage;
+
+/**
+ * {@code PlacementConstraintToProtoConverter} generates a
+ * {@link PlacementConstraintProto} given a
+ * {@link PlacementConstraint.AbstractConstraint}.
+ */
+@Private
+public class PlacementConstraintToProtoConverter
+    implements PlacementConstraint.Visitor<GeneratedMessage> {
+
+  private PlacementConstraint placementConstraint;
+
+  public PlacementConstraintToProtoConverter(
+      PlacementConstraint placementConstraint) {
+    this.placementConstraint = placementConstraint;
+  }
+
+  public PlacementConstraintProto convert() {
+    return (PlacementConstraintProto) placementConstraint.getConstraintExpr()
+        .accept(this);
+  }
+
+  @Override
+  public GeneratedMessage visit(SingleConstraint constraint) {
+    SimplePlacementConstraintProto.Builder sb =
+        SimplePlacementConstraintProto.newBuilder();
+
+    if (constraint.getScope() != null) {
+      sb.setScope(constraint.getScope());
+    }
+    sb.setMinCardinality(constraint.getMinCardinality());
+    sb.setMaxCardinality(constraint.getMaxCardinality());
+    if (constraint.getTargetExpressions() != null) {
+      for (TargetExpression target : constraint.getTargetExpressions()) {
+        sb.addTargetExpressions(
+            (PlacementConstraintTargetProto) target.accept(this));
+      }
+
+    }
+    SimplePlacementConstraintProto sProto = sb.build();
+
+    // Wrap around PlacementConstraintProto object.
+    PlacementConstraintProto.Builder pb = PlacementConstraintProto.newBuilder();
+    pb.setSimpleConstraint(sProto);
+    return pb.build();
+  }
+
+  @Override
+  public GeneratedMessage visit(TargetExpression target) {
+    PlacementConstraintTargetProto.Builder tb =
+        PlacementConstraintTargetProto.newBuilder();
+
+    tb.setTargetType(ProtoUtils.convertToProtoFormat(target.getTargetType()));
+    if (target.getTargetKey() != null) {
+      tb.setTargetKey(target.getTargetKey());
+    }
+    if (target.getTargetValues() != null) {
+      tb.addAllTargetValues(target.getTargetValues());
+    }
+    return tb.build();
+  }
+
+  @Override
+  public GeneratedMessage visit(TargetConstraint constraint) {
+    throw new YarnRuntimeException("Unexpected TargetConstraint found.");
+  }
+
+  @Override
+  public GeneratedMessage visit(CardinalityConstraint constraint) {
+    throw new YarnRuntimeException("Unexpected CardinalityConstraint found.");
+  }
+
+  private GeneratedMessage visitAndOr(
+      CompositeConstraint<AbstractConstraint> composite, CompositeType type) {
+    CompositePlacementConstraintProto.Builder cb =
+        CompositePlacementConstraintProto.newBuilder();
+
+    cb.setCompositeType(type);
+
+    for (AbstractConstraint c : composite.getChildren()) {
+      cb.addChildConstraints((PlacementConstraintProto) c.accept(this));
+    }
+    CompositePlacementConstraintProto cProto = cb.build();
+
+    // Wrap around PlacementConstraintProto object.
+    PlacementConstraintProto.Builder pb = PlacementConstraintProto.newBuilder();
+    pb.setCompositeConstraint(cProto);
+    return pb.build();
+  }
+
+  @Override
+  public GeneratedMessage visit(And constraint) {
+    return visitAndOr(constraint, CompositeType.AND);
+  }
+
+  @Override
+  public GeneratedMessage visit(Or constraint) {
+    return visitAndOr(constraint, CompositeType.OR);
+  }
+
+  @Override
+  public GeneratedMessage visit(DelayedOr constraint) {
+    CompositePlacementConstraintProto.Builder cb =
+        CompositePlacementConstraintProto.newBuilder();
+
+    cb.setCompositeType(CompositeType.DELAYED_OR);
+
+    for (TimedPlacementConstraint c : constraint.getChildren()) {
+      cb.addTimedChildConstraints(
+          (TimedPlacementConstraintProto) c.accept(this));
+    }
+    CompositePlacementConstraintProto cProto = cb.build();
+
+    // Wrap around PlacementConstraintProto object.
+    PlacementConstraintProto.Builder pb = PlacementConstraintProto.newBuilder();
+    pb.setCompositeConstraint(cProto);
+    return pb.build();
+  }
+
+  @Override
+  public GeneratedMessage visit(TimedPlacementConstraint constraint) {
+    TimedPlacementConstraintProto.Builder tb =
+        TimedPlacementConstraintProto.newBuilder();
+
+    tb.setDelayUnit(ProtoUtils.convertToProtoFormat(constraint.getDelayUnit()));
+    tb.setSchedulingDelay(constraint.getSchedulingDelay());
+    tb.setPlacementConstraint(
+        (PlacementConstraintProto) constraint.getConstraint().accept(this));
+
+    return tb.build();
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/package-info.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/package-info.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/package-info.java
new file mode 100644
index 0000000..18da80f
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/pb/package-info.java
@@ -0,0 +1,23 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+/**
+ * API related to protobuf objects that are not backed by PBImpl classes.
+ */
+@InterfaceAudience.Private
+package org.apache.hadoop.yarn.api.pb;
+import org.apache.hadoop.classification.InterfaceAudience;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java
index f3e665b..168d864 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java
@@ -56,6 +56,8 @@ import org.apache.hadoop.yarn.api.records.UpdateContainerError;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.api.records.YarnApplicationAttemptState;
 import org.apache.hadoop.yarn.api.records.YarnApplicationState;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TimedPlacementConstraint;
 import org.apache.hadoop.yarn.proto.YarnProtos;
 import org.apache.hadoop.yarn.proto.YarnProtos.AMCommandProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ApplicationAccessTypeProto;
@@ -70,10 +72,12 @@ import org.apache.hadoop.yarn.proto.YarnProtos.LocalResourceVisibilityProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.LogAggregationStatusProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.NodeIdProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.NodeStateProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.PlacementConstraintTargetProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.QueueACLProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.QueueStateProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ReservationRequestInterpreterProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.TimedPlacementConstraintProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.YarnApplicationAttemptStateProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.YarnApplicationStateProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ContainerRetryPolicyProto;
@@ -507,6 +511,29 @@ public class ProtoUtils {
     }
     return ret;
   }
+
+  public static PlacementConstraintTargetProto.TargetType convertToProtoFormat(
+          TargetExpression.TargetType t) {
+    return PlacementConstraintTargetProto.TargetType.valueOf(t.name());
+  }
+
+  public static TargetExpression.TargetType convertFromProtoFormat(
+          PlacementConstraintTargetProto.TargetType t) {
+    return TargetExpression.TargetType.valueOf(t.name());
+  }
+
+  /*
+   * TimedPlacementConstraint.DelayUnit
+   */
+  public static TimedPlacementConstraintProto.DelayUnit convertToProtoFormat(
+          TimedPlacementConstraint.DelayUnit u) {
+    return TimedPlacementConstraintProto.DelayUnit.valueOf(u.name());
+  }
+
+  public static TimedPlacementConstraint.DelayUnit convertFromProtoFormat(
+          TimedPlacementConstraintProto.DelayUnit u) {
+    return TimedPlacementConstraint.DelayUnit.valueOf(u.name());
+  }
 }
 
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java
new file mode 100644
index 0000000..e9eda6f
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraintTransformations.java
@@ -0,0 +1,209 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.resource;
+
+import java.util.ListIterator;
+
+import org.apache.hadoop.classification.InterfaceAudience.Private;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.And;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.CardinalityConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.CompositeConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.DelayedOr;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.Or;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetConstraint.TargetOperator;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TimedPlacementConstraint;
+import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
+
+/**
+ * This class contains inner classes that define transformation on a
+ * {@link PlacementConstraint} expression.
+ */
+@Private
+public class PlacementConstraintTransformations {
+
+  /**
+   * The default implementation of the {@link PlacementConstraint.Visitor} that
+   * does a traversal of the constraint tree, performing no action for the lead
+   * constraints.
+   */
+  public static class AbstractTransformer
+      implements PlacementConstraint.Visitor<AbstractConstraint> {
+
+    private PlacementConstraint placementConstraint;
+
+    public AbstractTransformer(PlacementConstraint placementConstraint) {
+      this.placementConstraint = placementConstraint;
+    }
+
+    /**
+     * This method performs the transformation of the
+     * {@link #placementConstraint}.
+     *
+     * @return the transformed placement constraint.
+     */
+    public PlacementConstraint transform() {
+      AbstractConstraint constraintExpr =
+          placementConstraint.getConstraintExpr();
+
+      // Visit the constraint tree to perform the transformation.
+      constraintExpr = constraintExpr.accept(this);
+
+      return new PlacementConstraint(constraintExpr);
+    }
+
+    @Override
+    public AbstractConstraint visit(SingleConstraint constraint) {
+      // Do nothing.
+      return constraint;
+    }
+
+    @Override
+    public AbstractConstraint visit(TargetExpression expression) {
+      // Do nothing.
+      return null;
+    }
+
+    @Override
+    public AbstractConstraint visit(TargetConstraint constraint) {
+      // Do nothing.
+      return constraint;
+    }
+
+    @Override
+    public AbstractConstraint visit(CardinalityConstraint constraint) {
+      // Do nothing.
+      return constraint;
+    }
+
+    private AbstractConstraint visitAndOr(
+        CompositeConstraint<AbstractConstraint> constraint) {
+      for (ListIterator<AbstractConstraint> iter =
+          constraint.getChildren().listIterator(); iter.hasNext();) {
+        AbstractConstraint child = iter.next();
+        child = child.accept(this);
+        iter.set(child);
+      }
+      return constraint;
+    }
+
+    @Override
+    public AbstractConstraint visit(And constraint) {
+      return visitAndOr(constraint);
+    }
+
+    @Override
+    public AbstractConstraint visit(Or constraint) {
+      return visitAndOr(constraint);
+    }
+
+    @Override
+    public AbstractConstraint visit(DelayedOr constraint) {
+      constraint.getChildren().forEach(
+          child -> child.setConstraint(child.getConstraint().accept(this)));
+      return constraint;
+    }
+
+    @Override
+    public AbstractConstraint visit(TimedPlacementConstraint constraint) {
+      // Do nothing.
+      return null;
+    }
+  }
+
+  /**
+   * Visits a {@link PlacementConstraint} tree and substitutes each
+   * {@link TargetConstraint} and {@link CardinalityConstraint} with an
+   * equivalent {@link SingleConstraint}.
+   */
+  public static class SingleConstraintTransformer extends AbstractTransformer {
+
+    public SingleConstraintTransformer(PlacementConstraint constraint) {
+      super(constraint);
+    }
+
+    @Override
+    public AbstractConstraint visit(TargetConstraint constraint) {
+      AbstractConstraint newConstraint;
+      if (constraint.getOp() == TargetOperator.IN) {
+        newConstraint = new SingleConstraint(constraint.getScope(), 1,
+            Integer.MAX_VALUE, constraint.getTargetExpressions());
+      } else if (constraint.getOp() == TargetOperator.NOT_IN) {
+        newConstraint = new SingleConstraint(constraint.getScope(), 0, 0,
+            constraint.getTargetExpressions());
+      } else {
+        throw new YarnRuntimeException(
+            "Encountered unexpected type of constraint target operator: "
+                + constraint.getOp());
+      }
+      return newConstraint;
+    }
+
+    @Override
+    public AbstractConstraint visit(CardinalityConstraint constraint) {
+      return new SingleConstraint(constraint.getScope(),
+          constraint.getMinCardinality(), constraint.getMaxCardinality(),
+          new TargetExpression(TargetExpression.TargetType.SELF));
+    }
+  }
+
+  /**
+   * Visits a {@link PlacementConstraint} tree and, whenever possible,
+   * substitutes each {@link SingleConstraint} with a {@link TargetConstraint}
+   * or a {@link CardinalityConstraint}. When such a substitution is not
+   * possible, we keep the original {@link SingleConstraint}.
+   */
+  public static class SpecializedConstraintTransformer
+      extends AbstractTransformer {
+
+    public SpecializedConstraintTransformer(PlacementConstraint constraint) {
+      super(constraint);
+    }
+
+    @Override
+    public AbstractConstraint visit(SingleConstraint constraint) {
+      AbstractConstraint transformedConstraint = constraint;
+      // Check if it is a cardinality constraint.
+      if (constraint.getTargetExpressions().size() == 1) {
+        TargetExpression targetExpr =
+            constraint.getTargetExpressions().iterator().next();
+        if (targetExpr.getTargetType() == TargetExpression.TargetType.SELF) {
+          transformedConstraint = new CardinalityConstraint(
+              constraint.getScope(), constraint.getMinCardinality(),
+              constraint.getMaxCardinality());
+        }
+      }
+      // Check if it is a target constraint.
+      if (constraint.getMinCardinality() == 1
+          && constraint.getMaxCardinality() == Integer.MAX_VALUE) {
+        transformedConstraint = new TargetConstraint(TargetOperator.IN,
+            constraint.getScope(), constraint.getTargetExpressions());
+      } else if (constraint.getMinCardinality() == 0
+          && constraint.getMaxCardinality() == 0) {
+        transformedConstraint = new TargetConstraint(TargetOperator.NOT_IN,
+            constraint.getScope(), constraint.getTargetExpressions());
+      }
+
+      return transformedConstraint;
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/package-info.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/package-info.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/package-info.java
new file mode 100644
index 0000000..660dc02
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/resource/package-info.java
@@ -0,0 +1,23 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+/**
+ * API related to resources.
+ */
+@InterfaceAudience.Private
+package org.apache.hadoop.yarn.api.resource;
+import org.apache.hadoop.classification.InterfaceAudience;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPlacementConstraintPBConversion.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPlacementConstraintPBConversion.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPlacementConstraintPBConversion.java
new file mode 100644
index 0000000..bd245e2
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPlacementConstraintPBConversion.java
@@ -0,0 +1,195 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api;
+
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.RACK;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.cardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.maxCardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.or;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetCardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.allocationTag;
+
+import java.util.Iterator;
+
+import org.apache.hadoop.yarn.api.pb.PlacementConstraintFromProtoConverter;
+import org.apache.hadoop.yarn.api.pb.PlacementConstraintToProtoConverter;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.Or;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.proto.YarnProtos.CompositePlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.CompositePlacementConstraintProto.CompositeType;
+import org.apache.hadoop.yarn.proto.YarnProtos.PlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.SimplePlacementConstraintProto;
+import org.junit.Assert;
+import org.junit.Test;
+
+/**
+ * Test class for {@link PlacementConstraintToProtoConverter} and
+ * {@link PlacementConstraintFromProtoConverter}.
+ */
+public class TestPlacementConstraintPBConversion {
+
+  @Test
+  public void testTargetConstraintProtoConverter() {
+    AbstractConstraint sConstraintExpr =
+        targetIn(NODE, allocationTag("hbase-m"));
+    Assert.assertTrue(sConstraintExpr instanceof SingleConstraint);
+    SingleConstraint single = (SingleConstraint) sConstraintExpr;
+    PlacementConstraint sConstraint =
+        PlacementConstraints.build(sConstraintExpr);
+
+    // Convert to proto.
+    PlacementConstraintToProtoConverter toProtoConverter =
+        new PlacementConstraintToProtoConverter(sConstraint);
+    PlacementConstraintProto protoConstraint = toProtoConverter.convert();
+
+    Assert.assertTrue(protoConstraint.hasSimpleConstraint());
+    Assert.assertFalse(protoConstraint.hasCompositeConstraint());
+    SimplePlacementConstraintProto sProto =
+        protoConstraint.getSimpleConstraint();
+    Assert.assertEquals(single.getScope(), sProto.getScope());
+    Assert.assertEquals(single.getMinCardinality(), sProto.getMinCardinality());
+    Assert.assertEquals(single.getMaxCardinality(), sProto.getMaxCardinality());
+    Assert.assertEquals(single.getTargetExpressions().size(),
+        sProto.getTargetExpressionsList().size());
+
+    // Convert from proto.
+    PlacementConstraintFromProtoConverter fromProtoConverter =
+        new PlacementConstraintFromProtoConverter(protoConstraint);
+    PlacementConstraint newConstraint = fromProtoConverter.convert();
+
+    AbstractConstraint newConstraintExpr = newConstraint.getConstraintExpr();
+    Assert.assertTrue(newConstraintExpr instanceof SingleConstraint);
+    SingleConstraint newSingle = (SingleConstraint) newConstraintExpr;
+    Assert.assertEquals(single.getScope(), newSingle.getScope());
+    Assert.assertEquals(single.getMinCardinality(),
+        newSingle.getMinCardinality());
+    Assert.assertEquals(single.getMaxCardinality(),
+        newSingle.getMaxCardinality());
+    Assert.assertEquals(single.getTargetExpressions(),
+        newSingle.getTargetExpressions());
+  }
+
+  @Test
+  public void testCardinalityConstraintProtoConverter() {
+    AbstractConstraint sConstraintExpr = cardinality(RACK, 3, 10);
+    Assert.assertTrue(sConstraintExpr instanceof SingleConstraint);
+    SingleConstraint single = (SingleConstraint) sConstraintExpr;
+    PlacementConstraint sConstraint =
+        PlacementConstraints.build(sConstraintExpr);
+
+    // Convert to proto.
+    PlacementConstraintToProtoConverter toProtoConverter =
+        new PlacementConstraintToProtoConverter(sConstraint);
+    PlacementConstraintProto protoConstraint = toProtoConverter.convert();
+
+    compareSimpleConstraintToProto(single, protoConstraint);
+
+    // Convert from proto.
+    PlacementConstraintFromProtoConverter fromProtoConverter =
+        new PlacementConstraintFromProtoConverter(protoConstraint);
+    PlacementConstraint newConstraint = fromProtoConverter.convert();
+
+    AbstractConstraint newConstraintExpr = newConstraint.getConstraintExpr();
+    Assert.assertTrue(newConstraintExpr instanceof SingleConstraint);
+    SingleConstraint newSingle = (SingleConstraint) newConstraintExpr;
+    compareSimpleConstraints(single, newSingle);
+  }
+
+  @Test
+  public void testCompositeConstraintProtoConverter() {
+    AbstractConstraint constraintExpr =
+        or(targetIn(RACK, allocationTag("spark")), maxCardinality(NODE, 3),
+            targetCardinality(RACK, 2, 10, allocationTag("zk")));
+    Assert.assertTrue(constraintExpr instanceof Or);
+    PlacementConstraint constraint = PlacementConstraints.build(constraintExpr);
+    Or orExpr = (Or) constraintExpr;
+
+    // Convert to proto.
+    PlacementConstraintToProtoConverter toProtoConverter =
+        new PlacementConstraintToProtoConverter(constraint);
+    PlacementConstraintProto protoConstraint = toProtoConverter.convert();
+
+    Assert.assertFalse(protoConstraint.hasSimpleConstraint());
+    Assert.assertTrue(protoConstraint.hasCompositeConstraint());
+    CompositePlacementConstraintProto cProto =
+        protoConstraint.getCompositeConstraint();
+
+    Assert.assertEquals(CompositeType.OR, cProto.getCompositeType());
+    Assert.assertEquals(3, cProto.getChildConstraintsCount());
+    Assert.assertEquals(0, cProto.getTimedChildConstraintsCount());
+    Iterator<AbstractConstraint> orChildren = orExpr.getChildren().iterator();
+    Iterator<PlacementConstraintProto> orProtoChildren =
+        cProto.getChildConstraintsList().iterator();
+    while (orChildren.hasNext() && orProtoChildren.hasNext()) {
+      AbstractConstraint orChild = orChildren.next();
+      PlacementConstraintProto orProtoChild = orProtoChildren.next();
+      compareSimpleConstraintToProto((SingleConstraint) orChild, orProtoChild);
+    }
+
+    // Convert from proto.
+    PlacementConstraintFromProtoConverter fromProtoConverter =
+        new PlacementConstraintFromProtoConverter(protoConstraint);
+    PlacementConstraint newConstraint = fromProtoConverter.convert();
+
+    AbstractConstraint newConstraintExpr = newConstraint.getConstraintExpr();
+    Assert.assertTrue(newConstraintExpr instanceof Or);
+    Or newOrExpr = (Or) newConstraintExpr;
+    Assert.assertEquals(3, newOrExpr.getChildren().size());
+    orChildren = orExpr.getChildren().iterator();
+    Iterator<AbstractConstraint> newOrChildren =
+        newOrExpr.getChildren().iterator();
+    while (orChildren.hasNext() && newOrChildren.hasNext()) {
+      AbstractConstraint orChild = orChildren.next();
+      AbstractConstraint newOrChild = newOrChildren.next();
+      compareSimpleConstraints((SingleConstraint) orChild,
+          (SingleConstraint) newOrChild);
+    }
+  }
+
+  private void compareSimpleConstraintToProto(SingleConstraint constraint,
+      PlacementConstraintProto proto) {
+    Assert.assertTrue(proto.hasSimpleConstraint());
+    Assert.assertFalse(proto.hasCompositeConstraint());
+    SimplePlacementConstraintProto sProto = proto.getSimpleConstraint();
+    Assert.assertEquals(constraint.getScope(), sProto.getScope());
+    Assert.assertEquals(constraint.getMinCardinality(),
+        sProto.getMinCardinality());
+    Assert.assertEquals(constraint.getMaxCardinality(),
+        sProto.getMaxCardinality());
+    Assert.assertEquals(constraint.getTargetExpressions().size(),
+        sProto.getTargetExpressionsList().size());
+  }
+
+  private void compareSimpleConstraints(SingleConstraint single,
+      SingleConstraint newSingle) {
+    Assert.assertEquals(single.getScope(), newSingle.getScope());
+    Assert.assertEquals(single.getMinCardinality(),
+        newSingle.getMinCardinality());
+    Assert.assertEquals(single.getMaxCardinality(),
+        newSingle.getMaxCardinality());
+    Assert.assertEquals(single.getTargetExpressions(),
+        newSingle.getTargetExpressions());
+  }
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/50cfc788/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java
new file mode 100644
index 0000000..1763735
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/resource/TestPlacementConstraintTransformations.java
@@ -0,0 +1,183 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.resource;
+
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.RACK;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.cardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.maxCardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.or;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetCardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.allocationTag;
+
+import java.util.Arrays;
+import java.util.HashSet;
+import java.util.List;
+
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.CardinalityConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.Or;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetConstraint.TargetOperator;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations.SingleConstraintTransformer;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations.SpecializedConstraintTransformer;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets;
+import org.junit.Assert;
+import org.junit.Test;
+
+/**
+ * Test class for {@link PlacementConstraintTransformations}.
+ */
+public class TestPlacementConstraintTransformations {
+
+  @Test
+  public void testTargetConstraint() {
+    AbstractConstraint sConstraintExpr =
+        targetIn(NODE, allocationTag("hbase-m"));
+    Assert.assertTrue(sConstraintExpr instanceof SingleConstraint);
+    PlacementConstraint sConstraint =
+        PlacementConstraints.build(sConstraintExpr);
+
+    // Transform from SimpleConstraint to specialized TargetConstraint
+    SpecializedConstraintTransformer specTransformer =
+        new SpecializedConstraintTransformer(sConstraint);
+    PlacementConstraint tConstraint = specTransformer.transform();
+
+    AbstractConstraint tConstraintExpr = tConstraint.getConstraintExpr();
+    Assert.assertTrue(tConstraintExpr instanceof TargetConstraint);
+
+    SingleConstraint single = (SingleConstraint) sConstraintExpr;
+    TargetConstraint target = (TargetConstraint) tConstraintExpr;
+    Assert.assertEquals(single.getScope(), target.getScope());
+    Assert.assertEquals(TargetOperator.IN, target.getOp());
+    Assert.assertEquals(single.getTargetExpressions(),
+        target.getTargetExpressions());
+
+    // Transform from specialized TargetConstraint to SimpleConstraint
+    SingleConstraintTransformer singleTransformer =
+        new SingleConstraintTransformer(tConstraint);
+    sConstraint = singleTransformer.transform();
+
+    sConstraintExpr = sConstraint.getConstraintExpr();
+    Assert.assertTrue(sConstraintExpr instanceof SingleConstraint);
+
+    single = (SingleConstraint) sConstraintExpr;
+    Assert.assertEquals(target.getScope(), single.getScope());
+    Assert.assertEquals(1, single.getMinCardinality());
+    Assert.assertEquals(Integer.MAX_VALUE, single.getMaxCardinality());
+    Assert.assertEquals(single.getTargetExpressions(),
+        target.getTargetExpressions());
+  }
+
+  @Test
+  public void testCardinalityConstraint() {
+    AbstractConstraint sConstraintExpr = cardinality(RACK, 3, 10);
+    Assert.assertTrue(sConstraintExpr instanceof SingleConstraint);
+    PlacementConstraint sConstraint =
+        PlacementConstraints.build(sConstraintExpr);
+
+    // Transform from SimpleConstraint to specialized CardinalityConstraint
+    SpecializedConstraintTransformer specTransformer =
+        new SpecializedConstraintTransformer(sConstraint);
+    PlacementConstraint cConstraint = specTransformer.transform();
+
+    AbstractConstraint cConstraintExpr = cConstraint.getConstraintExpr();
+    Assert.assertTrue(cConstraintExpr instanceof CardinalityConstraint);
+
+    SingleConstraint single = (SingleConstraint) sConstraintExpr;
+    CardinalityConstraint cardinality = (CardinalityConstraint) cConstraintExpr;
+    Assert.assertEquals(single.getScope(), cardinality.getScope());
+    Assert.assertEquals(single.getMinCardinality(),
+        cardinality.getMinCardinality());
+    Assert.assertEquals(single.getMaxCardinality(),
+        cardinality.getMaxCardinality());
+
+    // Transform from specialized CardinalityConstraint to SimpleConstraint
+    SingleConstraintTransformer singleTransformer =
+        new SingleConstraintTransformer(cConstraint);
+    sConstraint = singleTransformer.transform();
+
+    sConstraintExpr = sConstraint.getConstraintExpr();
+    Assert.assertTrue(sConstraintExpr instanceof SingleConstraint);
+
+    single = (SingleConstraint) sConstraintExpr;
+    Assert.assertEquals(cardinality.getScope(), single.getScope());
+    Assert.assertEquals(cardinality.getMinCardinality(),
+        single.getMinCardinality());
+    Assert.assertEquals(cardinality.getMaxCardinality(),
+        single.getMaxCardinality());
+    Assert.assertEquals(new HashSet<>(Arrays.asList(PlacementTargets.self())),
+        single.getTargetExpressions());
+  }
+
+  @Test
+  public void testTargetCardinalityConstraint() {
+    AbstractConstraint constraintExpr =
+        targetCardinality(RACK, 3, 10, allocationTag("zk"));
+    Assert.assertTrue(constraintExpr instanceof SingleConstraint);
+    PlacementConstraint constraint = PlacementConstraints.build(constraintExpr);
+
+    // Apply transformation. Should be a no-op.
+    SpecializedConstraintTransformer specTransformer =
+        new SpecializedConstraintTransformer(constraint);
+    PlacementConstraint newConstraint = specTransformer.transform();
+
+    // The constraint expression should be the same.
+    Assert.assertEquals(constraintExpr, newConstraint.getConstraintExpr());
+  }
+
+  @Test
+  public void testCompositeConstraint() {
+    AbstractConstraint constraintExpr =
+        or(targetIn(RACK, allocationTag("spark")), maxCardinality(NODE, 3),
+            targetCardinality(RACK, 2, 10, allocationTag("zk")));
+    Assert.assertTrue(constraintExpr instanceof Or);
+    PlacementConstraint constraint = PlacementConstraints.build(constraintExpr);
+    Or orExpr = (Or) constraintExpr;
+    for (AbstractConstraint child : orExpr.getChildren()) {
+      Assert.assertTrue(child instanceof SingleConstraint);
+    }
+
+    // Apply transformation. Should transform target and cardinality constraints
+    // included in the composite constraint to specialized ones.
+    SpecializedConstraintTransformer specTransformer =
+        new SpecializedConstraintTransformer(constraint);
+    PlacementConstraint specConstraint = specTransformer.transform();
+
+    Or specOrExpr = (Or) specConstraint.getConstraintExpr();
+    List<AbstractConstraint> specChildren = specOrExpr.getChildren();
+    Assert.assertEquals(3, specChildren.size());
+    Assert.assertTrue(specChildren.get(0) instanceof TargetConstraint);
+    Assert.assertTrue(specChildren.get(1) instanceof CardinalityConstraint);
+    Assert.assertTrue(specChildren.get(2) instanceof SingleConstraint);
+
+    // Transform from specialized TargetConstraint to SimpleConstraint
+    SingleConstraintTransformer singleTransformer =
+        new SingleConstraintTransformer(specConstraint);
+    PlacementConstraint simConstraint = singleTransformer.transform();
+    Assert.assertTrue(constraintExpr instanceof Or);
+    Or simOrExpr = (Or) specConstraint.getConstraintExpr();
+    for (AbstractConstraint child : simOrExpr.getChildren()) {
+      Assert.assertTrue(child instanceof SingleConstraint);
+    }
+  }
+
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[46/50] [abbrv] hadoop git commit: YARN-7788. Factor out management of temp tags from AllocationTagsManager. (Arun Suresh via kkaranasos)

Posted by as...@apache.org.
YARN-7788. Factor out management of temp tags from AllocationTagsManager. (Arun Suresh via kkaranasos)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/fca7371f
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/fca7371f
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/fca7371f

Branch: refs/heads/YARN-6592
Commit: fca7371f48cbd1faad6d06287b89a2526a0ff9d3
Parents: 3803dea
Author: Konstantinos Karanasos <kk...@apache.org>
Authored: Mon Jan 22 23:51:02 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../constraint/AllocationTagsManager.java       | 110 +++---------
 .../algorithm/DefaultPlacementAlgorithm.java    |   8 +-
 .../algorithm/LocalAllocationTagsManager.java   | 167 +++++++++++++++++++
 .../constraint/TestAllocationTagsManager.java   |  82 ---------
 .../TestLocalAllocationTagsManager.java         | 139 +++++++++++++++
 5 files changed, 336 insertions(+), 170 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/fca7371f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
index 962e548..7ad5e8c 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
@@ -24,17 +24,14 @@ import com.google.common.annotations.VisibleForTesting;
 import org.apache.commons.lang.StringUtils;
 import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceStability;
-import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
 import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.log4j.Logger;
 
 import java.util.HashMap;
-import java.util.HashSet;
 import java.util.Map;
 import java.util.Set;
 import java.util.concurrent.locks.ReentrantReadWriteLock;
@@ -61,9 +58,6 @@ public class AllocationTagsManager {
   // Application's tags to Rack
   private Map<ApplicationId, TypeToCountedTags> perAppRackMappings =
       new HashMap<>();
-  // Application's Temporary containers mapping
-  private Map<ApplicationId, Map<NodeId, Map<ContainerId, Set<String>>>>
-      appTempMappings = new HashMap<>();
 
   // Global tags to node mapping (used to fast return aggregated tags
   // cardinality across apps)
@@ -76,7 +70,7 @@ public class AllocationTagsManager {
    * Currently used both for NodeId to Tag, Count and Rack to Tag, Count
    */
   @VisibleForTesting
-  static class TypeToCountedTags<T> {
+  public static class TypeToCountedTags<T> {
     // Map<Type, Map<Tag, Count>>
     private Map<T, Map<String, Long>> typeToTagsWithCount = new HashMap<>();
 
@@ -214,7 +208,7 @@ public class AllocationTagsManager {
   }
 
   @VisibleForTesting
-  Map<ApplicationId, TypeToCountedTags> getPerAppNodeMappings() {
+  public Map<ApplicationId, TypeToCountedTags> getPerAppNodeMappings() {
     return perAppNodeMappings;
   }
 
@@ -233,12 +227,6 @@ public class AllocationTagsManager {
     return globalRackMapping;
   }
 
-  @VisibleForTesting
-  public Map<NodeId, Map<ContainerId, Set<String>>> getAppTempMappings(
-      ApplicationId applicationId) {
-    return appTempMappings.get(applicationId);
-  }
-
   public AllocationTagsManager(RMContext context) {
     ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
     readLock = lock.readLock();
@@ -246,39 +234,6 @@ public class AllocationTagsManager {
     rmContext = context;
   }
 
-  //
-
-  /**
-   * Method adds a temporary fake-container tag to Node mapping.
-   * Used by the constrained placement algorithm to keep track of containers
-   * that are currently placed on nodes but are not yet allocated.
-   * @param nodeId
-   * @param applicationId
-   * @param allocationTags
-   */
-  public void addTempContainer(NodeId nodeId, ApplicationId applicationId,
-      Set<String> allocationTags) {
-    ContainerId tmpContainer = ContainerId.newContainerId(
-        ApplicationAttemptId.newInstance(applicationId, 1), System.nanoTime());
-
-    writeLock.lock();
-    try {
-      Map<NodeId, Map<ContainerId, Set<String>>> appTempMapping =
-          appTempMappings.computeIfAbsent(applicationId, k -> new HashMap<>());
-      Map<ContainerId, Set<String>> containerTempMapping =
-          appTempMapping.computeIfAbsent(nodeId, k -> new HashMap<>());
-      containerTempMapping.put(tmpContainer, allocationTags);
-      if (LOG.isDebugEnabled()) {
-        LOG.debug("Added TEMP container=" + tmpContainer + " with tags=["
-            + StringUtils.join(allocationTags, ",") + "]");
-      }
-    } finally {
-      writeLock.unlock();
-    }
-
-    addContainer(nodeId, tmpContainer, allocationTags);
-  }
-
   /**
    * Notify container allocated on a node.
    *
@@ -297,6 +252,15 @@ public class AllocationTagsManager {
     }
     ApplicationId applicationId =
         containerId.getApplicationAttemptId().getApplicationId();
+    addTags(nodeId, applicationId, allocationTags);
+    if (LOG.isDebugEnabled()) {
+      LOG.debug("Added container=" + containerId + " with tags=["
+          + StringUtils.join(allocationTags, ",") + "]");
+    }
+  }
+
+  public void addTags(NodeId nodeId, ApplicationId applicationId,
+      Set<String> allocationTags) {
     writeLock.lock();
     try {
       TypeToCountedTags perAppTagsMapping = perAppNodeMappings
@@ -312,11 +276,6 @@ public class AllocationTagsManager {
       perAppRackTagsMapping.addTags(nodeRack, allocationTags);
       globalNodeMapping.addTags(nodeId, allocationTags);
       globalRackMapping.addTags(nodeRack, allocationTags);
-
-      if (LOG.isDebugEnabled()) {
-        LOG.debug("Added container=" + containerId + " with tags=["
-            + StringUtils.join(allocationTags, ",") + "]");
-      }
     } finally {
       writeLock.unlock();
     }
@@ -339,6 +298,21 @@ public class AllocationTagsManager {
     ApplicationId applicationId =
         containerId.getApplicationAttemptId().getApplicationId();
 
+    removeTags(nodeId, applicationId, allocationTags);
+    if (LOG.isDebugEnabled()) {
+      LOG.debug("Removed container=" + containerId + " with tags=["
+          + StringUtils.join(allocationTags, ",") + "]");
+    }
+  }
+
+  /**
+   * Helper method to just remove the tags associated with a container.
+   * @param nodeId
+   * @param applicationId
+   * @param allocationTags
+   */
+  public void removeTags(NodeId nodeId, ApplicationId applicationId,
+      Set<String> allocationTags) {
     writeLock.lock();
     try {
       TypeToCountedTags perAppTagsMapping =
@@ -364,43 +338,11 @@ public class AllocationTagsManager {
       if (perAppRackTagsMapping.isEmpty()) {
         perAppRackMappings.remove(applicationId);
       }
-
-      if (LOG.isDebugEnabled()) {
-        LOG.debug("Removed container=" + containerId + " with tags=["
-            + StringUtils.join(allocationTags, ",") + "]");
-      }
     } finally {
       writeLock.unlock();
     }
   }
 
-  /**
-   * Method removes temporary containers associated with an application
-   * Used by the placement algorithm to clean temporary tags at the end of
-   * a placement cycle.
-   * @param applicationId Application Id.
-   */
-  public void cleanTempContainers(ApplicationId applicationId) {
-
-    if (!appTempMappings.get(applicationId).isEmpty()) {
-      appTempMappings.get(applicationId).entrySet().stream().forEach(nodeE -> {
-        nodeE.getValue().entrySet().stream().forEach(containerE -> {
-          removeContainer(nodeE.getKey(), containerE.getKey(),
-              containerE.getValue());
-        });
-      });
-      writeLock.lock();
-      try {
-        appTempMappings.remove(applicationId);
-        if (LOG.isDebugEnabled()) {
-          LOG.debug("Removed TEMP containers of app=" + applicationId);
-        }
-      } finally {
-        writeLock.unlock();
-      }
-    }
-  }
-
 
   /**
    * Get Node cardinality for a specific tag.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fca7371f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
index cf2ed15..9887749 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
@@ -26,7 +26,6 @@ import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractYarnScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintsUtil;
@@ -53,13 +52,14 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
   // Number of times to re-attempt placing a single scheduling request.
   private static final int RE_ATTEMPT_COUNT = 2;
 
-  private AllocationTagsManager tagsManager;
+  private LocalAllocationTagsManager tagsManager;
   private PlacementConstraintManager constraintManager;
   private NodeCandidateSelector nodeSelector;
 
   @Override
   public void init(RMContext rmContext) {
-    this.tagsManager = rmContext.getAllocationTagsManager();
+    this.tagsManager = new LocalAllocationTagsManager(
+        rmContext.getAllocationTagsManager());
     this.constraintManager = rmContext.getPlacementConstraintManager();
     this.nodeSelector =
         filter -> ((AbstractYarnScheduler) (rmContext).getScheduler())
@@ -143,7 +143,7 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
             numAllocs =
                 schedulingRequest.getResourceSizing().getNumAllocations();
             // Add temp-container tags for current placement cycle
-            this.tagsManager.addTempContainer(node.getNodeID(),
+            this.tagsManager.addTempTags(node.getNodeID(),
                 requests.getApplicationId(),
                 schedulingRequest.getAllocationTags());
             lastSatisfiedNode = node;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fca7371f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/LocalAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/LocalAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/LocalAllocationTagsManager.java
new file mode 100644
index 0000000..9472719
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/LocalAllocationTagsManager.java
@@ -0,0 +1,167 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm;
+
+import org.apache.commons.lang.StringUtils;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.ContainerId;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.Map;
+import java.util.Set;
+import java.util.concurrent.atomic.AtomicInteger;
+import java.util.function.LongBinaryOperator;
+
+class LocalAllocationTagsManager extends AllocationTagsManager {
+
+  private static final Logger LOG =
+      LoggerFactory.getLogger(LocalAllocationTagsManager.class);
+
+  private final AllocationTagsManager tagsManager;
+
+  // Application's Temporary containers mapping
+  private Map<ApplicationId, Map<NodeId, Map<String, AtomicInteger>>>
+      appTempMappings = new HashMap<>();
+
+  LocalAllocationTagsManager(
+      AllocationTagsManager allocationTagsManager) {
+    super(null);
+    this.tagsManager = allocationTagsManager;
+  }
+
+  void addTempTags(NodeId nodeId,
+      ApplicationId applicationId, Set<String> allocationTags) {
+    Map<NodeId, Map<String, AtomicInteger>> appTempMapping =
+        appTempMappings.computeIfAbsent(applicationId, k -> new HashMap<>());
+    Map<String, AtomicInteger> containerTempMapping =
+        appTempMapping.computeIfAbsent(nodeId, k -> new HashMap<>());
+    for (String tag : allocationTags) {
+      containerTempMapping.computeIfAbsent(tag,
+          k -> new AtomicInteger(0)).incrementAndGet();
+    }
+    if (LOG.isDebugEnabled()) {
+      LOG.debug("Added TEMP container with tags=["
+          + StringUtils.join(allocationTags, ",") + "]");
+    }
+    tagsManager.addTags(nodeId, applicationId, allocationTags);
+  }
+
+  void removeTempTags(NodeId nodeId, ApplicationId applicationId,
+      Set<String> allocationTags) {
+    Map<NodeId, Map<String, AtomicInteger>> appTempMapping =
+        appTempMappings.get(applicationId);
+    if (appTempMapping != null) {
+      Map<String, AtomicInteger> containerTempMap =
+          appTempMapping.get(nodeId);
+      if (containerTempMap != null) {
+        for (String tag : allocationTags) {
+          AtomicInteger count = containerTempMap.get(tag);
+          if (count != null) {
+            if (count.decrementAndGet() <= 0) {
+              containerTempMap.remove(tag);
+            }
+          }
+        }
+      }
+    }
+    if (allocationTags != null) {
+      removeTags(nodeId, applicationId, allocationTags);
+    }
+  }
+
+  /**
+   * Method removes temporary containers associated with an application
+   * Used by the placement algorithm to clean temporary tags at the end of
+   * a placement cycle.
+   * @param applicationId Application Id.
+   */
+  public void cleanTempContainers(ApplicationId applicationId) {
+
+    if (!appTempMappings.get(applicationId).isEmpty()) {
+      appTempMappings.get(applicationId).entrySet().stream().forEach(nodeE -> {
+        nodeE.getValue().entrySet().stream().forEach(tagE -> {
+          for (int i = 0; i < tagE.getValue().get(); i++) {
+            removeTags(nodeE.getKey(), applicationId,
+                Collections.singleton(tagE.getKey()));
+          }
+        });
+      });
+      appTempMappings.remove(applicationId);
+      if (LOG.isDebugEnabled()) {
+        LOG.debug("Removed TEMP containers of app=" + applicationId);
+      }
+    }
+  }
+
+  @Override
+  public void addContainer(NodeId nodeId, ContainerId containerId,
+      Set<String> allocationTags) {
+    tagsManager.addContainer(nodeId, containerId, allocationTags);
+  }
+
+  @Override
+  public void removeContainer(NodeId nodeId, ContainerId containerId,
+      Set<String> allocationTags) {
+    tagsManager.removeContainer(nodeId, containerId, allocationTags);
+  }
+
+  @Override
+  public void removeTags(NodeId nodeId, ApplicationId applicationId,
+      Set<String> allocationTags) {
+    tagsManager.removeTags(nodeId, applicationId, allocationTags);
+  }
+
+  @Override
+  public long getNodeCardinality(NodeId nodeId, ApplicationId applicationId,
+      String tag) throws InvalidAllocationTagsQueryException {
+    return tagsManager.getNodeCardinality(nodeId, applicationId, tag);
+  }
+
+  @Override
+  public long getRackCardinality(String rack, ApplicationId applicationId,
+      String tag) throws InvalidAllocationTagsQueryException {
+    return tagsManager.getRackCardinality(rack, applicationId, tag);
+  }
+
+  @Override
+  public boolean allocationTagExistsOnNode(NodeId nodeId,
+      ApplicationId applicationId, String tag)
+      throws InvalidAllocationTagsQueryException {
+    return tagsManager.allocationTagExistsOnNode(nodeId, applicationId, tag);
+  }
+
+  @Override
+  public long getNodeCardinalityByOp(NodeId nodeId,
+      ApplicationId applicationId, Set<String> tags, LongBinaryOperator op)
+      throws InvalidAllocationTagsQueryException {
+    return tagsManager.getNodeCardinalityByOp(nodeId, applicationId, tags, op);
+  }
+
+  @Override
+  public long getRackCardinalityByOp(String rack, ApplicationId applicationId,
+      Set<String> tags, LongBinaryOperator op)
+      throws InvalidAllocationTagsQueryException {
+    return tagsManager.getRackCardinalityByOp(rack, applicationId, tags, op);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fca7371f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
index 7afe4ef..76f451e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
@@ -23,7 +23,6 @@ package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
 import com.google.common.collect.ImmutableSet;
 import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.Resource;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.server.resourcemanager.MockNodes;
 import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
@@ -363,87 +362,6 @@ public class TestAllocationTagsManager {
   }
 
   @Test
-  public void testTempContainerAllocations()
-      throws InvalidAllocationTagsQueryException {
-    /**
-     * Construct both TEMP and normal containers: Node1: TEMP container_1_1
-     * (mapper/reducer/app_1) container_1_2 (service/app_1)
-     *
-     * Node2: container_1_3 (reducer/app_1) TEMP container_2_1 (service/app_2)
-     */
-
-    AllocationTagsManager atm = new AllocationTagsManager(rmContext);
-
-    // 3 Containers from app1
-    atm.addTempContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockApplicationId(1),
-        ImmutableSet.of("mapper", "reducer"));
-
-    atm.addContainer(NodeId.fromString("host1:123"),
-        TestUtils.getMockContainerId(1, 2), ImmutableSet.of("service"));
-
-    atm.addContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockContainerId(1, 3), ImmutableSet.of("reducer"));
-
-    // 1 Container from app2
-    atm.addTempContainer(NodeId.fromString("host2:123"),
-        TestUtils.getMockApplicationId(2), ImmutableSet.of("service"));
-
-    // Expect tag mappings to be present including temp Tags
-    Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
-            Long::sum));
-
-    Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of("service"),
-            Long::sum));
-
-    Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
-            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
-            Long::sum));
-
-    // Do a temp Tag cleanup on app2
-    atm.cleanTempContainers(TestUtils.getMockApplicationId(2));
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
-            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
-            Long::sum));
-    // Expect app1 to be unaffected
-    Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
-            Long::sum));
-    // Do a cleanup on app1 as well
-    atm.cleanTempContainers(TestUtils.getMockApplicationId(1));
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
-            Long::sum));
-
-    // Non temp-tags should be unaffected
-    Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
-            TestUtils.getMockApplicationId(1), ImmutableSet.of("service"),
-            Long::sum));
-
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
-            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
-            Long::sum));
-
-    // Expect app2 with no containers, and app1 with 2 containers across 2 nodes
-    Assert.assertEquals(2,
-        atm.getPerAppNodeMappings().get(TestUtils.getMockApplicationId(1))
-            .getTypeToTagsWithCount().size());
-
-    Assert.assertNull(
-        atm.getPerAppNodeMappings().get(TestUtils.getMockApplicationId(2)));
-  }
-
-  @Test
   public void testQueryCardinalityWithIllegalParameters()
       throws InvalidAllocationTagsQueryException {
     /**

http://git-wip-us.apache.org/repos/asf/hadoop/blob/fca7371f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/TestLocalAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/TestLocalAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/TestLocalAllocationTagsManager.java
new file mode 100644
index 0000000..0b9657f
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/TestLocalAllocationTagsManager.java
@@ -0,0 +1,139 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm;
+
+import com.google.common.collect.ImmutableSet;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.server.resourcemanager.MockNodes;
+import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.TestUtils;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+
+import java.util.List;
+
+/**
+ * Tests the LocalAllocationTagsManager.
+ */
+public class TestLocalAllocationTagsManager {
+
+  private RMContext rmContext;
+
+  @Before
+  public void setup() {
+    MockRM rm = new MockRM();
+    rm.start();
+    MockNodes.resetHostIds();
+    List<RMNode> rmNodes =
+        MockNodes.newNodes(2, 4, Resource.newInstance(4096, 4));
+    for (RMNode rmNode : rmNodes) {
+      rm.getRMContext().getRMNodes().putIfAbsent(rmNode.getNodeID(), rmNode);
+    }
+    rmContext = rm.getRMContext();
+  }
+
+  @Test
+  public void testTempContainerAllocations()
+      throws InvalidAllocationTagsQueryException {
+    /**
+     * Construct both TEMP and normal containers: Node1: TEMP container_1_1
+     * (mapper/reducer/app_1) container_1_2 (service/app_1)
+     *
+     * Node2: container_1_3 (reducer/app_1) TEMP container_2_1 (service/app_2)
+     */
+
+    AllocationTagsManager atm = new AllocationTagsManager(rmContext);
+    LocalAllocationTagsManager ephAtm =
+        new LocalAllocationTagsManager(atm);
+
+    // 3 Containers from app1
+    ephAtm.addTempTags(NodeId.fromString("host1:123"),
+        TestUtils.getMockApplicationId(1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("host1:123"),
+        TestUtils.getMockContainerId(1, 2), ImmutableSet.of("service"));
+
+    atm.addContainer(NodeId.fromString("host2:123"),
+        TestUtils.getMockContainerId(1, 3), ImmutableSet.of("reducer"));
+
+    // 1 Container from app2
+    ephAtm.addTempTags(NodeId.fromString("host2:123"),
+        TestUtils.getMockApplicationId(2), ImmutableSet.of("service"));
+
+    // Expect tag mappings to be present including temp Tags
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::sum));
+
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("service"),
+            Long::sum));
+
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
+            Long::sum));
+
+    // Do a temp Tag cleanup on app2
+    ephAtm.cleanTempContainers(TestUtils.getMockApplicationId(2));
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
+            Long::sum));
+    // Expect app1 to be unaffected
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::sum));
+    // Do a cleanup on app1 as well
+    ephAtm.cleanTempContainers(TestUtils.getMockApplicationId(1));
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::sum));
+
+    // Non temp-tags should be unaffected
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("service"),
+            Long::sum));
+
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of("service"),
+            Long::sum));
+
+    // Expect app2 with no containers, and app1 with 2 containers across 2 nodes
+    Assert.assertEquals(2,
+        atm.getPerAppNodeMappings().get(TestUtils.getMockApplicationId(1))
+            .getTypeToTagsWithCount().size());
+
+    Assert.assertNull(
+        atm.getPerAppNodeMappings().get(TestUtils.getMockApplicationId(2)));
+  }
+
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[35/50] [abbrv] hadoop git commit: YARN-7669. API and interface modifications for placement constraint processor. (asuresh)

Posted by as...@apache.org.
YARN-7669. API and interface modifications for placement constraint processor. (asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/c83ef6f6
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/c83ef6f6
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/c83ef6f6

Branch: refs/heads/YARN-6592
Commit: c83ef6f6cd68c9cfdecaa005984e36fca6aad9e7
Parents: 9f9139c
Author: Arun Suresh <as...@apache.org>
Authored: Tue Dec 19 22:47:46 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../yarn/ams/ApplicationMasterServiceUtils.java |  16 +
 .../api/protocolrecords/AllocateResponse.java   |  23 +
 .../api/records/RejectedSchedulingRequest.java  |  70 +++
 .../yarn/api/records/RejectionReason.java       |  44 ++
 .../src/main/proto/yarn_protos.proto            |  10 +
 .../src/main/proto/yarn_service_protos.proto    |   1 +
 .../impl/pb/AllocateResponsePBImpl.java         |  85 ++++
 .../yarn/api/records/impl/pb/ProtoUtils.java    |  16 +
 .../pb/RejectedSchedulingRequestPBImpl.java     | 148 +++++++
 .../records/impl/pb/ResourceSizingPBImpl.java   |   8 +
 .../impl/pb/SchedulingRequestPBImpl.java        |  11 +
 .../hadoop/yarn/api/TestPBImplRecords.java      |   2 +
 .../resourcemanager/RMActiveServiceContext.java |   2 +-
 .../yarn/server/resourcemanager/RMContext.java  |   2 +-
 .../server/resourcemanager/RMContextImpl.java   |   2 +-
 .../server/resourcemanager/ResourceManager.java |   2 +-
 .../constraint/AllocationTagsManager.java       | 431 -------------------
 .../constraint/AllocationTagsNamespaces.java    |  31 --
 .../InvalidAllocationTagsQueryException.java    |  35 --
 .../constraint/AllocationTagsManager.java       | 431 +++++++++++++++++++
 .../constraint/AllocationTagsNamespaces.java    |  31 ++
 .../InvalidAllocationTagsQueryException.java    |  35 ++
 .../api/ConstraintPlacementAlgorithm.java       |  43 ++
 .../api/ConstraintPlacementAlgorithmInput.java  |  32 ++
 .../api/ConstraintPlacementAlgorithmOutput.java |  58 +++
 ...traintPlacementAlgorithmOutputCollector.java |  32 ++
 .../constraint/api/PlacedSchedulingRequest.java |  79 ++++
 .../constraint/api/SchedulingResponse.java      |  70 +++
 .../scheduler/constraint/api/package-info.java  |  28 ++
 .../constraint/TestAllocationTagsManager.java   | 328 --------------
 .../rmcontainer/TestRMContainerImpl.java        |   2 +-
 .../scheduler/capacity/TestUtils.java           |   2 +-
 .../constraint/TestAllocationTagsManager.java   | 328 ++++++++++++++
 .../scheduler/fifo/TestFifoScheduler.java       |   2 +-
 34 files changed, 1608 insertions(+), 832 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/ams/ApplicationMasterServiceUtils.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/ams/ApplicationMasterServiceUtils.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/ams/ApplicationMasterServiceUtils.java
index 476da8b..8bdfaf3 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/ams/ApplicationMasterServiceUtils.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/ams/ApplicationMasterServiceUtils.java
@@ -21,6 +21,7 @@ package org.apache.hadoop.yarn.ams;
 import org.apache.hadoop.yarn.api.protocolrecords.AllocateResponse;
 import org.apache.hadoop.yarn.api.records.Container;
 import org.apache.hadoop.yarn.api.records.ContainerUpdateType;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerError;
 import org.apache.hadoop.yarn.api.records.UpdatedContainer;
 
@@ -86,4 +87,19 @@ public final class ApplicationMasterServiceUtils {
     }
     allocateResponse.setAllocatedContainers(allocatedContainers);
   }
+
+  /**
+   * Add rejected Scheduling Requests to {@link AllocateResponse}.
+   * @param allocateResponse Allocate Response.
+   * @param rejectedRequests Rejected SchedulingRequests.
+   */
+  public static void addToRejectedSchedulingRequests(
+      AllocateResponse allocateResponse,
+      List<RejectedSchedulingRequest> rejectedRequests) {
+    if (allocateResponse.getRejectedSchedulingRequests() != null
+        && !allocateResponse.getRejectedSchedulingRequests().isEmpty()) {
+      rejectedRequests.addAll(allocateResponse.getRejectedSchedulingRequests());
+    }
+    allocateResponse.setRejectedSchedulingRequests(rejectedRequests);
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateResponse.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateResponse.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateResponse.java
index 655c6dc..52c30e2 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateResponse.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateResponse.java
@@ -19,6 +19,7 @@
 package org.apache.hadoop.yarn.api.protocolrecords;
 
 import java.util.ArrayList;
+import java.util.Collections;
 import java.util.List;
 
 import org.apache.hadoop.classification.InterfaceAudience.Private;
@@ -35,6 +36,7 @@ import org.apache.hadoop.yarn.api.records.NMToken;
 import org.apache.hadoop.yarn.api.records.NodeReport;
 import org.apache.hadoop.yarn.api.records.PreemptionMessage;
 import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.Token;
 import org.apache.hadoop.yarn.api.records.UpdateContainerError;
@@ -410,6 +412,27 @@ public abstract class AllocateResponse {
   public abstract void setContainersFromPreviousAttempts(
       List<Container> containersFromPreviousAttempt);
 
+  /**
+   * Get a list of all SchedulingRequests that the RM has rejected between
+   * this allocate call and the previous one.
+   * @return List of RejectedSchedulingRequests.
+   */
+  @Public
+  @Unstable
+  public List<RejectedSchedulingRequest> getRejectedSchedulingRequests() {
+    return Collections.EMPTY_LIST;
+  }
+
+  /**
+   * Add a list of rejected SchedulingRequests to the AllocateResponse.
+   * @param rejectedRequests List of Rejected Scheduling Requests.
+   */
+  @Private
+  @Unstable
+  public void setRejectedSchedulingRequests(
+      List<RejectedSchedulingRequest> rejectedRequests) {
+  }
+
   @Private
   @Unstable
   public static AllocateResponseBuilder newBuilder() {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/RejectedSchedulingRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/RejectedSchedulingRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/RejectedSchedulingRequest.java
new file mode 100644
index 0000000..6e2d95b
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/RejectedSchedulingRequest.java
@@ -0,0 +1,70 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.api.records;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.yarn.util.Records;
+
+/**
+ * This encapsulates a Rejected SchedulingRequest. It contains the offending
+ * Scheduling Request along with the reason for rejection.
+ */
+@InterfaceAudience.Public
+@InterfaceStability.Unstable
+public abstract class RejectedSchedulingRequest {
+
+  /**
+   * Create new RejectedSchedulingRequest.
+   * @param reason Rejection Reason.
+   * @param request Rejected Scheduling Request.
+   * @return RejectedSchedulingRequest.
+   */
+  public static RejectedSchedulingRequest newInstance(RejectionReason reason,
+      SchedulingRequest request) {
+    RejectedSchedulingRequest instance =
+        Records.newRecord(RejectedSchedulingRequest.class);
+    instance.setReason(reason);
+    instance.setRequest(request);
+    return instance;
+  }
+
+  /**
+   * Get Rejection Reason.
+   * @return Rejection reason.
+   */
+  public abstract RejectionReason getReason();
+
+  /**
+   * Set Rejection Reason.
+   * @param reason Rejection Reason.
+   */
+  public abstract void setReason(RejectionReason reason);
+
+  /**
+   * Get the Rejected Scheduling Request.
+   * @return SchedulingRequest.
+   */
+  public abstract SchedulingRequest getRequest();
+
+  /**
+   * Set the SchedulingRequest.
+   * @param request SchedulingRequest.
+   */
+  public abstract void setRequest(SchedulingRequest request);
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/RejectionReason.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/RejectionReason.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/RejectionReason.java
new file mode 100644
index 0000000..afbc2ed
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/RejectionReason.java
@@ -0,0 +1,44 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.api.records;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+
+/**
+ * Reason for rejecting a Scheduling Request.
+ */
+@InterfaceAudience.Public
+@InterfaceStability.Unstable
+public enum RejectionReason {
+  /**
+   * This is used to indicate a possible constraint violation. For eg. If the
+   * App requested anti-affinity across 5 container requests, but only 4 nodes
+   * exist. Another eg. could be if tag A has affinity with tag B and tag B has
+   * affinity with tag C, but tag A has anti-affinity with tag C, all at a rack
+   * scope - and only 1 rack exists. Essentially all situations where the
+   * Algorithm cannot assign a Node to SchedulingRequest.
+   */
+  COULD_NOT_PLACE_ON_NODE,
+  /**
+   * This is used to indicate when after the Algorithm has placed a Scheduling
+   * Request at a node, but the commit failed because the Queue has no
+   * capacity etc. This can be a transient situation.
+   */
+  COULD_NOT_SCHEDULE_ON_NODE
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
index fdc39a7..5cb1177 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
@@ -424,6 +424,16 @@ enum AMCommandProto {
   AM_SHUTDOWN = 2;
 }
 
+enum RejectionReasonProto {
+  RRP_COULD_NOT_PLACE_ON_NODE = 1;
+  RRP_COULD_NOT_SCHEDULE_ON_NODE = 2;
+}
+
+message RejectedSchedulingRequestProto {
+  required RejectionReasonProto reason = 1;
+  required SchedulingRequestProto request = 2;
+}
+
 message PreemptionMessageProto {
   optional StrictPreemptionContractProto strictContract = 1;
   optional PreemptionContractProto contract = 2;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
index e49c4e3..92a65ad 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
@@ -120,6 +120,7 @@ message AllocateResponseProto {
   repeated UpdateContainerErrorProto update_errors = 15;
   repeated UpdatedContainerProto updated_containers = 16;
   repeated ContainerProto containers_from_previous_attempts = 17;
+  repeated RejectedSchedulingRequestProto rejected_scheduling_requests = 18;
 }
 
 enum SchedulerResourceTypes {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateResponsePBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateResponsePBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateResponsePBImpl.java
index 5ca1e73..3ab5563 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateResponsePBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateResponsePBImpl.java
@@ -35,6 +35,7 @@ import org.apache.hadoop.yarn.api.records.NMToken;
 import org.apache.hadoop.yarn.api.records.NodeReport;
 import org.apache.hadoop.yarn.api.records.PreemptionMessage;
 import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.Token;
 import org.apache.hadoop.yarn.api.records.UpdateContainerError;
@@ -47,9 +48,11 @@ import org.apache.hadoop.yarn.api.records.impl.pb.NodeReportPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.PreemptionMessagePBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.PriorityPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.ProtoUtils;
+import org.apache.hadoop.yarn.api.records.impl.pb.RejectedSchedulingRequestPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.ResourcePBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.TokenPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.UpdatedContainerPBImpl;
+import org.apache.hadoop.yarn.proto.YarnProtos;
 import org.apache.hadoop.yarn.proto.YarnProtos.CollectorInfoProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ContainerProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ContainerStatusProto;
@@ -81,6 +84,7 @@ public class AllocateResponsePBImpl extends AllocateResponse {
 
   private List<NodeReport> updatedNodes = null;
   private List<UpdateContainerError> updateErrors = null;
+  private List<RejectedSchedulingRequest> rejectedRequests = null;
   private PreemptionMessage preempt;
   private Token amrmToken = null;
   private Priority appPriority = null;
@@ -140,6 +144,13 @@ public class AllocateResponsePBImpl extends AllocateResponse {
           getContainerStatusProtoIterable(this.completedContainersStatuses);
       builder.addAllCompletedContainerStatuses(iterable);
     }
+    if (this.rejectedRequests != null) {
+      builder.clearRejectedSchedulingRequests();
+      Iterable<YarnProtos.RejectedSchedulingRequestProto> iterable =
+          getRejectedSchedulingRequestsProtoIterable(
+              this.rejectedRequests);
+      builder.addAllRejectedSchedulingRequests(iterable);
+    }
     if (this.updatedNodes != null) {
       builder.clearUpdatedNodes();
       Iterable<NodeReportProto> iterable =
@@ -471,6 +482,24 @@ public class AllocateResponsePBImpl extends AllocateResponse {
     containersFromPreviousAttempts.addAll(containers);
   }
 
+  @Override
+  public synchronized List<RejectedSchedulingRequest>
+      getRejectedSchedulingRequests() {
+    initRejectedRequestsList();
+    return this.rejectedRequests;
+  }
+
+  @Override
+  public synchronized void setRejectedSchedulingRequests(
+      List<RejectedSchedulingRequest> rejectedReqs) {
+    if (rejectedReqs == null) {
+      return;
+    }
+    initRejectedRequestsList();
+    this.rejectedRequests.clear();
+    this.rejectedRequests.addAll(rejectedReqs);
+  }
+
   private synchronized void initLocalUpdatedContainerList() {
     if (this.updatedContainers != null) {
       return;
@@ -528,6 +557,20 @@ public class AllocateResponsePBImpl extends AllocateResponse {
     }
   }
 
+  private synchronized void initRejectedRequestsList() {
+    if (this.rejectedRequests != null) {
+      return;
+    }
+    AllocateResponseProtoOrBuilder p = viaProto ? proto : builder;
+    List<YarnProtos.RejectedSchedulingRequestProto> list =
+        p.getRejectedSchedulingRequestsList();
+    rejectedRequests = new ArrayList<>();
+
+    for (YarnProtos.RejectedSchedulingRequestProto c : list) {
+      rejectedRequests.add(convertFromProtoFormat(c));
+    }
+  }
+
   private synchronized void initLocalNewNMTokenList() {
     if (nmTokens != null) {
       return;
@@ -712,6 +755,38 @@ public class AllocateResponsePBImpl extends AllocateResponse {
       }
     };
   }
+
+  private synchronized Iterable<YarnProtos.RejectedSchedulingRequestProto>
+      getRejectedSchedulingRequestsProtoIterable(
+      final List<RejectedSchedulingRequest> rejectedReqsList) {
+    maybeInitBuilder();
+    return new Iterable<YarnProtos.RejectedSchedulingRequestProto>() {
+      @Override
+      public Iterator<YarnProtos.RejectedSchedulingRequestProto> iterator() {
+        return new Iterator<YarnProtos.RejectedSchedulingRequestProto>() {
+
+          private Iterator<RejectedSchedulingRequest> iter =
+              rejectedReqsList.iterator();
+
+          @Override
+          public synchronized boolean hasNext() {
+            return iter.hasNext();
+          }
+
+          @Override
+          public synchronized YarnProtos.RejectedSchedulingRequestProto next() {
+            return convertToProtoFormat(iter.next());
+          }
+
+          @Override
+          public synchronized void remove() {
+            throw new UnsupportedOperationException();
+
+          }
+        };
+      }
+    };
+  }
   
   private synchronized Iterable<NodeReportProto>
   getNodeReportProtoIterable(
@@ -808,6 +883,16 @@ public class AllocateResponsePBImpl extends AllocateResponse {
     return ((ContainerStatusPBImpl)t).getProto();
   }
 
+  private synchronized RejectedSchedulingRequestPBImpl convertFromProtoFormat(
+      YarnProtos.RejectedSchedulingRequestProto p) {
+    return new RejectedSchedulingRequestPBImpl(p);
+  }
+
+  private synchronized YarnProtos.RejectedSchedulingRequestProto
+      convertToProtoFormat(RejectedSchedulingRequest t) {
+    return ((RejectedSchedulingRequestPBImpl)t).getProto();
+  }
+
   private synchronized ResourcePBImpl convertFromProtoFormat(ResourceProto p) {
     return new ResourcePBImpl(p);
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java
index 168d864..76e86ad 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ProtoUtils.java
@@ -49,6 +49,7 @@ import org.apache.hadoop.yarn.api.records.NodeState;
 import org.apache.hadoop.yarn.api.records.NodeUpdateType;
 import org.apache.hadoop.yarn.api.records.QueueACL;
 import org.apache.hadoop.yarn.api.records.QueueState;
+import org.apache.hadoop.yarn.api.records.RejectionReason;
 import org.apache.hadoop.yarn.api.records.ReservationRequestInterpreter;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceInformation;
@@ -233,6 +234,21 @@ public class ProtoUtils {
   }
 
   /*
+   * RejectionReason
+   */
+  private static final String REJECTION_REASON_PREFIX = "RRP_";
+  public static YarnProtos.RejectionReasonProto convertToProtoFormat(
+      RejectionReason e) {
+    return YarnProtos.RejectionReasonProto
+        .valueOf(REJECTION_REASON_PREFIX + e.name());
+  }
+  public static RejectionReason convertFromProtoFormat(
+      YarnProtos.RejectionReasonProto e) {
+    return RejectionReason.valueOf(e.name()
+        .replace(REJECTION_REASON_PREFIX, ""));
+  }
+
+  /*
    * ByteBuffer
    */
   public static ByteBuffer convertFromProtoFormat(ByteString byteString) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/RejectedSchedulingRequestPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/RejectedSchedulingRequestPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/RejectedSchedulingRequestPBImpl.java
new file mode 100644
index 0000000..ed78551
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/RejectedSchedulingRequestPBImpl.java
@@ -0,0 +1,148 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.api.records.impl.pb;
+
+import com.google.protobuf.TextFormat;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
+import org.apache.hadoop.yarn.api.records.RejectionReason;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.proto.YarnProtos;
+
+/**
+ * Implementation of RejectedSchedulingRequest.
+ */
+public class RejectedSchedulingRequestPBImpl extends RejectedSchedulingRequest {
+
+  private YarnProtos.RejectedSchedulingRequestProto proto =
+      YarnProtos.RejectedSchedulingRequestProto.getDefaultInstance();
+  private YarnProtos.RejectedSchedulingRequestProto.Builder builder = null;
+  private boolean viaProto = false;
+  private SchedulingRequest request;
+
+  public RejectedSchedulingRequestPBImpl() {
+    builder = YarnProtos.RejectedSchedulingRequestProto.newBuilder();
+  }
+
+  public RejectedSchedulingRequestPBImpl(
+      YarnProtos.RejectedSchedulingRequestProto proto) {
+    this.proto = proto;
+    viaProto = true;
+  }
+
+  public synchronized YarnProtos.RejectedSchedulingRequestProto getProto() {
+    mergeLocalToProto();
+    proto = viaProto ? proto : builder.build();
+    viaProto = true;
+    return proto;
+  }
+
+  @Override
+  public int hashCode() {
+    return getProto().hashCode();
+  }
+
+  @Override
+  public boolean equals(Object other) {
+    if (other == null) {
+      return false;
+    }
+    if (other.getClass().isAssignableFrom(this.getClass())) {
+      return this.getProto().equals(this.getClass().cast(other).getProto());
+    }
+    return false;
+  }
+
+  @Override
+  public String toString() {
+    return TextFormat.shortDebugString(getProto());
+  }
+
+  private synchronized void mergeLocalToProto() {
+    if (viaProto) {
+      maybeInitBuilder();
+    }
+    mergeLocalToBuilder();
+    proto = builder.build();
+    viaProto = true;
+  }
+
+  private synchronized void mergeLocalToBuilder() {
+    if (this.request != null) {
+      builder.setRequest(convertToProtoFormat(this.request));
+    }
+  }
+  private synchronized void maybeInitBuilder() {
+    if (viaProto || builder == null) {
+      builder = YarnProtos.RejectedSchedulingRequestProto.newBuilder(proto);
+    }
+    viaProto = false;
+  }
+
+  @Override
+  public synchronized RejectionReason getReason() {
+    YarnProtos.RejectedSchedulingRequestProtoOrBuilder p =
+        viaProto ? proto : builder;
+    if (!p.hasReason()) {
+      return null;
+    }
+    return ProtoUtils.convertFromProtoFormat(p.getReason());
+  }
+
+  @Override
+  public synchronized void setReason(RejectionReason reason) {
+    maybeInitBuilder();
+    if (reason == null) {
+      builder.clearReason();
+      return;
+    }
+    builder.setReason(ProtoUtils.convertToProtoFormat(reason));
+  }
+
+  @Override
+  public synchronized SchedulingRequest getRequest() {
+    YarnProtos.RejectedSchedulingRequestProtoOrBuilder p =
+        viaProto ? proto : builder;
+    if (this.request != null) {
+      return this.request;
+    }
+    if (!p.hasRequest()) {
+      return null;
+    }
+    this.request = convertFromProtoFormat(p.getRequest());
+    return this.request;
+  }
+
+  @Override
+  public synchronized void setRequest(SchedulingRequest req) {
+    maybeInitBuilder();
+    if (null == req) {
+      builder.clearRequest();
+    }
+    this.request = req;
+  }
+
+  private synchronized YarnProtos.SchedulingRequestProto convertToProtoFormat(
+      SchedulingRequest r) {
+    return ((SchedulingRequestPBImpl)r).getProto();
+  }
+
+  private synchronized SchedulingRequestPBImpl convertFromProtoFormat(
+      YarnProtos.SchedulingRequestProto p) {
+    return new SchedulingRequestPBImpl(p);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
index f98e488..4054837 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
@@ -114,4 +114,12 @@ public class ResourceSizingPBImpl extends ResourceSizing {
   private ResourceProto convertToProtoFormat(Resource r) {
     return ProtoUtils.convertToProtoFormat(r);
   }
+
+  @Override
+  public String toString() {
+    return "ResourceSizingPBImpl{" +
+        "numAllocations=" + getNumAllocations() +
+        ", resources=" + getResources() +
+        '}';
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
index 305856a..1f86043 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
@@ -279,4 +279,15 @@ public class SchedulingRequestPBImpl extends SchedulingRequest {
     }
     return false;
   }
+
+  @Override
+  public String toString() {
+    return "SchedulingRequestPBImpl{" +
+        "priority=" + getPriority() +
+        ", allocationReqId=" + getAllocationRequestId() +
+        ", executionType=" + getExecutionType() +
+        ", allocationTags=" + getAllocationTags() +
+        ", resourceSizing=" + getResourceSizing() +
+        '}';
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java
index a0b907d..ae80910 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java
@@ -138,6 +138,7 @@ import org.apache.hadoop.yarn.api.records.QueueInfo;
 import org.apache.hadoop.yarn.api.records.QueueState;
 import org.apache.hadoop.yarn.api.records.QueueStatistics;
 import org.apache.hadoop.yarn.api.records.QueueUserACLInfo;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
 import org.apache.hadoop.yarn.api.records.ReservationAllocationState;
 import org.apache.hadoop.yarn.api.records.ReservationDefinition;
 import org.apache.hadoop.yarn.api.records.ReservationId;
@@ -436,6 +437,7 @@ public class TestPBImplRecords extends BasePBImplRecordsTest {
     generateByNewInstance(ResourceTypeInfo.class);
     generateByNewInstance(ResourceSizing.class);
     generateByNewInstance(SchedulingRequest.class);
+    generateByNewInstance(RejectedSchedulingRequest.class);
   }
 
   @Test

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
index 6ee3a4c..4d0c230 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
@@ -33,7 +33,6 @@ import org.apache.hadoop.yarn.event.Dispatcher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMDelegatedNodeLabelsUpdater;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.placement.PlacementManager;
-import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.NullRMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.reservation.ReservationSystem;
@@ -43,6 +42,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmapp.monitor.RMAppLifetime
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.ContainerAllocationExpirer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.distributed.QueueLimitCalculator;
 import org.apache.hadoop.yarn.server.resourcemanager.security.AMRMTokenSecretManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.ClientToAMTokenSecretManagerInRM;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
index 62899d9..00da108 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
@@ -32,7 +32,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWri
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMDelegatedNodeLabelsUpdater;
-import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.placement.PlacementManager;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.reservation.ReservationSystem;
@@ -44,6 +43,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.ContainerAlloca
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.distributed.QueueLimitCalculator;
 import org.apache.hadoop.yarn.server.resourcemanager.security.AMRMTokenSecretManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.ClientToAMTokenSecretManagerInRM;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
index 315fdc1..da50ef8 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
@@ -38,7 +38,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWri
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMDelegatedNodeLabelsUpdater;
-import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.placement.PlacementManager;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.reservation.ReservationSystem;
@@ -50,6 +49,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.ContainerAlloca
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.distributed.QueueLimitCalculator;
 import org.apache.hadoop.yarn.server.resourcemanager.security.AMRMTokenSecretManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.ClientToAMTokenSecretManagerInRM;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
index da0feda..a1d3dfc 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
@@ -73,7 +73,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.metrics.TimelineServiceV2Pu
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.CombinedSystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMDelegatedNodeLabelsUpdater;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
-import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.NullRMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore.RMState;
@@ -97,6 +96,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNodeEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNodeEventType;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.QueueMetrics;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.SchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.SchedulerEventType;
 import org.apache.hadoop.yarn.server.resourcemanager.security.DelegationTokenRenewer;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsManager.java
deleted file mode 100644
index b67fab9..0000000
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsManager.java
+++ /dev/null
@@ -1,431 +0,0 @@
-/*
- * *
- *  Licensed to the Apache Software Foundation (ASF) under one
- *  or more contributor license agreements.  See the NOTICE file
- *  distributed with this work for additional information
- *  regarding copyright ownership.  The ASF licenses this file
- *  to you under the Apache License, Version 2.0 (the
- *  "License"); you may not use this file except in compliance
- *  with the License.  You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- *  Unless required by applicable law or agreed to in writing, software
- *  distributed under the License is distributed on an "AS IS" BASIS,
- *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- *  See the License for the specific language governing permissions and
- *  limitations under the License.
- * /
- */
-
-package org.apache.hadoop.yarn.server.resourcemanager.constraint;
-
-import com.google.common.annotations.VisibleForTesting;
-import org.apache.commons.lang.StringUtils;
-import org.apache.hadoop.classification.InterfaceAudience;
-import org.apache.hadoop.classification.InterfaceStability;
-import org.apache.hadoop.yarn.api.records.ApplicationId;
-import org.apache.hadoop.yarn.api.records.ContainerId;
-import org.apache.hadoop.yarn.api.records.NodeId;
-import org.apache.hadoop.yarn.api.records.SchedulingRequest;
-import org.apache.log4j.Logger;
-
-import java.util.HashMap;
-import java.util.HashSet;
-import java.util.Map;
-import java.util.Set;
-import java.util.concurrent.locks.ReentrantReadWriteLock;
-import java.util.function.LongBinaryOperator;
-
-/**
- * Support storing maps between container-tags/applications and
- * nodes. This will be required by affinity/anti-affinity implementation and
- * cardinality.
- */
-@InterfaceAudience.Private
-@InterfaceStability.Unstable
-public class AllocationTagsManager {
-
-  private static final Logger LOG = Logger.getLogger(
-      AllocationTagsManager.class);
-
-  private ReentrantReadWriteLock.ReadLock readLock;
-  private ReentrantReadWriteLock.WriteLock writeLock;
-
-  // Application's tags to node
-  private Map<ApplicationId, NodeToCountedTags> perAppMappings =
-      new HashMap<>();
-
-  // Global tags to node mapping (used to fast return aggregated tags
-  // cardinality across apps)
-  private NodeToCountedTags globalMapping = new NodeToCountedTags();
-
-  /**
-   * Store node to counted tags.
-   */
-  @VisibleForTesting
-  static class NodeToCountedTags {
-    // Map<NodeId, Map<Tag, Count>>
-    private Map<NodeId, Map<String, Long>> nodeToTagsWithCount =
-        new HashMap<>();
-
-    // protected by external locks
-    private void addTagsToNode(NodeId nodeId, Set<String> tags) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.computeIfAbsent(nodeId,
-          k -> new HashMap<>());
-
-      for (String tag : tags) {
-        Long count = innerMap.get(tag);
-        if (count == null) {
-          innerMap.put(tag, 1L);
-        } else{
-          innerMap.put(tag, count + 1);
-        }
-      }
-    }
-
-    // protected by external locks
-    private void addTagToNode(NodeId nodeId, String tag) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.computeIfAbsent(nodeId,
-          k -> new HashMap<>());
-
-      Long count = innerMap.get(tag);
-      if (count == null) {
-        innerMap.put(tag, 1L);
-      } else{
-        innerMap.put(tag, count + 1);
-      }
-    }
-
-    private void removeTagFromInnerMap(Map<String, Long> innerMap, String tag) {
-      Long count = innerMap.get(tag);
-      if (count > 1) {
-        innerMap.put(tag, count - 1);
-      } else {
-        if (count <= 0) {
-          LOG.warn(
-              "Trying to remove tags from node, however the count already"
-                  + " becomes 0 or less, it could be a potential bug.");
-        }
-        innerMap.remove(tag);
-      }
-    }
-
-    private void removeTagsFromNode(NodeId nodeId, Set<String> tags) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
-      if (innerMap == null) {
-        LOG.warn("Failed to find node=" + nodeId
-            + " while trying to remove tags, please double check.");
-        return;
-      }
-
-      for (String tag : tags) {
-        removeTagFromInnerMap(innerMap, tag);
-      }
-
-      if (innerMap.isEmpty()) {
-        nodeToTagsWithCount.remove(nodeId);
-      }
-    }
-
-    private void removeTagFromNode(NodeId nodeId, String tag) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
-      if (innerMap == null) {
-        LOG.warn("Failed to find node=" + nodeId
-            + " while trying to remove tags, please double check.");
-        return;
-      }
-
-      removeTagFromInnerMap(innerMap, tag);
-
-      if (innerMap.isEmpty()) {
-        nodeToTagsWithCount.remove(nodeId);
-      }
-    }
-
-    private long getCardinality(NodeId nodeId, String tag) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
-      if (innerMap == null) {
-        return 0;
-      }
-      Long value = innerMap.get(tag);
-      return value == null ? 0 : value;
-    }
-
-    private long getCardinality(NodeId nodeId, Set<String> tags,
-        LongBinaryOperator op) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
-      if (innerMap == null) {
-        return 0;
-      }
-
-      long returnValue = 0;
-      boolean firstTag = true;
-
-      if (tags != null && !tags.isEmpty()) {
-        for (String tag : tags) {
-          Long value = innerMap.get(tag);
-          if (value == null) {
-            value = 0L;
-          }
-
-          if (firstTag) {
-            returnValue = value;
-            firstTag = false;
-            continue;
-          }
-
-          returnValue = op.applyAsLong(returnValue, value);
-        }
-      } else {
-        // Similar to above if, but only iterate values for better performance
-        for (long value : innerMap.values()) {
-          // For the first value, we will not apply op
-          if (firstTag) {
-            returnValue = value;
-            firstTag = false;
-            continue;
-          }
-          returnValue = op.applyAsLong(returnValue, value);
-        }
-      }
-      return returnValue;
-    }
-
-    private boolean isEmpty() {
-      return nodeToTagsWithCount.isEmpty();
-    }
-
-    @VisibleForTesting
-    public Map<NodeId, Map<String, Long>> getNodeToTagsWithCount() {
-      return nodeToTagsWithCount;
-    }
-  }
-
-  @VisibleForTesting
-  Map<ApplicationId, NodeToCountedTags> getPerAppMappings() {
-    return perAppMappings;
-  }
-
-  @VisibleForTesting
-  NodeToCountedTags getGlobalMapping() {
-    return globalMapping;
-  }
-
-  public AllocationTagsManager() {
-    ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
-    readLock = lock.readLock();
-    writeLock = lock.writeLock();
-  }
-
-  /**
-   * Notify container allocated on a node.
-   *
-   * @param nodeId         allocated node.
-   * @param applicationId  applicationId
-   * @param containerId    container id.
-   * @param allocationTags allocation tags, see
-   *                       {@link SchedulingRequest#getAllocationTags()}
-   *                       application_id will be added to allocationTags.
-   */
-  public void addContainer(NodeId nodeId, ApplicationId applicationId,
-      ContainerId containerId, Set<String> allocationTags) {
-    String applicationIdTag =
-        AllocationTagsNamespaces.APP_ID + applicationId.toString();
-
-    boolean useSet = false;
-    if (allocationTags != null && !allocationTags.isEmpty()) {
-      // Copy before edit it.
-      allocationTags = new HashSet<>(allocationTags);
-      allocationTags.add(applicationIdTag);
-      useSet = true;
-    }
-
-    writeLock.lock();
-    try {
-      NodeToCountedTags perAppTagsMapping = perAppMappings.computeIfAbsent(
-          applicationId, k -> new NodeToCountedTags());
-
-      if (useSet) {
-        perAppTagsMapping.addTagsToNode(nodeId, allocationTags);
-        globalMapping.addTagsToNode(nodeId, allocationTags);
-      } else {
-        perAppTagsMapping.addTagToNode(nodeId, applicationIdTag);
-        globalMapping.addTagToNode(nodeId, applicationIdTag);
-      }
-
-      if (LOG.isDebugEnabled()) {
-        LOG.debug(
-            "Added container=" + containerId + " with tags=[" + StringUtils
-                .join(allocationTags, ",") + "]");
-      }
-    } finally {
-      writeLock.unlock();
-    }
-  }
-
-  /**
-   * Notify container removed.
-   *
-   * @param nodeId         nodeId
-   * @param applicationId  applicationId
-   * @param containerId    containerId.
-   * @param allocationTags allocation tags for given container
-   */
-  public void removeContainer(NodeId nodeId, ApplicationId applicationId,
-      ContainerId containerId, Set<String> allocationTags) {
-    String applicationIdTag =
-        AllocationTagsNamespaces.APP_ID + applicationId.toString();
-    boolean useSet = false;
-
-    if (allocationTags != null && !allocationTags.isEmpty()) {
-      // Copy before edit it.
-      allocationTags = new HashSet<>(allocationTags);
-      allocationTags.add(applicationIdTag);
-      useSet = true;
-    }
-
-    writeLock.lock();
-    try {
-      NodeToCountedTags perAppTagsMapping = perAppMappings.get(applicationId);
-      if (perAppTagsMapping == null) {
-        return;
-      }
-
-      if (useSet) {
-        perAppTagsMapping.removeTagsFromNode(nodeId, allocationTags);
-        globalMapping.removeTagsFromNode(nodeId, allocationTags);
-      } else {
-        perAppTagsMapping.removeTagFromNode(nodeId, applicationIdTag);
-        globalMapping.removeTagFromNode(nodeId, applicationIdTag);
-      }
-
-      if (perAppTagsMapping.isEmpty()) {
-        perAppMappings.remove(applicationId);
-      }
-
-      if (LOG.isDebugEnabled()) {
-        LOG.debug(
-            "Removed container=" + containerId + " with tags=[" + StringUtils
-                .join(allocationTags, ",") + "]");
-      }
-    } finally {
-      writeLock.unlock();
-    }
-  }
-
-  /**
-   * Get cardinality for following conditions. External can pass-in a binary op
-   * to implement customized logic.   *
-   * @param nodeId        nodeId, required.
-   * @param applicationId applicationId. When null is specified, return
-   *                      aggregated cardinality among all nodes.
-   * @param tag           allocation tag, see
-   *                      {@link SchedulingRequest#getAllocationTags()},
-   *                      When multiple tags specified. Returns cardinality
-   *                      depends on op. If a specified tag doesn't exist,
-   *                      0 will be its cardinality.
-   *                      When null/empty tags specified, all tags
-   *                      (of the node/app) will be considered.
-   * @return cardinality of specified query on the node.
-   * @throws InvalidAllocationTagsQueryException when illegal query
-   *                                            parameter specified
-   */
-  public long getNodeCardinality(NodeId nodeId, ApplicationId applicationId,
-      String tag) throws InvalidAllocationTagsQueryException {
-    readLock.lock();
-
-    try {
-      if (nodeId == null) {
-        throw new InvalidAllocationTagsQueryException(
-            "Must specify nodeId/tags/op to query cardinality");
-      }
-
-      NodeToCountedTags mapping;
-      if (applicationId != null) {
-        mapping = perAppMappings.get(applicationId);
-      } else{
-        mapping = globalMapping;
-      }
-
-      if (mapping == null) {
-        return 0;
-      }
-
-      return mapping.getCardinality(nodeId, tag);
-    } finally {
-      readLock.unlock();
-    }
-  }
-
-  /**
-   * Check if given tag exists on node.
-   *
-   * @param nodeId        nodeId, required.
-   * @param applicationId applicationId. When null is specified, return
-   *                      aggregated cardinality among all nodes.
-   * @param tag           allocation tag, see
-   *                      {@link SchedulingRequest#getAllocationTags()},
-   *                      When multiple tags specified. Returns cardinality
-   *                      depends on op. If a specified tag doesn't exist,
-   *                      0 will be its cardinality.
-   *                      When null/empty tags specified, all tags
-   *                      (of the node/app) will be considered.
-   * @return cardinality of specified query on the node.
-   * @throws InvalidAllocationTagsQueryException when illegal query
-   *                                            parameter specified
-   */
-  public boolean allocationTagExistsOnNode(NodeId nodeId,
-      ApplicationId applicationId, String tag)
-      throws InvalidAllocationTagsQueryException {
-    return getNodeCardinality(nodeId, applicationId, tag) > 0;
-  }
-
-  /**
-   * Get cardinality for following conditions. External can pass-in a binary op
-   * to implement customized logic.
-   *
-   * @param nodeId        nodeId, required.
-   * @param applicationId applicationId. When null is specified, return
-   *                      aggregated cardinality among all nodes.
-   * @param tags          allocation tags, see
-   *                      {@link SchedulingRequest#getAllocationTags()},
-   *                      When multiple tags specified. Returns cardinality
-   *                      depends on op. If a specified tag doesn't exist, 0
-   *                      will be its cardinality. When null/empty tags
-   *                      specified, all tags (of the node/app) will be
-   *                      considered.
-   * @param op            operator. Such as Long::max, Long::sum, etc. Required.
-   *                      This sparameter only take effect when #values >= 2.
-   * @return cardinality of specified query on the node.
-   * @throws InvalidAllocationTagsQueryException when illegal query
-   *                                            parameter specified
-   */
-  public long getNodeCardinalityByOp(NodeId nodeId, ApplicationId applicationId,
-      Set<String> tags, LongBinaryOperator op)
-      throws InvalidAllocationTagsQueryException {
-    readLock.lock();
-
-    try {
-      if (nodeId == null || op == null) {
-        throw new InvalidAllocationTagsQueryException(
-            "Must specify nodeId/tags/op to query cardinality");
-      }
-
-      NodeToCountedTags mapping;
-      if (applicationId != null) {
-        mapping = perAppMappings.get(applicationId);
-      } else{
-        mapping = globalMapping;
-      }
-
-      if (mapping == null) {
-        return 0;
-      }
-
-      return mapping.getCardinality(nodeId, tags, op);
-    } finally {
-      readLock.unlock();
-    }
-  }
-}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsNamespaces.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsNamespaces.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsNamespaces.java
deleted file mode 100644
index 893ff1c..0000000
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsNamespaces.java
+++ /dev/null
@@ -1,31 +0,0 @@
-/*
- * *
- *  Licensed to the Apache Software Foundation (ASF) under one
- *  or more contributor license agreements.  See the NOTICE file
- *  distributed with this work for additional information
- *  regarding copyright ownership.  The ASF licenses this file
- *  to you under the Apache License, Version 2.0 (the
- *  "License"); you may not use this file except in compliance
- *  with the License.  You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- *  Unless required by applicable law or agreed to in writing, software
- *  distributed under the License is distributed on an "AS IS" BASIS,
- *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- *  See the License for the specific language governing permissions and
- *  limitations under the License.
- * /
- */
-
-package org.apache.hadoop.yarn.server.resourcemanager.constraint;
-
-/**
- * Predefined namespaces for tags
- *
- * Same as namespace  of resource types. Namespaces of placement tags are start
- * with alphabets and ended with "/"
- */
-public class AllocationTagsNamespaces {
-  public static final String APP_ID = "yarn_app_id/";
-}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/InvalidAllocationTagsQueryException.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/InvalidAllocationTagsQueryException.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/InvalidAllocationTagsQueryException.java
deleted file mode 100644
index 5519e39..0000000
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/InvalidAllocationTagsQueryException.java
+++ /dev/null
@@ -1,35 +0,0 @@
-/*
- * *
- *  Licensed to the Apache Software Foundation (ASF) under one
- *  or more contributor license agreements.  See the NOTICE file
- *  distributed with this work for additional information
- *  regarding copyright ownership.  The ASF licenses this file
- *  to you under the Apache License, Version 2.0 (the
- *  "License"); you may not use this file except in compliance
- *  with the License.  You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- *  Unless required by applicable law or agreed to in writing, software
- *  distributed under the License is distributed on an "AS IS" BASIS,
- *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- *  See the License for the specific language governing permissions and
- *  limitations under the License.
- * /
- */
-
-package org.apache.hadoop.yarn.server.resourcemanager.constraint;
-
-import org.apache.hadoop.yarn.exceptions.YarnException;
-
-/**
- * Exception when invalid parameter specified to do placement tags related
- * queries.
- */
-public class InvalidAllocationTagsQueryException extends YarnException {
-  private static final long serialVersionUID = 12312831974894L;
-
-  public InvalidAllocationTagsQueryException(String msg) {
-    super(msg);
-  }
-}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
new file mode 100644
index 0000000..c278606
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
@@ -0,0 +1,431 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import com.google.common.annotations.VisibleForTesting;
+import org.apache.commons.lang.StringUtils;
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.ContainerId;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.log4j.Logger;
+
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.Map;
+import java.util.Set;
+import java.util.concurrent.locks.ReentrantReadWriteLock;
+import java.util.function.LongBinaryOperator;
+
+/**
+ * Support storing maps between container-tags/applications and
+ * nodes. This will be required by affinity/anti-affinity implementation and
+ * cardinality.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+public class AllocationTagsManager {
+
+  private static final Logger LOG = Logger.getLogger(
+      AllocationTagsManager.class);
+
+  private ReentrantReadWriteLock.ReadLock readLock;
+  private ReentrantReadWriteLock.WriteLock writeLock;
+
+  // Application's tags to node
+  private Map<ApplicationId, NodeToCountedTags> perAppMappings =
+      new HashMap<>();
+
+  // Global tags to node mapping (used to fast return aggregated tags
+  // cardinality across apps)
+  private NodeToCountedTags globalMapping = new NodeToCountedTags();
+
+  /**
+   * Store node to counted tags.
+   */
+  @VisibleForTesting
+  static class NodeToCountedTags {
+    // Map<NodeId, Map<Tag, Count>>
+    private Map<NodeId, Map<String, Long>> nodeToTagsWithCount =
+        new HashMap<>();
+
+    // protected by external locks
+    private void addTagsToNode(NodeId nodeId, Set<String> tags) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.computeIfAbsent(nodeId,
+          k -> new HashMap<>());
+
+      for (String tag : tags) {
+        Long count = innerMap.get(tag);
+        if (count == null) {
+          innerMap.put(tag, 1L);
+        } else{
+          innerMap.put(tag, count + 1);
+        }
+      }
+    }
+
+    // protected by external locks
+    private void addTagToNode(NodeId nodeId, String tag) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.computeIfAbsent(nodeId,
+          k -> new HashMap<>());
+
+      Long count = innerMap.get(tag);
+      if (count == null) {
+        innerMap.put(tag, 1L);
+      } else{
+        innerMap.put(tag, count + 1);
+      }
+    }
+
+    private void removeTagFromInnerMap(Map<String, Long> innerMap, String tag) {
+      Long count = innerMap.get(tag);
+      if (count > 1) {
+        innerMap.put(tag, count - 1);
+      } else {
+        if (count <= 0) {
+          LOG.warn(
+              "Trying to remove tags from node, however the count already"
+                  + " becomes 0 or less, it could be a potential bug.");
+        }
+        innerMap.remove(tag);
+      }
+    }
+
+    private void removeTagsFromNode(NodeId nodeId, Set<String> tags) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      if (innerMap == null) {
+        LOG.warn("Failed to find node=" + nodeId
+            + " while trying to remove tags, please double check.");
+        return;
+      }
+
+      for (String tag : tags) {
+        removeTagFromInnerMap(innerMap, tag);
+      }
+
+      if (innerMap.isEmpty()) {
+        nodeToTagsWithCount.remove(nodeId);
+      }
+    }
+
+    private void removeTagFromNode(NodeId nodeId, String tag) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      if (innerMap == null) {
+        LOG.warn("Failed to find node=" + nodeId
+            + " while trying to remove tags, please double check.");
+        return;
+      }
+
+      removeTagFromInnerMap(innerMap, tag);
+
+      if (innerMap.isEmpty()) {
+        nodeToTagsWithCount.remove(nodeId);
+      }
+    }
+
+    private long getCardinality(NodeId nodeId, String tag) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      if (innerMap == null) {
+        return 0;
+      }
+      Long value = innerMap.get(tag);
+      return value == null ? 0 : value;
+    }
+
+    private long getCardinality(NodeId nodeId, Set<String> tags,
+        LongBinaryOperator op) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      if (innerMap == null) {
+        return 0;
+      }
+
+      long returnValue = 0;
+      boolean firstTag = true;
+
+      if (tags != null && !tags.isEmpty()) {
+        for (String tag : tags) {
+          Long value = innerMap.get(tag);
+          if (value == null) {
+            value = 0L;
+          }
+
+          if (firstTag) {
+            returnValue = value;
+            firstTag = false;
+            continue;
+          }
+
+          returnValue = op.applyAsLong(returnValue, value);
+        }
+      } else {
+        // Similar to above if, but only iterate values for better performance
+        for (long value : innerMap.values()) {
+          // For the first value, we will not apply op
+          if (firstTag) {
+            returnValue = value;
+            firstTag = false;
+            continue;
+          }
+          returnValue = op.applyAsLong(returnValue, value);
+        }
+      }
+      return returnValue;
+    }
+
+    private boolean isEmpty() {
+      return nodeToTagsWithCount.isEmpty();
+    }
+
+    @VisibleForTesting
+    public Map<NodeId, Map<String, Long>> getNodeToTagsWithCount() {
+      return nodeToTagsWithCount;
+    }
+  }
+
+  @VisibleForTesting
+  Map<ApplicationId, NodeToCountedTags> getPerAppMappings() {
+    return perAppMappings;
+  }
+
+  @VisibleForTesting
+  NodeToCountedTags getGlobalMapping() {
+    return globalMapping;
+  }
+
+  public AllocationTagsManager() {
+    ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
+    readLock = lock.readLock();
+    writeLock = lock.writeLock();
+  }
+
+  /**
+   * Notify container allocated on a node.
+   *
+   * @param nodeId         allocated node.
+   * @param applicationId  applicationId
+   * @param containerId    container id.
+   * @param allocationTags allocation tags, see
+   *                       {@link SchedulingRequest#getAllocationTags()}
+   *                       application_id will be added to allocationTags.
+   */
+  public void addContainer(NodeId nodeId, ApplicationId applicationId,
+      ContainerId containerId, Set<String> allocationTags) {
+    String applicationIdTag =
+        AllocationTagsNamespaces.APP_ID + applicationId.toString();
+
+    boolean useSet = false;
+    if (allocationTags != null && !allocationTags.isEmpty()) {
+      // Copy before edit it.
+      allocationTags = new HashSet<>(allocationTags);
+      allocationTags.add(applicationIdTag);
+      useSet = true;
+    }
+
+    writeLock.lock();
+    try {
+      NodeToCountedTags perAppTagsMapping = perAppMappings.computeIfAbsent(
+          applicationId, k -> new NodeToCountedTags());
+
+      if (useSet) {
+        perAppTagsMapping.addTagsToNode(nodeId, allocationTags);
+        globalMapping.addTagsToNode(nodeId, allocationTags);
+      } else {
+        perAppTagsMapping.addTagToNode(nodeId, applicationIdTag);
+        globalMapping.addTagToNode(nodeId, applicationIdTag);
+      }
+
+      if (LOG.isDebugEnabled()) {
+        LOG.debug(
+            "Added container=" + containerId + " with tags=[" + StringUtils
+                .join(allocationTags, ",") + "]");
+      }
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  /**
+   * Notify container removed.
+   *
+   * @param nodeId         nodeId
+   * @param applicationId  applicationId
+   * @param containerId    containerId.
+   * @param allocationTags allocation tags for given container
+   */
+  public void removeContainer(NodeId nodeId, ApplicationId applicationId,
+      ContainerId containerId, Set<String> allocationTags) {
+    String applicationIdTag =
+        AllocationTagsNamespaces.APP_ID + applicationId.toString();
+    boolean useSet = false;
+
+    if (allocationTags != null && !allocationTags.isEmpty()) {
+      // Copy before edit it.
+      allocationTags = new HashSet<>(allocationTags);
+      allocationTags.add(applicationIdTag);
+      useSet = true;
+    }
+
+    writeLock.lock();
+    try {
+      NodeToCountedTags perAppTagsMapping = perAppMappings.get(applicationId);
+      if (perAppTagsMapping == null) {
+        return;
+      }
+
+      if (useSet) {
+        perAppTagsMapping.removeTagsFromNode(nodeId, allocationTags);
+        globalMapping.removeTagsFromNode(nodeId, allocationTags);
+      } else {
+        perAppTagsMapping.removeTagFromNode(nodeId, applicationIdTag);
+        globalMapping.removeTagFromNode(nodeId, applicationIdTag);
+      }
+
+      if (perAppTagsMapping.isEmpty()) {
+        perAppMappings.remove(applicationId);
+      }
+
+      if (LOG.isDebugEnabled()) {
+        LOG.debug(
+            "Removed container=" + containerId + " with tags=[" + StringUtils
+                .join(allocationTags, ",") + "]");
+      }
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  /**
+   * Get cardinality for following conditions. External can pass-in a binary op
+   * to implement customized logic.   *
+   * @param nodeId        nodeId, required.
+   * @param applicationId applicationId. When null is specified, return
+   *                      aggregated cardinality among all nodes.
+   * @param tag           allocation tag, see
+   *                      {@link SchedulingRequest#getAllocationTags()},
+   *                      When multiple tags specified. Returns cardinality
+   *                      depends on op. If a specified tag doesn't exist,
+   *                      0 will be its cardinality.
+   *                      When null/empty tags specified, all tags
+   *                      (of the node/app) will be considered.
+   * @return cardinality of specified query on the node.
+   * @throws InvalidAllocationTagsQueryException when illegal query
+   *                                            parameter specified
+   */
+  public long getNodeCardinality(NodeId nodeId, ApplicationId applicationId,
+      String tag) throws InvalidAllocationTagsQueryException {
+    readLock.lock();
+
+    try {
+      if (nodeId == null) {
+        throw new InvalidAllocationTagsQueryException(
+            "Must specify nodeId/tags/op to query cardinality");
+      }
+
+      NodeToCountedTags mapping;
+      if (applicationId != null) {
+        mapping = perAppMappings.get(applicationId);
+      } else{
+        mapping = globalMapping;
+      }
+
+      if (mapping == null) {
+        return 0;
+      }
+
+      return mapping.getCardinality(nodeId, tag);
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  /**
+   * Check if given tag exists on node.
+   *
+   * @param nodeId        nodeId, required.
+   * @param applicationId applicationId. When null is specified, return
+   *                      aggregated cardinality among all nodes.
+   * @param tag           allocation tag, see
+   *                      {@link SchedulingRequest#getAllocationTags()},
+   *                      When multiple tags specified. Returns cardinality
+   *                      depends on op. If a specified tag doesn't exist,
+   *                      0 will be its cardinality.
+   *                      When null/empty tags specified, all tags
+   *                      (of the node/app) will be considered.
+   * @return cardinality of specified query on the node.
+   * @throws InvalidAllocationTagsQueryException when illegal query
+   *                                            parameter specified
+   */
+  public boolean allocationTagExistsOnNode(NodeId nodeId,
+      ApplicationId applicationId, String tag)
+      throws InvalidAllocationTagsQueryException {
+    return getNodeCardinality(nodeId, applicationId, tag) > 0;
+  }
+
+  /**
+   * Get cardinality for following conditions. External can pass-in a binary op
+   * to implement customized logic.
+   *
+   * @param nodeId        nodeId, required.
+   * @param applicationId applicationId. When null is specified, return
+   *                      aggregated cardinality among all nodes.
+   * @param tags          allocation tags, see
+   *                      {@link SchedulingRequest#getAllocationTags()},
+   *                      When multiple tags specified. Returns cardinality
+   *                      depends on op. If a specified tag doesn't exist, 0
+   *                      will be its cardinality. When null/empty tags
+   *                      specified, all tags (of the node/app) will be
+   *                      considered.
+   * @param op            operator. Such as Long::max, Long::sum, etc. Required.
+   *                      This sparameter only take effect when #values >= 2.
+   * @return cardinality of specified query on the node.
+   * @throws InvalidAllocationTagsQueryException when illegal query
+   *                                            parameter specified
+   */
+  public long getNodeCardinalityByOp(NodeId nodeId, ApplicationId applicationId,
+      Set<String> tags, LongBinaryOperator op)
+      throws InvalidAllocationTagsQueryException {
+    readLock.lock();
+
+    try {
+      if (nodeId == null || op == null) {
+        throw new InvalidAllocationTagsQueryException(
+            "Must specify nodeId/tags/op to query cardinality");
+      }
+
+      NodeToCountedTags mapping;
+      if (applicationId != null) {
+        mapping = perAppMappings.get(applicationId);
+      } else{
+        mapping = globalMapping;
+      }
+
+      if (mapping == null) {
+        return 0;
+      }
+
+      return mapping.getCardinality(nodeId, tags, op);
+    } finally {
+      readLock.unlock();
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsNamespaces.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsNamespaces.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsNamespaces.java
new file mode 100644
index 0000000..43fcfe5
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsNamespaces.java
@@ -0,0 +1,31 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+/**
+ * Predefined namespaces for tags
+ *
+ * Same as namespace  of resource types. Namespaces of placement tags are start
+ * with alphabets and ended with "/"
+ */
+public class AllocationTagsNamespaces {
+  public static final String APP_ID = "yarn_app_id/";
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/InvalidAllocationTagsQueryException.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/InvalidAllocationTagsQueryException.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/InvalidAllocationTagsQueryException.java
new file mode 100644
index 0000000..29483a2
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/InvalidAllocationTagsQueryException.java
@@ -0,0 +1,35 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import org.apache.hadoop.yarn.exceptions.YarnException;
+
+/**
+ * Exception when invalid parameter specified to do placement tags related
+ * queries.
+ */
+public class InvalidAllocationTagsQueryException extends YarnException {
+  private static final long serialVersionUID = 12312831974894L;
+
+  public InvalidAllocationTagsQueryException(String msg) {
+    super(msg);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithm.java
new file mode 100644
index 0000000..2651663
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithm.java
@@ -0,0 +1,43 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api;
+
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+
+/**
+ * Marker interface for a Constraint Placement. The only contract is that it
+ * should be initialized with the RMContext.
+ */
+public interface ConstraintPlacementAlgorithm {
+
+  /**
+   * Initialize the Algorithm.
+   * @param rmContext RMContext.
+   */
+  void init(RMContext rmContext);
+
+  /**
+   * The Algorithm is expected to compute the placement of the provided
+   * ConstraintPlacementAlgorithmInput and use the collector to aggregate
+   * any output.
+   * @param algorithmInput Input to the Algorithm.
+   * @param collector Collector for output of algorithm.
+   */
+  void place(ConstraintPlacementAlgorithmInput algorithmInput,
+      ConstraintPlacementAlgorithmOutputCollector collector);
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/c83ef6f6/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmInput.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmInput.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmInput.java
new file mode 100644
index 0000000..74572b8
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/api/ConstraintPlacementAlgorithmInput.java
@@ -0,0 +1,32 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api;
+
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+
+import java.util.Collection;
+
+/**
+ * This encapsulates an input to the Constraint Placement Algorithm. At the
+ * very least it must consist of a collection of SchedulerRequests.
+ */
+public interface ConstraintPlacementAlgorithmInput {
+
+  Collection<SchedulingRequest> getSchedulingRequests();
+
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[44/50] [abbrv] hadoop git commit: YARN-7780. Documentation for Placement Constraints. (Konstantinos Karanasos via asuresh)

Posted by as...@apache.org.
YARN-7780. Documentation for Placement Constraints. (Konstantinos Karanasos via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/6ae4cc99
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/6ae4cc99
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/6ae4cc99

Branch: refs/heads/YARN-6592
Commit: 6ae4cc995afb6e27922f4515b68033efa544afa7
Parents: 06d22eb
Author: Arun Suresh <as...@apache.org>
Authored: Tue Jan 30 07:38:27 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../yarn/api/resource/PlacementConstraints.java |  17 ++-
 .../hadoop/yarn/conf/YarnConfiguration.java     |  11 +-
 .../site/markdown/PlacementConstraints.md.vm    | 149 +++++++++++++++++++
 3 files changed, 164 insertions(+), 13 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/6ae4cc99/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
index 70a8080..c1549c5 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
@@ -96,8 +96,9 @@ public final class PlacementConstraints {
    * Creates a constraint that restricts the number of allocations within a
    * given scope (e.g., node or rack).
    *
-   * For example, {@code cardinality(NODE, 3, 10)}, restricts the number of
-   * allocations per node to be no less than 3 and no more than 10.
+   * For example, {@code cardinality(NODE, 3, 10, "zk")} is satisfied on nodes
+   * where there are no less than 3 allocations with tag "zk" and no more than
+   * 10.
    *
    * @param scope the scope of the constraint
    * @param minCardinality determines the minimum number of allocations within
@@ -132,7 +133,7 @@ public final class PlacementConstraints {
 
   /**
    * Similar to {@link #cardinality(String, int, int, String...)}, but
-   * determines only the maximum cardinality (the minimum can be as low as 0).
+   * determines only the maximum cardinality (the minimum cardinality is 0).
    *
    * @param scope the scope of the constraint
    * @param maxCardinality determines the maximum number of allocations within
@@ -150,7 +151,7 @@ public final class PlacementConstraints {
    *
    * Consider a set of nodes N that belongs to the scope specified in the
    * constraint. If the target expressions are satisfied at least minCardinality
-   * times and at most max-cardinality times in the node set N, then the
+   * times and at most maxCardinality times in the node set N, then the
    * constraint is satisfied.
    *
    * For example, {@code targetCardinality(RACK, 2, 10, allocationTag("zk"))},
@@ -197,7 +198,7 @@ public final class PlacementConstraints {
 
     /**
      * Constructs a target expression on a node partition. It is satisfied if
-     * the specified node partition has one of the specified nodePartitions
+     * the specified node partition has one of the specified nodePartitions.
      *
      * @param nodePartitions the set of values that the attribute should take
      *          values from
@@ -211,7 +212,7 @@ public final class PlacementConstraints {
 
     /**
      * Constructs a target expression on an allocation tag. It is satisfied if
-     * the there are allocations with one of the given tags.
+     * there are allocations with one of the given tags.
      *
      * @param allocationTags the set of tags that the attribute should take
      *          values from
@@ -224,8 +225,8 @@ public final class PlacementConstraints {
 
     /**
      * Constructs a target expression on an allocation tag. It is satisfied if
-     * the there are allocations with one of the given tags. Comparing to
-     * {@link PlacementTargets#allocationTag(String...)}, this only check tags
+     * there are allocations with one of the given tags. Comparing to
+     * {@link PlacementTargets#allocationTag(String...)}, this only checks tags
      * within the application.
      *
      * @param allocationTags the set of tags that the attribute should take

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6ae4cc99/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
index f5bb2c7..118f9fb 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
@@ -532,6 +532,12 @@ public class YarnConfiguration extends Configuration {
   public static final String RM_SCHEDULER = 
     RM_PREFIX + "scheduler.class";
 
+  /** Enable rich placement constraints. */
+  public static final String RM_PLACEMENT_CONSTRAINTS_ENABLED =
+      RM_PREFIX + "placement-constraints.enabled";
+
+  public static final boolean DEFAULT_RM_PLACEMENT_CONSTRAINTS_ENABLED = false;
+
   /** Placement Algorithm. */
   public static final String RM_PLACEMENT_CONSTRAINTS_ALGORITHM_CLASS =
       RM_PREFIX + "placement-constraints.algorithm.class";
@@ -540,11 +546,6 @@ public class YarnConfiguration extends Configuration {
   public static final String RM_PLACEMENT_CONSTRAINTS_ALGORITHM_ITERATOR =
       RM_PREFIX + "placement-constraints.algorithm.iterator";
 
-  public static final String RM_PLACEMENT_CONSTRAINTS_ENABLED =
-      RM_PREFIX + "placement-constraints.enabled";
-
-  public static final boolean DEFAULT_RM_PLACEMENT_CONSTRAINTS_ENABLED = false;
-
   public static final String RM_PLACEMENT_CONSTRAINTS_RETRY_ATTEMPTS =
       RM_PREFIX + "placement-constraints.retry-attempts";
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6ae4cc99/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-site/src/site/markdown/PlacementConstraints.md.vm
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-site/src/site/markdown/PlacementConstraints.md.vm b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-site/src/site/markdown/PlacementConstraints.md.vm
new file mode 100644
index 0000000..7926eab
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-site/src/site/markdown/PlacementConstraints.md.vm
@@ -0,0 +1,149 @@
+<!---
+  Licensed under the Apache License, Version 2.0 (the "License");
+  you may not use this file except in compliance with the License.
+  You may obtain a copy of the License at
+
+   http://www.apache.org/licenses/LICENSE-2.0
+
+  Unless required by applicable law or agreed to in writing, software
+  distributed under the License is distributed on an "AS IS" BASIS,
+  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+  See the License for the specific language governing permissions and
+  limitations under the License. See accompanying LICENSE file.
+-->
+
+#set ( $H3 = '###' )
+#set ( $H4 = '####' )
+#set ( $H5 = '#####' )
+
+Placement Constraints
+=====================
+
+<!-- MACRO{toc|fromDepth=0|toDepth=3} -->
+
+
+Overview
+--------
+
+YARN allows applications to specify placement constraints in the form of data locality (preference to specific nodes or racks) or (non-overlapping) node labels. This document focuses on more expressive placement constraints in YARN. Such constraints can be crucial for the performance and resilience of applications, especially those that include long-running containers, such as services, machine-learning and streaming workloads.
+
+For example, it may be beneficial to co-locate the allocations of a job on the same rack (*affinity* constraints) to reduce network costs, spread allocations across machines (*anti-affinity* constraints) to minimize resource interference, or allow up to a specific number of allocations in a node group (*cardinality* constraints) to strike a balance between the two. Placement decisions also affect resilience. For example, allocations placed within the same cluster upgrade domain would go offline simultaneously.
+
+The applications can specify constraints without requiring knowledge of the underlying topology of the cluster (e.g., one does not need to specify the specific node or rack where their containers should be placed with constraints) or the other applications deployed. Currently **intra-application** constraints are supported, but the design that is followed is generic and support for constraints across applications will soon be added. Moreover, all constraints at the moment are **hard**, that is, if the constraints for a container cannot be satisfied due to the current cluster condition or conflicting constraints, the container request gets rejected.
+
+Note that in this document we use the notion of “allocation” to refer to a unit of resources (e.g., CPU and memory) that gets allocated in a node. In the current implementation of YARN, an allocation corresponds to a single container. However, in case an application uses an allocation to spawn more than one containers, an allocation could correspond to multiple containers.
+
+
+Quick Guide
+-----------
+
+We first describe how to enable scheduling with placement constraints and then provide examples of how to experiment with this feature using the distributed shell, an application that allows to run a given shell command on a set of containers.
+
+$H3 Enabling placement constraints
+
+To enable placement constraints, the following property has to be set to **true** in **conf/yarn-site.xml**:
+
+| Property | Description | Default value |
+|:-------- |:----------- |:------------- |
+| `yarn.resourcemanager.placement-constraints.enabled` | Enables rich placement constraints. | `false` |
+
+
+Further, the user can choose between the following two alternatives for placing containers with constraints:
+
+* **Placement processor:** Following this approach, the placement of containers with constraints is determined as a pre-processing step before the capacity or the fair scheduler is called. Once the placement is decided, the capacity/fair scheduler is invoked to perform the actual allocation. The advantage of this approach is that it supports all constraint types (affinity, anti-affinity, cardinality). Moreover, it considers multiple containers at a time, which allows to satisfy more constraints than a container-at-a-time approach can achieve. As it sits outside the main scheduler, it can be used by both the capacity and fair schedulers. Note that at the moment it does not account for task priorities within an application, given that such priorities might be conflicting with the placement constraints.
+* **Placement allocator in capacity scheduler:** This approach places containers with constraints within the capacity scheduler. It currently supports anti-affinity constraints (no affinity or cardinality) and places one container at a time. However, it supports traditional task priorities within an application.
+
+The placement processor approach supports a wider range of constraints and can allow more containers to be placed especially when applications have demanding constraints or the cluster is highly-utilized (due to considering multiple containers at a time). However, if respecting task priority within an application is important for the user and the capacity scheduler is used, then the placement allocator in the capacity scheduler should be used instead.
+
+By default, the placement processor approach is enabled. To use the placement allocator in the capacity scheduler instead, the following parameter has to be set to **true** in the **conf/capacity-scheduler.xml**:
+
+| Property | Description | Default value |
+|:-------- |:----------- |:------------- |
+| `yarn.scheduler.capacity.scheduling-request.allowed` | When set to false, the placement processor is used; when set to true, the allocator inside the capacity scheduler is used. | `false` |
+
+
+
+$H3 Experimenting with placement constraints using distributed shell
+
+Users can experiment with placement constraints by using the distributed shell application through the following command:
+
+```
+$ yarn org.apache.hadoop.yarn.applications.distributedshell.Client -jar share/hadoop/yarn/hadoop-yarn-applications-distributedshell-${project.version}.jar -shell_command sleep -shell_args 10 -placement_spec PlacementSpec
+```
+
+where **PlacementSpec** is of the form:
+
+```
+PlacementSpec => "" | KeyVal;PlacementSpec
+KeyVal        => SourceTag=Constraint
+SourceTag     => String
+Constraint    => NumContainers | NumContainers,"IN",Scope,TargetTag | NumContainers,"NOTIN",Scope,TargetTag | NumContainers,"CARDINALITY",Scope,TargetTag,MinCard,MaxCard
+NumContainers => int
+Scope         => "NODE" | "RACK"
+TargetTag     => String
+MinCard       => int
+MaxCard       => int
+```
+
+Note that when the `-placement_spec` argument is specified in the distributed shell command, the `-num-containers` argument should not be used. In case `-num-containers` argument is used in conjunction with `-placement-spec`, the former is ignored. This is because in PlacementSpec, we determine the number of containers per tag, making the `-num-containers` redundant and possibly conflicting. Moreover, if `-placement_spec` is used, all containers will be requested with GUARANTEED execution type.
+
+An example of PlacementSpec is the following:
+```
+zk=3,NOTIN,NODE,zk:hbase=5,IN,RACK,zk:spark=7,CARDINALITY,NODE,hbase,1,3
+```
+The above encodes two constraints:
+* place 3 containers with tag "zk" (standing for ZooKeeper) with node anti-affinity to each other, i.e., do not place more than one container per node (notice that in this first constraint, the SourceTag and the TargetTag of the constraint coincide);
+* place 5 containers with tag "hbase" with affinity to a rack on which containers with tag "zk" are running (i.e., an "hbase" container should not be placed at a rack where an "zk" container is running, given that "zk" is the TargetTag of the second constraint);
+* place 7 container with tag "spark" in nodes that have at least one, but no more than three, containers, with tag "hbase".
+
+
+
+Defining Placement Constraints
+------------------------------
+
+$H3 Allocation tags
+
+Allocation tags are string tags that an application can associate with (groups of) its containers. Tags are used to identify components of applications. For example, an HBase Master allocation can be tagged with "hbase-m", and Region Servers with "hbase-rs". Other examples are "latency-critical" to refer to the more general demands of the allocation, or "app_0041" to denote the job ID. Allocation tags play a key role in constraints, as they allow to refer to multiple allocations that share a common tag.
+
+Note that instead of using the `ResourceRequest` object to define allocation tags, we use the new `SchedulingRequest` object. This has many similarities with the `ResourceRequest`, but better separates the sizing of the requested allocations (number and size of allocations, priority, execution type, etc.), and the constraints dictating how these allocations should be placed (resource name, relaxed locality). Applications can still use `ResourceRequest` objects, but in order to define allocation tags and constraints, they need to use the `SchedulingRequest` object. Within a single `AllocateRequest`, an application should use either the `ResourceRequest` or the `SchedulingRequest` objects, but not both of them.
+
+$H4 Differences between node labels, node attributes and allocation tags
+
+The difference between allocation tags and node labels or node attributes (YARN-3409), is that allocation tags are attached to allocations and not to nodes. When an allocation gets allocated to a node by the scheduler, the set of tags of that allocation are automatically added to the node for the duration of the allocation. Hence, a node inherits the tags of the allocations that are currently allocated to the node. Likewise, a rack inherits the tags of its nodes. Moreover, similar to node labels and unlike node attributes, allocation tags have no value attached to them. As we show below, our constraints can refer to allocation tags, as well as node labels and node attributes.
+
+
+$H3 Placement constraints API
+
+Applications can use the public API in the `PlacementConstraints` to construct placement constraint. Before describing the methods for building constraints, we describe the methods of the `PlacementTargets` class that are used to construct the target expressions that will then be used in constraints:
+
+| Method | Description |
+|:------ |:----------- |
+| `allocationTag(String... allocationTags)` | Constructs a target expression on an allocation tag. It is satisfied if there are allocations with one of the given tags. |
+| `allocationTagToIntraApp(String... allocationTags)` | similar to `allocationTag(String...)`, but targeting only the containers of the application that will use this target (intra-application constraints). |
+| `nodePartition(String... nodePartitions)` | Constructs a target expression on a node partition. It is satisfied for nodes that belong to one of the `nodePartitions`. |
+| `nodeAttribute(String attributeKey, String... attributeValues)` | Constructs a target expression on a node attribute. It is satisfied if the specified node attribute has one of the specified values. |
+
+Note that the `nodeAttribute` method above is not yet functional, as it requires the ongoing node attributes feature.
+
+The methods of the `PlacementConstraints` class for building constraints are the following:
+
+| Method | Description |
+|:------ |:----------- |
+| `targetIn(String scope, TargetExpression... targetExpressions)` | Creates a constraint that requires allocations to be placed on nodes that satisfy all target expressions within the given scope (e.g., node or rack). For example, `targetIn(RACK, allocationTag("hbase-m"))`, allows allocations on nodes that belong to a rack that has at least one allocation with tag "hbase-m". |
+| `targetNotIn(String scope, TargetExpression... targetExpressions)` | Creates a constraint that requires allocations to be placed on nodes that belong to a scope (e.g., node or rack) that does not satisfy any of the target expressions. |
+| `cardinality(String scope, int minCardinality, int maxCardinality, String... allocationTags)` | Creates a constraint that restricts the number of allocations within a given scope (e.g., node or rack). For example, {@code cardinality(NODE, 3, 10, "zk")} is satisfied on nodes where there are no less than 3 allocations with tag "zk" and no more than 10. |
+| `minCardinality(String scope, int minCardinality, String... allocationTags)` | Similar to `cardinality(String, int, int, String...)`, but determines only the minimum cardinality (the maximum cardinality is unbound). |
+| `maxCardinality(String scope, int maxCardinality, String... allocationTags)` | Similar to `cardinality(String, int, int, String...)`, but determines only the maximum cardinality (the minimum cardinality is 0). |
+| `targetCardinality(String scope, int minCardinality, int maxCardinality, String... allocationTags)` | This constraint generalizes the cardinality and target constraints. Consider a set of nodes N that belongs to the scope specified in the constraint. If the target expressions are satisfied at least minCardinality times and at most maxCardinality times in the node set N, then the constraint is satisfied. For example, `targetCardinality(RACK, 2, 10, allocationTag("zk"))`, requires an allocation to be placed within a rack that has at least 2 and at most 10 other allocations with tag "zk". |
+
+The `PlacementConstraints` class also includes method for building compound constraints (AND/OR expressions with multiple constraints). Adding support for compound constraints is work in progress.
+
+
+$H3 Specifying constraints in applications
+
+Applications have to specify the containers for which each constraint will be enabled. To this end, applications can provide a mapping from a set of allocation tags (source tags) to a placement constraint. For example, an entry of this mapping could be "hbase"->constraint1, which means that constraint1 will be applied when scheduling each allocation with tag "hbase".
+
+When using the placement processor approach (see [Enabling placement constraints](#Enabling_placement_constraints)), this constraint mapping is specified within the `RegisterApplicationMasterRequest`.
+
+When using the placement allocator in the capacity scheduler, the constraints can also be added at each `SchedulingRequest` object. Each such constraint is valid for the tag of that scheduling request. In case constraints are specified both at the `ReisterApplicationMasterRequest` and the scheduling requests, the latter override the former.
+


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[27/50] [abbrv] hadoop git commit: YARN-6595. [API] Add Placement Constraints at the application level. (Arun Suresh via kkaranasos)

Posted by as...@apache.org.
YARN-6595. [API] Add Placement Constraints at the application level. (Arun Suresh via kkaranasos)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/6c114d0f
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/6c114d0f
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/6c114d0f

Branch: refs/heads/YARN-6592
Commit: 6c114d0f85449d8fa34fd57a5c06fefec3bddd8e
Parents: 2dfe2c7
Author: Konstantinos Karanasos <kk...@apache.org>
Authored: Mon Nov 13 15:25:24 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../RegisterApplicationMasterRequest.java       |  42 ++++-
 .../yarn/api/resource/PlacementConstraint.java  | 156 +++++++++++++++++++
 .../src/main/proto/yarn_protos.proto            |   6 +
 .../src/main/proto/yarn_service_protos.proto    |   1 +
 .../RegisterApplicationMasterRequestPBImpl.java | 106 ++++++++++++-
 .../hadoop/yarn/api/BasePBImplRecordsTest.java  |  11 ++
 6 files changed, 313 insertions(+), 9 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/6c114d0f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/RegisterApplicationMasterRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/RegisterApplicationMasterRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/RegisterApplicationMasterRequest.java
index 395e190..f2d537a 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/RegisterApplicationMasterRequest.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/RegisterApplicationMasterRequest.java
@@ -18,11 +18,16 @@
 
 package org.apache.hadoop.yarn.api.protocolrecords;
 
+import java.util.HashMap;
+import java.util.Map;
+import java.util.Set;
+
 import org.apache.hadoop.classification.InterfaceAudience.Public;
 import org.apache.hadoop.classification.InterfaceStability.Stable;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
 import org.apache.hadoop.yarn.api.ApplicationMasterProtocol;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.util.Records;
-
 /**
  * The request sent by the {@code ApplicationMaster} to {@code ResourceManager}
  * on registration.
@@ -132,4 +137,39 @@ public abstract class RegisterApplicationMasterRequest {
   @Public
   @Stable
   public abstract void setTrackingUrl(String trackingUrl);
+
+  /**
+   * Return all Placement Constraints specified at the Application level. The
+   * mapping is from a set of allocation tags to a
+   * <code>PlacementConstraint</code> associated with the tags, i.e., each
+   * {@link org.apache.hadoop.yarn.api.records.SchedulingRequest} that has those
+   * tags will be placed taking into account the corresponding constraint.
+   *
+   * @return A map of Placement Constraints.
+   */
+  @Public
+  @Unstable
+  public Map<Set<String>, PlacementConstraint> getPlacementConstraints() {
+    return new HashMap<>();
+  }
+
+  /**
+   * Set Placement Constraints applicable to the
+   * {@link org.apache.hadoop.yarn.api.records.SchedulingRequest}s
+   * of this application.
+   * The mapping is from a set of allocation tags to a
+   * <code>PlacementConstraint</code> associated with the tags.
+   * For example:
+   *  Map &lt;
+   *   &lt;hb_regionserver&gt; -&gt; node_anti_affinity,
+   *   &lt;hb_regionserver, hb_master&gt; -&gt; rack_affinity,
+   *   ...
+   *  &gt;
+   * @param placementConstraints Placement Constraint Mapping.
+   */
+  @Public
+  @Unstable
+  public void setPlacementConstraints(
+      Map<Set<String>, PlacementConstraint> placementConstraints) {
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6c114d0f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
index f0e3982..b6e851a 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
@@ -54,6 +54,26 @@ public class PlacementConstraint {
     return constraintExpr;
   }
 
+  @Override
+  public boolean equals(Object o) {
+    if (this == o) {
+      return true;
+    }
+    if (!(o instanceof PlacementConstraint)) {
+      return false;
+    }
+
+    PlacementConstraint that = (PlacementConstraint) o;
+
+    return getConstraintExpr() != null ? getConstraintExpr().equals(that
+        .getConstraintExpr()) : that.getConstraintExpr() == null;
+  }
+
+  @Override
+  public int hashCode() {
+    return getConstraintExpr() != null ? getConstraintExpr().hashCode() : 0;
+  }
+
   /**
    * Interface used to enable the elements of the constraint tree to be visited.
    */
@@ -174,6 +194,38 @@ public class PlacementConstraint {
     }
 
     @Override
+    public boolean equals(Object o) {
+      if (this == o) {
+        return true;
+      }
+      if (!(o instanceof SingleConstraint)) {
+        return false;
+      }
+
+      SingleConstraint that = (SingleConstraint) o;
+
+      if (getMinCardinality() != that.getMinCardinality()) {
+        return false;
+      }
+      if (getMaxCardinality() != that.getMaxCardinality()) {
+        return false;
+      }
+      if (!getScope().equals(that.getScope())) {
+        return false;
+      }
+      return getTargetExpressions().equals(that.getTargetExpressions());
+    }
+
+    @Override
+    public int hashCode() {
+      int result = getScope().hashCode();
+      result = 31 * result + getMinCardinality();
+      result = 31 * result + getMaxCardinality();
+      result = 31 * result + getTargetExpressions().hashCode();
+      return result;
+    }
+
+    @Override
     public <T> T accept(Visitor<T> visitor) {
       return visitor.visit(this);
     }
@@ -332,6 +384,34 @@ public class PlacementConstraint {
     }
 
     @Override
+    public boolean equals(Object o) {
+      if (this == o) {
+        return true;
+      }
+      if (!(o instanceof TargetConstraint)) {
+        return false;
+      }
+
+      TargetConstraint that = (TargetConstraint) o;
+
+      if (getOp() != that.getOp()) {
+        return false;
+      }
+      if (!getScope().equals(that.getScope())) {
+        return false;
+      }
+      return getTargetExpressions().equals(that.getTargetExpressions());
+    }
+
+    @Override
+    public int hashCode() {
+      int result = getOp().hashCode();
+      result = 31 * result + getScope().hashCode();
+      result = 31 * result + getTargetExpressions().hashCode();
+      return result;
+    }
+
+    @Override
     public <T> T accept(Visitor<T> visitor) {
       return visitor.visit(this);
     }
@@ -388,6 +468,34 @@ public class PlacementConstraint {
     public <T> T accept(Visitor<T> visitor) {
       return visitor.visit(this);
     }
+
+    @Override
+    public boolean equals(Object o) {
+      if (this == o) {
+        return true;
+      }
+      if (o == null || getClass() != o.getClass()) {
+        return false;
+      }
+
+      CardinalityConstraint that = (CardinalityConstraint) o;
+
+      if (minCardinality != that.minCardinality) {
+        return false;
+      }
+      if (maxCardinality != that.maxCardinality) {
+        return false;
+      }
+      return scope != null ? scope.equals(that.scope) : that.scope == null;
+    }
+
+    @Override
+    public int hashCode() {
+      int result = scope != null ? scope.hashCode() : 0;
+      result = 31 * result + minCardinality;
+      result = 31 * result + maxCardinality;
+      return result;
+    }
   }
 
   /**
@@ -406,6 +514,25 @@ public class PlacementConstraint {
      * @return the children of the composite constraint
      */
     public abstract List<R> getChildren();
+
+    @Override
+    public boolean equals(Object o) {
+      if (this == o) {
+        return true;
+      }
+      if (o == null || getClass() != o.getClass()) {
+        return false;
+      }
+
+      return getChildren() != null ? getChildren().equals(
+          ((CompositeConstraint)o).getChildren()) :
+          ((CompositeConstraint)o).getChildren() == null;
+    }
+
+    @Override
+    public int hashCode() {
+      return getChildren() != null ? getChildren().hashCode() : 0;
+    }
   }
 
   /**
@@ -563,5 +690,34 @@ public class PlacementConstraint {
     public <T> T accept(Visitor<T> visitor) {
       return visitor.visit(this);
     }
+
+    @Override
+    public boolean equals(Object o) {
+      if (this == o) {
+        return true;
+      }
+      if (o == null || getClass() != o.getClass()) {
+        return false;
+      }
+
+      TimedPlacementConstraint that = (TimedPlacementConstraint) o;
+
+      if (schedulingDelay != that.schedulingDelay) {
+        return false;
+      }
+      if (constraint != null ? !constraint.equals(that.constraint) :
+          that.constraint != null) {
+        return false;
+      }
+      return delayUnit == that.delayUnit;
+    }
+
+    @Override
+    public int hashCode() {
+      int result = constraint != null ? constraint.hashCode() : 0;
+      result = 31 * result + (int) (schedulingDelay ^ (schedulingDelay >>> 32));
+      result = 31 * result + (delayUnit != null ? delayUnit.hashCode() : 0);
+      return result;
+    }
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6c114d0f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
index d24f863..fdc39a7 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
@@ -649,6 +649,12 @@ message CompositePlacementConstraintProto {
   repeated TimedPlacementConstraintProto timedChildConstraints = 3;
 }
 
+// This associates a set of allocation tags to a Placement Constraint.
+message PlacementConstraintMapEntryProto {
+  repeated string allocation_tags = 1;
+  optional PlacementConstraintProto placement_constraint = 2;
+}
+
 ////////////////////////////////////////////////////////////////////////
 ////// From reservation_protocol /////////////////////////////////////
 ////////////////////////////////////////////////////////////////////////

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6c114d0f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
index 4e97c74..68e585d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
@@ -38,6 +38,7 @@ message RegisterApplicationMasterRequestProto {
   optional string host = 1;
   optional int32 rpc_port = 2;
   optional string tracking_url = 3;
+  repeated PlacementConstraintMapEntryProto placement_constraints = 4;
 }
 
 message RegisterApplicationMasterResponseProto {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6c114d0f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/RegisterApplicationMasterRequestPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/RegisterApplicationMasterRequestPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/RegisterApplicationMasterRequestPBImpl.java
index 037dfd9..64bee85 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/RegisterApplicationMasterRequestPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/RegisterApplicationMasterRequestPBImpl.java
@@ -21,24 +21,41 @@ package org.apache.hadoop.yarn.api.protocolrecords.impl.pb;
 
 import org.apache.hadoop.classification.InterfaceAudience.Private;
 import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.yarn.api.pb.PlacementConstraintFromProtoConverter;
+import org.apache.hadoop.yarn.api.pb.PlacementConstraintToProtoConverter;
 import org.apache.hadoop.yarn.api.protocolrecords.RegisterApplicationMasterRequest;
+
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.proto.YarnProtos;
 import org.apache.hadoop.yarn.proto.YarnServiceProtos.RegisterApplicationMasterRequestProto;
 import org.apache.hadoop.yarn.proto.YarnServiceProtos.RegisterApplicationMasterRequestProtoOrBuilder;
 
 import com.google.protobuf.TextFormat;
 
+import java.util.ArrayList;
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.Iterator;
+import java.util.List;
+import java.util.Map;
+import java.util.Set;
+
 @Private
 @Unstable
-public class RegisterApplicationMasterRequestPBImpl extends RegisterApplicationMasterRequest {
-  RegisterApplicationMasterRequestProto proto = RegisterApplicationMasterRequestProto.getDefaultInstance();
-  RegisterApplicationMasterRequestProto.Builder builder = null;
+public class RegisterApplicationMasterRequestPBImpl
+    extends RegisterApplicationMasterRequest {
+  private RegisterApplicationMasterRequestProto proto =
+      RegisterApplicationMasterRequestProto.getDefaultInstance();
+  private RegisterApplicationMasterRequestProto.Builder builder = null;
+  private Map<Set<String>, PlacementConstraint> placementConstraints = null;
   boolean viaProto = false;
   
   public RegisterApplicationMasterRequestPBImpl() {
     builder = RegisterApplicationMasterRequestProto.newBuilder();
   }
 
-  public RegisterApplicationMasterRequestPBImpl(RegisterApplicationMasterRequestProto proto) {
+  public RegisterApplicationMasterRequestPBImpl(
+      RegisterApplicationMasterRequestProto proto) {
     this.proto = proto;
     viaProto = true;
   }
@@ -71,6 +88,30 @@ public class RegisterApplicationMasterRequestPBImpl extends RegisterApplicationM
   }
 
   private void mergeLocalToBuilder() {
+    if (this.placementConstraints != null) {
+      addPlacementConstraintMap();
+    }
+  }
+
+  private void addPlacementConstraintMap() {
+    maybeInitBuilder();
+    builder.clearPlacementConstraints();
+    if (this.placementConstraints == null) {
+      return;
+    }
+    List<YarnProtos.PlacementConstraintMapEntryProto> protoList =
+        new ArrayList<>();
+    for (Map.Entry<Set<String>, PlacementConstraint> entry :
+        this.placementConstraints.entrySet()) {
+      protoList.add(
+          YarnProtos.PlacementConstraintMapEntryProto.newBuilder()
+              .addAllAllocationTags(entry.getKey())
+              .setPlacementConstraint(
+                  new PlacementConstraintToProtoConverter(
+                      entry.getValue()).convert())
+              .build());
+    }
+    builder.addAllPlacementConstraints(protoList);
   }
 
   private void mergeLocalToProto() {
@@ -90,7 +131,8 @@ public class RegisterApplicationMasterRequestPBImpl extends RegisterApplicationM
 
   @Override
   public String getHost() {
-    RegisterApplicationMasterRequestProtoOrBuilder p = viaProto ? proto : builder;
+    RegisterApplicationMasterRequestProtoOrBuilder p =
+        viaProto ? proto : builder;
     return p.getHost();
   }
 
@@ -106,7 +148,8 @@ public class RegisterApplicationMasterRequestPBImpl extends RegisterApplicationM
 
   @Override
   public int getRpcPort() {
-    RegisterApplicationMasterRequestProtoOrBuilder p = viaProto ? proto : builder;
+    RegisterApplicationMasterRequestProtoOrBuilder p =
+        viaProto ? proto : builder;
     return p.getRpcPort();
   }
 
@@ -118,7 +161,8 @@ public class RegisterApplicationMasterRequestPBImpl extends RegisterApplicationM
 
   @Override
   public String getTrackingUrl() {
-    RegisterApplicationMasterRequestProtoOrBuilder p = viaProto ? proto : builder;
+    RegisterApplicationMasterRequestProtoOrBuilder p =
+        viaProto ? proto : builder;
     return p.getTrackingUrl();
   }
 
@@ -131,4 +175,50 @@ public class RegisterApplicationMasterRequestPBImpl extends RegisterApplicationM
     }
     builder.setTrackingUrl(url);
   }
-}  
+
+  private void initPlacementConstraintMap() {
+    if (this.placementConstraints != null) {
+      return;
+    }
+    RegisterApplicationMasterRequestProtoOrBuilder p =
+        viaProto ? proto : builder;
+    List<YarnProtos.PlacementConstraintMapEntryProto> pcmList =
+        p.getPlacementConstraintsList();
+    this.placementConstraints = new HashMap<>();
+    for (YarnProtos.PlacementConstraintMapEntryProto e : pcmList) {
+      this.placementConstraints.put(
+          new HashSet<>(e.getAllocationTagsList()),
+          new PlacementConstraintFromProtoConverter(
+              e.getPlacementConstraint()).convert());
+    }
+  }
+
+  @Override
+  public Map<Set<String>, PlacementConstraint> getPlacementConstraints() {
+    initPlacementConstraintMap();
+    return this.placementConstraints;
+  }
+
+  @Override
+  public void setPlacementConstraints(
+      Map<Set<String>, PlacementConstraint> constraints) {
+    maybeInitBuilder();
+    if (constraints == null) {
+      builder.clearPlacementConstraints();
+    } else {
+      removeEmptyKeys(constraints);
+    }
+    this.placementConstraints = constraints;
+  }
+
+  private void removeEmptyKeys(
+      Map<Set<String>, PlacementConstraint> constraintMap) {
+    Iterator<Set<String>> iter = constraintMap.keySet().iterator();
+    while (iter.hasNext()) {
+      Set<String> aTags = iter.next();
+      if (aTags.size() == 0) {
+        iter.remove();
+      }
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6c114d0f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/BasePBImplRecordsTest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/BasePBImplRecordsTest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/BasePBImplRecordsTest.java
index 8694651..ebd66af 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/BasePBImplRecordsTest.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/BasePBImplRecordsTest.java
@@ -22,12 +22,19 @@ import com.google.common.collect.Maps;
 import com.google.common.collect.Sets;
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.junit.Assert;
 
 import java.lang.reflect.*;
 import java.nio.ByteBuffer;
 import java.util.*;
 
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints
+    .PlacementTargets.allocationTag;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetIn;
+
 /**
  * Generic helper class to validate protocol records.
  */
@@ -85,6 +92,10 @@ public class BasePBImplRecordsTest {
         ByteBuffer buff = ByteBuffer.allocate(4);
         rand.nextBytes(buff.array());
         return buff;
+      } else if (type.equals(PlacementConstraint.class)) {
+        PlacementConstraint.AbstractConstraint sConstraintExpr =
+            targetIn(NODE, allocationTag("foo"));
+        ret = PlacementConstraints.build(sConstraintExpr);
       }
     } else if (type instanceof ParameterizedType) {
       ParameterizedType pt = (ParameterizedType)type;


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[22/50] [abbrv] hadoop git commit: YARN-6599. Support anti-affinity constraint via AppPlacementAllocator. (Wangda Tan via asuresh)

Posted by as...@apache.org.
http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAutoQueueCreation.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAutoQueueCreation.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAutoQueueCreation.java
index a3b88c0..01d5e6c 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAutoQueueCreation.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAutoQueueCreation.java
@@ -170,7 +170,7 @@ public class TestCapacitySchedulerAutoQueueCreation
           1 * GB, 1, true, priority, recordFactory);
 
       cs.allocate(appAttemptId, Collections.<ResourceRequest>singletonList(r1),
-          Collections.<ContainerId>emptyList(), Collections.singletonList(host),
+          null, Collections.<ContainerId>emptyList(), Collections.singletonList(host),
           null, NULL_UPDATE_REQUESTS);
 
       //And this will result in container assignment for app1

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java
new file mode 100644
index 0000000..b6ac4b6
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java
@@ -0,0 +1,260 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity;
+
+import com.google.common.collect.ImmutableMap;
+import com.google.common.collect.ImmutableSet;
+import org.apache.hadoop.conf.Configuration;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
+import org.apache.hadoop.yarn.server.resourcemanager.MockNM;
+import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.NullRMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptState;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptRemovedSchedulerEvent;
+import org.apache.hadoop.yarn.util.resource.Resources;
+import org.junit.Test;
+
+import java.util.Arrays;
+
+public class TestCapacitySchedulerSchedulingRequestUpdate
+    extends CapacitySchedulerTestBase {
+  @Test
+  public void testBasicPendingResourceUpdate() throws Exception {
+    Configuration conf = TestUtils.getConfigurationWithQueueLabels(
+        new Configuration(false));
+    conf.setBoolean(YarnConfiguration.NODE_LABELS_ENABLED, true);
+
+    final RMNodeLabelsManager mgr = new NullRMNodeLabelsManager();
+    mgr.init(conf);
+    mgr.addToCluserNodeLabelsWithDefaultExclusivity(ImmutableSet.of("x", "y"));
+    mgr.addLabelsToNode(
+        ImmutableMap.of(NodeId.newInstance("h1", 0), toSet("x")));
+
+    MockRM rm = new MockRM(conf) {
+      protected RMNodeLabelsManager createNodeLabelManager() {
+        return mgr;
+      }
+    };
+
+    rm.start();
+    MockNM nm1 = // label = x
+        new MockNM("h1:1234", 200 * GB, rm.getResourceTrackerService());
+    nm1.registerNode();
+
+    MockNM nm2 = // label = ""
+        new MockNM("h2:1234", 200 * GB, rm.getResourceTrackerService());
+    nm2.registerNode();
+
+    // Launch app1 in queue=a1
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "a1");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2);
+
+    // Launch app2 in queue=b1
+    RMApp app2 = rm.submitApp(8 * GB, "app", "user", null, "b1");
+    MockAM am2 = MockRM.launchAndRegisterAM(app2, rm, nm2);
+    // am1 asks for 8 * 1GB container for no label
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(8, Resource.newInstance(1 * GB, 1)),
+        Priority.newInstance(1), 0, ImmutableSet.of("mapper", "reducer"),
+        "mapper", "reducer");
+
+    checkPendingResource(rm, "a1", 8 * GB, null);
+    checkPendingResource(rm, "a", 8 * GB, null);
+    checkPendingResource(rm, "root", 8 * GB, null);
+
+    // am2 asks for 8 * 1GB container for no label
+    am2.allocate(Arrays.asList(ResourceRequest
+        .newInstance(Priority.newInstance(1), "*",
+            Resources.createResource(1 * GB), 8)), null);
+
+    checkPendingResource(rm, "a1", 8 * GB, null);
+    checkPendingResource(rm, "a", 8 * GB, null);
+    checkPendingResource(rm, "b1", 8 * GB, null);
+    checkPendingResource(rm, "b", 8 * GB, null);
+    // root = a + b
+    checkPendingResource(rm, "root", 16 * GB, null);
+
+    // am2 asks for 8 * 1GB container in another priority for no label
+    am2.allocate(Arrays.asList(ResourceRequest
+        .newInstance(Priority.newInstance(2), "*",
+            Resources.createResource(1 * GB), 8)), null);
+
+    checkPendingResource(rm, "a1", 8 * GB, null);
+    checkPendingResource(rm, "a", 8 * GB, null);
+    checkPendingResource(rm, "b1", 16 * GB, null);
+    checkPendingResource(rm, "b", 16 * GB, null);
+    // root = a + b
+    checkPendingResource(rm, "root", 24 * GB, null);
+
+    // am1 asks 4 GB resource instead of 8 * GB for priority=1
+    // am1 asks for 8 * 1GB container for no label
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(4, Resource.newInstance(1 * GB, 1)),
+        Priority.newInstance(1), 0, ImmutableSet.of("mapper", "reducer"),
+        "mapper", "reducer");
+
+    checkPendingResource(rm, "a1", 4 * GB, null);
+    checkPendingResource(rm, "a", 4 * GB, null);
+    checkPendingResource(rm, "b1", 16 * GB, null);
+    checkPendingResource(rm, "b", 16 * GB, null);
+    // root = a + b
+    checkPendingResource(rm, "root", 20 * GB, null);
+
+    // am1 asks 8 * GB resource which label=x
+    am1.allocate(Arrays.asList(ResourceRequest
+        .newInstance(Priority.newInstance(2), "*",
+            Resources.createResource(8 * GB), 1, true, "x")), null);
+
+    checkPendingResource(rm, "a1", 4 * GB, null);
+    checkPendingResource(rm, "a", 4 * GB, null);
+    checkPendingResource(rm, "a1", 8 * GB, "x");
+    checkPendingResource(rm, "a", 8 * GB, "x");
+    checkPendingResource(rm, "b1", 16 * GB, null);
+    checkPendingResource(rm, "b", 16 * GB, null);
+    // root = a + b
+    checkPendingResource(rm, "root", 20 * GB, null);
+    checkPendingResource(rm, "root", 8 * GB, "x");
+
+    // complete am1/am2, pending resource should be 0 now
+    AppAttemptRemovedSchedulerEvent appRemovedEvent =
+        new AppAttemptRemovedSchedulerEvent(am2.getApplicationAttemptId(),
+            RMAppAttemptState.FINISHED, false);
+    rm.getResourceScheduler().handle(appRemovedEvent);
+    appRemovedEvent = new AppAttemptRemovedSchedulerEvent(
+        am1.getApplicationAttemptId(), RMAppAttemptState.FINISHED, false);
+    rm.getResourceScheduler().handle(appRemovedEvent);
+
+    checkPendingResource(rm, "a1", 0 * GB, null);
+    checkPendingResource(rm, "a", 0 * GB, null);
+    checkPendingResource(rm, "a1", 0 * GB, "x");
+    checkPendingResource(rm, "a", 0 * GB, "x");
+    checkPendingResource(rm, "b1", 0 * GB, null);
+    checkPendingResource(rm, "b", 0 * GB, null);
+    checkPendingResource(rm, "root", 0 * GB, null);
+    checkPendingResource(rm, "root", 0 * GB, "x");
+  }
+
+  @Test
+  public void testNodePartitionPendingResourceUpdate() throws Exception {
+    Configuration conf = TestUtils.getConfigurationWithQueueLabels(
+        new Configuration(false));
+    conf.setBoolean(YarnConfiguration.NODE_LABELS_ENABLED, true);
+
+    final RMNodeLabelsManager mgr = new NullRMNodeLabelsManager();
+    mgr.init(conf);
+    mgr.addToCluserNodeLabelsWithDefaultExclusivity(ImmutableSet.of("x", "y"));
+    mgr.addLabelsToNode(
+        ImmutableMap.of(NodeId.newInstance("h1", 0), toSet("x")));
+
+    MockRM rm = new MockRM(conf) {
+      protected RMNodeLabelsManager createNodeLabelManager() {
+        return mgr;
+      }
+    };
+
+    rm.start();
+    MockNM nm1 = // label = x
+        new MockNM("h1:1234", 200 * GB, rm.getResourceTrackerService());
+    nm1.registerNode();
+
+    MockNM nm2 = // label = ""
+        new MockNM("h2:1234", 200 * GB, rm.getResourceTrackerService());
+    nm2.registerNode();
+
+    // Launch app1 in queue=a1
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "a1");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2);
+
+    // Launch app2 in queue=b1
+    RMApp app2 = rm.submitApp(8 * GB, "app", "user", null, "b1");
+    MockAM am2 = MockRM.launchAndRegisterAM(app2, rm, nm2);
+    // am1 asks for 8 * 1GB container for "x"
+    am1.allocateIntraAppAntiAffinity("x",
+        ResourceSizing.newInstance(8, Resource.newInstance(1 * GB, 1)),
+        Priority.newInstance(1), 0, "mapper", "reducer");
+
+    checkPendingResource(rm, "a1", 8 * GB, "x");
+    checkPendingResource(rm, "a", 8 * GB, "x");
+    checkPendingResource(rm, "root", 8 * GB, "x");
+
+    // am2 asks for 8 * 1GB container for "x"
+    am2.allocateIntraAppAntiAffinity("x",
+        ResourceSizing.newInstance(8, Resource.newInstance(1 * GB, 1)),
+        Priority.newInstance(1), 0, "mapper", "reducer");
+
+    checkPendingResource(rm, "a1", 8 * GB, "x");
+    checkPendingResource(rm, "a", 8 * GB, "x");
+    checkPendingResource(rm, "b1", 8 * GB, "x");
+    checkPendingResource(rm, "b", 8 * GB, "x");
+    // root = a + b
+    checkPendingResource(rm, "root", 16 * GB, "x");
+
+    // am1 asks for 6 * 1GB container for "x" in another priority
+    am1.allocateIntraAppAntiAffinity("x",
+        ResourceSizing.newInstance(6, Resource.newInstance(1 * GB, 1)),
+        Priority.newInstance(2), 0, "mapper", "reducer");
+
+    checkPendingResource(rm, "a1", 14 * GB, "x");
+    checkPendingResource(rm, "a", 14 * GB, "x");
+    checkPendingResource(rm, "b1", 8 * GB, "x");
+    checkPendingResource(rm, "b", 8 * GB, "x");
+    // root = a + b
+    checkPendingResource(rm, "root", 22 * GB, "x");
+
+    // am1 asks for 4 * 1GB container for "x" in priority=1, which should
+    // override 8 * 1GB
+    am1.allocateIntraAppAntiAffinity("x",
+        ResourceSizing.newInstance(4, Resource.newInstance(1 * GB, 1)),
+        Priority.newInstance(1), 0, "mapper", "reducer");
+
+    checkPendingResource(rm, "a1", 10 * GB, "x");
+    checkPendingResource(rm, "a", 10 * GB, "x");
+    checkPendingResource(rm, "b1", 8 * GB, "x");
+    checkPendingResource(rm, "b", 8 * GB, "x");
+    // root = a + b
+    checkPendingResource(rm, "root", 18 * GB, "x");
+
+    // complete am1/am2, pending resource should be 0 now
+    AppAttemptRemovedSchedulerEvent appRemovedEvent =
+        new AppAttemptRemovedSchedulerEvent(am2.getApplicationAttemptId(),
+            RMAppAttemptState.FINISHED, false);
+    rm.getResourceScheduler().handle(appRemovedEvent);
+    appRemovedEvent = new AppAttemptRemovedSchedulerEvent(
+        am1.getApplicationAttemptId(), RMAppAttemptState.FINISHED, false);
+    rm.getResourceScheduler().handle(appRemovedEvent);
+
+    checkPendingResource(rm, "a1", 0 * GB, null);
+    checkPendingResource(rm, "a", 0 * GB, null);
+    checkPendingResource(rm, "a1", 0 * GB, "x");
+    checkPendingResource(rm, "a", 0 * GB, "x");
+    checkPendingResource(rm, "b1", 0 * GB, null);
+    checkPendingResource(rm, "b", 0 * GB, null);
+    checkPendingResource(rm, "root", 0 * GB, null);
+    checkPendingResource(rm, "root", 0 * GB, "x");
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestIncreaseAllocationExpirer.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestIncreaseAllocationExpirer.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestIncreaseAllocationExpirer.java
index d2e28be..a800bef 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestIncreaseAllocationExpirer.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestIncreaseAllocationExpirer.java
@@ -132,7 +132,7 @@ public class TestIncreaseAllocationExpirer {
     Assert.assertEquals(RMContainerState.RUNNING,
         rm1.getResourceScheduler().getRMContainer(containerId2).getState());
     // Verify container size is 3G
-    Assert.assertEquals(
+      Assert.assertEquals(
         3 * GB, rm1.getResourceScheduler().getRMContainer(containerId2)
             .getAllocatedResource().getMemorySize());
     // Verify total resource usage

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java
new file mode 100644
index 0000000..0a44a1e
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java
@@ -0,0 +1,277 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity;
+
+import com.google.common.collect.ImmutableSet;
+import org.apache.hadoop.conf.Configuration;
+import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
+import org.apache.hadoop.yarn.server.resourcemanager.MockNM;
+import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
+import org.apache.hadoop.yarn.server.resourcemanager.ResourceManager;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.NullRMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptState;
+import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainer;
+import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerAppReport;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.YarnScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.fica.FiCaSchedulerApp;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptRemovedSchedulerEvent;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.NodeUpdateSchedulerEvent;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+
+public class TestSchedulingRequestContainerAllocation {
+  private final int GB = 1024;
+
+  private YarnConfiguration conf;
+
+  RMNodeLabelsManager mgr;
+
+  @Before
+  public void setUp() throws Exception {
+    conf = new YarnConfiguration();
+    conf.setClass(YarnConfiguration.RM_SCHEDULER, CapacityScheduler.class,
+        ResourceScheduler.class);
+    mgr = new NullRMNodeLabelsManager();
+    mgr.init(conf);
+  }
+
+  @Test
+  public void testIntraAppAntiAffinity() throws Exception {
+    Configuration csConf = TestUtils.getConfigurationWithMultipleQueues(
+        new Configuration());
+    csConf.setBoolean(CapacitySchedulerConfiguration.SCHEDULING_REQUEST_ALLOWED,
+        true);
+
+    // inject node label manager
+    MockRM rm1 = new MockRM(csConf) {
+      @Override
+      public RMNodeLabelsManager createNodeLabelManager() {
+        return mgr;
+      }
+    };
+
+    rm1.getRMContext().setNodeLabelManager(mgr);
+    rm1.start();
+
+    // 4 NMs.
+    MockNM[] nms = new MockNM[4];
+    RMNode[] rmNodes = new RMNode[4];
+    for (int i = 0; i < 4; i++) {
+      nms[i] = rm1.registerNode("192.168.0." + i + ":1234", 10 * GB);
+      rmNodes[i] = rm1.getRMContext().getRMNodes().get(nms[i].getNodeId());
+    }
+
+    // app1 -> c
+    RMApp app1 = rm1.submitApp(1 * GB, "app", "user", null, "c");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm1, nms[0]);
+
+    // app1 asks for 10 anti-affinity containers for the same app. It should
+    // only get 4 containers allocated because we only have 4 nodes.
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(10, Resource.newInstance(1024, 1)),
+        Priority.newInstance(1), 1L, ImmutableSet.of("mapper"), "mapper");
+
+    CapacityScheduler cs = (CapacityScheduler) rm1.getResourceScheduler();
+
+    for (int i = 0; i < 3; i++) {
+      for (int j = 0; j < 4; j++) {
+        cs.handle(new NodeUpdateSchedulerEvent(rmNodes[j]));
+      }
+    }
+
+    // App1 should get 5 containers allocated (1 AM + 1 node each).
+    FiCaSchedulerApp schedulerApp = cs.getApplicationAttempt(
+        am1.getApplicationAttemptId());
+    Assert.assertEquals(5, schedulerApp.getLiveContainers().size());
+
+    // Similarly, app1 asks 10 anti-affinity containers at different priority,
+    // it should be satisfied as well.
+    // app1 asks for 10 anti-affinity containers for the same app. It should
+    // only get 4 containers allocated because we only have 4 nodes.
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(10, Resource.newInstance(2048, 1)),
+        Priority.newInstance(2), 1L, ImmutableSet.of("reducer"), "reducer");
+
+    for (int i = 0; i < 3; i++) {
+      for (int j = 0; j < 4; j++) {
+        cs.handle(new NodeUpdateSchedulerEvent(rmNodes[j]));
+      }
+    }
+
+    // App1 should get 9 containers allocated (1 AM + 8 containers).
+    Assert.assertEquals(9, schedulerApp.getLiveContainers().size());
+
+    // Test anti-affinity to both of "mapper/reducer", we should only get no
+    // container allocated
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(10, Resource.newInstance(2048, 1)),
+        Priority.newInstance(3), 1L, ImmutableSet.of("reducer2"), "mapper");
+    for (int i = 0; i < 3; i++) {
+      for (int j = 0; j < 4; j++) {
+        cs.handle(new NodeUpdateSchedulerEvent(rmNodes[j]));
+      }
+    }
+
+    // App1 should get 10 containers allocated (1 AM + 9 containers).
+    Assert.assertEquals(9, schedulerApp.getLiveContainers().size());
+
+    rm1.close();
+  }
+
+  @Test
+  public void testIntraAppAntiAffinityWithMultipleTags() throws Exception {
+    Configuration csConf = TestUtils.getConfigurationWithMultipleQueues(
+        new Configuration());
+    csConf.setBoolean(CapacitySchedulerConfiguration.SCHEDULING_REQUEST_ALLOWED,
+        true);
+
+    // inject node label manager
+    MockRM rm1 = new MockRM(csConf) {
+      @Override
+      public RMNodeLabelsManager createNodeLabelManager() {
+        return mgr;
+      }
+    };
+
+    rm1.getRMContext().setNodeLabelManager(mgr);
+    rm1.start();
+
+    // 4 NMs.
+    MockNM[] nms = new MockNM[4];
+    RMNode[] rmNodes = new RMNode[4];
+    for (int i = 0; i < 4; i++) {
+      nms[i] = rm1.registerNode("192.168.0." + i + ":1234", 10 * GB);
+      rmNodes[i] = rm1.getRMContext().getRMNodes().get(nms[i].getNodeId());
+    }
+
+    // app1 -> c
+    RMApp app1 = rm1.submitApp(1 * GB, "app", "user", null, "c");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm1, nms[0]);
+
+    // app1 asks for 2 anti-affinity containers for the same app.
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(2, Resource.newInstance(1024, 1)),
+        Priority.newInstance(1), 1L, ImmutableSet.of("tag_1_1", "tag_1_2"),
+        "tag_1_1", "tag_1_2");
+
+    CapacityScheduler cs = (CapacityScheduler) rm1.getResourceScheduler();
+
+    for (int i = 0; i < 3; i++) {
+      for (int j = 0; j < 4; j++) {
+        cs.handle(new NodeUpdateSchedulerEvent(rmNodes[j]));
+      }
+    }
+
+    // App1 should get 3 containers allocated (1 AM + 2 task).
+    FiCaSchedulerApp schedulerApp = cs.getApplicationAttempt(
+        am1.getApplicationAttemptId());
+    Assert.assertEquals(3, schedulerApp.getLiveContainers().size());
+
+    // app1 asks for 1 anti-affinity containers for the same app. anti-affinity
+    // to tag_1_1/tag_1_2. With allocation_tag = tag_2_1/tag_2_2
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)),
+        Priority.newInstance(2), 1L, ImmutableSet.of("tag_2_1", "tag_2_2"),
+        "tag_1_1", "tag_1_2");
+
+    for (int i = 0; i < 3; i++) {
+      for (int j = 0; j < 4; j++) {
+        cs.handle(new NodeUpdateSchedulerEvent(rmNodes[j]));
+      }
+    }
+
+    // App1 should get 4 containers allocated (1 AM + 2 task (first request) +
+    // 1 task (2nd request).
+    Assert.assertEquals(4, schedulerApp.getLiveContainers().size());
+
+    // app1 asks for 10 anti-affinity containers for the same app. anti-affinity
+    // to tag_1_1/tag_1_2/tag_2_1/tag_2_2. With allocation_tag = tag_3
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)),
+        Priority.newInstance(3), 1L, ImmutableSet.of("tag_3"),
+        "tag_1_1", "tag_1_2", "tag_2_1", "tag_2_2");
+
+    for (int i = 0; i < 3; i++) {
+      for (int j = 0; j < 4; j++) {
+        cs.handle(new NodeUpdateSchedulerEvent(rmNodes[j]));
+      }
+    }
+
+    // App1 should get 1 more containers allocated
+    // 1 AM + 2 task (first request) + 1 task (2nd request) +
+    // 1 task (3rd request)
+    Assert.assertEquals(5, schedulerApp.getLiveContainers().size());
+
+    rm1.close();
+  }
+
+  @Test
+  public void testSchedulingRequestDisabledByDefault() throws Exception {
+    Configuration csConf = TestUtils.getConfigurationWithMultipleQueues(
+        new Configuration());
+
+    // inject node label manager
+    MockRM rm1 = new MockRM(csConf) {
+      @Override
+      public RMNodeLabelsManager createNodeLabelManager() {
+        return mgr;
+      }
+    };
+
+    rm1.getRMContext().setNodeLabelManager(mgr);
+    rm1.start();
+
+    // 4 NMs.
+    MockNM[] nms = new MockNM[4];
+    RMNode[] rmNodes = new RMNode[4];
+    for (int i = 0; i < 4; i++) {
+      nms[i] = rm1.registerNode("192.168.0." + i + ":1234", 10 * GB);
+      rmNodes[i] = rm1.getRMContext().getRMNodes().get(nms[i].getNodeId());
+    }
+
+    // app1 -> c
+    RMApp app1 = rm1.submitApp(1 * GB, "app", "user", null, "c");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm1, nms[0]);
+
+    // app1 asks for 2 anti-affinity containers for the same app.
+    boolean caughtException = false;
+    try {
+      // Since feature is disabled by default, we should expect exception.
+      am1.allocateIntraAppAntiAffinity(
+          ResourceSizing.newInstance(2, Resource.newInstance(1024, 1)),
+          Priority.newInstance(1), 1L, ImmutableSet.of("tag_1_1", "tag_1_2"),
+          "tag_1_1", "tag_1_2");
+    } catch (Exception e) {
+      caughtException = true;
+    }
+    Assert.assertTrue(caughtException);
+    rm1.close();
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java
new file mode 100644
index 0000000..c7f13cd
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java
@@ -0,0 +1,139 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity;
+
+import com.google.common.collect.ImmutableSet;
+import org.apache.hadoop.conf.Configuration;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
+import org.apache.hadoop.yarn.server.resourcemanager.MockNM;
+import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.NullRMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
+import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.fica.FiCaSchedulerApp;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.NodeUpdateSchedulerEvent;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+
+public class TestSchedulingRequestContainerAllocationAsync {
+  private final int GB = 1024;
+
+  private YarnConfiguration conf;
+
+  RMNodeLabelsManager mgr;
+
+  @Before
+  public void setUp() throws Exception {
+    conf = new YarnConfiguration();
+    conf.setClass(YarnConfiguration.RM_SCHEDULER, CapacityScheduler.class,
+        ResourceScheduler.class);
+    mgr = new NullRMNodeLabelsManager();
+    mgr.init(conf);
+  }
+
+  private void testIntraAppAntiAffinityAsync(int numThreads) throws Exception {
+    Configuration csConf = TestUtils.getConfigurationWithMultipleQueues(
+        new Configuration());
+    csConf.setBoolean(CapacitySchedulerConfiguration.SCHEDULING_REQUEST_ALLOWED,
+        true);
+    csConf.setInt(
+        CapacitySchedulerConfiguration.SCHEDULE_ASYNCHRONOUSLY_MAXIMUM_THREAD,
+        numThreads);
+    csConf.setInt(CapacitySchedulerConfiguration.SCHEDULE_ASYNCHRONOUSLY_PREFIX
+        + ".scheduling-interval-ms", 0);
+
+    // inject node label manager
+    MockRM rm1 = new MockRM(csConf) {
+      @Override
+      public RMNodeLabelsManager createNodeLabelManager() {
+        return mgr;
+      }
+    };
+
+    rm1.getRMContext().setNodeLabelManager(mgr);
+    rm1.start();
+
+    // 200 NMs.
+    int nNMs = 200;
+    MockNM[] nms = new MockNM[nNMs];
+    RMNode[] rmNodes = new RMNode[nNMs];
+    for (int i = 0; i < nNMs; i++) {
+      nms[i] = rm1.registerNode("127.0.0." + i + ":1234", 10 * GB);
+      rmNodes[i] = rm1.getRMContext().getRMNodes().get(nms[i].getNodeId());
+    }
+
+    // app1 -> c
+    RMApp app1 = rm1.submitApp(1 * GB, "app", "user", null, "c");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm1, nms[0]);
+
+    // app1 asks for 10 anti-affinity containers for the same app. It should
+    // only get 4 containers allocated because we only have 4 nodes.
+    am1.allocateIntraAppAntiAffinity(
+        ResourceSizing.newInstance(1000, Resource.newInstance(1024, 1)),
+        Priority.newInstance(1), 1L, ImmutableSet.of("mapper"), "mapper");
+
+    CapacityScheduler cs = (CapacityScheduler) rm1.getResourceScheduler();
+
+    for (int i = 0; i < 3; i++) {
+      for (int j = 0; j < nNMs; j++) {
+        cs.handle(new NodeUpdateSchedulerEvent(rmNodes[j]));
+      }
+    }
+
+    // App1 should get #NM + 1 containers allocated (1 node each + 1 AM).
+    FiCaSchedulerApp schedulerApp = cs.getApplicationAttempt(
+        am1.getApplicationAttemptId());
+    Assert.assertEquals(nNMs + 1, schedulerApp.getLiveContainers().size());
+
+    rm1.close();
+  }
+
+  @Test(timeout = 300000)
+  public void testSingleThreadAsyncContainerAllocation() throws Exception {
+    testIntraAppAntiAffinityAsync(1);
+  }
+
+  @Test(timeout = 300000)
+  public void testTwoThreadsAsyncContainerAllocation() throws Exception {
+    testIntraAppAntiAffinityAsync(2);
+  }
+
+  @Test(timeout = 300000)
+  public void testThreeThreadsAsyncContainerAllocation() throws Exception {
+    testIntraAppAntiAffinityAsync(3);
+  }
+
+  @Test(timeout = 300000)
+  public void testFourThreadsAsyncContainerAllocation() throws Exception {
+    testIntraAppAntiAffinityAsync(4);
+  }
+
+  @Test(timeout = 300000)
+  public void testFiveThreadsAsyncContainerAllocation() throws Exception {
+    testIntraAppAntiAffinityAsync(5);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
index e8734cc..542ba3e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
@@ -275,6 +275,8 @@ public class TestUtils {
   public static Configuration getConfigurationWithQueueLabels(Configuration config) {
     CapacitySchedulerConfiguration conf =
         new CapacitySchedulerConfiguration(config);
+    conf.setBoolean(CapacitySchedulerConfiguration.SCHEDULING_REQUEST_ALLOWED,
+        true);
     
     // Define top-level queues
     conf.setQueues(CapacitySchedulerConfiguration.ROOT, new String[] {"a", "b", "c"});

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
index f1d5663..7afe4ef 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
@@ -20,10 +20,10 @@
 
 package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
 
-import java.util.List;
-
+import com.google.common.collect.ImmutableSet;
 import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.server.resourcemanager.MockNodes;
 import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
@@ -33,7 +33,7 @@ import org.junit.Assert;
 import org.junit.Before;
 import org.junit.Test;
 
-import com.google.common.collect.ImmutableSet;
+import java.util.List;
 
 /**
  * Test functionality of AllocationTagsManager.
@@ -54,7 +54,6 @@ public class TestAllocationTagsManager {
     rmContext = rm.getRMContext();
   }
 
-
   @Test
   public void testAllocationTagsManagerSimpleCases()
       throws InvalidAllocationTagsQueryException {
@@ -141,30 +140,31 @@ public class TestAllocationTagsManager {
 
     // Get Node Cardinality of app1 on node2, with tag "<applicationId>", op=max
     // (Expect this returns #containers from app1 on node2)
-    Assert
-        .assertEquals(2,
-            atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
-                TestUtils.getMockApplicationId(1),
-                ImmutableSet.of(AllocationTagsNamespaces.APP_ID
-                    + TestUtils.getMockApplicationId(1).toString()),
-                Long::max));
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+            TestUtils.getMockApplicationId(1), null, Long::max));
 
     // Get Node Cardinality of app1 on node2, with empty tag set, op=max
     Assert.assertEquals(2,
         atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+            TestUtils.getMockApplicationId(1), null, Long::max));
+
+    // Get Cardinality of app1 on node2, with empty tag set, op=max
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
 
     // Get Node Cardinality of all apps on node2, with empty tag set, op=sum
-    Assert.assertEquals(7, atm.getNodeCardinalityByOp(
+    Assert.assertEquals(4, atm.getNodeCardinalityByOp(
         NodeId.fromString("host2:123"), null, ImmutableSet.of(), Long::sum));
 
     // Get Node Cardinality of app_1 on node2, with empty tag set, op=sum
-    Assert.assertEquals(5,
+    Assert.assertEquals(3,
         atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
 
     // Get Node Cardinality of app_1 on node2, with empty tag set, op=sum
-    Assert.assertEquals(2,
+    Assert.assertEquals(1,
         atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
 
@@ -296,7 +296,7 @@ public class TestAllocationTagsManager {
     Assert.assertEquals(3, atm.getRackCardinality("rack0", null, "reducer"));
 
     // Get Rack Cardinality of app_1 on rack0, with empty tag set, op=max
-    Assert.assertEquals(2, atm.getRackCardinalityByOp("rack0",
+    Assert.assertEquals(1, atm.getRackCardinalityByOp("rack0",
         TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
 
     // Get Rack Cardinality of app_1 on rack0, with empty tag set, op=min

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
index 7492233..8ad726e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
@@ -117,9 +117,9 @@ public class TestPlacementConstraintsUtil {
       RMNode currentNode = nodeIterator.next();
       FiCaSchedulerNode schedulerNode = TestUtils.getMockNode(
           currentNode.getHostName(), currentNode.getRackName(), 123, 4 * GB);
-      Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+      Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
           sourceTag1, schedulerNode, pcm, tm));
-      Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+      Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
           sourceTag2, schedulerNode, pcm, tm));
     }
     /**
@@ -145,14 +145,14 @@ public class TestPlacementConstraintsUtil {
     tm.addContainer(n0_r1.getNodeID(), hbase_m, ImmutableSet.of("hbase-m"));
 
     // 'spark' placement on Node0 should now SUCCEED
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag1, schedulerNode0, pcm, tm));
     // FAIL on the rest of the nodes
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag1, schedulerNode1, pcm, tm));
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag1, schedulerNode2, pcm, tm));
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag1, schedulerNode3, pcm, tm));
   }
 
@@ -187,15 +187,15 @@ public class TestPlacementConstraintsUtil {
     FiCaSchedulerNode schedulerNode3 = TestUtils
         .getMockNode(n3_r2.getHostName(), n3_r2.getRackName(), 123, 4 * GB);
     // 'zk' placement on Rack1 should now SUCCEED
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag2, schedulerNode0, pcm, tm));
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag2, schedulerNode1, pcm, tm));
 
     // FAIL on the rest of the RACKs
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag2, schedulerNode2, pcm, tm));
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag2, schedulerNode3, pcm, tm));
   }
 
@@ -230,14 +230,14 @@ public class TestPlacementConstraintsUtil {
     tm.addContainer(n0_r1.getNodeID(), hbase_m, ImmutableSet.of("hbase-m"));
 
     // 'spark' placement on Node0 should now FAIL
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag1, schedulerNode0, pcm, tm));
     // SUCCEED on the rest of the nodes
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag1, schedulerNode1, pcm, tm));
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag1, schedulerNode2, pcm, tm));
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag1, schedulerNode3, pcm, tm));
   }
 
@@ -273,15 +273,15 @@ public class TestPlacementConstraintsUtil {
         .getMockNode(n3_r2.getHostName(), n3_r2.getRackName(), 123, 4 * GB);
 
     // 'zk' placement on Rack1 should FAIL
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag2, schedulerNode0, pcm, tm));
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag2, schedulerNode1, pcm, tm));
 
     // SUCCEED on the rest of the RACKs
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag2, schedulerNode2, pcm, tm));
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
         sourceTag2, schedulerNode3, pcm, tm));
   }
 }
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairSchedulerTestBase.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairSchedulerTestBase.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairSchedulerTestBase.java
index 5f29186..b998564 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairSchedulerTestBase.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairSchedulerTestBase.java
@@ -192,7 +192,7 @@ public class FairSchedulerTestBase {
     resourceManager.getRMContext().getRMApps()
         .put(id.getApplicationId(), rmApp);
 
-    scheduler.allocate(id, ask, new ArrayList<ContainerId>(),
+    scheduler.allocate(id, ask, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
     scheduler.update();
     return id;
@@ -222,7 +222,7 @@ public class FairSchedulerTestBase {
     resourceManager.getRMContext().getRMApps()
         .put(id.getApplicationId(), rmApp);
 
-    scheduler.allocate(id, ask, new ArrayList<ContainerId>(),
+    scheduler.allocate(id, ask, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
     return id;
   }
@@ -245,7 +245,7 @@ public class FairSchedulerTestBase {
       ResourceRequest request, ApplicationAttemptId attId) {
     List<ResourceRequest> ask = new ArrayList<ResourceRequest>();
     ask.add(request);
-    scheduler.allocate(attId, ask,  new ArrayList<ContainerId>(),
+    scheduler.allocate(attId, ask, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
     scheduler.update();
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestContinuousScheduling.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestContinuousScheduling.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestContinuousScheduling.java
index 95dbaea..2512787 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestContinuousScheduling.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestContinuousScheduling.java
@@ -125,7 +125,7 @@ public class TestContinuousScheduling extends FairSchedulerTestBase {
     List<ResourceRequest> ask = new ArrayList<>();
     ask.add(createResourceRequest(1024, 1, ResourceRequest.ANY, 1, 1, true));
     scheduler.allocate(
-        appAttemptId, ask, new ArrayList<ContainerId>(),
+        appAttemptId, ask, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
     FSAppAttempt app = scheduler.getSchedulerApp(appAttemptId);
 
@@ -163,8 +163,7 @@ public class TestContinuousScheduling extends FairSchedulerTestBase {
     ResourceRequest request =
         createResourceRequest(1024, 1, ResourceRequest.ANY, 1, 1, true);
     ask.add(request);
-    scheduler.allocate(appAttemptId, ask,
-        new ArrayList<ContainerId>(), null, null, NULL_UPDATE_REQUESTS);
+    scheduler.allocate(appAttemptId, ask, null, new ArrayList<ContainerId>(), null, null, NULL_UPDATE_REQUESTS);
     triggerSchedulingAttempt();
 
     FSAppAttempt app = scheduler.getSchedulerApp(appAttemptId);
@@ -175,8 +174,7 @@ public class TestContinuousScheduling extends FairSchedulerTestBase {
         createResourceRequest(1024, 1, ResourceRequest.ANY, 2, 1, true);
     ask.clear();
     ask.add(request);
-    scheduler.allocate(appAttemptId, ask,
-        new ArrayList<ContainerId>(), null, null, NULL_UPDATE_REQUESTS);
+    scheduler.allocate(appAttemptId, ask, null, new ArrayList<ContainerId>(), null, null, NULL_UPDATE_REQUESTS);
     triggerSchedulingAttempt();
 
     checkAppConsumption(app, Resources.createResource(2048,2));
@@ -373,7 +371,7 @@ public class TestContinuousScheduling extends FairSchedulerTestBase {
         true);
     ask1.add(request1);
     ask1.add(request2);
-    scheduler.allocate(id11, ask1, new ArrayList<ContainerId>(), null, null,
+    scheduler.allocate(id11, ask1, null, new ArrayList<ContainerId>(), null, null,
         NULL_UPDATE_REQUESTS);
 
     NodeAddedSchedulerEvent nodeEvent1 = new NodeAddedSchedulerEvent(node1);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestFairScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestFairScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestFairScheduler.java
index 77b6d04..d9c06a7 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestFairScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/TestFairScheduler.java
@@ -1280,7 +1280,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
     List<ResourceRequest> asks = new ArrayList<ResourceRequest>();
     asks.add(createResourceRequest(2048, node2.getRackName(), 1, 1, false));
 
-    scheduler.allocate(attemptId, asks, new ArrayList<ContainerId>(), null,
+    scheduler.allocate(attemptId, asks, null, new ArrayList<ContainerId>(), null,
             null, NULL_UPDATE_REQUESTS);
 
     ApplicationAttemptId attId = createSchedulingRequest(2048, "queue1", "user1", 1);
@@ -2125,7 +2125,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
     ResourceRequest request1 = createResourceRequest(minReqSize * 2,
         ResourceRequest.ANY, 1, 1, true);
     ask1.add(request1);
-    scheduler.allocate(id11, ask1, new ArrayList<ContainerId>(),
+    scheduler.allocate(id11, ask1, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
 
     // Second ask, queue2 requests 1 large.
@@ -2141,7 +2141,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
         ResourceRequest.ANY, 1, 1, false);
     ask2.add(request2);
     ask2.add(request3);
-    scheduler.allocate(id21, ask2, new ArrayList<ContainerId>(),
+    scheduler.allocate(id21, ask2, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
 
     // Third ask, queue2 requests 2 small (minReqSize).
@@ -2157,7 +2157,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
         ResourceRequest.ANY, 2, 2, true);
     ask3.add(request4);
     ask3.add(request5);
-    scheduler.allocate(id22, ask3, new ArrayList<ContainerId>(),
+    scheduler.allocate(id22, ask3, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
 
     scheduler.update();
@@ -2683,7 +2683,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
     // Complete the first container so we can trigger allocation for app2
     ContainerId containerId =
         app1.getLiveContainers().iterator().next().getContainerId();
-    scheduler.allocate(app1.getApplicationAttemptId(), new ArrayList<>(),
+    scheduler.allocate(app1.getApplicationAttemptId(), new ArrayList<>(), null,
         Arrays.asList(containerId), null, null, NULL_UPDATE_REQUESTS);
 
     // Trigger allocation for app2
@@ -2769,7 +2769,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
     asks.add(createResourceRequest(1024, node3.getRackName(), 1, 1, true));
     asks.add(createResourceRequest(1024, ResourceRequest.ANY, 1, 2, true));
 
-    scheduler.allocate(attemptId, asks, new ArrayList<ContainerId>(), null,
+    scheduler.allocate(attemptId, asks, null, new ArrayList<ContainerId>(), null,
         null, NULL_UPDATE_REQUESTS);
     
     // node 1 checks in
@@ -3216,7 +3216,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
         createResourceRequest(1024, node1.getHostName(), 1, 0, true),
         createResourceRequest(1024, "rack1", 1, 0, true),
         createResourceRequest(1024, ResourceRequest.ANY, 1, 1, true));
-    scheduler.allocate(attId1, update, new ArrayList<ContainerId>(),
+    scheduler.allocate(attId1, update, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
     
     // then node2 should get the container
@@ -4432,7 +4432,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
         createResourceRequest(1024, 8, ResourceRequest.ANY, 1, 1, true);
 
     ask1.add(request1);
-    scheduler.allocate(id11, ask1, new ArrayList<ContainerId>(), null,
+    scheduler.allocate(id11, ask1, null, new ArrayList<ContainerId>(), null,
         null, NULL_UPDATE_REQUESTS);
 
     String hostName = "127.0.0.1";
@@ -4508,11 +4508,11 @@ public class TestFairScheduler extends FairSchedulerTestBase {
 
     // Verify the blacklist can be updated independent of requesting containers
     scheduler.allocate(appAttemptId, Collections.<ResourceRequest>emptyList(),
-        Collections.<ContainerId>emptyList(),
+        null, Collections.<ContainerId>emptyList(),
         Collections.singletonList(host), null, NULL_UPDATE_REQUESTS);
     assertTrue(app.isPlaceBlacklisted(host));
     scheduler.allocate(appAttemptId, Collections.<ResourceRequest>emptyList(),
-        Collections.<ContainerId>emptyList(), null,
+        null, Collections.<ContainerId>emptyList(), null,
         Collections.singletonList(host), NULL_UPDATE_REQUESTS);
     assertFalse(scheduler.getSchedulerApp(appAttemptId)
         .isPlaceBlacklisted(host));
@@ -4521,8 +4521,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
         createResourceRequest(GB, node.getHostName(), 1, 0, true));
 
     // Verify a container does not actually get placed on the blacklisted host
-    scheduler.allocate(appAttemptId, update,
-        Collections.<ContainerId>emptyList(),
+    scheduler.allocate(appAttemptId, update, null, Collections.<ContainerId>emptyList(),
         Collections.singletonList(host), null, NULL_UPDATE_REQUESTS);
     assertTrue(app.isPlaceBlacklisted(host));
     scheduler.update();
@@ -4531,8 +4530,7 @@ public class TestFairScheduler extends FairSchedulerTestBase {
         .getLiveContainers().size());
 
     // Verify a container gets placed on the empty blacklist
-    scheduler.allocate(appAttemptId, update,
-        Collections.<ContainerId>emptyList(), null,
+    scheduler.allocate(appAttemptId, update, null, Collections.<ContainerId>emptyList(), null,
         Collections.singletonList(host), NULL_UPDATE_REQUESTS);
     assertFalse(app.isPlaceBlacklisted(host));
     createSchedulingRequest(GB, "root.default", "user", 1);
@@ -5391,8 +5389,8 @@ public class TestFairScheduler extends FairSchedulerTestBase {
     ask1.add(request3);
 
     // Perform allocation
-    scheduler.allocate(appAttemptId, ask1, new ArrayList<ContainerId>(), null,
-        null, NULL_UPDATE_REQUESTS);
+    scheduler.allocate(appAttemptId, ask1, null, new ArrayList<ContainerId>(),
+        null, null, NULL_UPDATE_REQUESTS);
     scheduler.update();
     scheduler.handle(new NodeUpdateSchedulerEvent(node));
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
index db749ac..8814c0e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
@@ -281,7 +281,7 @@ public class TestFifoScheduler {
     ask.add(nodeLocal);
     ask.add(rackLocal);
     ask.add(any);
-    scheduler.allocate(appAttemptId, ask, new ArrayList<ContainerId>(),
+    scheduler.allocate(appAttemptId, ask, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
 
     NodeUpdateSchedulerEvent node0Update = new NodeUpdateSchedulerEvent(node0);
@@ -378,7 +378,7 @@ public class TestFifoScheduler {
     ask.add(nodeLocal);
     ask.add(rackLocal);
     ask.add(any);
-    scheduler.allocate(appAttemptId, ask, new ArrayList<ContainerId>(),
+    scheduler.allocate(appAttemptId, ask, null, new ArrayList<ContainerId>(),
         null, null, NULL_UPDATE_REQUESTS);
 
     // Before the node update event, there are one local request
@@ -954,7 +954,7 @@ public class TestFifoScheduler {
     ask1.add(BuilderUtils.newResourceRequest(BuilderUtils.newPriority(0),
         ResourceRequest.ANY, BuilderUtils.newResource(GB, 1), 1,
         RMNodeLabelsManager.NO_LABEL));
-    fs.allocate(appAttemptId1, ask1, emptyId,
+    fs.allocate(appAttemptId1, ask1, null, emptyId,
         Collections.singletonList(host_1_0), null, NULL_UPDATE_REQUESTS);
 
     // Trigger container assignment
@@ -963,7 +963,7 @@ public class TestFifoScheduler {
     // Get the allocation for the application and verify no allocation on
     // blacklist node
     Allocation allocation1 =
-        fs.allocate(appAttemptId1, emptyAsk, emptyId,
+        fs.allocate(appAttemptId1, emptyAsk, null, emptyId,
             null, null, NULL_UPDATE_REQUESTS);
 
     Assert.assertEquals("allocation1", 0, allocation1.getContainers().size());
@@ -971,7 +971,7 @@ public class TestFifoScheduler {
     // verify host_1_1 can get allocated as not in blacklist
     fs.handle(new NodeUpdateSchedulerEvent(n4));
     Allocation allocation2 =
-        fs.allocate(appAttemptId1, emptyAsk, emptyId,
+        fs.allocate(appAttemptId1, emptyAsk, null, emptyId,
             null, null, NULL_UPDATE_REQUESTS);
     Assert.assertEquals("allocation2", 1, allocation2.getContainers().size());
     List<Container> containerList = allocation2.getContainers();
@@ -986,33 +986,33 @@ public class TestFifoScheduler {
     // be assigned
     ask2.add(BuilderUtils.newResourceRequest(BuilderUtils.newPriority(0),
         ResourceRequest.ANY, BuilderUtils.newResource(GB, 1), 1));
-    fs.allocate(appAttemptId1, ask2, emptyId,
+    fs.allocate(appAttemptId1, ask2, null, emptyId,
         Collections.singletonList("rack0"), null, NULL_UPDATE_REQUESTS);
 
     // verify n1 is not qualified to be allocated
     fs.handle(new NodeUpdateSchedulerEvent(n1));
     Allocation allocation3 =
-        fs.allocate(appAttemptId1, emptyAsk, emptyId,
+        fs.allocate(appAttemptId1, emptyAsk, null, emptyId,
             null, null, NULL_UPDATE_REQUESTS);
     Assert.assertEquals("allocation3", 0, allocation3.getContainers().size());
 
     // verify n2 is not qualified to be allocated
     fs.handle(new NodeUpdateSchedulerEvent(n2));
     Allocation allocation4 =
-        fs.allocate(appAttemptId1, emptyAsk, emptyId,
+        fs.allocate(appAttemptId1, emptyAsk, null, emptyId,
             null, null, NULL_UPDATE_REQUESTS);
     Assert.assertEquals("allocation4", 0, allocation4.getContainers().size());
 
     // verify n3 is not qualified to be allocated
     fs.handle(new NodeUpdateSchedulerEvent(n3));
     Allocation allocation5 =
-        fs.allocate(appAttemptId1, emptyAsk, emptyId,
+        fs.allocate(appAttemptId1, emptyAsk, null, emptyId,
             null, null, NULL_UPDATE_REQUESTS);
     Assert.assertEquals("allocation5", 0, allocation5.getContainers().size());
 
     fs.handle(new NodeUpdateSchedulerEvent(n4));
     Allocation allocation6 =
-        fs.allocate(appAttemptId1, emptyAsk, emptyId,
+        fs.allocate(appAttemptId1, emptyAsk, null, emptyId,
             null, null, NULL_UPDATE_REQUESTS);
     Assert.assertEquals("allocation6", 1, allocation6.getContainers().size());
 
@@ -1072,14 +1072,14 @@ public class TestFifoScheduler {
     List<ResourceRequest> ask1 = new ArrayList<ResourceRequest>();
     ask1.add(BuilderUtils.newResourceRequest(BuilderUtils.newPriority(0),
         ResourceRequest.ANY, BuilderUtils.newResource(GB, 1), 1));
-    fs.allocate(appAttemptId1, ask1, emptyId,
+    fs.allocate(appAttemptId1, ask1, null, emptyId,
         null, null, NULL_UPDATE_REQUESTS);
 
     // Ask for a 2 GB container for app 2
     List<ResourceRequest> ask2 = new ArrayList<ResourceRequest>();
     ask2.add(BuilderUtils.newResourceRequest(BuilderUtils.newPriority(0),
         ResourceRequest.ANY, BuilderUtils.newResource(2 * GB, 1), 1));
-    fs.allocate(appAttemptId2, ask2, emptyId,
+    fs.allocate(appAttemptId2, ask2, null, emptyId,
         null, null, NULL_UPDATE_REQUESTS);
 
     // Trigger container assignment
@@ -1087,13 +1087,13 @@ public class TestFifoScheduler {
 
     // Get the allocation for the applications and verify headroom
     Allocation allocation1 =
-        fs.allocate(appAttemptId1, emptyAsk, emptyId,
+        fs.allocate(appAttemptId1, emptyAsk, null, emptyId,
             null, null, NULL_UPDATE_REQUESTS);
     Assert.assertEquals("Allocation headroom", 1 * GB, allocation1
         .getResourceLimit().getMemorySize());
 
     Allocation allocation2 =
-        fs.allocate(appAttemptId2, emptyAsk, emptyId,
+        fs.allocate(appAttemptId2, emptyAsk, null, emptyId,
             null, null, NULL_UPDATE_REQUESTS);
     Assert.assertEquals("Allocation headroom", 1 * GB, allocation2
         .getResourceLimit().getMemorySize());

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java
new file mode 100644
index 0000000..479d2c1
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/TestSingleConstraintAppPlacementAllocator.java
@@ -0,0 +1,403 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement;
+
+import com.google.common.collect.ImmutableSet;
+import org.apache.hadoop.yarn.api.records.ExecutionType;
+import org.apache.hadoop.yarn.api.records.ExecutionTypeRequest;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.exceptions.SchedulerInvalidResoureRequestException;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AppSchedulingInfo;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.NodeType;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.SchedulingMode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.TestUtils;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
+import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+import org.mockito.Mockito;
+
+import java.util.function.LongBinaryOperator;
+
+import static org.mockito.Matchers.any;
+import static org.mockito.Matchers.eq;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.spy;
+import static org.mockito.Mockito.verify;
+import static org.mockito.Mockito.when;
+
+/**
+ * Test behaviors of single constraint app placement allocator.
+ */
+public class TestSingleConstraintAppPlacementAllocator {
+  private AppSchedulingInfo appSchedulingInfo;
+  private AllocationTagsManager spyAllocationTagsManager;
+  private RMContext rmContext;
+  private SchedulerRequestKey schedulerRequestKey;
+  private SingleConstraintAppPlacementAllocator allocator;
+
+  @Before
+  public void setup() throws Exception {
+    // stub app scheduling info.
+    appSchedulingInfo = mock(AppSchedulingInfo.class);
+    when(appSchedulingInfo.getApplicationId()).thenReturn(
+        TestUtils.getMockApplicationId(1));
+    when(appSchedulingInfo.getApplicationAttemptId()).thenReturn(
+        TestUtils.getMockApplicationAttemptId(1, 1));
+
+    // stub RMContext
+    rmContext = TestUtils.getMockRMContext();
+
+    // Create allocation tags manager
+    AllocationTagsManager allocationTagsManager = new AllocationTagsManager(
+        rmContext);
+    spyAllocationTagsManager = spy(allocationTagsManager);
+    schedulerRequestKey = new SchedulerRequestKey(Priority.newInstance(1), 2L,
+        TestUtils.getMockContainerId(1, 1));
+    rmContext.setAllocationTagsManager(spyAllocationTagsManager);
+
+    // Create allocator
+    allocator = new SingleConstraintAppPlacementAllocator();
+    allocator.initialize(appSchedulingInfo, schedulerRequestKey, rmContext);
+  }
+
+  private void assertValidSchedulingRequest(
+      SchedulingRequest schedulingRequest) {
+    // Create allocator to avoid fields polluted by previous runs
+    allocator = new SingleConstraintAppPlacementAllocator();
+    allocator.initialize(appSchedulingInfo, schedulerRequestKey, rmContext);
+    allocator.updatePendingAsk(schedulerRequestKey, schedulingRequest, false);
+  }
+
+  private void assertInvalidSchedulingRequest(
+      SchedulingRequest schedulingRequest, boolean recreateAllocator) {
+    try {
+      // Create allocator
+      if (recreateAllocator) {
+        allocator = new SingleConstraintAppPlacementAllocator();
+        allocator.initialize(appSchedulingInfo, schedulerRequestKey, rmContext);
+      }
+      allocator.updatePendingAsk(schedulerRequestKey, schedulingRequest, false);
+    } catch (SchedulerInvalidResoureRequestException e) {
+      // Expected
+      return;
+    }
+    Assert.fail(
+        "Expect failure for schedulingRequest=" + schedulingRequest.toString());
+  }
+
+  @Test
+  public void testSchedulingRequestValidation() {
+    // Valid
+    assertValidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer"),
+                PlacementConstraints.PlacementTargets.nodePartition(""))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build());
+    Assert.assertEquals(ImmutableSet.of("mapper", "reducer"),
+        allocator.getTargetAllocationTags());
+    Assert.assertEquals("", allocator.getTargetNodePartition());
+
+    // Valid (with partition)
+    assertValidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer"),
+                PlacementConstraints.PlacementTargets.nodePartition("x"))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build());
+    Assert.assertEquals(ImmutableSet.of("mapper", "reducer"),
+        allocator.getTargetAllocationTags());
+    Assert.assertEquals("x", allocator.getTargetNodePartition());
+
+    // Valid (without specifying node partition)
+    assertValidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer")).build())
+        .resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build());
+    Assert.assertEquals(ImmutableSet.of("mapper", "reducer"),
+        allocator.getTargetAllocationTags());
+    Assert.assertEquals("", allocator.getTargetNodePartition());
+
+    // Valid (with application Id target)
+    assertValidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer")).build())
+        .resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build());
+    // Allocation tags should not include application Id
+    Assert.assertEquals(ImmutableSet.of("mapper", "reducer"),
+        allocator.getTargetAllocationTags());
+    Assert.assertEquals("", allocator.getTargetNodePartition());
+
+    // Invalid (without sizing)
+    assertInvalidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer")).build())
+        .build(), true);
+
+    // Invalid (without target tags)
+    assertInvalidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1).build())
+        .build(), true);
+
+    // Invalid (with multiple allocation tags expression specified)
+    assertInvalidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper"),
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("reducer"),
+                PlacementConstraints.PlacementTargets.nodePartition(""))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build(), true);
+
+    // Invalid (with multiple node partition target expression specified)
+    assertInvalidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper"),
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp(""),
+                PlacementConstraints.PlacementTargets.nodePartition("x"))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build(), true);
+
+    // Invalid (not anti-affinity cardinality)
+    assertInvalidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 1, 2,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper"),
+                PlacementConstraints.PlacementTargets.nodePartition(""))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build(), true);
+
+    // Invalid (not anti-affinity cardinality)
+    assertInvalidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 2,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper"),
+                PlacementConstraints.PlacementTargets.nodePartition(""))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build(), true);
+
+    // Invalid (not NODE scope)
+    assertInvalidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.RACK, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer"),
+                PlacementConstraints.PlacementTargets.nodePartition(""))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build(), true);
+
+    // Invalid (not GUARANTEED)
+    assertInvalidSchedulingRequest(SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.OPPORTUNISTIC))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer"),
+                PlacementConstraints.PlacementTargets.nodePartition(""))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build(), true);
+  }
+
+  @Test
+  public void testSchedulingRequestUpdate() {
+    SchedulingRequest schedulingRequest =
+        SchedulingRequest.newBuilder().executionType(
+            ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+            .allocationRequestId(10L).priority(Priority.newInstance(1))
+            .placementConstraintExpression(PlacementConstraints
+                .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                    PlacementConstraints.PlacementTargets
+                        .allocationTagToIntraApp("mapper", "reducer"),
+                    PlacementConstraints.PlacementTargets.nodePartition(""))
+                .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+            .build();
+    allocator.updatePendingAsk(schedulerRequestKey, schedulingRequest, false);
+
+    // Update allocator with exactly same scheduling request, should succeeded.
+    allocator.updatePendingAsk(schedulerRequestKey, schedulingRequest, false);
+
+    // Update allocator with scheduling request different at #allocations,
+    // should succeeded.
+    schedulingRequest.getResourceSizing().setNumAllocations(10);
+    allocator.updatePendingAsk(schedulerRequestKey, schedulingRequest, false);
+
+    // Update allocator with scheduling request different at resource,
+    // should failed.
+    schedulingRequest.getResourceSizing().setResources(
+        Resource.newInstance(2048, 1));
+    assertInvalidSchedulingRequest(schedulingRequest, false);
+
+    // Update allocator with a different placement target (allocator tag),
+    // should failed
+    schedulingRequest = SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper"),
+                PlacementConstraints.PlacementTargets.nodePartition(""))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build();
+    assertInvalidSchedulingRequest(schedulingRequest, false);
+
+    // Update allocator with recover == true
+    int existingNumAllocations =
+        allocator.getSchedulingRequest().getResourceSizing()
+            .getNumAllocations();
+    schedulingRequest = SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer"),
+                PlacementConstraints.PlacementTargets.nodePartition(""))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build();
+    allocator.updatePendingAsk(schedulerRequestKey, schedulingRequest, true);
+    Assert.assertEquals(existingNumAllocations + 1,
+        allocator.getSchedulingRequest().getResourceSizing()
+            .getNumAllocations());
+  }
+
+  @Test
+  public void testFunctionality() throws InvalidAllocationTagsQueryException {
+    SchedulingRequest schedulingRequest =
+        SchedulingRequest.newBuilder().executionType(
+            ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+            .allocationRequestId(10L).priority(Priority.newInstance(1))
+            .placementConstraintExpression(PlacementConstraints
+                .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                    PlacementConstraints.PlacementTargets
+                        .allocationTagToIntraApp("mapper", "reducer"),
+                    PlacementConstraints.PlacementTargets.nodePartition(""))
+                .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+            .build();
+    allocator.updatePendingAsk(schedulerRequestKey, schedulingRequest, false);
+    allocator.canAllocate(NodeType.NODE_LOCAL,
+        TestUtils.getMockNode("host1", "/rack1", 123, 1024));
+    verify(spyAllocationTagsManager, Mockito.times(1)).getNodeCardinalityByOp(
+        eq(NodeId.fromString("host1:123")), eq(TestUtils.getMockApplicationId(1)),
+        eq(ImmutableSet.of("mapper", "reducer")),
+        any(LongBinaryOperator.class));
+
+    allocator = new SingleConstraintAppPlacementAllocator();
+    allocator.initialize(appSchedulingInfo, schedulerRequestKey, rmContext);
+    // Valid (with partition)
+    schedulingRequest = SchedulingRequest.newBuilder().executionType(
+        ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+        .allocationRequestId(10L).priority(Priority.newInstance(1))
+        .placementConstraintExpression(PlacementConstraints
+            .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                PlacementConstraints.PlacementTargets
+                    .allocationTagToIntraApp("mapper", "reducer"),
+                PlacementConstraints.PlacementTargets.nodePartition("x"))
+            .build()).resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(1024, 1)))
+        .build();
+    allocator.updatePendingAsk(schedulerRequestKey, schedulingRequest, false);
+    allocator.canAllocate(NodeType.NODE_LOCAL,
+        TestUtils.getMockNode("host1", "/rack1", 123, 1024));
+    verify(spyAllocationTagsManager, Mockito.atLeast(1)).getNodeCardinalityByOp(
+        eq(NodeId.fromString("host1:123")),
+        eq(TestUtils.getMockApplicationId(1)), eq(ImmutableSet
+            .of("mapper", "reducer")), any(LongBinaryOperator.class));
+
+    SchedulerNode node1 = mock(SchedulerNode.class);
+    when(node1.getPartition()).thenReturn("x");
+    when(node1.getNodeID()).thenReturn(NodeId.fromString("host1:123"));
+
+    Assert.assertTrue(allocator
+        .precheckNode(node1, SchedulingMode.RESPECT_PARTITION_EXCLUSIVITY));
+
+    SchedulerNode node2 = mock(SchedulerNode.class);
+    when(node1.getPartition()).thenReturn("");
+    when(node1.getNodeID()).thenReturn(NodeId.fromString("host2:123"));
+    Assert.assertFalse(allocator
+        .precheckNode(node2, SchedulingMode.RESPECT_PARTITION_EXCLUSIVITY));
+  }
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[28/50] [abbrv] hadoop git commit: YARN-6594. [API] Introduce SchedulingRequest object. (Konstantinos Karanasos via wangda)

Posted by as...@apache.org.
YARN-6594. [API] Introduce SchedulingRequest object. (Konstantinos Karanasos via wangda)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/2dfe2c77
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/2dfe2c77
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/2dfe2c77

Branch: refs/heads/YARN-6592
Commit: 2dfe2c77442db972c63df69df75f7a8e0bebddfa
Parents: 50cfc78
Author: Wangda Tan <wa...@apache.org>
Authored: Mon Oct 30 16:54:02 2017 -0700
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../hadoop/yarn/api/records/ResourceSizing.java |  64 +++++
 .../yarn/api/records/SchedulingRequest.java     | 205 ++++++++++++++
 .../src/main/proto/yarn_protos.proto            |  14 +
 .../records/impl/pb/ResourceSizingPBImpl.java   | 117 ++++++++
 .../impl/pb/SchedulingRequestPBImpl.java        | 266 +++++++++++++++++++
 5 files changed, 666 insertions(+)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/2dfe2c77/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java
new file mode 100644
index 0000000..d82be11
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java
@@ -0,0 +1,64 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.records;
+
+import org.apache.hadoop.classification.InterfaceAudience.Public;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.yarn.util.Records;
+
+/**
+ * {@code ResourceSizing} contains information for the size of a
+ * {@link SchedulingRequest}, such as the number of requested allocations and
+ * the resources for each allocation.
+ */
+@Public
+@Unstable
+public abstract class ResourceSizing {
+
+  @Public
+  @Unstable
+  public static ResourceSizing newInstance(Resource resources) {
+    return ResourceSizing.newInstance(1, resources);
+  }
+
+  @Public
+  @Unstable
+  public static ResourceSizing newInstance(int numAllocations, Resource resources) {
+    ResourceSizing resourceSizing = Records.newRecord(ResourceSizing.class);
+    resourceSizing.setNumAllocations(numAllocations);
+    resourceSizing.setResources(resources);
+    return resourceSizing;
+  }
+
+  @Public
+  @Unstable
+  public abstract int getNumAllocations();
+
+  @Public
+  @Unstable
+  public abstract void setNumAllocations(int numAllocations);
+
+  @Public
+  @Unstable
+  public abstract Resource getResources();
+
+  @Public
+  @Unstable
+  public abstract void setResources(Resource resources);
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2dfe2c77/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
new file mode 100644
index 0000000..47a0697
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
@@ -0,0 +1,205 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.records;
+
+import java.util.Set;
+
+import org.apache.hadoop.classification.InterfaceAudience.Public;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.util.Records;
+
+/**
+ * {@code SchedulingRequest} represents a request made by an application to the
+ * {@code ResourceManager} to obtain an allocation. It is similar to the
+ * {@link ResourceRequest}. However, it is more complete than the latter, as it
+ * allows applications to specify allocation tags (e.g., to express that an
+ * allocation belongs to {@code Spark} or is an {@code HBase-master}), as well
+ * as involved {@link PlacementConstraint}s (e.g., anti-affinity between Spark
+ * and HBase allocations).
+ *
+ * The size specification of the allocation is in {@code ResourceSizing}.
+ */
+@Public
+@Unstable
+public abstract class SchedulingRequest {
+
+  @Public
+  @Unstable
+  public static SchedulingRequest newInstance(long allocationRequestId,
+      Priority priority, ExecutionTypeRequest executionType,
+      Set<String> allocationTags, ResourceSizing resourceSizing,
+      PlacementConstraint placementConstraintExpression) {
+    return SchedulingRequest.newBuilder()
+        .allocationRequestId(allocationRequestId).priority(priority)
+        .executionType(executionType).allocationTags(allocationTags)
+        .placementConstraintExpression(placementConstraintExpression).build();
+  }
+
+  @Public
+  @Unstable
+  public static SchedulingRequestBuilder newBuilder() {
+    return new SchedulingRequestBuilder();
+  }
+
+  /**
+   * Class to construct instances of {@link SchedulingRequest} with specific
+   * options.
+   */
+  @Public
+  @Unstable
+  public static final class SchedulingRequestBuilder {
+    private SchedulingRequest schedulingRequest =
+            Records.newRecord(SchedulingRequest.class);
+
+    private SchedulingRequestBuilder() {
+      schedulingRequest.setAllocationRequestId(0);
+      schedulingRequest.setPriority(Priority.newInstance(0));
+      schedulingRequest.setExecutionType(ExecutionTypeRequest.newInstance());
+    }
+
+    /**
+     * Set the <code>allocationRequestId</code> of the request.
+     * 
+     * @see SchedulingRequest#setAllocationRequestId(long)
+     * @param allocationRequestId <code>allocationRequestId</code> of the
+     *          request
+     * @return {@link SchedulingRequest.SchedulingRequestBuilder}
+     */
+    @Public
+    @Unstable
+    public SchedulingRequestBuilder allocationRequestId(
+            long allocationRequestId) {
+      schedulingRequest.setAllocationRequestId(allocationRequestId);
+      return this;
+    }
+
+    /**
+     * Set the <code>priority</code> of the request.
+     *
+     * @param priority <code>priority</code> of the request
+     * @return {@link SchedulingRequest.SchedulingRequestBuilder}
+     * @see SchedulingRequest#setPriority(Priority)
+     */
+    @Public
+    @Unstable
+    public SchedulingRequestBuilder priority(Priority priority) {
+      schedulingRequest.setPriority(priority);
+      return this;
+    }
+
+    /**
+     * Set the <code>executionType</code> of the request.
+     * 
+     * @see SchedulingRequest#setExecutionType(ExecutionTypeRequest)
+     * @param executionType <code>executionType</code> of the request
+     * @return {@link SchedulingRequest.SchedulingRequestBuilder}
+     */
+    @Public
+    @Unstable
+    public SchedulingRequestBuilder executionType(
+        ExecutionTypeRequest executionType) {
+      schedulingRequest.setExecutionType(executionType);
+      return this;
+    }
+    
+    /**
+     * Set the <code>allocationTags</code> of the request.
+     *
+     * @see SchedulingRequest#setAllocationTags(Set)
+     * @param allocationTags <code>allocationsTags</code> of the request
+     * @return {@link SchedulingRequest.SchedulingRequestBuilder}
+     */
+    @Public
+    @Unstable
+    public SchedulingRequestBuilder allocationTags(Set<String> allocationTags) {
+      schedulingRequest.setAllocationTags(allocationTags);
+      return this;
+    }
+
+    /**
+     * Set the <code>executionType</code> of the request.
+     *
+     * @see SchedulingRequest#setResourceSizing(ResourceSizing)
+     * @param resourceSizing <code>resourceSizing</code> of the request
+     * @return {@link SchedulingRequest.SchedulingRequestBuilder}
+     */
+    @Public
+    @Unstable
+    public SchedulingRequestBuilder resourceSizing(
+        ResourceSizing resourceSizing) {
+      schedulingRequest.setResourceSizing(resourceSizing);
+      return this;
+    }
+
+    /**
+     * Set the <code>placementConstraintExpression</code> of the request.
+     *
+     * @see SchedulingRequest#setPlacementConstraint(
+     *      PlacementConstraint)
+     * @param placementConstraintExpression <code>placementConstraints</code> of
+     *          the request
+     * @return {@link SchedulingRequest.SchedulingRequestBuilder}
+     */
+    @Public
+    @Unstable
+    public SchedulingRequestBuilder placementConstraintExpression(
+        PlacementConstraint placementConstraintExpression) {
+      schedulingRequest
+          .setPlacementConstraint(placementConstraintExpression);
+      return this;
+    }
+
+    /**
+     * Return generated {@link SchedulingRequest} object.
+     * 
+     * @return {@link SchedulingRequest}
+     */
+    @Public
+    @Unstable
+    public SchedulingRequest build() {
+      return schedulingRequest;
+    }
+  }
+
+  public abstract long getAllocationRequestId();
+
+  public abstract void setAllocationRequestId(long allocationRequestId);
+
+  public abstract Priority getPriority();
+
+  public abstract void setPriority(Priority priority);
+
+  public abstract ExecutionTypeRequest getExecutionType();
+
+  public abstract void setExecutionType(ExecutionTypeRequest executionType);
+
+  public abstract Set<String> getAllocationTags();
+
+  public abstract void setAllocationTags(Set<String> allocationTags);
+
+  public abstract ResourceSizing getResourceSizing();
+
+  public abstract void setResourceSizing(ResourceSizing resourceSizing);
+
+  public abstract PlacementConstraint getPlacementConstraint();
+
+  public abstract void setPlacementConstraint(
+      PlacementConstraint placementConstraint);
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2dfe2c77/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
index ff0d54b..d24f863 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_protos.proto
@@ -405,6 +405,20 @@ message ExecutionTypeRequestProto {
   optional bool enforce_execution_type = 2 [default = false];
 }
 
+message SchedulingRequestProto {
+  optional int64 allocationRequestId = 1 [default = 0];
+  optional PriorityProto priority = 2;
+  optional ExecutionTypeRequestProto executionType = 3;
+  repeated string allocationTags = 4;
+  optional ResourceSizingProto resourceSizing = 5;
+  optional PlacementConstraintProto placementConstraint = 6;
+}
+
+message ResourceSizingProto {
+  optional int32 numAllocations = 1;
+  optional ResourceProto resources = 2;
+}
+
 enum AMCommandProto {
   AM_RESYNC = 1;
   AM_SHUTDOWN = 2;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2dfe2c77/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
new file mode 100644
index 0000000..05bb3bd
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
@@ -0,0 +1,117 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.records.impl.pb;
+
+import org.apache.hadoop.classification.InterfaceAudience.Private;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.proto.YarnProtos.ResourceProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.ResourceSizingProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.ResourceSizingProtoOrBuilder;
+
+@Private
+@Unstable
+public class ResourceSizingPBImpl extends ResourceSizing {
+  ResourceSizingProto proto = ResourceSizingProto.getDefaultInstance();
+  ResourceSizingProto.Builder builder = null;
+  boolean viaProto = false;
+
+  private Resource resources = null;
+
+  public ResourceSizingPBImpl() {
+    builder = ResourceSizingProto.newBuilder();
+  }
+
+  public ResourceSizingPBImpl(ResourceSizingProto proto) {
+    this.proto = proto;
+    viaProto = true;
+  }
+
+  public ResourceSizingProto getProto() {
+    mergeLocalToProto();
+    proto = viaProto ? proto : builder.build();
+    viaProto = true;
+    return proto;
+  }
+
+  private void mergeLocalToBuilder() {
+    if (this.resources != null) {
+      builder.setResources(convertToProtoFormat(this.resources));
+    }
+  }
+
+  private void mergeLocalToProto() {
+    if (viaProto) {
+      maybeInitBuilder();
+    }
+    mergeLocalToBuilder();
+    proto = builder.build();
+    viaProto = true;
+  }
+
+  private void maybeInitBuilder() {
+    if (viaProto || builder == null) {
+      builder = ResourceSizingProto.newBuilder(proto);
+    }
+    viaProto = false;
+  }
+
+  @Override
+  public int getNumAllocations() {
+    ResourceSizingProtoOrBuilder p = viaProto ? proto : builder;
+    return (p.getNumAllocations());
+  }
+
+  @Override
+  public void setNumAllocations(int numAllocations) {
+    maybeInitBuilder();
+    builder.setNumAllocations(numAllocations);
+  }
+
+  @Override
+  public Resource getResources() {
+    ResourceSizingProtoOrBuilder p = viaProto ? proto : builder;
+    if (this.resources != null) {
+      return this.resources;
+    }
+    if (!p.hasResources()) {
+      return null;
+    }
+    this.resources = convertFromProtoFormat(p.getResources());
+    return this.resources;
+  }
+
+  @Override
+  public void setResources(Resource resources) {
+    maybeInitBuilder();
+    if (resources == null) {
+      builder.clearResources();
+    }
+    this.resources = resources;
+  }
+
+  private ResourcePBImpl convertFromProtoFormat(ResourceProto r) {
+    return new ResourcePBImpl(r);
+  }
+
+  private ResourceProto convertToProtoFormat(Resource r) {
+    return ((ResourcePBImpl) r).getProto();
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2dfe2c77/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
new file mode 100644
index 0000000..7826b36
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
@@ -0,0 +1,266 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.api.records.impl.pb;
+
+import java.util.HashSet;
+import java.util.Set;
+
+import org.apache.hadoop.classification.InterfaceAudience.Private;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.yarn.api.pb.PlacementConstraintFromProtoConverter;
+import org.apache.hadoop.yarn.api.pb.PlacementConstraintToProtoConverter;
+import org.apache.hadoop.yarn.api.records.ExecutionTypeRequest;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.proto.YarnProtos.ExecutionTypeRequestProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.PlacementConstraintProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.PriorityProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.ResourceSizingProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.SchedulingRequestProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.SchedulingRequestProtoOrBuilder;
+
+@Private
+@Unstable
+public class SchedulingRequestPBImpl extends SchedulingRequest {
+  SchedulingRequestProto proto = SchedulingRequestProto.getDefaultInstance();
+  SchedulingRequestProto.Builder builder = null;
+  boolean viaProto = false;
+
+  private Priority priority = null;
+  private ExecutionTypeRequest executionType = null;
+  private Set<String> allocationTags = null;
+  private ResourceSizing resourceSizing = null;
+  private PlacementConstraint placementConstraint = null;
+
+  public SchedulingRequestPBImpl() {
+    builder = SchedulingRequestProto.newBuilder();
+  }
+
+  public SchedulingRequestPBImpl(SchedulingRequestProto proto) {
+    this.proto = proto;
+    viaProto = true;
+  }
+
+  public SchedulingRequestProto getProto() {
+    mergeLocalToProto();
+    proto = viaProto ? proto : builder.build();
+    viaProto = true;
+    return proto;
+  }
+
+  private void mergeLocalToBuilder() {
+    if (this.priority != null) {
+      builder.setPriority(convertToProtoFormat(this.priority));
+    }
+    if (this.executionType != null) {
+      builder.setExecutionType(convertToProtoFormat(this.executionType));
+    }
+    if (this.allocationTags != null) {
+      builder.clearAllocationTags();
+      builder.addAllAllocationTags(this.allocationTags);
+    }
+    if (this.resourceSizing != null) {
+      builder.setResourceSizing(convertToProtoFormat(this.resourceSizing));
+    }
+    if (this.placementConstraint != null) {
+      builder.setPlacementConstraint(
+          convertToProtoFormat(this.placementConstraint));
+    }
+  }
+
+  private void mergeLocalToProto() {
+    if (viaProto) {
+      maybeInitBuilder();
+    }
+    mergeLocalToBuilder();
+    proto = builder.build();
+    viaProto = true;
+  }
+
+  private void maybeInitBuilder() {
+    if (viaProto || builder == null) {
+      builder = SchedulingRequestProto.newBuilder(proto);
+    }
+    viaProto = false;
+  }
+
+  @Override
+  public long getAllocationRequestId() {
+    SchedulingRequestProtoOrBuilder p = viaProto ? proto : builder;
+    return (p.getAllocationRequestId());
+  }
+
+  @Override
+  public void setAllocationRequestId(long allocationRequestId) {
+    maybeInitBuilder();
+    builder.setAllocationRequestId(allocationRequestId);
+  }
+
+  @Override
+  public Priority getPriority() {
+    SchedulingRequestProtoOrBuilder p = viaProto ? proto : builder;
+    if (this.priority != null) {
+      return this.priority;
+    }
+    if (!p.hasPriority()) {
+      return null;
+    }
+    this.priority = convertFromProtoFormat(p.getPriority());
+    return this.priority;
+  }
+
+  @Override
+  public void setPriority(Priority priority) {
+    maybeInitBuilder();
+    if (priority == null) {
+      builder.clearPriority();
+    }
+    this.priority = priority;
+  }
+
+  @Override
+  public ExecutionTypeRequest getExecutionType() {
+    SchedulingRequestProtoOrBuilder p = viaProto ? proto : builder;
+    if (this.executionType != null) {
+      return this.executionType;
+    }
+    if (!p.hasExecutionType()) {
+      return null;
+    }
+    this.executionType = convertFromProtoFormat(p.getExecutionType());
+    return this.executionType;
+  }
+
+  @Override
+  public void setExecutionType(ExecutionTypeRequest executionType) {
+    maybeInitBuilder();
+    if (executionType == null) {
+      builder.clearExecutionType();
+    }
+    this.executionType = executionType;
+  }
+
+  @Override
+  public Set<String> getAllocationTags() {
+    initAllocationTags();
+    return this.allocationTags;
+  }
+
+  @Override
+  public void setAllocationTags(Set<String> allocationTags) {
+    maybeInitBuilder();
+    builder.clearAllocationTags();
+    this.allocationTags = allocationTags;
+  }
+
+  @Override
+  public ResourceSizing getResourceSizing() {
+    SchedulingRequestProtoOrBuilder p = viaProto ? proto : builder;
+    if (this.resourceSizing != null) {
+      return this.resourceSizing;
+    }
+    if (!p.hasResourceSizing()) {
+      return null;
+    }
+    this.resourceSizing = convertFromProtoFormat(p.getResourceSizing());
+    return this.resourceSizing;
+  }
+
+  @Override
+  public void setResourceSizing(ResourceSizing resourceSizing) {
+    maybeInitBuilder();
+    if (resourceSizing == null) {
+      builder.clearResourceSizing();
+    }
+    this.resourceSizing = resourceSizing;
+  }
+
+  @Override
+  public PlacementConstraint getPlacementConstraint() {
+    SchedulingRequestProtoOrBuilder p = viaProto ? proto : builder;
+    if (this.placementConstraint != null) {
+      return this.placementConstraint;
+    }
+    if (!p.hasPlacementConstraint()) {
+      return null;
+    }
+    this.placementConstraint =
+        convertFromProtoFormat(p.getPlacementConstraint());
+    return this.placementConstraint;
+  }
+
+  @Override
+  public void setPlacementConstraint(PlacementConstraint placementConstraint) {
+    maybeInitBuilder();
+    if (placementConstraint == null) {
+      builder.clearPlacementConstraint();
+    }
+    this.placementConstraint = placementConstraint;
+  }
+
+  private PriorityPBImpl convertFromProtoFormat(PriorityProto p) {
+    return new PriorityPBImpl(p);
+  }
+
+  private PriorityProto convertToProtoFormat(Priority p) {
+    return ((PriorityPBImpl) p).getProto();
+  }
+
+  private ExecutionTypeRequestPBImpl convertFromProtoFormat(
+      ExecutionTypeRequestProto p) {
+    return new ExecutionTypeRequestPBImpl(p);
+  }
+
+  private ExecutionTypeRequestProto convertToProtoFormat(
+      ExecutionTypeRequest p) {
+    return ((ExecutionTypeRequestPBImpl) p).getProto();
+  }
+
+  private ResourceSizingPBImpl convertFromProtoFormat(ResourceSizingProto p) {
+    return new ResourceSizingPBImpl(p);
+  }
+
+  private ResourceSizingProto convertToProtoFormat(ResourceSizing p) {
+    return ((ResourceSizingPBImpl) p).getProto();
+  }
+
+  private PlacementConstraint convertFromProtoFormat(
+      PlacementConstraintProto c) {
+    PlacementConstraintFromProtoConverter fromProtoConverter =
+        new PlacementConstraintFromProtoConverter(c);
+    return fromProtoConverter.convert();
+  }
+
+  private PlacementConstraintProto convertToProtoFormat(PlacementConstraint c) {
+    PlacementConstraintToProtoConverter toProtoConverter =
+        new PlacementConstraintToProtoConverter(c);
+    return toProtoConverter.convert();
+  }
+
+  private void initAllocationTags() {
+    if (this.allocationTags != null) {
+      return;
+    }
+    SchedulingRequestProtoOrBuilder p = viaProto ? proto : builder;
+    this.allocationTags = new HashSet<>();
+    this.allocationTags.addAll(p.getAllocationTagsList());
+  }
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[05/50] [abbrv] hadoop git commit: HDFS-13054. Handling PathIsNotEmptyDirectoryException in DFSClient delete call. Contributed by Nanda kumar.

Posted by as...@apache.org.
HDFS-13054. Handling PathIsNotEmptyDirectoryException in DFSClient delete call. Contributed by Nanda kumar.


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/e990904d
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/e990904d
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/e990904d

Branch: refs/heads/YARN-6592
Commit: e990904dd568a1d8f98efb55c1dd2d598ae4752b
Parents: a37e7f0
Author: Arpit Agarwal <ar...@apache.org>
Authored: Fri Jan 26 11:42:27 2018 -0800
Committer: Arpit Agarwal <ar...@apache.org>
Committed: Fri Jan 26 13:09:13 2018 -0800

----------------------------------------------------------------------
 .../java/org/apache/hadoop/hdfs/DFSClient.java     |  4 +++-
 .../hadoop/hdfs/protocol/ClientProtocol.java       |  3 +++
 .../hadoop/hdfs/TestDistributedFileSystem.java     | 17 +++++++++++++++++
 3 files changed, 23 insertions(+), 1 deletion(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/e990904d/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java
index f0769c1..92bb99e 100644
--- a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java
+++ b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/DFSClient.java
@@ -82,6 +82,7 @@ import org.apache.hadoop.fs.Options;
 import org.apache.hadoop.fs.Options.ChecksumOpt;
 import org.apache.hadoop.fs.ParentNotDirectoryException;
 import org.apache.hadoop.fs.Path;
+import org.apache.hadoop.fs.PathIsNotEmptyDirectoryException;
 import org.apache.hadoop.fs.QuotaUsage;
 import org.apache.hadoop.fs.RemoteIterator;
 import org.apache.hadoop.fs.StorageType;
@@ -1620,7 +1621,8 @@ public class DFSClient implements java.io.Closeable, RemotePeerFactory,
           FileNotFoundException.class,
           SafeModeException.class,
           UnresolvedPathException.class,
-          SnapshotAccessControlException.class);
+          SnapshotAccessControlException.class,
+          PathIsNotEmptyDirectoryException.class);
     }
   }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e990904d/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java
index fbef037..0d77037 100644
--- a/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java
+++ b/hadoop-hdfs-project/hadoop-hdfs-client/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java
@@ -26,6 +26,7 @@ import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceStability;
 import org.apache.hadoop.crypto.CryptoProtocolVersion;
 import org.apache.hadoop.fs.BatchedRemoteIterator.BatchedEntries;
+import org.apache.hadoop.fs.PathIsNotEmptyDirectoryException;
 import org.apache.hadoop.hdfs.AddBlockFlag;
 import org.apache.hadoop.fs.CacheFlag;
 import org.apache.hadoop.fs.ContentSummary;
@@ -625,6 +626,8 @@ public interface ClientProtocol {
    * @throws org.apache.hadoop.fs.UnresolvedLinkException If <code>src</code>
    *           contains a symlink
    * @throws SnapshotAccessControlException if path is in RO snapshot
+   * @throws PathIsNotEmptyDirectoryException if path is a non-empty directory
+   *           and <code>recursive</code> is set to false
    * @throws IOException If an I/O error occurred
    */
   @AtMostOnce

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e990904d/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDistributedFileSystem.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDistributedFileSystem.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDistributedFileSystem.java
index 823c747..072ee9f 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDistributedFileSystem.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDistributedFileSystem.java
@@ -67,6 +67,7 @@ import org.apache.hadoop.fs.LocatedFileStatus;
 import org.apache.hadoop.fs.MD5MD5CRC32FileChecksum;
 import org.apache.hadoop.fs.Options.ChecksumOpt;
 import org.apache.hadoop.fs.Path;
+import org.apache.hadoop.fs.PathIsNotEmptyDirectoryException;
 import org.apache.hadoop.fs.RemoteIterator;
 import org.apache.hadoop.fs.StorageStatistics.LongStatistic;
 import org.apache.hadoop.fs.StorageType;
@@ -571,6 +572,22 @@ public class TestDistributedFileSystem {
         in.close();
         fs.close();
       }
+
+      {
+        // Test PathIsNotEmptyDirectoryException while deleting non-empty dir
+        FileSystem fs = cluster.getFileSystem();
+        fs.mkdirs(new Path("/test/nonEmptyDir"));
+        fs.create(new Path("/tmp/nonEmptyDir/emptyFile")).close();
+        try {
+          fs.delete(new Path("/tmp/nonEmptyDir"), false);
+          Assert.fail("Expecting PathIsNotEmptyDirectoryException");
+        } catch (PathIsNotEmptyDirectoryException ex) {
+          // This is the proper exception to catch; move on.
+        }
+        Assert.assertTrue(fs.exists(new Path("/test/nonEmptyDir")));
+        fs.delete(new Path("/tmp/nonEmptyDir"), true);
+      }
+
     }
     finally {
       if (cluster != null) {cluster.shutdown();}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[04/50] [abbrv] hadoop git commit: MAPREDUCE-7022. Fast fail rogue jobs based on task scratch dir size. Contributed by Johan Gustavsson

Posted by as...@apache.org.
MAPREDUCE-7022. Fast fail rogue jobs based on task scratch dir size. Contributed by Johan Gustavsson


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/a37e7f0a
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/a37e7f0a
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/a37e7f0a

Branch: refs/heads/YARN-6592
Commit: a37e7f0ad8b68c7ed16c242bedf62f4cde48d6fd
Parents: 1b0f265
Author: Jason Lowe <jl...@apache.org>
Authored: Fri Jan 26 14:36:45 2018 -0600
Committer: Jason Lowe <jl...@apache.org>
Committed: Fri Jan 26 14:36:45 2018 -0600

----------------------------------------------------------------------
 .../hadoop/mapred/LocalContainerLauncher.java   |  2 +-
 .../hadoop/mapred/TaskAttemptListenerImpl.java  |  7 +-
 .../org/apache/hadoop/mapred/YarnChild.java     |  4 +-
 .../v2/app/job/event/TaskAttemptFailEvent.java  | 53 ++++++++++++
 .../app/job/event/TaskTAttemptFailedEvent.java  | 39 +++++++++
 .../v2/app/job/impl/TaskAttemptImpl.java        | 40 ++++++---
 .../mapreduce/v2/app/job/impl/TaskImpl.java     |  6 +-
 .../hadoop/mapreduce/v2/app/TestFail.java       |  7 +-
 .../hadoop/mapreduce/v2/app/TestRecovery.java   |  7 +-
 .../mapreduce/v2/app/job/impl/TestJobImpl.java  |  5 +-
 .../v2/app/job/impl/TestTaskAttempt.java        |  9 +-
 .../mapreduce/v2/app/job/impl/TestTaskImpl.java | 42 ++++-----
 .../apache/hadoop/mapred/LocalJobRunner.java    |  4 +-
 .../java/org/apache/hadoop/mapred/MapTask.java  |  3 +-
 .../java/org/apache/hadoop/mapred/Task.java     | 87 ++++++++++++++++++-
 .../hadoop/mapred/TaskUmbilicalProtocol.java    | 12 ++-
 .../apache/hadoop/mapreduce/MRJobConfig.java    | 14 +++
 .../src/main/resources/mapred-default.xml       | 22 +++++
 .../hadoop/mapred/TestTaskProgressReporter.java | 90 +++++++++++++++++++-
 .../mapreduce/v2/hs/TestJobHistoryParsing.java  |  9 +-
 .../apache/hadoop/mapred/TestMapProgress.java   |  4 +-
 .../apache/hadoop/mapred/TestTaskCommit.java    |  2 +-
 22 files changed, 397 insertions(+), 71 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/LocalContainerLauncher.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/LocalContainerLauncher.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/LocalContainerLauncher.java
index 6f9cc34..fed500a 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/LocalContainerLauncher.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/LocalContainerLauncher.java
@@ -510,7 +510,7 @@ public class LocalContainerLauncher extends AbstractService implements
           String cause =
               (tCause == null) ? throwable.getMessage() : StringUtils
                   .stringifyException(tCause);
-          umbilical.fatalError(classicAttemptID, cause);
+          umbilical.fatalError(classicAttemptID, cause, false);
         }
         throw new RuntimeException();
       }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java
index 556c90c..b155af22 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/TaskAttemptListenerImpl.java
@@ -48,6 +48,7 @@ import org.apache.hadoop.mapreduce.v2.app.job.Task;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptDiagnosticsUpdateEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptEventType;
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptFailEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptStatusUpdateEvent.TaskAttemptStatus;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptStatusUpdateEvent;
 import org.apache.hadoop.mapreduce.v2.app.rm.RMHeartbeatHandler;
@@ -281,7 +282,7 @@ public class TaskAttemptListenerImpl extends CompositeService
   }
 
   @Override
-  public void fatalError(TaskAttemptID taskAttemptID, String msg)
+  public void fatalError(TaskAttemptID taskAttemptID, String msg, boolean fastFail)
       throws IOException {
     // This happens only in Child and in the Task.
     LOG.error("Task: " + taskAttemptID + " - exited : " + msg);
@@ -294,7 +295,7 @@ public class TaskAttemptListenerImpl extends CompositeService
     preemptionPolicy.handleFailedContainer(attemptID);
 
     context.getEventHandler().handle(
-        new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_FAILMSG));
+        new TaskAttemptFailEvent(attemptID, fastFail));
   }
 
   @Override
@@ -312,7 +313,7 @@ public class TaskAttemptListenerImpl extends CompositeService
     preemptionPolicy.handleFailedContainer(attemptID);
 
     context.getEventHandler().handle(
-        new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_FAILMSG));
+        new TaskAttemptFailEvent(attemptID));
   }
 
   @Override

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/YarnChild.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/YarnChild.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/YarnChild.java
index 7ae7a1e..bd40e54 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/YarnChild.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapred/YarnChild.java
@@ -206,7 +206,7 @@ class YarnChild {
       if (taskid != null) {
         if (!ShutdownHookManager.get().isShutdownInProgress()) {
           umbilical.fatalError(taskid,
-              StringUtils.stringifyException(exception));
+              StringUtils.stringifyException(exception), false);
         }
       }
     } catch (Throwable throwable) {
@@ -218,7 +218,7 @@ class YarnChild {
           String cause =
               tCause == null ? throwable.getMessage() : StringUtils
                   .stringifyException(tCause);
-          umbilical.fatalError(taskid, cause);
+          umbilical.fatalError(taskid, cause, false);
         }
       }
     } finally {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/event/TaskAttemptFailEvent.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/event/TaskAttemptFailEvent.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/event/TaskAttemptFailEvent.java
new file mode 100644
index 0000000..6ea1d15
--- /dev/null
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/event/TaskAttemptFailEvent.java
@@ -0,0 +1,53 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.mapreduce.v2.app.job.event;
+
+import org.apache.hadoop.mapreduce.v2.api.records.TaskAttemptId;
+
+public class TaskAttemptFailEvent extends TaskAttemptEvent {
+  private boolean fastFail;
+
+  /**
+   * Create a new TaskAttemptFailEvent, with task fastFail disabled.
+   *
+   * @param id the id of the task attempt
+   */
+  public TaskAttemptFailEvent(TaskAttemptId id) {
+    this(id, false);
+  }
+
+  /**
+   * Create a new TaskAttemptFailEvent.
+   *
+   * @param id the id of the task attempt
+   * @param fastFail should the task fastFail or not.
+   */
+  public TaskAttemptFailEvent(TaskAttemptId id, boolean fastFail) {
+    super(id, TaskAttemptEventType.TA_FAILMSG);
+    this.fastFail = fastFail;
+  }
+
+  /**
+   * Check if task should fast fail or retry
+   * @return boolean value where true indicates the task should not retry
+   */
+  public boolean isFastFail() {
+    return fastFail;
+  }
+}
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/event/TaskTAttemptFailedEvent.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/event/TaskTAttemptFailedEvent.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/event/TaskTAttemptFailedEvent.java
new file mode 100644
index 0000000..30392ac
--- /dev/null
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/event/TaskTAttemptFailedEvent.java
@@ -0,0 +1,39 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.mapreduce.v2.app.job.event;
+
+import org.apache.hadoop.mapreduce.v2.api.records.TaskAttemptId;
+
+public class TaskTAttemptFailedEvent extends TaskTAttemptEvent {
+
+  private boolean fastFail;
+
+  public TaskTAttemptFailedEvent(TaskAttemptId id) {
+    this(id, false);
+  }
+
+  public TaskTAttemptFailedEvent(TaskAttemptId id, boolean fastFail) {
+    super(id, TaskEventType.T_ATTEMPT_FAILED);
+    this.fastFail = fastFail;
+  }
+
+  public boolean isFastFail() {
+    return fastFail;
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskAttemptImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskAttemptImpl.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskAttemptImpl.java
index 431128b..6632f27 100755
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskAttemptImpl.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskAttemptImpl.java
@@ -94,6 +94,7 @@ import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptContainerLaunched
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptDiagnosticsUpdateEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptEventType;
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptFailEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptKillEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptRecoverEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptStatusUpdateEvent;
@@ -101,6 +102,7 @@ import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptStatusUpdateEvent
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptTooManyFetchFailureEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskEventType;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptEvent;
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptFailedEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptKilledEvent;
 import org.apache.hadoop.mapreduce.v2.app.launcher.ContainerLauncher;
 import org.apache.hadoop.mapreduce.v2.app.launcher.ContainerLauncherEvent;
@@ -194,6 +196,7 @@ public abstract class TaskAttemptImpl implements
   private Locality locality;
   private Avataar avataar;
   private boolean rescheduleNextAttempt = false;
+  private boolean failFast = false;
 
   private static final CleanupContainerTransition
       CLEANUP_CONTAINER_TRANSITION = new CleanupContainerTransition();
@@ -1412,6 +1415,14 @@ public abstract class TaskAttemptImpl implements
   public void setAvataar(Avataar avataar) {
     this.avataar = avataar;
   }
+
+  public void setTaskFailFast(boolean failFast) {
+    this.failFast = failFast;
+  }
+
+  public boolean isTaskFailFast() {
+    return failFast;
+  }
   
   @SuppressWarnings("unchecked")
   public TaskAttemptStateInternal recover(TaskAttemptInfo taInfo,
@@ -1921,9 +1932,12 @@ public abstract class TaskAttemptImpl implements
 
       switch(finalState) {
         case FAILED:
-          taskAttempt.eventHandler.handle(new TaskTAttemptEvent(
-              taskAttempt.attemptId,
-              TaskEventType.T_ATTEMPT_FAILED));
+          boolean fastFail = false;
+          if (event instanceof TaskAttemptFailEvent) {
+            fastFail = ((TaskAttemptFailEvent) event).isFastFail();
+          }
+          taskAttempt.eventHandler.handle(new TaskTAttemptFailedEvent(
+              taskAttempt.attemptId, fastFail));
           break;
         case KILLED:
           taskAttempt.eventHandler.handle(new TaskTAttemptKilledEvent(
@@ -2041,13 +2055,16 @@ public abstract class TaskAttemptImpl implements
 
   private static class FailedTransition implements
       SingleArcTransition<TaskAttemptImpl, TaskAttemptEvent> {
+
+
     @SuppressWarnings("unchecked")
     @Override
     public void transition(TaskAttemptImpl taskAttempt,
         TaskAttemptEvent event) {
       // set the finish time
       taskAttempt.setFinishTime();
-      notifyTaskAttemptFailed(taskAttempt);
+
+      notifyTaskAttemptFailed(taskAttempt, taskAttempt.isTaskFailFast());
     }
   }
 
@@ -2154,8 +2171,8 @@ public abstract class TaskAttemptImpl implements
         LOG.debug("Not generating HistoryFinish event since start event not " +
             "generated for taskAttempt: " + taskAttempt.getID());
       }
-      taskAttempt.eventHandler.handle(new TaskTAttemptEvent(
-          taskAttempt.attemptId, TaskEventType.T_ATTEMPT_FAILED));
+      taskAttempt.eventHandler.handle(new TaskTAttemptFailedEvent(
+          taskAttempt.attemptId));
     }
   }
   
@@ -2332,6 +2349,8 @@ public abstract class TaskAttemptImpl implements
       if (event instanceof TaskAttemptKillEvent) {
         taskAttempt.setRescheduleNextAttempt(
             ((TaskAttemptKillEvent)event).getRescheduleAttempt());
+      } else if (event instanceof TaskAttemptFailEvent) {
+        taskAttempt.setTaskFailFast(((TaskAttemptFailEvent)event).isFastFail());
       }
     }
   }
@@ -2400,12 +2419,13 @@ public abstract class TaskAttemptImpl implements
       // register it to finishing state
       taskAttempt.appContext.getTaskAttemptFinishingMonitor().register(
           taskAttempt.attemptId);
-      notifyTaskAttemptFailed(taskAttempt);
+      notifyTaskAttemptFailed(taskAttempt, false);
     }
   }
 
   @SuppressWarnings("unchecked")
-  private static void notifyTaskAttemptFailed(TaskAttemptImpl taskAttempt) {
+  private static void notifyTaskAttemptFailed(TaskAttemptImpl taskAttempt,
+      boolean fastFail) {
     if (taskAttempt.getLaunchTime() == 0) {
       sendJHStartEventForAssignedFailTask(taskAttempt);
     }
@@ -2419,8 +2439,8 @@ public abstract class TaskAttemptImpl implements
     taskAttempt.eventHandler.handle(new JobHistoryEvent(
         taskAttempt.attemptId.getTaskId().getJobId(), tauce));
 
-    taskAttempt.eventHandler.handle(new TaskTAttemptEvent(
-        taskAttempt.attemptId, TaskEventType.T_ATTEMPT_FAILED));
+    taskAttempt.eventHandler.handle(new TaskTAttemptFailedEvent(
+        taskAttempt.attemptId, fastFail));
 
   }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskImpl.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskImpl.java
index 086d4d5..ce3b3cc 100755
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskImpl.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/main/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TaskImpl.java
@@ -74,6 +74,7 @@ import org.apache.hadoop.mapreduce.v2.app.job.event.TaskEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskEventType;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskRecoverEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptEvent;
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptFailedEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptKilledEvent;
 import org.apache.hadoop.mapreduce.v2.app.metrics.MRAppMetrics;
 import org.apache.hadoop.mapreduce.v2.app.rm.ContainerFailedEvent;
@@ -1054,7 +1055,7 @@ public abstract class TaskImpl implements Task, EventHandler<TaskEvent> {
 
     @Override
     public TaskStateInternal transition(TaskImpl task, TaskEvent event) {
-      TaskTAttemptEvent castEvent = (TaskTAttemptEvent) event;
+      TaskTAttemptFailedEvent castEvent = (TaskTAttemptFailedEvent) event;
       TaskAttemptId taskAttemptId = castEvent.getTaskAttemptID();
       task.failedAttempts.add(taskAttemptId); 
       if (taskAttemptId.equals(task.commitAttempt)) {
@@ -1068,7 +1069,8 @@ public abstract class TaskImpl implements Task, EventHandler<TaskEvent> {
       }
       
       task.finishedAttempts.add(taskAttemptId);
-      if (task.failedAttempts.size() < task.maxAttempts) {
+      if (!castEvent.isFastFail()
+          && task.failedAttempts.size() < task.maxAttempts) {
         task.handleTaskAttemptCompletion(
             taskAttemptId, 
             TaskAttemptCompletionEventStatus.FAILED);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestFail.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestFail.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestFail.java
index 4d3f6f4..a2f0aba 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestFail.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestFail.java
@@ -23,6 +23,7 @@ import java.net.InetSocketAddress;
 import java.util.Iterator;
 import java.util.Map;
 
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptFailEvent;
 import org.junit.Assert;
 
 import org.apache.hadoop.conf.Configuration;
@@ -288,8 +289,7 @@ public class TestFail {
       if (attemptID.getTaskId().getId() == 0) {//check if it is first task
         // send the Fail event
         getContext().getEventHandler().handle(
-            new TaskAttemptEvent(attemptID, 
-                TaskAttemptEventType.TA_FAILMSG));
+            new TaskAttemptFailEvent(attemptID));
       } else {
         getContext().getEventHandler().handle(
             new TaskAttemptEvent(attemptID,
@@ -310,8 +310,7 @@ public class TestFail {
         //check if it is first task's first attempt
         // send the Fail event
         getContext().getEventHandler().handle(
-            new TaskAttemptEvent(attemptID, 
-                TaskAttemptEventType.TA_FAILMSG));
+            new TaskAttemptFailEvent(attemptID));
       } else {
         getContext().getEventHandler().handle(
             new TaskAttemptEvent(attemptID,

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestRecovery.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestRecovery.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestRecovery.java
index 893c4a0..b2807c1 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestRecovery.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/TestRecovery.java
@@ -38,6 +38,8 @@ import java.util.List;
 import java.util.Map;
 
 import java.util.concurrent.TimeoutException;
+
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptFailEvent;
 import org.junit.Assert;
 
 import org.apache.hadoop.conf.Configuration;
@@ -167,9 +169,8 @@ public class TestRecovery {
     /////////// Play some games with the TaskAttempts of the first task //////
     //send the fail signal to the 1st map task attempt
     app.getContext().getEventHandler().handle(
-        new TaskAttemptEvent(
-            task1Attempt1.getID(),
-            TaskAttemptEventType.TA_FAILMSG));
+        new TaskAttemptFailEvent(
+            task1Attempt1.getID()));
     
     app.waitForState(task1Attempt1, TaskAttemptState.FAILED);
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestJobImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestJobImpl.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestJobImpl.java
index 1827ce4..8592b20 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestJobImpl.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestJobImpl.java
@@ -81,7 +81,7 @@ import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptEventType;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskEventType;
-import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptEvent;
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptFailedEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.impl.JobImpl.InitTransition;
 import org.apache.hadoop.mapreduce.v2.app.metrics.MRAppMetrics;
 import org.apache.hadoop.mapreduce.v2.app.rm.RMHeartbeatHandler;
@@ -437,8 +437,7 @@ public class TestJobImpl {
       TaskImpl task = (TaskImpl) t;
       task.handle(new TaskEvent(task.getID(), TaskEventType.T_SCHEDULE));
       for(TaskAttempt ta: task.getAttempts().values()) {
-        task.handle(new TaskTAttemptEvent(ta.getID(),
-          TaskEventType.T_ATTEMPT_FAILED));
+        task.handle(new TaskTAttemptFailedEvent(ta.getID()));
       }
     }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskAttempt.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskAttempt.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskAttempt.java
index fe5d95d..43571a9 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskAttempt.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskAttempt.java
@@ -39,6 +39,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.concurrent.CopyOnWriteArrayList;
 
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptFailEvent;
 import org.junit.After;
 import org.junit.Assert;
 import org.junit.BeforeClass;
@@ -499,7 +500,7 @@ public class TestTaskAttempt{
           new TaskAttemptDiagnosticsUpdateEvent(attemptID,
               "Test Diagnostic Event"));
       getContext().getEventHandler().handle(
-          new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_FAILMSG));
+          new TaskAttemptFailEvent(attemptID));
     }
 
     protected EventHandler<JobHistoryEvent> createJobHistoryHandler(
@@ -1357,8 +1358,7 @@ public class TestTaskAttempt{
     MockEventHandler eventHandler = new MockEventHandler();
     TaskAttemptImpl taImpl = createTaskAttemptImpl(eventHandler);
 
-    taImpl.handle(new TaskAttemptEvent(taImpl.getID(),
-        TaskAttemptEventType.TA_FAILMSG));
+    taImpl.handle(new TaskAttemptFailEvent(taImpl.getID()));
 
     assertEquals("Task attempt is not in FAILED state", taImpl.getState(),
         TaskAttemptState.FAILED);
@@ -1484,8 +1484,7 @@ public class TestTaskAttempt{
     MockEventHandler eventHandler = new MockEventHandler();
     TaskAttemptImpl taImpl = createTaskAttemptImpl(eventHandler);
 
-    taImpl.handle(new TaskAttemptEvent(taImpl.getID(),
-        TaskAttemptEventType.TA_FAILMSG));
+    taImpl.handle(new TaskAttemptFailEvent(taImpl.getID()));
 
     assertEquals("Task attempt is not in RUNNING state", taImpl.getState(),
         TaskAttemptState.FAILED);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskImpl.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskImpl.java
index 62d4cc0..1225c43 100755
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskImpl.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-app/src/test/java/org/apache/hadoop/mapreduce/v2/app/job/impl/TestTaskImpl.java
@@ -53,6 +53,7 @@ import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptEventType;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskEventType;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptEvent;
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptFailedEvent;
 import org.apache.hadoop.mapreduce.v2.app.job.event.TaskTAttemptKilledEvent;
 import org.apache.hadoop.mapreduce.v2.app.metrics.MRAppMetrics;
 import org.apache.hadoop.security.Credentials;
@@ -345,8 +346,7 @@ public class TestTaskImpl {
   }
 
   private void failRunningTaskAttempt(TaskAttemptId attemptId) {
-    mockTask.handle(new TaskTAttemptEvent(attemptId, 
-        TaskEventType.T_ATTEMPT_FAILED));
+    mockTask.handle(new TaskTAttemptFailedEvent(attemptId));
     assertTaskRunningState();
   }
   
@@ -612,11 +612,16 @@ public class TestTaskImpl {
     
     // The task should now have succeeded
     assertTaskSucceededState();
-    
+
     // Now complete the first task attempt, after the second has succeeded
-    mockTask.handle(new TaskTAttemptEvent(taskAttempts.get(0).getAttemptId(), 
-        firstAttemptFinishEvent));
-    
+    if (firstAttemptFinishEvent.equals(TaskEventType.T_ATTEMPT_FAILED)) {
+      mockTask.handle(new TaskTAttemptFailedEvent(taskAttempts
+          .get(0).getAttemptId()));
+    } else {
+      mockTask.handle(new TaskTAttemptEvent(taskAttempts.get(0).getAttemptId(),
+          firstAttemptFinishEvent));
+    }
+
     // The task should still be in the succeeded state
     assertTaskSucceededState();
     
@@ -668,8 +673,8 @@ public class TestTaskImpl {
     assertEquals(2, taskAttempts.size());
 
     // speculative attempt retroactively fails from fetch failures
-    mockTask.handle(new TaskTAttemptEvent(taskAttempts.get(1).getAttemptId(),
-        TaskEventType.T_ATTEMPT_FAILED));
+    mockTask.handle(new TaskTAttemptFailedEvent(
+        taskAttempts.get(1).getAttemptId()));
 
     assertTaskScheduledState();
     assertEquals(3, taskAttempts.size());
@@ -683,8 +688,8 @@ public class TestTaskImpl {
     assertEquals(2, taskAttempts.size());
 
     // speculative attempt retroactively fails from fetch failures
-    mockTask.handle(new TaskTAttemptEvent(taskAttempts.get(1).getAttemptId(),
-        TaskEventType.T_ATTEMPT_FAILED));
+    mockTask.handle(new TaskTAttemptFailedEvent(
+        taskAttempts.get(1).getAttemptId()));
 
     assertTaskScheduledState();
     assertEquals(3, taskAttempts.size());
@@ -698,8 +703,8 @@ public class TestTaskImpl {
     assertEquals(2, taskAttempts.size());
 
     // speculative attempt retroactively fails from fetch failures
-    mockTask.handle(new TaskTAttemptEvent(taskAttempts.get(1).getAttemptId(),
-        TaskEventType.T_ATTEMPT_FAILED));
+    mockTask.handle(new TaskTAttemptFailedEvent(
+        taskAttempts.get(1).getAttemptId()));
 
     assertTaskScheduledState();
     assertEquals(3, taskAttempts.size());
@@ -734,8 +739,8 @@ public class TestTaskImpl {
     // have the first attempt fail, verify task failed due to no retries
     MockTaskAttemptImpl taskAttempt = taskAttempts.get(0);
     taskAttempt.setState(TaskAttemptState.FAILED);
-    mockTask.handle(new TaskTAttemptEvent(taskAttempt.getAttemptId(),
-        TaskEventType.T_ATTEMPT_FAILED));
+    mockTask.handle(new TaskTAttemptFailedEvent(
+        taskAttempt.getAttemptId()));
     assertEquals(TaskState.FAILED, mockTask.getState());
 
     // verify task can no longer be killed
@@ -757,8 +762,7 @@ public class TestTaskImpl {
         TaskEventType.T_ATTEMPT_COMMIT_PENDING));
     assertEquals(TaskState.FAILED, mockTask.getState());
     taskAttempt.setState(TaskAttemptState.FAILED);
-    mockTask.handle(new TaskTAttemptEvent(taskAttempt.getAttemptId(),
-        TaskEventType.T_ATTEMPT_FAILED));
+    mockTask.handle(new TaskTAttemptFailedEvent(taskAttempt.getAttemptId()));
     assertEquals(TaskState.FAILED, mockTask.getState());
     taskAttempt = taskAttempts.get(2);
     taskAttempt.setState(TaskAttemptState.SUCCEEDED);
@@ -808,8 +812,7 @@ public class TestTaskImpl {
     // max attempts is 4
     MockTaskAttemptImpl taskAttempt = taskAttempts.get(0);
     taskAttempt.setState(TaskAttemptState.FAILED);
-    mockTask.handle(new TaskTAttemptEvent(taskAttempt.getAttemptId(),
-        TaskEventType.T_ATTEMPT_FAILED));
+    mockTask.handle(new TaskTAttemptFailedEvent(taskAttempt.getAttemptId()));
     assertEquals(TaskState.RUNNING, mockTask.getState());
 
     // verify a new attempt(#3) added because the speculative attempt(#2)
@@ -829,8 +832,7 @@ public class TestTaskImpl {
     // hasn't reach the max attempts which is 4
     MockTaskAttemptImpl taskAttempt1 = taskAttempts.get(1);
     taskAttempt1.setState(TaskAttemptState.FAILED);
-    mockTask.handle(new TaskTAttemptEvent(taskAttempt1.getAttemptId(),
-        TaskEventType.T_ATTEMPT_FAILED));
+    mockTask.handle(new TaskTAttemptFailedEvent(taskAttempt1.getAttemptId()));
     assertEquals(TaskState.RUNNING, mockTask.getState());
 
     // verify there's no new attempt added because of the running attempt(#3)

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-common/src/main/java/org/apache/hadoop/mapred/LocalJobRunner.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-common/src/main/java/org/apache/hadoop/mapred/LocalJobRunner.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-common/src/main/java/org/apache/hadoop/mapred/LocalJobRunner.java
index c9dff6a..5e7a250 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-common/src/main/java/org/apache/hadoop/mapred/LocalJobRunner.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-common/src/main/java/org/apache/hadoop/mapred/LocalJobRunner.java
@@ -729,9 +729,9 @@ public class LocalJobRunner implements ClientProtocol {
       LOG.error("shuffleError: "+ message + "from task: " + taskId);
     }
     
-    public synchronized void fatalError(TaskAttemptID taskId, String msg) 
+    public synchronized void fatalError(TaskAttemptID taskId, String msg, boolean fastFail)
     throws IOException {
-      LOG.error("Fatal: "+ msg + "from task: " + taskId);
+      LOG.error("Fatal: "+ msg + " from task: " + taskId + " fast fail: " + fastFail);
     }
     
     @Override

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/MapTask.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/MapTask.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/MapTask.java
index 27c8976..ab7cba5 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/MapTask.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/MapTask.java
@@ -1568,7 +1568,8 @@ public class MapTask extends Task {
         if (lspillException instanceof Error) {
           final String logMsg = "Task " + getTaskID() + " failed : " +
             StringUtils.stringifyException(lspillException);
-          mapTask.reportFatalError(getTaskID(), lspillException, logMsg);
+          mapTask.reportFatalError(getTaskID(), lspillException, logMsg,
+              false);
         }
         throw new IOException("Spill failed", lspillException);
       }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java
index 730f4ee..87c9e16 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/Task.java
@@ -40,6 +40,7 @@ import org.apache.hadoop.classification.InterfaceStability;
 import org.apache.hadoop.conf.Configurable;
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.fs.FileSystem;
+import org.apache.hadoop.fs.FileUtil;
 import org.apache.hadoop.fs.LocalDirAllocator;
 import org.apache.hadoop.fs.LocalFileSystem;
 import org.apache.hadoop.fs.Path;
@@ -354,7 +355,7 @@ abstract public class Task implements Writable, Configurable {
    * Report a fatal error to the parent (task) tracker.
    */
   protected void reportFatalError(TaskAttemptID id, Throwable throwable, 
-                                  String logMsg) {
+                                  String logMsg, boolean fastFail) {
     LOG.error(logMsg);
     
     if (ShutdownHookManager.get().isShutdownInProgress()) {
@@ -366,7 +367,7 @@ abstract public class Task implements Writable, Configurable {
                    ? StringUtils.stringifyException(throwable)
                    : StringUtils.stringifyException(tCause);
     try {
-      umbilical.fatalError(id, cause);
+      umbilical.fatalError(id, cause, fastFail);
     } catch (IOException ioe) {
       LOG.error("Failed to contact the tasktracker", ioe);
       System.exit(-1);
@@ -652,6 +653,8 @@ abstract public class Task implements Writable, Configurable {
     private Thread pingThread = null;
     private boolean done = true;
     private Object lock = new Object();
+    private volatile String diskLimitCheckStatus = null;
+    private Thread diskLimitCheckThread = null;
 
     /**
      * flag that indicates whether progress update needs to be sent to parent.
@@ -749,6 +752,65 @@ abstract public class Task implements Writable, Configurable {
     }
 
     /**
+     * disk limit checker, runs in separate thread when activated.
+     */
+    public class DiskLimitCheck implements Runnable {
+      private LocalFileSystem localFS;
+      private long fsLimit;
+      private long checkInterval;
+      private String[] localDirs;
+      private boolean killOnLimitExceeded;
+
+      public DiskLimitCheck(JobConf conf) throws IOException {
+        this.localFS = FileSystem.getLocal(conf);
+        this.fsLimit = conf.getLong(MRJobConfig.JOB_SINGLE_DISK_LIMIT_BYTES,
+            MRJobConfig.DEFAULT_JOB_SINGLE_DISK_LIMIT_BYTES);
+        this.localDirs = conf.getLocalDirs();
+        this.checkInterval = conf.getLong(
+            MRJobConfig.JOB_SINGLE_DISK_LIMIT_CHECK_INTERVAL_MS,
+            MRJobConfig.DEFAULT_JOB_SINGLE_DISK_LIMIT_CHECK_INTERVAL_MS);
+        this.killOnLimitExceeded = conf.getBoolean(
+            MRJobConfig.JOB_SINGLE_DISK_LIMIT_KILL_LIMIT_EXCEED,
+            MRJobConfig.DEFAULT_JOB_SINGLE_DISK_LIMIT_KILL_LIMIT_EXCEED);
+      }
+
+      @Override
+      public void run() {
+        while (!taskDone.get()) {
+          try {
+            long localWritesSize = 0L;
+            String largestWorkDir = null;
+            for (String local : localDirs) {
+              long size = FileUtil.getDU(localFS.pathToFile(new Path(local)));
+              if (localWritesSize < size) {
+                localWritesSize = size;
+                largestWorkDir = local;
+              }
+            }
+            if (localWritesSize > fsLimit) {
+              String localStatus =
+                  "too much data in local scratch dir="
+                      + largestWorkDir
+                      + ". current size is "
+                      + localWritesSize
+                      + " the limit is " + fsLimit;
+              if (killOnLimitExceeded) {
+                LOG.error(localStatus);
+                diskLimitCheckStatus = localStatus;
+              } else {
+                LOG.warn(localStatus);
+              }
+              break;
+            }
+            Thread.sleep(checkInterval);
+          } catch (Exception e) {
+            LOG.error(e.getMessage(), e);
+          }
+        }
+      }
+    }
+
+    /**
      * check the counters to see whether the task has exceeded any configured
      * limits.
      * @throws TaskLimitException
@@ -773,6 +835,9 @@ abstract public class Task implements Writable, Configurable {
                   " the limit is " + limit);
         }
       }
+      if (diskLimitCheckStatus != null) {
+        throw new TaskLimitException(diskLimitCheckStatus);
+      }
     }
 
     /**
@@ -851,7 +916,7 @@ abstract public class Task implements Writable, Configurable {
                   StringUtils.stringifyException(e);
           LOG.error(errMsg);
           try {
-            umbilical.fatalError(taskId, errMsg);
+            umbilical.fatalError(taskId, errMsg, true);
           } catch (IOException ioe) {
             LOG.error("Failed to update failure diagnosis", ioe);
           }
@@ -884,6 +949,22 @@ abstract public class Task implements Writable, Configurable {
         pingThread.setDaemon(true);
         pingThread.start();
       }
+      startDiskLimitCheckerThreadIfNeeded();
+    }
+    public void startDiskLimitCheckerThreadIfNeeded() {
+      if (diskLimitCheckThread == null && conf.getLong(
+          MRJobConfig.JOB_SINGLE_DISK_LIMIT_BYTES,
+          MRJobConfig.DEFAULT_JOB_SINGLE_DISK_LIMIT_BYTES) >= 0) {
+        try {
+          diskLimitCheckThread = new Thread(new DiskLimitCheck(conf),
+              "disk limit check thread");
+          diskLimitCheckThread.setDaemon(true);
+          diskLimitCheckThread.start();
+        } catch (IOException e) {
+          LOG.error("Issues starting disk monitor thread: "
+              + e.getMessage(), e);
+        }
+      }
     }
     public void stopCommunicationThread() throws InterruptedException {
       if (pingThread != null) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/TaskUmbilicalProtocol.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/TaskUmbilicalProtocol.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/TaskUmbilicalProtocol.java
index c3678d6..041ab39 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/TaskUmbilicalProtocol.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapred/TaskUmbilicalProtocol.java
@@ -68,9 +68,10 @@ public interface TaskUmbilicalProtocol extends VersionedProtocol {
    * Version 18 Added numRequiredSlots to TaskStatus for MAPREDUCE-516
    * Version 19 Added fatalError for child to communicate fatal errors to TT
    * Version 20 Added methods to manage checkpoints
+   * Version 21 Added fastFail parameter to fatalError
    * */
 
-  public static final long versionID = 20L;
+  public static final long versionID = 21L;
   
   /**
    * Called when a child task process starts, to get its task.
@@ -140,8 +141,13 @@ public interface TaskUmbilicalProtocol extends VersionedProtocol {
   /** Report that the task encounted a local filesystem error.*/
   void fsError(TaskAttemptID taskId, String message) throws IOException;
 
-  /** Report that the task encounted a fatal error.*/
-  void fatalError(TaskAttemptID taskId, String message) throws IOException;
+  /**
+   * Report that the task encounted a fatal error.
+   * @param taskId task's id
+   * @param message fail message
+   * @param fastFail flag to enable fast fail for task
+   */
+  void fatalError(TaskAttemptID taskId, String message, boolean fastFail) throws IOException;
   
   /** Called by a reduce task to get the map output locations for finished maps.
    * Returns an update centered around the map-task-completion-events. 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapreduce/MRJobConfig.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapreduce/MRJobConfig.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapreduce/MRJobConfig.java
index 6acf1bc..ca18bfe 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapreduce/MRJobConfig.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/java/org/apache/hadoop/mapreduce/MRJobConfig.java
@@ -52,6 +52,20 @@ public interface MRJobConfig {
 
   public static final String TASK_CLEANUP_NEEDED = "mapreduce.job.committer.task.cleanup.needed";
 
+  public static final String JOB_SINGLE_DISK_LIMIT_BYTES =
+          "mapreduce.job.local-fs.single-disk-limit.bytes";
+  // negative values disable the limit
+  public static final long DEFAULT_JOB_SINGLE_DISK_LIMIT_BYTES = -1;
+
+  public static final String JOB_SINGLE_DISK_LIMIT_KILL_LIMIT_EXCEED =
+      "mapreduce.job.local-fs.single-disk-limit.check.kill-limit-exceed";
+  // setting to false only logs the kill
+  public static final boolean DEFAULT_JOB_SINGLE_DISK_LIMIT_KILL_LIMIT_EXCEED = true;
+
+  public static final String JOB_SINGLE_DISK_LIMIT_CHECK_INTERVAL_MS =
+      "mapreduce.job.local-fs.single-disk-limit.check.interval-ms";
+  public static final long DEFAULT_JOB_SINGLE_DISK_LIMIT_CHECK_INTERVAL_MS = 5000;
+
   public static final String TASK_LOCAL_WRITE_LIMIT_BYTES =
           "mapreduce.task.local-fs.write-limit.bytes";
   // negative values disable the limit

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/resources/mapred-default.xml
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/resources/mapred-default.xml b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/resources/mapred-default.xml
index 62f3dfa..72f509c 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/resources/mapred-default.xml
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/main/resources/mapred-default.xml
@@ -63,6 +63,28 @@
 </property>
 
 <property>
+  <name>mapreduce.job.local-fs.single-disk-limit.bytes</name>
+  <value>-1</value>
+  <description>Enable an in task monitor thread to watch for single disk
+    consumption by jobs. By setting this to x nr of bytes, the task will fast
+    fail in case it is reached. This is a per disk configuration.</description>
+</property>
+
+<property>
+  <name>mapreduce.job.local-fs.single-disk-limit.check.interval-ms</name>
+  <value>5000</value>
+  <description>Interval of disk limit check to run in ms.</description>
+</property>
+
+<property>
+  <name>mapreduce.job.local-fs.single-disk-limit.check.kill-limit-exceed</name>
+  <value>true</value>
+  <description>If mapreduce.job.local-fs.single-disk-limit.bytes is triggered
+    should the task be killed or logged. If false the intent to kill the task
+    is only logged in the container logs.</description>
+</property>
+
+<property>
   <name>mapreduce.job.maps</name>
   <value>2</value>
   <description>The default number of map tasks per job.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/test/java/org/apache/hadoop/mapred/TestTaskProgressReporter.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/test/java/org/apache/hadoop/mapred/TestTaskProgressReporter.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/test/java/org/apache/hadoop/mapred/TestTaskProgressReporter.java
index 18442d6..e5ff64e 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/test/java/org/apache/hadoop/mapred/TestTaskProgressReporter.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-core/src/test/java/org/apache/hadoop/mapred/TestTaskProgressReporter.java
@@ -18,15 +18,19 @@
 
 package org.apache.hadoop.mapred;
 
+import java.io.File;
 import java.io.IOException;
 import java.util.Random;
 
+import org.apache.commons.io.FileUtils;
 import org.apache.hadoop.fs.FSDataOutputStream;
 import org.apache.hadoop.fs.FileSystem;
+import org.apache.hadoop.fs.FileUtil;
 import org.apache.hadoop.fs.LocalFileSystem;
 import org.apache.hadoop.fs.Path;
 import org.apache.hadoop.ipc.ProtocolSignature;
 import org.apache.hadoop.mapred.SortedRanges.Range;
+import org.apache.hadoop.mapreduce.MRConfig;
 import org.apache.hadoop.mapreduce.MRJobConfig;
 import org.apache.hadoop.mapreduce.checkpoint.TaskCheckpointID;
 import org.apache.hadoop.util.ExitUtil;
@@ -43,6 +47,11 @@ public class TestTaskProgressReporter {
 
   private FakeUmbilical fakeUmbilical = new FakeUmbilical();
 
+  private static final String TEST_DIR =
+      System.getProperty("test.build.data",
+          System.getProperty("java.io.tmpdir")) + "/" +
+      TestTaskProgressReporter.class.getName();
+
   private static class DummyTask extends Task {
     @Override
     public void run(JobConf job, TaskUmbilicalProtocol umbilical)
@@ -53,6 +62,11 @@ public class TestTaskProgressReporter {
     public boolean isMapTask() {
       return true;
     }
+
+    @Override
+    public boolean isCommitRequired() {
+      return false;
+    }
   }
 
   private static class FakeUmbilical implements TaskUmbilicalProtocol {
@@ -118,7 +132,7 @@ public class TestTaskProgressReporter {
     }
 
     @Override
-    public void fatalError(TaskAttemptID taskId, String message)
+    public void fatalError(TaskAttemptID taskId, String message, boolean fastFail)
         throws IOException {
     }
 
@@ -163,6 +177,78 @@ public class TestTaskProgressReporter {
     }
   }
 
+  @Test(timeout=60000)
+  public void testScratchDirSize() throws Exception {
+    String tmpPath = TEST_DIR + "/testBytesWrittenLimit-tmpFile-"
+        + new Random(System.currentTimeMillis()).nextInt();
+    File data = new File(tmpPath + "/out");
+    File testDir = new File(tmpPath);
+    testDir.mkdirs();
+    testDir.deleteOnExit();
+    JobConf conf = new JobConf();
+    conf.setStrings(MRConfig.LOCAL_DIR, "file://" + tmpPath);
+    conf.setLong(MRJobConfig.JOB_SINGLE_DISK_LIMIT_BYTES, 1024L);
+    conf.setBoolean(MRJobConfig.JOB_SINGLE_DISK_LIMIT_KILL_LIMIT_EXCEED,
+        true);
+    getBaseConfAndWriteToFile(-1, data);
+    testScratchDirLimit(false, conf);
+    data.delete();
+    getBaseConfAndWriteToFile(100, data);
+    testScratchDirLimit(false, conf);
+    data.delete();
+    getBaseConfAndWriteToFile(1536, data);
+    testScratchDirLimit(true, conf);
+    conf.setBoolean(MRJobConfig.JOB_SINGLE_DISK_LIMIT_KILL_LIMIT_EXCEED,
+        false);
+    testScratchDirLimit(false, conf);
+    conf.setBoolean(MRJobConfig.JOB_SINGLE_DISK_LIMIT_KILL_LIMIT_EXCEED,
+        true);
+    conf.setLong(MRJobConfig.JOB_SINGLE_DISK_LIMIT_BYTES, -1L);
+    testScratchDirLimit(false, conf);
+    data.delete();
+    FileUtil.fullyDelete(testDir);
+  }
+
+  private void getBaseConfAndWriteToFile(int size, File data)
+      throws IOException {
+    if (size > 0) {
+      byte[] b = new byte[size];
+      for (int i = 0; i < size; i++) {
+        b[i] = 1;
+      }
+      FileUtils.writeByteArrayToFile(data, b);
+    }
+  }
+
+  public void testScratchDirLimit(boolean fastFail, JobConf conf)
+          throws Exception {
+    ExitUtil.disableSystemExit();
+    threadExited = false;
+    Thread.UncaughtExceptionHandler h = new Thread.UncaughtExceptionHandler() {
+      public void uncaughtException(Thread th, Throwable ex) {
+        if (ex instanceof ExitUtil.ExitException) {
+          threadExited = true;
+          th.interrupt();
+        }
+      }
+    };
+    Task task = new DummyTask();
+    task.setConf(conf);
+    DummyTaskReporter reporter = new DummyTaskReporter(task);
+    reporter.startDiskLimitCheckerThreadIfNeeded();
+    Thread t = new Thread(reporter);
+    t.setUncaughtExceptionHandler(h);
+    reporter.setProgressFlag();
+    t.start();
+    while (!reporter.taskLimitIsChecked) {
+      Thread.yield();
+    }
+    task.done(fakeUmbilical, reporter);
+    reporter.resetDoneFlag();
+    t.join(1000L);
+    Assert.assertEquals(fastFail, threadExited);
+  }
+
   @Test (timeout=10000)
   public void testTaskProgress() throws Exception {
     JobConf job = new JobConf();
@@ -214,7 +300,7 @@ public class TestTaskProgressReporter {
     conf.getLong(MRJobConfig.TASK_PROGRESS_REPORT_INTERVAL, 0);
     conf.setLong(MRJobConfig.TASK_LOCAL_WRITE_LIMIT_BYTES, limit);
     LocalFileSystem localFS = FileSystem.getLocal(conf);
-    Path tmpPath = new Path("/tmp/testBytesWrittenLimit-tmpFile-"
+    Path tmpPath = new Path(TEST_DIR + "/testBytesWrittenLimit-tmpFile-"
             + new Random(System.currentTimeMillis()).nextInt());
     FSDataOutputStream out = localFS.create(tmpPath, true);
     out.write(new byte[LOCAL_BYTES_WRITTEN]);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-hs/src/test/java/org/apache/hadoop/mapreduce/v2/hs/TestJobHistoryParsing.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-hs/src/test/java/org/apache/hadoop/mapreduce/v2/hs/TestJobHistoryParsing.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-hs/src/test/java/org/apache/hadoop/mapreduce/v2/hs/TestJobHistoryParsing.java
index 83e35fe..7b70f98 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-hs/src/test/java/org/apache/hadoop/mapreduce/v2/hs/TestJobHistoryParsing.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-hs/src/test/java/org/apache/hadoop/mapreduce/v2/hs/TestJobHistoryParsing.java
@@ -36,6 +36,7 @@ import java.util.Map;
 import java.util.StringTokenizer;
 import java.util.concurrent.atomic.AtomicInteger;
 
+import org.apache.hadoop.mapreduce.v2.app.job.event.TaskAttemptFailEvent;
 import org.junit.Assert;
 
 import org.apache.hadoop.conf.Configuration;
@@ -712,7 +713,7 @@ public class TestJobHistoryParsing {
     protected void attemptLaunched(TaskAttemptId attemptID) {
       if (attemptID.getTaskId().getId() == 0 && attemptID.getId() == 0) {
         getContext().getEventHandler().handle(
-            new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_FAILMSG));
+            new TaskAttemptFailEvent(attemptID));
       } else {
         getContext().getEventHandler().handle(
             new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_DONE));
@@ -732,7 +733,7 @@ public class TestJobHistoryParsing {
     protected void attemptLaunched(TaskAttemptId attemptID) {
       if (attemptID.getTaskId().getId() == 0) {
         getContext().getEventHandler().handle(
-            new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_FAILMSG));
+            new TaskAttemptFailEvent(attemptID));
       } else {
         getContext().getEventHandler().handle(
             new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_DONE));
@@ -760,10 +761,10 @@ public class TestJobHistoryParsing {
             new TaskEvent(attemptID.getTaskId(), TaskEventType.T_KILL));
       } else if (taskType == TaskType.MAP && taskId == 1) {
         getContext().getEventHandler().handle(
-            new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_FAILMSG));
+            new TaskAttemptFailEvent(attemptID));
       } else if (taskType == TaskType.REDUCE && taskId == 0) {
         getContext().getEventHandler().handle(
-            new TaskAttemptEvent(attemptID, TaskAttemptEventType.TA_FAILMSG));
+            new TaskAttemptFailEvent(attemptID));
       } else if (taskType == TaskType.REDUCE && taskId == 1) {
         getContext().getEventHandler().handle(
             new TaskEvent(attemptID.getTaskId(), TaskEventType.T_KILL));

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestMapProgress.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestMapProgress.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestMapProgress.java
index f364c18..9b6ebda 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestMapProgress.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestMapProgress.java
@@ -91,8 +91,8 @@ public class TestMapProgress {
       LOG.info("Task " + taskId + " reporting shuffle error: " + message);
     }
 
-    public void fatalError(TaskAttemptID taskId, String msg) throws IOException {
-      LOG.info("Task " + taskId + " reporting fatal error: " + msg);
+    public void fatalError(TaskAttemptID taskId, String msg, boolean fastFail) throws IOException {
+      LOG.info("Task " + taskId + " reporting fatal error: " + msg + " fast fail: " + fastFail);
     }
 
     public JvmTask getTask(JvmContext context) throws IOException {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/a37e7f0a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestTaskCommit.java
----------------------------------------------------------------------
diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestTaskCommit.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestTaskCommit.java
index bed545e..a534cfa 100644
--- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestTaskCommit.java
+++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-jobclient/src/test/java/org/apache/hadoop/mapred/TestTaskCommit.java
@@ -124,7 +124,7 @@ public class TestTaskCommit extends HadoopTestCase {
     }
 
     @Override
-    public void fatalError(TaskAttemptID taskId, String message)
+    public void fatalError(TaskAttemptID taskId, String message, boolean fastFail)
         throws IOException { }
 
     @Override


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[29/50] [abbrv] hadoop git commit: YARN-7522. Introduce AllocationTagsManager to associate allocation tags to nodes. (Wangda Tan via asuresh)

Posted by as...@apache.org.
YARN-7522. Introduce AllocationTagsManager to associate allocation tags to nodes. (Wangda Tan via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/2615da83
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/2615da83
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/2615da83

Branch: refs/heads/YARN-6592
Commit: 2615da8345b16b63350e687ad543f99933078f2d
Parents: 10494c4
Author: Arun Suresh <as...@apache.org>
Authored: Fri Dec 8 00:24:00 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../resourcemanager/RMActiveServiceContext.java |  15 +
 .../yarn/server/resourcemanager/RMContext.java  |   5 +
 .../server/resourcemanager/RMContextImpl.java   |  12 +
 .../server/resourcemanager/ResourceManager.java |   9 +
 .../constraint/AllocationTagsManager.java       | 431 +++++++++++++++++++
 .../constraint/AllocationTagsNamespaces.java    |  31 ++
 .../InvalidAllocationTagsQueryException.java    |  35 ++
 .../rmcontainer/RMContainer.java                |   8 +
 .../rmcontainer/RMContainerImpl.java            |  21 +
 .../constraint/TestAllocationTagsManager.java   | 328 ++++++++++++++
 .../rmcontainer/TestRMContainerImpl.java        | 124 ++++++
 .../scheduler/capacity/TestUtils.java           |   9 +
 .../scheduler/fifo/TestFifoScheduler.java       |   5 +
 13 files changed, 1033 insertions(+)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
index 9dc5945..6ee3a4c 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
@@ -33,6 +33,7 @@ import org.apache.hadoop.yarn.event.Dispatcher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMDelegatedNodeLabelsUpdater;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.placement.PlacementManager;
+import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.NullRMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.reservation.ReservationSystem;
@@ -107,6 +108,7 @@ public class RMActiveServiceContext {
 
   private RMAppLifetimeMonitor rmAppLifetimeMonitor;
   private QueueLimitCalculator queueLimitCalculator;
+  private AllocationTagsManager allocationTagsManager;
 
   public RMActiveServiceContext() {
     queuePlacementManager = new PlacementManager();
@@ -398,6 +400,19 @@ public class RMActiveServiceContext {
 
   @Private
   @Unstable
+  public AllocationTagsManager getAllocationTagsManager() {
+    return allocationTagsManager;
+  }
+
+  @Private
+  @Unstable
+  public void setAllocationTagsManager(
+      AllocationTagsManager allocationTagsManager) {
+    this.allocationTagsManager = allocationTagsManager;
+  }
+
+  @Private
+  @Unstable
   public RMDelegatedNodeLabelsUpdater getRMDelegatedNodeLabelsUpdater() {
     return rmDelegatedNodeLabelsUpdater;
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
index ec94030..62899d9 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
@@ -32,6 +32,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWri
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMDelegatedNodeLabelsUpdater;
+import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.placement.PlacementManager;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.reservation.ReservationSystem;
@@ -166,4 +167,8 @@ public interface RMContext extends ApplicationMasterServiceContext {
   void setResourceProfilesManager(ResourceProfilesManager mgr);
 
   String getAppProxyUrl(Configuration conf, ApplicationId applicationId);
+
+  AllocationTagsManager getAllocationTagsManager();
+
+  void setAllocationTagsManager(AllocationTagsManager allocationTagsManager);
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
index 80a9109..315fdc1 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
@@ -38,6 +38,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWri
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMDelegatedNodeLabelsUpdater;
+import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.placement.PlacementManager;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.reservation.ReservationSystem;
@@ -504,6 +505,17 @@ public class RMContextImpl implements RMContext {
   }
 
   @Override
+  public AllocationTagsManager getAllocationTagsManager() {
+    return activeServiceContext.getAllocationTagsManager();
+  }
+
+  @Override
+  public void setAllocationTagsManager(
+      AllocationTagsManager allocationTagsManager) {
+    activeServiceContext.setAllocationTagsManager(allocationTagsManager);
+  }
+
+  @Override
   public RMDelegatedNodeLabelsUpdater getRMDelegatedNodeLabelsUpdater() {
     return activeServiceContext.getRMDelegatedNodeLabelsUpdater();
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
index 32c4b0a..da0feda 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
@@ -73,6 +73,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.metrics.TimelineServiceV2Pu
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.CombinedSystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMDelegatedNodeLabelsUpdater;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.NullRMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.RMStateStore.RMState;
@@ -493,6 +494,10 @@ public class ResourceManager extends CompositeService implements Recoverable {
       throws InstantiationException, IllegalAccessException {
     return new RMNodeLabelsManager();
   }
+
+  protected AllocationTagsManager createAllocationTagsManager() {
+    return new AllocationTagsManager();
+  }
   
   protected DelegationTokenRenewer createDelegationTokenRenewer() {
     return new DelegationTokenRenewer();
@@ -619,6 +624,10 @@ public class ResourceManager extends CompositeService implements Recoverable {
       addService(nlm);
       rmContext.setNodeLabelManager(nlm);
 
+      AllocationTagsManager allocationTagsManager =
+          createAllocationTagsManager();
+      rmContext.setAllocationTagsManager(allocationTagsManager);
+
       RMDelegatedNodeLabelsUpdater delegatedNodeLabelsUpdater =
           createRMDelegatedNodeLabelsUpdater();
       if (delegatedNodeLabelsUpdater != null) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsManager.java
new file mode 100644
index 0000000..b67fab9
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsManager.java
@@ -0,0 +1,431 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.constraint;
+
+import com.google.common.annotations.VisibleForTesting;
+import org.apache.commons.lang.StringUtils;
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.ContainerId;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.log4j.Logger;
+
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.Map;
+import java.util.Set;
+import java.util.concurrent.locks.ReentrantReadWriteLock;
+import java.util.function.LongBinaryOperator;
+
+/**
+ * Support storing maps between container-tags/applications and
+ * nodes. This will be required by affinity/anti-affinity implementation and
+ * cardinality.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+public class AllocationTagsManager {
+
+  private static final Logger LOG = Logger.getLogger(
+      AllocationTagsManager.class);
+
+  private ReentrantReadWriteLock.ReadLock readLock;
+  private ReentrantReadWriteLock.WriteLock writeLock;
+
+  // Application's tags to node
+  private Map<ApplicationId, NodeToCountedTags> perAppMappings =
+      new HashMap<>();
+
+  // Global tags to node mapping (used to fast return aggregated tags
+  // cardinality across apps)
+  private NodeToCountedTags globalMapping = new NodeToCountedTags();
+
+  /**
+   * Store node to counted tags.
+   */
+  @VisibleForTesting
+  static class NodeToCountedTags {
+    // Map<NodeId, Map<Tag, Count>>
+    private Map<NodeId, Map<String, Long>> nodeToTagsWithCount =
+        new HashMap<>();
+
+    // protected by external locks
+    private void addTagsToNode(NodeId nodeId, Set<String> tags) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.computeIfAbsent(nodeId,
+          k -> new HashMap<>());
+
+      for (String tag : tags) {
+        Long count = innerMap.get(tag);
+        if (count == null) {
+          innerMap.put(tag, 1L);
+        } else{
+          innerMap.put(tag, count + 1);
+        }
+      }
+    }
+
+    // protected by external locks
+    private void addTagToNode(NodeId nodeId, String tag) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.computeIfAbsent(nodeId,
+          k -> new HashMap<>());
+
+      Long count = innerMap.get(tag);
+      if (count == null) {
+        innerMap.put(tag, 1L);
+      } else{
+        innerMap.put(tag, count + 1);
+      }
+    }
+
+    private void removeTagFromInnerMap(Map<String, Long> innerMap, String tag) {
+      Long count = innerMap.get(tag);
+      if (count > 1) {
+        innerMap.put(tag, count - 1);
+      } else {
+        if (count <= 0) {
+          LOG.warn(
+              "Trying to remove tags from node, however the count already"
+                  + " becomes 0 or less, it could be a potential bug.");
+        }
+        innerMap.remove(tag);
+      }
+    }
+
+    private void removeTagsFromNode(NodeId nodeId, Set<String> tags) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      if (innerMap == null) {
+        LOG.warn("Failed to find node=" + nodeId
+            + " while trying to remove tags, please double check.");
+        return;
+      }
+
+      for (String tag : tags) {
+        removeTagFromInnerMap(innerMap, tag);
+      }
+
+      if (innerMap.isEmpty()) {
+        nodeToTagsWithCount.remove(nodeId);
+      }
+    }
+
+    private void removeTagFromNode(NodeId nodeId, String tag) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      if (innerMap == null) {
+        LOG.warn("Failed to find node=" + nodeId
+            + " while trying to remove tags, please double check.");
+        return;
+      }
+
+      removeTagFromInnerMap(innerMap, tag);
+
+      if (innerMap.isEmpty()) {
+        nodeToTagsWithCount.remove(nodeId);
+      }
+    }
+
+    private long getCardinality(NodeId nodeId, String tag) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      if (innerMap == null) {
+        return 0;
+      }
+      Long value = innerMap.get(tag);
+      return value == null ? 0 : value;
+    }
+
+    private long getCardinality(NodeId nodeId, Set<String> tags,
+        LongBinaryOperator op) {
+      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      if (innerMap == null) {
+        return 0;
+      }
+
+      long returnValue = 0;
+      boolean firstTag = true;
+
+      if (tags != null && !tags.isEmpty()) {
+        for (String tag : tags) {
+          Long value = innerMap.get(tag);
+          if (value == null) {
+            value = 0L;
+          }
+
+          if (firstTag) {
+            returnValue = value;
+            firstTag = false;
+            continue;
+          }
+
+          returnValue = op.applyAsLong(returnValue, value);
+        }
+      } else {
+        // Similar to above if, but only iterate values for better performance
+        for (long value : innerMap.values()) {
+          // For the first value, we will not apply op
+          if (firstTag) {
+            returnValue = value;
+            firstTag = false;
+            continue;
+          }
+          returnValue = op.applyAsLong(returnValue, value);
+        }
+      }
+      return returnValue;
+    }
+
+    private boolean isEmpty() {
+      return nodeToTagsWithCount.isEmpty();
+    }
+
+    @VisibleForTesting
+    public Map<NodeId, Map<String, Long>> getNodeToTagsWithCount() {
+      return nodeToTagsWithCount;
+    }
+  }
+
+  @VisibleForTesting
+  Map<ApplicationId, NodeToCountedTags> getPerAppMappings() {
+    return perAppMappings;
+  }
+
+  @VisibleForTesting
+  NodeToCountedTags getGlobalMapping() {
+    return globalMapping;
+  }
+
+  public AllocationTagsManager() {
+    ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
+    readLock = lock.readLock();
+    writeLock = lock.writeLock();
+  }
+
+  /**
+   * Notify container allocated on a node.
+   *
+   * @param nodeId         allocated node.
+   * @param applicationId  applicationId
+   * @param containerId    container id.
+   * @param allocationTags allocation tags, see
+   *                       {@link SchedulingRequest#getAllocationTags()}
+   *                       application_id will be added to allocationTags.
+   */
+  public void addContainer(NodeId nodeId, ApplicationId applicationId,
+      ContainerId containerId, Set<String> allocationTags) {
+    String applicationIdTag =
+        AllocationTagsNamespaces.APP_ID + applicationId.toString();
+
+    boolean useSet = false;
+    if (allocationTags != null && !allocationTags.isEmpty()) {
+      // Copy before edit it.
+      allocationTags = new HashSet<>(allocationTags);
+      allocationTags.add(applicationIdTag);
+      useSet = true;
+    }
+
+    writeLock.lock();
+    try {
+      NodeToCountedTags perAppTagsMapping = perAppMappings.computeIfAbsent(
+          applicationId, k -> new NodeToCountedTags());
+
+      if (useSet) {
+        perAppTagsMapping.addTagsToNode(nodeId, allocationTags);
+        globalMapping.addTagsToNode(nodeId, allocationTags);
+      } else {
+        perAppTagsMapping.addTagToNode(nodeId, applicationIdTag);
+        globalMapping.addTagToNode(nodeId, applicationIdTag);
+      }
+
+      if (LOG.isDebugEnabled()) {
+        LOG.debug(
+            "Added container=" + containerId + " with tags=[" + StringUtils
+                .join(allocationTags, ",") + "]");
+      }
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  /**
+   * Notify container removed.
+   *
+   * @param nodeId         nodeId
+   * @param applicationId  applicationId
+   * @param containerId    containerId.
+   * @param allocationTags allocation tags for given container
+   */
+  public void removeContainer(NodeId nodeId, ApplicationId applicationId,
+      ContainerId containerId, Set<String> allocationTags) {
+    String applicationIdTag =
+        AllocationTagsNamespaces.APP_ID + applicationId.toString();
+    boolean useSet = false;
+
+    if (allocationTags != null && !allocationTags.isEmpty()) {
+      // Copy before edit it.
+      allocationTags = new HashSet<>(allocationTags);
+      allocationTags.add(applicationIdTag);
+      useSet = true;
+    }
+
+    writeLock.lock();
+    try {
+      NodeToCountedTags perAppTagsMapping = perAppMappings.get(applicationId);
+      if (perAppTagsMapping == null) {
+        return;
+      }
+
+      if (useSet) {
+        perAppTagsMapping.removeTagsFromNode(nodeId, allocationTags);
+        globalMapping.removeTagsFromNode(nodeId, allocationTags);
+      } else {
+        perAppTagsMapping.removeTagFromNode(nodeId, applicationIdTag);
+        globalMapping.removeTagFromNode(nodeId, applicationIdTag);
+      }
+
+      if (perAppTagsMapping.isEmpty()) {
+        perAppMappings.remove(applicationId);
+      }
+
+      if (LOG.isDebugEnabled()) {
+        LOG.debug(
+            "Removed container=" + containerId + " with tags=[" + StringUtils
+                .join(allocationTags, ",") + "]");
+      }
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  /**
+   * Get cardinality for following conditions. External can pass-in a binary op
+   * to implement customized logic.   *
+   * @param nodeId        nodeId, required.
+   * @param applicationId applicationId. When null is specified, return
+   *                      aggregated cardinality among all nodes.
+   * @param tag           allocation tag, see
+   *                      {@link SchedulingRequest#getAllocationTags()},
+   *                      When multiple tags specified. Returns cardinality
+   *                      depends on op. If a specified tag doesn't exist,
+   *                      0 will be its cardinality.
+   *                      When null/empty tags specified, all tags
+   *                      (of the node/app) will be considered.
+   * @return cardinality of specified query on the node.
+   * @throws InvalidAllocationTagsQueryException when illegal query
+   *                                            parameter specified
+   */
+  public long getNodeCardinality(NodeId nodeId, ApplicationId applicationId,
+      String tag) throws InvalidAllocationTagsQueryException {
+    readLock.lock();
+
+    try {
+      if (nodeId == null) {
+        throw new InvalidAllocationTagsQueryException(
+            "Must specify nodeId/tags/op to query cardinality");
+      }
+
+      NodeToCountedTags mapping;
+      if (applicationId != null) {
+        mapping = perAppMappings.get(applicationId);
+      } else{
+        mapping = globalMapping;
+      }
+
+      if (mapping == null) {
+        return 0;
+      }
+
+      return mapping.getCardinality(nodeId, tag);
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  /**
+   * Check if given tag exists on node.
+   *
+   * @param nodeId        nodeId, required.
+   * @param applicationId applicationId. When null is specified, return
+   *                      aggregated cardinality among all nodes.
+   * @param tag           allocation tag, see
+   *                      {@link SchedulingRequest#getAllocationTags()},
+   *                      When multiple tags specified. Returns cardinality
+   *                      depends on op. If a specified tag doesn't exist,
+   *                      0 will be its cardinality.
+   *                      When null/empty tags specified, all tags
+   *                      (of the node/app) will be considered.
+   * @return cardinality of specified query on the node.
+   * @throws InvalidAllocationTagsQueryException when illegal query
+   *                                            parameter specified
+   */
+  public boolean allocationTagExistsOnNode(NodeId nodeId,
+      ApplicationId applicationId, String tag)
+      throws InvalidAllocationTagsQueryException {
+    return getNodeCardinality(nodeId, applicationId, tag) > 0;
+  }
+
+  /**
+   * Get cardinality for following conditions. External can pass-in a binary op
+   * to implement customized logic.
+   *
+   * @param nodeId        nodeId, required.
+   * @param applicationId applicationId. When null is specified, return
+   *                      aggregated cardinality among all nodes.
+   * @param tags          allocation tags, see
+   *                      {@link SchedulingRequest#getAllocationTags()},
+   *                      When multiple tags specified. Returns cardinality
+   *                      depends on op. If a specified tag doesn't exist, 0
+   *                      will be its cardinality. When null/empty tags
+   *                      specified, all tags (of the node/app) will be
+   *                      considered.
+   * @param op            operator. Such as Long::max, Long::sum, etc. Required.
+   *                      This sparameter only take effect when #values >= 2.
+   * @return cardinality of specified query on the node.
+   * @throws InvalidAllocationTagsQueryException when illegal query
+   *                                            parameter specified
+   */
+  public long getNodeCardinalityByOp(NodeId nodeId, ApplicationId applicationId,
+      Set<String> tags, LongBinaryOperator op)
+      throws InvalidAllocationTagsQueryException {
+    readLock.lock();
+
+    try {
+      if (nodeId == null || op == null) {
+        throw new InvalidAllocationTagsQueryException(
+            "Must specify nodeId/tags/op to query cardinality");
+      }
+
+      NodeToCountedTags mapping;
+      if (applicationId != null) {
+        mapping = perAppMappings.get(applicationId);
+      } else{
+        mapping = globalMapping;
+      }
+
+      if (mapping == null) {
+        return 0;
+      }
+
+      return mapping.getCardinality(nodeId, tags, op);
+    } finally {
+      readLock.unlock();
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsNamespaces.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsNamespaces.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsNamespaces.java
new file mode 100644
index 0000000..893ff1c
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/AllocationTagsNamespaces.java
@@ -0,0 +1,31 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.constraint;
+
+/**
+ * Predefined namespaces for tags
+ *
+ * Same as namespace  of resource types. Namespaces of placement tags are start
+ * with alphabets and ended with "/"
+ */
+public class AllocationTagsNamespaces {
+  public static final String APP_ID = "yarn_app_id/";
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/InvalidAllocationTagsQueryException.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/InvalidAllocationTagsQueryException.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/InvalidAllocationTagsQueryException.java
new file mode 100644
index 0000000..5519e39
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/InvalidAllocationTagsQueryException.java
@@ -0,0 +1,35 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.constraint;
+
+import org.apache.hadoop.yarn.exceptions.YarnException;
+
+/**
+ * Exception when invalid parameter specified to do placement tags related
+ * queries.
+ */
+public class InvalidAllocationTagsQueryException extends YarnException {
+  private static final long serialVersionUID = 12312831974894L;
+
+  public InvalidAllocationTagsQueryException(String msg) {
+    super(msg);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainer.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainer.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainer.java
index f3cbf63..8f751b0 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainer.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainer.java
@@ -19,6 +19,7 @@
 package org.apache.hadoop.yarn.server.resourcemanager.rmcontainer;
 
 import java.util.List;
+import java.util.Set;
 
 import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
 import org.apache.hadoop.yarn.api.records.Container;
@@ -30,6 +31,7 @@ import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.event.EventHandler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.ContainerRequest;
 import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
@@ -115,4 +117,10 @@ public interface RMContainer extends EventHandler<RMContainerEvent>,
   boolean completed();
 
   NodeId getNodeId();
+
+  /**
+   * Return {@link SchedulingRequest#getAllocationTags()} specified by AM.
+   * @return allocation tags, could be null/empty
+   */
+  Set<String> getAllocationTags();
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
index e26689e..184cdfc 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
@@ -21,6 +21,7 @@ package org.apache.hadoop.yarn.server.resourcemanager.rmcontainer;
 import java.util.Collections;
 import java.util.EnumSet;
 import java.util.List;
+import java.util.Set;
 import java.util.concurrent.locks.ReentrantReadWriteLock;
 import java.util.concurrent.locks.ReentrantReadWriteLock.ReadLock;
 import java.util.concurrent.locks.ReentrantReadWriteLock.WriteLock;
@@ -189,6 +190,9 @@ public class RMContainerImpl implements RMContainer {
   private boolean isExternallyAllocated;
   private SchedulerRequestKey allocatedSchedulerKey;
 
+  // TODO, set it when container allocated by scheduler (From SchedulingRequest)
+  private Set<String> allocationTags = null;
+
   public RMContainerImpl(Container container, SchedulerRequestKey schedulerKey,
       ApplicationAttemptId appAttemptId, NodeId nodeId, String user,
       RMContext rmContext) {
@@ -501,6 +505,11 @@ public class RMContainerImpl implements RMContainer {
     return nodeId;
   }
 
+  @Override
+  public Set<String> getAllocationTags() {
+    return allocationTags;
+  }
+
   private static class BaseTransition implements
       SingleArcTransition<RMContainerImpl, RMContainerEvent> {
 
@@ -565,6 +574,12 @@ public class RMContainerImpl implements RMContainer {
 
     @Override
     public void transition(RMContainerImpl container, RMContainerEvent event) {
+      // Notify placementManager
+      container.rmContext.getAllocationTagsManager().addContainer(
+          container.getNodeId(),
+          container.getApplicationAttemptId().getApplicationId(),
+          container.getContainerId(), container.getAllocationTags());
+
       container.eventHandler.handle(new RMAppAttemptEvent(
           container.appAttemptId, RMAppAttemptEventType.CONTAINER_ALLOCATED));
     }
@@ -676,6 +691,12 @@ public class RMContainerImpl implements RMContainer {
 
     @Override
     public void transition(RMContainerImpl container, RMContainerEvent event) {
+      // Notify placementManager
+      container.rmContext.getAllocationTagsManager().removeContainer(
+          container.getNodeId(),
+          container.getApplicationAttemptId().getApplicationId(),
+          container.getContainerId(), container.getAllocationTags());
+
       RMContainerFinishedEvent finishedEvent = (RMContainerFinishedEvent) event;
 
       container.finishTime = System.currentTimeMillis();

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/TestAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/TestAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/TestAllocationTagsManager.java
new file mode 100644
index 0000000..0358792
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/constraint/TestAllocationTagsManager.java
@@ -0,0 +1,328 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.constraint;
+
+import com.google.common.collect.ImmutableSet;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.TestUtils;
+import org.junit.Assert;
+import org.junit.Test;
+
+/**
+ * Test functionality of AllocationTagsManager.
+ */
+public class TestAllocationTagsManager {
+  @Test
+  public void testAllocationTagsManagerSimpleCases()
+      throws InvalidAllocationTagsQueryException {
+    AllocationTagsManager atm = new AllocationTagsManager();
+
+    /**
+     * Construct test case:
+     * Node1:
+     *    container_1_1 (mapper/reducer/app_1)
+     *    container_1_3 (service/app_1)
+     *
+     * Node2:
+     *    container_1_2 (mapper/reducer/app_1)
+     *    container_1_4 (reducer/app_1)
+     *    container_2_1 (service/app_2)
+     */
+
+    // 3 Containers from app1
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    // 1 Container from app2
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Get Cardinality of app1 on node1, with tag "mapper"
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node1:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::max));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=min
+    Assert.assertEquals(1,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::min));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=max
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::max));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
+    Assert.assertEquals(3,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::sum));
+
+    // Get Cardinality by passing single tag.
+    Assert.assertEquals(1,
+        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), "mapper"));
+
+    Assert.assertEquals(2,
+        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), "reducer"));
+
+    // Get Cardinality of app1 on node2, with tag "no_existed/reducer", op=min
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("no_existed", "reducer"), Long::min));
+
+    // Get Cardinality of app1 on node2, with tag "<applicationId>", op=max
+    // (Expect this returns #containers from app1 on node2)
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet
+                .of(AllocationTagsNamespaces.APP_ID + TestUtils
+                    .getMockApplicationId(1).toString()), Long::max));
+
+    // Get Cardinality of app1 on node2, with empty tag set, op=max
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
+
+    // Get Cardinality of all apps on node2, with empty tag set, op=sum
+    Assert.assertEquals(7,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"), null,
+            ImmutableSet.of(), Long::sum));
+
+    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    Assert.assertEquals(5,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
+
+    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    Assert.assertEquals(2,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
+
+    // Finish all containers:
+    atm.removeContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.removeContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Expect all cardinality to be 0
+    // Get Cardinality of app1 on node1, with tag "mapper"
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node1:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
+            Long::max));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=min
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::min));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=max
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::max));
+
+    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of("mapper", "reducer"), Long::sum));
+
+    // Get Cardinality of app1 on node2, with tag "<applicationId>", op=max
+    // (Expect this returns #containers from app1 on node2)
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            ImmutableSet.of(TestUtils.getMockApplicationId(1).toString()),
+            Long::max));
+
+    Assert.assertEquals(0,
+        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1),
+            TestUtils.getMockApplicationId(1).toString()));
+
+    // Get Cardinality of app1 on node2, with empty tag set, op=max
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
+
+    // Get Cardinality of all apps on node2, with empty tag set, op=sum
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"), null,
+            ImmutableSet.of(), Long::sum));
+
+    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
+
+    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    Assert.assertEquals(0,
+        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+            TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
+  }
+
+  @Test
+  public void testAllocationTagsManagerMemoryAfterCleanup()
+      throws InvalidAllocationTagsQueryException {
+    /**
+     * Make sure YARN cleans up all memory once container/app finishes.
+     */
+
+    AllocationTagsManager atm = new AllocationTagsManager();
+
+    // Add a bunch of containers
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Remove all these containers
+    atm.removeContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.removeContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.removeContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Check internal data structure
+    Assert.assertEquals(0,
+        atm.getGlobalMapping().getNodeToTagsWithCount().size());
+    Assert.assertEquals(0, atm.getPerAppMappings().size());
+  }
+
+  @Test
+  public void testQueryCardinalityWithIllegalParameters()
+      throws InvalidAllocationTagsQueryException {
+    /**
+     * Make sure YARN cleans up all memory once container/app finishes.
+     */
+
+    AllocationTagsManager atm = new AllocationTagsManager();
+
+    // Add a bunch of containers
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("node1:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.addContainer(NodeId.fromString("node2:1234"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // No node-id
+    boolean caughtException = false;
+    try {
+      atm.getNodeCardinalityByOp(null, TestUtils.getMockApplicationId(2),
+          ImmutableSet.of("mapper"), Long::min);
+    } catch (InvalidAllocationTagsQueryException e) {
+      caughtException = true;
+    }
+    Assert.assertTrue("should fail because of nodeId specified",
+        caughtException);
+
+    // No op
+    caughtException = false;
+    try {
+      atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+          TestUtils.getMockApplicationId(2), ImmutableSet.of("mapper"), null);
+    } catch (InvalidAllocationTagsQueryException e) {
+      caughtException = true;
+    }
+    Assert.assertTrue("should fail because of nodeId specified",
+        caughtException);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
index 6c189b3..27ff311 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
@@ -54,6 +54,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWriter;
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
+import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptEventType;
@@ -109,6 +110,8 @@ public class TestRMContainerImpl {
     when(rmContext.getRMApplicationHistoryWriter()).thenReturn(writer);
     when(rmContext.getRMApps()).thenReturn(rmApps);
     when(rmContext.getSystemMetricsPublisher()).thenReturn(publisher);
+    AllocationTagsManager ptm = mock(AllocationTagsManager.class);
+    when(rmContext.getAllocationTagsManager()).thenReturn(ptm);
     YarnConfiguration conf = new YarnConfiguration();
     conf.setBoolean(
         YarnConfiguration.APPLICATION_HISTORY_SAVE_NON_AM_CONTAINER_META_INFO,
@@ -209,6 +212,8 @@ public class TestRMContainerImpl {
     when(rmContext.getContainerAllocationExpirer()).thenReturn(expirer);
     when(rmContext.getRMApplicationHistoryWriter()).thenReturn(writer);
     when(rmContext.getSystemMetricsPublisher()).thenReturn(publisher);
+    AllocationTagsManager ptm = mock(AllocationTagsManager.class);
+    when(rmContext.getAllocationTagsManager()).thenReturn(ptm);
 
     YarnConfiguration conf = new YarnConfiguration();
     conf.setBoolean(
@@ -367,4 +372,123 @@ public class TestRMContainerImpl {
     verify(publisher, times(1)).containerCreated(any(RMContainer.class), anyLong());
     verify(publisher, times(1)).containerFinished(any(RMContainer.class), anyLong());
   }
+
+  @Test
+  public void testContainerTransitionNotifyPlacementTagsManager()
+      throws Exception {
+    DrainDispatcher drainDispatcher = new DrainDispatcher();
+    EventHandler<RMAppAttemptEvent> appAttemptEventHandler = mock(
+        EventHandler.class);
+    EventHandler generic = mock(EventHandler.class);
+    drainDispatcher.register(RMAppAttemptEventType.class,
+        appAttemptEventHandler);
+    drainDispatcher.register(RMNodeEventType.class, generic);
+    drainDispatcher.init(new YarnConfiguration());
+    drainDispatcher.start();
+    NodeId nodeId = BuilderUtils.newNodeId("host", 3425);
+    ApplicationId appId = BuilderUtils.newApplicationId(1, 1);
+    ApplicationAttemptId appAttemptId = BuilderUtils.newApplicationAttemptId(
+        appId, 1);
+    ContainerId containerId = BuilderUtils.newContainerId(appAttemptId, 1);
+    ContainerAllocationExpirer expirer = mock(ContainerAllocationExpirer.class);
+
+    Resource resource = BuilderUtils.newResource(512, 1);
+    Priority priority = BuilderUtils.newPriority(5);
+
+    Container container = BuilderUtils.newContainer(containerId, nodeId,
+        "host:3465", resource, priority, null);
+    ConcurrentMap<ApplicationId, RMApp> rmApps =
+        spy(new ConcurrentHashMap<ApplicationId, RMApp>());
+    RMApp rmApp = mock(RMApp.class);
+    when(rmApp.getRMAppAttempt(Matchers.any())).thenReturn(null);
+    Mockito.doReturn(rmApp).when(rmApps).get(Matchers.any());
+
+    RMApplicationHistoryWriter writer = mock(RMApplicationHistoryWriter.class);
+    SystemMetricsPublisher publisher = mock(SystemMetricsPublisher.class);
+    AllocationTagsManager tagsManager = new AllocationTagsManager();
+    RMContext rmContext = mock(RMContext.class);
+    when(rmContext.getDispatcher()).thenReturn(drainDispatcher);
+    when(rmContext.getContainerAllocationExpirer()).thenReturn(expirer);
+    when(rmContext.getRMApplicationHistoryWriter()).thenReturn(writer);
+    when(rmContext.getRMApps()).thenReturn(rmApps);
+    when(rmContext.getSystemMetricsPublisher()).thenReturn(publisher);
+    when(rmContext.getAllocationTagsManager()).thenReturn(tagsManager);
+    YarnConfiguration conf = new YarnConfiguration();
+    conf.setBoolean(
+        YarnConfiguration.APPLICATION_HISTORY_SAVE_NON_AM_CONTAINER_META_INFO,
+        true);
+    when(rmContext.getYarnConfiguration()).thenReturn(conf);
+
+    /* First container: ALLOCATED -> KILLED */
+    RMContainer rmContainer = new RMContainerImpl(container,
+        SchedulerRequestKey.extractFrom(container), appAttemptId,
+        nodeId, "user", rmContext);
+
+    Assert.assertEquals(0,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    rmContainer.handle(new RMContainerEvent(containerId,
+        RMContainerEventType.START));
+
+    Assert.assertEquals(1,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    rmContainer.handle(new RMContainerFinishedEvent(containerId, ContainerStatus
+        .newInstance(containerId, ContainerState.COMPLETE, "", 0),
+        RMContainerEventType.KILL));
+
+    Assert.assertEquals(0,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    /* Second container: ACQUIRED -> FINISHED */
+    rmContainer = new RMContainerImpl(container,
+        SchedulerRequestKey.extractFrom(container), appAttemptId,
+        nodeId, "user", rmContext);
+
+    Assert.assertEquals(0,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    rmContainer.handle(new RMContainerEvent(containerId,
+        RMContainerEventType.START));
+
+    Assert.assertEquals(1,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    rmContainer.handle(
+        new RMContainerEvent(containerId, RMContainerEventType.ACQUIRED));
+
+    rmContainer.handle(new RMContainerFinishedEvent(containerId, ContainerStatus
+        .newInstance(containerId, ContainerState.COMPLETE, "", 0),
+        RMContainerEventType.FINISHED));
+
+    Assert.assertEquals(0,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    /* Third container: RUNNING -> FINISHED */
+    rmContainer = new RMContainerImpl(container,
+        SchedulerRequestKey.extractFrom(container), appAttemptId,
+        nodeId, "user", rmContext);
+
+    Assert.assertEquals(0,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    rmContainer.handle(new RMContainerEvent(containerId,
+        RMContainerEventType.START));
+
+    Assert.assertEquals(1,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    rmContainer.handle(
+        new RMContainerEvent(containerId, RMContainerEventType.ACQUIRED));
+
+    rmContainer.handle(
+        new RMContainerEvent(containerId, RMContainerEventType.LAUNCHED));
+
+    rmContainer.handle(new RMContainerFinishedEvent(containerId, ContainerStatus
+        .newInstance(containerId, ContainerState.COMPLETE, "", 0),
+        RMContainerEventType.FINISHED));
+
+    Assert.assertEquals(0,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
index e3326c7..61a5555 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestUtils.java
@@ -42,6 +42,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.RMContextImpl;
 import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWriter;
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.ContainerAllocationExpirer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
@@ -135,6 +136,9 @@ public class TestUtils {
         new DefaultResourceCalculator());
     rmContext.setScheduler(mockScheduler);
 
+    AllocationTagsManager ptm = mock(AllocationTagsManager.class);
+    rmContext.setAllocationTagsManager(ptm);
+
     return rmContext;
   }
   
@@ -234,6 +238,11 @@ public class TestUtils {
     doReturn(id).when(containerId).getContainerId();
     return containerId;
   }
+
+  public static ContainerId getMockContainerId(int appId, int containerId) {
+    ApplicationAttemptId attemptId = getMockApplicationAttemptId(appId, 1);
+    return ContainerId.newContainerId(attemptId, containerId);
+  }
   
   public static Container getMockContainer(
       ContainerId containerId, NodeId nodeId, 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/2615da83/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
index 3f97b59..4b902a7 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/TestFifoScheduler.java
@@ -74,6 +74,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.ahs.RMApplicationHistoryWri
 import org.apache.hadoop.yarn.server.resourcemanager.metrics.SystemMetricsPublisher;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.NullRMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMAppImpl;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttempt;
@@ -234,6 +235,8 @@ public class TestFifoScheduler {
     FifoScheduler scheduler = new FifoScheduler();
     RMContext rmContext = new RMContextImpl(dispatcher, null, null, null, null,
         null, containerTokenSecretManager, nmTokenSecretManager, null, scheduler);
+    AllocationTagsManager ptm = mock(AllocationTagsManager.class);
+    rmContext.setAllocationTagsManager(ptm);
     rmContext.setSystemMetricsPublisher(mock(SystemMetricsPublisher.class));
     rmContext.setRMApplicationHistoryWriter(
         mock(RMApplicationHistoryWriter.class));
@@ -312,12 +315,14 @@ public class TestFifoScheduler {
     FifoScheduler scheduler = new FifoScheduler();
     RMContext rmContext = new RMContextImpl(dispatcher, null, null, null, null,
         null, containerTokenSecretManager, nmTokenSecretManager, null, scheduler);
+    AllocationTagsManager ptm = mock(AllocationTagsManager.class);
     rmContext.setSystemMetricsPublisher(mock(SystemMetricsPublisher.class));
     rmContext.setRMApplicationHistoryWriter(mock(RMApplicationHistoryWriter.class));
     ((RMContextImpl) rmContext).setYarnConfiguration(new YarnConfiguration());
     NullRMNodeLabelsManager nlm = new NullRMNodeLabelsManager();
     nlm.init(new Configuration());
     rmContext.setNodeLabelManager(nlm);
+    rmContext.setAllocationTagsManager(ptm);
 
     scheduler.setRMContext(rmContext);
     ((RMContextImpl) rmContext).setScheduler(scheduler);


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[45/50] [abbrv] hadoop git commit: YARN-6597. Add RMContainer recovery test to verify tag population in the AllocationTagsManager. (Panagiotis Garefalakis via asuresh)

Posted by as...@apache.org.
YARN-6597. Add RMContainer recovery test to verify tag population in the AllocationTagsManager. (Panagiotis Garefalakis via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/06d22eb2
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/06d22eb2
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/06d22eb2

Branch: refs/heads/YARN-6592
Commit: 06d22eb2784d4e2386b50926286409adb8b47973
Parents: 3663239
Author: Arun Suresh <as...@apache.org>
Authored: Thu Jan 25 23:01:43 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../rmcontainer/RMContainerImpl.java            |  8 +++----
 .../rmcontainer/TestRMContainerImpl.java        | 25 ++++++++++++++++++--
 2 files changed, 26 insertions(+), 7 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/06d22eb2/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
index a504221..541621b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
@@ -20,7 +20,6 @@ package org.apache.hadoop.yarn.server.resourcemanager.rmcontainer;
 
 import java.util.Collections;
 import java.util.EnumSet;
-import java.util.List;
 import java.util.Set;
 import java.util.concurrent.locks.ReentrantReadWriteLock;
 import java.util.concurrent.locks.ReentrantReadWriteLock.ReadLock;
@@ -40,7 +39,6 @@ import org.apache.hadoop.yarn.api.records.ExecutionType;
 import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
-import org.apache.hadoop.yarn.api.records.ResourceRequest;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.event.EventHandler;
 import org.apache.hadoop.yarn.server.api.protocolrecords.NMContainerStatus;
@@ -533,7 +531,7 @@ public class RMContainerImpl implements RMContainer {
         RMContainerEvent event) {
       NMContainerStatus report =
           ((RMContainerRecoverEvent) event).getContainerReport();
-      // Set the allocation tags from the
+      // Set the allocation tags from the NMContainerStatus
       container.setAllocationTags(report.getAllocationTags());
       // Notify AllocationTagsManager
       container.rmContext.getAllocationTagsManager().addContainer(
@@ -689,7 +687,7 @@ public class RMContainerImpl implements RMContainer {
         // Something wrong happened, kill the container
         LOG.warn("Something wrong happened, container size reported by NM"
             + " is not expected, ContainerID=" + container.getContainerId()
-            + " rm-size-resource:" + rmContainerResource + " nm-size-reosurce:"
+            + " rm-size-resource:" + rmContainerResource + " nm-size-resource:"
             + nmContainerResource);
         container.eventHandler.handle(new RMNodeCleanContainerEvent(
             container.nodeId, container.getContainerId()));
@@ -702,7 +700,7 @@ public class RMContainerImpl implements RMContainer {
 
     @Override
     public void transition(RMContainerImpl container, RMContainerEvent event) {
-      // Notify placementManager
+      // Notify AllocationTagsManager
       container.rmContext.getAllocationTagsManager().removeContainer(
           container.getNodeId(), container.getContainerId(),
           container.getAllocationTags());

http://git-wip-us.apache.org/repos/asf/hadoop/blob/06d22eb2/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
index 2bf6a21..27c5fbd 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
@@ -49,6 +49,7 @@ import org.apache.hadoop.yarn.api.records.ResourceRequest;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.event.DrainDispatcher;
 import org.apache.hadoop.yarn.event.EventHandler;
+import org.apache.hadoop.yarn.server.api.protocolrecords.NMContainerStatus;
 import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
 import org.apache.hadoop.yarn.server.resourcemanager.MockNM;
 import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
@@ -171,7 +172,7 @@ public class TestRMContainerImpl {
     assertEquals(containerStatus, cfEvent.getContainerStatus());
     assertEquals(RMAppAttemptEventType.CONTAINER_FINISHED, cfEvent.getType());
     
-    // In RELEASED state. A FINIHSED event may come in.
+    // In RELEASED state. A FINISHED event may come in.
     rmContainer.handle(new RMContainerFinishedEvent(containerId, SchedulerUtils
         .createAbnormalContainerStatus(containerId, "FinishedContainer"),
         RMContainerEventType.FINISHED));
@@ -375,7 +376,7 @@ public class TestRMContainerImpl {
   }
 
   @Test
-  public void testContainerTransitionNotifyPlacementTagsManager()
+  public void testContainerTransitionNotifyAllocationTagsManager()
       throws Exception {
     DrainDispatcher drainDispatcher = new DrainDispatcher();
     EventHandler<RMAppAttemptEvent> appAttemptEventHandler = mock(
@@ -494,5 +495,25 @@ public class TestRMContainerImpl {
 
     Assert.assertEquals(0,
         tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    /* Fourth container: NEW -> RECOVERED */
+    rmContainer = new RMContainerImpl(container,
+        SchedulerRequestKey.extractFrom(container), appAttemptId, nodeId,
+        "user", rmContext);
+    rmContainer.setAllocationTags(ImmutableSet.of("mapper"));
+
+    Assert.assertEquals(0,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
+
+    NMContainerStatus containerStatus = NMContainerStatus
+        .newInstance(containerId, 0, ContainerState.NEW,
+            Resource.newInstance(1024, 1), "recover container", 0,
+            Priority.newInstance(0), 0);
+    containerStatus.setAllocationTags(ImmutableSet.of("mapper"));
+    rmContainer
+        .handle(new RMContainerRecoverEvent(containerId, containerStatus));
+
+    Assert.assertEquals(1,
+        tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
   }
 }


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[08/50] [abbrv] hadoop git commit: YARN-7765. Fixed an issue that kerberos tgt not found when NM posting timeline events. Contributed by Rohith Sharma K S

Posted by as...@apache.org.
YARN-7765. Fixed an issue that kerberos tgt not found when NM posting timeline events. Contributed by Rohith Sharma K S


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/443523f9
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/443523f9
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/443523f9

Branch: refs/heads/YARN-6592
Commit: 443523f9c0fcc4ba2503791090b1879c6031759b
Parents: 649ef7a
Author: Jian He <ji...@apache.org>
Authored: Sat Jan 27 22:18:51 2018 -0800
Committer: Jian He <ji...@apache.org>
Committed: Sat Jan 27 22:18:51 2018 -0800

----------------------------------------------------------------------
 .../hadoop/yarn/server/nodemanager/NodeManager.java      | 11 ++++-------
 .../nodemanager/timelineservice/NMTimelinePublisher.java |  1 +
 .../timelineservice/storage/HBaseTimelineWriterImpl.java |  5 +++++
 3 files changed, 10 insertions(+), 7 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/443523f9/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/NodeManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/NodeManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/NodeManager.java
index 5cacd20..42b7b5f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/NodeManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/NodeManager.java
@@ -454,18 +454,15 @@ public class NodeManager extends CompositeService
     ((NMContext) context).setNodeStatusUpdater(nodeStatusUpdater);
     nmStore.setNodeStatusUpdater(nodeStatusUpdater);
 
-    super.serviceInit(conf);
-    // TODO add local dirs to del
-  }
-
-  @Override
-  protected void serviceStart() throws Exception {
+    // Do secure login before calling init for added services.
     try {
       doSecureLogin();
     } catch (IOException e) {
       throw new YarnRuntimeException("Failed NodeManager login", e);
     }
-    super.serviceStart();
+
+    super.serviceInit(conf);
+    // TODO add local dirs to del
   }
 
   @Override

http://git-wip-us.apache.org/repos/asf/hadoop/blob/443523f9/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/timelineservice/NMTimelinePublisher.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/timelineservice/NMTimelinePublisher.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/timelineservice/NMTimelinePublisher.java
index b8192ca..2ce3c5e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/timelineservice/NMTimelinePublisher.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/timelineservice/NMTimelinePublisher.java
@@ -100,6 +100,7 @@ public class NMTimelinePublisher extends CompositeService {
     this.nmLoginUGI =  UserGroupInformation.isSecurityEnabled() ?
         UserGroupInformation.getLoginUser() :
         UserGroupInformation.getCurrentUser();
+    LOG.info("Initialized NMTimelinePublisher UGI to " + nmLoginUGI);
     super.serviceInit(conf);
   }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/443523f9/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-timelineservice-hbase/src/main/java/org/apache/hadoop/yarn/server/timelineservice/storage/HBaseTimelineWriterImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-timelineservice-hbase/src/main/java/org/apache/hadoop/yarn/server/timelineservice/storage/HBaseTimelineWriterImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-timelineservice-hbase/src/main/java/org/apache/hadoop/yarn/server/timelineservice/storage/HBaseTimelineWriterImpl.java
index 9e9134c..f938185 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-timelineservice-hbase/src/main/java/org/apache/hadoop/yarn/server/timelineservice/storage/HBaseTimelineWriterImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-timelineservice-hbase/src/main/java/org/apache/hadoop/yarn/server/timelineservice/storage/HBaseTimelineWriterImpl.java
@@ -129,6 +129,11 @@ public class HBaseTimelineWriterImpl extends AbstractService implements
         new FlowActivityTable().getTableMutator(hbaseConf, conn);
     subApplicationTable =
         new SubApplicationTable().getTableMutator(hbaseConf, conn);
+
+    UserGroupInformation ugi = UserGroupInformation.isSecurityEnabled() ?
+        UserGroupInformation.getLoginUser() :
+        UserGroupInformation.getCurrentUser();
+    LOG.info("Initialized HBaseTimelineWriterImpl UGI to " + ugi);
   }
 
   /**


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[07/50] [abbrv] hadoop git commit: YARN-7064. Use cgroup to get container resource utilization. (Miklos Szegedi via Haibo Chen)

Posted by as...@apache.org.
YARN-7064. Use cgroup to get container resource utilization. (Miklos Szegedi via Haibo Chen)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/649ef7ac
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/649ef7ac
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/649ef7ac

Branch: refs/heads/YARN-6592
Commit: 649ef7ac334e63a7c676f8e7406f59d9466eb6f2
Parents: 6eef3d7
Author: Haibo Chen <ha...@apache.org>
Authored: Fri Jan 26 16:27:31 2018 -0800
Committer: Haibo Chen <ha...@apache.org>
Committed: Fri Jan 26 16:27:31 2018 -0800

----------------------------------------------------------------------
 .../org/apache/hadoop/util/CpuTimeTracker.java  |   2 +-
 .../hadoop/yarn/conf/YarnConfiguration.java     |  10 +-
 .../yarn/conf/TestYarnConfigurationFields.java  |   2 -
 .../yarn/util/ProcfsBasedProcessTree.java       |   3 +
 .../util/ResourceCalculatorProcessTree.java     |   9 +
 .../src/main/resources/yarn-default.xml         |  34 +-
 .../linux/resources/CGroupsHandler.java         |   9 +-
 .../linux/resources/CGroupsHandlerImpl.java     |   3 +-
 .../CGroupsMemoryResourceHandlerImpl.java       |  52 +--
 .../resources/CGroupsResourceCalculator.java    | 357 +++++++++++++++++++
 .../resources/CombinedResourceCalculator.java   | 108 ++++++
 .../linux/resources/ResourceHandlerModule.java  |  43 ++-
 .../monitor/ContainersMonitorImpl.java          |  33 +-
 .../TestCGroupsMemoryResourceHandlerImpl.java   |  45 +++
 .../TestCGroupsResourceCalculator.java          | 274 ++++++++++++++
 .../TestCompareResourceCalculators.java         | 227 ++++++++++++
 .../resources/TestResourceHandlerModule.java    |  47 ++-
 17 files changed, 1183 insertions(+), 75 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/CpuTimeTracker.java
----------------------------------------------------------------------
diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/CpuTimeTracker.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/CpuTimeTracker.java
index b4ebe86..4355367 100644
--- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/CpuTimeTracker.java
+++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/CpuTimeTracker.java
@@ -99,7 +99,7 @@ public class CpuTimeTracker {
   public void updateElapsedJiffies(BigInteger elapsedJiffies, long newTime) {
     BigInteger newValue = elapsedJiffies.multiply(jiffyLengthInMillis);
     cumulativeCpuTime = newValue.compareTo(cumulativeCpuTime) >= 0 ?
-        newValue : cumulativeCpuTime;
+            newValue : cumulativeCpuTime;
     sampleTime = newTime;
   }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
index f132683..bbbfc52 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
@@ -1357,22 +1357,20 @@ public class YarnConfiguration extends Configuration {
   public static final String NM_MEMORY_RESOURCE_PREFIX = NM_PREFIX
       + "resource.memory.";
 
-  @Private
   public static final String NM_MEMORY_RESOURCE_ENABLED =
       NM_MEMORY_RESOURCE_PREFIX + "enabled";
-  @Private
   public static final boolean DEFAULT_NM_MEMORY_RESOURCE_ENABLED = false;
 
-  @Private
+  public static final String NM_MEMORY_RESOURCE_ENFORCED =
+      NM_MEMORY_RESOURCE_PREFIX + "enforced";
+  public static final boolean DEFAULT_NM_MEMORY_RESOURCE_ENFORCED = true;
+
   public static final String NM_MEMORY_RESOURCE_CGROUPS_SWAPPINESS =
       NM_MEMORY_RESOURCE_PREFIX + "cgroups.swappiness";
-  @Private
   public static final int DEFAULT_NM_MEMORY_RESOURCE_CGROUPS_SWAPPINESS = 0;
 
-  @Private
   public static final String NM_MEMORY_RESOURCE_CGROUPS_SOFT_LIMIT_PERCENTAGE =
       NM_MEMORY_RESOURCE_PREFIX + "cgroups.soft-limit-percentage";
-  @Private
   public static final float
       DEFAULT_NM_MEMORY_RESOURCE_CGROUPS_SOFT_LIMIT_PERCENTAGE =
       90.0f;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/conf/TestYarnConfigurationFields.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/conf/TestYarnConfigurationFields.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/conf/TestYarnConfigurationFields.java
index 3976d2d..9fe4f88 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/conf/TestYarnConfigurationFields.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/test/java/org/apache/hadoop/yarn/conf/TestYarnConfigurationFields.java
@@ -159,8 +159,6 @@ public class TestYarnConfigurationFields extends TestConfigurationFieldsBase {
     configurationPrefixToSkipCompare
         .add(YarnConfiguration.NM_DISK_RESOURCE_ENABLED);
     configurationPrefixToSkipCompare
-        .add(YarnConfiguration.NM_MEMORY_RESOURCE_PREFIX);
-    configurationPrefixToSkipCompare
         .add(YarnConfiguration.NM_CPU_RESOURCE_ENABLED);
     configurationPrefixToSkipCompare.add(
         YarnConfiguration.NM_NETWORK_TAG_MAPPING_MANAGER);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ProcfsBasedProcessTree.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ProcfsBasedProcessTree.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ProcfsBasedProcessTree.java
index 7431fdf..55be001 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ProcfsBasedProcessTree.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ProcfsBasedProcessTree.java
@@ -468,6 +468,9 @@ public class ProcfsBasedProcessTree extends ResourceCalculatorProcessTree {
   @Override
   public float getCpuUsagePercent() {
     BigInteger processTotalJiffies = getTotalProcessJiffies();
+    if (LOG.isDebugEnabled()) {
+      LOG.debug("Process " + pid + " jiffies:" + processTotalJiffies);
+    }
     cpuTimeTracker.updateElapsedJiffies(processTotalJiffies,
         clock.getTime());
     return cpuTimeTracker.getCpuTrackerUsagePercent();

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ResourceCalculatorProcessTree.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ResourceCalculatorProcessTree.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ResourceCalculatorProcessTree.java
index 7e5cf55..c581b83 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ResourceCalculatorProcessTree.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/ResourceCalculatorProcessTree.java
@@ -27,6 +27,7 @@ import org.apache.hadoop.classification.InterfaceAudience.Private;
 import org.apache.hadoop.classification.InterfaceStability.Evolving;
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.conf.Configured;
+import org.apache.hadoop.yarn.exceptions.YarnException;
 
 /**
  * Interface class to obtain process resource usage
@@ -51,6 +52,13 @@ public abstract class ResourceCalculatorProcessTree extends Configured {
   }
 
   /**
+   * Initialize the object.
+   * @throws YarnException Throws an exception on error.
+   */
+  public void initialize() throws YarnException {
+  }
+
+  /**
    * Update the process-tree with latest state.
    *
    * Each call to this function should increment the age of the running
@@ -168,6 +176,7 @@ public abstract class ResourceCalculatorProcessTree extends Configured {
         Constructor <? extends ResourceCalculatorProcessTree> c = clazz.getConstructor(String.class);
         ResourceCalculatorProcessTree rctree = c.newInstance(pid);
         rctree.setConf(conf);
+        rctree.initialize();
         return rctree;
       } catch(Exception e) {
         throw new RuntimeException(e);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
index 1348d6d..0bb4fca 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
@@ -1309,6 +1309,37 @@
   </property>
 
   <property>
+    <description>Whether YARN CGroups memory tracking is enabled.</description>
+    <name>yarn.nodemanager.resource.memory.enabled</name>
+    <value>false</value>
+  </property>
+
+  <property>
+    <description>Whether YARN CGroups strict memory enforcement is enabled.
+    </description>
+    <name>yarn.nodemanager.resource.memory.enforced</name>
+    <value>true</value>
+  </property>
+
+  <property>
+    <description>If memory limit is enforced, this the percentage of soft limit
+      compared to the memory assigned to the container. If there is memory
+      pressure container memory usage will be pushed back to its soft limit
+      by swapping out memory.
+    </description>
+    <name>yarn.nodemanager.resource.memory.cgroups.soft-limit-percentage</name>
+    <value>90.0</value>
+  </property>
+
+  <property>
+    <description>Container swappiness is the likelihood a page will be swapped
+      out compared to be kept in memory. Value is between 0-100.
+    </description>
+    <name>yarn.nodemanager.resource.memory.cgroups.swappiness</name>
+    <value>0</value>
+  </property>
+
+  <property>
     <description>Whether physical memory limits will be enforced for
     containers.</description>
     <name>yarn.nodemanager.pmem-check-enabled</name>
@@ -1622,7 +1653,8 @@
     or be allowed to consume spare resources if they need them. For example, turning the
     flag on will restrict apps to use only their share of CPU, even if the node has spare
     CPU cycles. The default value is false i.e. use available resources. Please note that
-    turning this flag on may reduce job throughput on the cluster.</description>
+    turning this flag on may reduce job throughput on the cluster. This setting does
+    not apply to other subsystems like memory.</description>
     <name>yarn.nodemanager.linux-container-executor.cgroups.strict-resource-usage</name>
     <value>false</value>
   </property>

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandler.java
index 5f4d3e4..e279504 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandler.java
@@ -54,7 +54,7 @@ public interface CGroupsHandler {
       this.name = name;
     }
 
-    String getName() {
+    public String getName() {
       return name;
     }
 
@@ -113,6 +113,13 @@ public interface CGroupsHandler {
       ResourceHandlerException;
 
   /**
+   * Gets the absolute path to the specified cgroup controller.
+   * @param controller - controller type for the cgroup
+   * @return the root of the controller.
+   */
+  String getControllerPath(CGroupController controller);
+
+  /**
    * Gets the relative path for the cgroup, independent of a controller, for a
    * given cgroup id.
    * @param cGroupId - id of the cgroup

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandlerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandlerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandlerImpl.java
index 619a65b..008f3d7 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandlerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsHandlerImpl.java
@@ -125,7 +125,8 @@ class CGroupsHandlerImpl implements CGroupsHandler {
     initializeControllerPaths();
   }
 
-  private String getControllerPath(CGroupController controller) {
+  @Override
+  public String getControllerPath(CGroupController controller) {
     try {
       rwLock.readLock().lock();
       return controllerPaths.get(controller);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsMemoryResourceHandlerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsMemoryResourceHandlerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsMemoryResourceHandlerImpl.java
index d3e787e..558751f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsMemoryResourceHandlerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsMemoryResourceHandlerImpl.java
@@ -52,6 +52,7 @@ public class CGroupsMemoryResourceHandlerImpl implements MemoryResourceHandler {
   private static final int OPPORTUNISTIC_SOFT_LIMIT = 0;
 
   private CGroupsHandler cGroupsHandler;
+  private boolean enforce = true;
   private int swappiness = 0;
   // multiplier to set the soft limit - value should be between 0 and 1
   private float softLimit = 0.0f;
@@ -79,6 +80,9 @@ public class CGroupsMemoryResourceHandlerImpl implements MemoryResourceHandler {
       throw new ResourceHandlerException(msg);
     }
     this.cGroupsHandler.initializeCGroupController(MEMORY);
+    enforce = conf.getBoolean(
+        YarnConfiguration.NM_MEMORY_RESOURCE_ENFORCED,
+        YarnConfiguration.DEFAULT_NM_MEMORY_RESOURCE_ENFORCED);
     swappiness = conf
         .getInt(YarnConfiguration.NM_MEMORY_RESOURCE_CGROUPS_SWAPPINESS,
             YarnConfiguration.DEFAULT_NM_MEMORY_RESOURCE_CGROUPS_SWAPPINESS);
@@ -124,31 +128,33 @@ public class CGroupsMemoryResourceHandlerImpl implements MemoryResourceHandler {
         (long) (container.getResource().getMemorySize() * this.softLimit);
     long containerHardLimit = container.getResource().getMemorySize();
     cGroupsHandler.createCGroup(MEMORY, cgroupId);
-    try {
-      cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
-          CGroupsHandler.CGROUP_PARAM_MEMORY_HARD_LIMIT_BYTES,
-          String.valueOf(containerHardLimit) + "M");
-      ContainerTokenIdentifier id = container.getContainerTokenIdentifier();
-      if (id != null && id.getExecutionType() ==
-          ExecutionType.OPPORTUNISTIC) {
+    if (enforce) {
+      try {
         cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
-            CGroupsHandler.CGROUP_PARAM_MEMORY_SOFT_LIMIT_BYTES,
-            String.valueOf(OPPORTUNISTIC_SOFT_LIMIT) + "M");
-        cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
-            CGroupsHandler.CGROUP_PARAM_MEMORY_SWAPPINESS,
-            String.valueOf(OPPORTUNISTIC_SWAPPINESS));
-      } else {
-        cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
-            CGroupsHandler.CGROUP_PARAM_MEMORY_SOFT_LIMIT_BYTES,
-            String.valueOf(containerSoftLimit) + "M");
-        cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
-            CGroupsHandler.CGROUP_PARAM_MEMORY_SWAPPINESS,
-            String.valueOf(swappiness));
+            CGroupsHandler.CGROUP_PARAM_MEMORY_HARD_LIMIT_BYTES,
+            String.valueOf(containerHardLimit) + "M");
+        ContainerTokenIdentifier id = container.getContainerTokenIdentifier();
+        if (id != null && id.getExecutionType() ==
+            ExecutionType.OPPORTUNISTIC) {
+          cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
+              CGroupsHandler.CGROUP_PARAM_MEMORY_SOFT_LIMIT_BYTES,
+              String.valueOf(OPPORTUNISTIC_SOFT_LIMIT) + "M");
+          cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
+              CGroupsHandler.CGROUP_PARAM_MEMORY_SWAPPINESS,
+              String.valueOf(OPPORTUNISTIC_SWAPPINESS));
+        } else {
+          cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
+              CGroupsHandler.CGROUP_PARAM_MEMORY_SOFT_LIMIT_BYTES,
+              String.valueOf(containerSoftLimit) + "M");
+          cGroupsHandler.updateCGroupParam(MEMORY, cgroupId,
+              CGroupsHandler.CGROUP_PARAM_MEMORY_SWAPPINESS,
+              String.valueOf(swappiness));
+        }
+      } catch (ResourceHandlerException re) {
+        cGroupsHandler.deleteCGroup(MEMORY, cgroupId);
+        LOG.warn("Could not update cgroup for container", re);
+        throw re;
       }
-    } catch (ResourceHandlerException re) {
-      cGroupsHandler.deleteCGroup(MEMORY, cgroupId);
-      LOG.warn("Could not update cgroup for container", re);
-      throw re;
     }
     List<PrivilegedOperation> ret = new ArrayList<>();
     ret.add(new PrivilegedOperation(

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsResourceCalculator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsResourceCalculator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsResourceCalculator.java
new file mode 100644
index 0000000..50ce3ea
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CGroupsResourceCalculator.java
@@ -0,0 +1,357 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.nodemanager.containermanager.linux.resources;
+
+import com.google.common.annotations.VisibleForTesting;
+import org.apache.commons.logging.Log;
+import org.apache.commons.logging.LogFactory;
+import org.apache.hadoop.util.CpuTimeTracker;
+import org.apache.hadoop.util.Shell;
+import org.apache.hadoop.util.SysInfoLinux;
+import org.apache.hadoop.yarn.exceptions.YarnException;
+import org.apache.hadoop.yarn.util.Clock;
+import org.apache.hadoop.yarn.util.ResourceCalculatorProcessTree;
+import org.apache.hadoop.yarn.util.SystemClock;
+
+import java.io.BufferedReader;
+import java.io.File;
+import java.io.FileInputStream;
+import java.io.IOException;
+import java.io.InputStreamReader;
+import java.math.BigInteger;
+import java.nio.charset.Charset;
+import java.util.function.Function;
+import java.util.regex.Matcher;
+import java.util.regex.Pattern;
+
+/**
+ * A cgroups file-system based Resource calculator without the process tree
+ * features.
+ *
+ * CGroups has its limitations. It can only be enabled, if both CPU and memory
+ * cgroups are enabled with yarn.nodemanager.resource.cpu.enabled and
+ * yarn.nodemanager.resource.memory.enabled respectively. This means that
+ * memory limits are enforced by default. You can turn this off and keep
+ * memory reporting only with yarn.nodemanager.resource.memory.enforced.
+ *
+ * Another limitation is virtual memory measurement. CGroups does not have the
+ * ability to measure virtual memory usage. This includes memory reserved but
+ * not used. CGroups measures used memory as sa sum of
+ * physical memory and swap usage. This will be returned in the virtual
+ * memory counters.
+ * If the real virtual memory is required please use the legacy procfs based
+ * resource calculator or CombinedResourceCalculator.
+ */
+public class CGroupsResourceCalculator extends ResourceCalculatorProcessTree {
+  enum Result {
+    Continue,
+    Exit
+  }
+  protected static final Log LOG = LogFactory
+      .getLog(CGroupsResourceCalculator.class);
+  private static final String PROCFS = "/proc";
+  static final String CGROUP = "cgroup";
+  static final String CPU_STAT = "cpuacct.stat";
+  static final String MEM_STAT = "memory.usage_in_bytes";
+  static final String MEMSW_STAT = "memory.memsw.usage_in_bytes";
+  private static final String USER = "user ";
+  private static final String SYSTEM = "system ";
+
+  private static final Pattern CGROUP_FILE_FORMAT = Pattern.compile(
+      "^(\\d+):([^:]+):/(.*)$");
+  private final String procfsDir;
+  private CGroupsHandler cGroupsHandler;
+
+  private String pid;
+  private File cpuStat;
+  private File memStat;
+  private File memswStat;
+
+  private BigInteger processTotalJiffies;
+  private long processPhysicalMemory;
+  private long processVirtualMemory;
+
+  private final long jiffyLengthMs;
+  private final CpuTimeTracker cpuTimeTracker;
+  private Clock clock;
+
+  /**
+   * Create resource calculator for all Yarn containers.
+   */
+  public CGroupsResourceCalculator()
+      throws YarnException {
+    this(null, PROCFS, ResourceHandlerModule.getCGroupsHandler(),
+        SystemClock.getInstance(), SysInfoLinux.JIFFY_LENGTH_IN_MILLIS);
+  }
+
+  /**
+   * Create resource calculator for the container that has the specified pid.
+   * @param pid A pid from the cgroup or null for all containers
+   */
+  public CGroupsResourceCalculator(String pid) {
+    this(pid, PROCFS, ResourceHandlerModule.getCGroupsHandler(),
+        SystemClock.getInstance(), SysInfoLinux.JIFFY_LENGTH_IN_MILLIS);
+  }
+
+  /**
+   * Create resource calculator for testing.
+   * @param pid A pid from the cgroup or null for all containers
+   * @param procfsDir Path to /proc or a mock /proc directory
+   * @param cGroupsHandler Initialized cgroups handler object
+   * @param clock A clock object
+   * @param jiffyLengthMs0 Jiffy length in milliseconds
+   */
+  @VisibleForTesting
+  CGroupsResourceCalculator(String pid, String procfsDir,
+                            CGroupsHandler cGroupsHandler,
+                            Clock clock,
+                            long jiffyLengthMs0) {
+    super(pid);
+    this.procfsDir = procfsDir;
+    this.cGroupsHandler = cGroupsHandler;
+    this.pid = pid != null && pid.equals("0") ? "1" : pid;
+    this.jiffyLengthMs = jiffyLengthMs0;
+    this.cpuTimeTracker =
+        new CpuTimeTracker(this.jiffyLengthMs);
+    this.clock = clock;
+    this.processTotalJiffies = BigInteger.ZERO;
+    this.processPhysicalMemory = UNAVAILABLE;
+    this.processVirtualMemory = UNAVAILABLE;
+  }
+
+  @Override
+  public void initialize() throws YarnException {
+    if (!CGroupsResourceCalculator.isAvailable()) {
+      throw new YarnException("CGroupsResourceCalculator is not available");
+    }
+    setCGroupFilePaths();
+  }
+
+  @Override
+  public float getCpuUsagePercent() {
+    if (LOG.isDebugEnabled()) {
+      LOG.debug("Process " + pid + " jiffies:" + processTotalJiffies);
+    }
+    return cpuTimeTracker.getCpuTrackerUsagePercent();
+  }
+
+  @Override
+  public long getCumulativeCpuTime() {
+    if (jiffyLengthMs < 0) {
+      return UNAVAILABLE;
+    }
+    return processTotalJiffies.longValue() * jiffyLengthMs;
+  }
+
+  @Override
+  public long getRssMemorySize(int olderThanAge) {
+    if (olderThanAge > 1) {
+      return UNAVAILABLE;
+    }
+    return processPhysicalMemory;
+  }
+
+  @Override
+  public long getVirtualMemorySize(int olderThanAge) {
+    if (olderThanAge > 1) {
+      return UNAVAILABLE;
+    }
+    return processVirtualMemory;
+  }
+
+  @Override
+  public void updateProcessTree() {
+    try {
+      this.processTotalJiffies = readTotalProcessJiffies();
+      cpuTimeTracker.updateElapsedJiffies(processTotalJiffies,
+          clock.getTime());
+    } catch (YarnException e) {
+      LOG.warn("Failed to parse " + pid, e);
+    }
+    processPhysicalMemory = getMemorySize(memStat);
+    if (memswStat.exists()) {
+      processVirtualMemory = getMemorySize(memswStat);
+    } else if(LOG.isDebugEnabled()) {
+      LOG.debug("Swap cgroups monitoring is not compiled into the kernel " +
+          memswStat.getAbsolutePath().toString());
+    }
+  }
+
+  @Override
+  public String getProcessTreeDump() {
+    // We do not have a process tree in cgroups return just the pid for tracking
+    return pid;
+  }
+
+  @Override
+  public boolean checkPidPgrpidForMatch() {
+    // We do not have a process tree in cgroups returning default ok
+    return true;
+  }
+
+  /**
+   * Checks if the CGroupsResourceCalculator is available on this system.
+   * This assumes that Linux container executor is already initialized.
+   *
+   * @return true if CGroupsResourceCalculator is available. False otherwise.
+   */
+  public static boolean isAvailable() {
+    try {
+      if (!Shell.LINUX) {
+        LOG.info("CGroupsResourceCalculator currently is supported only on "
+            + "Linux.");
+        return false;
+      }
+      if (ResourceHandlerModule.getCGroupsHandler() == null ||
+          ResourceHandlerModule.getCpuResourceHandler() == null ||
+          ResourceHandlerModule.getMemoryResourceHandler() == null) {
+        LOG.info("CGroupsResourceCalculator requires enabling CGroups" +
+            "cpu and memory");
+        return false;
+      }
+    } catch (SecurityException se) {
+      LOG.warn("Failed to get Operating System name. " + se);
+      return false;
+    }
+    return true;
+  }
+
+  private long getMemorySize(File cgroupUsageFile) {
+    long[] mem = new long[1];
+    try {
+      processFile(cgroupUsageFile, (String line) -> {
+        mem[0] = Long.parseLong(line);
+        return Result.Exit;
+      });
+      return mem[0];
+    } catch (YarnException e) {
+      LOG.warn("Failed to parse cgroups " + memswStat, e);
+    }
+    return UNAVAILABLE;
+  }
+
+  private BigInteger readTotalProcessJiffies() throws YarnException {
+    final BigInteger[] totalCPUTimeJiffies = new BigInteger[1];
+    totalCPUTimeJiffies[0] = BigInteger.ZERO;
+    processFile(cpuStat, (String line) -> {
+      if (line.startsWith(USER)) {
+        totalCPUTimeJiffies[0] = totalCPUTimeJiffies[0].add(
+            new BigInteger(line.substring(USER.length())));
+      }
+      if (line.startsWith(SYSTEM)) {
+        totalCPUTimeJiffies[0] = totalCPUTimeJiffies[0].add(
+            new BigInteger(line.substring(SYSTEM.length())));
+      }
+      return Result.Continue;
+    });
+    return totalCPUTimeJiffies[0];
+  }
+
+  private String getCGroupRelativePath(
+      CGroupsHandler.CGroupController controller)
+      throws YarnException {
+    if (pid == null) {
+      return cGroupsHandler.getRelativePathForCGroup("");
+    } else {
+      return getCGroupRelativePathForPid(controller);
+    }
+  }
+
+  private String getCGroupRelativePathForPid(
+      CGroupsHandler.CGroupController controller)
+      throws YarnException {
+    File pidCgroupFile = new File(new File(procfsDir, pid), CGROUP);
+    String[] result = new String[1];
+    processFile(pidCgroupFile, (String line)->{
+      Matcher m = CGROUP_FILE_FORMAT.matcher(line);
+      boolean mat = m.find();
+      if (mat) {
+        if (m.group(2).contains(controller.getName())) {
+          // Instead of returning the full path we compose it
+          // based on the last item as the container id
+          // This helps to avoid confusion within a privileged Docker container
+          // where the path is referred in /proc/<pid>/cgroup as
+          // /docker/<dcontainerid>/hadoop-yarn/<containerid>
+          // but it is /hadoop-yarn/<containerid> in the cgroups hierarchy
+          String cgroupPath = m.group(3);
+
+          if (cgroupPath != null) {
+            String cgroup =
+                new File(cgroupPath).toPath().getFileName().toString();
+            result[0] = cGroupsHandler.getRelativePathForCGroup(cgroup);
+          } else {
+            LOG.warn("Invalid cgroup path for " + pidCgroupFile);
+          }
+          return Result.Exit;
+        }
+      } else {
+        LOG.warn(
+            "Unexpected: cgroup file is not in the expected format"
+                + " for process with pid " + pid);
+      }
+      return Result.Continue;
+    });
+    if (result[0] == null) {
+      throw new YarnException(controller.getName() + " CGroup for pid " + pid +
+          " not found " + pidCgroupFile);
+    }
+    return result[0];
+  }
+
+  private void processFile(File file, Function<String, Result> processLine)
+      throws YarnException {
+    // Read "procfsDir/<pid>/stat" file - typically /proc/<pid>/stat
+    try (InputStreamReader fReader = new InputStreamReader(
+        new FileInputStream(file), Charset.forName("UTF-8"))) {
+      try (BufferedReader in = new BufferedReader(fReader)) {
+        try {
+          String str;
+          while ((str = in.readLine()) != null) {
+            Result result = processLine.apply(str);
+            if (result == Result.Exit) {
+              return;
+            }
+          }
+        } catch (IOException io) {
+          throw new YarnException("Error reading the stream " + io, io);
+        }
+      }
+    } catch (IOException f) {
+      throw new YarnException("The process vanished in the interim " + pid, f);
+    }
+  }
+
+  void setCGroupFilePaths() throws YarnException {
+    if (cGroupsHandler == null) {
+      throw new YarnException("CGroups handler is not initialized");
+    }
+    File cpuDir = new File(
+        cGroupsHandler.getControllerPath(
+            CGroupsHandler.CGroupController.CPUACCT),
+        getCGroupRelativePath(CGroupsHandler.CGroupController.CPUACCT));
+    File memDir = new File(
+        cGroupsHandler.getControllerPath(
+            CGroupsHandler.CGroupController.MEMORY),
+        getCGroupRelativePath(CGroupsHandler.CGroupController.MEMORY));
+    cpuStat = new File(cpuDir, CPU_STAT);
+    memStat = new File(memDir, MEM_STAT);
+    memswStat = new File(memDir, MEMSW_STAT);
+  }
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CombinedResourceCalculator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CombinedResourceCalculator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CombinedResourceCalculator.java
new file mode 100644
index 0000000..84b3ed0
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/CombinedResourceCalculator.java
@@ -0,0 +1,108 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.nodemanager.containermanager.linux.resources;
+
+import org.apache.commons.logging.Log;
+import org.apache.commons.logging.LogFactory;
+import org.apache.hadoop.yarn.exceptions.YarnException;
+import org.apache.hadoop.yarn.util.ProcfsBasedProcessTree;
+import org.apache.hadoop.yarn.util.ResourceCalculatorProcessTree;
+
+/**
+ * CombinedResourceCalculator is a resource calculator that uses cgroups but
+ * it is backward compatible with procfs in terms of virtual memory usage.
+ */
+public class CombinedResourceCalculator  extends ResourceCalculatorProcessTree {
+  protected static final Log LOG = LogFactory
+      .getLog(CombinedResourceCalculator.class);
+  private ProcfsBasedProcessTree procfs;
+  private CGroupsResourceCalculator cgroup;
+
+  public CombinedResourceCalculator(String pid) {
+    super(pid);
+    procfs = new ProcfsBasedProcessTree(pid);
+    cgroup = new CGroupsResourceCalculator(pid);
+  }
+
+  @Override
+  public void initialize() throws YarnException {
+    procfs.initialize();
+    cgroup.initialize();
+  }
+
+  @Override
+  public void updateProcessTree() {
+    procfs.updateProcessTree();
+    cgroup.updateProcessTree();
+  }
+
+  @Override
+  public String getProcessTreeDump() {
+    return procfs.getProcessTreeDump();
+  }
+
+  @Override
+  public float getCpuUsagePercent() {
+    float cgroupUsage = cgroup.getCpuUsagePercent();
+    if (LOG.isDebugEnabled()) {
+      float procfsUsage = procfs.getCpuUsagePercent();
+      LOG.debug("CPU Comparison:" + procfsUsage + " " + cgroupUsage);
+      LOG.debug("Jiffy Comparison:" +
+          procfs.getCumulativeCpuTime() + " " +
+          cgroup.getCumulativeCpuTime());
+    }
+
+    return cgroupUsage;
+  }
+
+  @Override
+  public boolean checkPidPgrpidForMatch() {
+    return procfs.checkPidPgrpidForMatch();
+  }
+
+  @Override
+  public long getCumulativeCpuTime() {
+    if (LOG.isDebugEnabled()) {
+      LOG.debug("CPU Comparison:" +
+          procfs.getCumulativeCpuTime() + " " +
+          cgroup.getCumulativeCpuTime());
+    }
+    return cgroup.getCumulativeCpuTime();
+  }
+
+  @Override
+  public long getRssMemorySize(int olderThanAge) {
+    if (LOG.isDebugEnabled()) {
+      LOG.debug("MEM Comparison:" +
+          procfs.getRssMemorySize(olderThanAge) + " " +
+          cgroup.getRssMemorySize(olderThanAge));
+    }
+    return cgroup.getRssMemorySize(olderThanAge);
+  }
+
+  @Override
+  public long getVirtualMemorySize(int olderThanAge) {
+    if (LOG.isDebugEnabled()) {
+      LOG.debug("VMEM Comparison:" +
+          procfs.getVirtualMemorySize(olderThanAge) + " " +
+          cgroup.getVirtualMemorySize(olderThanAge));
+    }
+    return procfs.getVirtualMemorySize(olderThanAge);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/ResourceHandlerModule.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/ResourceHandlerModule.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/ResourceHandlerModule.java
index 921f920..a02204d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/ResourceHandlerModule.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/ResourceHandlerModule.java
@@ -25,7 +25,6 @@ import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceStability;
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
-import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
 import org.apache.hadoop.yarn.server.nodemanager.Context;
 import org.apache.hadoop.yarn.server.nodemanager.containermanager.linux.privileged.PrivilegedOperationExecutor;
 import org.apache.hadoop.yarn.server.nodemanager.containermanager.resourceplugin.ResourcePlugin;
@@ -101,7 +100,27 @@ public class ResourceHandlerModule {
     return cGroupsHandler;
   }
 
-  private static CGroupsCpuResourceHandlerImpl getCGroupsCpuResourceHandler(
+  public static NetworkPacketTaggingHandlerImpl
+      getNetworkResourceHandler() {
+    return networkPacketTaggingHandlerImpl;
+  }
+
+  public static DiskResourceHandler
+      getDiskResourceHandler() {
+    return cGroupsBlkioResourceHandler;
+  }
+
+  public static MemoryResourceHandler
+      getMemoryResourceHandler() {
+    return cGroupsMemoryResourceHandler;
+  }
+
+  public static CpuResourceHandler
+      getCpuResourceHandler() {
+    return cGroupsCpuResourceHandler;
+  }
+
+  private static CGroupsCpuResourceHandlerImpl initCGroupsCpuResourceHandler(
       Configuration conf) throws ResourceHandlerException {
     boolean cgroupsCpuEnabled =
         conf.getBoolean(YarnConfiguration.NM_CPU_RESOURCE_ENABLED,
@@ -150,7 +169,7 @@ public class ResourceHandlerModule {
     }
   }
 
-  public static ResourceHandler getNetworkResourceHandler(Configuration conf)
+  public static ResourceHandler initNetworkResourceHandler(Configuration conf)
         throws ResourceHandlerException {
     boolean useNetworkTagHandler = conf.getBoolean(
         YarnConfiguration.NM_NETWORK_TAG_HANDLER_ENABLED,
@@ -181,12 +200,12 @@ public class ResourceHandlerModule {
   }
 
   public static OutboundBandwidthResourceHandler
-      getOutboundBandwidthResourceHandler(Configuration conf)
+      initOutboundBandwidthResourceHandler(Configuration conf)
       throws ResourceHandlerException {
     return getTrafficControlBandwidthHandler(conf);
   }
 
-  public static DiskResourceHandler getDiskResourceHandler(Configuration conf)
+  public static DiskResourceHandler initDiskResourceHandler(Configuration conf)
       throws ResourceHandlerException {
     if (conf.getBoolean(YarnConfiguration.NM_DISK_RESOURCE_ENABLED,
         YarnConfiguration.DEFAULT_NM_DISK_RESOURCE_ENABLED)) {
@@ -210,7 +229,7 @@ public class ResourceHandlerModule {
     return cGroupsBlkioResourceHandler;
   }
 
-  public static MemoryResourceHandler getMemoryResourceHandler(
+  public static MemoryResourceHandler initMemoryResourceHandler(
       Configuration conf) throws ResourceHandlerException {
     if (conf.getBoolean(YarnConfiguration.NM_MEMORY_RESOURCE_ENABLED,
         YarnConfiguration.DEFAULT_NM_MEMORY_RESOURCE_ENABLED)) {
@@ -246,10 +265,14 @@ public class ResourceHandlerModule {
       throws ResourceHandlerException {
     ArrayList<ResourceHandler> handlerList = new ArrayList<>();
 
-    addHandlerIfNotNull(handlerList, getNetworkResourceHandler(conf));
-    addHandlerIfNotNull(handlerList, getDiskResourceHandler(conf));
-    addHandlerIfNotNull(handlerList, getMemoryResourceHandler(conf));
-    addHandlerIfNotNull(handlerList, getCGroupsCpuResourceHandler(conf));
+    addHandlerIfNotNull(handlerList,
+        initNetworkResourceHandler(conf));
+    addHandlerIfNotNull(handlerList,
+        initDiskResourceHandler(conf));
+    addHandlerIfNotNull(handlerList,
+        initMemoryResourceHandler(conf));
+    addHandlerIfNotNull(handlerList,
+        initCGroupsCpuResourceHandler(conf));
     addHandlersFromConfiguredResourcePlugins(handlerList, conf, nmContext);
     resourceHandlerChain = new ResourceHandlerChain(handlerList);
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/monitor/ContainersMonitorImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/monitor/ContainersMonitorImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/monitor/ContainersMonitorImpl.java
index 23c89c0..33986a0 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/monitor/ContainersMonitorImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/monitor/ContainersMonitorImpl.java
@@ -215,15 +215,25 @@ public class ContainersMonitorImpl extends AbstractService implements
         YarnConfiguration.DEFAULT_NM_CONTAINER_MONITOR_ENABLED);
   }
 
+  /**
+   * Get the best process tree calculator.
+   * @param pId container process id
+   * @return process tree calculator
+   */
+  private ResourceCalculatorProcessTree
+      getResourceCalculatorProcessTree(String pId) {
+    return ResourceCalculatorProcessTree.
+        getResourceCalculatorProcessTree(
+            pId, processTreeClass, conf);
+  }
+
   private boolean isResourceCalculatorAvailable() {
     if (resourceCalculatorPlugin == null) {
       LOG.info("ResourceCalculatorPlugin is unavailable on this system. " + this
           .getClass().getName() + " is disabled.");
       return false;
     }
-    if (ResourceCalculatorProcessTree
-        .getResourceCalculatorProcessTree("0", processTreeClass, conf)
-        == null) {
+    if (getResourceCalculatorProcessTree("0") == null) {
       LOG.info("ResourceCalculatorProcessTree is unavailable on this system. "
           + this.getClass().getName() + " is disabled.");
       return false;
@@ -535,9 +545,7 @@ public class ContainersMonitorImpl extends AbstractService implements
             LOG.debug("Tracking ProcessTree " + pId + " for the first time");
           }
           ResourceCalculatorProcessTree pt =
-                  ResourceCalculatorProcessTree.
-                        getResourceCalculatorProcessTree(
-                            pId, processTreeClass, conf);
+              getResourceCalculatorProcessTree(pId);
           ptInfo.setPid(pId);
           ptInfo.setProcessTree(pt);
 
@@ -599,11 +607,14 @@ public class ContainersMonitorImpl extends AbstractService implements
       long pmemLimit = ptInfo.getPmemLimit();
       if (AUDITLOG.isDebugEnabled()) {
         AUDITLOG.debug(String.format(
-                "Memory usage of ProcessTree %s for container-id %s: ",
-                pId, containerId.toString()) +
-                formatUsageString(
-                      currentVmemUsage, vmemLimit,
-                      currentPmemUsage, pmemLimit));
+            "Resource usage of ProcessTree %s for container-id %s:" +
+                " %s CPU:%f CPU/core:%f",
+            pId, containerId.toString(),
+            formatUsageString(
+                currentVmemUsage, vmemLimit,
+                currentPmemUsage, pmemLimit),
+            cpuUsagePercentPerCore,
+            cpuUsageTotalCoresPercentage));
       }
 
       // Add resource utilization for this container

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsMemoryResourceHandlerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsMemoryResourceHandlerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsMemoryResourceHandlerImpl.java
index 8fd5a9d..78ccc61 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsMemoryResourceHandlerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsMemoryResourceHandlerImpl.java
@@ -149,6 +149,51 @@ public class TestCGroupsMemoryResourceHandlerImpl {
   }
 
   @Test
+  public void testPreStartNonEnforced() throws Exception {
+    Configuration conf = new Configuration();
+    conf.setBoolean(YarnConfiguration.NM_PMEM_CHECK_ENABLED, false);
+    conf.setBoolean(YarnConfiguration.NM_VMEM_CHECK_ENABLED, false);
+    conf.setBoolean(YarnConfiguration.NM_MEMORY_RESOURCE_ENFORCED, false);
+    cGroupsMemoryResourceHandler.bootstrap(conf);
+    String id = "container_01_01";
+    String path = "test-path/" + id;
+    ContainerId mockContainerId = mock(ContainerId.class);
+    when(mockContainerId.toString()).thenReturn(id);
+    Container mockContainer = mock(Container.class);
+    when(mockContainer.getContainerId()).thenReturn(mockContainerId);
+    when(mockCGroupsHandler
+        .getPathForCGroupTasks(CGroupsHandler.CGroupController.MEMORY, id))
+        .thenReturn(path);
+    int memory = 1024;
+    when(mockContainer.getResource())
+        .thenReturn(Resource.newInstance(memory, 1));
+    List<PrivilegedOperation> ret =
+        cGroupsMemoryResourceHandler.preStart(mockContainer);
+    verify(mockCGroupsHandler, times(1))
+        .createCGroup(CGroupsHandler.CGroupController.MEMORY, id);
+    verify(mockCGroupsHandler, times(0))
+        .updateCGroupParam(CGroupsHandler.CGroupController.MEMORY, id,
+            CGroupsHandler.CGROUP_PARAM_MEMORY_HARD_LIMIT_BYTES,
+            String.valueOf(memory) + "M");
+    verify(mockCGroupsHandler, times(0))
+        .updateCGroupParam(CGroupsHandler.CGroupController.MEMORY, id,
+            CGroupsHandler.CGROUP_PARAM_MEMORY_SOFT_LIMIT_BYTES,
+            String.valueOf((int) (memory * 0.9)) + "M");
+    verify(mockCGroupsHandler, times(0))
+        .updateCGroupParam(CGroupsHandler.CGroupController.MEMORY, id,
+            CGroupsHandler.CGROUP_PARAM_MEMORY_SWAPPINESS, String.valueOf(0));
+    Assert.assertNotNull(ret);
+    Assert.assertEquals(1, ret.size());
+    PrivilegedOperation op = ret.get(0);
+    Assert.assertEquals(PrivilegedOperation.OperationType.ADD_PID_TO_CGROUP,
+        op.getOperationType());
+    List<String> args = op.getArguments();
+    Assert.assertEquals(1, args.size());
+    Assert.assertEquals(PrivilegedOperation.CGROUP_ARG_PREFIX + path,
+        args.get(0));
+  }
+
+  @Test
   public void testReacquireContainer() throws Exception {
     ContainerId containerIdMock = mock(ContainerId.class);
     Assert.assertNull(

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsResourceCalculator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsResourceCalculator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsResourceCalculator.java
new file mode 100644
index 0000000..a2ad11f
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCGroupsResourceCalculator.java
@@ -0,0 +1,274 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.nodemanager.containermanager.linux.resources;
+
+import org.apache.commons.io.FileUtils;
+import org.apache.hadoop.yarn.exceptions.YarnException;
+import org.apache.hadoop.yarn.util.ControlledClock;
+import org.apache.hadoop.yarn.util.ResourceCalculatorProcessTree;
+import org.junit.Assert;
+import org.junit.Test;
+
+import java.io.File;
+
+import static org.mockito.Mockito.*;
+
+/**
+ * Unit test for CGroupsResourceCalculator.
+ */
+public class TestCGroupsResourceCalculator {
+
+  private ControlledClock clock = new ControlledClock();
+  private CGroupsHandler cGroupsHandler = mock(CGroupsHandler.class);
+  private String basePath = "/tmp/" + this.getClass().getName();
+
+  public TestCGroupsResourceCalculator() {
+    when(cGroupsHandler.getRelativePathForCGroup("container_1"))
+        .thenReturn("/yarn/container_1");
+    when(cGroupsHandler.getRelativePathForCGroup("")).thenReturn("/yarn/");
+  }
+
+  @Test(expected = YarnException.class)
+  public void testPidNotFound() throws Exception {
+    CGroupsResourceCalculator calculator =
+        new CGroupsResourceCalculator(
+            "1234", ".", cGroupsHandler, clock, 10);
+    calculator.setCGroupFilePaths();
+    Assert.assertEquals("Expected exception", null, calculator);
+  }
+
+  @Test(expected = YarnException.class)
+  public void testNoMemoryCGgroupMount() throws Exception {
+    File procfs = new File(basePath + "/1234");
+    Assert.assertTrue("Setup error", procfs.mkdirs());
+    try {
+      FileUtils.writeStringToFile(
+          new File(procfs, CGroupsResourceCalculator.CGROUP),
+          "7:devices:/yarn/container_1\n" +
+              "6:cpuacct,cpu:/yarn/container_1\n" +
+              "5:pids:/yarn/container_1\n");
+      CGroupsResourceCalculator calculator =
+          new CGroupsResourceCalculator(
+              "1234", basePath,
+              cGroupsHandler, clock, 10);
+      calculator.setCGroupFilePaths();
+      Assert.assertEquals("Expected exception", null, calculator);
+    } finally {
+      FileUtils.deleteDirectory(new File(basePath));
+    }
+  }
+
+  @Test
+  public void testCGgroupNotFound() throws Exception {
+    File procfs = new File(basePath + "/1234");
+    Assert.assertTrue("Setup error", procfs.mkdirs());
+    try {
+      FileUtils.writeStringToFile(
+          new File(procfs, CGroupsResourceCalculator.CGROUP),
+          "7:devices:/yarn/container_1\n" +
+              "6:cpuacct,cpu:/yarn/container_1\n" +
+              "5:pids:/yarn/container_1\n" +
+              "4:memory:/yarn/container_1\n");
+
+      CGroupsResourceCalculator calculator =
+          new CGroupsResourceCalculator(
+              "1234", basePath,
+              cGroupsHandler, clock, 10);
+      calculator.setCGroupFilePaths();
+      calculator.updateProcessTree();
+      Assert.assertEquals("cgroups should be missing",
+          (long)ResourceCalculatorProcessTree.UNAVAILABLE,
+          calculator.getRssMemorySize(0));
+    } finally {
+      FileUtils.deleteDirectory(new File(basePath));
+    }
+  }
+
+  @Test
+  public void testCPUParsing() throws Exception {
+    File cgcpuacctDir =
+        new File(basePath + "/cgcpuacct");
+    File cgcpuacctContainerDir =
+        new File(cgcpuacctDir, "/yarn/container_1");
+    File procfs = new File(basePath + "/1234");
+    when(cGroupsHandler.getControllerPath(
+        CGroupsHandler.CGroupController.CPUACCT)).
+        thenReturn(cgcpuacctDir.getAbsolutePath());
+    Assert.assertTrue("Setup error", procfs.mkdirs());
+    Assert.assertTrue("Setup error", cgcpuacctContainerDir.mkdirs());
+    try {
+      FileUtils.writeStringToFile(
+          new File(procfs, CGroupsResourceCalculator.CGROUP),
+          "7:devices:/yarn/container_1\n" +
+              "6:cpuacct,cpu:/yarn/container_1\n" +
+              "5:pids:/yarn/container_1\n" +
+              "4:memory:/yarn/container_1\n");
+      FileUtils.writeStringToFile(
+          new File(cgcpuacctContainerDir, CGroupsResourceCalculator.CPU_STAT),
+          "Can you handle this?\n" +
+              "user 5415\n" +
+              "system 3632");
+      CGroupsResourceCalculator calculator =
+          new CGroupsResourceCalculator(
+              "1234", basePath,
+              cGroupsHandler, clock, 10);
+      calculator.setCGroupFilePaths();
+      calculator.updateProcessTree();
+      Assert.assertEquals("Incorrect CPU usage",
+          90470,
+          calculator.getCumulativeCpuTime());
+    } finally {
+      FileUtils.deleteDirectory(new File(basePath));
+    }
+  }
+
+  @Test
+  public void testMemoryParsing() throws Exception {
+    File cgcpuacctDir =
+        new File(basePath + "/cgcpuacct");
+    File cgcpuacctContainerDir =
+        new File(cgcpuacctDir, "/yarn/container_1");
+    File cgmemoryDir =
+        new File(basePath + "/memory");
+    File cgMemoryContainerDir =
+        new File(cgmemoryDir, "/yarn/container_1");
+    File procfs = new File(basePath + "/1234");
+    when(cGroupsHandler.getControllerPath(
+        CGroupsHandler.CGroupController.MEMORY)).
+        thenReturn(cgmemoryDir.getAbsolutePath());
+    Assert.assertTrue("Setup error", procfs.mkdirs());
+    Assert.assertTrue("Setup error", cgcpuacctContainerDir.mkdirs());
+    Assert.assertTrue("Setup error", cgMemoryContainerDir.mkdirs());
+    try {
+      FileUtils.writeStringToFile(
+          new File(procfs, CGroupsResourceCalculator.CGROUP),
+              "6:cpuacct,cpu:/yarn/container_1\n" +
+              "4:memory:/yarn/container_1\n");
+      FileUtils.writeStringToFile(
+          new File(cgMemoryContainerDir, CGroupsResourceCalculator.MEM_STAT),
+          "418496512\n");
+
+      CGroupsResourceCalculator calculator =
+          new CGroupsResourceCalculator(
+              "1234", basePath,
+              cGroupsHandler, clock, 10);
+      calculator.setCGroupFilePaths();
+
+      calculator.updateProcessTree();
+      // Test the case where memsw is not available (Ubuntu)
+      Assert.assertEquals("Incorrect memory usage",
+          418496512,
+          calculator.getRssMemorySize());
+      Assert.assertEquals("Incorrect swap usage",
+          (long)ResourceCalculatorProcessTree.UNAVAILABLE,
+          calculator.getVirtualMemorySize());
+
+      // Test the case where memsw is available
+      FileUtils.writeStringToFile(
+          new File(cgMemoryContainerDir, CGroupsResourceCalculator.MEMSW_STAT),
+          "418496513\n");
+      calculator.updateProcessTree();
+      Assert.assertEquals("Incorrect swap usage",
+          418496513,
+          calculator.getVirtualMemorySize());
+    } finally {
+      FileUtils.deleteDirectory(new File(basePath));
+    }
+  }
+
+  @Test
+  public void testCPUParsingRoot() throws Exception {
+    File cgcpuacctDir =
+        new File(basePath + "/cgcpuacct");
+    File cgcpuacctRootDir =
+        new File(cgcpuacctDir, "/yarn");
+    when(cGroupsHandler.getControllerPath(
+        CGroupsHandler.CGroupController.CPUACCT)).
+        thenReturn(cgcpuacctDir.getAbsolutePath());
+    Assert.assertTrue("Setup error", cgcpuacctRootDir.mkdirs());
+    try {
+      FileUtils.writeStringToFile(
+          new File(cgcpuacctRootDir, CGroupsResourceCalculator.CPU_STAT),
+              "user 5415\n" +
+              "system 3632");
+      CGroupsResourceCalculator calculator =
+          new CGroupsResourceCalculator(
+              null, basePath,
+              cGroupsHandler, clock, 10);
+      calculator.setCGroupFilePaths();
+      calculator.updateProcessTree();
+      Assert.assertEquals("Incorrect CPU usage",
+          90470,
+          calculator.getCumulativeCpuTime());
+    } finally {
+      FileUtils.deleteDirectory(new File(basePath));
+    }
+  }
+
+  @Test
+  public void testMemoryParsingRoot() throws Exception {
+    File cgcpuacctDir =
+        new File(basePath + "/cgcpuacct");
+    File cgcpuacctRootDir =
+        new File(cgcpuacctDir, "/yarn");
+    File cgmemoryDir =
+        new File(basePath + "/memory");
+    File cgMemoryRootDir =
+        new File(cgmemoryDir, "/yarn");
+    File procfs = new File(basePath + "/1234");
+    when(cGroupsHandler.getControllerPath(
+        CGroupsHandler.CGroupController.MEMORY)).
+        thenReturn(cgmemoryDir.getAbsolutePath());
+    Assert.assertTrue("Setup error", procfs.mkdirs());
+    Assert.assertTrue("Setup error", cgcpuacctRootDir.mkdirs());
+    Assert.assertTrue("Setup error", cgMemoryRootDir.mkdirs());
+    try {
+      FileUtils.writeStringToFile(
+          new File(cgMemoryRootDir, CGroupsResourceCalculator.MEM_STAT),
+          "418496512\n");
+
+      CGroupsResourceCalculator calculator =
+          new CGroupsResourceCalculator(
+              null, basePath,
+              cGroupsHandler, clock, 10);
+      calculator.setCGroupFilePaths();
+
+      calculator.updateProcessTree();
+
+      // Test the case where memsw is not available (Ubuntu)
+      Assert.assertEquals("Incorrect memory usage",
+          418496512,
+          calculator.getRssMemorySize());
+      Assert.assertEquals("Incorrect swap usage",
+          (long)ResourceCalculatorProcessTree.UNAVAILABLE,
+          calculator.getVirtualMemorySize());
+
+      // Test the case where memsw is available
+      FileUtils.writeStringToFile(
+          new File(cgMemoryRootDir, CGroupsResourceCalculator.MEMSW_STAT),
+          "418496513\n");
+      calculator.updateProcessTree();
+      Assert.assertEquals("Incorrect swap usage",
+          418496513,
+          calculator.getVirtualMemorySize());
+    } finally {
+      FileUtils.deleteDirectory(new File(basePath));
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCompareResourceCalculators.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCompareResourceCalculators.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCompareResourceCalculators.java
new file mode 100644
index 0000000..8be0590
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestCompareResourceCalculators.java
@@ -0,0 +1,227 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.nodemanager.containermanager.linux.resources;
+
+
+import org.apache.commons.lang3.SystemUtils;
+import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.apache.hadoop.yarn.exceptions.YarnException;
+import org.apache.hadoop.yarn.server.nodemanager.Context;
+import org.apache.hadoop.yarn.util.ProcfsBasedProcessTree;
+import org.apache.hadoop.yarn.util.ResourceCalculatorProcessTree;
+import org.junit.*;
+
+import java.io.File;
+import java.io.IOException;
+import java.lang.reflect.Field;
+import java.util.Random;
+
+import static org.mockito.Mockito.mock;
+
+/**
+ * Functional test for CGroupsResourceCalculator to compare two resource
+ * calculators. It is OS dependent.
+ * Ignored in automated tests due to flakiness by design.
+ */
+public class TestCompareResourceCalculators {
+  private Process target = null;
+  private String cgroup = null;
+  private String cgroupCPU = null;
+  private String cgroupMemory = null;
+  public static final long SHMEM_KB = 100 * 1024;
+
+  @Before
+  public void setup() throws IOException, YarnException {
+    Assume.assumeTrue(SystemUtils.IS_OS_LINUX);
+
+    YarnConfiguration conf = new YarnConfiguration();
+    conf.set(YarnConfiguration.NM_LINUX_CONTAINER_CGROUPS_HIERARCHY,
+        "TestCompareResourceCalculators");
+    conf.setBoolean(YarnConfiguration.NM_LINUX_CONTAINER_CGROUPS_MOUNT, false);
+    conf.setStrings(YarnConfiguration.NM_LINUX_CONTAINER_CGROUPS_MOUNT_PATH,
+        "/sys/fs/cgroup");
+    conf.setBoolean(YarnConfiguration.NM_CPU_RESOURCE_ENABLED, true);
+    ResourceHandlerChain module = null;
+    try {
+      module = ResourceHandlerModule.getConfiguredResourceHandlerChain(conf,
+          mock(Context.class));
+    } catch (ResourceHandlerException e) {
+      throw new YarnException("Cannot access cgroups", e);
+    }
+    Assume.assumeNotNull(module);
+    Assume.assumeNotNull(
+        ResourceHandlerModule.getCGroupsHandler()
+            .getControllerPath(CGroupsHandler.CGroupController.CPU));
+    Assume.assumeNotNull(
+        ResourceHandlerModule.getCGroupsHandler()
+            .getControllerPath(CGroupsHandler.CGroupController.MEMORY));
+
+    Random random = new Random(System.currentTimeMillis());
+    cgroup = Long.toString(random.nextLong());
+    cgroupCPU = ResourceHandlerModule.getCGroupsHandler()
+        .getPathForCGroup(CGroupsHandler.CGroupController.CPU, cgroup);
+    cgroupMemory = ResourceHandlerModule.getCGroupsHandler()
+        .getPathForCGroup(CGroupsHandler.CGroupController.MEMORY, cgroup);
+  }
+
+  @After
+  public void tearDown() throws YarnException {
+    stopTestProcess();
+  }
+
+
+  // Ignored in automated tests due to flakiness by design
+  @Ignore
+  @Test
+  public void testCompareResults()
+      throws YarnException, InterruptedException, IOException {
+
+    startTestProcess();
+
+    ProcfsBasedProcessTree legacyCalculator =
+        new ProcfsBasedProcessTree(Long.toString(getPid()));
+    CGroupsResourceCalculator cgroupsCalculator =
+        new CGroupsResourceCalculator(Long.toString(getPid()));
+    cgroupsCalculator.setCGroupFilePaths();
+
+    for (int i = 0; i < 5; ++i) {
+      Thread.sleep(3000);
+      compareMetrics(legacyCalculator, cgroupsCalculator);
+    }
+
+    stopTestProcess();
+
+    ensureCleanedUp(legacyCalculator, cgroupsCalculator);
+  }
+
+  private void ensureCleanedUp(
+          ResourceCalculatorProcessTree metric1,
+          ResourceCalculatorProcessTree metric2) {
+    metric1.updateProcessTree();
+    metric2.updateProcessTree();
+    long pmem1 = metric1.getRssMemorySize(0);
+    long pmem2 = metric2.getRssMemorySize(0);
+    System.out.println(pmem1 + " " + pmem2);
+    Assert.assertTrue("pmem should be invalid " + pmem1 + " " + pmem2,
+            pmem1 == ResourceCalculatorProcessTree.UNAVAILABLE &&
+                    pmem2 == ResourceCalculatorProcessTree.UNAVAILABLE);
+    long vmem1 = metric1.getRssMemorySize(0);
+    long vmem2 = metric2.getRssMemorySize(0);
+    System.out.println(vmem1 + " " + vmem2);
+    Assert.assertTrue("vmem Error outside range " + vmem1 + " " + vmem2,
+            vmem1 == ResourceCalculatorProcessTree.UNAVAILABLE &&
+                    vmem2 == ResourceCalculatorProcessTree.UNAVAILABLE);
+    float cpu1 = metric1.getCpuUsagePercent();
+    float cpu2 = metric2.getCpuUsagePercent();
+    // TODO ProcfsBasedProcessTree may report negative on process exit
+    Assert.assertTrue("CPU% Error outside range " + cpu1 + " " + cpu2,
+            cpu1 == 0 && cpu2 == 0);
+  }
+
+  private void compareMetrics(
+      ResourceCalculatorProcessTree metric1,
+      ResourceCalculatorProcessTree metric2) {
+    metric1.updateProcessTree();
+    metric2.updateProcessTree();
+    long pmem1 = metric1.getRssMemorySize(0);
+    long pmem2 = metric2.getRssMemorySize(0);
+    // TODO The calculation is different and cgroup
+    // can report a small amount after process stop
+    // This is not an issue since the cgroup is deleted
+    System.out.println(pmem1 + " " + (pmem2 - SHMEM_KB * 1024));
+    Assert.assertTrue("pmem Error outside range " + pmem1 + " " + pmem2,
+        Math.abs(pmem1 - (pmem2 - SHMEM_KB * 1024)) < 5000000);
+    long vmem1 = metric1.getRssMemorySize(0);
+    long vmem2 = metric2.getRssMemorySize(0);
+    System.out.println(vmem1 + " " + (vmem2 - SHMEM_KB * 1024));
+    // TODO The calculation is different and cgroup
+    // can report a small amount after process stop
+    // This is not an issue since the cgroup is deleted
+    Assert.assertTrue("vmem Error outside range " + vmem1 + " " + vmem2,
+        Math.abs(vmem1 - (vmem2 - SHMEM_KB * 1024)) < 5000000);
+    float cpu1 = metric1.getCpuUsagePercent();
+    float cpu2 = metric2.getCpuUsagePercent();
+    if (cpu1 > 0) {
+      // TODO ProcfsBasedProcessTree may report negative on process exit
+      Assert.assertTrue("CPU% Error outside range " + cpu1 + " " + cpu2,
+              Math.abs(cpu2 - cpu1) < 10);
+    }
+  }
+
+  private void startTestProcess() throws IOException {
+    ProcessBuilder builder = new ProcessBuilder();
+    String script =
+        "mkdir -p " + cgroupCPU + ";" +
+        "echo $$ >" + cgroupCPU + "/tasks;" +
+        "mkdir -p " + cgroupMemory + ";" +
+        "echo $$ >" + cgroupMemory + "/tasks;" +
+        "dd if=/dev/zero of=/dev/shm/" +
+            cgroup + " bs=1k count=" + SHMEM_KB + ";" +
+        "dd if=/dev/zero of=/dev/null bs=1k &" +
+        "echo $! >/tmp/\" + cgroup + \".pid;" +
+        //"echo while [ -f /tmp/" + cgroup + ".pid ]; do sleep 1; done;" +
+        "sleep 10000;" +
+        "echo kill $(jobs -p);";
+    builder.command("bash", "-c", script);
+    builder.redirectError(new File("/tmp/a.txt"));
+    builder.redirectOutput(new File("/tmp/b.txt"));
+    target = builder.start();
+  }
+
+  private void stopTestProcess() throws YarnException {
+    if (target != null) {
+      target.destroyForcibly();
+      target = null;
+    }
+    try {
+      ProcessBuilder builder = new ProcessBuilder();
+      String script =
+          "rm -f /dev/shm/" + cgroup + ";" +
+          "cat " + cgroupCPU + "/tasks | xargs kill;" +
+          "rm -f /tmp/" + cgroup + ".pid;" +
+          "sleep 4;" +
+          "rmdir " + cgroupCPU + ";" +
+          "rmdir " + cgroupMemory + ";";
+      builder.command("bash", "-c", script);
+      Process cleanup = builder.start();
+      cleanup.waitFor();
+    } catch (IOException|InterruptedException e) {
+      throw new YarnException("Could not clean up", e);
+    }
+  }
+
+  private long getPid() throws YarnException {
+    Class processClass = target.getClass();
+    if (processClass.getName().equals("java.lang.UNIXProcess")) {
+      try {
+        Field pidField = processClass.getDeclaredField("pid");
+        pidField.setAccessible(true);
+        long pid = pidField.getLong(target);
+        pidField.setAccessible(false);
+        return pid;
+      } catch (NoSuchFieldException|IllegalAccessException e) {
+        throw new YarnException("Reflection error", e);
+      }
+    } else {
+      throw new YarnException("Not Unix " + processClass.getName());
+    }
+  }
+
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/649ef7ac/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestResourceHandlerModule.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestResourceHandlerModule.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestResourceHandlerModule.java
index 0563694..9456303 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestResourceHandlerModule.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/resources/TestResourceHandlerModule.java
@@ -36,8 +36,8 @@ import static org.mockito.Mockito.mock;
 public class TestResourceHandlerModule {
   private static final Logger LOG =
        LoggerFactory.getLogger(TestResourceHandlerModule.class);
-  Configuration emptyConf;
-  Configuration networkEnabledConf;
+  private Configuration emptyConf;
+  private Configuration networkEnabledConf;
 
   @Before
   public void setup() throws Exception {
@@ -55,23 +55,28 @@ public class TestResourceHandlerModule {
       //This resourceHandler should be non-null only if network as a resource
       //is explicitly enabled
       OutboundBandwidthResourceHandler resourceHandler = ResourceHandlerModule
-          .getOutboundBandwidthResourceHandler(emptyConf);
+          .initOutboundBandwidthResourceHandler(emptyConf);
       Assert.assertNull(resourceHandler);
 
       //When network as a resource is enabled this should be non-null
       resourceHandler = ResourceHandlerModule
-          .getOutboundBandwidthResourceHandler(networkEnabledConf);
+          .initOutboundBandwidthResourceHandler(networkEnabledConf);
       Assert.assertNotNull(resourceHandler);
 
       //Ensure that outbound bandwidth resource handler is present in the chain
       ResourceHandlerChain resourceHandlerChain = ResourceHandlerModule
-          .getConfiguredResourceHandlerChain(networkEnabledConf, mock(Context.class));
-      List<ResourceHandler> resourceHandlers = resourceHandlerChain
-          .getResourceHandlerList();
-      //Exactly one resource handler in chain
-      Assert.assertEquals(resourceHandlers.size(), 1);
-      //Same instance is expected to be in the chain.
-      Assert.assertTrue(resourceHandlers.get(0) == resourceHandler);
+          .getConfiguredResourceHandlerChain(networkEnabledConf,
+              mock(Context.class));
+      if (resourceHandlerChain != null) {
+        List<ResourceHandler> resourceHandlers = resourceHandlerChain
+            .getResourceHandlerList();
+        //Exactly one resource handler in chain
+        Assert.assertEquals(resourceHandlers.size(), 1);
+        //Same instance is expected to be in the chain.
+        Assert.assertTrue(resourceHandlers.get(0) == resourceHandler);
+      } else {
+        Assert.fail("Null returned");
+      }
     } catch (ResourceHandlerException e) {
       Assert.fail("Unexpected ResourceHandlerException: " + e);
     }
@@ -81,23 +86,27 @@ public class TestResourceHandlerModule {
   public void testDiskResourceHandler() throws Exception {
 
     DiskResourceHandler handler =
-        ResourceHandlerModule.getDiskResourceHandler(emptyConf);
+        ResourceHandlerModule.initDiskResourceHandler(emptyConf);
     Assert.assertNull(handler);
 
     Configuration diskConf = new YarnConfiguration();
     diskConf.setBoolean(YarnConfiguration.NM_DISK_RESOURCE_ENABLED, true);
 
-    handler = ResourceHandlerModule.getDiskResourceHandler(diskConf);
+    handler = ResourceHandlerModule.initDiskResourceHandler(diskConf);
     Assert.assertNotNull(handler);
 
     ResourceHandlerChain resourceHandlerChain =
         ResourceHandlerModule.getConfiguredResourceHandlerChain(diskConf,
             mock(Context.class));
-    List<ResourceHandler> resourceHandlers =
-        resourceHandlerChain.getResourceHandlerList();
-    // Exactly one resource handler in chain
-    Assert.assertEquals(resourceHandlers.size(), 1);
-    // Same instance is expected to be in the chain.
-    Assert.assertTrue(resourceHandlers.get(0) == handler);
+    if (resourceHandlerChain != null) {
+      List<ResourceHandler> resourceHandlers =
+          resourceHandlerChain.getResourceHandlerList();
+      // Exactly one resource handler in chain
+      Assert.assertEquals(resourceHandlers.size(), 1);
+      // Same instance is expected to be in the chain.
+      Assert.assertTrue(resourceHandlers.get(0) == handler);
+    } else {
+      Assert.fail("Null returned");
+    }
   }
 }
\ No newline at end of file


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[02/50] [abbrv] hadoop git commit: YARN-7797. Docker host network can not obtain IP address for RegistryDNS. Contributed by Eric Yang

Posted by as...@apache.org.
YARN-7797. Docker host network can not obtain IP address for RegistryDNS. Contributed by Eric Yang


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/f2fa736f
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/f2fa736f
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/f2fa736f

Branch: refs/heads/YARN-6592
Commit: f2fa736f0ab139b5251d115fd75b833d1d7d1dcd
Parents: 56872cf
Author: Billie Rinaldi <bi...@apache.org>
Authored: Fri Jan 26 09:32:23 2018 -0800
Committer: Billie Rinaldi <bi...@apache.org>
Committed: Fri Jan 26 09:32:23 2018 -0800

----------------------------------------------------------------------
 .../runtime/DockerLinuxContainerRuntime.java    | 28 ++++++++++++++++++++
 1 file changed, 28 insertions(+)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/f2fa736f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java
index 2868dea..f3ce73d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java
@@ -58,6 +58,8 @@ import org.apache.hadoop.yarn.server.nodemanager.containermanager.runtime.Contai
 import org.apache.hadoop.yarn.server.nodemanager.containermanager.runtime.ContainerRuntimeConstants;
 import org.apache.hadoop.yarn.server.nodemanager.containermanager.runtime.ContainerRuntimeContext;
 
+import java.net.InetAddress;
+import java.net.UnknownHostException;
 import java.nio.file.Files;
 import java.nio.file.Paths;
 import java.util.ArrayList;
@@ -1013,6 +1015,32 @@ public class DockerLinuxContainerRuntime implements LinuxContainerRuntime {
       }
       String ips = output.substring(0, index).trim();
       String host = output.substring(index+1).trim();
+      if (ips.equals("")) {
+        String network;
+        try {
+          network = container.getLaunchContext().getEnvironment()
+              .get("YARN_CONTAINER_RUNTIME_DOCKER_CONTAINER_NETWORK");
+          if (network == null || network.isEmpty()) {
+            network = defaultNetwork;
+          }
+        } catch (NullPointerException e) {
+          network = defaultNetwork;
+        }
+        boolean useHostNetwork = network.equalsIgnoreCase("host");
+        if (useHostNetwork) {
+          // Report back node manager IP in the event where docker
+          // inspect reports no IP address.  This is for bridging a gap for
+          // docker environment to run with host network.
+          InetAddress address;
+          try {
+            address = InetAddress.getLocalHost();
+            ips = address.getHostAddress();
+          } catch (UnknownHostException e) {
+            LOG.error("Can not determine IP for container:"
+                + containerId);
+          }
+        }
+      }
       String[] ipAndHost = new String[2];
       ipAndHost[0] = ips;
       ipAndHost[1] = host;


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[32/50] [abbrv] hadoop git commit: YARN-7653. Node group support for AllocationTagsManager. (Panagiotis Garefalakis via asuresh)

Posted by as...@apache.org.
YARN-7653. Node group support for AllocationTagsManager. (Panagiotis Garefalakis via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/e724972b
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/e724972b
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/e724972b

Branch: refs/heads/YARN-6592
Commit: e724972bf756bafaf395d05748d940d8d68b09bd
Parents: c83ef6f
Author: Arun Suresh <as...@apache.org>
Authored: Fri Dec 22 07:24:37 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../server/resourcemanager/ResourceManager.java |   2 +-
 .../constraint/AllocationTagsManager.java       | 282 ++++++++++++++-----
 .../rmcontainer/TestRMContainerImpl.java        |   2 +-
 .../constraint/TestAllocationTagsManager.java   | 269 ++++++++++++------
 4 files changed, 392 insertions(+), 163 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/e724972b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
index a1d3dfc..1d838f0 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
@@ -496,7 +496,7 @@ public class ResourceManager extends CompositeService implements Recoverable {
   }
 
   protected AllocationTagsManager createAllocationTagsManager() {
-    return new AllocationTagsManager();
+    return new AllocationTagsManager(this.rmContext);
   }
   
   protected DelegationTokenRenewer createDelegationTokenRenewer() {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e724972b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
index c278606..7b0b959 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
@@ -28,6 +28,7 @@ import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.log4j.Logger;
 
 import java.util.HashMap;
@@ -38,9 +39,8 @@ import java.util.concurrent.locks.ReentrantReadWriteLock;
 import java.util.function.LongBinaryOperator;
 
 /**
- * Support storing maps between container-tags/applications and
- * nodes. This will be required by affinity/anti-affinity implementation and
- * cardinality.
+ * In-memory mapping between applications/container-tags and nodes/racks.
+ * Required by constrained affinity/anti-affinity and cardinality placement.
  */
 @InterfaceAudience.Private
 @InterfaceStability.Unstable
@@ -51,48 +51,54 @@ public class AllocationTagsManager {
 
   private ReentrantReadWriteLock.ReadLock readLock;
   private ReentrantReadWriteLock.WriteLock writeLock;
+  private final RMContext rmContext;
 
-  // Application's tags to node
-  private Map<ApplicationId, NodeToCountedTags> perAppMappings =
+  // Application's tags to Node
+  private Map<ApplicationId, NodeToCountedTags> perAppNodeMappings =
+      new HashMap<>();
+  // Application's tags to Rack
+  private Map<ApplicationId, NodeToCountedTags> perAppRackMappings =
       new HashMap<>();
 
   // Global tags to node mapping (used to fast return aggregated tags
   // cardinality across apps)
-  private NodeToCountedTags globalMapping = new NodeToCountedTags();
+  private NodeToCountedTags<NodeId> globalNodeMapping = new NodeToCountedTags();
+  // Global tags to Rack mapping
+  private NodeToCountedTags<String> globalRackMapping = new NodeToCountedTags();
 
   /**
-   * Store node to counted tags.
+   * Generic store mapping type <T> to counted tags.
+   * Currently used both for NodeId to Tag, Count and Rack to Tag, Count
    */
   @VisibleForTesting
-  static class NodeToCountedTags {
-    // Map<NodeId, Map<Tag, Count>>
-    private Map<NodeId, Map<String, Long>> nodeToTagsWithCount =
-        new HashMap<>();
+  static class NodeToCountedTags<T> {
+    // Map<Type, Map<Tag, Count>>
+    private Map<T, Map<String, Long>> typeToTagsWithCount = new HashMap<>();
 
     // protected by external locks
-    private void addTagsToNode(NodeId nodeId, Set<String> tags) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.computeIfAbsent(nodeId,
-          k -> new HashMap<>());
+    private void addTags(T type, Set<String> tags) {
+      Map<String, Long> innerMap =
+          typeToTagsWithCount.computeIfAbsent(type, k -> new HashMap<>());
 
       for (String tag : tags) {
         Long count = innerMap.get(tag);
         if (count == null) {
           innerMap.put(tag, 1L);
-        } else{
+        } else {
           innerMap.put(tag, count + 1);
         }
       }
     }
 
     // protected by external locks
-    private void addTagToNode(NodeId nodeId, String tag) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.computeIfAbsent(nodeId,
-          k -> new HashMap<>());
+    private void addTag(T type, String tag) {
+      Map<String, Long> innerMap =
+          typeToTagsWithCount.computeIfAbsent(type, k -> new HashMap<>());
 
       Long count = innerMap.get(tag);
       if (count == null) {
         innerMap.put(tag, 1L);
-      } else{
+      } else {
         innerMap.put(tag, count + 1);
       }
     }
@@ -104,17 +110,17 @@ public class AllocationTagsManager {
       } else {
         if (count <= 0) {
           LOG.warn(
-              "Trying to remove tags from node, however the count already"
+              "Trying to remove tags from node/rack, however the count already"
                   + " becomes 0 or less, it could be a potential bug.");
         }
         innerMap.remove(tag);
       }
     }
 
-    private void removeTagsFromNode(NodeId nodeId, Set<String> tags) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+    private void removeTags(T type, Set<String> tags) {
+      Map<String, Long> innerMap = typeToTagsWithCount.get(type);
       if (innerMap == null) {
-        LOG.warn("Failed to find node=" + nodeId
+        LOG.warn("Failed to find node/rack=" + type
             + " while trying to remove tags, please double check.");
         return;
       }
@@ -124,14 +130,14 @@ public class AllocationTagsManager {
       }
 
       if (innerMap.isEmpty()) {
-        nodeToTagsWithCount.remove(nodeId);
+        typeToTagsWithCount.remove(type);
       }
     }
 
-    private void removeTagFromNode(NodeId nodeId, String tag) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+    private void removeTag(T type, String tag) {
+      Map<String, Long> innerMap = typeToTagsWithCount.get(type);
       if (innerMap == null) {
-        LOG.warn("Failed to find node=" + nodeId
+        LOG.warn("Failed to find node/rack=" + type
             + " while trying to remove tags, please double check.");
         return;
       }
@@ -139,12 +145,12 @@ public class AllocationTagsManager {
       removeTagFromInnerMap(innerMap, tag);
 
       if (innerMap.isEmpty()) {
-        nodeToTagsWithCount.remove(nodeId);
+        typeToTagsWithCount.remove(type);
       }
     }
 
-    private long getCardinality(NodeId nodeId, String tag) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+    private long getCardinality(T type, String tag) {
+      Map<String, Long> innerMap = typeToTagsWithCount.get(type);
       if (innerMap == null) {
         return 0;
       }
@@ -152,9 +158,9 @@ public class AllocationTagsManager {
       return value == null ? 0 : value;
     }
 
-    private long getCardinality(NodeId nodeId, Set<String> tags,
+    private long getCardinality(T type, Set<String> tags,
         LongBinaryOperator op) {
-      Map<String, Long> innerMap = nodeToTagsWithCount.get(nodeId);
+      Map<String, Long> innerMap = typeToTagsWithCount.get(type);
       if (innerMap == null) {
         return 0;
       }
@@ -193,29 +199,40 @@ public class AllocationTagsManager {
     }
 
     private boolean isEmpty() {
-      return nodeToTagsWithCount.isEmpty();
+      return typeToTagsWithCount.isEmpty();
     }
 
     @VisibleForTesting
-    public Map<NodeId, Map<String, Long>> getNodeToTagsWithCount() {
-      return nodeToTagsWithCount;
+    public Map<T, Map<String, Long>> getTypeToTagsWithCount() {
+      return typeToTagsWithCount;
     }
   }
 
   @VisibleForTesting
-  Map<ApplicationId, NodeToCountedTags> getPerAppMappings() {
-    return perAppMappings;
+  Map<ApplicationId, NodeToCountedTags> getPerAppNodeMappings() {
+    return perAppNodeMappings;
+  }
+
+  @VisibleForTesting
+  Map<ApplicationId, NodeToCountedTags> getPerAppRackMappings() {
+    return perAppRackMappings;
+  }
+
+  @VisibleForTesting
+  NodeToCountedTags getGlobalNodeMapping() {
+    return globalNodeMapping;
   }
 
   @VisibleForTesting
-  NodeToCountedTags getGlobalMapping() {
-    return globalMapping;
+  NodeToCountedTags getGlobalRackMapping() {
+    return globalRackMapping;
   }
 
-  public AllocationTagsManager() {
+  public AllocationTagsManager(RMContext context) {
     ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
     readLock = lock.readLock();
     writeLock = lock.writeLock();
+    rmContext = context;
   }
 
   /**
@@ -243,21 +260,30 @@ public class AllocationTagsManager {
 
     writeLock.lock();
     try {
-      NodeToCountedTags perAppTagsMapping = perAppMappings.computeIfAbsent(
-          applicationId, k -> new NodeToCountedTags());
-
+      NodeToCountedTags perAppTagsMapping = perAppNodeMappings
+          .computeIfAbsent(applicationId, k -> new NodeToCountedTags());
+      NodeToCountedTags perAppRackTagsMapping = perAppRackMappings
+          .computeIfAbsent(applicationId, k -> new NodeToCountedTags());
+      // Covering test-cases where context is mocked
+      String nodeRack = (rmContext.getRMNodes() != null
+          && rmContext.getRMNodes().get(nodeId) != null)
+              ? rmContext.getRMNodes().get(nodeId).getRackName()
+              : "default-rack";
       if (useSet) {
-        perAppTagsMapping.addTagsToNode(nodeId, allocationTags);
-        globalMapping.addTagsToNode(nodeId, allocationTags);
+        perAppTagsMapping.addTags(nodeId, allocationTags);
+        perAppRackTagsMapping.addTags(nodeRack, allocationTags);
+        globalNodeMapping.addTags(nodeId, allocationTags);
+        globalRackMapping.addTags(nodeRack, allocationTags);
       } else {
-        perAppTagsMapping.addTagToNode(nodeId, applicationIdTag);
-        globalMapping.addTagToNode(nodeId, applicationIdTag);
+        perAppTagsMapping.addTag(nodeId, applicationIdTag);
+        perAppRackTagsMapping.addTag(nodeRack, applicationIdTag);
+        globalNodeMapping.addTag(nodeId, applicationIdTag);
+        globalRackMapping.addTag(nodeRack, applicationIdTag);
       }
 
       if (LOG.isDebugEnabled()) {
-        LOG.debug(
-            "Added container=" + containerId + " with tags=[" + StringUtils
-                .join(allocationTags, ",") + "]");
+        LOG.debug("Added container=" + containerId + " with tags=["
+            + StringUtils.join(allocationTags, ",") + "]");
       }
     } finally {
       writeLock.unlock();
@@ -287,27 +313,40 @@ public class AllocationTagsManager {
 
     writeLock.lock();
     try {
-      NodeToCountedTags perAppTagsMapping = perAppMappings.get(applicationId);
+      NodeToCountedTags perAppTagsMapping =
+          perAppNodeMappings.get(applicationId);
+      NodeToCountedTags perAppRackTagsMapping =
+          perAppRackMappings.get(applicationId);
       if (perAppTagsMapping == null) {
         return;
       }
-
+      // Covering test-cases where context is mocked
+      String nodeRack = (rmContext.getRMNodes() != null
+          && rmContext.getRMNodes().get(nodeId) != null)
+              ? rmContext.getRMNodes().get(nodeId).getRackName()
+              : "default-rack";
       if (useSet) {
-        perAppTagsMapping.removeTagsFromNode(nodeId, allocationTags);
-        globalMapping.removeTagsFromNode(nodeId, allocationTags);
+        perAppTagsMapping.removeTags(nodeId, allocationTags);
+        perAppRackTagsMapping.removeTags(nodeRack, allocationTags);
+        globalNodeMapping.removeTags(nodeId, allocationTags);
+        globalRackMapping.removeTags(nodeRack, allocationTags);
       } else {
-        perAppTagsMapping.removeTagFromNode(nodeId, applicationIdTag);
-        globalMapping.removeTagFromNode(nodeId, applicationIdTag);
+        perAppTagsMapping.removeTag(nodeId, applicationIdTag);
+        perAppRackTagsMapping.removeTag(nodeRack, applicationIdTag);
+        globalNodeMapping.removeTag(nodeId, applicationIdTag);
+        globalRackMapping.removeTag(nodeRack, applicationIdTag);
       }
 
       if (perAppTagsMapping.isEmpty()) {
-        perAppMappings.remove(applicationId);
+        perAppNodeMappings.remove(applicationId);
+      }
+      if (perAppRackTagsMapping.isEmpty()) {
+        perAppRackMappings.remove(applicationId);
       }
 
       if (LOG.isDebugEnabled()) {
-        LOG.debug(
-            "Removed container=" + containerId + " with tags=[" + StringUtils
-                .join(allocationTags, ",") + "]");
+        LOG.debug("Removed container=" + containerId + " with tags=["
+            + StringUtils.join(allocationTags, ",") + "]");
       }
     } finally {
       writeLock.unlock();
@@ -315,18 +354,16 @@ public class AllocationTagsManager {
   }
 
   /**
-   * Get cardinality for following conditions. External can pass-in a binary op
-   * to implement customized logic.   *
+   * Get Node cardinality for a specific tag.
+   * When applicationId is null, method returns aggregated cardinality
+   *
    * @param nodeId        nodeId, required.
    * @param applicationId applicationId. When null is specified, return
    *                      aggregated cardinality among all nodes.
    * @param tag           allocation tag, see
    *                      {@link SchedulingRequest#getAllocationTags()},
-   *                      When multiple tags specified. Returns cardinality
-   *                      depends on op. If a specified tag doesn't exist,
-   *                      0 will be its cardinality.
-   *                      When null/empty tags specified, all tags
-   *                      (of the node/app) will be considered.
+   *                      If a specified tag doesn't exist,
+   *                      method returns 0.
    * @return cardinality of specified query on the node.
    * @throws InvalidAllocationTagsQueryException when illegal query
    *                                            parameter specified
@@ -338,14 +375,14 @@ public class AllocationTagsManager {
     try {
       if (nodeId == null) {
         throw new InvalidAllocationTagsQueryException(
-            "Must specify nodeId/tags/op to query cardinality");
+            "Must specify nodeId/tag to query cardinality");
       }
 
       NodeToCountedTags mapping;
       if (applicationId != null) {
-        mapping = perAppMappings.get(applicationId);
-      } else{
-        mapping = globalMapping;
+        mapping = perAppNodeMappings.get(applicationId);
+      } else {
+        mapping = globalNodeMapping;
       }
 
       if (mapping == null) {
@@ -359,11 +396,54 @@ public class AllocationTagsManager {
   }
 
   /**
+   * Get Rack cardinality for a specific tag.
+   *
+   * @param rack          rack, required.
+   * @param applicationId applicationId. When null is specified, return
+   *                      aggregated cardinality among all nodes.
+   * @param tag           allocation tag, see
+   *                      {@link SchedulingRequest#getAllocationTags()},
+   *                      If a specified tag doesn't exist,
+   *                      method returns 0.
+   * @return cardinality of specified query on the rack.
+   * @throws InvalidAllocationTagsQueryException when illegal query
+   *                                            parameter specified
+   */
+  public long getRackCardinality(String rack, ApplicationId applicationId,
+      String tag) throws InvalidAllocationTagsQueryException {
+    readLock.lock();
+
+    try {
+      if (rack == null) {
+        throw new InvalidAllocationTagsQueryException(
+            "Must specify rack/tag to query cardinality");
+      }
+
+      NodeToCountedTags mapping;
+      if (applicationId != null) {
+        mapping = perAppRackMappings.get(applicationId);
+      } else {
+        mapping = globalRackMapping;
+      }
+
+      if (mapping == null) {
+        return 0;
+      }
+
+      return mapping.getCardinality(rack, tag);
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+
+
+  /**
    * Check if given tag exists on node.
    *
    * @param nodeId        nodeId, required.
    * @param applicationId applicationId. When null is specified, return
-   *                      aggregated cardinality among all nodes.
+   *                      aggregation among all applications.
    * @param tag           allocation tag, see
    *                      {@link SchedulingRequest#getAllocationTags()},
    *                      When multiple tags specified. Returns cardinality
@@ -387,7 +467,7 @@ public class AllocationTagsManager {
    *
    * @param nodeId        nodeId, required.
    * @param applicationId applicationId. When null is specified, return
-   *                      aggregated cardinality among all nodes.
+   *                      aggregated cardinality among all applications.
    * @param tags          allocation tags, see
    *                      {@link SchedulingRequest#getAllocationTags()},
    *                      When multiple tags specified. Returns cardinality
@@ -396,7 +476,7 @@ public class AllocationTagsManager {
    *                      specified, all tags (of the node/app) will be
    *                      considered.
    * @param op            operator. Such as Long::max, Long::sum, etc. Required.
-   *                      This sparameter only take effect when #values >= 2.
+   *                      This parameter only take effect when #values >= 2.
    * @return cardinality of specified query on the node.
    * @throws InvalidAllocationTagsQueryException when illegal query
    *                                            parameter specified
@@ -414,9 +494,9 @@ public class AllocationTagsManager {
 
       NodeToCountedTags mapping;
       if (applicationId != null) {
-        mapping = perAppMappings.get(applicationId);
-      } else{
-        mapping = globalMapping;
+        mapping = perAppNodeMappings.get(applicationId);
+      } else {
+        mapping = globalNodeMapping;
       }
 
       if (mapping == null) {
@@ -428,4 +508,52 @@ public class AllocationTagsManager {
       readLock.unlock();
     }
   }
+
+  /**
+   * Get cardinality for following conditions. External can pass-in a binary op
+   * to implement customized logic.
+   *
+   * @param rack          rack, required.
+   * @param applicationId applicationId. When null is specified, return
+   *                      aggregated cardinality among all applications.
+   * @param tags          allocation tags, see
+   *                      {@link SchedulingRequest#getAllocationTags()},
+   *                      When multiple tags specified. Returns cardinality
+   *                      depends on op. If a specified tag doesn't exist, 0
+   *                      will be its cardinality. When null/empty tags
+   *                      specified, all tags (of the rack/app) will be
+   *                      considered.
+   * @param op            operator. Such as Long::max, Long::sum, etc. Required.
+   *                      This parameter only take effect when #values >= 2.
+   * @return cardinality of specified query on the rack.
+   * @throws InvalidAllocationTagsQueryException when illegal query
+   *                                            parameter specified
+   */
+  public long getRackCardinalityByOp(String rack, ApplicationId applicationId,
+      Set<String> tags, LongBinaryOperator op)
+      throws InvalidAllocationTagsQueryException {
+    readLock.lock();
+
+    try {
+      if (rack == null || op == null) {
+        throw new InvalidAllocationTagsQueryException(
+            "Must specify rack/tags/op to query cardinality");
+      }
+
+      NodeToCountedTags mapping;
+      if (applicationId != null) {
+        mapping = perAppRackMappings.get(applicationId);
+      } else {
+        mapping = globalRackMapping;
+      }
+
+      if (mapping == null) {
+        return 0;
+      }
+
+      return mapping.getCardinality(rack, tags, op);
+    } finally {
+      readLock.unlock();
+    }
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e724972b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
index 538d128..b927870 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
@@ -405,8 +405,8 @@ public class TestRMContainerImpl {
 
     RMApplicationHistoryWriter writer = mock(RMApplicationHistoryWriter.class);
     SystemMetricsPublisher publisher = mock(SystemMetricsPublisher.class);
-    AllocationTagsManager tagsManager = new AllocationTagsManager();
     RMContext rmContext = mock(RMContext.class);
+    AllocationTagsManager tagsManager = new AllocationTagsManager(rmContext);
     when(rmContext.getDispatcher()).thenReturn(drainDispatcher);
     when(rmContext.getContainerAllocationExpirer()).thenReturn(expirer);
     when(rmContext.getRMApplicationHistoryWriter()).thenReturn(writer);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/e724972b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
index 4bb2a18..0ce1614 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestAllocationTagsManager.java
@@ -20,202 +20,300 @@
 
 package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
 
-import com.google.common.collect.ImmutableSet;
+import java.util.List;
+
 import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.server.resourcemanager.MockNodes;
+import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.TestUtils;
 import org.junit.Assert;
+import org.junit.Before;
 import org.junit.Test;
 
+import com.google.common.collect.ImmutableSet;
+
 /**
  * Test functionality of AllocationTagsManager.
  */
 public class TestAllocationTagsManager {
+  private RMContext rmContext;
+
+  @Before
+  public void setup() {
+    MockRM rm = new MockRM();
+    rm.start();
+    MockNodes.resetHostIds();
+    List<RMNode> rmNodes =
+        MockNodes.newNodes(2, 4, Resource.newInstance(4096, 4));
+    for (RMNode rmNode : rmNodes) {
+      rm.getRMContext().getRMNodes().putIfAbsent(rmNode.getNodeID(), rmNode);
+    }
+    rmContext = rm.getRMContext();
+  }
+
+
   @Test
   public void testAllocationTagsManagerSimpleCases()
       throws InvalidAllocationTagsQueryException {
-    AllocationTagsManager atm = new AllocationTagsManager();
+
+    AllocationTagsManager atm = new AllocationTagsManager(rmContext);
 
     /**
      * Construct test case:
-     * Node1:
+     * Node1 (rack0):
      *    container_1_1 (mapper/reducer/app_1)
      *    container_1_3 (service/app_1)
      *
-     * Node2:
+     * Node2 (rack0):
      *    container_1_2 (mapper/reducer/app_1)
      *    container_1_4 (reducer/app_1)
      *    container_2_1 (service/app_2)
      */
 
     // 3 Containers from app1
-    atm.addContainer(NodeId.fromString("node1:1234"),
+    atm.addContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.addContainer(NodeId.fromString("node1:1234"),
+    atm.addContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
         ImmutableSet.of("service"));
 
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
         ImmutableSet.of("reducer"));
 
     // 1 Container from app2
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
         ImmutableSet.of("service"));
 
-    // Get Cardinality of app1 on node1, with tag "mapper"
+    // Get Node Cardinality of app1 on node1, with tag "mapper"
     Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node1:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
             TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
             Long::max));
 
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=min
+    // Get Rack Cardinality of app1 on rack0, with tag "mapper"
+    Assert.assertEquals(2, atm.getRackCardinality("rack0",
+        TestUtils.getMockApplicationId(1), "mapper"));
+
+    // Get Node Cardinality of app1 on node2, with tag "mapper/reducer", op=min
     Assert.assertEquals(1,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             ImmutableSet.of("mapper", "reducer"), Long::min));
 
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=max
+    // Get Node Cardinality of app1 on node2, with tag "mapper/reducer", op=max
     Assert.assertEquals(2,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             ImmutableSet.of("mapper", "reducer"), Long::max));
 
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
+    // Get Node Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
     Assert.assertEquals(3,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             ImmutableSet.of("mapper", "reducer"), Long::sum));
 
-    // Get Cardinality by passing single tag.
+    // Get Node Cardinality by passing single tag.
     Assert.assertEquals(1,
-        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinality(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1), "mapper"));
 
     Assert.assertEquals(2,
-        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinality(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1), "reducer"));
 
-    // Get Cardinality of app1 on node2, with tag "no_existed/reducer", op=min
+    // Get Node Cardinality of app1 on node2, with tag "no_existed/reducer",
+    // op=min
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             ImmutableSet.of("no_existed", "reducer"), Long::min));
 
-    // Get Cardinality of app1 on node2, with tag "<applicationId>", op=max
+    // Get Node Cardinality of app1 on node2, with tag "<applicationId>", op=max
     // (Expect this returns #containers from app1 on node2)
+    Assert
+        .assertEquals(2,
+            atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
+                TestUtils.getMockApplicationId(1),
+                ImmutableSet.of(AllocationTagsNamespaces.APP_ID
+                    + TestUtils.getMockApplicationId(1).toString()),
+                Long::max));
+
+    // Get Node Cardinality of app1 on node2, with empty tag set, op=max
     Assert.assertEquals(2,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
-            TestUtils.getMockApplicationId(1), ImmutableSet
-                .of(AllocationTagsNamespaces.APP_ID + TestUtils
-                    .getMockApplicationId(1).toString()), Long::max));
-
-    // Get Cardinality of app1 on node2, with empty tag set, op=max
-    Assert.assertEquals(2,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
 
-    // Get Cardinality of all apps on node2, with empty tag set, op=sum
-    Assert.assertEquals(7,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"), null,
-            ImmutableSet.of(), Long::sum));
+    // Get Node Cardinality of all apps on node2, with empty tag set, op=sum
+    Assert.assertEquals(7, atm.getNodeCardinalityByOp(
+        NodeId.fromString("host2:123"), null, ImmutableSet.of(), Long::sum));
 
-    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    // Get Node Cardinality of app_1 on node2, with empty tag set, op=sum
     Assert.assertEquals(5,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
 
-    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    // Get Node Cardinality of app_1 on node2, with empty tag set, op=sum
     Assert.assertEquals(2,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
 
     // Finish all containers:
-    atm.removeContainer(NodeId.fromString("node1:1234"),
+    atm.removeContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.removeContainer(NodeId.fromString("node2:1234"),
+    atm.removeContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.removeContainer(NodeId.fromString("node1:1234"),
+    atm.removeContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
         ImmutableSet.of("service"));
 
-    atm.removeContainer(NodeId.fromString("node2:1234"),
+    atm.removeContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
         ImmutableSet.of("reducer"));
 
-    atm.removeContainer(NodeId.fromString("node2:1234"),
+    atm.removeContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
         ImmutableSet.of("service"));
 
     // Expect all cardinality to be 0
     // Get Cardinality of app1 on node1, with tag "mapper"
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node1:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host1:123"),
             TestUtils.getMockApplicationId(1), ImmutableSet.of("mapper"),
             Long::max));
 
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=min
+    // Get Node Cardinality of app1 on node2, with tag "mapper/reducer", op=min
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             ImmutableSet.of("mapper", "reducer"), Long::min));
 
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=max
+    // Get Node Cardinality of app1 on node2, with tag "mapper/reducer", op=max
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             ImmutableSet.of("mapper", "reducer"), Long::max));
 
-    // Get Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
+    // Get Node Cardinality of app1 on node2, with tag "mapper/reducer", op=sum
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             ImmutableSet.of("mapper", "reducer"), Long::sum));
 
-    // Get Cardinality of app1 on node2, with tag "<applicationId>", op=max
+    // Get Node Cardinality of app1 on node2, with tag "<applicationId>", op=max
     // (Expect this returns #containers from app1 on node2)
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             ImmutableSet.of(TestUtils.getMockApplicationId(1).toString()),
             Long::max));
 
     Assert.assertEquals(0,
-        atm.getNodeCardinality(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinality(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1),
             TestUtils.getMockApplicationId(1).toString()));
 
-    // Get Cardinality of app1 on node2, with empty tag set, op=max
+    // Get Node Cardinality of app1 on node2, with empty tag set, op=max
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
 
-    // Get Cardinality of all apps on node2, with empty tag set, op=sum
-    Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"), null,
-            ImmutableSet.of(), Long::sum));
+    // Get Node Cardinality of all apps on node2, with empty tag set, op=sum
+    Assert.assertEquals(0, atm.getNodeCardinalityByOp(
+        NodeId.fromString("host2:123"), null, ImmutableSet.of(), Long::sum));
 
-    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    // Get Node Cardinality of app_1 on node2, with empty tag set, op=sum
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::sum));
 
-    // Get Cardinality of app_1 on node2, with empty tag set, op=sum
+    // Get Node Cardinality of app_2 on node2, with empty tag set, op=sum
     Assert.assertEquals(0,
-        atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+        atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
             TestUtils.getMockApplicationId(2), ImmutableSet.of(), Long::sum));
   }
 
+
+  @Test
+  public void testAllocationTagsManagerRackMapping()
+      throws InvalidAllocationTagsQueryException {
+
+    AllocationTagsManager atm = new AllocationTagsManager(rmContext);
+
+    /**
+     * Construct Rack test case:
+     * Node1 (rack0):
+     *    container_1_1 (mapper/reducer/app_1)
+     *    container_1_4 (reducer/app_2)
+     *
+     * Node2 (rack0):
+     *    container_1_2 (mapper/reducer/app_2)
+     *    container_1_3 (service/app_1)
+     *
+     * Node5 (rack1):
+     *    container_2_1 (service/app_2)
+     */
+
+    // 3 Containers from app1
+    atm.addContainer(NodeId.fromString("host1:123"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("host2:123"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 2),
+        ImmutableSet.of("mapper", "reducer"));
+
+    atm.addContainer(NodeId.fromString("host1:123"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 4),
+        ImmutableSet.of("reducer"));
+
+    atm.addContainer(NodeId.fromString("host2:123"),
+        TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
+        ImmutableSet.of("service"));
+
+    // 1 Container from app2
+    atm.addContainer(NodeId.fromString("host2:123"),
+        TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
+        ImmutableSet.of("service"));
+
+    // Get Rack Cardinality of app1 on rack0, with tag "mapper"
+    Assert.assertEquals(1, atm.getRackCardinality("rack0",
+        TestUtils.getMockApplicationId(1), "mapper"));
+
+    // Get Rack Cardinality of app2 on rack0, with tag "reducer"
+    Assert.assertEquals(2, atm.getRackCardinality("rack0",
+        TestUtils.getMockApplicationId(2), "reducer"));
+
+    // Get Rack Cardinality of all apps on rack0, with tag "reducer"
+    Assert.assertEquals(3, atm.getRackCardinality("rack0", null, "reducer"));
+
+    // Get Rack Cardinality of app_1 on rack0, with empty tag set, op=max
+    Assert.assertEquals(2, atm.getRackCardinalityByOp("rack0",
+        TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::max));
+
+    // Get Rack Cardinality of app_1 on rack0, with empty tag set, op=min
+    Assert.assertEquals(1, atm.getRackCardinalityByOp("rack0",
+        TestUtils.getMockApplicationId(1), ImmutableSet.of(), Long::min));
+
+    // Get Rack Cardinality of all apps on rack0, with empty tag set, op=min
+    Assert.assertEquals(3, atm.getRackCardinalityByOp("rack0", null,
+        ImmutableSet.of(), Long::max));
+  }
+
   @Test
   public void testAllocationTagsManagerMemoryAfterCleanup()
       throws InvalidAllocationTagsQueryException {
@@ -223,54 +321,57 @@ public class TestAllocationTagsManager {
      * Make sure YARN cleans up all memory once container/app finishes.
      */
 
-    AllocationTagsManager atm = new AllocationTagsManager();
+    AllocationTagsManager atm = new AllocationTagsManager(rmContext);
 
     // Add a bunch of containers
-    atm.addContainer(NodeId.fromString("node1:1234"),
+    atm.addContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.addContainer(NodeId.fromString("node1:1234"),
+    atm.addContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
         ImmutableSet.of("service"));
 
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
         ImmutableSet.of("reducer"));
 
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
         ImmutableSet.of("service"));
 
     // Remove all these containers
-    atm.removeContainer(NodeId.fromString("node1:1234"),
+    atm.removeContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.removeContainer(NodeId.fromString("node2:1234"),
+    atm.removeContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.removeContainer(NodeId.fromString("node1:1234"),
+    atm.removeContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
         ImmutableSet.of("service"));
 
-    atm.removeContainer(NodeId.fromString("node2:1234"),
+    atm.removeContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
         ImmutableSet.of("reducer"));
 
-    atm.removeContainer(NodeId.fromString("node2:1234"),
+    atm.removeContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
         ImmutableSet.of("service"));
 
     // Check internal data structure
     Assert.assertEquals(0,
-        atm.getGlobalMapping().getNodeToTagsWithCount().size());
-    Assert.assertEquals(0, atm.getPerAppMappings().size());
+        atm.getGlobalNodeMapping().getTypeToTagsWithCount().size());
+    Assert.assertEquals(0, atm.getPerAppNodeMappings().size());
+    Assert.assertEquals(0,
+        atm.getGlobalRackMapping().getTypeToTagsWithCount().size());
+    Assert.assertEquals(0, atm.getPerAppRackMappings().size());
   }
 
   @Test
@@ -280,26 +381,26 @@ public class TestAllocationTagsManager {
      * Make sure YARN cleans up all memory once container/app finishes.
      */
 
-    AllocationTagsManager atm = new AllocationTagsManager();
+    AllocationTagsManager atm = new AllocationTagsManager(rmContext);
 
     // Add a bunch of containers
-    atm.addContainer(NodeId.fromString("node1:1234"),
+    atm.addContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 1),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 2),
         ImmutableSet.of("mapper", "reducer"));
 
-    atm.addContainer(NodeId.fromString("node1:1234"),
+    atm.addContainer(NodeId.fromString("host1:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 3),
         ImmutableSet.of("service"));
 
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(1), TestUtils.getMockContainerId(1, 4),
         ImmutableSet.of("reducer"));
 
-    atm.addContainer(NodeId.fromString("node2:1234"),
+    atm.addContainer(NodeId.fromString("host2:123"),
         TestUtils.getMockApplicationId(2), TestUtils.getMockContainerId(2, 3),
         ImmutableSet.of("service"));
 
@@ -317,7 +418,7 @@ public class TestAllocationTagsManager {
     // No op
     caughtException = false;
     try {
-      atm.getNodeCardinalityByOp(NodeId.fromString("node2:1234"),
+      atm.getNodeCardinalityByOp(NodeId.fromString("host2:123"),
           TestUtils.getMockApplicationId(2), ImmutableSet.of("mapper"), null);
     } catch (InvalidAllocationTagsQueryException e) {
       caughtException = true;


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[49/50] [abbrv] hadoop git commit: YARN-7807. Assume intra-app anti-affinity as default for scheduling request inside AppPlacementAllocator. (Wangda Tan via asuresh)

Posted by as...@apache.org.
YARN-7807. Assume intra-app anti-affinity as default for scheduling request inside AppPlacementAllocator. (Wangda Tan via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/c7cee3e4
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/c7cee3e4
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/c7cee3e4

Branch: refs/heads/YARN-6592
Commit: c7cee3e49ecfcab928fd36a95562e5aff23569ec
Parents: d04ec49
Author: Arun Suresh <as...@apache.org>
Authored: Wed Jan 24 12:55:01 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../placement/SingleConstraintAppPlacementAllocator.java        | 5 +++--
 1 file changed, 3 insertions(+), 2 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/c7cee3e4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
index 9e7d71c..b02cb00 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
@@ -334,14 +334,15 @@ public class SingleConstraintAppPlacementAllocator<N extends SchedulerNode>
         targetAllocationTags = new HashSet<>(
             targetExpression.getTargetValues());
 
-        if (targetExpression.getTargetKey() == null || !targetExpression
+        if (targetExpression.getTargetKey() != null && !targetExpression
             .getTargetKey().equals(APPLICATION_LABEL_INTRA_APPLICATION)) {
           throwExceptionWithMetaInfo(
               "As of now, the only accepted target key for targetKey of "
                   + "allocation_tag target expression is: ["
                   + APPLICATION_LABEL_INTRA_APPLICATION
                   + "]. Please make changes to placement constraints "
-                  + "accordingly.");
+                  + "accordingly. If this is null, it will be set to "
+                  + APPLICATION_LABEL_INTRA_APPLICATION + " by default.");
         }
       }
     }


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[48/50] [abbrv] hadoop git commit: YARN-7795. Fix jenkins issues of YARN-6592 branch. (Sunil G via asuresh)

Posted by as...@apache.org.
YARN-7795. Fix jenkins issues of YARN-6592 branch. (Sunil G via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/7c6644fe
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/7c6644fe
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/7c6644fe

Branch: refs/heads/YARN-6592
Commit: 7c6644fedf8243e907d26e2d3d2194ab13fbf213
Parents: c7cee3e
Author: Arun Suresh <as...@apache.org>
Authored: Wed Jan 24 14:18:32 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../hadoop/yarn/api/protocolrecords/AllocateRequest.java     | 4 ++--
 .../apache/hadoop/yarn/api/records/SchedulingRequest.java    | 8 ++++----
 .../apache/hadoop/yarn/api/resource/PlacementConstraint.java | 3 +++
 .../hadoop/yarn/api/resource/PlacementConstraints.java       | 3 ---
 .../yarn/api/records/impl/pb/ResourceSizingPBImpl.java       | 3 +++
 .../yarn/api/records/impl/pb/SchedulingRequestPBImpl.java    | 3 +++
 .../resourcemanager/scheduler/AbstractYarnScheduler.java     | 1 -
 .../server/resourcemanager/scheduler/AppSchedulingInfo.java  | 3 +--
 .../yarn/server/resourcemanager/scheduler/SchedulerNode.java | 8 ++++++--
 .../scheduler/capacity/CapacityScheduler.java                | 3 +--
 .../scheduler/constraint/AllocationTagsManager.java          | 8 +++++---
 .../scheduler/constraint/PlacementConstraintsUtil.java       | 4 ++--
 .../scheduler/placement/AppPlacementAllocator.java           | 4 ++--
 .../placement/SingleConstraintAppPlacementAllocator.java     | 1 -
 .../scheduler/capacity/TestCapacityScheduler.java            | 1 -
 .../TestCapacitySchedulerSchedulingRequestUpdate.java        | 4 +++-
 .../capacity/TestSchedulingRequestContainerAllocation.java   | 8 --------
 .../TestSchedulingRequestContainerAllocationAsync.java       | 1 -
 18 files changed, 35 insertions(+), 35 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java
index d8d2347..876957e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java
@@ -229,8 +229,8 @@ public abstract class AllocateRequest {
   /**
    * Set the list of Scheduling requests to inform the
    * <code>ResourceManager</code> about the application's resource requirements
-   * (potentially including allocation tags & placement constraints).
-   * @param schedulingRequests list of <code>SchedulingRequest</code> to update
+   * (potentially including allocation tags and placement constraints).
+   * @param schedulingRequests list of {@link SchedulingRequest} to update
    *          the <code>ResourceManager</code> about the application's resource
    *          requirements.
    */

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
index e32dd24..4bb2b84 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
@@ -77,7 +77,7 @@ public abstract class SchedulingRequest {
 
     /**
      * Set the <code>allocationRequestId</code> of the request.
-     * 
+     *
      * @see SchedulingRequest#setAllocationRequestId(long)
      * @param allocationRequestId <code>allocationRequestId</code> of the
      *          request
@@ -107,7 +107,7 @@ public abstract class SchedulingRequest {
 
     /**
      * Set the <code>executionType</code> of the request.
-     * 
+     *
      * @see SchedulingRequest#setExecutionType(ExecutionTypeRequest)
      * @param executionType <code>executionType</code> of the request
      * @return {@link SchedulingRequest.SchedulingRequestBuilder}
@@ -119,7 +119,7 @@ public abstract class SchedulingRequest {
       schedulingRequest.setExecutionType(executionType);
       return this;
     }
-    
+
     /**
      * Set the <code>allocationTags</code> of the request.
      *
@@ -169,7 +169,7 @@ public abstract class SchedulingRequest {
 
     /**
      * Return generated {@link SchedulingRequest} object.
-     * 
+     *
      * @return {@link SchedulingRequest}
      */
     @Public

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
index 4d998ac..c054cbc 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraint.java
@@ -341,6 +341,9 @@ public class PlacementConstraint {
    * {@link TargetOperator} used.
    */
   public static class TargetConstraint extends AbstractConstraint {
+    /**
+     * TargetOperator enum helps to specify type.
+     */
     enum TargetOperator {
       IN, NOT_IN
     }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
index ba1beae..70a8080 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/resource/PlacementConstraints.java
@@ -20,12 +20,9 @@ package org.apache.hadoop.yarn.api.resource;
 
 import java.util.concurrent.TimeUnit;
 
-import org.apache.commons.logging.Log;
-import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceAudience.Public;
 import org.apache.hadoop.classification.InterfaceStability.Unstable;
-import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.And;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.DelayedOr;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
index 4054837..1363942 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
@@ -26,6 +26,9 @@ import org.apache.hadoop.yarn.proto.YarnProtos.ResourceProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceSizingProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceSizingProtoOrBuilder;
 
+/**
+ * Proto Implementation for {@link ResourceSizing} interface.
+ */
 @Private
 @Unstable
 public class ResourceSizingPBImpl extends ResourceSizing {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
index 1f86043..11f75bb 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
@@ -37,6 +37,9 @@ import org.apache.hadoop.yarn.proto.YarnProtos.ResourceSizingProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.SchedulingRequestProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.SchedulingRequestProtoOrBuilder;
 
+/**
+ * Proto implementation for {@link SchedulingRequest} interface.
+ */
 @Private
 @Unstable
 public class SchedulingRequestPBImpl extends SchedulingRequest {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
index 7f81f00..e76287d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
@@ -53,7 +53,6 @@ import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceOption;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
-import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerError;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
index 7d6f233..0389895 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
@@ -51,7 +51,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.Applicatio
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.ContainerRequest;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.PendingAsk;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.AppPlacementAllocator;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.LocalityAppPlacementAllocator;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.PendingAskUpdateResult;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.SingleConstraintAppPlacementAllocator;
 import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
@@ -739,7 +738,7 @@ public class AppSchedulingInfo {
 
   /**
    * Pre-check node to see if it satisfy the given schedulerKey and
-   * scheduler mode
+   * scheduler mode.
    *
    * @param schedulerKey schedulerKey
    * @param schedulerNode schedulerNode

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
index 96a8e34..d5bfc57 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/SchedulerNode.java
@@ -471,8 +471,12 @@ public abstract class SchedulerNode {
 
   @Override
   public boolean equals(Object o) {
-    if (this == o) return true;
-    if (!(o instanceof SchedulerNode)) return false;
+    if (this == o) {
+      return true;
+    }
+    if (!(o instanceof SchedulerNode)) {
+      return false;
+    }
 
     SchedulerNode that = (SchedulerNode) o;
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
index a096e2f..cb01351 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
@@ -63,7 +63,6 @@ import org.apache.hadoop.yarn.api.records.ResourceRequest;
 import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
-import org.apache.hadoop.yarn.exceptions.InvalidResourceRequestException;
 import org.apache.hadoop.yarn.exceptions.SchedulerInvalidResoureRequestException;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
@@ -1062,7 +1061,7 @@ public class CapacityScheduler extends
   }
 
   /**
-   * Normalize a list of SchedulingRequest
+   * Normalize a list of SchedulingRequest.
    *
    * @param asks scheduling request
    */

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
index 42a78c9..8ef9999 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/AllocationTagsManager.java
@@ -66,7 +66,7 @@ public class AllocationTagsManager {
   private TypeToCountedTags<String> globalRackMapping = new TypeToCountedTags();
 
   /**
-   * Generic store mapping type <T> to counted tags.
+   * Generic store mapping type T to counted tags.
    * Currently used both for NodeId to Tag, Count and Rack to Tag, Count
    */
   @VisibleForTesting
@@ -467,7 +467,8 @@ public class AllocationTagsManager {
    *                      specified, all tags (of the node/app) will be
    *                      considered.
    * @param op            operator. Such as Long::max, Long::sum, etc. Required.
-   *                      This parameter only take effect when #values >= 2.
+   *                      This parameter only take effect when #values greater
+   *                      than 2.
    * @return cardinality of specified query on the node.
    * @throws InvalidAllocationTagsQueryException when illegal query
    *                                            parameter specified
@@ -515,7 +516,8 @@ public class AllocationTagsManager {
    *                      specified, all tags (of the rack/app) will be
    *                      considered.
    * @param op            operator. Such as Long::max, Long::sum, etc. Required.
-   *                      This parameter only take effect when #values >= 2.
+   *                      This parameter only take effect when #values
+   *                      greater than 2.
    * @return cardinality of specified query on the rack.
    * @throws InvalidAllocationTagsQueryException when illegal query
    *                                            parameter specified

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
index c07c16f..199dd62 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
@@ -74,7 +74,7 @@ public final class PlacementConstraintsUtil {
       throws InvalidAllocationTagsQueryException {
     long minScopeCardinality = 0;
     long maxScopeCardinality = 0;
-    
+
     // Optimizations to only check cardinality if necessary.
     int desiredMinCardinality = sc.getMinCardinality();
     int desiredMaxCardinality = sc.getMaxCardinality();
@@ -179,7 +179,7 @@ public final class PlacementConstraintsUtil {
    * first validates the constraint specified in the request; if not specified,
    * then it validates application level constraint if exists; otherwise, it
    * validates the global constraint if exists.
-   * <p/>
+   *
    * This method only checks whether a scheduling request can be placed
    * on a node with respect to the certain placement constraint. It gives no
    * guarantee that asked allocations can be eventually allocated because

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java
index 72a6c4c..df58157 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java
@@ -57,7 +57,7 @@ public abstract class AppPlacementAllocator<N extends SchedulerNode> {
   protected RMContext rmContext;
 
   /**
-   * Get iterator of preferred node depends on requirement and/or availability
+   * Get iterator of preferred node depends on requirement and/or availability.
    * @param candidateNodeSet input CandidateNodeSet
    * @return iterator of preferred node
    */
@@ -180,7 +180,7 @@ public abstract class AppPlacementAllocator<N extends SchedulerNode> {
   public abstract void showRequests();
 
   /**
-   * Initialize this allocator, this will be called by Factory automatically
+   * Initialize this allocator, this will be called by Factory automatically.
    *
    * @param appSchedulingInfo appSchedulingInfo
    * @param schedulerRequestKey schedulerRequestKey

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
index b02cb00..a04816b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
@@ -23,7 +23,6 @@ import org.apache.commons.collections.IteratorUtils;
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.util.StringUtils;
-import org.apache.hadoop.yarn.api.records.ApplicationId;
 import org.apache.hadoop.yarn.api.records.ExecutionType;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
 import org.apache.hadoop.yarn.api.records.ResourceSizing;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java
index 79898bb..7764ac8 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java
@@ -37,7 +37,6 @@ import java.util.Collections;
 import java.util.HashMap;
 import java.util.List;
 import java.util.Map;
-import java.util.Set;
 import java.util.concurrent.BrokenBarrierException;
 import java.util.concurrent.CyclicBarrier;
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java
index b6ac4b6..484d780 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerSchedulingRequestUpdate.java
@@ -26,7 +26,6 @@ import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
 import org.apache.hadoop.yarn.api.records.ResourceSizing;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
 import org.apache.hadoop.yarn.server.resourcemanager.MockNM;
@@ -41,6 +40,9 @@ import org.junit.Test;
 
 import java.util.Arrays;
 
+/**
+ * Test class for verifying Scheduling requests in CS.
+ */
 public class TestCapacitySchedulerSchedulingRequestUpdate
     extends CapacitySchedulerTestBase {
   @Test

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java
index 0a44a1e..b297f79 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocation.java
@@ -20,27 +20,19 @@ package org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity;
 
 import com.google.common.collect.ImmutableSet;
 import org.apache.hadoop.conf.Configuration;
-import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceSizing;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
 import org.apache.hadoop.yarn.server.resourcemanager.MockNM;
 import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
-import org.apache.hadoop.yarn.server.resourcemanager.ResourceManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.NullRMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
-import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptState;
-import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerAppReport;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.YarnScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.fica.FiCaSchedulerApp;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.AppAttemptRemovedSchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.NodeUpdateSchedulerEvent;
 import org.junit.Assert;
 import org.junit.Before;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/7c6644fe/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java
index c7f13cd..fc1cb0d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestSchedulingRequestContainerAllocationAsync.java
@@ -23,7 +23,6 @@ import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceSizing;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
 import org.apache.hadoop.yarn.server.resourcemanager.MockNM;


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[33/50] [abbrv] hadoop git commit: YARN-7670. Modifications to the ResourceScheduler API to support SchedulingRequests. (asuresh)

Posted by as...@apache.org.
YARN-7670. Modifications to the ResourceScheduler API to support SchedulingRequests. (asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/9f9139cc
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/9f9139cc
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/9f9139cc

Branch: refs/heads/YARN-6592
Commit: 9f9139ccad3de707d6c5a1bc4664794468dcb1dd
Parents: 2615da8
Author: Arun Suresh <as...@apache.org>
Authored: Tue Dec 19 08:59:23 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../scheduler/AbstractYarnScheduler.java        | 18 +++++
 .../scheduler/ResourceScheduler.java            | 13 ++++
 .../scheduler/capacity/CapacityScheduler.java   | 78 ++++++++++++++++++--
 .../common/ResourceAllocationCommitter.java     | 12 ++-
 .../scheduler/common/fica/FiCaSchedulerApp.java | 30 +++++---
 .../TestCapacitySchedulerAsyncScheduling.java   | 10 +--
 6 files changed, 138 insertions(+), 23 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/9f9139cc/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
index 4b76327..213d784 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AbstractYarnScheduler.java
@@ -53,6 +53,7 @@ import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceOption;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerError;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
@@ -295,6 +296,10 @@ public abstract class AbstractYarnScheduler
     return nodeTracker.getNodes(nodeFilter);
   }
 
+  public List<N> getNodes(final NodeFilter filter) {
+    return nodeTracker.getNodes(filter);
+  }
+
   public boolean shouldContainersBeAutoUpdated() {
     return this.autoUpdateContainers;
   }
@@ -1443,4 +1448,17 @@ public abstract class AbstractYarnScheduler
       throw new IOException(e);
     }
   }
+
+  /**
+   * Default implementation. Always returns false.
+   * @param appAttempt ApplicationAttempt.
+   * @param schedulingRequest SchedulingRequest.
+   * @param schedulerNode SchedulerNode.
+   * @return Success or not.
+   */
+  @Override
+  public boolean attemptAllocationOnNode(SchedulerApplicationAttempt appAttempt,
+      SchedulingRequest schedulingRequest, SchedulerNode schedulerNode) {
+    return false;
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/9f9139cc/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ResourceScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ResourceScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ResourceScheduler.java
index d96d625..5a56ac7 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ResourceScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/ResourceScheduler.java
@@ -25,6 +25,7 @@ import org.apache.hadoop.classification.InterfaceAudience.LimitedPrivate;
 import org.apache.hadoop.classification.InterfaceStability.Evolving;
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.hadoop.yarn.server.resourcemanager.recovery.Recoverable;
 
@@ -58,4 +59,16 @@ public interface ResourceScheduler extends YarnScheduler, Recoverable {
    * @return the number of available {@link NodeId} by resource name.
    */
   List<NodeId> getNodeIds(String resourceName);
+
+  /**
+   * Attempts to allocate a SchedulerRequest on a Node.
+   * NOTE: This ignores the numAllocations in the resource sizing and tries
+   *       to allocate a SINGLE container only.
+   * @param appAttempt ApplicationAttempt.
+   * @param schedulingRequest SchedulingRequest.
+   * @param schedulerNode SchedulerNode.
+   * @return true if proposal was accepted.
+   */
+  boolean attemptAllocationOnNode(SchedulerApplicationAttempt appAttempt,
+      SchedulingRequest schedulingRequest, SchedulerNode schedulerNode);
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/9f9139cc/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
index 03ca507..676c0fe 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
@@ -50,6 +50,7 @@ import org.apache.hadoop.yarn.api.records.Container;
 import org.apache.hadoop.yarn.api.records.ContainerExitStatus;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.ContainerStatus;
+import org.apache.hadoop.yarn.api.records.ExecutionType;
 import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.QueueACL;
@@ -59,6 +60,7 @@ import org.apache.hadoop.yarn.api.records.ReservationId;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceOption;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
@@ -82,6 +84,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptE
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttemptState;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainer;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainerEventType;
+import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainerImpl;
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainerState;
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractYarnScheduler;
@@ -99,7 +102,9 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceLimits;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceUsage;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerApplication;
 
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerApplicationAttempt;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerDynamicEditException;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerUtils;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.activities.ActivitiesLogger;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.activities.ActivitiesManager;
@@ -141,6 +146,8 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.Candida
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement.SimpleCandidateNodeSet;
 import org.apache.hadoop.yarn.server.resourcemanager.security.AppPriorityACLsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.RMContainerTokenSecretManager;
+import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
+import org.apache.hadoop.yarn.server.utils.BuilderUtils;
 import org.apache.hadoop.yarn.server.utils.Lock;
 import org.apache.hadoop.yarn.util.resource.DefaultResourceCalculator;
 import org.apache.hadoop.yarn.util.resource.ResourceCalculator;
@@ -596,7 +603,7 @@ public class CapacityScheduler extends
 
           try {
             cs.writeLock.lock();
-            cs.tryCommit(cs.getClusterResource(), request);
+            cs.tryCommit(cs.getClusterResource(), request, true);
           } finally {
             cs.writeLock.unlock();
           }
@@ -2551,10 +2558,67 @@ public class CapacityScheduler extends
       resourceCommitterService.addNewCommitRequest(request);
     } else{
       // Otherwise do it sync-ly.
-      tryCommit(cluster, request);
+      tryCommit(cluster, request, true);
     }
   }
 
+  @Override
+  public boolean attemptAllocationOnNode(SchedulerApplicationAttempt appAttempt,
+      SchedulingRequest schedulingRequest, SchedulerNode schedulerNode) {
+    if (schedulingRequest.getResourceSizing() != null) {
+      if (schedulingRequest.getResourceSizing().getNumAllocations() > 1) {
+        LOG.warn("The SchedulingRequest has requested more than 1 allocation," +
+            " but only 1 will be attempted !!");
+      }
+      if (!appAttempt.isStopped()) {
+        ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode>
+            resourceCommitRequest = createResourceCommitRequest(
+            appAttempt, schedulingRequest, schedulerNode);
+        return tryCommit(getClusterResource(), resourceCommitRequest, false);
+      }
+    }
+    return false;
+  }
+
+  // This assumes numContainers = 1 for the request.
+  private ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode>
+      createResourceCommitRequest(SchedulerApplicationAttempt appAttempt,
+      SchedulingRequest schedulingRequest, SchedulerNode schedulerNode) {
+    ContainerAllocationProposal<FiCaSchedulerApp, FiCaSchedulerNode> allocated =
+        null;
+    Resource resource = schedulingRequest.getResourceSizing().getResources();
+    if (Resources.greaterThan(calculator, getClusterResource(),
+        resource, Resources.none())) {
+      ContainerId cId =
+          ContainerId.newContainerId(appAttempt.getApplicationAttemptId(),
+              appAttempt.getAppSchedulingInfo().getNewContainerId());
+      Container container = BuilderUtils.newContainer(
+          cId, schedulerNode.getNodeID(), schedulerNode.getHttpAddress(),
+          resource, schedulingRequest.getPriority(), null,
+          ExecutionType.GUARANTEED,
+          schedulingRequest.getAllocationRequestId());
+      RMContainer rmContainer = new RMContainerImpl(container,
+          SchedulerRequestKey.extractFrom(container),
+          appAttempt.getApplicationAttemptId(), container.getNodeId(),
+          appAttempt.getUser(), rmContext, false);
+
+      allocated = new ContainerAllocationProposal<>(
+          getSchedulerContainer(rmContainer, true),
+          null, null, NodeType.NODE_LOCAL, NodeType.NODE_LOCAL,
+          SchedulingMode.RESPECT_PARTITION_EXCLUSIVITY,
+          resource);
+    }
+
+    if (null != allocated) {
+      List<ContainerAllocationProposal<FiCaSchedulerApp, FiCaSchedulerNode>>
+          allocationsList = new ArrayList<>();
+      allocationsList.add(allocated);
+
+      return new ResourceCommitRequest<>(allocationsList, null, null);
+    }
+    return null;
+  }
+
   @VisibleForTesting
   public ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode>
       createResourceCommitRequest(CSAssignment csAssignment) {
@@ -2632,7 +2696,8 @@ public class CapacityScheduler extends
   }
 
   @Override
-  public void tryCommit(Resource cluster, ResourceCommitRequest r) {
+  public boolean tryCommit(Resource cluster, ResourceCommitRequest r,
+      boolean updatePending) {
     ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode> request =
         (ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode>) r;
 
@@ -2662,15 +2727,17 @@ public class CapacityScheduler extends
       LOG.debug("Try to commit allocation proposal=" + request);
     }
 
+    boolean isSuccess = false;
     if (attemptId != null) {
       FiCaSchedulerApp app = getApplicationAttempt(attemptId);
       // Required sanity check for attemptId - when async-scheduling enabled,
       // proposal might be outdated if AM failover just finished
       // and proposal queue was not be consumed in time
       if (app != null && attemptId.equals(app.getApplicationAttemptId())) {
-        if (app.accept(cluster, request)) {
-          app.apply(cluster, request);
+        if (app.accept(cluster, request, updatePending)) {
+          app.apply(cluster, request, updatePending);
           LOG.info("Allocation proposal accepted");
+          isSuccess = true;
         } else{
           LOG.info("Failed to accept allocation proposal");
         }
@@ -2681,6 +2748,7 @@ public class CapacityScheduler extends
         }
       }
     }
+    return isSuccess;
   }
 
   public int getAsyncSchedulingPendingBacklogs() {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/9f9139cc/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ResourceAllocationCommitter.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ResourceAllocationCommitter.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ResourceAllocationCommitter.java
index bdea97d..2e36b2e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ResourceAllocationCommitter.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/ResourceAllocationCommitter.java
@@ -25,5 +25,15 @@ import org.apache.hadoop.yarn.api.records.Resource;
  * plus global scheduling functionality
  */
 public interface ResourceAllocationCommitter {
-  void tryCommit(Resource cluster, ResourceCommitRequest proposal);
+
+  /**
+   * Try to commit the allocation Proposal. This also gives the option of
+   * not updating a pending queued request.
+   * @param cluster Cluster Resource.
+   * @param proposal Proposal.
+   * @param updatePending Decrement pending if successful.
+   * @return Is successful or not.
+   */
+  boolean tryCommit(Resource cluster, ResourceCommitRequest proposal,
+      boolean updatePending);
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/9f9139cc/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
index d6ad292..4ea0347 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
@@ -375,7 +375,8 @@ public class FiCaSchedulerApp extends SchedulerApplicationAttempt {
   }
 
   public boolean accept(Resource cluster,
-      ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode> request) {
+      ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode> request,
+      boolean checkPending) {
     ContainerRequest containerRequest = null;
     boolean reReservation = false;
 
@@ -408,9 +409,11 @@ public class FiCaSchedulerApp extends SchedulerApplicationAttempt {
               schedulerContainer.getRmContainer().getContainerRequest();
 
           // Check pending resource request
-          if (!appSchedulingInfo.checkAllocation(allocation.getAllocationLocalityType(),
-              schedulerContainer.getSchedulerNode(),
-              schedulerContainer.getSchedulerRequestKey())) {
+          if (checkPending &&
+              !appSchedulingInfo.checkAllocation(
+                  allocation.getAllocationLocalityType(),
+                  schedulerContainer.getSchedulerNode(),
+                  schedulerContainer.getSchedulerRequestKey())) {
             if (LOG.isDebugEnabled()) {
               LOG.debug("No pending resource for: nodeType=" + allocation
                   .getAllocationLocalityType() + ", node=" + schedulerContainer
@@ -485,8 +488,8 @@ public class FiCaSchedulerApp extends SchedulerApplicationAttempt {
     return accepted;
   }
 
-  public void apply(Resource cluster,
-      ResourceCommitRequest<FiCaSchedulerApp, FiCaSchedulerNode> request) {
+  public void apply(Resource cluster, ResourceCommitRequest<FiCaSchedulerApp,
+      FiCaSchedulerNode> request, boolean updatePending) {
     boolean reReservation = false;
 
     try {
@@ -531,12 +534,15 @@ public class FiCaSchedulerApp extends SchedulerApplicationAttempt {
           liveContainers.put(containerId, rmContainer);
 
           // Deduct pending resource requests
-          ContainerRequest containerRequest = appSchedulingInfo.allocate(
-              allocation.getAllocationLocalityType(),
-              schedulerContainer.getSchedulerNode(),
-              schedulerContainer.getSchedulerRequestKey(),
-              schedulerContainer.getRmContainer().getContainer());
-          ((RMContainerImpl) rmContainer).setContainerRequest(containerRequest);
+          if (updatePending) {
+            ContainerRequest containerRequest = appSchedulingInfo.allocate(
+                allocation.getAllocationLocalityType(),
+                schedulerContainer.getSchedulerNode(),
+                schedulerContainer.getSchedulerRequestKey(),
+                schedulerContainer.getRmContainer().getContainer());
+            ((RMContainerImpl) rmContainer).setContainerRequest(
+                containerRequest);
+          }
 
           attemptResourceUsage.incUsed(schedulerContainer.getNodePartition(),
               allocation.getAllocatedOrReservedResource());

http://git-wip-us.apache.org/repos/asf/hadoop/blob/9f9139cc/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
index 548b909..eddf8c8 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
@@ -264,7 +264,7 @@ public class TestCapacitySchedulerAsyncScheduling {
     reservedProposals.add(reservedForAttempt1Proposal);
     ResourceCommitRequest request =
         new ResourceCommitRequest(null, reservedProposals, null);
-    scheduler.tryCommit(scheduler.getClusterResource(), request);
+    scheduler.tryCommit(scheduler.getClusterResource(), request, true);
     Assert.assertNull("Outdated proposal should not be accepted!",
         sn2.getReservedContainer());
 
@@ -385,7 +385,7 @@ public class TestCapacitySchedulerAsyncScheduling {
           // call real apply
           try {
             cs.tryCommit((Resource) invocation.getArguments()[0],
-                (ResourceCommitRequest) invocation.getArguments()[1]);
+                (ResourceCommitRequest) invocation.getArguments()[1], true);
           } catch (Exception e) {
             e.printStackTrace();
             Assert.fail();
@@ -393,12 +393,12 @@ public class TestCapacitySchedulerAsyncScheduling {
           isChecked.set(true);
         } else {
           cs.tryCommit((Resource) invocation.getArguments()[0],
-              (ResourceCommitRequest) invocation.getArguments()[1]);
+              (ResourceCommitRequest) invocation.getArguments()[1], true);
         }
         return null;
       }
     }).when(spyCs).tryCommit(Mockito.any(Resource.class),
-        Mockito.any(ResourceCommitRequest.class));
+        Mockito.any(ResourceCommitRequest.class), Mockito.anyBoolean());
 
     spyCs.handle(new NodeUpdateSchedulerEvent(sn1.getRMNode()));
 
@@ -473,7 +473,7 @@ public class TestCapacitySchedulerAsyncScheduling {
       newProposals.add(newContainerProposal);
       ResourceCommitRequest request =
           new ResourceCommitRequest(newProposals, null, null);
-      scheduler.tryCommit(scheduler.getClusterResource(), request);
+      scheduler.tryCommit(scheduler.getClusterResource(), request, true);
     }
     // make sure node resource can't be over-allocated!
     Assert.assertTrue("Node resource is Over-allocated!",


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[20/50] [abbrv] hadoop git commit: YARN-7745. Allow DistributedShell to take a placement specification for containers it wants to launch. (Arun Suresh via wangda)

Posted by as...@apache.org.
YARN-7745. Allow DistributedShell to take a placement specification for containers it wants to launch. (Arun Suresh via wangda)

Change-Id: Ided146d662e944a8a4692e5d6885f23fd9bbcad5


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/77200ae1
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/77200ae1
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/77200ae1

Branch: refs/heads/YARN-6592
Commit: 77200ae10dc60aaf800a69a27b4c6b77c3c34b91
Parents: 0b9dffa
Author: Wangda Tan <wa...@apache.org>
Authored: Thu Jan 18 14:22:45 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../distributedshell/ApplicationMaster.java     | 124 +++++++++++++++--
 .../applications/distributedshell/Client.java   |  14 ++
 .../distributedshell/PlacementSpec.java         | 137 +++++++++++++++++++
 3 files changed, 263 insertions(+), 12 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/77200ae1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/ApplicationMaster.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/ApplicationMaster.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/ApplicationMaster.java
index 270ef1b..9ba2138 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/ApplicationMaster.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/ApplicationMaster.java
@@ -42,6 +42,7 @@ import java.util.concurrent.ConcurrentHashMap;
 import java.util.concurrent.ConcurrentMap;
 import java.util.concurrent.atomic.AtomicInteger;
 import java.util.Arrays;
+import java.util.concurrent.atomic.AtomicLong;
 
 import org.apache.commons.cli.CommandLine;
 import org.apache.commons.cli.GnuParser;
@@ -87,8 +88,11 @@ import org.apache.hadoop.yarn.api.records.LocalResourceVisibility;
 import org.apache.hadoop.yarn.api.records.NodeReport;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.ProfileCapability;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.URL;
 import org.apache.hadoop.yarn.api.records.UpdatedContainer;
 import org.apache.hadoop.yarn.api.records.ExecutionType;
@@ -99,6 +103,7 @@ import org.apache.hadoop.yarn.api.records.timeline.TimelineEntity;
 import org.apache.hadoop.yarn.api.records.timeline.TimelineEntityGroupId;
 import org.apache.hadoop.yarn.api.records.timeline.TimelineEvent;
 import org.apache.hadoop.yarn.api.records.timeline.TimelinePutResponse;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.client.api.AMRMClient.ContainerRequest;
 import org.apache.hadoop.yarn.client.api.TimelineClient;
 import org.apache.hadoop.yarn.client.api.TimelineV2Client;
@@ -274,6 +279,10 @@ public class ApplicationMaster {
   @VisibleForTesting
   protected AtomicInteger numRequestedContainers = new AtomicInteger();
 
+  protected AtomicInteger numIgnore = new AtomicInteger();
+
+  protected AtomicInteger totalRetries = new AtomicInteger(10);
+
   // Shell command to be executed
   private String shellCommand = "";
   // Args to be passed to the shell command
@@ -289,6 +298,9 @@ public class ApplicationMaster {
   // File length needed for local resource
   private long shellScriptPathLen = 0;
 
+  // Placement Specifications
+  private Map<String, PlacementSpec> placementSpecs = null;
+
   // Container retry options
   private ContainerRetryPolicy containerRetryPolicy =
       ContainerRetryPolicy.NEVER_RETRY;
@@ -334,6 +346,7 @@ public class ApplicationMaster {
   private final String windows_command = "cmd /c";
 
   private int yarnShellIdCounter = 1;
+  private final AtomicLong allocIdCounter = new AtomicLong(1);
 
   @VisibleForTesting
   protected final Set<ContainerId> launchedContainers =
@@ -457,6 +470,7 @@ public class ApplicationMaster {
         "If container could retry, it specifies max retires");
     opts.addOption("container_retry_interval", true,
         "Interval between each retry, unit is milliseconds");
+    opts.addOption("placement_spec", true, "Placement specification");
     opts.addOption("debug", false, "Dump out debug information");
 
     opts.addOption("help", false, "Print usage");
@@ -487,6 +501,17 @@ public class ApplicationMaster {
       dumpOutDebugInfo();
     }
 
+    if (cliParser.hasOption("placement_spec")) {
+      String placementSpec = cliParser.getOptionValue("placement_spec");
+      LOG.info("Placement Spec received [{}]", placementSpec);
+      parsePlacementSpecs(placementSpec);
+      LOG.info("Total num containers requested [{}]", numTotalContainers);
+      if (numTotalContainers == 0) {
+        throw new IllegalArgumentException(
+            "Cannot run distributed shell with no containers");
+      }
+    }
+
     Map<String, String> envs = System.getenv();
 
     if (!envs.containsKey(Environment.CONTAINER_ID.name())) {
@@ -609,8 +634,11 @@ public class ApplicationMaster {
     }
     containerResourceProfile =
         cliParser.getOptionValue("container_resource_profile", "");
-    numTotalContainers = Integer.parseInt(cliParser.getOptionValue(
-        "num_containers", "1"));
+
+    if (this.placementSpecs == null) {
+      numTotalContainers = Integer.parseInt(cliParser.getOptionValue(
+          "num_containers", "1"));
+    }
     if (numTotalContainers == 0) {
       throw new IllegalArgumentException(
           "Cannot run distributed shell with no containers");
@@ -642,6 +670,17 @@ public class ApplicationMaster {
     return true;
   }
 
+  private void parsePlacementSpecs(String placementSpecifications) {
+    Map<String, PlacementSpec> pSpecs =
+        PlacementSpec.parse(placementSpecifications);
+    this.placementSpecs = new HashMap<>();
+    this.numTotalContainers = 0;
+    for (PlacementSpec pSpec : pSpecs.values()) {
+      this.numTotalContainers += pSpec.numContainers;
+      this.placementSpecs.put(pSpec.sourceTag, pSpec);
+    }
+  }
+
   /**
    * Helper function to print usage
    *
@@ -719,9 +758,19 @@ public class ApplicationMaster {
     // Register self with ResourceManager
     // This will start heartbeating to the RM
     appMasterHostname = NetUtils.getHostname();
+    Map<Set<String>, PlacementConstraint> placementConstraintMap = null;
+    if (this.placementSpecs != null) {
+      placementConstraintMap = new HashMap<>();
+      for (PlacementSpec spec : this.placementSpecs.values()) {
+        if (spec.constraint != null) {
+          placementConstraintMap.put(
+              Collections.singleton(spec.sourceTag), spec.constraint);
+        }
+      }
+    }
     RegisterApplicationMasterResponse response = amRMClient
         .registerApplicationMaster(appMasterHostname, appMasterRpcPort,
-            appMasterTrackingUrl);
+            appMasterTrackingUrl, placementConstraintMap);
     resourceProfiles = response.getResourceProfiles();
     ResourceUtils.reinitializeResources(response.getResourceTypes());
     // Dump out information about cluster capability as seen by the
@@ -765,9 +814,20 @@ public class ApplicationMaster {
     // containers
     // Keep looping until all the containers are launched and shell script
     // executed on them ( regardless of success/failure).
-    for (int i = 0; i < numTotalContainersToRequest; ++i) {
-      ContainerRequest containerAsk = setupContainerAskForRM();
-      amRMClient.addContainerRequest(containerAsk);
+    if (this.placementSpecs == null) {
+      for (int i = 0; i < numTotalContainersToRequest; ++i) {
+        ContainerRequest containerAsk = setupContainerAskForRM();
+        amRMClient.addContainerRequest(containerAsk);
+      }
+    } else {
+      List<SchedulingRequest> schedReqs = new ArrayList<>();
+      for (PlacementSpec pSpec : this.placementSpecs.values()) {
+        for (int i = 0; i < pSpec.numContainers; i++) {
+          SchedulingRequest sr = setupSchedulingRequest(pSpec);
+          schedReqs.add(sr);
+        }
+      }
+      amRMClient.addSchedulingRequests(schedReqs);
     }
     numRequestedContainers.set(numTotalContainers);
   }
@@ -933,6 +993,12 @@ public class ApplicationMaster {
             numRequestedContainers.decrementAndGet();
             // we do not need to release the container as it would be done
             // by the RM
+
+            // Ignore these containers if placementspec is enabled
+            // for the time being.
+            if (placementSpecs != null) {
+              numIgnore.incrementAndGet();
+            }
           }
         } else {
           // nothing to do
@@ -962,14 +1028,18 @@ public class ApplicationMaster {
       int askCount = numTotalContainers - numRequestedContainers.get();
       numRequestedContainers.addAndGet(askCount);
 
-      if (askCount > 0) {
-        for (int i = 0; i < askCount; ++i) {
-          ContainerRequest containerAsk = setupContainerAskForRM();
-          amRMClient.addContainerRequest(containerAsk);
+      // Dont bother re-asking if we are using placementSpecs
+      if (placementSpecs == null) {
+        if (askCount > 0) {
+          for (int i = 0; i < askCount; ++i) {
+            ContainerRequest containerAsk = setupContainerAskForRM();
+            amRMClient.addContainerRequest(containerAsk);
+          }
         }
       }
-      
-      if (numCompletedContainers.get() == numTotalContainers) {
+
+      if (numCompletedContainers.get() + numIgnore.get() >=
+          numTotalContainers) {
         done = true;
       }
     }
@@ -1029,6 +1099,23 @@ public class ApplicationMaster {
     }
 
     @Override
+    public void onRequestsRejected(List<RejectedSchedulingRequest> rejReqs) {
+      List<SchedulingRequest> reqsToRetry = new ArrayList<>();
+      for (RejectedSchedulingRequest rejReq : rejReqs) {
+        LOG.info("Scheduling Request {} has been rejected. Reason {}",
+            rejReq.getRequest(), rejReq.getReason());
+        reqsToRetry.add(rejReq.getRequest());
+      }
+      totalRetries.addAndGet(-1 * reqsToRetry.size());
+      if (totalRetries.get() <= 0) {
+        LOG.info("Exiting, since retries are exhausted !!");
+        done = true;
+      } else {
+        amRMClient.addSchedulingRequests(reqsToRetry);
+      }
+    }
+
+    @Override
     public void onShutdownRequest() {
       done = true;
     }
@@ -1335,6 +1422,19 @@ public class ApplicationMaster {
     return request;
   }
 
+  private SchedulingRequest setupSchedulingRequest(PlacementSpec spec) {
+    long allocId = allocIdCounter.incrementAndGet();
+    SchedulingRequest sReq = SchedulingRequest.newInstance(
+        allocId, Priority.newInstance(requestPriority),
+        ExecutionTypeRequest.newInstance(),
+        Collections.singleton(spec.sourceTag),
+        ResourceSizing.newInstance(
+            createProfileCapability().getProfileCapabilityOverride()), null);
+    sReq.setPlacementConstraint(spec.constraint);
+    LOG.info("Scheduling Request made: " + sReq.toString());
+    return sReq;
+  }
+
   private boolean fileExist(String filePath) {
     return new File(filePath).exists();
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/77200ae1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/Client.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/Client.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/Client.java
index ef635d3..2aafa94 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/Client.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/Client.java
@@ -188,6 +188,8 @@ public class Client {
   // Whether to auto promote opportunistic containers
   private boolean autoPromoteContainers = false;
 
+  // Placement specification
+  private String placementSpec = "";
   // log4j.properties file 
   // if available, add to local resources and set into classpath 
   private String log4jPropFile = "";	
@@ -366,6 +368,10 @@ public class Client {
         "If container could retry, it specifies max retires");
     opts.addOption("container_retry_interval", true,
         "Interval between each retry, unit is milliseconds");
+    opts.addOption("placement_spec", true,
+        "Placement specification. Please note, if this option is specified,"
+            + " The \"num_containers\" option will be ignored. All requested"
+            + " containers will be of type GUARANTEED" );
   }
 
   /**
@@ -419,6 +425,11 @@ public class Client {
       keepContainers = true;
     }
 
+    if (cliParser.hasOption("placement_spec")) {
+      placementSpec = cliParser.getOptionValue("placement_spec");
+      // Check if it is parsable
+      PlacementSpec.parse(this.placementSpec);
+    }
     appName = cliParser.getOptionValue("appname", "DistributedShell");
     amPriority = Integer.parseInt(cliParser.getOptionValue("priority", "0"));
     amQueue = cliParser.getOptionValue("queue", "default");
@@ -834,6 +845,9 @@ public class Client {
       vargs.add("--container_resource_profile " + containerResourceProfile);
     }
     vargs.add("--num_containers " + String.valueOf(numContainers));
+    if (placementSpec != null && placementSpec.length() > 0) {
+      vargs.add("--placement_spec " + placementSpec);
+    }
     if (null != nodeLabelExpression) {
       appContext.setNodeLabelExpression(nodeLabelExpression);
     }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/77200ae1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/PlacementSpec.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/PlacementSpec.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/PlacementSpec.java
new file mode 100644
index 0000000..ed13ee0
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-applications/hadoop-yarn-applications-distributedshell/src/main/java/org/apache/hadoop/yarn/applications/distributedshell/PlacementSpec.java
@@ -0,0 +1,137 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.applications.distributedshell;
+
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import java.util.HashMap;
+import java.util.Map;
+import java.util.Scanner;
+
+/**
+ * Class encapsulating a SourceTag, number of container and a Placement
+ * Constraint.
+ */
+public class PlacementSpec {
+
+  private static final Logger LOG =
+      LoggerFactory.getLogger(PlacementSpec.class);
+  private static final String SPEC_DELIM = ":";
+  private static final String KV_SPLIT_DELIM = "=";
+  private static final String SPEC_VAL_DELIM = ",";
+  private static final String IN = "in";
+  private static final String NOT_IN = "notin";
+  private static final String CARDINALITY = "cardinality";
+
+  public final String sourceTag;
+  public final int numContainers;
+  public final PlacementConstraint constraint;
+
+  public PlacementSpec(String sourceTag, int numContainers,
+      PlacementConstraint constraint) {
+    this.sourceTag = sourceTag;
+    this.numContainers = numContainers;
+    this.constraint = constraint;
+  }
+
+  // Placement specification should be of the form:
+  // PlacementSpec => ""|KeyVal;PlacementSpec
+  // KeyVal => SourceTag=Constraint
+  // SourceTag => String
+  // Constraint => NumContainers|
+  //               NumContainers,"in",Scope,TargetTag|
+  //               NumContainers,"notin",Scope,TargetTag|
+  //               NumContainers,"cardinality",Scope,TargetTag,MinCard,MaxCard
+  // NumContainers => int (number of containers)
+  // Scope => "NODE"|"RACK"
+  // TargetTag => String (Target Tag)
+  // MinCard => int (min cardinality - needed if ConstraintType == cardinality)
+  // MaxCard => int (max cardinality - needed if ConstraintType == cardinality)
+
+  /**
+   * Parser to convert a string representation of a placement spec to mapping
+   * from source tag to Placement Constraint.
+   *
+   * @param specs Placement spec.
+   * @return Mapping from source tag to placement constraint.
+   */
+  public static Map<String, PlacementSpec> parse(String specs) {
+    LOG.info("Parsing Placement Specs: [{}]", specs);
+    Scanner s = new Scanner(specs).useDelimiter(SPEC_DELIM);
+    Map<String, PlacementSpec> pSpecs = new HashMap<>();
+    while (s.hasNext()) {
+      String sp = s.next();
+      LOG.info("Parsing Spec: [{}]", sp);
+      String[] specSplit = sp.split(KV_SPLIT_DELIM);
+      String sourceTag = specSplit[0];
+      Scanner ps = new Scanner(specSplit[1]).useDelimiter(SPEC_VAL_DELIM);
+      int numContainers = ps.nextInt();
+      if (!ps.hasNext()) {
+        pSpecs.put(sourceTag,
+            new PlacementSpec(sourceTag, numContainers, null));
+        LOG.info("Creating Spec without constraint {}: num[{}]",
+            sourceTag, numContainers);
+        continue;
+      }
+      String cType = ps.next().toLowerCase();
+      String scope = ps.next().toLowerCase();
+
+      String targetTag = ps.next();
+      scope = scope.equals("rack") ? PlacementConstraints.RACK :
+          PlacementConstraints.NODE;
+
+      PlacementConstraint pc;
+      if (cType.equals(IN)) {
+        pc = PlacementConstraints.build(
+            PlacementConstraints.targetIn(scope,
+                PlacementConstraints.PlacementTargets.allocationTag(
+                    targetTag)));
+        LOG.info("Creating IN Constraint for source tag [{}], num[{}]: " +
+                "scope[{}], target[{}]",
+            sourceTag, numContainers, scope, targetTag);
+      } else if (cType.equals(NOT_IN)) {
+        pc = PlacementConstraints.build(
+            PlacementConstraints.targetNotIn(scope,
+                PlacementConstraints.PlacementTargets.allocationTag(
+                    targetTag)));
+        LOG.info("Creating NOT_IN Constraint for source tag [{}], num[{}]: " +
+                "scope[{}], target[{}]",
+            sourceTag, numContainers, scope, targetTag);
+      } else if (cType.equals(CARDINALITY)) {
+        int minCard = ps.nextInt();
+        int maxCard = ps.nextInt();
+        pc = PlacementConstraints.build(
+            PlacementConstraints.targetCardinality(scope, minCard, maxCard,
+                PlacementConstraints.PlacementTargets.allocationTag(
+                    targetTag)));
+        LOG.info("Creating CARDINALITY Constraint source tag [{}], num[{}]: " +
+                "scope[{}], min[{}], max[{}], target[{}]",
+            sourceTag, numContainers, scope, minCard, maxCard, targetTag);
+      } else {
+        throw new RuntimeException(
+            "Could not parse constraintType [" + cType + "]" +
+                " in [" + specSplit[1] + "]");
+      }
+      pSpecs.put(sourceTag, new PlacementSpec(sourceTag, numContainers, pc));
+    }
+    return pSpecs;
+  }
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[16/50] [abbrv] hadoop git commit: HDFS-13044. RBF: Add a safe mode for the Router. Contributed by Inigo Goiri.

Posted by as...@apache.org.
HDFS-13044. RBF: Add a safe mode for the Router. Contributed by Inigo Goiri.


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/dbb9dded
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/dbb9dded
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/dbb9dded

Branch: refs/heads/YARN-6592
Commit: dbb9dded33b3cff3b630e98300d30515a9d1eec4
Parents: fde95d4
Author: Yiqun Lin <yq...@apache.org>
Authored: Tue Jan 30 12:12:08 2018 +0800
Committer: Yiqun Lin <yq...@apache.org>
Committed: Tue Jan 30 12:12:08 2018 +0800

----------------------------------------------------------------------
 .../org/apache/hadoop/hdfs/DFSConfigKeys.java   |  13 ++
 .../hdfs/server/federation/router/Router.java   |  16 +-
 .../federation/router/RouterRpcServer.java      |  43 ++++-
 .../router/RouterSafeModeException.java         |  53 +++++
 .../router/RouterSafemodeService.java           | 150 +++++++++++++++
 .../store/StateStoreCacheUpdateService.java     |   7 +-
 .../src/main/resources/hdfs-default.xml         |  36 +++-
 .../src/site/markdown/HDFSRouterFederation.md   |   4 +
 .../server/federation/RouterConfigBuilder.java  |  13 ++
 .../federation/router/TestRouterSafemode.java   | 192 +++++++++++++++++++
 10 files changed, 515 insertions(+), 12 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java
index 84215f3f..4589aaa 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java
@@ -1291,6 +1291,19 @@ public class DFSConfigKeys extends CommonConfigurationKeys {
   public static final long FEDERATION_STORE_ROUTER_EXPIRATION_MS_DEFAULT =
       TimeUnit.MINUTES.toMillis(5);
 
+  // HDFS Router safe mode
+  public static final String DFS_ROUTER_SAFEMODE_ENABLE =
+      FEDERATION_ROUTER_PREFIX + "safemode.enable";
+  public static final boolean DFS_ROUTER_SAFEMODE_ENABLE_DEFAULT = true;
+  public static final String DFS_ROUTER_SAFEMODE_EXTENSION =
+      FEDERATION_ROUTER_PREFIX + "safemode.extension";
+  public static final long DFS_ROUTER_SAFEMODE_EXTENSION_DEFAULT =
+      TimeUnit.SECONDS.toMillis(30);
+  public static final String DFS_ROUTER_SAFEMODE_EXPIRATION =
+      FEDERATION_ROUTER_PREFIX + "safemode.expiration";
+  public static final long DFS_ROUTER_SAFEMODE_EXPIRATION_DEFAULT =
+      3 * DFS_ROUTER_CACHE_TIME_TO_LIVE_MS_DEFAULT;
+
   // HDFS Router-based federation mount table entries
   /** Maximum number of cache entries to have. */
   public static final String FEDERATION_MOUNT_TABLE_MAX_CACHE_SIZE =

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/Router.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/Router.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/Router.java
index 1e72c93..79f43bb 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/Router.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/Router.java
@@ -118,6 +118,8 @@ public class Router extends CompositeService {
   private RouterStore routerStateManager;
   /** Heartbeat our run status to the router state manager. */
   private RouterHeartbeatService routerHeartbeatService;
+  /** Enter/exit safemode. */
+  private RouterSafemodeService safemodeService;
 
   /** The start time of the namesystem. */
   private final long startTime = Time.now();
@@ -232,13 +234,25 @@ public class Router extends CompositeService {
       addService(this.quotaUpdateService);
     }
 
+    // Safemode service to refuse RPC calls when the router is out of sync
+    if (conf.getBoolean(
+        DFSConfigKeys.DFS_ROUTER_SAFEMODE_ENABLE,
+        DFSConfigKeys.DFS_ROUTER_SAFEMODE_ENABLE_DEFAULT)) {
+      // Create safemode monitoring service
+      this.safemodeService = new RouterSafemodeService(this);
+      addService(this.safemodeService);
+    }
+
     super.serviceInit(conf);
   }
 
   @Override
   protected void serviceStart() throws Exception {
 
-    updateRouterState(RouterServiceState.RUNNING);
+    if (this.safemodeService == null) {
+      // Router is running now
+      updateRouterState(RouterServiceState.RUNNING);
+    }
 
     if (this.pauseMonitor != null) {
       this.pauseMonitor.start();

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterRpcServer.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterRpcServer.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterRpcServer.java
index 9afd441..57125ca 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterRpcServer.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterRpcServer.java
@@ -179,6 +179,8 @@ public class RouterRpcServer extends AbstractService implements ClientProtocol {
   /** Interface to map global name space to HDFS subcluster name spaces. */
   private final FileSubclusterResolver subclusterResolver;
 
+  /** If we are in safe mode, fail requests as if a standby NN. */
+  private volatile boolean safeMode;
 
   /** Category of the operation that a thread is executing. */
   private final ThreadLocal<OperationCategory> opCategory = new ThreadLocal<>();
@@ -370,12 +372,12 @@ public class RouterRpcServer extends AbstractService implements ClientProtocol {
    * @param op Category of the operation to check.
    * @param supported If the operation is supported or not. If not, it will
    *                  throw an UnsupportedOperationException.
-   * @throws StandbyException If the Router is in safe mode and cannot serve
-   *                          client requests.
+   * @throws SafeModeException If the Router is in safe mode and cannot serve
+   *                           client requests.
    * @throws UnsupportedOperationException If the operation is not supported.
    */
   protected void checkOperation(OperationCategory op, boolean supported)
-      throws StandbyException, UnsupportedOperationException {
+      throws RouterSafeModeException, UnsupportedOperationException {
     checkOperation(op);
 
     if (!supported) {
@@ -393,10 +395,11 @@ public class RouterRpcServer extends AbstractService implements ClientProtocol {
    * UNCHECKED. This function should be called by all ClientProtocol functions.
    *
    * @param op Category of the operation to check.
-   * @throws StandbyException If the Router is in safe mode and cannot serve
-   *                          client requests.
+   * @throws SafeModeException If the Router is in safe mode and cannot serve
+   *                           client requests.
    */
-  protected void checkOperation(OperationCategory op) throws StandbyException {
+  protected void checkOperation(OperationCategory op)
+      throws RouterSafeModeException {
     // Log the function we are currently calling.
     if (rpcMonitor != null) {
       rpcMonitor.startOp();
@@ -415,7 +418,33 @@ public class RouterRpcServer extends AbstractService implements ClientProtocol {
       return;
     }
 
-    // TODO check Router safe mode and return Standby exception
+    if (safeMode) {
+      // Throw standby exception, router is not available
+      if (rpcMonitor != null) {
+        rpcMonitor.routerFailureSafemode();
+      }
+      throw new RouterSafeModeException(router.getRouterId(), op);
+    }
+  }
+
+  /**
+   * In safe mode all RPC requests will fail and return a standby exception.
+   * The client will try another Router, similar to the client retry logic for
+   * HA.
+   *
+   * @param mode True if enabled, False if disabled.
+   */
+  public void setSafeMode(boolean mode) {
+    this.safeMode = mode;
+  }
+
+  /**
+   * Check if the Router is in safe mode and cannot serve RPC calls.
+   *
+   * @return If the Router is in safe mode.
+   */
+  public boolean isInSafeMode() {
+    return this.safeMode;
   }
 
   @Override // ClientProtocol

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterSafeModeException.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterSafeModeException.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterSafeModeException.java
new file mode 100644
index 0000000..7a78b5b
--- /dev/null
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterSafeModeException.java
@@ -0,0 +1,53 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.hdfs.server.federation.router;
+
+import org.apache.hadoop.hdfs.server.namenode.NameNode.OperationCategory;
+import org.apache.hadoop.ipc.StandbyException;
+
+/**
+ * Exception that the Router throws when it is in safe mode. This extends
+ * {@link StandbyException} for the client to try another Router when it gets
+ * this exception.
+ */
+public class RouterSafeModeException extends StandbyException {
+
+  private static final long serialVersionUID = 453568188334993493L;
+
+  /** Identifier of the Router that generated this exception. */
+  private final String routerId;
+
+  /**
+   * Build a new Router safe mode exception.
+   * @param router Identifier of the Router.
+   * @param op Category of the operation (READ/WRITE).
+   */
+  public RouterSafeModeException(String router, OperationCategory op) {
+    super("Router " + router + " is in safe mode and cannot handle " + op
+        + " requests.");
+    this.routerId = router;
+  }
+
+  /**
+   * Get the id of the Router that generated this exception.
+   * @return Id of the Router that generated this exception.
+   */
+  public String getRouterId() {
+    return this.routerId;
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterSafemodeService.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterSafemodeService.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterSafemodeService.java
new file mode 100644
index 0000000..56aab0a
--- /dev/null
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/router/RouterSafemodeService.java
@@ -0,0 +1,150 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.hdfs.server.federation.router;
+
+import static org.apache.hadoop.util.Time.now;
+
+import java.util.concurrent.TimeUnit;
+
+import org.apache.hadoop.conf.Configuration;
+import org.apache.hadoop.hdfs.DFSConfigKeys;
+import org.apache.hadoop.hdfs.server.federation.store.StateStoreService;
+import org.apache.hadoop.util.Time;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+/**
+ * Service to periodically check if the {@link org.apache.hadoop.hdfs.server.
+ * federation.store.StateStoreService StateStoreService} cached information in
+ * the {@link Router} is up to date. This is for performance and removes the
+ * {@link org.apache.hadoop.hdfs.server.federation.store.StateStoreService
+ * StateStoreService} from the critical path in common operations.
+ */
+public class RouterSafemodeService extends PeriodicService {
+
+  private static final Logger LOG =
+      LoggerFactory.getLogger(RouterSafemodeService.class);
+
+  /** Router to manage safe mode. */
+  private final Router router;
+
+  /** Interval in ms to wait post startup before allowing RPC requests. */
+  private long startupInterval;
+  /** Interval in ms after which the State Store cache is too stale. */
+  private long staleInterval;
+  /** Start time in ms of this service. */
+  private long startupTime;
+
+  /** The time the Router enters safe mode in milliseconds. */
+  private long enterSafeModeTime = now();
+
+
+  /**
+   * Create a new Cache update service.
+   *
+   * @param router Router containing the cache.
+   */
+  public RouterSafemodeService(Router router) {
+    super(RouterSafemodeService.class.getSimpleName());
+    this.router = router;
+  }
+
+  /**
+   * Enter safe mode.
+   */
+  private void enter() {
+    LOG.info("Entering safe mode");
+    enterSafeModeTime = now();
+    RouterRpcServer rpcServer = router.getRpcServer();
+    rpcServer.setSafeMode(true);
+    router.updateRouterState(RouterServiceState.SAFEMODE);
+  }
+
+  /**
+   * Leave safe mode.
+   */
+  private void leave() {
+    // Cache recently updated, leave safemode
+    long timeInSafemode = now() - enterSafeModeTime;
+    LOG.info("Leaving safe mode after {} milliseconds", timeInSafemode);
+    RouterMetrics routerMetrics = router.getRouterMetrics();
+    if (routerMetrics == null) {
+      LOG.error("The Router metrics are not enabled");
+    } else {
+      routerMetrics.setSafeModeTime(timeInSafemode);
+    }
+    RouterRpcServer rpcServer = router.getRpcServer();
+    rpcServer.setSafeMode(false);
+    router.updateRouterState(RouterServiceState.RUNNING);
+  }
+
+  @Override
+  protected void serviceInit(Configuration conf) throws Exception {
+
+    // Use same interval as cache update service
+    this.setIntervalMs(conf.getTimeDuration(
+        DFSConfigKeys.DFS_ROUTER_CACHE_TIME_TO_LIVE_MS,
+        DFSConfigKeys.DFS_ROUTER_CACHE_TIME_TO_LIVE_MS_DEFAULT,
+        TimeUnit.MILLISECONDS));
+
+    this.startupInterval = conf.getTimeDuration(
+        DFSConfigKeys.DFS_ROUTER_SAFEMODE_EXTENSION,
+        DFSConfigKeys.DFS_ROUTER_SAFEMODE_EXTENSION_DEFAULT,
+        TimeUnit.MILLISECONDS);
+    LOG.info("Leave startup safe mode after {} ms", this.startupInterval);
+
+    this.staleInterval = conf.getTimeDuration(
+        DFSConfigKeys.DFS_ROUTER_SAFEMODE_EXPIRATION,
+        DFSConfigKeys.DFS_ROUTER_SAFEMODE_EXPIRATION_DEFAULT,
+        TimeUnit.MILLISECONDS);
+    LOG.info("Enter safe mode after {} ms without reaching the State Store",
+        this.staleInterval);
+
+    this.startupTime = Time.now();
+
+    // Initializing the RPC server in safe mode, it will disable it later
+    enter();
+
+    super.serviceInit(conf);
+  }
+
+  @Override
+  public void periodicInvoke() {
+    long now = Time.now();
+    long delta = now - startupTime;
+    if (delta < startupInterval) {
+      LOG.info("Delaying safemode exit for {} milliseconds...",
+          this.startupInterval - delta);
+      return;
+    }
+    RouterRpcServer rpcServer = router.getRpcServer();
+    StateStoreService stateStore = router.getStateStore();
+    long cacheUpdateTime = stateStore.getCacheUpdateTime();
+    boolean isCacheStale = (now - cacheUpdateTime) > this.staleInterval;
+
+    // Always update to indicate our cache was updated
+    if (isCacheStale) {
+      if (!rpcServer.isInSafeMode()) {
+        enter();
+      }
+    } else if (rpcServer.isInSafeMode()) {
+      // Cache recently updated, leave safe mode
+      leave();
+    }
+  }
+}
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/store/StateStoreCacheUpdateService.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/store/StateStoreCacheUpdateService.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/store/StateStoreCacheUpdateService.java
index bb8cfb0..9bcbc1e 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/store/StateStoreCacheUpdateService.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/federation/store/StateStoreCacheUpdateService.java
@@ -17,6 +17,8 @@
  */
 package org.apache.hadoop.hdfs.server.federation.store;
 
+import java.util.concurrent.TimeUnit;
+
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.hdfs.DFSConfigKeys;
 import org.apache.hadoop.hdfs.server.federation.router.PeriodicService;
@@ -52,9 +54,10 @@ public class StateStoreCacheUpdateService extends PeriodicService {
   @Override
   protected void serviceInit(Configuration conf) throws Exception {
 
-    this.setIntervalMs(conf.getLong(
+    this.setIntervalMs(conf.getTimeDuration(
         DFSConfigKeys.DFS_ROUTER_CACHE_TIME_TO_LIVE_MS,
-        DFSConfigKeys.DFS_ROUTER_CACHE_TIME_TO_LIVE_MS_DEFAULT));
+        DFSConfigKeys.DFS_ROUTER_CACHE_TIME_TO_LIVE_MS_DEFAULT,
+        TimeUnit.MILLISECONDS));
 
     super.serviceInit(conf);
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml b/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml
index d24310e..7446766 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml
@@ -5080,9 +5080,12 @@
 
   <property>
     <name>dfs.federation.router.cache.ttl</name>
-    <value>60000</value>
+    <value>1m</value>
     <description>
-      How often to refresh the State Store caches in milliseconds.
+      How often to refresh the State Store caches in milliseconds. This setting
+      supports multiple time unit suffixes as described in
+      dfs.heartbeat.interval. If no suffix is specified then milliseconds is
+      assumed.
     </description>
   </property>
 
@@ -5131,6 +5134,35 @@
   </property>
 
   <property>
+    <name>dfs.federation.router.safemode.enable</name>
+    <value>true</value>
+    <description>
+    </description>
+  </property>
+
+  <property>
+    <name>dfs.federation.router.safemode.extension</name>
+    <value>30s</value>
+    <description>
+      Time after startup that the Router is in safe mode. This setting
+      supports multiple time unit suffixes as described in
+      dfs.heartbeat.interval. If no suffix is specified then milliseconds is
+      assumed.
+    </description>
+  </property>
+
+  <property>
+    <name>dfs.federation.router.safemode.expiration</name>
+    <value>3m</value>
+    <description>
+      Time without being able to reach the State Store to enter safe mode. This
+      setting supports multiple time unit suffixes as described in
+      dfs.heartbeat.interval. If no suffix is specified then milliseconds is
+      assumed.
+    </description>
+  </property>
+
+  <property>
     <name>dfs.federation.router.monitor.namenode</name>
     <value></value>
     <description>

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/site/markdown/HDFSRouterFederation.md
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/site/markdown/HDFSRouterFederation.md b/hadoop-hdfs-project/hadoop-hdfs/src/site/markdown/HDFSRouterFederation.md
index 75798a1..6b21123 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/site/markdown/HDFSRouterFederation.md
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/site/markdown/HDFSRouterFederation.md
@@ -81,6 +81,10 @@ The Routers are stateless and metadata operations are atomic at the NameNodes.
 If a Router becomes unavailable, any Router can take over for it.
 The clients configure their DFS HA client (e.g., ConfiguredFailoverProvider or RequestHedgingProxyProvider) with all the Routers in the federation as endpoints.
 
+* **Unavailable State Store:**
+If a Router cannot contact the State Store, it will enter into a Safe Mode state which disallows it from serving requests.
+Clients will treat Routers in Safe Mode as it was an Standby NameNode and try another Router.
+
 * **NameNode heartbeat HA:**
 For high availability and flexibility, multiple Routers can monitor the same NameNode and heartbeat the information to the State Store.
 This increases clients' resiliency to stale information, should a Router fail.

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/RouterConfigBuilder.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/RouterConfigBuilder.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/RouterConfigBuilder.java
index 3d8b35c..3659bf9 100644
--- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/RouterConfigBuilder.java
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/RouterConfigBuilder.java
@@ -35,6 +35,7 @@ public class RouterConfigBuilder {
   private boolean enableStateStore = false;
   private boolean enableMetrics = false;
   private boolean enableQuota = false;
+  private boolean enableSafemode = false;
 
   public RouterConfigBuilder(Configuration configuration) {
     this.conf = configuration;
@@ -52,6 +53,7 @@ public class RouterConfigBuilder {
     this.enableLocalHeartbeat = true;
     this.enableStateStore = true;
     this.enableMetrics = true;
+    this.enableSafemode = true;
     return this;
   }
 
@@ -95,6 +97,11 @@ public class RouterConfigBuilder {
     return this;
   }
 
+  public RouterConfigBuilder safemode(boolean enable) {
+    this.enableSafemode = enable;
+    return this;
+  }
+
   public RouterConfigBuilder rpc() {
     return this.rpc(true);
   }
@@ -123,6 +130,10 @@ public class RouterConfigBuilder {
     return this.quota(true);
   }
 
+  public RouterConfigBuilder safemode() {
+    return this.safemode(true);
+  }
+
   public Configuration build() {
     conf.setBoolean(DFSConfigKeys.DFS_ROUTER_STORE_ENABLE,
         this.enableStateStore);
@@ -139,6 +150,8 @@ public class RouterConfigBuilder {
         this.enableMetrics);
     conf.setBoolean(DFSConfigKeys.DFS_ROUTER_QUOTA_ENABLE,
         this.enableQuota);
+    conf.setBoolean(DFSConfigKeys.DFS_ROUTER_SAFEMODE_ENABLE,
+        this.enableSafemode);
     return conf;
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/dbb9dded/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/router/TestRouterSafemode.java
----------------------------------------------------------------------
diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/router/TestRouterSafemode.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/router/TestRouterSafemode.java
new file mode 100644
index 0000000..9299f77
--- /dev/null
+++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/federation/router/TestRouterSafemode.java
@@ -0,0 +1,192 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.hdfs.server.federation.router;
+
+import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_ROUTER_CACHE_TIME_TO_LIVE_MS;
+import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_ROUTER_SAFEMODE_EXPIRATION;
+import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_ROUTER_SAFEMODE_EXTENSION;
+import static org.apache.hadoop.hdfs.server.federation.store.FederationStateStoreTestUtils.deleteStateStore;
+import static org.apache.hadoop.hdfs.server.federation.store.FederationStateStoreTestUtils.getStateStoreConfiguration;
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertFalse;
+import static org.junit.Assert.assertTrue;
+import static org.junit.Assert.fail;
+
+import java.io.IOException;
+import java.net.URISyntaxException;
+import java.util.concurrent.TimeUnit;
+
+import org.apache.hadoop.conf.Configuration;
+import org.apache.hadoop.hdfs.server.federation.RouterConfigBuilder;
+import org.apache.hadoop.service.Service.STATE;
+import org.apache.hadoop.util.Time;
+import org.junit.After;
+import org.junit.AfterClass;
+import org.junit.Before;
+import org.junit.BeforeClass;
+import org.junit.Test;
+
+/**
+ * Test the safe mode for the {@link Router} controlled by
+ * {@link RouterSafemodeService}.
+ */
+public class TestRouterSafemode {
+
+  private Router router;
+  private static Configuration conf;
+
+  @BeforeClass
+  public static void create() throws IOException {
+    // Wipe state store
+    deleteStateStore();
+    // Configuration that supports the state store
+    conf = getStateStoreConfiguration();
+    // 2 sec startup standby
+    conf.setTimeDuration(DFS_ROUTER_SAFEMODE_EXTENSION,
+        TimeUnit.SECONDS.toMillis(2), TimeUnit.MILLISECONDS);
+    // 1 sec cache refresh
+    conf.setTimeDuration(DFS_ROUTER_CACHE_TIME_TO_LIVE_MS,
+        TimeUnit.SECONDS.toMillis(1), TimeUnit.MILLISECONDS);
+    // 2 sec post cache update before entering safemode (2 intervals)
+    conf.setTimeDuration(DFS_ROUTER_SAFEMODE_EXPIRATION,
+        TimeUnit.SECONDS.toMillis(2), TimeUnit.MILLISECONDS);
+    // RPC + State Store + Safe Mode only
+    conf = new RouterConfigBuilder(conf)
+        .rpc()
+        .safemode()
+        .stateStore()
+        .metrics()
+        .build();
+  }
+
+  @AfterClass
+  public static void destroy() {
+  }
+
+  @Before
+  public void setup() throws IOException, URISyntaxException {
+    router = new Router();
+    router.init(conf);
+    router.start();
+  }
+
+  @After
+  public void cleanup() throws IOException {
+    if (router != null) {
+      router.stop();
+      router = null;
+    }
+  }
+
+  @Test
+  public void testSafemodeService() throws IOException {
+    RouterSafemodeService server = new RouterSafemodeService(router);
+    server.init(conf);
+    assertEquals(STATE.INITED, server.getServiceState());
+    server.start();
+    assertEquals(STATE.STARTED, server.getServiceState());
+    server.stop();
+    assertEquals(STATE.STOPPED, server.getServiceState());
+    server.close();
+  }
+
+  @Test
+  public void testRouterExitSafemode()
+      throws InterruptedException, IllegalStateException, IOException {
+
+    assertTrue(router.getRpcServer().isInSafeMode());
+    verifyRouter(RouterServiceState.SAFEMODE);
+
+    // Wait for initial time in milliseconds
+    long interval =
+        conf.getTimeDuration(DFS_ROUTER_SAFEMODE_EXTENSION,
+            TimeUnit.SECONDS.toMillis(2), TimeUnit.MILLISECONDS) +
+        conf.getTimeDuration(DFS_ROUTER_CACHE_TIME_TO_LIVE_MS,
+            TimeUnit.SECONDS.toMillis(1), TimeUnit.MILLISECONDS);
+    Thread.sleep(interval);
+
+    assertFalse(router.getRpcServer().isInSafeMode());
+    verifyRouter(RouterServiceState.RUNNING);
+  }
+
+  @Test
+  public void testRouterEnterSafemode()
+      throws IllegalStateException, IOException, InterruptedException {
+
+    // Verify starting state
+    assertTrue(router.getRpcServer().isInSafeMode());
+    verifyRouter(RouterServiceState.SAFEMODE);
+
+    // We should be in safe mode for DFS_ROUTER_SAFEMODE_EXTENSION time
+    long interval0 = conf.getTimeDuration(DFS_ROUTER_SAFEMODE_EXTENSION,
+        TimeUnit.SECONDS.toMillis(2), TimeUnit.MILLISECONDS) - 1000;
+    long t0 = Time.now();
+    while (Time.now() - t0 < interval0) {
+      verifyRouter(RouterServiceState.SAFEMODE);
+      Thread.sleep(100);
+    }
+
+    // We wait some time for the state to propagate
+    long interval1 = 1000 + 2 * conf.getTimeDuration(
+        DFS_ROUTER_CACHE_TIME_TO_LIVE_MS, TimeUnit.SECONDS.toMillis(1),
+        TimeUnit.MILLISECONDS);
+    Thread.sleep(interval1);
+
+    // Running
+    assertFalse(router.getRpcServer().isInSafeMode());
+    verifyRouter(RouterServiceState.RUNNING);
+
+    // Disable cache
+    router.getStateStore().stopCacheUpdateService();
+
+    // Wait until the State Store cache is stale in milliseconds
+    long interval2 =
+        conf.getTimeDuration(DFS_ROUTER_SAFEMODE_EXPIRATION,
+            TimeUnit.SECONDS.toMillis(2), TimeUnit.MILLISECONDS) +
+        conf.getTimeDuration(DFS_ROUTER_CACHE_TIME_TO_LIVE_MS,
+            TimeUnit.SECONDS.toMillis(1), TimeUnit.MILLISECONDS);
+    Thread.sleep(interval2);
+
+    // Safemode
+    assertTrue(router.getRpcServer().isInSafeMode());
+    verifyRouter(RouterServiceState.SAFEMODE);
+  }
+
+  @Test
+  public void testRouterRpcSafeMode()
+      throws IllegalStateException, IOException {
+
+    assertTrue(router.getRpcServer().isInSafeMode());
+    verifyRouter(RouterServiceState.SAFEMODE);
+
+    // If the Router is in Safe Mode, we should get a SafeModeException
+    boolean exception = false;
+    try {
+      router.getRpcServer().delete("/testfile.txt", true);
+      fail("We should have thrown a safe mode exception");
+    } catch (RouterSafeModeException sme) {
+      exception = true;
+    }
+    assertTrue("We should have thrown a safe mode exception", exception);
+  }
+
+  private void verifyRouter(RouterServiceState status)
+      throws IllegalStateException, IOException {
+    assertEquals(status, router.getRouterState());
+  }
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[42/50] [abbrv] hadoop git commit: YARN-7784. Fix Cluster metrics when placement processor is enabled. (asuresh)

Posted by as...@apache.org.
YARN-7784. Fix Cluster metrics when placement processor is enabled. (asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/3663239d
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/3663239d
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/3663239d

Branch: refs/heads/YARN-6592
Commit: 3663239d8726a435bd4dda71c0553e7965b5d628
Parents: 7c6644f
Author: Arun Suresh <as...@apache.org>
Authored: Thu Jan 25 19:09:21 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../scheduler/AppSchedulingInfo.java            | 10 ++++-
 .../scheduler/common/fica/FiCaSchedulerApp.java |  7 +++
 .../constraint/TestPlacementProcessor.java      | 45 ++++++++++++++++++++
 3 files changed, 60 insertions(+), 2 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/3663239d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
index 0389895..1efdd8b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/AppSchedulingInfo.java
@@ -694,6 +694,12 @@ public class AppSchedulingInfo {
       metrics.runAppAttempt(applicationId, user);
     }
 
+    updateMetrics(applicationId, type, node, containerAllocated, user, queue);
+  }
+
+  public static void updateMetrics(ApplicationId applicationId, NodeType type,
+      SchedulerNode node, Container containerAllocated, String user,
+      Queue queue) {
     if (LOG.isDebugEnabled()) {
       LOG.debug("allocate: applicationId=" + applicationId + " container="
           + containerAllocated.getId() + " host=" + containerAllocated
@@ -702,10 +708,10 @@ public class AppSchedulingInfo {
           + type);
     }
     if(node != null) {
-      metrics.allocateResources(node.getPartition(), user, 1,
+      queue.getMetrics().allocateResources(node.getPartition(), user, 1,
           containerAllocated.getResource(), true);
     }
-    metrics.incrNodeTypeAggregations(user, type);
+    queue.getMetrics().incrNodeTypeAggregations(user, type);
   }
 
   // Get AppPlacementAllocator by specified schedulerKey

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3663239d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
index 7eb1e31..f3da0a3 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/common/fica/FiCaSchedulerApp.java
@@ -56,6 +56,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainerRese
 import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.RMContainerState;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractUsersManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.Allocation;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AppSchedulingInfo;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.Queue;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.QueueResourceQuotas;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceLimits;
@@ -548,6 +549,12 @@ public class FiCaSchedulerApp extends SchedulerApplicationAttempt {
               ((RMContainerImpl) rmContainer).setAllocationTags(
                   containerRequest.getSchedulingRequest().getAllocationTags());
             }
+          } else {
+            AppSchedulingInfo.updateMetrics(getApplicationId(),
+                allocation.getAllocationLocalityType(),
+                schedulerContainer.getSchedulerNode(),
+                schedulerContainer.getRmContainer().getContainer(), getUser(),
+                getQueue());
           }
 
           attemptResourceUsage.incUsed(schedulerContainer.getNodePartition(),

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3663239d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
index 8426b20..698c17b 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
@@ -39,6 +39,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
 import org.apache.hadoop.yarn.server.resourcemanager.MockNM;
 import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.QueueMetrics;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacityScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacitySchedulerConfiguration;
@@ -148,6 +149,10 @@ public class TestPlacementProcessor {
         .collect(Collectors.toSet());
     // Ensure unique nodes (antiaffinity)
     Assert.assertEquals(4, nodeIds.size());
+
+    QueueMetrics metrics = rm.getResourceScheduler().getRootQueueMetrics();
+    // Verify Metrics
+    verifyMetrics(metrics, 11264, 11, 5120, 5, 5);
   }
 
   @Test(timeout = 300000)
@@ -197,6 +202,10 @@ public class TestPlacementProcessor {
         .collect(Collectors.toSet());
     // Ensure unique nodes (antiaffinity)
     Assert.assertEquals(5, nodeIds.size());
+
+    QueueMetrics metrics = rm.getResourceScheduler().getRootQueueMetrics();
+    // Verify Metrics
+    verifyMetrics(metrics, 14336, 14, 6144, 6, 6);
   }
 
   @Test(timeout = 300000)
@@ -245,6 +254,10 @@ public class TestPlacementProcessor {
     for (NodeId n : nodeIdContainerIdMap.keySet()) {
       Assert.assertTrue(nodeIdContainerIdMap.get(n) < 5);
     }
+
+    QueueMetrics metrics = rm.getResourceScheduler().getRootQueueMetrics();
+    // Verify Metrics
+    verifyMetrics(metrics, 23552, 23, 9216, 9, 9);
   }
 
   @Test(timeout = 300000)
@@ -288,6 +301,10 @@ public class TestPlacementProcessor {
         .collect(Collectors.toSet());
     // Ensure all containers end up on the same node (affinity)
     Assert.assertEquals(1, nodeIds.size());
+
+    QueueMetrics metrics = rm.getResourceScheduler().getRootQueueMetrics();
+    // Verify Metrics
+    verifyMetrics(metrics, 26624, 26, 6144, 6, 6);
   }
 
   @Test(timeout = 300000)
@@ -340,6 +357,10 @@ public class TestPlacementProcessor {
     for (NodeId n : nodeIdContainerIdMap.keySet()) {
       Assert.assertTrue(nodeIdContainerIdMap.get(n) < 4);
     }
+
+    QueueMetrics metrics = rm.getResourceScheduler().getRootQueueMetrics();
+    // Verify Metrics
+    verifyMetrics(metrics, 9216, 9, 7168, 7, 7);
   }
 
   @Test(timeout = 300000)
@@ -407,6 +428,10 @@ public class TestPlacementProcessor {
     Assert.assertEquals(4, rej.getRequest().getAllocationRequestId());
     Assert.assertEquals(RejectionReason.COULD_NOT_SCHEDULE_ON_NODE,
         rej.getReason());
+
+    QueueMetrics metrics = rm.getResourceScheduler().getRootQueueMetrics();
+    // Verify Metrics
+    verifyMetrics(metrics, 12288, 12, 4096, 4, 4);
   }
 
   @Test(timeout = 300000)
@@ -490,6 +515,10 @@ public class TestPlacementProcessor {
         .map(x -> x.getNodeId()).collect(Collectors.toSet());
     // Ensure unique nodes
     Assert.assertEquals(4, nodeIds.size());
+
+    QueueMetrics metrics = rm.getResourceScheduler().getRootQueueMetrics();
+    // Verify Metrics
+    verifyMetrics(metrics, 15360, 19, 9216, 5, 5);
   }
 
   @Test(timeout = 300000)
@@ -557,6 +586,10 @@ public class TestPlacementProcessor {
     RejectedSchedulingRequest rej = rejectedReqs.get(0);
     Assert.assertEquals(RejectionReason.COULD_NOT_PLACE_ON_NODE,
         rej.getReason());
+
+    QueueMetrics metrics = rm.getResourceScheduler().getRootQueueMetrics();
+    // Verify Metrics
+    verifyMetrics(metrics, 11264, 11, 5120, 5, 5);
   }
 
   private static void waitForContainerAllocation(Collection<MockNM> nodes,
@@ -594,4 +627,16 @@ public class TestPlacementProcessor {
             ResourceSizing.newInstance(1, Resource.newInstance(mem, cores)))
         .build();
   }
+
+  private static void verifyMetrics(QueueMetrics metrics, long availableMB,
+      int availableVirtualCores, long allocatedMB,
+      int allocatedVirtualCores, int allocatedContainers) {
+    Assert.assertEquals(availableMB, metrics.getAvailableMB());
+    Assert.assertEquals(availableVirtualCores,
+        metrics.getAvailableVirtualCores());
+    Assert.assertEquals(allocatedMB, metrics.getAllocatedMB());
+    Assert.assertEquals(allocatedVirtualCores,
+        metrics.getAllocatedVirtualCores());
+    Assert.assertEquals(allocatedContainers, metrics.getAllocatedContainers());
+  }
 }


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[31/50] [abbrv] hadoop git commit: YARN-7448. [API] Add SchedulingRequest to the AllocateRequest. (Panagiotis Garefalakis via asuresh)

Posted by as...@apache.org.
YARN-7448. [API] Add SchedulingRequest to the AllocateRequest. (Panagiotis Garefalakis via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/10494c4f
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/10494c4f
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/10494c4f

Branch: refs/heads/YARN-6592
Commit: 10494c4f28d7510799629780ba345f264c5067d5
Parents: 6c114d0
Author: Arun Suresh <as...@apache.org>
Authored: Fri Nov 17 10:42:43 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../api/protocolrecords/AllocateRequest.java    | 42 ++++++++++
 .../hadoop/yarn/api/records/ResourceSizing.java | 27 +++++++
 .../yarn/api/records/SchedulingRequest.java     |  1 +
 .../src/main/proto/yarn_service_protos.proto    |  1 +
 .../impl/pb/AllocateRequestPBImpl.java          | 83 ++++++++++++++++++++
 .../records/impl/pb/ResourceSizingPBImpl.java   |  2 +-
 .../impl/pb/SchedulingRequestPBImpl.java        | 16 ++++
 .../hadoop/yarn/api/TestPBImplRecords.java      | 19 +++++
 8 files changed, 190 insertions(+), 1 deletion(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/10494c4f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java
index ae0891e..d8d2347 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/AllocateRequest.java
@@ -18,6 +18,7 @@
 
 package org.apache.hadoop.yarn.api.protocolrecords;
 
+import java.util.Collections;
 import java.util.List;
 
 import org.apache.hadoop.classification.InterfaceAudience.Public;
@@ -28,6 +29,7 @@ import org.apache.hadoop.yarn.api.records.Container;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.ResourceBlacklistRequest;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.util.Records;
 
@@ -212,6 +214,32 @@ public abstract class AllocateRequest {
   public abstract void setUpdateRequests(
       List<UpdateContainerRequest> updateRequests);
 
+  /**
+   * Get the list of Scheduling requests being sent by the
+   * <code>ApplicationMaster</code>.
+   * @return list of {@link SchedulingRequest} being sent by the
+   *         <code>ApplicationMaster</code>.
+   */
+  @Public
+  @Unstable
+  public List<SchedulingRequest> getSchedulingRequests() {
+    return Collections.EMPTY_LIST;
+  }
+
+  /**
+   * Set the list of Scheduling requests to inform the
+   * <code>ResourceManager</code> about the application's resource requirements
+   * (potentially including allocation tags & placement constraints).
+   * @param schedulingRequests list of <code>SchedulingRequest</code> to update
+   *          the <code>ResourceManager</code> about the application's resource
+   *          requirements.
+   */
+  @Public
+  @Unstable
+  public void setSchedulingRequests(
+      List<SchedulingRequest> schedulingRequests) {
+  }
+
   @Public
   @Unstable
   public static AllocateRequestBuilder newBuilder() {
@@ -314,6 +342,20 @@ public abstract class AllocateRequest {
     }
 
     /**
+     * Set the <code>schedulingRequests</code> of the request.
+     * @see AllocateRequest#setSchedulingRequests(List)
+     * @param schedulingRequests <code>SchedulingRequest</code> of the request
+     * @return {@link AllocateRequestBuilder}
+     */
+    @Public
+    @Unstable
+    public AllocateRequestBuilder schedulingRequests(
+        List<SchedulingRequest> schedulingRequests) {
+      allocateRequest.setSchedulingRequests(schedulingRequests);
+      return this;
+    }
+
+    /**
      * Return generated {@link AllocateRequest} object.
      * @return {@link AllocateRequest}
      */

http://git-wip-us.apache.org/repos/asf/hadoop/blob/10494c4f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java
index d82be11..8cdc63f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/ResourceSizing.java
@@ -61,4 +61,31 @@ public abstract class ResourceSizing {
   @Public
   @Unstable
   public abstract void setResources(Resource resources);
+
+  @Override
+  public int hashCode() {
+    int result = getResources().hashCode();
+    result = 31 * result + getNumAllocations();
+    return result;
+  }
+
+  @Override
+  public boolean equals(Object obj) {
+    if (this == obj) {
+      return true;
+    }
+    if(obj == null || getClass() != obj.getClass()) {
+      return false;
+    }
+
+    ResourceSizing that = (ResourceSizing) obj;
+
+    if(getNumAllocations() != that.getNumAllocations()) {
+      return  false;
+    }
+    if(!getResources().equals(that.getResources())) {
+      return false;
+    }
+    return true;
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/10494c4f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
index 47a0697..e32dd24 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/api/records/SchedulingRequest.java
@@ -49,6 +49,7 @@ public abstract class SchedulingRequest {
     return SchedulingRequest.newBuilder()
         .allocationRequestId(allocationRequestId).priority(priority)
         .executionType(executionType).allocationTags(allocationTags)
+        .resourceSizing(resourceSizing)
         .placementConstraintExpression(placementConstraintExpression).build();
   }
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/10494c4f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
index 68e585d..e49c4e3 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/proto/yarn_service_protos.proto
@@ -91,6 +91,7 @@ message AllocateRequestProto {
   optional int32 response_id = 4;
   optional float progress = 5;
   repeated UpdateContainerRequestProto update_requests = 7;
+  repeated SchedulingRequestProto scheduling_requests = 10;
 }
 
 message NMTokenProto {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/10494c4f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java
index 0f0f571..b460044 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/protocolrecords/impl/pb/AllocateRequestPBImpl.java
@@ -29,14 +29,17 @@ import org.apache.hadoop.yarn.api.protocolrecords.AllocateRequest;
 import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.ResourceBlacklistRequest;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.api.records.impl.pb.ContainerIdPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.ResourceBlacklistRequestPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.ResourceRequestPBImpl;
+import org.apache.hadoop.yarn.api.records.impl.pb.SchedulingRequestPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.UpdateContainerRequestPBImpl;
 import org.apache.hadoop.yarn.proto.YarnProtos.ContainerIdProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceBlacklistRequestProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceRequestProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.SchedulingRequestProto;
 import org.apache.hadoop.yarn.proto.YarnServiceProtos.UpdateContainerRequestProto;
 import org.apache.hadoop.yarn.proto.YarnServiceProtos.AllocateRequestProto;
 import org.apache.hadoop.yarn.proto.YarnServiceProtos.AllocateRequestProtoOrBuilder;
@@ -53,6 +56,7 @@ public class AllocateRequestPBImpl extends AllocateRequest {
   private List<ResourceRequest> ask = null;
   private List<ContainerId> release = null;
   private List<UpdateContainerRequest> updateRequests = null;
+  private List<SchedulingRequest> schedulingRequests = null;
   private ResourceBlacklistRequest blacklistRequest = null;
   
   public AllocateRequestPBImpl() {
@@ -101,6 +105,9 @@ public class AllocateRequestPBImpl extends AllocateRequest {
     if (this.updateRequests != null) {
       addUpdateRequestsToProto();
     }
+    if (this.schedulingRequests != null) {
+      addSchedulingRequestsToProto();
+    }
     if (this.blacklistRequest != null) {
       builder.setBlacklistRequest(convertToProtoFormat(this.blacklistRequest));
     }
@@ -178,6 +185,23 @@ public class AllocateRequestPBImpl extends AllocateRequest {
   }
 
   @Override
+  public List<SchedulingRequest> getSchedulingRequests() {
+    initSchedulingRequests();
+    return this.schedulingRequests;
+  }
+
+  @Override
+  public void setSchedulingRequests(
+      List<SchedulingRequest> schedulingRequests) {
+    if (schedulingRequests == null) {
+      return;
+    }
+    initSchedulingRequests();
+    this.schedulingRequests.clear();
+    this.schedulingRequests.addAll(schedulingRequests);
+  }
+
+  @Override
   public ResourceBlacklistRequest getResourceBlacklistRequest() {
     AllocateRequestProtoOrBuilder p = viaProto ? proto : builder;
     if (this.blacklistRequest != null) {
@@ -261,6 +285,20 @@ public class AllocateRequestPBImpl extends AllocateRequest {
     }
   }
 
+  private void initSchedulingRequests() {
+    if (this.schedulingRequests != null) {
+      return;
+    }
+    AllocateRequestProtoOrBuilder p = viaProto ? proto : builder;
+    List<SchedulingRequestProto> list =
+        p.getSchedulingRequestsList();
+    this.schedulingRequests = new ArrayList<>();
+
+    for (SchedulingRequestProto c : list) {
+      this.schedulingRequests.add(convertFromProtoFormat(c));
+    }
+  }
+
   private void addUpdateRequestsToProto() {
     maybeInitBuilder();
     builder.clearUpdateRequests();
@@ -297,6 +335,41 @@ public class AllocateRequestPBImpl extends AllocateRequest {
     builder.addAllUpdateRequests(iterable);
   }
 
+  private void addSchedulingRequestsToProto() {
+    maybeInitBuilder();
+    builder.clearSchedulingRequests();
+    if (schedulingRequests == null) {
+      return;
+    }
+    Iterable<SchedulingRequestProto> iterable =
+        new Iterable<SchedulingRequestProto>() {
+          @Override
+          public Iterator<SchedulingRequestProto> iterator() {
+            return new Iterator<SchedulingRequestProto>() {
+
+              private Iterator<SchedulingRequest> iter =
+                  schedulingRequests.iterator();
+
+              @Override
+              public boolean hasNext() {
+                return iter.hasNext();
+              }
+
+              @Override
+              public SchedulingRequestProto next() {
+                return convertToProtoFormat(iter.next());
+              }
+
+              @Override
+              public void remove() {
+                throw new UnsupportedOperationException();
+              }
+            };
+
+          }
+        };
+    builder.addAllSchedulingRequests(iterable);
+  }
   @Override
   public List<ContainerId> getReleaseList() {
     initReleases();
@@ -377,6 +450,16 @@ public class AllocateRequestPBImpl extends AllocateRequest {
     return ((UpdateContainerRequestPBImpl) t).getProto();
   }
 
+  private SchedulingRequestPBImpl convertFromProtoFormat(
+      SchedulingRequestProto p) {
+    return new SchedulingRequestPBImpl(p);
+  }
+
+  private SchedulingRequestProto convertToProtoFormat(
+      SchedulingRequest t) {
+    return ((SchedulingRequestPBImpl) t).getProto();
+  }
+
   private ContainerIdPBImpl convertFromProtoFormat(ContainerIdProto p) {
     return new ContainerIdPBImpl(p);
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/10494c4f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
index 05bb3bd..f98e488 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/ResourceSizingPBImpl.java
@@ -112,6 +112,6 @@ public class ResourceSizingPBImpl extends ResourceSizing {
   }
 
   private ResourceProto convertToProtoFormat(Resource r) {
-    return ((ResourcePBImpl) r).getProto();
+    return ProtoUtils.convertToProtoFormat(r);
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/10494c4f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
index 7826b36..305856a 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/api/records/impl/pb/SchedulingRequestPBImpl.java
@@ -263,4 +263,20 @@ public class SchedulingRequestPBImpl extends SchedulingRequest {
     this.allocationTags = new HashSet<>();
     this.allocationTags.addAll(p.getAllocationTagsList());
   }
+
+  @Override
+  public int hashCode() {
+    return getProto().hashCode();
+  }
+
+  @Override
+  public boolean equals(Object other) {
+    if (other == null) {
+      return false;
+    }
+    if (other.getClass().isAssignableFrom(this.getClass())) {
+      return this.getProto().equals(this.getClass().cast(other).getProto());
+    }
+    return false;
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/10494c4f/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java
index c5585c2..a0b907d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/api/TestPBImplRecords.java
@@ -149,8 +149,10 @@ import org.apache.hadoop.yarn.api.records.ResourceInformation;
 import org.apache.hadoop.yarn.api.records.ResourceBlacklistRequest;
 import org.apache.hadoop.yarn.api.records.ResourceOption;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.api.records.ResourceTypeInfo;
 import org.apache.hadoop.yarn.api.records.ResourceUtilization;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.SerializedException;
 import org.apache.hadoop.yarn.api.records.StrictPreemptionContract;
 import org.apache.hadoop.yarn.api.records.Token;
@@ -189,7 +191,9 @@ import org.apache.hadoop.yarn.api.records.impl.pb.ResourceBlacklistRequestPBImpl
 import org.apache.hadoop.yarn.api.records.impl.pb.ResourceOptionPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.ResourcePBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.ResourceRequestPBImpl;
+import org.apache.hadoop.yarn.api.records.impl.pb.ResourceSizingPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.ResourceTypeInfoPBImpl;
+import org.apache.hadoop.yarn.api.records.impl.pb.SchedulingRequestPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.SerializedExceptionPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.StrictPreemptionContractPBImpl;
 import org.apache.hadoop.yarn.api.records.impl.pb.TokenPBImpl;
@@ -225,6 +229,8 @@ import org.apache.hadoop.yarn.proto.YarnProtos.ResourceBlacklistRequestProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceOptionProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.ResourceRequestProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.ResourceSizingProto;
+import org.apache.hadoop.yarn.proto.YarnProtos.SchedulingRequestProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.SerializedExceptionProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.StrictPreemptionContractProto;
 import org.apache.hadoop.yarn.proto.YarnProtos.URLProto;
@@ -428,6 +434,8 @@ public class TestPBImplRecords extends BasePBImplRecordsTest {
     generateByNewInstance(QueueConfigurations.class);
     generateByNewInstance(CollectorInfo.class);
     generateByNewInstance(ResourceTypeInfo.class);
+    generateByNewInstance(ResourceSizing.class);
+    generateByNewInstance(SchedulingRequest.class);
   }
 
   @Test
@@ -907,6 +915,17 @@ public class TestPBImplRecords extends BasePBImplRecordsTest {
   }
 
   @Test
+  public void testResourceSizingPBImpl() throws Exception {
+    validatePBImplRecord(ResourceSizingPBImpl.class, ResourceSizingProto.class);
+  }
+
+  @Test
+  public void testSchedulingRequestPBImpl() throws Exception {
+    validatePBImplRecord(SchedulingRequestPBImpl.class,
+        SchedulingRequestProto.class);
+  }
+
+  @Test
   public void testSerializedExceptionPBImpl() throws Exception {
     validatePBImplRecord(SerializedExceptionPBImpl.class,
         SerializedExceptionProto.class);


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[03/50] [abbrv] hadoop git commit: YARN-2185. Use pipes when localizing archives. Contributed by Miklos Szegedi

Posted by as...@apache.org.
YARN-2185. Use pipes when localizing archives. Contributed by Miklos Szegedi


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/1b0f265d
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/1b0f265d
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/1b0f265d

Branch: refs/heads/YARN-6592
Commit: 1b0f265db1a5bfccf1d870912237ea9618bd9c34
Parents: f2fa736
Author: Jason Lowe <jl...@apache.org>
Authored: Fri Jan 26 13:25:20 2018 -0600
Committer: Jason Lowe <jl...@apache.org>
Committed: Fri Jan 26 13:25:20 2018 -0600

----------------------------------------------------------------------
 .../java/org/apache/hadoop/fs/FileUtil.java     | 251 ++++++++++++++++++-
 .../java/org/apache/hadoop/util/RunJar.java     |  65 +++++
 .../org/apache/hadoop/yarn/util/FSDownload.java | 215 ++++++++++------
 .../apache/hadoop/yarn/util/TestFSDownload.java |  30 ++-
 4 files changed, 462 insertions(+), 99 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/1b0f265d/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java
index 4d971aa..bf9b146 100644
--- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java
+++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/FileUtil.java
@@ -20,27 +20,35 @@ package org.apache.hadoop.fs;
 
 import java.io.BufferedInputStream;
 import java.io.BufferedOutputStream;
+import java.io.BufferedReader;
 import java.io.File;
 import java.io.FileInputStream;
 import java.io.FileNotFoundException;
 import java.io.FileOutputStream;
 import java.io.IOException;
 import java.io.InputStream;
+import java.io.InputStreamReader;
 import java.io.OutputStream;
 import java.net.InetAddress;
 import java.net.URI;
 import java.net.UnknownHostException;
+import java.nio.charset.Charset;
 import java.nio.file.AccessDeniedException;
 import java.util.ArrayList;
 import java.util.Enumeration;
 import java.util.List;
 import java.util.Map;
+import java.util.concurrent.ExecutionException;
+import java.util.concurrent.ExecutorService;
+import java.util.concurrent.Executors;
+import java.util.concurrent.Future;
 import java.util.jar.Attributes;
 import java.util.jar.JarOutputStream;
 import java.util.jar.Manifest;
 import java.util.zip.GZIPInputStream;
 import java.util.zip.ZipEntry;
 import java.util.zip.ZipFile;
+import java.util.zip.ZipInputStream;
 
 import org.apache.commons.collections.map.CaseInsensitiveMap;
 import org.apache.commons.compress.archivers.tar.TarArchiveEntry;
@@ -75,6 +83,11 @@ public class FileUtil {
   public static final int SYMLINK_NO_PRIVILEGE = 2;
 
   /**
+   * Buffer size for copy the content of compressed file to new file.
+   */
+  private static final int BUFFER_SIZE = 8_192;
+
+  /**
    * convert an array of FileStatus to an array of Path
    *
    * @param stats
@@ -526,6 +539,22 @@ public class FileUtil {
   }
 
   /**
+   * Convert a os-native filename to a path that works for the shell
+   * and avoids script injection attacks.
+   * @param file The filename to convert
+   * @return The unix pathname
+   * @throws IOException on windows, there can be problems with the subprocess
+   */
+  public static String makeSecureShellPath(File file) throws IOException {
+    if (Shell.WINDOWS) {
+      // Currently it is never called, but it might be helpful in the future.
+      throw new UnsupportedOperationException("Not implemented for Windows");
+    } else {
+      return makeShellPath(file, false).replace("'", "'\\''");
+    }
+  }
+
+  /**
    * Convert a os-native filename to a path that works for the shell.
    * @param file The filename to convert
    * @param makeCanonicalPath
@@ -576,11 +605,48 @@ public class FileUtil {
   }
 
   /**
-   * Given a File input it will unzip the file in a the unzip directory
+   * Given a stream input it will unzip the it in the unzip directory.
+   * passed as the second parameter
+   * @param inputStream The zip file as input
+   * @param toDir The unzip directory where to unzip the zip file.
+   * @throws IOException an exception occurred
+   */
+  public static void unZip(InputStream inputStream, File toDir)
+      throws IOException {
+    try (ZipInputStream zip = new ZipInputStream(inputStream)) {
+      int numOfFailedLastModifiedSet = 0;
+      for(ZipEntry entry = zip.getNextEntry();
+          entry != null;
+          entry = zip.getNextEntry()) {
+        if (!entry.isDirectory()) {
+          File file = new File(toDir, entry.getName());
+          File parent = file.getParentFile();
+          if (!parent.mkdirs() &&
+              !parent.isDirectory()) {
+            throw new IOException("Mkdirs failed to create " +
+                parent.getAbsolutePath());
+          }
+          try (OutputStream out = new FileOutputStream(file)) {
+            IOUtils.copyBytes(zip, out, BUFFER_SIZE);
+          }
+          if (!file.setLastModified(entry.getTime())) {
+            numOfFailedLastModifiedSet++;
+          }
+        }
+      }
+      if (numOfFailedLastModifiedSet > 0) {
+        LOG.warn("Could not set last modfied time for {} file(s)",
+            numOfFailedLastModifiedSet);
+      }
+    }
+  }
+
+  /**
+   * Given a File input it will unzip it in the unzip directory.
    * passed as the second parameter
    * @param inFile The zip file as input
    * @param unzipDir The unzip directory where to unzip the zip file.
-   * @throws IOException
+   * @throws IOException An I/O exception has occurred
    */
   public static void unZip(File inFile, File unzipDir) throws IOException {
     Enumeration<? extends ZipEntry> entries;
@@ -621,6 +687,138 @@ public class FileUtil {
   }
 
   /**
+   * Run a command and send the contents of an input stream to it.
+   * @param inputStream Input stream to forward to the shell command
+   * @param command shell command to run
+   * @throws IOException read or write failed
+   * @throws InterruptedException command interrupted
+   * @throws ExecutionException task submit failed
+   */
+  private static void runCommandOnStream(
+      InputStream inputStream, String command)
+      throws IOException, InterruptedException, ExecutionException {
+    ExecutorService executor = null;
+    ProcessBuilder builder = new ProcessBuilder();
+    builder.command(
+        Shell.WINDOWS ? "cmd" : "bash",
+        Shell.WINDOWS ? "/c" : "-c",
+        command);
+    Process process = builder.start();
+    int exitCode;
+    try {
+      // Consume stdout and stderr, to avoid blocking the command
+      executor = Executors.newFixedThreadPool(2);
+      Future output = executor.submit(() -> {
+        try {
+          // Read until the output stream receives an EOF and closed.
+          if (LOG.isDebugEnabled()) {
+            // Log directly to avoid out of memory errors
+            try (BufferedReader reader =
+                     new BufferedReader(
+                         new InputStreamReader(process.getInputStream(),
+                             Charset.forName("UTF-8")))) {
+              String line;
+              while((line = reader.readLine()) != null) {
+                LOG.debug(line);
+              }
+            }
+          } else {
+            org.apache.commons.io.IOUtils.copy(
+                process.getInputStream(),
+                new IOUtils.NullOutputStream());
+          }
+        } catch (IOException e) {
+          LOG.debug(e.getMessage());
+        }
+      });
+      Future error = executor.submit(() -> {
+        try {
+          // Read until the error stream receives an EOF and closed.
+          if (LOG.isDebugEnabled()) {
+            // Log directly to avoid out of memory errors
+            try (BufferedReader reader =
+                     new BufferedReader(
+                         new InputStreamReader(process.getErrorStream(),
+                             Charset.forName("UTF-8")))) {
+              String line;
+              while((line = reader.readLine()) != null) {
+                LOG.debug(line);
+              }
+            }
+          } else {
+            org.apache.commons.io.IOUtils.copy(
+                process.getErrorStream(),
+                new IOUtils.NullOutputStream());
+          }
+        } catch (IOException e) {
+          LOG.debug(e.getMessage());
+        }
+      });
+
+      // Pass the input stream to the command to process
+      try {
+        org.apache.commons.io.IOUtils.copy(
+            inputStream, process.getOutputStream());
+      } finally {
+        process.getOutputStream().close();
+      }
+
+      // Wait for both stdout and stderr futures to finish
+      error.get();
+      output.get();
+    } finally {
+      // Clean up the threads
+      if (executor != null) {
+        executor.shutdown();
+      }
+      // Wait to avoid leaking the child process
+      exitCode = process.waitFor();
+    }
+
+    if (exitCode != 0) {
+      throw new IOException(
+          String.format(
+              "Error executing command. %s " +
+                  "Process exited with exit code %d.",
+              command, exitCode));
+    }
+  }
+
+  /**
+   * Given a Tar File as input it will untar the file in a the untar directory
+   * passed as the second parameter
+   *
+   * This utility will untar ".tar" files and ".tar.gz","tgz" files.
+   *
+   * @param inputStream The tar file as input.
+   * @param untarDir The untar directory where to untar the tar file.
+   * @param gzipped The input stream is gzipped
+   *                TODO Use magic number and PusbackInputStream to identify
+   * @throws IOException an exception occurred
+   * @throws InterruptedException command interrupted
+   * @throws ExecutionException task submit failed
+   */
+  public static void unTar(InputStream inputStream, File untarDir,
+                           boolean gzipped)
+      throws IOException, InterruptedException, ExecutionException {
+    if (!untarDir.mkdirs()) {
+      if (!untarDir.isDirectory()) {
+        throw new IOException("Mkdirs failed to create " + untarDir);
+      }
+    }
+
+    if(Shell.WINDOWS) {
+      // Tar is not native to Windows. Use simple Java based implementation for
+      // tests and simple tar archives
+      unTarUsingJava(inputStream, untarDir, gzipped);
+    } else {
+      // spawn tar utility to untar archive for full fledged unix behavior such
+      // as resolving symlinks in tar archives
+      unTarUsingTar(inputStream, untarDir, gzipped);
+    }
+  }
+
+  /**
    * Given a Tar File as input it will untar the file in a the untar directory
    * passed as the second parameter
    *
@@ -650,23 +848,41 @@ public class FileUtil {
     }
   }
 
+  private static void unTarUsingTar(InputStream inputStream, File untarDir,
+                                    boolean gzipped)
+      throws IOException, InterruptedException, ExecutionException {
+    StringBuilder untarCommand = new StringBuilder();
+    if (gzipped) {
+      untarCommand.append("gzip -dc | (");
+    }
+    untarCommand.append("cd '");
+    untarCommand.append(FileUtil.makeSecureShellPath(untarDir));
+    untarCommand.append("' && ");
+    untarCommand.append("tar -x ");
+
+    if (gzipped) {
+      untarCommand.append(")");
+    }
+    runCommandOnStream(inputStream, untarCommand.toString());
+  }
+
   private static void unTarUsingTar(File inFile, File untarDir,
       boolean gzipped) throws IOException {
     StringBuffer untarCommand = new StringBuffer();
     if (gzipped) {
       untarCommand.append(" gzip -dc '");
-      untarCommand.append(FileUtil.makeShellPath(inFile));
+      untarCommand.append(FileUtil.makeSecureShellPath(inFile));
       untarCommand.append("' | (");
     }
     untarCommand.append("cd '");
-    untarCommand.append(FileUtil.makeShellPath(untarDir));
-    untarCommand.append("' ; ");
+    untarCommand.append(FileUtil.makeSecureShellPath(untarDir));
+    untarCommand.append("' && ");
     untarCommand.append("tar -xf ");
 
     if (gzipped) {
       untarCommand.append(" -)");
     } else {
-      untarCommand.append(FileUtil.makeShellPath(inFile));
+      untarCommand.append(FileUtil.makeSecureShellPath(inFile));
     }
     String[] shellCmd = { "bash", "-c", untarCommand.toString() };
     ShellCommandExecutor shexec = new ShellCommandExecutor(shellCmd);
@@ -701,6 +917,29 @@ public class FileUtil {
     }
   }
 
+  private static void unTarUsingJava(InputStream inputStream, File untarDir,
+                                     boolean gzipped) throws IOException {
+    TarArchiveInputStream tis = null;
+    try {
+      if (gzipped) {
+        inputStream = new BufferedInputStream(new GZIPInputStream(
+            inputStream));
+      } else {
+        inputStream =
+            new BufferedInputStream(inputStream);
+      }
+
+      tis = new TarArchiveInputStream(inputStream);
+
+      for (TarArchiveEntry entry = tis.getNextTarEntry(); entry != null;) {
+        unpackEntries(tis, entry, untarDir);
+        entry = tis.getNextTarEntry();
+      }
+    } finally {
+      IOUtils.cleanupWithLogger(LOG, tis, inputStream);
+    }
+  }
+
   private static void unpackEntries(TarArchiveInputStream tis,
       TarArchiveEntry entry, File outputDir) throws IOException {
     if (entry.isDirectory()) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/1b0f265d/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java
----------------------------------------------------------------------
diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java
index 19b51ad..89b7d76 100644
--- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java
+++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/RunJar.java
@@ -34,9 +34,11 @@ import java.util.Enumeration;
 import java.util.List;
 import java.util.jar.JarEntry;
 import java.util.jar.JarFile;
+import java.util.jar.JarInputStream;
 import java.util.jar.Manifest;
 import java.util.regex.Pattern;
 
+import org.apache.commons.io.input.TeeInputStream;
 import org.apache.hadoop.classification.InterfaceAudience;
 import org.apache.hadoop.classification.InterfaceStability;
 import org.apache.hadoop.fs.FileUtil;
@@ -98,6 +100,69 @@ public class RunJar {
    * Unpack matching files from a jar. Entries inside the jar that do
    * not match the given pattern will be skipped.
    *
+   * @param inputStream the jar stream to unpack
+   * @param toDir the destination directory into which to unpack the jar
+   * @param unpackRegex the pattern to match jar entries against
+   *
+   * @throws IOException if an I/O error has occurred or toDir
+   * cannot be created and does not already exist
+   */
+  public static void unJar(InputStream inputStream, File toDir,
+                           Pattern unpackRegex)
+      throws IOException {
+    try (JarInputStream jar = new JarInputStream(inputStream)) {
+      int numOfFailedLastModifiedSet = 0;
+      for (JarEntry entry = jar.getNextJarEntry();
+           entry != null;
+           entry = jar.getNextJarEntry()) {
+        if (!entry.isDirectory() &&
+            unpackRegex.matcher(entry.getName()).matches()) {
+          File file = new File(toDir, entry.getName());
+          ensureDirectory(file.getParentFile());
+          try (OutputStream out = new FileOutputStream(file)) {
+            IOUtils.copyBytes(jar, out, BUFFER_SIZE);
+          }
+          if (!file.setLastModified(entry.getTime())) {
+            numOfFailedLastModifiedSet++;
+          }
+        }
+      }
+      if (numOfFailedLastModifiedSet > 0) {
+        LOG.warn("Could not set last modfied time for {} file(s)",
+            numOfFailedLastModifiedSet);
+      }
+    }
+  }
+
+  /**
+   * Unpack matching files from a jar. Entries inside the jar that do
+   * not match the given pattern will be skipped. Keep also a copy
+   * of the entire jar in the same directory for backward compatibility.
+   * TODO remove this feature in a new release and do only unJar
+   *
+   * @param inputStream the jar stream to unpack
+   * @param toDir the destination directory into which to unpack the jar
+   * @param unpackRegex the pattern to match jar entries against
+   *
+   * @throws IOException if an I/O error has occurred or toDir
+   * cannot be created and does not already exist
+   */
+  @Deprecated
+  public static void unJarAndSave(InputStream inputStream, File toDir,
+                           String name, Pattern unpackRegex)
+      throws IOException{
+    File file = new File(toDir, name);
+    ensureDirectory(toDir);
+    try (OutputStream jar = new FileOutputStream(file);
+         TeeInputStream teeInputStream = new TeeInputStream(inputStream, jar)) {
+      unJar(teeInputStream, toDir, unpackRegex);
+    }
+  }
+
+  /**
+   * Unpack matching files from a jar. Entries inside the jar that do
+   * not match the given pattern will be skipped.
+   *
    * @param jarFile the .jar file to unpack
    * @param toDir the destination directory into which to unpack the jar
    * @param unpackRegex the pattern to match jar entries against

http://git-wip-us.apache.org/repos/asf/hadoop/blob/1b0f265d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java
index 6e59574..1a60948 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/java/org/apache/hadoop/yarn/util/FSDownload.java
@@ -21,6 +21,8 @@ package org.apache.hadoop.yarn.util;
 import java.io.File;
 import java.io.FileNotFoundException;
 import java.io.IOException;
+import java.io.InputStream;
+import java.io.OutputStream;
 import java.net.URISyntaxException;
 import java.security.PrivilegedExceptionAction;
 import java.util.concurrent.Callable;
@@ -29,6 +31,7 @@ import java.util.concurrent.Future;
 import java.util.regex.Pattern;
 
 import org.apache.commons.io.FileUtils;
+import org.apache.commons.io.IOUtils;
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.classification.InterfaceAudience.LimitedPrivate;
@@ -54,6 +57,7 @@ import com.google.common.annotations.VisibleForTesting;
 import com.google.common.cache.CacheLoader;
 import com.google.common.cache.LoadingCache;
 import com.google.common.util.concurrent.Futures;
+import org.apache.hadoop.yarn.exceptions.YarnException;
 
 /**
  * Download a single URL to the local disk.
@@ -247,9 +251,21 @@ public class FSDownload implements Callable<Path> {
     }
   }
 
-  private Path copy(Path sCopy, Path dstdir) throws IOException {
+  /**
+   * Localize files.
+   * @param destination destination directory
+   * @throws IOException cannot read or write file
+   * @throws YarnException subcommand returned an error
+   */
+  private void verifyAndCopy(Path destination)
+      throws IOException, YarnException {
+    final Path sCopy;
+    try {
+      sCopy = resource.getResource().toPath();
+    } catch (URISyntaxException e) {
+      throw new IOException("Invalid resource", e);
+    }
     FileSystem sourceFs = sCopy.getFileSystem(conf);
-    Path dCopy = new Path(dstdir, "tmp_"+sCopy.getName());
     FileStatus sStat = sourceFs.getFileStatus(sCopy);
     if (sStat.getModificationTime() != resource.getTimestamp()) {
       throw new IOException("Resource " + sCopy +
@@ -264,82 +280,108 @@ public class FSDownload implements Callable<Path> {
       }
     }
 
-    FileUtil.copy(sourceFs, sStat, FileSystem.getLocal(conf), dCopy, false,
-        true, conf);
-    return dCopy;
+    downloadAndUnpack(sCopy, destination);
   }
 
-  private long unpack(File localrsrc, File dst) throws IOException {
-    switch (resource.getType()) {
-    case ARCHIVE: {
-      String lowerDst = StringUtils.toLowerCase(dst.getName());
-      if (lowerDst.endsWith(".jar")) {
-        RunJar.unJar(localrsrc, dst);
-      } else if (lowerDst.endsWith(".zip")) {
-        FileUtil.unZip(localrsrc, dst);
-      } else if (lowerDst.endsWith(".tar.gz") ||
-                 lowerDst.endsWith(".tgz") ||
-                 lowerDst.endsWith(".tar")) {
-        FileUtil.unTar(localrsrc, dst);
+  /**
+   * Copy source path to destination with localization rules.
+   * @param source source path to copy. Typically HDFS
+   * @param destination destination path. Typically local filesystem
+   * @exception YarnException Any error has occurred
+   */
+  private void downloadAndUnpack(Path source, Path destination)
+      throws YarnException {
+    try {
+      FileSystem sourceFileSystem = source.getFileSystem(conf);
+      FileSystem destinationFileSystem = destination.getFileSystem(conf);
+      if (sourceFileSystem.getFileStatus(source).isDirectory()) {
+        FileUtil.copy(
+            sourceFileSystem, source,
+            destinationFileSystem, destination, false,
+            true, conf);
       } else {
-        LOG.warn("Cannot unpack " + localrsrc);
-        if (!localrsrc.renameTo(dst)) {
-            throw new IOException("Unable to rename file: [" + localrsrc
-              + "] to [" + dst + "]");
-        }
+        unpack(source, destination, sourceFileSystem, destinationFileSystem);
       }
+    } catch (Exception e) {
+      throw new YarnException("Download and unpack failed", e);
     }
-    break;
-    case PATTERN: {
+  }
+
+  /**
+   * Do the localization action on the input stream.
+   * We use the deprecated method RunJar.unJarAndSave for compatibility reasons.
+   * We should use the more efficient RunJar.unJar in the future.
+   * @param source Source path
+   * @param destination Destination pth
+   * @param sourceFileSystem Source filesystem
+   * @param destinationFileSystem Destination filesystem
+   * @throws IOException Could not read or write stream
+   * @throws InterruptedException Operation interrupted by caller
+   * @throws ExecutionException Could not create thread pool execution
+   */
+  @SuppressWarnings("deprecation")
+  private void unpack(Path source, Path destination,
+                      FileSystem sourceFileSystem,
+                      FileSystem destinationFileSystem)
+      throws IOException, InterruptedException, ExecutionException {
+    try (InputStream inputStream = sourceFileSystem.open(source)) {
+      File dst = new File(destination.toUri());
       String lowerDst = StringUtils.toLowerCase(dst.getName());
-      if (lowerDst.endsWith(".jar")) {
-        String p = resource.getPattern();
-        RunJar.unJar(localrsrc, dst,
-            p == null ? RunJar.MATCH_ANY : Pattern.compile(p));
-        File newDst = new File(dst, dst.getName());
-        if (!dst.exists() && !dst.mkdir()) {
-          throw new IOException("Unable to create directory: [" + dst + "]");
+      switch (resource.getType()) {
+      case ARCHIVE:
+        if (lowerDst.endsWith(".jar")) {
+          RunJar.unJar(inputStream, dst, RunJar.MATCH_ANY);
+        } else if (lowerDst.endsWith(".zip")) {
+          FileUtil.unZip(inputStream, dst);
+        } else if (lowerDst.endsWith(".tar.gz") ||
+            lowerDst.endsWith(".tgz") ||
+            lowerDst.endsWith(".tar")) {
+          FileUtil.unTar(inputStream, dst, lowerDst.endsWith("gz"));
+        } else {
+          LOG.warn("Cannot unpack " + source);
+          try (OutputStream outputStream =
+                   destinationFileSystem.create(destination, true)) {
+            IOUtils.copy(inputStream, outputStream);
+          }
         }
-        if (!localrsrc.renameTo(newDst)) {
-          throw new IOException("Unable to rename file: [" + localrsrc
-              + "] to [" + newDst + "]");
+        break;
+      case PATTERN:
+        if (lowerDst.endsWith(".jar")) {
+          String p = resource.getPattern();
+          if (!dst.exists() && !dst.mkdir()) {
+            throw new IOException("Unable to create directory: [" + dst + "]");
+          }
+          RunJar.unJarAndSave(inputStream, dst, source.getName(),
+              p == null ? RunJar.MATCH_ANY : Pattern.compile(p));
+        } else if (lowerDst.endsWith(".zip")) {
+          LOG.warn("Treating [" + source + "] as an archive even though it " +
+              "was specified as PATTERN");
+          FileUtil.unZip(inputStream, dst);
+        } else if (lowerDst.endsWith(".tar.gz") ||
+            lowerDst.endsWith(".tgz") ||
+            lowerDst.endsWith(".tar")) {
+          LOG.warn("Treating [" + source + "] as an archive even though it " +
+              "was specified as PATTERN");
+          FileUtil.unTar(inputStream, dst, lowerDst.endsWith("gz"));
+        } else {
+          LOG.warn("Cannot unpack " + source);
+          try (OutputStream outputStream =
+                   destinationFileSystem.create(destination, true)) {
+            IOUtils.copy(inputStream, outputStream);
+          }
         }
-      } else if (lowerDst.endsWith(".zip")) {
-        LOG.warn("Treating [" + localrsrc + "] as an archive even though it " +
-        		"was specified as PATTERN");
-        FileUtil.unZip(localrsrc, dst);
-      } else if (lowerDst.endsWith(".tar.gz") ||
-                 lowerDst.endsWith(".tgz") ||
-                 lowerDst.endsWith(".tar")) {
-        LOG.warn("Treating [" + localrsrc + "] as an archive even though it " +
-        "was specified as PATTERN");
-        FileUtil.unTar(localrsrc, dst);
-      } else {
-        LOG.warn("Cannot unpack " + localrsrc);
-        if (!localrsrc.renameTo(dst)) {
-          throw new IOException("Unable to rename file: [" + localrsrc
-              + "] to [" + dst + "]");
+        break;
+      case FILE:
+      default:
+        try (OutputStream outputStream =
+                 destinationFileSystem.create(destination, true)) {
+          IOUtils.copy(inputStream, outputStream);
         }
+        break;
       }
+      // TODO Should calculate here before returning
+      //return FileUtil.getDU(destDir);
     }
-    break;
-    case FILE:
-    default:
-      if (!localrsrc.renameTo(dst)) {
-        throw new IOException("Unable to rename file: [" + localrsrc
-          + "] to [" + dst + "]");
-      }
-      break;
-    }
-    if(localrsrc.isFile()){
-      try {
-        files.delete(new Path(localrsrc.toString()), false);
-      } catch (IOException ignore) {
-      }
-    }
-    return 0;
-    // TODO Should calculate here before returning
-    //return FileUtil.getDU(destDir);
   }
 
   @Override
@@ -352,27 +394,34 @@ public class FSDownload implements Callable<Path> {
     }
 
     if (LOG.isDebugEnabled()) {
-      LOG.debug("Starting to download " + sCopy);
+      LOG.debug(String.format("Starting to download %s %s %s",
+          sCopy,
+          resource.getType(),
+          resource.getPattern()));
     }
 
-    createDir(destDirPath, cachePerms);
-    final Path dst_work = new Path(destDirPath + "_tmp");
-    createDir(dst_work, cachePerms);
-    Path dFinal = files.makeQualified(new Path(dst_work, sCopy.getName()));
+    final Path destinationTmp = new Path(destDirPath + "_tmp");
+    createDir(destinationTmp, PRIVATE_DIR_PERMS);
+    Path dFinal =
+        files.makeQualified(new Path(destinationTmp, sCopy.getName()));
     try {
-      Path dTmp = null == userUgi ? files.makeQualified(copy(sCopy, dst_work))
-          : userUgi.doAs(new PrivilegedExceptionAction<Path>() {
-            public Path run() throws Exception {
-              return files.makeQualified(copy(sCopy, dst_work));
-            };
-          });
-      unpack(new File(dTmp.toUri()), new File(dFinal.toUri()));
+      if (userUgi == null) {
+        verifyAndCopy(dFinal);
+      } else {
+        userUgi.doAs(new PrivilegedExceptionAction<Void>() {
+          @Override
+          public Void run() throws Exception {
+            verifyAndCopy(dFinal);
+            return null;
+          }
+        });
+      }
       changePermissions(dFinal.getFileSystem(conf), dFinal);
-      files.rename(dst_work, destDirPath, Rename.OVERWRITE);
+      files.rename(destinationTmp, destDirPath, Rename.OVERWRITE);
 
       if (LOG.isDebugEnabled()) {
-        LOG.debug("File has been downloaded to " +
-            new Path(destDirPath, sCopy.getName()));
+        LOG.debug(String.format("File has been downloaded to %s from %s",
+            new Path(destDirPath, sCopy.getName()), sCopy));
       }
     } catch (Exception e) {
       try {
@@ -382,7 +431,7 @@ public class FSDownload implements Callable<Path> {
       throw e;
     } finally {
       try {
-        files.delete(dst_work, true);
+        files.delete(destinationTmp, true);
       } catch (FileNotFoundException ignore) {
       }
       conf = null;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/1b0f265d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java
index 877dd08..fa8c039 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/test/java/org/apache/hadoop/yarn/util/TestFSDownload.java
@@ -82,6 +82,9 @@ import com.google.common.cache.CacheBuilder;
 import com.google.common.cache.CacheLoader;
 import com.google.common.cache.LoadingCache;
 
+/**
+ * Unit test for the FSDownload class.
+ */
 public class TestFSDownload {
 
   private static final Log LOG = LogFactory.getLog(TestFSDownload.class);
@@ -90,7 +93,8 @@ public class TestFSDownload {
   private enum TEST_FILE_TYPE {
     TAR, JAR, ZIP, TGZ
   };
-  
+  private Configuration conf = new Configuration();
+
   @AfterClass
   public static void deleteTestDir() throws IOException {
     FileContext fs = FileContext.getLocalFSFileContext();
@@ -132,6 +136,18 @@ public class TestFSDownload {
     FileOutputStream stream = new FileOutputStream(jarFile);
     LOG.info("Create jar out stream ");
     JarOutputStream out = new JarOutputStream(stream, new Manifest());
+    ZipEntry entry = new ZipEntry("classes/1.class");
+    out.putNextEntry(entry);
+    out.write(1);
+    out.write(2);
+    out.write(3);
+    out.closeEntry();
+    ZipEntry entry2 = new ZipEntry("classes/2.class");
+    out.putNextEntry(entry2);
+    out.write(1);
+    out.write(2);
+    out.write(3);
+    out.closeEntry();
     LOG.info("Done writing jar stream ");
     out.close();
     LocalResource ret = recordFactory.newRecordInstance(LocalResource.class);
@@ -256,7 +272,6 @@ public class TestFSDownload {
   @Test (timeout=10000)
   public void testDownloadBadPublic() throws IOException, URISyntaxException,
       InterruptedException {
-    Configuration conf = new Configuration();
     conf.set(CommonConfigurationKeys.FS_PERMISSIONS_UMASK_KEY, "077");
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
@@ -307,7 +322,6 @@ public class TestFSDownload {
   @Test (timeout=60000)
   public void testDownloadPublicWithStatCache() throws IOException,
       URISyntaxException, InterruptedException, ExecutionException {
-    final Configuration conf = new Configuration();
     FileContext files = FileContext.getLocalFSFileContext(conf);
     Path basedir = files.makeQualified(new Path("target",
       TestFSDownload.class.getSimpleName()));
@@ -382,7 +396,6 @@ public class TestFSDownload {
   @Test (timeout=10000)
   public void testDownload() throws IOException, URISyntaxException,
       InterruptedException {
-    Configuration conf = new Configuration();
     conf.set(CommonConfigurationKeys.FS_PERMISSIONS_UMASK_KEY, "077");
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
@@ -438,7 +451,7 @@ public class TestFSDownload {
         FileStatus status = files.getFileStatus(localized.getParent());
         FsPermission perm = status.getPermission();
         assertEquals("Cache directory permissions are incorrect",
-            new FsPermission((short)0755), perm);
+            new FsPermission((short)0700), perm);
 
         status = files.getFileStatus(localized);
         perm = status.getPermission();
@@ -455,7 +468,6 @@ public class TestFSDownload {
 
   private void downloadWithFileType(TEST_FILE_TYPE fileType) throws IOException, 
       URISyntaxException, InterruptedException{
-    Configuration conf = new Configuration();
     conf.set(CommonConfigurationKeys.FS_PERMISSIONS_UMASK_KEY, "077");
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
@@ -530,7 +542,7 @@ public class TestFSDownload {
     }
   }
 
-  @Test (timeout=10000) 
+  @Test (timeout=10000)
   public void testDownloadArchive() throws IOException, URISyntaxException,
       InterruptedException {
     downloadWithFileType(TEST_FILE_TYPE.TAR);
@@ -542,7 +554,7 @@ public class TestFSDownload {
     downloadWithFileType(TEST_FILE_TYPE.JAR);
   }
 
-  @Test (timeout=10000) 
+  @Test (timeout=10000)
   public void testDownloadArchiveZip() throws IOException, URISyntaxException,
       InterruptedException {
     downloadWithFileType(TEST_FILE_TYPE.ZIP);
@@ -603,7 +615,6 @@ public class TestFSDownload {
 
   @Test (timeout=10000)
   public void testDirDownload() throws IOException, InterruptedException {
-    Configuration conf = new Configuration();
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
       TestFSDownload.class.getSimpleName()));
@@ -668,7 +679,6 @@ public class TestFSDownload {
 
   @Test (timeout=10000)
   public void testUniqueDestinationPath() throws Exception {
-    Configuration conf = new Configuration();
     FileContext files = FileContext.getLocalFSFileContext(conf);
     final Path basedir = files.makeQualified(new Path("target",
         TestFSDownload.class.getSimpleName()));


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[37/50] [abbrv] hadoop git commit: YARN-7612. Add Processor Framework for Rich Placement Constraints. (asuresh)

Posted by as...@apache.org.
YARN-7612. Add Processor Framework for Rich Placement Constraints. (asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/f7d01a2c
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/f7d01a2c
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/f7d01a2c

Branch: refs/heads/YARN-6592
Commit: f7d01a2cf23fbf837144d4b2a93efd6d2fd4ab7f
Parents: 80af031
Author: Arun Suresh <as...@apache.org>
Authored: Fri Dec 22 15:51:20 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../hadoop/yarn/conf/YarnConfiguration.java     |  26 ++
 .../src/main/resources/yarn-default.xml         |  30 ++
 .../ApplicationMasterService.java               |  15 +
 .../rmcontainer/RMContainerImpl.java            |   7 +-
 .../scheduler/capacity/CapacityScheduler.java   |   2 +
 .../constraint/processor/BatchedRequests.java   | 105 +++++
 .../processor/NodeCandidateSelector.java        |  38 ++
 .../processor/PlacementDispatcher.java          | 145 +++++++
 .../processor/PlacementProcessor.java           | 343 ++++++++++++++++
 .../processor/SamplePlacementAlgorithm.java     | 144 +++++++
 .../constraint/processor/package-info.java      |  29 ++
 .../yarn/server/resourcemanager/MockAM.java     |  26 ++
 .../yarn/server/resourcemanager/MockRM.java     |  14 +
 .../constraint/TestPlacementProcessor.java      | 394 +++++++++++++++++++
 14 files changed, 1316 insertions(+), 2 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
index bbbfc52..8fb3c2e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-api/src/main/java/org/apache/hadoop/yarn/conf/YarnConfiguration.java
@@ -531,6 +531,32 @@ public class YarnConfiguration extends Configuration {
   /** The class to use as the resource scheduler.*/
   public static final String RM_SCHEDULER = 
     RM_PREFIX + "scheduler.class";
+
+  /** Placement Algorithm. */
+  public static final String RM_PLACEMENT_CONSTRAINTS_ALGORITHM_CLASS =
+      RM_PREFIX + "placement-constraints.algorithm.class";
+
+  public static final String RM_PLACEMENT_CONSTRAINTS_ENABLED =
+      RM_PREFIX + "placement-constraints.enabled";
+
+  public static final boolean DEFAULT_RM_PLACEMENT_CONSTRAINTS_ENABLED = true;
+
+  public static final String RM_PLACEMENT_CONSTRAINTS_RETRY_ATTEMPTS =
+      RM_PREFIX + "placement-constraints.retry-attempts";
+
+  public static final int DEFAULT_RM_PLACEMENT_CONSTRAINTS_RETRY_ATTEMPTS = 3;
+
+  public static final String RM_PLACEMENT_CONSTRAINTS_ALGORITHM_POOL_SIZE =
+      RM_PREFIX + "placement-constraints.algorithm.pool-size";
+
+  public static final int DEFAULT_RM_PLACEMENT_CONSTRAINTS_ALGORITHM_POOL_SIZE =
+      1;
+
+  public static final String RM_PLACEMENT_CONSTRAINTS_SCHEDULER_POOL_SIZE =
+      RM_PREFIX + "placement-constraints.scheduler.pool-size";
+
+  public static final int DEFAULT_RM_PLACEMENT_CONSTRAINTS_SCHEDULER_POOL_SIZE =
+      1;
  
   public static final String DEFAULT_RM_SCHEDULER = 
       "org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacityScheduler";

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
index 0bb4fca..6d52ace 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-common/src/main/resources/yarn-default.xml
@@ -131,6 +131,36 @@
   </property>
 
   <property>
+    <description>Enable Constraint Placement.</description>
+    <name>yarn.resourcemanager.placement-constraints.enabled</name>
+    <value>false</value>
+  </property>
+
+  <property>
+    <description>Number of times to retry placing of rejected SchedulingRequests</description>
+    <name>yarn.resourcemanager.placement-constraints.retry-attempts</name>
+    <value>3</value>
+  </property>
+
+  <property>
+    <description>Constraint Placement Algorithm to be used.</description>
+    <name>yarn.resourcemanager.placement-constraints.algorithm.class</name>
+    <value>org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor.SamplePlacementAlgorithm</value>
+  </property>
+
+  <property>
+    <description>Threadpool size for the Algorithm used for placement constraint processing.</description>
+    <name>yarn.resourcemanager.placement-constraints.algorithm.pool-size</name>
+    <value>1</value>
+  </property>
+
+  <property>
+    <description>Threadpool size for the Scheduler invocation phase of placement constraint processing.</description>
+    <name>yarn.resourcemanager.placement-constraints.scheduler.pool-size</name>
+    <value>1</value>
+  </property>
+
+  <property>
     <description>
       Comma separated class names of ApplicationMasterServiceProcessor
       implementations. The processors will be applied in the order

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ApplicationMasterService.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ApplicationMasterService.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ApplicationMasterService.java
index 90c42be..aa1177d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ApplicationMasterService.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ApplicationMasterService.java
@@ -59,6 +59,7 @@ import org.apache.hadoop.yarn.factory.providers.RecordFactoryProvider;
 import org.apache.hadoop.yarn.ipc.YarnRPC;
 import org.apache.hadoop.yarn.security.AMRMTokenIdentifier;
 import org.apache.hadoop.yarn.server.resourcemanager.RMAuditLogger.AuditConstants;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor.PlacementProcessor;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMAppImpl;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.AMLivelinessMonitor;
@@ -114,11 +115,25 @@ public class ApplicationMasterService extends AbstractService implements
         YarnConfiguration.RM_SCHEDULER_ADDRESS,
         YarnConfiguration.DEFAULT_RM_SCHEDULER_ADDRESS,
         YarnConfiguration.DEFAULT_RM_SCHEDULER_PORT);
+    initializeProcessingChain(conf);
+  }
+
+  private void initializeProcessingChain(Configuration conf) {
     amsProcessingChain.init(rmContext, null);
+    boolean enablePlacementConstraints = conf.getBoolean(
+        YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_ENABLED,
+        YarnConfiguration.DEFAULT_RM_PLACEMENT_CONSTRAINTS_ENABLED);
+    if (enablePlacementConstraints) {
+      amsProcessingChain.addProcessor(new PlacementProcessor());
+    }
     List<ApplicationMasterServiceProcessor> processors = getProcessorList(conf);
     if (processors != null) {
       Collections.reverse(processors);
       for (ApplicationMasterServiceProcessor p : processors) {
+        // Ensure only single instance of PlacementProcessor is included
+        if (enablePlacementConstraints && p instanceof PlacementProcessor) {
+          continue;
+        }
         this.amsProcessingChain.addProcessor(p);
       }
     }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
index 184cdfc..c873509 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/RMContainerImpl.java
@@ -190,8 +190,7 @@ public class RMContainerImpl implements RMContainer {
   private boolean isExternallyAllocated;
   private SchedulerRequestKey allocatedSchedulerKey;
 
-  // TODO, set it when container allocated by scheduler (From SchedulingRequest)
-  private Set<String> allocationTags = null;
+  private volatile Set<String> allocationTags = null;
 
   public RMContainerImpl(Container container, SchedulerRequestKey schedulerKey,
       ApplicationAttemptId appAttemptId, NodeId nodeId, String user,
@@ -510,6 +509,10 @@ public class RMContainerImpl implements RMContainer {
     return allocationTags;
   }
 
+  public void setAllocationTags(Set<String> tags) {
+    this.allocationTags = tags;
+  }
+
   private static class BaseTransition implements
       SingleArcTransition<RMContainerImpl, RMContainerEvent> {
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
index 676c0fe..e682d0f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
@@ -2601,6 +2601,8 @@ public class CapacityScheduler extends
           SchedulerRequestKey.extractFrom(container),
           appAttempt.getApplicationAttemptId(), container.getNodeId(),
           appAttempt.getUser(), rmContext, false);
+      ((RMContainerImpl)rmContainer).setAllocationTags(
+          new HashSet<>(schedulingRequest.getAllocationTags()));
 
       allocated = new ContainerAllocationProposal<>(
           getSchedulerContainer(rmContainer, true),

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
new file mode 100644
index 0000000..fe92d2f
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/BatchedRequests.java
@@ -0,0 +1,105 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor;
+
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmInput;
+
+import java.util.Collection;
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.Map;
+import java.util.Set;
+
+/**
+ * A grouping of Scheduling Requests which are sent to the PlacementAlgorithm
+ * to place as a batch. The placement algorithm tends to give more optimal
+ * placements if more requests are batched together.
+ */
+class BatchedRequests implements ConstraintPlacementAlgorithmInput {
+
+  // PlacementAlgorithmOutput attempt - the number of times the requests in this
+  // batch has been placed but was rejected by the scheduler.
+  private final int placementAttempt;
+
+  private final ApplicationId applicationId;
+  private final Collection<SchedulingRequest> requests;
+  private final Map<String, Set<NodeId>> blacklist = new HashMap<>();
+
+  BatchedRequests(ApplicationId applicationId,
+      Collection<SchedulingRequest> requests, int attempt) {
+    this.applicationId = applicationId;
+    this.requests = requests;
+    this.placementAttempt = attempt;
+  }
+
+  /**
+   * Get Application Id.
+   * @return Application Id.
+   */
+  ApplicationId getApplicationId() {
+    return applicationId;
+  }
+
+  /**
+   * Get Collection of SchedulingRequests in this batch.
+   * @return Collection of Scheduling Requests.
+   */
+  @Override
+  public Collection<SchedulingRequest> getSchedulingRequests() {
+    return requests;
+  }
+
+  /**
+   * Add a Scheduling request to the batch.
+   * @param req Scheduling Request.
+   */
+  void addToBatch(SchedulingRequest req) {
+    requests.add(req);
+  }
+
+  void addToBlacklist(Set<String> tags, SchedulerNode node) {
+    if (tags != null && !tags.isEmpty()) {
+      // We are currently assuming a single allocation tag
+      // per scheduler request currently.
+      blacklist.computeIfAbsent(tags.iterator().next(),
+          k -> new HashSet<>()).add(node.getNodeID());
+    }
+  }
+
+  /**
+   * Get placement attempt.
+   * @return PlacementAlgorithmOutput placement Attempt.
+   */
+  int getPlacementAttempt() {
+    return placementAttempt;
+  }
+
+  /**
+   * Get any blacklisted nodes associated with tag.
+   * @param tag Tag.
+   * @return Set of blacklisted Nodes.
+   */
+  Set<NodeId> getBlacklist(String tag) {
+    return blacklist.getOrDefault(tag, Collections.EMPTY_SET);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/NodeCandidateSelector.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/NodeCandidateSelector.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/NodeCandidateSelector.java
new file mode 100644
index 0000000..4299050
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/NodeCandidateSelector.java
@@ -0,0 +1,38 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor;
+
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.NodeFilter;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+
+import java.util.List;
+
+/**
+ * A read only implementation of the ClusterNodeTracker which exposes a method
+ * to simply return a filtered list of nodes.
+ */
+public interface NodeCandidateSelector {
+
+  /**
+   * Select a list of nodes given a filter.
+   * @param filter a NodeFilter.
+   * @return List of SchedulerNodes.
+   */
+  List<SchedulerNode> selectNodes(NodeFilter filter);
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementDispatcher.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementDispatcher.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementDispatcher.java
new file mode 100644
index 0000000..6a00ba8
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementDispatcher.java
@@ -0,0 +1,145 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor;
+
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithm;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutput;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutputCollector;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.PlacedSchedulingRequest;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import java.util.ArrayList;
+import java.util.Collections;
+import java.util.List;
+import java.util.Map;
+import java.util.concurrent.ConcurrentHashMap;
+import java.util.concurrent.ExecutorService;
+import java.util.concurrent.Executors;
+
+/**
+ * This class initializes the Constraint Placement Algorithm. It dispatches
+ * input to the algorithm and collects output from it.
+ */
+class PlacementDispatcher implements
+    ConstraintPlacementAlgorithmOutputCollector {
+
+  private static final Logger LOG =
+      LoggerFactory.getLogger(PlacementDispatcher.class);
+  private ConstraintPlacementAlgorithm algorithm;
+  private ExecutorService algorithmThreadPool;
+
+  private Map<ApplicationId, List<PlacedSchedulingRequest>>
+      placedRequests = new ConcurrentHashMap<>();
+  private Map<ApplicationId, List<SchedulingRequest>>
+      rejectedRequests = new ConcurrentHashMap<>();
+
+  public void init(RMContext rmContext,
+      ConstraintPlacementAlgorithm placementAlgorithm, int poolSize) {
+    LOG.info("Initializing Constraint Placement Planner:");
+    this.algorithm = placementAlgorithm;
+    this.algorithm.init(rmContext);
+    this.algorithmThreadPool = Executors.newFixedThreadPool(poolSize);
+  }
+
+  void dispatch(final BatchedRequests batchedRequests) {
+    final ConstraintPlacementAlgorithmOutputCollector collector = this;
+    Runnable placingTask = () -> {
+      LOG.debug("Got [{}] requests to place from application [{}].. " +
+              "Attempt count [{}]",
+          batchedRequests.getSchedulingRequests().size(),
+          batchedRequests.getApplicationId(),
+          batchedRequests.getPlacementAttempt());
+      algorithm.place(batchedRequests, collector);
+    };
+    this.algorithmThreadPool.submit(placingTask);
+  }
+
+  public List<PlacedSchedulingRequest> pullPlacedRequests(
+      ApplicationId applicationId) {
+    List<PlacedSchedulingRequest> placedReqs =
+        this.placedRequests.get(applicationId);
+    if (placedReqs != null && !placedReqs.isEmpty()) {
+      List<PlacedSchedulingRequest> retList = new ArrayList<>();
+      synchronized (placedReqs) {
+        if (placedReqs.size() > 0) {
+          retList.addAll(placedReqs);
+          placedReqs.clear();
+        }
+      }
+      return retList;
+    }
+    return Collections.EMPTY_LIST;
+  }
+
+  public List<SchedulingRequest> pullRejectedRequests(
+      ApplicationId applicationId) {
+    List<SchedulingRequest> rejectedReqs =
+        this.rejectedRequests.get(applicationId);
+    if (rejectedReqs != null && !rejectedReqs.isEmpty()) {
+      List<SchedulingRequest> retList = new ArrayList<>();
+      synchronized (rejectedReqs) {
+        if (rejectedReqs.size() > 0) {
+          retList.addAll(rejectedReqs);
+          rejectedReqs.clear();
+        }
+      }
+      return retList;
+    }
+    return Collections.EMPTY_LIST;
+  }
+
+  void clearApplicationState(ApplicationId applicationId) {
+    placedRequests.remove(applicationId);
+    rejectedRequests.remove(applicationId);
+  }
+
+  @Override
+  public void collect(ConstraintPlacementAlgorithmOutput placement) {
+    if (!placement.getPlacedRequests().isEmpty()) {
+      List<PlacedSchedulingRequest> processed =
+          placedRequests.computeIfAbsent(
+              placement.getApplicationId(), k -> new ArrayList<>());
+      synchronized (processed) {
+        LOG.debug(
+            "Planning Algorithm has placed for application [{}]" +
+                " the following [{}]", placement.getApplicationId(),
+            placement.getPlacedRequests());
+        for (PlacedSchedulingRequest esr :
+            placement.getPlacedRequests()) {
+          processed.add(esr);
+        }
+      }
+    }
+    if (!placement.getRejectedRequests().isEmpty()) {
+      List<SchedulingRequest> rejected =
+          rejectedRequests.computeIfAbsent(
+              placement.getApplicationId(), k -> new ArrayList());
+      LOG.warn(
+          "Planning Algorithm has rejected for application [{}]" +
+              " the following [{}]", placement.getApplicationId(),
+          placement.getRejectedRequests());
+      synchronized (rejected) {
+        rejected.addAll(placement.getRejectedRequests());
+      }
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
new file mode 100644
index 0000000..d613d4e
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
@@ -0,0 +1,343 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor;
+
+import org.apache.hadoop.yarn.ams.ApplicationMasterServiceContext;
+import org.apache.hadoop.yarn.ams.ApplicationMasterServiceProcessor;
+import org.apache.hadoop.yarn.ams.ApplicationMasterServiceUtils;
+import org.apache.hadoop.yarn.api.protocolrecords.AllocateRequest;
+import org.apache.hadoop.yarn.api.protocolrecords.AllocateResponse;
+import org.apache.hadoop.yarn.api.protocolrecords.FinishApplicationMasterRequest;
+import org.apache.hadoop.yarn.api.protocolrecords.FinishApplicationMasterResponse;
+import org.apache.hadoop.yarn.api.protocolrecords.RegisterApplicationMasterRequest;
+import org.apache.hadoop.yarn.api.protocolrecords.RegisterApplicationMasterResponse;
+import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
+import org.apache.hadoop.yarn.api.records.RejectionReason;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.apache.hadoop.yarn.exceptions.YarnException;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContextImpl;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithm;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.PlacedSchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.SchedulingResponse;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractYarnScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerApplicationAttempt;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import java.io.IOException;
+import java.util.ArrayList;
+import java.util.Collections;
+import java.util.List;
+import java.util.Map;
+import java.util.Set;
+import java.util.concurrent.ConcurrentHashMap;
+import java.util.concurrent.ExecutorService;
+import java.util.concurrent.Executors;
+import java.util.stream.Collectors;
+
+/**
+ * An ApplicationMasterService Processor that performs Constrained placement of
+ * Scheduling Requests. It does the following:
+ * 1. All initialization.
+ * 2. Intercepts placement constraints from the register call and adds it to
+ *    the placement constraint manager.
+ * 3. Dispatches Scheduling Requests to the Planner.
+ */
+public class PlacementProcessor implements ApplicationMasterServiceProcessor {
+
+  /**
+   * Wrapper over the SchedulingResponse that wires in the placement attempt
+   * and last attempted Node.
+   */
+  static final class Response extends SchedulingResponse {
+
+    private final int placementAttempt;
+    private final SchedulerNode attemptedNode;
+
+    private Response(boolean isSuccess, ApplicationId applicationId,
+        SchedulingRequest schedulingRequest, int placementAttempt,
+        SchedulerNode attemptedNode) {
+      super(isSuccess, applicationId, schedulingRequest);
+      this.placementAttempt = placementAttempt;
+      this.attemptedNode = attemptedNode;
+    }
+  }
+
+  private static final Logger LOG =
+      LoggerFactory.getLogger(PlacementProcessor.class);
+  private PlacementConstraintManager constraintManager;
+  private ApplicationMasterServiceProcessor nextAMSProcessor;
+
+  private AbstractYarnScheduler scheduler;
+  private ExecutorService schedulingThreadPool;
+  private int retryAttempts;
+  private Map<ApplicationId, List<BatchedRequests>> requestsToRetry =
+      new ConcurrentHashMap<>();
+  private Map<ApplicationId, List<SchedulingRequest>> requestsToReject =
+      new ConcurrentHashMap<>();
+
+  private PlacementDispatcher placementDispatcher;
+
+
+  @Override
+  public void init(ApplicationMasterServiceContext amsContext,
+      ApplicationMasterServiceProcessor nextProcessor) {
+    LOG.info("Initializing Constraint Placement Processor:");
+    this.nextAMSProcessor = nextProcessor;
+    this.constraintManager =
+        ((RMContextImpl)amsContext).getPlacementConstraintManager();
+
+    this.scheduler =
+        (AbstractYarnScheduler)((RMContextImpl)amsContext).getScheduler();
+    // Only the first class is considered - even if a comma separated
+    // list is provided. (This is for simplicity, since getInstances does a
+    // lot of good things by handling things correctly)
+    List<ConstraintPlacementAlgorithm> instances =
+        ((RMContextImpl) amsContext).getYarnConfiguration().getInstances(
+            YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_ALGORITHM_CLASS,
+            ConstraintPlacementAlgorithm.class);
+    ConstraintPlacementAlgorithm algorithm = null;
+    if (instances != null && !instances.isEmpty()) {
+      algorithm = instances.get(0);
+    } else {
+      algorithm = new SamplePlacementAlgorithm();
+    }
+    LOG.info("Planning Algorithm [{}]", algorithm.getClass().getName());
+
+    int algoPSize = ((RMContextImpl) amsContext).getYarnConfiguration().getInt(
+        YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_ALGORITHM_POOL_SIZE,
+        YarnConfiguration.DEFAULT_RM_PLACEMENT_CONSTRAINTS_ALGORITHM_POOL_SIZE);
+    this.placementDispatcher = new PlacementDispatcher();
+    this.placementDispatcher.init(
+        ((RMContextImpl)amsContext), algorithm, algoPSize);
+    LOG.info("Planning Algorithm pool size [{}]", algoPSize);
+
+    int schedPSize = ((RMContextImpl) amsContext).getYarnConfiguration().getInt(
+        YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_SCHEDULER_POOL_SIZE,
+        YarnConfiguration.DEFAULT_RM_PLACEMENT_CONSTRAINTS_SCHEDULER_POOL_SIZE);
+    this.schedulingThreadPool = Executors.newFixedThreadPool(schedPSize);
+    LOG.info("Scheduler pool size [{}]", schedPSize);
+
+    // Number of times a request that is not satisfied by the scheduler
+    // can be retried.
+    this.retryAttempts =
+        ((RMContextImpl) amsContext).getYarnConfiguration().getInt(
+            YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_RETRY_ATTEMPTS,
+            YarnConfiguration.DEFAULT_RM_PLACEMENT_CONSTRAINTS_RETRY_ATTEMPTS);
+    LOG.info("Num retry attempts [{}]", this.retryAttempts);
+  }
+
+  @Override
+  public void registerApplicationMaster(ApplicationAttemptId appAttemptId,
+      RegisterApplicationMasterRequest request,
+      RegisterApplicationMasterResponse response)
+      throws IOException, YarnException {
+    Map<Set<String>, PlacementConstraint> appPlacementConstraints =
+        request.getPlacementConstraints();
+    processPlacementConstraints(
+        appAttemptId.getApplicationId(), appPlacementConstraints);
+    nextAMSProcessor.registerApplicationMaster(appAttemptId, request, response);
+  }
+
+  private void processPlacementConstraints(ApplicationId applicationId,
+      Map<Set<String>, PlacementConstraint> appPlacementConstraints) {
+    if (appPlacementConstraints != null && !appPlacementConstraints.isEmpty()) {
+      LOG.info("Constraints added for application [{}] against tags [{}]",
+          applicationId, appPlacementConstraints);
+      constraintManager.registerApplication(
+          applicationId, appPlacementConstraints);
+    }
+  }
+
+  @Override
+  public void allocate(ApplicationAttemptId appAttemptId,
+      AllocateRequest request, AllocateResponse response) throws YarnException {
+    List<SchedulingRequest> schedulingRequests =
+        request.getSchedulingRequests();
+    dispatchRequestsForPlacement(appAttemptId, schedulingRequests);
+    reDispatchRetryableRequests(appAttemptId);
+    schedulePlacedRequests(appAttemptId);
+
+    nextAMSProcessor.allocate(appAttemptId, request, response);
+
+    handleRejectedRequests(appAttemptId, response);
+  }
+
+  private void dispatchRequestsForPlacement(ApplicationAttemptId appAttemptId,
+      List<SchedulingRequest> schedulingRequests) {
+    if (schedulingRequests != null && !schedulingRequests.isEmpty()) {
+      this.placementDispatcher.dispatch(
+          new BatchedRequests(appAttemptId.getApplicationId(),
+              schedulingRequests, 1));
+    }
+  }
+
+  private void reDispatchRetryableRequests(ApplicationAttemptId appAttId) {
+    List<BatchedRequests> reqsToRetry =
+        this.requestsToRetry.get(appAttId.getApplicationId());
+    if (reqsToRetry != null && !reqsToRetry.isEmpty()) {
+      synchronized (reqsToRetry) {
+        for (BatchedRequests bReq: reqsToRetry) {
+          this.placementDispatcher.dispatch(bReq);
+        }
+        reqsToRetry.clear();
+      }
+    }
+  }
+
+  private void schedulePlacedRequests(ApplicationAttemptId appAttemptId) {
+    ApplicationId applicationId = appAttemptId.getApplicationId();
+    List<PlacedSchedulingRequest> placedSchedulingRequests =
+        this.placementDispatcher.pullPlacedRequests(applicationId);
+    for (PlacedSchedulingRequest placedReq : placedSchedulingRequests) {
+      SchedulingRequest sReq = placedReq.getSchedulingRequest();
+      for (SchedulerNode node : placedReq.getNodes()) {
+        final SchedulingRequest sReqClone =
+            SchedulingRequest.newInstance(sReq.getAllocationRequestId(),
+                sReq.getPriority(), sReq.getExecutionType(),
+                sReq.getAllocationTags(),
+                ResourceSizing.newInstance(
+                    sReq.getResourceSizing().getResources()),
+                sReq.getPlacementConstraint());
+        SchedulerApplicationAttempt applicationAttempt =
+            this.scheduler.getApplicationAttempt(appAttemptId);
+        Runnable task = () -> {
+          boolean success =
+              scheduler.attemptAllocationOnNode(
+                  applicationAttempt, sReqClone, node);
+          if (!success) {
+            LOG.warn("Unsuccessful allocation attempt [{}] for [{}]",
+                placedReq.getPlacementAttempt(), sReqClone);
+          }
+          handleSchedulingResponse(
+              new Response(success, applicationId, sReqClone,
+              placedReq.getPlacementAttempt(), node));
+        };
+        this.schedulingThreadPool.submit(task);
+      }
+    }
+  }
+
+  private void handleRejectedRequests(ApplicationAttemptId appAttemptId,
+      AllocateResponse response) {
+    List<SchedulingRequest> rejectedRequests =
+        this.placementDispatcher.pullRejectedRequests(
+            appAttemptId.getApplicationId());
+    if (rejectedRequests != null && !rejectedRequests.isEmpty()) {
+      LOG.warn("Following requests of [{}] were rejected by" +
+              " the PlacementAlgorithmOutput Algorithm: {}",
+          appAttemptId.getApplicationId(), rejectedRequests);
+      ApplicationMasterServiceUtils.addToRejectedSchedulingRequests(response,
+          rejectedRequests.stream()
+              .map(sr -> RejectedSchedulingRequest.newInstance(
+                  RejectionReason.COULD_NOT_PLACE_ON_NODE, sr))
+              .collect(Collectors.toList()));
+    }
+    rejectedRequests =
+        this.requestsToReject.get(appAttemptId.getApplicationId());
+    if (rejectedRequests != null && !rejectedRequests.isEmpty()) {
+      synchronized (rejectedRequests) {
+        LOG.warn("Following requests of [{}] exhausted all retry attempts " +
+                "trying to schedule on placed node: {}",
+            appAttemptId.getApplicationId(), rejectedRequests);
+        ApplicationMasterServiceUtils.addToRejectedSchedulingRequests(response,
+            rejectedRequests.stream()
+                .map(sr -> RejectedSchedulingRequest.newInstance(
+                    RejectionReason.COULD_NOT_SCHEDULE_ON_NODE, sr))
+                .collect(Collectors.toList()));
+        rejectedRequests.clear();
+      }
+    }
+  }
+
+  @Override
+  public void finishApplicationMaster(ApplicationAttemptId appAttemptId,
+      FinishApplicationMasterRequest request,
+      FinishApplicationMasterResponse response) {
+    constraintManager.unregisterApplication(appAttemptId.getApplicationId());
+    placementDispatcher.clearApplicationState(appAttemptId.getApplicationId());
+    requestsToReject.remove(appAttemptId.getApplicationId());
+    requestsToRetry.remove(appAttemptId.getApplicationId());
+    nextAMSProcessor.finishApplicationMaster(appAttemptId, request, response);
+  }
+
+  private void handleSchedulingResponse(SchedulingResponse schedulerResponse) {
+    int placementAttempt = ((Response)schedulerResponse).placementAttempt;
+    // Retry this placement as it is not successful and we are still
+    // under max retry. The req is batched with other unsuccessful
+    // requests from the same app
+    if (!schedulerResponse.isSuccess() && placementAttempt < retryAttempts) {
+      List<BatchedRequests> reqsToRetry =
+          requestsToRetry.computeIfAbsent(
+              schedulerResponse.getApplicationId(),
+              k -> new ArrayList<>());
+      synchronized (reqsToRetry) {
+        addToRetryList(schedulerResponse, placementAttempt, reqsToRetry);
+      }
+      LOG.warn("Going to retry request for application [{}] after [{}]" +
+              " attempts: [{}]", schedulerResponse.getApplicationId(),
+          placementAttempt, schedulerResponse.getSchedulingRequest());
+    } else {
+      if (!schedulerResponse.isSuccess()) {
+        LOG.warn("Not retrying request for application [{}] after [{}]" +
+                " attempts: [{}]", schedulerResponse.getApplicationId(),
+            placementAttempt, schedulerResponse.getSchedulingRequest());
+        List<SchedulingRequest> reqsToReject =
+            requestsToReject.computeIfAbsent(
+                schedulerResponse.getApplicationId(),
+                k -> new ArrayList<>());
+        synchronized (reqsToReject) {
+          reqsToReject.add(schedulerResponse.getSchedulingRequest());
+        }
+      }
+    }
+  }
+
+  private void addToRetryList(SchedulingResponse schedulerResponse,
+      int placementAttempt, List<BatchedRequests> reqsToRetry) {
+    boolean isAdded = false;
+    for (BatchedRequests br : reqsToRetry) {
+      if (br.getPlacementAttempt() == placementAttempt + 1) {
+        br.addToBatch(schedulerResponse.getSchedulingRequest());
+        br.addToBlacklist(
+            schedulerResponse.getSchedulingRequest().getAllocationTags(),
+            ((Response) schedulerResponse).attemptedNode);
+        isAdded = true;
+        break;
+      }
+    }
+    if (!isAdded) {
+      BatchedRequests br =
+          new BatchedRequests(schedulerResponse.getApplicationId(),
+              Collections.singleton(
+                  schedulerResponse.getSchedulingRequest()),
+              placementAttempt + 1);
+      reqsToRetry.add(br);
+      br.addToBlacklist(
+          schedulerResponse.getSchedulingRequest().getAllocationTags(),
+          ((Response) schedulerResponse).attemptedNode);
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/SamplePlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/SamplePlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/SamplePlacementAlgorithm.java
new file mode 100644
index 0000000..8d49801
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/SamplePlacementAlgorithm.java
@@ -0,0 +1,144 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor;
+
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations.SpecializedConstraintTransformer;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithm;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmInput;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutput;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutputCollector;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.PlacedSchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractYarnScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+import java.util.ArrayList;
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.Iterator;
+import java.util.List;
+import java.util.Map;
+
+/**
+ * Sample Test algorithm. Assumes anti-affinity always
+ * It also assumes the numAllocations in resource sizing is always = 1
+ *
+ * NOTE: This is just a sample implementation. Not be actually used
+ */
+public class SamplePlacementAlgorithm implements ConstraintPlacementAlgorithm {
+
+  private static final Logger LOG =
+      LoggerFactory.getLogger(SamplePlacementAlgorithm.class);
+
+  private AllocationTagsManager tagsManager;
+  private PlacementConstraintManager constraintManager;
+  private NodeCandidateSelector nodeSelector;
+
+  @Override
+  public void init(RMContext rmContext) {
+    this.tagsManager = rmContext.getAllocationTagsManager();
+    this.constraintManager = rmContext.getPlacementConstraintManager();
+    this.nodeSelector =
+        filter -> ((AbstractYarnScheduler)(rmContext)
+            .getScheduler()).getNodes(filter);
+  }
+
+  @Override
+  public void place(ConstraintPlacementAlgorithmInput input,
+      ConstraintPlacementAlgorithmOutputCollector collector) {
+    BatchedRequests requests = (BatchedRequests)input;
+    ConstraintPlacementAlgorithmOutput resp =
+        new ConstraintPlacementAlgorithmOutput(requests.getApplicationId());
+    List<SchedulerNode> allNodes = nodeSelector.selectNodes(null);
+    Map<String, List<SchedulingRequest>> tagIndexedRequests = new HashMap<>();
+    requests.getSchedulingRequests()
+        .stream()
+        .filter(r -> r.getAllocationTags() != null)
+        .forEach(
+            req -> req.getAllocationTags().forEach(
+                tag -> tagIndexedRequests.computeIfAbsent(tag,
+                    k -> new ArrayList<>()).add(req))
+        );
+    for (Map.Entry<String, List<SchedulingRequest>> entry :
+        tagIndexedRequests.entrySet()) {
+      String tag = entry.getKey();
+      PlacementConstraint constraint =
+          constraintManager.getConstraint(requests.getApplicationId(),
+              Collections.singleton(tag));
+      if (constraint != null) {
+        // Currently works only for simple anti-affinity
+        // NODE scope target expressions
+        SpecializedConstraintTransformer transformer =
+            new SpecializedConstraintTransformer(constraint);
+        PlacementConstraint transform = transformer.transform();
+        TargetConstraint targetConstraint =
+            (TargetConstraint) transform.getConstraintExpr();
+        // Assume a single target expression tag;
+        // The Sample Algorithm assumes a constraint will always be a simple
+        // Target Constraint with a single entry in the target set.
+        // As mentioned in the class javadoc - This algorithm should be
+        // used mostly for testing and validating end-2-end workflow.
+        String targetTag =
+            targetConstraint.getTargetExpressions().iterator().next()
+            .getTargetValues().iterator().next();
+        // iterate over all nodes
+        Iterator<SchedulerNode> nodeIter = allNodes.iterator();
+        List<SchedulingRequest> schedulingRequests = entry.getValue();
+        Iterator<SchedulingRequest> reqIter = schedulingRequests.iterator();
+        while (reqIter.hasNext()) {
+          SchedulingRequest sReq = reqIter.next();
+          int numAllocs = sReq.getResourceSizing().getNumAllocations();
+          while (numAllocs > 0 && nodeIter.hasNext()) {
+            SchedulerNode node = nodeIter.next();
+            long nodeCardinality = 0;
+            try {
+              nodeCardinality = tagsManager.getNodeCardinality(
+                  node.getNodeID(), requests.getApplicationId(),
+                  targetTag);
+              if (nodeCardinality == 0 &&
+                  !requests.getBlacklist(tag).contains(node.getNodeID())) {
+                numAllocs--;
+                sReq.getResourceSizing().setNumAllocations(numAllocs);
+                PlacedSchedulingRequest placedReq =
+                    new PlacedSchedulingRequest(sReq);
+                placedReq.setPlacementAttempt(requests.getPlacementAttempt());
+                placedReq.getNodes().add(node);
+                resp.getPlacedRequests().add(placedReq);
+              }
+            } catch (InvalidAllocationTagsQueryException e) {
+              LOG.warn("Got exception from TagManager !", e);
+            }
+          }
+        }
+      }
+    }
+    // Add all requests whose numAllocations still > 0 to rejected list.
+    requests.getSchedulingRequests().stream()
+        .filter(sReq -> sReq.getResourceSizing().getNumAllocations() > 0)
+        .forEach(rejReq -> resp.getRejectedRequests().add(rejReq));
+    collector.collect(resp);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/package-info.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/package-info.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/package-info.java
new file mode 100644
index 0000000..7090154
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/package-info.java
@@ -0,0 +1,29 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * Package o.a.h.yarn.server.resourcemanager.scheduler.constraint.processor
+ * contains classes related to scheduling containers using placement
+ * processor.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.processor;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
index 12dfe18..975abe6 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
@@ -21,7 +21,10 @@ package org.apache.hadoop.yarn.server.resourcemanager;
 import java.lang.reflect.UndeclaredThrowableException;
 import java.security.PrivilegedExceptionAction;
 import java.util.ArrayList;
+import java.util.HashMap;
 import java.util.List;
+import java.util.Map;
+import java.util.Set;
 
 import org.apache.hadoop.security.UserGroupInformation;
 import org.apache.hadoop.security.token.Token;
@@ -39,7 +42,9 @@ import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
 import org.apache.hadoop.yarn.api.records.ExecutionTypeRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.security.AMRMTokenIdentifier;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttempt;
@@ -57,6 +62,9 @@ public class MockAM {
   private ApplicationMasterProtocol amRMProtocol;
   private UserGroupInformation ugi;
   private volatile AllocateResponse lastResponse;
+  private Map<Set<String>, PlacementConstraint> placementConstraints =
+      new HashMap<>();
+  private List<SchedulingRequest> schedulingRequests = new ArrayList<>();
 
   private final List<ResourceRequest> requests = new ArrayList<ResourceRequest>();
   private final List<ContainerId> releases = new ArrayList<ContainerId>();
@@ -93,6 +101,16 @@ public class MockAM {
     return registerAppAttempt(true);
   }
 
+  public void addPlacementConstraint(Set<String> tags,
+      PlacementConstraint constraint) {
+    placementConstraints.put(tags, constraint);
+  }
+
+  public MockAM addSchedulingRequest(List<SchedulingRequest> reqs) {
+    schedulingRequests.addAll(reqs);
+    return this;
+  }
+
   public RegisterApplicationMasterResponse registerAppAttempt(boolean wait)
       throws Exception {
     if (wait) {
@@ -104,6 +122,9 @@ public class MockAM {
     req.setHost("");
     req.setRpcPort(1);
     req.setTrackingUrl("");
+    if (!placementConstraints.isEmpty()) {
+      req.setPlacementConstraints(this.placementConstraints);
+    }
     if (ugi == null) {
       ugi = UserGroupInformation.createRemoteUser(
           attemptId.toString());
@@ -247,12 +268,17 @@ public class MockAM {
 
   }
 
+
   public AllocateResponse allocate(
       List<ResourceRequest> resourceRequest, List<ContainerId> releases)
       throws Exception {
     final AllocateRequest req =
         AllocateRequest.newInstance(0, 0F, resourceRequest,
           releases, null);
+    if (!schedulingRequests.isEmpty()) {
+      req.setSchedulingRequests(schedulingRequests);
+      schedulingRequests.clear();
+    }
     return allocate(req);
   }
   

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockRM.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockRM.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockRM.java
index 2df3788..eb4c626 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockRM.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockRM.java
@@ -27,6 +27,7 @@ import java.util.Collections;
 import java.util.EnumSet;
 import java.util.List;
 import java.util.Map;
+import java.util.Set;
 
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.io.DataOutputBuffer;
@@ -65,6 +66,7 @@ import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
 import org.apache.hadoop.yarn.api.records.SignalContainerCommand;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.event.AsyncDispatcher;
 import org.apache.hadoop.yarn.event.Dispatcher;
@@ -1240,6 +1242,18 @@ public class MockRM extends ResourceManager {
     return am;
   }
 
+  public static MockAM launchAndRegisterAM(RMApp app, MockRM rm, MockNM nm,
+      Map<Set<String>, PlacementConstraint> constraints) throws Exception {
+    MockAM am = launchAM(app, rm, nm);
+    for (Map.Entry<Set<String>, PlacementConstraint> e :
+        constraints.entrySet()) {
+      am.addPlacementConstraint(e.getKey(), e.getValue());
+    }
+    am.registerAppAttempt();
+    rm.waitForState(app.getApplicationId(), RMAppState.RUNNING);
+    return am;
+  }
+
   public ApplicationReport getApplicationReport(ApplicationId appId)
       throws YarnException, IOException {
     ApplicationClientProtocol client = getClientRMService();

http://git-wip-us.apache.org/repos/asf/hadoop/blob/f7d01a2c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
new file mode 100644
index 0000000..db8ae15
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
@@ -0,0 +1,394 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import org.apache.commons.logging.Log;
+import org.apache.commons.logging.LogFactory;
+import org.apache.hadoop.yarn.api.protocolrecords.AllocateResponse;
+import org.apache.hadoop.yarn.api.records.Container;
+import org.apache.hadoop.yarn.api.records.ExecutionType;
+import org.apache.hadoop.yarn.api.records.ExecutionTypeRequest;
+import org.apache.hadoop.yarn.api.records.NodeId;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.RejectedSchedulingRequest;
+import org.apache.hadoop.yarn.api.records.RejectionReason;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.conf.YarnConfiguration;
+import org.apache.hadoop.yarn.event.Dispatcher;
+import org.apache.hadoop.yarn.event.DrainDispatcher;
+import org.apache.hadoop.yarn.server.resourcemanager.MockAM;
+import org.apache.hadoop.yarn.server.resourcemanager.MockNM;
+import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
+import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacityScheduler;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.CapacitySchedulerConfiguration;
+import org.junit.After;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.List;
+import java.util.Set;
+import java.util.stream.Collectors;
+
+import static java.lang.Thread.sleep;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.allocationTag;
+
+/**
+ * This tests end2end workflow of the constraint placement framework.
+ */
+public class TestPlacementProcessor {
+
+  private static final int GB = 1024;
+
+  private static final Log LOG =
+      LogFactory.getLog(TestPlacementProcessor.class);
+  private MockRM rm;
+  private DrainDispatcher dispatcher;
+
+  @Before
+  public void createAndStartRM() {
+    CapacitySchedulerConfiguration csConf =
+        new CapacitySchedulerConfiguration();
+    YarnConfiguration conf = new YarnConfiguration(csConf);
+    conf.setClass(YarnConfiguration.RM_SCHEDULER, CapacityScheduler.class,
+        ResourceScheduler.class);
+    conf.setBoolean(
+        YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_ENABLED, true);
+    conf.setInt(
+        YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_RETRY_ATTEMPTS, 1);
+    startRM(conf);
+  }
+
+  private void startRM(final YarnConfiguration conf) {
+    dispatcher = new DrainDispatcher();
+    rm = new MockRM(conf) {
+      @Override
+      protected Dispatcher createDispatcher() {
+        return dispatcher;
+      }
+    };
+    rm.start();
+  }
+
+  @After
+  public void stopRM() {
+    if (rm != null) {
+      rm.stop();
+    }
+  }
+
+  @Test(timeout = 300000)
+  public void testPlacement() throws Exception {
+    HashMap<NodeId, MockNM> nodes = new HashMap<>();
+    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm1.getNodeId(), nm1);
+    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm2.getNodeId(), nm2);
+    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm3.getNodeId(), nm3);
+    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm4.getNodeId(), nm4);
+    nm1.registerNode();
+    nm2.registerNode();
+    nm3.registerNode();
+    nm4.registerNode();
+
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
+        Collections.singletonMap(
+            Collections.singleton("foo"),
+            PlacementConstraints.build(
+                PlacementConstraints.targetNotIn(NODE, allocationTag("foo")))
+        ));
+    am1.addSchedulingRequest(
+        Arrays.asList(
+            schedulingRequest(1, 1, 1, 512, "foo"),
+            schedulingRequest(1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            schedulingRequest(1, 5, 1, 512, "foo"))
+    );
+    AllocateResponse allocResponse = am1.schedule(); // send the request
+    List<Container> allocatedContainers = new ArrayList<>();
+    allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+
+    // kick the scheduler
+
+    while (allocatedContainers.size() < 4) {
+      nm1.nodeHeartbeat(true);
+      nm2.nodeHeartbeat(true);
+      nm3.nodeHeartbeat(true);
+      nm4.nodeHeartbeat(true);
+      LOG.info("Waiting for containers to be created for app 1...");
+      sleep(1000);
+      allocResponse = am1.schedule();
+      allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+    }
+
+    Assert.assertEquals(4, allocatedContainers.size());
+    Set<NodeId> nodeIds = allocatedContainers.stream()
+        .map(x -> x.getNodeId()).collect(Collectors.toSet());
+    // Ensure unique nodes
+    Assert.assertEquals(4, nodeIds.size());
+  }
+
+  @Test(timeout = 300000)
+  public void testSchedulerRejection() throws Exception {
+    HashMap<NodeId, MockNM> nodes = new HashMap<>();
+    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm1.getNodeId(), nm1);
+    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm2.getNodeId(), nm2);
+    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm3.getNodeId(), nm3);
+    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm4.getNodeId(), nm4);
+    nm1.registerNode();
+    nm2.registerNode();
+    nm3.registerNode();
+    nm4.registerNode();
+
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
+        Collections.singletonMap(
+            Collections.singleton("foo"),
+            PlacementConstraints.build(
+                PlacementConstraints.targetNotIn(NODE, allocationTag("foo")))
+        ));
+    am1.addSchedulingRequest(
+        Arrays.asList(
+            schedulingRequest(1, 1, 1, 512, "foo"),
+            schedulingRequest(1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            // Ask for a container larger than the node
+            schedulingRequest(1, 4, 1, 5120, "foo"))
+    );
+    AllocateResponse allocResponse = am1.schedule(); // send the request
+    List<Container> allocatedContainers = new ArrayList<>();
+    List<RejectedSchedulingRequest> rejectedReqs = new ArrayList<>();
+    int allocCount = 1;
+    allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+    rejectedReqs.addAll(allocResponse.getRejectedSchedulingRequests());
+
+    // kick the scheduler
+
+    while (allocCount < 11) {
+      nm1.nodeHeartbeat(true);
+      nm2.nodeHeartbeat(true);
+      nm3.nodeHeartbeat(true);
+      nm4.nodeHeartbeat(true);
+      LOG.info("Waiting for containers to be created for app 1...");
+      sleep(1000);
+      allocResponse = am1.schedule();
+      allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+      rejectedReqs.addAll(allocResponse.getRejectedSchedulingRequests());
+      allocCount++;
+      if (rejectedReqs.size() > 0 && allocatedContainers.size() > 2) {
+        break;
+      }
+    }
+
+    Assert.assertEquals(3, allocatedContainers.size());
+    Set<NodeId> nodeIds = allocatedContainers.stream()
+        .map(x -> x.getNodeId()).collect(Collectors.toSet());
+    // Ensure unique nodes
+    Assert.assertEquals(3, nodeIds.size());
+    RejectedSchedulingRequest rej = rejectedReqs.get(0);
+    Assert.assertEquals(4, rej.getRequest().getAllocationRequestId());
+    Assert.assertEquals(RejectionReason.COULD_NOT_SCHEDULE_ON_NODE,
+        rej.getReason());
+  }
+
+  @Test(timeout = 300000)
+  public void testRePlacementAfterSchedulerRejection() throws Exception {
+    stopRM();
+    CapacitySchedulerConfiguration csConf =
+        new CapacitySchedulerConfiguration();
+    YarnConfiguration conf = new YarnConfiguration(csConf);
+    conf.setClass(YarnConfiguration.RM_SCHEDULER, CapacityScheduler.class,
+        ResourceScheduler.class);
+    conf.setBoolean(
+        YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_ENABLED, true);
+    conf.setInt(
+        YarnConfiguration.RM_PLACEMENT_CONSTRAINTS_RETRY_ATTEMPTS, 2);
+    startRM(conf);
+
+    HashMap<NodeId, MockNM> nodes = new HashMap<>();
+    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm1.getNodeId(), nm1);
+    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm2.getNodeId(), nm2);
+    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm3.getNodeId(), nm3);
+    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm4.getNodeId(), nm4);
+    MockNM nm5 = new MockNM("h5:1234", 8192, rm.getResourceTrackerService());
+    nodes.put(nm5.getNodeId(), nm5);
+    nm1.registerNode();
+    nm2.registerNode();
+    nm3.registerNode();
+    nm4.registerNode();
+    // No not register nm5 yet..
+
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
+        Collections.singletonMap(
+            Collections.singleton("foo"),
+            PlacementConstraints.build(
+                PlacementConstraints.targetNotIn(NODE, allocationTag("foo")))
+        ));
+    am1.addSchedulingRequest(
+        Arrays.asList(
+            schedulingRequest(1, 1, 1, 512, "foo"),
+            schedulingRequest(1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            // Ask for a container larger than the node
+            schedulingRequest(1, 4, 1, 5120, "foo"))
+    );
+    AllocateResponse allocResponse = am1.schedule(); // send the request
+    List<Container> allocatedContainers = new ArrayList<>();
+    List<RejectedSchedulingRequest> rejectedReqs = new ArrayList<>();
+    int allocCount = 1;
+    allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+    rejectedReqs.addAll(allocResponse.getRejectedSchedulingRequests());
+
+    // Register node5 only after first allocate - so the initial placement
+    // for the large schedReq goes to some other node..
+    nm5.registerNode();
+
+    // kick the scheduler
+    while (allocCount < 11) {
+      nm1.nodeHeartbeat(true);
+      nm2.nodeHeartbeat(true);
+      nm3.nodeHeartbeat(true);
+      nm4.nodeHeartbeat(true);
+      nm5.nodeHeartbeat(true);
+      LOG.info("Waiting for containers to be created for app 1...");
+      sleep(1000);
+      allocResponse = am1.schedule();
+      allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+      rejectedReqs.addAll(allocResponse.getRejectedSchedulingRequests());
+      allocCount++;
+      if (allocatedContainers.size() > 3) {
+        break;
+      }
+    }
+
+    Assert.assertEquals(4, allocatedContainers.size());
+    Set<NodeId> nodeIds = allocatedContainers.stream()
+        .map(x -> x.getNodeId()).collect(Collectors.toSet());
+    // Ensure unique nodes
+    Assert.assertEquals(4, nodeIds.size());
+  }
+
+  @Test(timeout = 300000)
+  public void testPlacementRejection() throws Exception {
+    HashMap<NodeId, MockNM> nodes = new HashMap<>();
+    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm1.getNodeId(), nm1);
+    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm2.getNodeId(), nm2);
+    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm3.getNodeId(), nm3);
+    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm4.getNodeId(), nm4);
+    nm1.registerNode();
+    nm2.registerNode();
+    nm3.registerNode();
+    nm4.registerNode();
+
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
+        Collections.singletonMap(
+            Collections.singleton("foo"),
+            PlacementConstraints.build(
+                PlacementConstraints.targetNotIn(NODE, allocationTag("foo")))
+        ));
+    am1.addSchedulingRequest(
+        Arrays.asList(
+            schedulingRequest(1, 1, 1, 512, "foo"),
+            schedulingRequest(1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            schedulingRequest(1, 4, 1, 512, "foo"),
+            // Ask for more containers than nodes
+            schedulingRequest(1, 5, 1, 512, "foo"))
+    );
+    AllocateResponse allocResponse = am1.schedule(); // send the request
+    List<Container> allocatedContainers = new ArrayList<>();
+    List<RejectedSchedulingRequest> rejectedReqs = new ArrayList<>();
+    int allocCount = 1;
+    allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+    rejectedReqs.addAll(allocResponse.getRejectedSchedulingRequests());
+
+    // kick the scheduler
+
+    while (allocCount < 11) {
+      nm1.nodeHeartbeat(true);
+      nm2.nodeHeartbeat(true);
+      nm3.nodeHeartbeat(true);
+      nm4.nodeHeartbeat(true);
+      LOG.info("Waiting for containers to be created for app 1...");
+      sleep(1000);
+      allocResponse = am1.schedule();
+      allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+      rejectedReqs.addAll(allocResponse.getRejectedSchedulingRequests());
+      allocCount++;
+      if (rejectedReqs.size() > 0 && allocatedContainers.size() > 3) {
+        break;
+      }
+    }
+
+    Assert.assertEquals(4, allocatedContainers.size());
+    Set<NodeId> nodeIds = allocatedContainers.stream()
+        .map(x -> x.getNodeId()).collect(Collectors.toSet());
+    // Ensure unique nodes
+    Assert.assertEquals(4, nodeIds.size());
+    RejectedSchedulingRequest rej = rejectedReqs.get(0);
+    Assert.assertEquals(RejectionReason.COULD_NOT_PLACE_ON_NODE,
+        rej.getReason());
+  }
+
+  private static SchedulingRequest schedulingRequest(
+      int priority, long allocReqId, int cores, int mem, String... tags) {
+    return schedulingRequest(priority, allocReqId, cores, mem,
+        ExecutionType.GUARANTEED, tags);
+  }
+
+  private static SchedulingRequest schedulingRequest(
+      int priority, long allocReqId, int cores, int mem,
+      ExecutionType execType, String... tags) {
+    return SchedulingRequest.newBuilder()
+        .priority(Priority.newInstance(priority))
+        .allocationRequestId(allocReqId)
+        .allocationTags(new HashSet<>(Arrays.asList(tags)))
+        .executionType(ExecutionTypeRequest.newInstance(execType, true))
+        .resourceSizing(
+            ResourceSizing.newInstance(1, Resource.newInstance(mem, cores)))
+        .build();
+  }
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[50/50] [abbrv] hadoop git commit: YARN-7763. Allow Constraints specified in the SchedulingRequest to override application level constraints. (Weiwei Yang via asuresh)

Posted by as...@apache.org.
YARN-7763. Allow Constraints specified in the SchedulingRequest to override application level constraints. (Weiwei Yang via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/3803dea4
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/3803dea4
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/3803dea4

Branch: refs/heads/YARN-6592
Commit: 3803dea47f3f498f5b4165bef677fed12e66a36e
Parents: 7445139
Author: Arun Suresh <as...@apache.org>
Authored: Sun Jan 21 19:11:17 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../scheduler/capacity/CapacityScheduler.java   |  4 +-
 .../constraint/PlacementConstraintsUtil.java    | 98 +++++++++++---------
 .../algorithm/DefaultPlacementAlgorithm.java    |  4 +-
 .../SingleConstraintAppPlacementAllocator.java  | 10 +-
 .../TestPlacementConstraintsUtil.java           | 94 ++++++++++++-------
 5 files changed, 123 insertions(+), 87 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/3803dea4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
index 429f9f3..a096e2f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacityScheduler.java
@@ -2621,9 +2621,9 @@ public class CapacityScheduler extends
         // Validate placement constraint is satisfied before
         // committing the request.
         try {
-          if (!PlacementConstraintsUtil.canSatisfySingleConstraint(
+          if (!PlacementConstraintsUtil.canSatisfyConstraints(
               appAttempt.getApplicationId(),
-              schedulingRequest.getAllocationTags(), schedulerNode,
+              schedulingRequest, schedulerNode,
               rmContext.getPlacementConstraintManager(),
               rmContext.getAllocationTagsManager())) {
             LOG.debug("Failed to allocate container for application "

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3803dea4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
index ff5cb67..c07c16f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
@@ -25,6 +25,7 @@ import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.classification.InterfaceAudience.Public;
 import org.apache.hadoop.classification.InterfaceStability.Unstable;
 import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
@@ -54,7 +55,7 @@ public final class PlacementConstraintsUtil {
   }
 
   /**
-   * Returns true if **single** placement constraint with associated
+   * Returns true if <b>single</b> placement constraint with associated
    * allocationTags and scope is satisfied by a specific scheduler Node.
    *
    * @param targetApplicationId the application id, which could be override by
@@ -148,59 +149,70 @@ public final class PlacementConstraintsUtil {
     return true;
   }
 
-  /**
-   * Returns true if all placement constraints are **currently** satisfied by a
-   * specific scheduler Node..
-   *
-   * To do so the method retrieves and goes through all application constraint
-   * expressions and checks if the specific allocation is between the allowed
-   * min-max cardinality values under the constraint scope (Node/Rack/etc).
-   *
-   * @param applicationId applicationId,
-   * @param placementConstraint placement constraint.
-   * @param node the scheduler node
-   * @param tagsManager the allocation tags store
-   * @return true if all application constraints are satisfied by node
-   * @throws InvalidAllocationTagsQueryException
-   */
-  public static boolean canSatisfySingleConstraint(ApplicationId applicationId,
-      PlacementConstraint placementConstraint, SchedulerNode node,
-      AllocationTagsManager tagsManager)
+  private static boolean canSatisfyConstraints(ApplicationId appId,
+      PlacementConstraint constraint, SchedulerNode node,
+      AllocationTagsManager atm)
       throws InvalidAllocationTagsQueryException {
-    if (placementConstraint == null) {
+    if (constraint == null) {
       return true;
     }
-    // Transform to SimpleConstraint
+
+    // If this is a single constraint, transform to SingleConstraint
     SingleConstraintTransformer singleTransformer =
-        new SingleConstraintTransformer(placementConstraint);
-    placementConstraint = singleTransformer.transform();
-    AbstractConstraint sConstraintExpr = placementConstraint.getConstraintExpr();
-    SingleConstraint single = (SingleConstraint) sConstraintExpr;
+        new SingleConstraintTransformer(constraint);
+    constraint = singleTransformer.transform();
+    AbstractConstraint sConstraintExpr = constraint.getConstraintExpr();
 
-    return canSatisfySingleConstraint(applicationId, single, node, tagsManager);
+    // TODO handle other type of constraints, e.g CompositeConstraint
+    if (sConstraintExpr instanceof SingleConstraint) {
+      SingleConstraint single = (SingleConstraint) sConstraintExpr;
+      return canSatisfySingleConstraint(appId, single, node, atm);
+    } else {
+      throw new InvalidAllocationTagsQueryException(
+          "Unsupported type of constraint.");
+    }
   }
 
   /**
-   * Returns true if all placement constraints with associated allocationTags
-   * are **currently** satisfied by a specific scheduler Node.
-   * To do so the method retrieves and goes through all application constraint
-   * expressions and checks if the specific allocation is between the allowed
-   * min-max cardinality values under the constraint scope (Node/Rack/etc).
+   * Returns true if the placement constraint for a given scheduling request
+   * is <b>currently</b> satisfied by the specific scheduler node. This method
+   * first validates the constraint specified in the request; if not specified,
+   * then it validates application level constraint if exists; otherwise, it
+   * validates the global constraint if exists.
+   * <p/>
+   * This method only checks whether a scheduling request can be placed
+   * on a node with respect to the certain placement constraint. It gives no
+   * guarantee that asked allocations can be eventually allocated because
+   * it doesn't check resource, that needs to be further decided by a scheduler.
    *
-   * @param appId the application id
-   * @param allocationTags the allocation tags set
-   * @param node the scheduler node
-   * @param pcm the placement constraints store
-   * @param tagsManager the allocation tags store
-   * @return true if all application constraints are satisfied by node
+   * @param applicationId application id
+   * @param request scheduling request
+   * @param schedulerNode node
+   * @param pcm placement constraint manager
+   * @param atm allocation tags manager
+   * @return true if the given node satisfies the constraint of the request
    * @throws InvalidAllocationTagsQueryException
    */
-  public static boolean canSatisfySingleConstraint(ApplicationId appId,
-      Set<String> allocationTags, SchedulerNode node,
-      PlacementConstraintManager pcm, AllocationTagsManager tagsManager)
+  public static boolean canSatisfyConstraints(ApplicationId applicationId,
+      SchedulingRequest request, SchedulerNode schedulerNode,
+      PlacementConstraintManager pcm, AllocationTagsManager atm)
       throws InvalidAllocationTagsQueryException {
-    PlacementConstraint constraint = pcm.getConstraint(appId, allocationTags);
-    return canSatisfySingleConstraint(appId, constraint, node, tagsManager);
-  }
+    // TODO do proper merge on different level of constraints, see YARN-7778.
 
+    // Request level constraint
+    PlacementConstraint constraint = request.getPlacementConstraint();
+    if (constraint == null) {
+      // Application level constraint
+      constraint = pcm.getConstraint(applicationId,
+          request.getAllocationTags());
+      if (constraint == null) {
+        // Global level constraint
+        constraint = pcm.getGlobalConstraint(request.getAllocationTags());
+        if (constraint == null) {
+          return true;
+        }
+      }
+    }
+    return canSatisfyConstraints(applicationId, constraint, schedulerNode, atm);
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3803dea4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
index a0749f5..cf2ed15 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
@@ -71,8 +71,8 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
       throws InvalidAllocationTagsQueryException {
     int numAllocs = schedulingRequest.getResourceSizing().getNumAllocations();
     if (numAllocs > 0) {
-      if (PlacementConstraintsUtil.canSatisfySingleConstraint(appId,
-          schedulingRequest.getAllocationTags(), schedulerNode,
+      if (PlacementConstraintsUtil.canSatisfyConstraints(appId,
+          schedulingRequest, schedulerNode,
           constraintManager, tagsManager)) {
         return true;
       }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3803dea4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
index dd30b61..9e7d71c 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
@@ -42,6 +42,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.ContainerR
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.PendingAsk;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintsUtil;
 import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
 
@@ -72,6 +73,7 @@ public class SingleConstraintAppPlacementAllocator<N extends SchedulerNode>
   private String targetNodePartition;
   private Set<String> targetAllocationTags;
   private AllocationTagsManager allocationTagsManager;
+  private PlacementConstraintManager placementConstraintManager;
 
   public SingleConstraintAppPlacementAllocator() {
     ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
@@ -437,10 +439,9 @@ public class SingleConstraintAppPlacementAllocator<N extends SchedulerNode>
 
     // node type will be ignored.
     try {
-      return PlacementConstraintsUtil.canSatisfySingleConstraint(
-          appSchedulingInfo.getApplicationId(),
-          this.schedulingRequest.getPlacementConstraint(), node,
-          allocationTagsManager);
+      return PlacementConstraintsUtil.canSatisfyConstraints(
+          appSchedulingInfo.getApplicationId(), schedulingRequest, node,
+          placementConstraintManager, allocationTagsManager);
     } catch (InvalidAllocationTagsQueryException e) {
       LOG.warn("Failed to query node cardinality:", e);
       return false;
@@ -527,5 +528,6 @@ public class SingleConstraintAppPlacementAllocator<N extends SchedulerNode>
       SchedulerRequestKey schedulerRequestKey, RMContext rmContext) {
     super.initialize(appSchedulingInfo, schedulerRequestKey, rmContext);
     this.allocationTagsManager = rmContext.getAllocationTagsManager();
+    this.placementConstraintManager = rmContext.getPlacementConstraintManager();
   }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/3803dea4/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
index 8ad726e..a5460c2 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
@@ -32,6 +32,7 @@ import java.util.Map;
 import java.util.Set;
 import java.util.stream.Collectors;
 import java.util.stream.Stream;
+import java.util.concurrent.atomic.AtomicLong;
 
 import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
 import org.apache.hadoop.yarn.api.records.ApplicationId;
@@ -39,6 +40,10 @@ import org.apache.hadoop.yarn.api.records.ContainerId;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.records.Priority;
+import org.apache.hadoop.yarn.api.records.ExecutionTypeRequest;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.server.resourcemanager.MockNodes;
 import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
@@ -64,6 +69,7 @@ public class TestPlacementConstraintsUtil {
   private PlacementConstraint c1, c2, c3, c4;
   private Set<String> sourceTag1, sourceTag2;
   private Map<Set<String>, PlacementConstraint> constraintMap1, constraintMap2;
+  private AtomicLong requestID = new AtomicLong(0);
 
   @Before
   public void setup() {
@@ -102,6 +108,22 @@ public class TestPlacementConstraintsUtil {
             AbstractMap.SimpleEntry::getValue));
   }
 
+  private SchedulingRequest createSchedulingRequest(Set<String> allocationTags,
+      PlacementConstraint constraint) {
+    return SchedulingRequest
+        .newInstance(requestID.incrementAndGet(),
+            Priority.newInstance(0),
+            ExecutionTypeRequest.newInstance(),
+            allocationTags,
+            ResourceSizing.newInstance(Resource.newInstance(1024, 3)),
+            constraint);
+  }
+
+  private SchedulingRequest createSchedulingRequest(Set<String>
+      allocationTags) {
+    return createSchedulingRequest(allocationTags, null);
+  }
+
   @Test
   public void testNodeAffinityAssignment()
       throws InvalidAllocationTagsQueryException {
@@ -117,10 +139,10 @@ public class TestPlacementConstraintsUtil {
       RMNode currentNode = nodeIterator.next();
       FiCaSchedulerNode schedulerNode = TestUtils.getMockNode(
           currentNode.getHostName(), currentNode.getRackName(), 123, 4 * GB);
-      Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-          sourceTag1, schedulerNode, pcm, tm));
-      Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-          sourceTag2, schedulerNode, pcm, tm));
+      Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+          createSchedulingRequest(sourceTag1), schedulerNode, pcm, tm));
+      Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+          createSchedulingRequest(sourceTag2), schedulerNode, pcm, tm));
     }
     /**
      * Now place container:
@@ -145,15 +167,15 @@ public class TestPlacementConstraintsUtil {
     tm.addContainer(n0_r1.getNodeID(), hbase_m, ImmutableSet.of("hbase-m"));
 
     // 'spark' placement on Node0 should now SUCCEED
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag1, schedulerNode0, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag1), schedulerNode0, pcm, tm));
     // FAIL on the rest of the nodes
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag1, schedulerNode1, pcm, tm));
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag1, schedulerNode2, pcm, tm));
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag1, schedulerNode3, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag1), schedulerNode1, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag1), schedulerNode2, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag1), schedulerNode3, pcm, tm));
   }
 
   @Test
@@ -187,16 +209,16 @@ public class TestPlacementConstraintsUtil {
     FiCaSchedulerNode schedulerNode3 = TestUtils
         .getMockNode(n3_r2.getHostName(), n3_r2.getRackName(), 123, 4 * GB);
     // 'zk' placement on Rack1 should now SUCCEED
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag2, schedulerNode0, pcm, tm));
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag2, schedulerNode1, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag2), schedulerNode0, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag2), schedulerNode1, pcm, tm));
 
     // FAIL on the rest of the RACKs
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag2, schedulerNode2, pcm, tm));
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag2, schedulerNode3, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag2), schedulerNode2, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag2), schedulerNode3, pcm, tm));
   }
 
   @Test
@@ -230,15 +252,15 @@ public class TestPlacementConstraintsUtil {
     tm.addContainer(n0_r1.getNodeID(), hbase_m, ImmutableSet.of("hbase-m"));
 
     // 'spark' placement on Node0 should now FAIL
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag1, schedulerNode0, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag1), schedulerNode0, pcm, tm));
     // SUCCEED on the rest of the nodes
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag1, schedulerNode1, pcm, tm));
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag1, schedulerNode2, pcm, tm));
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag1, schedulerNode3, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag1), schedulerNode1, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag1), schedulerNode2, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag1), schedulerNode3, pcm, tm));
   }
 
   @Test
@@ -273,15 +295,15 @@ public class TestPlacementConstraintsUtil {
         .getMockNode(n3_r2.getHostName(), n3_r2.getRackName(), 123, 4 * GB);
 
     // 'zk' placement on Rack1 should FAIL
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag2, schedulerNode0, pcm, tm));
-    Assert.assertFalse(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag2, schedulerNode1, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag2), schedulerNode0, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag2), schedulerNode1, pcm, tm));
 
     // SUCCEED on the rest of the RACKs
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag2, schedulerNode2, pcm, tm));
-    Assert.assertTrue(PlacementConstraintsUtil.canSatisfySingleConstraint(appId1,
-        sourceTag2, schedulerNode3, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag2), schedulerNode2, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        createSchedulingRequest(sourceTag2), schedulerNode3, pcm, tm));
   }
 }
\ No newline at end of file


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[36/50] [abbrv] hadoop git commit: YARN-6596. Introduce Placement Constraint Manager module. (Konstantinos Karanasos via asuresh)

Posted by as...@apache.org.
YARN-6596. Introduce Placement Constraint Manager module. (Konstantinos Karanasos via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/80af031d
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/80af031d
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/80af031d

Branch: refs/heads/YARN-6592
Commit: 80af031dccf5b264949d5a996d40ed993f0e21c3
Parents: e724972
Author: Arun Suresh <as...@apache.org>
Authored: Fri Dec 22 13:26:30 2017 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../resourcemanager/RMActiveServiceContext.java |  15 +
 .../yarn/server/resourcemanager/RMContext.java  |   6 +
 .../server/resourcemanager/RMContextImpl.java   |  13 +
 .../server/resourcemanager/ResourceManager.java |  13 +
 .../MemoryPlacementConstraintManager.java       | 282 +++++++++++++++++++
 .../constraint/PlacementConstraintManager.java  | 151 ++++++++++
 .../PlacementConstraintManagerService.java      |  93 ++++++
 .../scheduler/constraint/package-info.java      |  29 ++
 .../TestPlacementConstraintManagerService.java  | 182 ++++++++++++
 9 files changed, 784 insertions(+)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
index 4d0c230..06a1d00 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMActiveServiceContext.java
@@ -43,6 +43,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.ContainerAlloca
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.distributed.QueueLimitCalculator;
 import org.apache.hadoop.yarn.server.resourcemanager.security.AMRMTokenSecretManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.ClientToAMTokenSecretManagerInRM;
@@ -109,6 +110,7 @@ public class RMActiveServiceContext {
   private RMAppLifetimeMonitor rmAppLifetimeMonitor;
   private QueueLimitCalculator queueLimitCalculator;
   private AllocationTagsManager allocationTagsManager;
+  private PlacementConstraintManager placementConstraintManager;
 
   public RMActiveServiceContext() {
     queuePlacementManager = new PlacementManager();
@@ -413,6 +415,19 @@ public class RMActiveServiceContext {
 
   @Private
   @Unstable
+  public PlacementConstraintManager getPlacementConstraintManager() {
+    return placementConstraintManager;
+  }
+
+  @Private
+  @Unstable
+  public void setPlacementConstraintManager(
+      PlacementConstraintManager placementConstraintManager) {
+    this.placementConstraintManager = placementConstraintManager;
+  }
+
+  @Private
+  @Unstable
   public RMDelegatedNodeLabelsUpdater getRMDelegatedNodeLabelsUpdater() {
     return rmDelegatedNodeLabelsUpdater;
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
index 00da108..eb91a31 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContext.java
@@ -43,6 +43,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmcontainer.ContainerAlloca
 import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.distributed.QueueLimitCalculator;
 import org.apache.hadoop.yarn.server.resourcemanager.security.AMRMTokenSecretManager;
@@ -171,4 +172,9 @@ public interface RMContext extends ApplicationMasterServiceContext {
   AllocationTagsManager getAllocationTagsManager();
 
   void setAllocationTagsManager(AllocationTagsManager allocationTagsManager);
+
+  PlacementConstraintManager getPlacementConstraintManager();
+
+  void setPlacementConstraintManager(
+      PlacementConstraintManager placementConstraintManager);
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
index da50ef8..0b6be72 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/RMContextImpl.java
@@ -50,6 +50,7 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.distributed.QueueLimitCalculator;
 import org.apache.hadoop.yarn.server.resourcemanager.security.AMRMTokenSecretManager;
 import org.apache.hadoop.yarn.server.resourcemanager.security.ClientToAMTokenSecretManagerInRM;
@@ -516,6 +517,18 @@ public class RMContextImpl implements RMContext {
   }
 
   @Override
+  public PlacementConstraintManager getPlacementConstraintManager() {
+    return activeServiceContext.getPlacementConstraintManager();
+  }
+
+  @Override
+  public void setPlacementConstraintManager(
+      PlacementConstraintManager placementConstraintManager) {
+    activeServiceContext
+        .setPlacementConstraintManager(placementConstraintManager);
+  }
+
+  @Override
   public RMDelegatedNodeLabelsUpdater getRMDelegatedNodeLabelsUpdater() {
     return activeServiceContext.getRMDelegatedNodeLabelsUpdater();
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
index 1d838f0..5140c9f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/ResourceManager.java
@@ -97,6 +97,8 @@ import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNodeEventType;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.QueueMetrics;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.MemoryPlacementConstraintManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManagerService;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.SchedulerEvent;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.event.SchedulerEventType;
 import org.apache.hadoop.yarn.server.resourcemanager.security.DelegationTokenRenewer;
@@ -498,6 +500,12 @@ public class ResourceManager extends CompositeService implements Recoverable {
   protected AllocationTagsManager createAllocationTagsManager() {
     return new AllocationTagsManager(this.rmContext);
   }
+
+  protected PlacementConstraintManagerService
+      createPlacementConstraintManager() {
+    // Use the in memory Placement Constraint Manager.
+    return new MemoryPlacementConstraintManager();
+  }
   
   protected DelegationTokenRenewer createDelegationTokenRenewer() {
     return new DelegationTokenRenewer();
@@ -628,6 +636,11 @@ public class ResourceManager extends CompositeService implements Recoverable {
           createAllocationTagsManager();
       rmContext.setAllocationTagsManager(allocationTagsManager);
 
+      PlacementConstraintManagerService placementConstraintManager =
+          createPlacementConstraintManager();
+      addService(placementConstraintManager);
+      rmContext.setPlacementConstraintManager(placementConstraintManager);
+
       RMDelegatedNodeLabelsUpdater delegatedNodeLabelsUpdater =
           createRMDelegatedNodeLabelsUpdater();
       if (delegatedNodeLabelsUpdater != null) {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/MemoryPlacementConstraintManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/MemoryPlacementConstraintManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/MemoryPlacementConstraintManager.java
new file mode 100644
index 0000000..ceff6f6
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/MemoryPlacementConstraintManager.java
@@ -0,0 +1,282 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.Map;
+import java.util.Set;
+import java.util.concurrent.locks.ReentrantReadWriteLock;
+import java.util.stream.Collectors;
+import java.util.stream.Stream;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.conf.Configuration;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.slf4j.Logger;
+import org.slf4j.LoggerFactory;
+
+/**
+ * In memory implementation of the {@link PlacementConstraintManagerService}.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+public class MemoryPlacementConstraintManager
+    extends PlacementConstraintManagerService {
+
+  private static final Logger LOG =
+      LoggerFactory.getLogger(MemoryPlacementConstraintManager.class);
+
+  private ReentrantReadWriteLock.ReadLock readLock;
+  private ReentrantReadWriteLock.WriteLock writeLock;
+
+  /**
+   * Stores the global constraints that will be manipulated by the cluster
+   * admin. The key of each entry is the tag that will enable the corresponding
+   * constraint.
+   */
+  private Map<String, PlacementConstraint> globalConstraints;
+  /**
+   * Stores the constraints for each application, along with the allocation tags
+   * that will enable each of the constraints for a given application.
+   */
+  private Map<ApplicationId, Map<String, PlacementConstraint>> appConstraints;
+
+  public MemoryPlacementConstraintManager() {
+    this.globalConstraints = new HashMap<>();
+    this.appConstraints = new HashMap<>();
+    ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
+    readLock = lock.readLock();
+    writeLock = lock.writeLock();
+  }
+
+  @Override
+  protected void serviceInit(Configuration conf) throws Exception {
+    super.serviceInit(conf);
+  }
+
+  @Override
+  public void registerApplication(ApplicationId appId,
+      Map<Set<String>, PlacementConstraint> constraintMap) {
+    // Check if app already exists. If not, prepare its constraint map.
+    Map<String, PlacementConstraint> constraintsForApp = new HashMap<>();
+    try {
+      readLock.lock();
+      if (appConstraints.get(appId) != null) {
+        LOG.warn("Application {} has already been registered.", appId);
+        return;
+      }
+      // Go over each sourceTag-constraint pair, validate it, and add it to the
+      // constraint map for this app.
+      for (Map.Entry<Set<String>, PlacementConstraint> entry : constraintMap
+          .entrySet()) {
+        Set<String> sourceTags = entry.getKey();
+        PlacementConstraint constraint = entry.getValue();
+        if (validateConstraint(sourceTags, constraint)) {
+          String sourceTag = getValidSourceTag(sourceTags);
+          constraintsForApp.put(sourceTag, constraint);
+        }
+      }
+    } finally {
+      readLock.unlock();
+    }
+
+    if (constraintsForApp.isEmpty()) {
+      LOG.info("Application {} was registered, but no constraints were added.",
+          appId);
+    }
+    // Update appConstraints.
+    try {
+      writeLock.lock();
+      appConstraints.put(appId, constraintsForApp);
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  @Override
+  public void addConstraint(ApplicationId appId, Set<String> sourceTags,
+      PlacementConstraint placementConstraint, boolean replace) {
+    try {
+      writeLock.lock();
+      Map<String, PlacementConstraint> constraintsForApp =
+          appConstraints.get(appId);
+      if (constraintsForApp == null) {
+        LOG.info("Cannot add constraint to application {}, as it has not "
+            + "been registered yet.", appId);
+        return;
+      }
+
+      addConstraintToMap(constraintsForApp, sourceTags, placementConstraint,
+          replace);
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  @Override
+  public void addGlobalConstraint(Set<String> sourceTags,
+      PlacementConstraint placementConstraint, boolean replace) {
+    try {
+      writeLock.lock();
+      addConstraintToMap(globalConstraints, sourceTags, placementConstraint,
+          replace);
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  /**
+   * Helper method that adds a constraint to a map for a given source tag.
+   * Assumes there is already a lock on the constraint map.
+   *
+   * @param constraintMap constraint map to which the constraint will be added
+   * @param sourceTags the source tags that will enable this constraint
+   * @param placementConstraint the new constraint to be added
+   * @param replace if true, an existing constraint for these sourceTags will be
+   *          replaced with the new one
+   */
+  private void addConstraintToMap(
+      Map<String, PlacementConstraint> constraintMap, Set<String> sourceTags,
+      PlacementConstraint placementConstraint, boolean replace) {
+    if (validateConstraint(sourceTags, placementConstraint)) {
+      String sourceTag = getValidSourceTag(sourceTags);
+      if (constraintMap.get(sourceTag) == null || replace) {
+        if (replace) {
+          LOG.info("Replacing the constraint associated with tag {} with {}.",
+              sourceTag, placementConstraint);
+        }
+        constraintMap.put(sourceTag, placementConstraint);
+      } else {
+        LOG.info("Constraint {} will not be added. There is already a "
+                + "constraint associated with tag {}.",
+            placementConstraint, sourceTag);
+      }
+    }
+  }
+
+  @Override
+  public Map<Set<String>, PlacementConstraint> getConstraints(
+      ApplicationId appId) {
+    try {
+      readLock.lock();
+      if (appConstraints.get(appId) == null) {
+        LOG.info("Application {} is not registered in the Placement "
+            + "Constraint Manager.", appId);
+        return null;
+      }
+
+      // Copy to a new map and return an unmodifiable version of it.
+      // Each key of the map is a set with a single source tag.
+      Map<Set<String>, PlacementConstraint> constraintMap =
+          appConstraints.get(appId).entrySet().stream()
+              .collect(Collectors.toMap(
+                  e -> Stream.of(e.getKey()).collect(Collectors.toSet()),
+                  e -> e.getValue()));
+
+      return Collections.unmodifiableMap(constraintMap);
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  @Override
+  public PlacementConstraint getConstraint(ApplicationId appId,
+      Set<String> sourceTags) {
+    if (!validateSourceTags(sourceTags)) {
+      return null;
+    }
+    String sourceTag = getValidSourceTag(sourceTags);
+    try {
+      readLock.lock();
+      if (appConstraints.get(appId) == null) {
+        LOG.info("Application {} is not registered in the Placement "
+            + "Constraint Manager.", appId);
+        return null;
+      }
+      // TODO: Merge this constraint with the global one for this tag, if one
+      // exists.
+      return appConstraints.get(appId).get(sourceTag);
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  @Override
+  public PlacementConstraint getGlobalConstraint(Set<String> sourceTags) {
+    if (!validateSourceTags(sourceTags)) {
+      return null;
+    }
+    String sourceTag = getValidSourceTag(sourceTags);
+    try {
+      readLock.lock();
+      return globalConstraints.get(sourceTag);
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  @Override
+  public void unregisterApplication(ApplicationId appId) {
+    try {
+      writeLock.lock();
+      appConstraints.remove(appId);
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  @Override
+  public void removeGlobalConstraint(Set<String> sourceTags) {
+    if (!validateSourceTags(sourceTags)) {
+      return;
+    }
+    String sourceTag = getValidSourceTag(sourceTags);
+    try {
+      writeLock.lock();
+      globalConstraints.remove(sourceTag);
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  @Override
+  public int getNumRegisteredApplications() {
+    try {
+      readLock.lock();
+      return appConstraints.size();
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  @Override
+  public int getNumGlobalConstraints() {
+    try {
+      readLock.lock();
+      return globalConstraints.size();
+    } finally {
+      readLock.unlock();
+    }
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintManager.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintManager.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintManager.java
new file mode 100644
index 0000000..7725d0d
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintManager.java
@@ -0,0 +1,151 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import java.util.Map;
+import java.util.Set;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+
+/**
+ * Interface for storing and retrieving placement constraints (see
+ * {@link PlacementConstraint}).
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+public interface PlacementConstraintManager {
+
+  /**
+   * Register all placement constraints of an application.
+   *
+   * @param appId the application ID
+   * @param constraintMap the map of allocation tags to constraints for this
+   *          application
+   */
+  void registerApplication(ApplicationId appId,
+      Map<Set<String>, PlacementConstraint> constraintMap);
+
+  /**
+   * Add a placement constraint for a given application and a given set of
+   * (source) allocation tags. The constraint will be used on Scheduling
+   * Requests that carry this set of allocation tags.
+   * TODO: Support merge and not only replace when adding a constraint.
+   *
+   * @param appId the application ID
+   * @param sourceTags the set of allocation tags that will enable this
+   *          constraint
+   * @param placementConstraint the constraint
+   * @param replace if true, an existing constraint for these tags will be
+   *          replaced by the given one
+   */
+  void addConstraint(ApplicationId appId, Set<String> sourceTags,
+      PlacementConstraint placementConstraint, boolean replace);
+
+  /**
+   * Add a placement constraint that will be used globally. These constraints
+   * are added by the cluster administrator.
+   * TODO: Support merge and not only replace when adding a constraint.
+   *
+   * @param sourceTags the allocation tags that will enable this constraint
+   * @param placementConstraint the constraint
+   * @param replace if true, an existing constraint for these tags will be
+   *          replaced by the given one
+   */
+  void addGlobalConstraint(Set<String> sourceTags,
+      PlacementConstraint placementConstraint, boolean replace);
+
+  /**
+   * Retrieve all constraints for a given application, along with the allocation
+   * tags that enable each constraint.
+   *
+   * @param appId the application ID
+   * @return the constraints for this application with the associated tags
+   */
+  Map<Set<String>, PlacementConstraint> getConstraints(ApplicationId appId);
+
+  /**
+   * Retrieve the placement constraint that is associated with a set of
+   * allocation tags for a given application.
+   *
+   * @param appId the application ID
+   * @param sourceTags the allocation tags that enable this constraint
+   * @return the constraint
+   */
+  PlacementConstraint getConstraint(ApplicationId appId,
+      Set<String> sourceTags);
+
+  /**
+   * Retrieve a global constraint that is associated with a given set of
+   * allocation tags.
+   *
+   * @param sourceTags the allocation tags that enable this constraint
+   * @return the constraint
+   */
+  PlacementConstraint getGlobalConstraint(Set<String> sourceTags);
+
+  /**
+   * Remove the constraints that correspond to a given application.
+   *
+   * @param appId the application that will be removed.
+   */
+  void unregisterApplication(ApplicationId appId);
+
+  /**
+   * Remove a global constraint that is associated with the given allocation
+   * tags.
+   *
+   * @param sourceTags the allocation tags
+   */
+  void removeGlobalConstraint(Set<String> sourceTags);
+
+  /**
+   * Returns the number of currently registered applications in the Placement
+   * Constraint Manager.
+   *
+   * @return number of registered applications.
+   */
+  int getNumRegisteredApplications();
+
+  /**
+   * Returns the number of global constraints registered in the Placement
+   * Constraint Manager.
+   *
+   * @return number of global constraints.
+   */
+  int getNumGlobalConstraints();
+
+  /**
+   * Validate a placement constraint and the set of allocation tags that will
+   * enable it.
+   *
+   * @param sourceTags the associated allocation tags
+   * @param placementConstraint the constraint
+   * @return true if constraint and tags are valid
+   */
+  default boolean validateConstraint(Set<String> sourceTags,
+      PlacementConstraint placementConstraint) {
+    return true;
+  }
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintManagerService.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintManagerService.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintManagerService.java
new file mode 100644
index 0000000..967f251
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintManagerService.java
@@ -0,0 +1,93 @@
+/*
+ * *
+ *  Licensed to the Apache Software Foundation (ASF) under one
+ *  or more contributor license agreements.  See the NOTICE file
+ *  distributed with this work for additional information
+ *  regarding copyright ownership.  The ASF licenses this file
+ *  to you under the Apache License, Version 2.0 (the
+ *  "License"); you may not use this file except in compliance
+ *  with the License.  You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *  Unless required by applicable law or agreed to in writing, software
+ *  distributed under the License is distributed on an "AS IS" BASIS,
+ *  WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *  See the License for the specific language governing permissions and
+ *  limitations under the License.
+ * /
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import java.util.Set;
+
+import org.apache.commons.logging.Log;
+import org.apache.commons.logging.LogFactory;
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.service.AbstractService;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+
+/**
+ * The service that implements the {@link PlacementConstraintManager} interface.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+public abstract class PlacementConstraintManagerService extends AbstractService
+    implements PlacementConstraintManager {
+
+  protected static final Log LOG =
+      LogFactory.getLog(PlacementConstraintManagerService.class);
+
+  private PlacementConstraintManager placementConstraintManager = null;
+
+  public PlacementConstraintManagerService() {
+    super(PlacementConstraintManagerService.class.getName());
+  }
+
+  @Override
+  public boolean validateConstraint(Set<String> sourceTags,
+      PlacementConstraint placementConstraint) {
+    if (!validateSourceTags(sourceTags)) {
+      return false;
+    }
+    // TODO: Perform actual validation of the constraint (in YARN-6621).
+    // TODO: Perform satisfiability check for constraint.
+    return true;
+  }
+
+  /**
+   * Validates whether the allocation tags that will enable a constraint have
+   * the expected format. At the moment we support a single allocation tag per
+   * constraint.
+   *
+   * @param sourceTags the source allocation tags
+   * @return true if the tags have the expected format
+   */
+  protected boolean validateSourceTags(Set<String> sourceTags) {
+    if (sourceTags.isEmpty()) {
+      LOG.warn("A placement constraint cannot be associated with an empty "
+          + "set of tags.");
+      return false;
+    }
+    if (sourceTags.size() > 1) {
+      LOG.warn("Only a single tag can be associated with a placement "
+          + "constraint currently.");
+      return false;
+    }
+    return true;
+  }
+
+  /**
+   * This method will return a single allocation tag. It should be called after
+   * validating the tags by calling {@link #validateSourceTags}.
+   *
+   * @param sourceTags the source allocation tags
+   * @return the single source tag
+   */
+  protected String getValidSourceTag(Set<String> sourceTags) {
+    return sourceTags.iterator().next();
+  }
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/package-info.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/package-info.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/package-info.java
new file mode 100644
index 0000000..cbb7a55
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/package-info.java
@@ -0,0 +1,29 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * Package org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement
+ * contains classes related to scheduling containers using placement
+ * constraints.
+ */
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/80af031d/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintManagerService.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintManagerService.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintManagerService.java
new file mode 100644
index 0000000..abcab1a
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintManagerService.java
@@ -0,0 +1,182 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one or more
+ * contributor license agreements.  See the NOTICE file distributed with this
+ * work for additional information regarding copyright ownership.  The ASF
+ * licenses this file to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+ * WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+ * License for the specific language governing permissions and limitations under
+ * the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.RACK;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetCardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetNotIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.allocationTag;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.nodeAttribute;
+
+import java.util.AbstractMap.SimpleEntry;
+import java.util.Arrays;
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.Map;
+import java.util.Set;
+import java.util.stream.Collectors;
+import java.util.stream.Stream;
+
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.server.utils.BuilderUtils;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+
+/**
+ * Unit tests for {@link PlacementConstraintManagerService}.
+ */
+public class TestPlacementConstraintManagerService {
+
+  private PlacementConstraintManagerService pcm;
+
+  protected PlacementConstraintManagerService createPCM() {
+    return new MemoryPlacementConstraintManager();
+  }
+
+  private ApplicationId appId1, appId2;
+  private PlacementConstraint c1, c2, c3, c4;
+  private Set<String> sourceTag1, sourceTag2, sourceTag3, sourceTag4;
+  private Map<Set<String>, PlacementConstraint> constraintMap1, constraintMap2;
+
+  @Before
+  public void before() {
+    this.pcm = createPCM();
+
+    // Build appIDs, constraints, source tags, and constraint map.
+    long ts = System.currentTimeMillis();
+    appId1 = BuilderUtils.newApplicationId(ts, 123);
+    appId2 = BuilderUtils.newApplicationId(ts, 234);
+
+    c1 = PlacementConstraints.build(targetIn(NODE, allocationTag("hbase-m")));
+    c2 = PlacementConstraints.build(targetIn(RACK, allocationTag("hbase-rs")));
+    c3 = PlacementConstraints
+        .build(targetNotIn(NODE, nodeAttribute("java", "1.8")));
+    c4 = PlacementConstraints
+        .build(targetCardinality(RACK, 2, 10, allocationTag("zk")));
+
+    sourceTag1 = new HashSet<>(Arrays.asList("spark"));
+    sourceTag2 = new HashSet<>(Arrays.asList("zk"));
+    sourceTag3 = new HashSet<>(Arrays.asList("storm"));
+    sourceTag4 = new HashSet<>(Arrays.asList("hbase-m", "hbase-sec"));
+
+    constraintMap1 = Stream
+        .of(new SimpleEntry<>(sourceTag1, c1),
+            new SimpleEntry<>(sourceTag2, c2))
+        .collect(Collectors.toMap(SimpleEntry::getKey, SimpleEntry::getValue));
+
+    constraintMap2 = Stream.of(new SimpleEntry<>(sourceTag3, c4))
+        .collect(Collectors.toMap(SimpleEntry::getKey, SimpleEntry::getValue));
+  }
+
+  @Test
+  public void testRegisterUnregisterApps() {
+    Assert.assertEquals(0, pcm.getNumRegisteredApplications());
+
+    // Register two applications.
+    pcm.registerApplication(appId1, constraintMap1);
+    Assert.assertEquals(1, pcm.getNumRegisteredApplications());
+    Map<Set<String>, PlacementConstraint> constrMap =
+        pcm.getConstraints(appId1);
+    Assert.assertNotNull(constrMap);
+    Assert.assertEquals(2, constrMap.size());
+    Assert.assertNotNull(constrMap.get(sourceTag1));
+    Assert.assertNotNull(constrMap.get(sourceTag2));
+
+    pcm.registerApplication(appId2, constraintMap2);
+    Assert.assertEquals(2, pcm.getNumRegisteredApplications());
+    constrMap = pcm.getConstraints(appId2);
+    Assert.assertNotNull(constrMap);
+    Assert.assertEquals(1, constrMap.size());
+    Assert.assertNotNull(constrMap.get(sourceTag3));
+    Assert.assertNull(constrMap.get(sourceTag2));
+
+    // Try to register the same app again.
+    pcm.registerApplication(appId2, constraintMap1);
+    Assert.assertEquals(2, pcm.getNumRegisteredApplications());
+
+    // Unregister appId1.
+    pcm.unregisterApplication(appId1);
+    Assert.assertEquals(1, pcm.getNumRegisteredApplications());
+    Assert.assertNull(pcm.getConstraints(appId1));
+    Assert.assertNotNull(pcm.getConstraints(appId2));
+  }
+
+  @Test
+  public void testAddConstraint() {
+    // Cannot add constraint to unregistered app.
+    Assert.assertEquals(0, pcm.getNumRegisteredApplications());
+    pcm.addConstraint(appId1, sourceTag1, c1, false);
+    Assert.assertEquals(0, pcm.getNumRegisteredApplications());
+
+    // Register application.
+    pcm.registerApplication(appId1, new HashMap<>());
+    Assert.assertEquals(1, pcm.getNumRegisteredApplications());
+    Assert.assertEquals(0, pcm.getConstraints(appId1).size());
+
+    // Add two constraints.
+    pcm.addConstraint(appId1, sourceTag1, c1, false);
+    pcm.addConstraint(appId1, sourceTag2, c3, false);
+    Assert.assertEquals(2, pcm.getConstraints(appId1).size());
+
+    // Constraint for sourceTag1 should not be replaced.
+    pcm.addConstraint(appId1, sourceTag1, c2, false);
+    Assert.assertEquals(2, pcm.getConstraints(appId1).size());
+    Assert.assertEquals(c1, pcm.getConstraint(appId1, sourceTag1));
+    Assert.assertNotEquals(c2, pcm.getConstraint(appId1, sourceTag1));
+
+    // Now c2 should replace c1 for sourceTag1.
+    pcm.addConstraint(appId1, sourceTag1, c2, true);
+    Assert.assertEquals(2, pcm.getConstraints(appId1).size());
+    Assert.assertEquals(c2, pcm.getConstraint(appId1, sourceTag1));
+  }
+
+  @Test
+  public void testGlobalConstraints() {
+    Assert.assertEquals(0, pcm.getNumGlobalConstraints());
+    pcm.addGlobalConstraint(sourceTag1, c1, false);
+    Assert.assertEquals(1, pcm.getNumGlobalConstraints());
+    Assert.assertNotNull(pcm.getGlobalConstraint(sourceTag1));
+
+    // Constraint for sourceTag1 should not be replaced.
+    pcm.addGlobalConstraint(sourceTag1, c2, false);
+    Assert.assertEquals(1, pcm.getNumGlobalConstraints());
+    Assert.assertEquals(c1, pcm.getGlobalConstraint(sourceTag1));
+    Assert.assertNotEquals(c2, pcm.getGlobalConstraint(sourceTag1));
+
+    // Now c2 should replace c1 for sourceTag1.
+    pcm.addGlobalConstraint(sourceTag1, c2, true);
+    Assert.assertEquals(1, pcm.getNumGlobalConstraints());
+    Assert.assertEquals(c2, pcm.getGlobalConstraint(sourceTag1));
+
+    pcm.removeGlobalConstraint(sourceTag1);
+    Assert.assertEquals(0, pcm.getNumGlobalConstraints());
+  }
+
+  @Test
+  public void testValidateConstraint() {
+    // At the moment we only disallow multiple source tags to be associated with
+    // a constraint. TODO: More tests to be added for YARN-6621.
+    Assert.assertTrue(pcm.validateConstraint(sourceTag1, c1));
+    Assert.assertFalse(pcm.validateConstraint(sourceTag4, c1));
+  }
+}


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[18/50] [abbrv] hadoop git commit: YARN-7723. Avoid using docker volume --format option to run against to older docker releases. Contributed by Wangda Tan

Posted by as...@apache.org.
YARN-7723. Avoid using docker volume --format option to run against to older docker releases. Contributed by Wangda Tan


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/6463e10c
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/6463e10c
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/6463e10c

Branch: refs/heads/YARN-6592
Commit: 6463e10c72344e1720c991307cf2e7b67e112a3a
Parents: f666e7c
Author: Sunil G <su...@apache.org>
Authored: Tue Jan 30 15:58:11 2018 +0530
Committer: Sunil G <su...@apache.org>
Committed: Tue Jan 30 15:58:11 2018 +0530

----------------------------------------------------------------------
 .../runtime/DockerLinuxContainerRuntime.java    |  9 +------
 .../runtime/TestDockerContainerRuntime.java     | 25 ++++++++++++++++----
 2 files changed, 22 insertions(+), 12 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/6463e10c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java
index f3ce73d..601c32c 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/main/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/DockerLinuxContainerRuntime.java
@@ -437,7 +437,6 @@ public class DockerLinuxContainerRuntime implements LinuxContainerRuntime {
       throws ContainerExecutionException {
     DockerVolumeCommand dockerVolumeInspectCommand = new DockerVolumeCommand(
         DockerVolumeCommand.VOLUME_LS_SUB_COMMAND);
-    dockerVolumeInspectCommand.setFormat("{{.Name}},{{.Driver}}");
     String output = runDockerVolumeCommand(dockerVolumeInspectCommand,
         container);
 
@@ -450,13 +449,7 @@ public class DockerLinuxContainerRuntime implements LinuxContainerRuntime {
 
     for (String line : output.split("\n")) {
       line = line.trim();
-      String[] arr = line.split(",");
-      String v = arr[0].trim();
-      String d = null;
-      if (arr.length > 1) {
-        d = arr[1].trim();
-      }
-      if (d != null && volumeName.equals(v) && driverName.equals(d)) {
+      if (line.contains(volumeName) && line.contains(driverName)) {
         // Good we found it.
         LOG.info(
             "Docker volume-name=" + volumeName + " driver-name=" + driverName

http://git-wip-us.apache.org/repos/asf/hadoop/blob/6463e10c/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/TestDockerContainerRuntime.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/TestDockerContainerRuntime.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/TestDockerContainerRuntime.java
index 48a96e1..fe4e238 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/TestDockerContainerRuntime.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-nodemanager/src/test/java/org/apache/hadoop/yarn/server/nodemanager/containermanager/linux/runtime/TestDockerContainerRuntime.java
@@ -1473,9 +1473,9 @@ public class TestDockerContainerRuntime {
     commandFile = new File(StringUtils.join(",", op.getArguments()));
     fileInputStream = new FileInputStream(commandFile);
     fileContent = new String(IOUtils.toByteArray(fileInputStream));
-    Assert.assertEquals("[docker-command-execution]\n"
-        + "  docker-command=volume\n" + "  format={{.Name}},{{.Driver}}\n"
-        + "  sub-command=ls\n", fileContent);
+    Assert.assertEquals(
+        "[docker-command-execution]\n" + "  docker-command=volume\n"
+            + "  sub-command=ls\n", fileContent);
     fileInputStream.close();
   }
 
@@ -1577,16 +1577,33 @@ public class TestDockerContainerRuntime {
     // For following tests, we expect to have volume1,local in output
 
     // Failure cases
+    testDockerCommandPluginWithVolumesOutput(
+        "DRIVER              VOLUME NAME\n", true);
     testDockerCommandPluginWithVolumesOutput("", true);
     testDockerCommandPluginWithVolumesOutput("volume1", true);
+    testDockerCommandPluginWithVolumesOutput(
+        "DRIVER              VOLUME NAME\n" +
+        "nvidia-docker       nvidia_driver_375.66\n", true);
+    testDockerCommandPluginWithVolumesOutput(
+        "DRIVER              VOLUME NAME\n" +
+        "                    volume1\n", true);
     testDockerCommandPluginWithVolumesOutput("local", true);
     testDockerCommandPluginWithVolumesOutput("volume2,local", true);
+    testDockerCommandPluginWithVolumesOutput(
+        "DRIVER              VOLUME NAME\n" +
+        "local               volume2\n", true);
     testDockerCommandPluginWithVolumesOutput("volum1,something", true);
+    testDockerCommandPluginWithVolumesOutput(
+        "DRIVER              VOLUME NAME\n" +
+        "something               volume1\n", true);
     testDockerCommandPluginWithVolumesOutput("volum1,something\nvolum2,local",
         true);
 
     // Success case
-    testDockerCommandPluginWithVolumesOutput("volume1,local\n", false);
+    testDockerCommandPluginWithVolumesOutput(
+        "DRIVER              VOLUME NAME\n" +
+        "nvidia-docker       nvidia_driver_375.66\n" +
+        "local               volume1\n", false);
     testDockerCommandPluginWithVolumesOutput(
         "volume_xyz,nvidia\nvolume1,local\n\n", false);
     testDockerCommandPluginWithVolumesOutput(" volume1,  local \n", false);


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[23/50] [abbrv] hadoop git commit: YARN-6599. Support anti-affinity constraint via AppPlacementAllocator. (Wangda Tan via asuresh)

Posted by as...@apache.org.
http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
index 73b4f9e..24c5a5e 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
@@ -20,6 +20,8 @@ package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
 import java.util.Iterator;
 import java.util.Set;
 
+import org.apache.commons.logging.Log;
+import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.classification.InterfaceAudience.Public;
 import org.apache.hadoop.classification.InterfaceStability.Unstable;
 import org.apache.hadoop.yarn.api.records.ApplicationId;
@@ -30,9 +32,12 @@ import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression.TargetType;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations.SingleConstraintTransformer;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.DefaultPlacementAlgorithm;
 
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE_PARTITION;
+
 /**
  * This class contains various static methods used by the Placement Algorithms
  * to simplify constrained placement.
@@ -41,16 +46,20 @@ import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algori
 @Public
 @Unstable
 public final class PlacementConstraintsUtil {
+  private static final Log LOG =
+      LogFactory.getLog(PlacementConstraintsUtil.class);
 
   // Suppresses default constructor, ensuring non-instantiability.
   private PlacementConstraintsUtil() {
   }
 
   /**
-   * Returns true if **single** application constraint with associated
+   * Returns true if **single** placement constraint with associated
    * allocationTags and scope is satisfied by a specific scheduler Node.
    *
-   * @param appId the application id
+   * @param targetApplicationId the application id, which could be override by
+   *                           target application id specified inside allocation
+   *                           tags.
    * @param sc the placement constraint
    * @param te the target expression
    * @param node the scheduler node
@@ -59,32 +68,123 @@ public final class PlacementConstraintsUtil {
    * @throws InvalidAllocationTagsQueryException
    */
   private static boolean canSatisfySingleConstraintExpression(
-      ApplicationId appId, SingleConstraint sc, TargetExpression te,
-      SchedulerNode node, AllocationTagsManager tm)
+      ApplicationId targetApplicationId, SingleConstraint sc,
+      TargetExpression te, SchedulerNode node, AllocationTagsManager tm)
       throws InvalidAllocationTagsQueryException {
     long minScopeCardinality = 0;
     long maxScopeCardinality = 0;
+    
+    // Optimizations to only check cardinality if necessary.
+    int desiredMinCardinality = sc.getMinCardinality();
+    int desiredMaxCardinality = sc.getMaxCardinality();
+    boolean checkMinCardinality = desiredMinCardinality > 0;
+    boolean checkMaxCardinality = desiredMaxCardinality < Integer.MAX_VALUE;
+
     if (sc.getScope().equals(PlacementConstraints.NODE)) {
-      minScopeCardinality = tm.getNodeCardinalityByOp(node.getNodeID(), appId,
-          te.getTargetValues(), Long::max);
-      maxScopeCardinality = tm.getNodeCardinalityByOp(node.getNodeID(), appId,
-          te.getTargetValues(), Long::min);
+      if (checkMinCardinality) {
+        minScopeCardinality = tm.getNodeCardinalityByOp(node.getNodeID(),
+            targetApplicationId, te.getTargetValues(), Long::max);
+      }
+      if (checkMaxCardinality) {
+        maxScopeCardinality = tm.getNodeCardinalityByOp(node.getNodeID(),
+            targetApplicationId, te.getTargetValues(), Long::min);
+      }
     } else if (sc.getScope().equals(PlacementConstraints.RACK)) {
-      minScopeCardinality = tm.getRackCardinalityByOp(node.getRackName(), appId,
-          te.getTargetValues(), Long::max);
-      maxScopeCardinality = tm.getRackCardinalityByOp(node.getRackName(), appId,
-          te.getTargetValues(), Long::min);
+      if (checkMinCardinality) {
+        minScopeCardinality = tm.getRackCardinalityByOp(node.getRackName(),
+            targetApplicationId, te.getTargetValues(), Long::max);
+      }
+      if (checkMaxCardinality) {
+        maxScopeCardinality = tm.getRackCardinalityByOp(node.getRackName(),
+            targetApplicationId, te.getTargetValues(), Long::min);
+      }
     }
     // Make sure Anti-affinity satisfies hard upper limit
-    maxScopeCardinality = sc.getMaxCardinality() == 0 ? maxScopeCardinality - 1
+    maxScopeCardinality = desiredMaxCardinality == 0 ? maxScopeCardinality - 1
         : maxScopeCardinality;
 
-    return (minScopeCardinality >= sc.getMinCardinality()
-        && maxScopeCardinality < sc.getMaxCardinality());
+    return (desiredMinCardinality <= 0
+        || minScopeCardinality >= desiredMinCardinality) && (
+        desiredMaxCardinality == Integer.MAX_VALUE
+            || maxScopeCardinality < desiredMaxCardinality);
+  }
+
+  private static boolean canSatisfyNodePartitionConstraintExpresssion(
+      TargetExpression targetExpression, SchedulerNode schedulerNode) {
+    Set<String> values = targetExpression.getTargetValues();
+    if (values == null || values.isEmpty()) {
+      return schedulerNode.getPartition().equals(
+          RMNodeLabelsManager.NO_LABEL);
+    } else{
+      String nodePartition = values.iterator().next();
+      if (!nodePartition.equals(schedulerNode.getPartition())) {
+        return false;
+      }
+    }
+
+    return true;
+  }
+
+  private static boolean canSatisfySingleConstraint(ApplicationId applicationId,
+      SingleConstraint singleConstraint, SchedulerNode schedulerNode,
+      AllocationTagsManager tagsManager)
+      throws InvalidAllocationTagsQueryException {
+    // Iterate through TargetExpressions
+    Iterator<TargetExpression> expIt =
+        singleConstraint.getTargetExpressions().iterator();
+    while (expIt.hasNext()) {
+      TargetExpression currentExp = expIt.next();
+      // Supporting AllocationTag Expressions for now
+      if (currentExp.getTargetType().equals(TargetType.ALLOCATION_TAG)) {
+        // Check if conditions are met
+        if (!canSatisfySingleConstraintExpression(applicationId,
+            singleConstraint, currentExp, schedulerNode, tagsManager)) {
+          return false;
+        }
+      } else if (currentExp.getTargetType().equals(TargetType.NODE_ATTRIBUTE)
+          && currentExp.getTargetKey().equals(NODE_PARTITION)) {
+        // This is a node partition expression, check it.
+        canSatisfyNodePartitionConstraintExpresssion(currentExp, schedulerNode);
+      }
+    }
+    // return true if all targetExpressions are satisfied
+    return true;
+  }
+
+  /**
+   * Returns true if all placement constraints are **currently** satisfied by a
+   * specific scheduler Node..
+   *
+   * To do so the method retrieves and goes through all application constraint
+   * expressions and checks if the specific allocation is between the allowed
+   * min-max cardinality values under the constraint scope (Node/Rack/etc).
+   *
+   * @param applicationId applicationId,
+   * @param placementConstraint placement constraint.
+   * @param node the scheduler node
+   * @param tagsManager the allocation tags store
+   * @return true if all application constraints are satisfied by node
+   * @throws InvalidAllocationTagsQueryException
+   */
+  public static boolean canSatisfySingleConstraint(ApplicationId applicationId,
+      PlacementConstraint placementConstraint, SchedulerNode node,
+      AllocationTagsManager tagsManager)
+      throws InvalidAllocationTagsQueryException {
+    if (placementConstraint == null) {
+      return true;
+    }
+    // Transform to SimpleConstraint
+    SingleConstraintTransformer singleTransformer =
+        new SingleConstraintTransformer(placementConstraint);
+    placementConstraint = singleTransformer.transform();
+    AbstractConstraint sConstraintExpr = placementConstraint.getConstraintExpr();
+    SingleConstraint single = (SingleConstraint) sConstraintExpr;
+
+    return canSatisfySingleConstraint(applicationId, single, node, tagsManager);
   }
 
   /**
-   * Returns true if all application constraints with associated allocationTags
+   * Returns true if all placement constraints with associated allocationTags
    * are **currently** satisfied by a specific scheduler Node.
    * To do so the method retrieves and goes through all application constraint
    * expressions and checks if the specific allocation is between the allowed
@@ -98,41 +198,12 @@ public final class PlacementConstraintsUtil {
    * @return true if all application constraints are satisfied by node
    * @throws InvalidAllocationTagsQueryException
    */
-  public static boolean canSatisfyConstraints(ApplicationId appId,
+  public static boolean canSatisfySingleConstraint(ApplicationId appId,
       Set<String> allocationTags, SchedulerNode node,
       PlacementConstraintManager pcm, AllocationTagsManager tagsManager)
       throws InvalidAllocationTagsQueryException {
     PlacementConstraint constraint = pcm.getConstraint(appId, allocationTags);
-    if (constraint == null) {
-      return true;
-    }
-    // Transform to SimpleConstraint
-    SingleConstraintTransformer singleTransformer =
-        new SingleConstraintTransformer(constraint);
-    constraint = singleTransformer.transform();
-    AbstractConstraint sConstraintExpr = constraint.getConstraintExpr();
-    SingleConstraint single = (SingleConstraint) sConstraintExpr;
-    // Iterate through TargetExpressions
-    Iterator<TargetExpression> expIt = single.getTargetExpressions().iterator();
-    while (expIt.hasNext()) {
-      TargetExpression currentExp = expIt.next();
-      // Supporting AllocationTag Expressions for now
-      if (currentExp.getTargetType().equals(TargetType.ALLOCATION_TAG)) {
-        // If source and tag allocation tags are the same, we do not enforce
-        // constraints with minimum cardinality.
-        if (currentExp.getTargetValues().equals(allocationTags)
-            && single.getMinCardinality() > 0) {
-          return true;
-        }
-        // Check if conditions are met
-        if (!canSatisfySingleConstraintExpression(appId, single, currentExp,
-            node, tagsManager)) {
-          return false;
-        }
-      }
-    }
-    // return true if all targetExpressions are satisfied
-    return true;
+    return canSatisfySingleConstraint(appId, constraint, node, tagsManager);
   }
 
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
index 9ed9ab1..eb3fe88 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
@@ -67,7 +67,7 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
       throws InvalidAllocationTagsQueryException {
     int numAllocs = schedulingRequest.getResourceSizing().getNumAllocations();
     if (numAllocs > 0) {
-      if (PlacementConstraintsUtil.canSatisfyConstraints(appId,
+      if (PlacementConstraintsUtil.canSatisfySingleConstraint(appId,
           schedulingRequest.getAllocationTags(), schedulerNode,
           constraintManager, tagsManager)) {
         return true;

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
index 8e9c79c..2a6b889 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/processor/PlacementProcessor.java
@@ -188,12 +188,18 @@ public class PlacementProcessor implements ApplicationMasterServiceProcessor {
   @Override
   public void allocate(ApplicationAttemptId appAttemptId,
       AllocateRequest request, AllocateResponse response) throws YarnException {
+    // Copy the scheduling request since we will clear it later after sending
+    // to dispatcher
     List<SchedulingRequest> schedulingRequests =
-        request.getSchedulingRequests();
+        new ArrayList<>(request.getSchedulingRequests());
     dispatchRequestsForPlacement(appAttemptId, schedulingRequests);
     reDispatchRetryableRequests(appAttemptId);
     schedulePlacedRequests(appAttemptId);
 
+    // Remove SchedulingRequest from AllocateRequest to avoid SchedulingRequest
+    // added to scheduler.
+    request.setSchedulingRequests(Collections.emptyList());
+
     nextAMSProcessor.allocate(appAttemptId, request, response);
 
     handleRejectedRequests(appAttemptId, response);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairScheduler.java
index e2a62ec..1f85814 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fair/FairScheduler.java
@@ -40,6 +40,7 @@ import org.apache.hadoop.yarn.api.records.ReservationId;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceOption;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.exceptions.YarnException;
 import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
@@ -830,9 +831,9 @@ public class FairScheduler extends
 
   @Override
   public Allocation allocate(ApplicationAttemptId appAttemptId,
-      List<ResourceRequest> ask, List<ContainerId> release,
-      List<String> blacklistAdditions, List<String> blacklistRemovals,
-      ContainerUpdates updateRequests) {
+      List<ResourceRequest> ask, List<SchedulingRequest> schedulingRequests,
+      List<ContainerId> release, List<String> blacklistAdditions,
+      List<String> blacklistRemovals, ContainerUpdates updateRequests) {
 
     // Make sure this application exists
     FSAppAttempt application = getSchedulerApp(appAttemptId);
@@ -857,7 +858,9 @@ public class FairScheduler extends
     handleContainerUpdates(application, updateRequests);
 
     // Sanity check
-    normalizeRequests(ask);
+    normalizeResourceRequests(ask);
+
+    // TODO, normalize SchedulingRequest
 
     // Record container allocation start time
     application.recordContainerRequestTime(getClock().getTime());
@@ -879,6 +882,7 @@ public class FairScheduler extends
         // Update application requests
         application.updateResourceRequests(ask);
 
+        // TODO, handle SchedulingRequest
         application.showRequests();
       }
     } finally {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/FifoScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/FifoScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/FifoScheduler.java
index 59b9608..7ac9027 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/FifoScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/fifo/FifoScheduler.java
@@ -40,6 +40,7 @@ import org.apache.hadoop.yarn.api.records.QueueState;
 import org.apache.hadoop.yarn.api.records.QueueUserACLInfo;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.exceptions.YarnRuntimeException;
 import org.apache.hadoop.yarn.factories.RecordFactory;
@@ -320,8 +321,8 @@ public class FifoScheduler extends
 
   @Override
   public Allocation allocate(ApplicationAttemptId applicationAttemptId,
-      List<ResourceRequest> ask, List<ContainerId> release,
-      List<String> blacklistAdditions, List<String> blacklistRemovals,
+      List<ResourceRequest> ask, List<SchedulingRequest> schedulingRequests,
+      List<ContainerId> release, List<String> blacklistAdditions, List<String> blacklistRemovals,
       ContainerUpdates updateRequests) {
     FifoAppAttempt application = getApplicationAttempt(applicationAttemptId);
     if (application == null) {
@@ -342,7 +343,7 @@ public class FifoScheduler extends
     }
 
     // Sanity check
-    normalizeRequests(ask);
+    normalizeResourceRequests(ask);
 
     // Release containers
     releaseContainers(release, application);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java
index 5c49450..72a6c4c 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/AppPlacementAllocator.java
@@ -19,6 +19,8 @@
 package org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement;
 
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AppSchedulingInfo;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.NodeType;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
@@ -29,7 +31,6 @@ import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
 
 import java.util.Collection;
 import java.util.Iterator;
-import java.util.List;
 import java.util.Map;
 
 /**
@@ -50,13 +51,18 @@ import java.util.Map;
  * requests.
  * </p>
  */
-public interface AppPlacementAllocator<N extends SchedulerNode> {
+public abstract class AppPlacementAllocator<N extends SchedulerNode> {
+  protected AppSchedulingInfo appSchedulingInfo;
+  protected SchedulerRequestKey schedulerRequestKey;
+  protected RMContext rmContext;
+
   /**
    * Get iterator of preferred node depends on requirement and/or availability
    * @param candidateNodeSet input CandidateNodeSet
    * @return iterator of preferred node
    */
-  Iterator<N> getPreferredNodeIterator(CandidateNodeSet<N> candidateNodeSet);
+  public abstract Iterator<N> getPreferredNodeIterator(
+      CandidateNodeSet<N> candidateNodeSet);
 
   /**
    * Replace existing pending asks by the new requests
@@ -66,15 +72,29 @@ public interface AppPlacementAllocator<N extends SchedulerNode> {
    * requests for preempted container
    * @return true if total pending resource changed
    */
-  PendingAskUpdateResult updatePendingAsk(
+  public abstract PendingAskUpdateResult updatePendingAsk(
       Collection<ResourceRequest> requests,
       boolean recoverPreemptedRequestForAContainer);
 
   /**
+   * Replace existing pending asks by the new SchedulingRequest
+   *
+   * @param schedulerRequestKey                  scheduler request key
+   * @param schedulingRequest                    new asks
+   * @param recoverPreemptedRequestForAContainer if we're recovering resource
+   *                                             requests for preempted container
+   * @return true if total pending resource changed
+   */
+  public abstract PendingAskUpdateResult updatePendingAsk(
+      SchedulerRequestKey schedulerRequestKey,
+      SchedulingRequest schedulingRequest,
+      boolean recoverPreemptedRequestForAContainer);
+
+  /**
    * Get pending ResourceRequests by given schedulerRequestKey
    * @return Map of resourceName to ResourceRequest
    */
-  Map<String, ResourceRequest> getResourceRequests();
+  public abstract Map<String, ResourceRequest> getResourceRequests();
 
   /**
    * Get pending ask for given resourceName. If there's no such pendingAsk,
@@ -83,7 +103,7 @@ public interface AppPlacementAllocator<N extends SchedulerNode> {
    * @param resourceName resourceName
    * @return PendingAsk
    */
-  PendingAsk getPendingAsk(String resourceName);
+  public abstract PendingAsk getPendingAsk(String resourceName);
 
   /**
    * Get #pending-allocations for given resourceName. If there's no such
@@ -92,7 +112,7 @@ public interface AppPlacementAllocator<N extends SchedulerNode> {
    * @param resourceName resourceName
    * @return #pending-allocations
    */
-  int getOutstandingAsksCount(String resourceName);
+  public abstract int getOutstandingAsksCount(String resourceName);
 
   /**
    * Notify container allocated.
@@ -103,7 +123,7 @@ public interface AppPlacementAllocator<N extends SchedulerNode> {
    *         the container. This will be used by scheduler to recover requests.
    *         Please refer to {@link ContainerRequest} for more details.
    */
-  ContainerRequest allocate(SchedulerRequestKey schedulerKey,
+  public abstract ContainerRequest allocate(SchedulerRequestKey schedulerKey,
       NodeType type, SchedulerNode node);
 
   /**
@@ -112,7 +132,7 @@ public interface AppPlacementAllocator<N extends SchedulerNode> {
    * @param node which node we will allocate on
    * @return true if we has pending requirement
    */
-  boolean canAllocate(NodeType type, SchedulerNode node);
+  public abstract boolean canAllocate(NodeType type, SchedulerNode node);
 
   /**
    * Can delay to give locality?
@@ -123,16 +143,16 @@ public interface AppPlacementAllocator<N extends SchedulerNode> {
    * @param resourceName resourceName
    * @return can/cannot
    */
-  boolean canDelayTo(String resourceName);
+  public abstract boolean canDelayTo(String resourceName);
 
   /**
-   * Does this {@link AppPlacementAllocator} accept resources on nodePartition?
+   * Does this {@link AppPlacementAllocator} accept resources on given node?
    *
-   * @param nodePartition nodePartition
+   * @param schedulerNode schedulerNode
    * @param schedulingMode schedulingMode
    * @return accepted/not
    */
-  boolean acceptNodePartition(String nodePartition,
+  public abstract boolean precheckNode(SchedulerNode schedulerNode,
       SchedulingMode schedulingMode);
 
   /**
@@ -142,7 +162,7 @@ public interface AppPlacementAllocator<N extends SchedulerNode> {
    *
    * @return primary requested node partition
    */
-  String getPrimaryRequestedNodePartition();
+  public abstract String getPrimaryRequestedNodePartition();
 
   /**
    * @return number of unique location asks with #pending greater than 0,
@@ -152,18 +172,24 @@ public interface AppPlacementAllocator<N extends SchedulerNode> {
    * and should belong to specific delay scheduling policy impl.
    * See YARN-7457 for more details.
    */
-  int getUniqueLocationAsks();
+  public abstract int getUniqueLocationAsks();
 
   /**
    * Print human-readable requests to LOG debug.
    */
-  void showRequests();
+  public abstract void showRequests();
 
   /**
-   * Set app scheduling info.
+   * Initialize this allocator, this will be called by Factory automatically
    *
-   * @param appSchedulingInfo
-   *          app info object.
+   * @param appSchedulingInfo appSchedulingInfo
+   * @param schedulerRequestKey schedulerRequestKey
+   * @param rmContext rmContext
    */
-  void setAppSchedulingInfo(AppSchedulingInfo appSchedulingInfo);
+  public void initialize(AppSchedulingInfo appSchedulingInfo,
+      SchedulerRequestKey schedulerRequestKey, RMContext rmContext) {
+    this.appSchedulingInfo = appSchedulingInfo;
+    this.rmContext = rmContext;
+    this.schedulerRequestKey = schedulerRequestKey;
+  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/LocalityAppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/LocalityAppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/LocalityAppPlacementAllocator.java
index be1c1cc..a0358b4 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/LocalityAppPlacementAllocator.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/LocalityAppPlacementAllocator.java
@@ -22,8 +22,9 @@ import org.apache.commons.collections.IteratorUtils;
 import org.apache.commons.logging.Log;
 import org.apache.commons.logging.LogFactory;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.exceptions.SchedulerInvalidResoureRequestException;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
-import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AppSchedulingInfo;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.NodeType;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.ResourceScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
@@ -46,26 +47,18 @@ import java.util.concurrent.locks.ReentrantReadWriteLock;
  * containers.
  */
 public class LocalityAppPlacementAllocator <N extends SchedulerNode>
-    implements AppPlacementAllocator<N> {
+    extends AppPlacementAllocator<N> {
   private static final Log LOG =
       LogFactory.getLog(LocalityAppPlacementAllocator.class);
 
   private final Map<String, ResourceRequest> resourceRequestMap =
       new ConcurrentHashMap<>();
-  private AppSchedulingInfo appSchedulingInfo;
   private volatile String primaryRequestedPartition =
       RMNodeLabelsManager.NO_LABEL;
 
   private final ReentrantReadWriteLock.ReadLock readLock;
   private final ReentrantReadWriteLock.WriteLock writeLock;
 
-  public LocalityAppPlacementAllocator(AppSchedulingInfo info) {
-    ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
-    readLock = lock.readLock();
-    writeLock = lock.writeLock();
-    this.appSchedulingInfo = info;
-  }
-
   public LocalityAppPlacementAllocator() {
     ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
     readLock = lock.readLock();
@@ -182,6 +175,19 @@ public class LocalityAppPlacementAllocator <N extends SchedulerNode>
   }
 
   @Override
+  public PendingAskUpdateResult updatePendingAsk(
+      SchedulerRequestKey schedulerRequestKey,
+      SchedulingRequest schedulingRequest,
+      boolean recoverPreemptedRequestForAContainer)
+      throws SchedulerInvalidResoureRequestException {
+    throw new SchedulerInvalidResoureRequestException(this.getClass().getName()
+        + " not be able to handle SchedulingRequest, there exists a "
+        + "ResourceRequest with the same scheduler key=" + schedulerRequestKey
+        + ", please send SchedulingRequest with a different allocationId and "
+        + "priority");
+  }
+
+  @Override
   public Map<String, ResourceRequest> getResourceRequests() {
     return resourceRequestMap;
   }
@@ -362,13 +368,13 @@ public class LocalityAppPlacementAllocator <N extends SchedulerNode>
   }
 
   @Override
-  public boolean acceptNodePartition(String nodePartition,
+  public boolean precheckNode(SchedulerNode schedulerNode,
       SchedulingMode schedulingMode) {
     // We will only look at node label = nodeLabelToLookAt according to
     // schedulingMode and partition of node.
     String nodePartitionToLookAt;
     if (schedulingMode == SchedulingMode.RESPECT_PARTITION_EXCLUSIVITY) {
-      nodePartitionToLookAt = nodePartition;
+      nodePartitionToLookAt = schedulerNode.getPartition();
     } else {
       nodePartitionToLookAt = RMNodeLabelsManager.NO_LABEL;
     }
@@ -425,9 +431,4 @@ public class LocalityAppPlacementAllocator <N extends SchedulerNode>
       writeLock.unlock();
     }
   }
-
-  @Override
-  public void setAppSchedulingInfo(AppSchedulingInfo appSchedulingInfo) {
-    this.appSchedulingInfo = appSchedulingInfo;
-  }
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
new file mode 100644
index 0000000..f8f758c
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/placement/SingleConstraintAppPlacementAllocator.java
@@ -0,0 +1,531 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.placement;
+
+import com.google.common.annotations.VisibleForTesting;
+import org.apache.commons.collections.IteratorUtils;
+import org.apache.commons.logging.Log;
+import org.apache.commons.logging.LogFactory;
+import org.apache.hadoop.util.StringUtils;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.ExecutionType;
+import org.apache.hadoop.yarn.api.records.ResourceRequest;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
+import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.records.impl.pb.SchedulingRequestPBImpl;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.exceptions.SchedulerInvalidResoureRequestException;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AppSchedulingInfo;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.NodeType;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.SchedulingMode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.ContainerRequest;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.PendingAsk;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintsUtil;
+import org.apache.hadoop.yarn.server.scheduler.SchedulerRequestKey;
+
+import java.util.Collection;
+import java.util.Collections;
+import java.util.HashSet;
+import java.util.Iterator;
+import java.util.Map;
+import java.util.Set;
+import java.util.concurrent.locks.ReentrantReadWriteLock;
+
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.APPLICATION_LABEL_INTRA_APPLICATION;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE_PARTITION;
+
+/**
+ * This is a simple implementation to do affinity or anti-affinity for
+ * inter/intra apps.
+ */
+public class SingleConstraintAppPlacementAllocator<N extends SchedulerNode>
+    extends AppPlacementAllocator<N> {
+  private static final Log LOG =
+      LogFactory.getLog(SingleConstraintAppPlacementAllocator.class);
+
+  private ReentrantReadWriteLock.ReadLock readLock;
+  private ReentrantReadWriteLock.WriteLock writeLock;
+
+  private SchedulingRequest schedulingRequest = null;
+  private String targetNodePartition;
+  private Set<String> targetAllocationTags;
+  private AllocationTagsManager allocationTagsManager;
+
+  public SingleConstraintAppPlacementAllocator() {
+    ReentrantReadWriteLock lock = new ReentrantReadWriteLock();
+    readLock = lock.readLock();
+    writeLock = lock.writeLock();
+  }
+
+  @Override
+  @SuppressWarnings("unchecked")
+  public Iterator<N> getPreferredNodeIterator(
+      CandidateNodeSet<N> candidateNodeSet) {
+    // Now only handle the case that single node in the candidateNodeSet
+    // TODO, Add support to multi-hosts inside candidateNodeSet which is passed
+    // in.
+
+    N singleNode = CandidateNodeSetUtils.getSingleNode(candidateNodeSet);
+    if (null != singleNode) {
+      return IteratorUtils.singletonIterator(singleNode);
+    }
+
+    return IteratorUtils.emptyIterator();
+  }
+
+  @Override
+  public PendingAskUpdateResult updatePendingAsk(
+      Collection<ResourceRequest> requests,
+      boolean recoverPreemptedRequestForAContainer) {
+    if (requests != null && !requests.isEmpty()) {
+      throw new SchedulerInvalidResoureRequestException(
+          this.getClass().getName()
+              + " not be able to handle ResourceRequest, there exists a "
+              + "SchedulingRequest with the same scheduler key="
+              + SchedulerRequestKey.create(requests.iterator().next())
+              + ", please send ResourceRequest with a different allocationId and "
+              + "priority");
+    }
+
+    // Do nothing
+    return null;
+  }
+
+  private PendingAskUpdateResult internalUpdatePendingAsk(
+      SchedulingRequest newSchedulingRequest, boolean recoverContainer) {
+    // When it is a recover container, there must exists an schedulingRequest.
+    if (recoverContainer && schedulingRequest == null) {
+      throw new SchedulerInvalidResoureRequestException("Trying to recover a "
+          + "container request=" + newSchedulingRequest.toString() + ", however"
+          + "there's no existing scheduling request, this should not happen.");
+    }
+
+    if (schedulingRequest != null) {
+      // If we have an old scheduling request, we will make sure that no changes
+      // made except sizing.
+      // To avoid unnecessary copy of the data structure, we do this by
+      // replacing numAllocations with old numAllocations in the
+      // newSchedulingRequest#getResourceSizing, and compare the two objects.
+      ResourceSizing sizing = newSchedulingRequest.getResourceSizing();
+      int existingNumAllocations =
+          schedulingRequest.getResourceSizing().getNumAllocations();
+
+      // When it is a recovered container request, just set
+      // #newAllocations = #existingAllocations + 1;
+      int newNumAllocations;
+      if (recoverContainer) {
+        newNumAllocations = existingNumAllocations + 1;
+      } else {
+        newNumAllocations = sizing.getNumAllocations();
+      }
+      sizing.setNumAllocations(existingNumAllocations);
+
+      // Compare two objects
+      if (!schedulingRequest.equals(newSchedulingRequest)) {
+        // Rollback #numAllocations
+        sizing.setNumAllocations(newNumAllocations);
+        throw new SchedulerInvalidResoureRequestException(
+            "Invalid updated SchedulingRequest added to scheduler, "
+                + " we only allows changing numAllocations for the updated "
+                + "SchedulingRequest. Old=" + schedulingRequest.toString()
+                + " new=" + newSchedulingRequest.toString()
+                + ", if any fields need to be updated, please cancel the "
+                + "old request (by setting numAllocations to 0) and send a "
+                + "SchedulingRequest with different combination of "
+                + "priority/allocationId");
+      } else {
+        if (newNumAllocations == existingNumAllocations) {
+          // No update on pending asks, return null.
+          return null;
+        }
+      }
+
+      // Rollback #numAllocations
+      sizing.setNumAllocations(newNumAllocations);
+
+      // Basic sanity check
+      if (newNumAllocations < 0) {
+        throw new SchedulerInvalidResoureRequestException(
+            "numAllocation in ResourceSizing field must be >= 0, "
+                + "updating schedulingRequest failed.");
+      }
+
+      PendingAskUpdateResult updateResult = new PendingAskUpdateResult(
+          new PendingAsk(schedulingRequest.getResourceSizing()),
+          new PendingAsk(newSchedulingRequest.getResourceSizing()),
+          targetNodePartition, targetNodePartition);
+
+      // Ok, now everything is same except numAllocation, update numAllocation.
+      this.schedulingRequest.getResourceSizing().setNumAllocations(
+          newNumAllocations);
+      LOG.info(
+          "Update numAllocation from old=" + existingNumAllocations + " to new="
+              + newNumAllocations);
+
+      return updateResult;
+    }
+
+    // For a new schedulingRequest, we need to validate if we support its asks.
+    // This will update internal partitions, etc. after the SchedulingRequest is
+    // valid.
+    validateAndSetSchedulingRequest(newSchedulingRequest);
+
+    return new PendingAskUpdateResult(null,
+        new PendingAsk(newSchedulingRequest.getResourceSizing()), null,
+        targetNodePartition);
+  }
+
+  @Override
+  public PendingAskUpdateResult updatePendingAsk(
+      SchedulerRequestKey schedulerRequestKey,
+      SchedulingRequest newSchedulingRequest,
+      boolean recoverPreemptedRequestForAContainer) {
+    writeLock.lock();
+    try {
+      return internalUpdatePendingAsk(newSchedulingRequest,
+          recoverPreemptedRequestForAContainer);
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  private String throwExceptionWithMetaInfo(String message) {
+    StringBuilder sb = new StringBuilder();
+    sb.append("AppId=").append(appSchedulingInfo.getApplicationId()).append(
+        " Key=").append(this.schedulerRequestKey).append(". Exception message:")
+        .append(message);
+    throw new SchedulerInvalidResoureRequestException(sb.toString());
+  }
+
+  private void validateAndSetSchedulingRequest(SchedulingRequest newSchedulingRequest)
+      throws SchedulerInvalidResoureRequestException {
+    // Check sizing exists
+    if (newSchedulingRequest.getResourceSizing() == null
+        || newSchedulingRequest.getResourceSizing().getResources() == null) {
+      throwExceptionWithMetaInfo(
+          "No ResourceSizing found in the scheduling request, please double "
+              + "check");
+    }
+
+    // Check execution type == GUARANTEED
+    if (newSchedulingRequest.getExecutionType() != null
+        && newSchedulingRequest.getExecutionType().getExecutionType()
+        != ExecutionType.GUARANTEED) {
+      throwExceptionWithMetaInfo(
+          "Only GUARANTEED execution type is supported.");
+    }
+
+    PlacementConstraint constraint =
+        newSchedulingRequest.getPlacementConstraint();
+
+    // We only accept SingleConstraint
+    PlacementConstraint.AbstractConstraint ac = constraint.getConstraintExpr();
+    if (!(ac instanceof PlacementConstraint.SingleConstraint)) {
+      throwExceptionWithMetaInfo(
+          "Only accepts " + PlacementConstraint.SingleConstraint.class.getName()
+              + " as constraint-expression. Rejecting the new added "
+              + "constraint-expression.class=" + ac.getClass().getName());
+    }
+
+    PlacementConstraint.SingleConstraint singleConstraint =
+        (PlacementConstraint.SingleConstraint) ac;
+
+    // Make sure it is an anti-affinity request (actually this implementation
+    // should be able to support both affinity / anti-affinity without much
+    // effort. Considering potential test effort required. Limit to
+    // anti-affinity to intra-app and scope is node.
+    if (!singleConstraint.getScope().equals(PlacementConstraints.NODE)) {
+      throwExceptionWithMetaInfo(
+          "Only support scope=" + PlacementConstraints.NODE
+              + "now. PlacementConstraint=" + singleConstraint);
+    }
+
+    if (singleConstraint.getMinCardinality() != 0
+        || singleConstraint.getMaxCardinality() != 1) {
+      throwExceptionWithMetaInfo(
+          "Only support anti-affinity, which is: minCardinality=0, "
+              + "maxCardinality=1");
+    }
+
+    Set<PlacementConstraint.TargetExpression> targetExpressionSet =
+        singleConstraint.getTargetExpressions();
+    if (targetExpressionSet == null || targetExpressionSet.isEmpty()) {
+      throwExceptionWithMetaInfo(
+          "TargetExpression should not be null or empty");
+    }
+
+    // Set node partition
+    String nodePartition = null;
+
+    // Target allocation tags
+    Set<String> targetAllocationTags = null;
+
+    for (PlacementConstraint.TargetExpression targetExpression : targetExpressionSet) {
+      // Handle node partition
+      if (targetExpression.getTargetType().equals(
+          PlacementConstraint.TargetExpression.TargetType.NODE_ATTRIBUTE)) {
+        // For node attribute target, we only support Partition now. And once
+        // YARN-3409 is merged, we will support node attribute.
+        if (!targetExpression.getTargetKey().equals(NODE_PARTITION)) {
+          throwExceptionWithMetaInfo("When TargetType="
+              + PlacementConstraint.TargetExpression.TargetType.NODE_ATTRIBUTE
+              + " only " + NODE_PARTITION + " is accepted as TargetKey.");
+        }
+
+        if (nodePartition != null) {
+          // This means we have duplicated node partition entry inside placement
+          // constraint, which might be set by mistake.
+          throwExceptionWithMetaInfo(
+              "Only one node partition targetExpression is allowed");
+        }
+
+        Set<String> values = targetExpression.getTargetValues();
+        if (values == null || values.isEmpty()) {
+          nodePartition = RMNodeLabelsManager.NO_LABEL;
+          continue;
+        }
+
+        if (values.size() > 1) {
+          throwExceptionWithMetaInfo("Inside one targetExpression, we only "
+              + "support affinity to at most one node partition now");
+        }
+
+        nodePartition = values.iterator().next();
+      } else if (targetExpression.getTargetType().equals(
+          PlacementConstraint.TargetExpression.TargetType.ALLOCATION_TAG)) {
+        // Handle allocation tags
+        if (targetAllocationTags != null) {
+          // This means we have duplicated AllocationTag expressions entries
+          // inside placement constraint, which might be set by mistake.
+          throwExceptionWithMetaInfo(
+              "Only one AllocationTag targetExpression is allowed");
+        }
+
+        if (targetExpression.getTargetValues() == null || targetExpression
+            .getTargetValues().isEmpty()) {
+          throwExceptionWithMetaInfo("Failed to find allocation tags from "
+              + "TargetExpressions or couldn't find self-app target.");
+        }
+
+        targetAllocationTags = new HashSet<>(
+            targetExpression.getTargetValues());
+
+        if (targetExpression.getTargetKey() == null || !targetExpression
+            .getTargetKey().equals(APPLICATION_LABEL_INTRA_APPLICATION)) {
+          throwExceptionWithMetaInfo(
+              "As of now, the only accepted target key for targetKey of "
+                  + "allocation_tag target expression is: ["
+                  + APPLICATION_LABEL_INTRA_APPLICATION
+                  + "]. Please make changes to placement constraints "
+                  + "accordingly.");
+        }
+      }
+    }
+
+    if (targetAllocationTags == null) {
+      // That means we don't have ALLOCATION_TAG specified
+      throwExceptionWithMetaInfo(
+          "Couldn't find target expression with type == ALLOCATION_TAG, it is "
+              + "required to include one and only one target expression with "
+              + "type == ALLOCATION_TAG");
+
+    }
+
+    if (nodePartition == null) {
+      nodePartition = RMNodeLabelsManager.NO_LABEL;
+    }
+
+    // Validation is done. set local results:
+    this.targetNodePartition = nodePartition;
+    this.targetAllocationTags = targetAllocationTags;
+
+    this.schedulingRequest = new SchedulingRequestPBImpl(
+        ((SchedulingRequestPBImpl) newSchedulingRequest).getProto());
+
+    LOG.info("Successfully added SchedulingRequest to app=" + appSchedulingInfo
+        .getApplicationAttemptId() + " targetAllocationTags=[" + StringUtils
+        .join(",", targetAllocationTags) + "]. nodePartition="
+        + targetNodePartition);
+  }
+
+  @Override
+  @SuppressWarnings("unchecked")
+  public Map<String, ResourceRequest> getResourceRequests() {
+    return Collections.EMPTY_MAP;
+  }
+
+  @Override
+  public PendingAsk getPendingAsk(String resourceName) {
+    readLock.lock();
+    try {
+      if (resourceName.equals("*") && schedulingRequest != null) {
+        return new PendingAsk(schedulingRequest.getResourceSizing());
+      }
+      return PendingAsk.ZERO;
+    } finally {
+      readLock.unlock();
+    }
+
+  }
+
+  @Override
+  public int getOutstandingAsksCount(String resourceName) {
+    readLock.lock();
+    try {
+      if (resourceName.equals("*") && schedulingRequest != null) {
+        return schedulingRequest.getResourceSizing().getNumAllocations();
+      }
+      return 0;
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  private void decreasePendingNumAllocation() {
+    // Deduct pending #allocations by 1
+    ResourceSizing sizing = schedulingRequest.getResourceSizing();
+    sizing.setNumAllocations(sizing.getNumAllocations() - 1);
+  }
+
+  @Override
+  public ContainerRequest allocate(SchedulerRequestKey schedulerKey,
+      NodeType type, SchedulerNode node) {
+    writeLock.lock();
+    try {
+      // Per container scheduling request, it is just a copy of existing
+      // scheduling request with #allocations=1
+      SchedulingRequest containerSchedulingRequest = new SchedulingRequestPBImpl(
+          ((SchedulingRequestPBImpl) schedulingRequest).getProto());
+      containerSchedulingRequest.getResourceSizing().setNumAllocations(1);
+
+      // Deduct sizing
+      decreasePendingNumAllocation();
+
+      return new ContainerRequest(containerSchedulingRequest);
+    } finally {
+      writeLock.unlock();
+    }
+  }
+
+  private boolean checkCardinalityAndPending(SchedulerNode node) {
+    // Do we still have pending resource?
+    if (schedulingRequest.getResourceSizing().getNumAllocations() <= 0) {
+      return false;
+    }
+
+    // node type will be ignored.
+    try {
+      return PlacementConstraintsUtil.canSatisfySingleConstraint(
+          appSchedulingInfo.getApplicationId(),
+          this.schedulingRequest.getPlacementConstraint(), node,
+          allocationTagsManager);
+    } catch (InvalidAllocationTagsQueryException e) {
+      LOG.warn("Failed to query node cardinality:", e);
+      return false;
+    }
+  }
+
+  @Override
+  public boolean canAllocate(NodeType type, SchedulerNode node) {
+    try {
+      readLock.lock();
+      return checkCardinalityAndPending(node);
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  @Override
+  public boolean canDelayTo(String resourceName) {
+    return true;
+  }
+
+  @Override
+  public boolean precheckNode(SchedulerNode schedulerNode,
+      SchedulingMode schedulingMode) {
+    // We will only look at node label = nodeLabelToLookAt according to
+    // schedulingMode and partition of node.
+    String nodePartitionToLookAt;
+    if (schedulingMode == SchedulingMode.RESPECT_PARTITION_EXCLUSIVITY) {
+      nodePartitionToLookAt = schedulerNode.getPartition();
+    } else{
+      nodePartitionToLookAt = RMNodeLabelsManager.NO_LABEL;
+    }
+
+    readLock.lock();
+    try {
+      // Check node partition as well as cardinality/pending resources.
+      return this.targetNodePartition.equals(nodePartitionToLookAt)
+          && checkCardinalityAndPending(schedulerNode);
+    } finally {
+      readLock.unlock();
+    }
+
+  }
+
+  @Override
+  public String getPrimaryRequestedNodePartition() {
+    return targetNodePartition;
+  }
+
+  @Override
+  public int getUniqueLocationAsks() {
+    return 1;
+  }
+
+  @Override
+  public void showRequests() {
+    try {
+      readLock.lock();
+      if (schedulingRequest != null) {
+        LOG.info(schedulingRequest.toString());
+      }
+    } finally {
+      readLock.unlock();
+    }
+  }
+
+  @VisibleForTesting
+  SchedulingRequest getSchedulingRequest() {
+    return schedulingRequest;
+  }
+
+  @VisibleForTesting
+  String getTargetNodePartition() {
+    return targetNodePartition;
+  }
+
+  @VisibleForTesting
+  Set<String> getTargetAllocationTags() {
+    return targetAllocationTags;
+  }
+
+  @Override
+  public void initialize(AppSchedulingInfo appSchedulingInfo,
+      SchedulerRequestKey schedulerRequestKey, RMContext rmContext) {
+    super.initialize(appSchedulingInfo, schedulerRequestKey, rmContext);
+    this.allocationTagsManager = rmContext.getAllocationTagsManager();
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/Application.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/Application.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/Application.java
index fbde681..7d1140d 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/Application.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/Application.java
@@ -331,8 +331,7 @@ public class Application {
     
     // Get resources from the ResourceManager
     Allocation allocation = resourceManager.getResourceScheduler().allocate(
-        applicationAttemptId, new ArrayList<ResourceRequest>(ask),
-        new ArrayList<ContainerId>(), null, null,
+        applicationAttemptId, new ArrayList<ResourceRequest>(ask), null, new ArrayList<ContainerId>(), null, null,
         new ContainerUpdates());
 
     if (LOG.isInfoEnabled()) {
@@ -431,7 +430,7 @@ public class Application {
     if (type == NodeType.NODE_LOCAL) {
       for (String host : task.getHosts()) {
         if(LOG.isDebugEnabled()) {
-          LOG.debug("updatePendingAsk:" + " application=" + applicationId
+          LOG.debug("updateResourceDemands:" + " application=" + applicationId
             + " type=" + type + " host=" + host
             + " request=" + ((requests == null) ? "null" : requests.get(host)));
         }
@@ -442,7 +441,7 @@ public class Application {
     if (type == NodeType.NODE_LOCAL || type == NodeType.RACK_LOCAL) {
       for (String rack : task.getRacks()) {
         if(LOG.isDebugEnabled()) {
-          LOG.debug("updatePendingAsk:" + " application=" + applicationId
+          LOG.debug("updateResourceDemands:" + " application=" + applicationId
             + " type=" + type + " rack=" + rack
             + " request=" + ((requests == null) ? "null" : requests.get(rack)));
         }
@@ -453,7 +452,7 @@ public class Application {
     updateResourceRequest(requests.get(ResourceRequest.ANY));
     
     if(LOG.isDebugEnabled()) {
-      LOG.debug("updatePendingAsk:" + " application=" + applicationId
+      LOG.debug("updateResourceDemands:" + " application=" + applicationId
         + " #asks=" + ask.size());
     }
   }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
index 975abe6..9fa2c40 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/MockAM.java
@@ -21,6 +21,7 @@ package org.apache.hadoop.yarn.server.resourcemanager;
 import java.lang.reflect.UndeclaredThrowableException;
 import java.security.PrivilegedExceptionAction;
 import java.util.ArrayList;
+import java.util.Arrays;
 import java.util.HashMap;
 import java.util.List;
 import java.util.Map;
@@ -37,14 +38,17 @@ import org.apache.hadoop.yarn.api.protocolrecords.RegisterApplicationMasterRespo
 import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
 import org.apache.hadoop.yarn.api.records.Container;
 import org.apache.hadoop.yarn.api.records.ContainerId;
+import org.apache.hadoop.yarn.api.records.ExecutionType;
 import org.apache.hadoop.yarn.api.records.FinalApplicationStatus;
 import org.apache.hadoop.yarn.api.records.Priority;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceRequest;
 import org.apache.hadoop.yarn.api.records.ExecutionTypeRequest;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.api.records.UpdateContainerRequest;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.security.AMRMTokenIdentifier;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.attempt.RMAppAttempt;
@@ -281,6 +285,53 @@ public class MockAM {
     }
     return allocate(req);
   }
+
+  public AllocateResponse allocate(List<ResourceRequest> resourceRequest,
+      List<SchedulingRequest> newSchedulingRequests, List<ContainerId> releases)
+      throws Exception {
+    final AllocateRequest req =
+        AllocateRequest.newInstance(0, 0F, resourceRequest,
+            releases, null);
+    if (newSchedulingRequests != null) {
+      addSchedulingRequest(newSchedulingRequests);
+    }
+    if (!schedulingRequests.isEmpty()) {
+      req.setSchedulingRequests(schedulingRequests);
+      schedulingRequests.clear();
+    }
+    return allocate(req);
+  }
+
+  public AllocateResponse allocateIntraAppAntiAffinity(
+      ResourceSizing resourceSizing, Priority priority, long allocationId,
+      Set<String> allocationTags, String... targetTags) throws Exception {
+    return this.allocate(null,
+        Arrays.asList(SchedulingRequest.newBuilder().executionType(
+            ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+            .allocationRequestId(allocationId).priority(priority)
+            .allocationTags(allocationTags).placementConstraintExpression(
+                PlacementConstraints
+                    .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                        PlacementConstraints.PlacementTargets
+                            .allocationTagToIntraApp(targetTags)).build())
+            .resourceSizing(resourceSizing).build()), null);
+  }
+
+  public AllocateResponse allocateIntraAppAntiAffinity(
+      String nodePartition, ResourceSizing resourceSizing, Priority priority,
+      long allocationId, String... tags) throws Exception {
+    return this.allocate(null,
+        Arrays.asList(SchedulingRequest.newBuilder().executionType(
+            ExecutionTypeRequest.newInstance(ExecutionType.GUARANTEED))
+            .allocationRequestId(allocationId).priority(priority)
+            .placementConstraintExpression(PlacementConstraints
+                .targetCardinality(PlacementConstraints.NODE, 0, 1,
+                    PlacementConstraints.PlacementTargets
+                        .allocationTagToIntraApp(tags),
+                    PlacementConstraints.PlacementTargets
+                        .nodePartition(nodePartition)).build())
+            .resourceSizing(resourceSizing).build()), null);
+  }
   
   public AllocateResponse sendContainerResizingRequest(
       List<UpdateContainerRequest> updateRequests) throws Exception {

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/TestRMAppAttemptTransitions.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/TestRMAppAttemptTransitions.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/TestRMAppAttemptTransitions.java
index 0e4f308..4a5c671 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/TestRMAppAttemptTransitions.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmapp/attempt/TestRMAppAttemptTransitions.java
@@ -474,7 +474,7 @@ public class TestRMAppAttemptTransitions {
 
     assertEquals(expectedState, applicationAttempt.getAppAttemptState());
     verify(scheduler, times(expectedAllocateCount)).allocate(
-        any(ApplicationAttemptId.class), any(List.class), any(List.class),
+        any(ApplicationAttemptId.class), any(List.class), eq(null), any(List.class),
         any(List.class), any(List.class), any(ContainerUpdates.class));
 
     assertEquals(0,applicationAttempt.getJustFinishedContainers().size());
@@ -495,7 +495,7 @@ public class TestRMAppAttemptTransitions {
     // Check events
     verify(applicationMasterLauncher).handle(any(AMLauncherEvent.class));
     verify(scheduler, times(2)).allocate(any(ApplicationAttemptId.class),
-        any(List.class), any(List.class), any(List.class), any(List.class),
+        any(List.class), any(List.class), any(List.class), any(List.class), any(List.class),
         any(ContainerUpdates.class));
     verify(nmTokenManager).clearNodeSetForAttempt(
       applicationAttempt.getAppAttemptId());
@@ -643,7 +643,7 @@ public class TestRMAppAttemptTransitions {
     when(allocation.getContainers()).
         thenReturn(Collections.singletonList(container));
     when(scheduler.allocate(any(ApplicationAttemptId.class), any(List.class),
-        any(List.class), any(List.class), any(List.class),
+        any(List.class), any(List.class), any(List.class), any(List.class),
         any(ContainerUpdates.class))).
     thenReturn(allocation);
     RMContainer rmContainer = mock(RMContainerImpl.class);
@@ -1161,7 +1161,7 @@ public class TestRMAppAttemptTransitions {
     when(allocation.getContainers()).
         thenReturn(Collections.singletonList(amContainer));
     when(scheduler.allocate(any(ApplicationAttemptId.class), any(List.class),
-        any(List.class), any(List.class), any(List.class),
+        any(List.class), any(List.class), any(List.class), any(List.class),
         any(ContainerUpdates.class)))
         .thenReturn(allocation);
     RMContainer rmContainer = mock(RMContainerImpl.class);
@@ -1636,7 +1636,7 @@ public class TestRMAppAttemptTransitions {
   public void testScheduleTransitionReplaceAMContainerRequestWithDefaults() {
     YarnScheduler mockScheduler = mock(YarnScheduler.class);
     when(mockScheduler.allocate(any(ApplicationAttemptId.class),
-        any(List.class), any(List.class), any(List.class), any(List.class),
+        any(List.class), any(List.class), any(List.class), any(List.class), any(List.class),
         any(ContainerUpdates.class)))
         .thenAnswer(new Answer<Allocation>() {
 

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
index b927870..2bf6a21 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/rmcontainer/TestRMContainerImpl.java
@@ -33,6 +33,7 @@ import java.util.ArrayList;
 import java.util.concurrent.ConcurrentHashMap;
 import java.util.concurrent.ConcurrentMap;
 
+import com.google.common.collect.ImmutableSet;
 import org.apache.hadoop.conf.Configuration;
 import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
 import org.apache.hadoop.yarn.api.records.ApplicationId;
@@ -420,9 +421,10 @@ public class TestRMContainerImpl {
     when(rmContext.getYarnConfiguration()).thenReturn(conf);
 
     /* First container: ALLOCATED -> KILLED */
-    RMContainer rmContainer = new RMContainerImpl(container,
+    RMContainerImpl rmContainer = new RMContainerImpl(container,
         SchedulerRequestKey.extractFrom(container), appAttemptId,
         nodeId, "user", rmContext);
+    rmContainer.setAllocationTags(ImmutableSet.of("mapper"));
 
     Assert.assertEquals(0,
         tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
@@ -448,6 +450,7 @@ public class TestRMContainerImpl {
     Assert.assertEquals(0,
         tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));
 
+    rmContainer.setAllocationTags(ImmutableSet.of("mapper"));
     rmContainer.handle(new RMContainerEvent(containerId,
         RMContainerEventType.START));
 
@@ -468,6 +471,7 @@ public class TestRMContainerImpl {
     rmContainer = new RMContainerImpl(container,
         SchedulerRequestKey.extractFrom(container), appAttemptId,
         nodeId, "user", rmContext);
+    rmContainer.setAllocationTags(ImmutableSet.of("mapper"));
 
     Assert.assertEquals(0,
         tagsManager.getNodeCardinalityByOp(nodeId, appId, null, Long::max));

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/TestAppSchedulingInfo.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/TestAppSchedulingInfo.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/TestAppSchedulingInfo.java
index 3692b29..b7b0eb7 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/TestAppSchedulingInfo.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/TestAppSchedulingInfo.java
@@ -46,7 +46,7 @@ public class TestAppSchedulingInfo {
     doReturn("test").when(queue).getQueueName();
     AppSchedulingInfo appSchedulingInfo = new AppSchedulingInfo(appAttemptId,
         "test", queue, null, 0, new ResourceUsage(),
-        new HashMap<String, String>());
+        new HashMap<String, String>(), null);
 
     appSchedulingInfo.updatePlacesBlacklistedByApp(new ArrayList<String>(),
         new ArrayList<String>());
@@ -118,7 +118,7 @@ public class TestAppSchedulingInfo {
     doReturn(mock(QueueMetrics.class)).when(queue).getMetrics();
     AppSchedulingInfo  info = new AppSchedulingInfo(
         appAttemptId, "test", queue, mock(ActiveUsersManager.class), 0,
-        new ResourceUsage(), new HashMap<String, String>());
+        new ResourceUsage(), new HashMap<>(), null);
     Assert.assertEquals(0, info.getSchedulerKeys().size());
 
     Priority pri1 = Priority.newInstance(1);

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerTestBase.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerTestBase.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerTestBase.java
new file mode 100644
index 0000000..5cea3a2
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/CapacitySchedulerTestBase.java
@@ -0,0 +1,79 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity;
+
+import com.google.common.collect.Sets;
+import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
+import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
+import org.junit.Assert;
+
+import java.util.Set;
+
+public class CapacitySchedulerTestBase {
+  protected final int GB = 1024;
+
+  protected static final String A = CapacitySchedulerConfiguration.ROOT + ".a";
+  protected static final String B = CapacitySchedulerConfiguration.ROOT + ".b";
+  protected static final String A1 = A + ".a1";
+  protected static final String A2 = A + ".a2";
+  protected static final String B1 = B + ".b1";
+  protected static final String B2 = B + ".b2";
+  protected static final String B3 = B + ".b3";
+  protected static float A_CAPACITY = 10.5f;
+  protected static float B_CAPACITY = 89.5f;
+  protected static final String P1 = CapacitySchedulerConfiguration.ROOT + ".p1";
+  protected static final String P2 = CapacitySchedulerConfiguration.ROOT + ".p2";
+  protected static final String X1 = P1 + ".x1";
+  protected static final String X2 = P1 + ".x2";
+  protected static final String Y1 = P2 + ".y1";
+  protected static final String Y2 = P2 + ".y2";
+  protected static float A1_CAPACITY = 30;
+  protected static float A2_CAPACITY = 70;
+  protected static float B1_CAPACITY = 79.2f;
+  protected static float B2_CAPACITY = 0.8f;
+  protected static float B3_CAPACITY = 20;
+
+
+  @SuppressWarnings("unchecked")
+  protected <E> Set<E> toSet(E... elements) {
+    Set<E> set = Sets.newHashSet(elements);
+    return set;
+  }
+
+  protected void checkPendingResource(MockRM rm, String queueName, int memory,
+      String label) {
+    CapacityScheduler cs = (CapacityScheduler) rm.getResourceScheduler();
+    CSQueue queue = cs.getQueue(queueName);
+    Assert.assertEquals(
+        memory,
+        queue.getQueueResourceUsage()
+            .getPending(label == null ? RMNodeLabelsManager.NO_LABEL : label)
+            .getMemorySize());
+  }
+
+
+  protected void checkPendingResourceGreaterThanZero(MockRM rm, String queueName,
+      String label) {
+    CapacityScheduler cs = (CapacityScheduler) rm.getResourceScheduler();
+    CSQueue queue = cs.getQueue(queueName);
+    Assert.assertTrue(queue.getQueueResourceUsage()
+        .getPending(label == null ? RMNodeLabelsManager.NO_LABEL : label)
+        .getMemorySize() > 0);
+  }
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java
index 7628312..79898bb 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacityScheduler.java
@@ -103,7 +103,6 @@ import org.apache.hadoop.yarn.server.resourcemanager.TestAMAuthorization.MockRMW
 import org.apache.hadoop.yarn.server.resourcemanager.TestAMAuthorization.MyContainerManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.NullRMNodeLabelsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.nodelabels.RMNodeLabelsManager;
-import org.apache.hadoop.yarn.server.resourcemanager.placement.UserGroupMappingPlacementRule;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMApp;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMAppImpl;
 import org.apache.hadoop.yarn.server.resourcemanager.rmapp.RMAppMetrics;
@@ -167,33 +166,10 @@ import com.google.common.collect.ImmutableMap;
 import com.google.common.collect.ImmutableSet;
 import com.google.common.collect.Sets;
 
-public class TestCapacityScheduler {
+public class TestCapacityScheduler extends CapacitySchedulerTestBase {
   private static final Log LOG = LogFactory.getLog(TestCapacityScheduler.class);
-  private final int GB = 1024;
   private final static ContainerUpdates NULL_UPDATE_REQUESTS =
       new ContainerUpdates();
-
-  private static final String A = CapacitySchedulerConfiguration.ROOT + ".a";
-  private static final String B = CapacitySchedulerConfiguration.ROOT + ".b";
-  private static final String A1 = A + ".a1";
-  private static final String A2 = A + ".a2";
-  private static final String B1 = B + ".b1";
-  private static final String B2 = B + ".b2";
-  private static final String B3 = B + ".b3";
-  private static float A_CAPACITY = 10.5f;
-  private static float B_CAPACITY = 89.5f;
-  private static final String P1 = CapacitySchedulerConfiguration.ROOT + ".p1";
-  private static final String P2 = CapacitySchedulerConfiguration.ROOT + ".p2";
-  private static final String X1 = P1 + ".x1";
-  private static final String X2 = P1 + ".x2";
-  private static final String Y1 = P2 + ".y1";
-  private static final String Y2 = P2 + ".y2";
-  private static float A1_CAPACITY = 30;
-  private static float A2_CAPACITY = 70;
-  private static float B1_CAPACITY = 79.2f;
-  private static float B2_CAPACITY = 0.8f;
-  private static float B3_CAPACITY = 20;
-
   private ResourceManager resourceManager = null;
   private RMContext mockContext;
 
@@ -1116,12 +1092,12 @@ public class TestCapacityScheduler {
     cs.handle(addAttemptEvent);
 
     // Verify the blacklist can be updated independent of requesting containers
-    cs.allocate(appAttemptId, Collections.<ResourceRequest>emptyList(),
+    cs.allocate(appAttemptId, Collections.<ResourceRequest>emptyList(), null,
         Collections.<ContainerId>emptyList(),
         Collections.singletonList(host), null, NULL_UPDATE_REQUESTS);
     Assert.assertTrue(cs.getApplicationAttempt(appAttemptId)
         .isPlaceBlacklisted(host));
-    cs.allocate(appAttemptId, Collections.<ResourceRequest>emptyList(),
+    cs.allocate(appAttemptId, Collections.<ResourceRequest>emptyList(), null,
         Collections.<ContainerId>emptyList(), null,
         Collections.singletonList(host), NULL_UPDATE_REQUESTS);
     Assert.assertFalse(cs.getApplicationAttempt(appAttemptId)
@@ -1217,8 +1193,7 @@ public class TestCapacityScheduler {
 
     //This will allocate for app1
     cs.allocate(appAttemptId1,
-        Collections.<ResourceRequest>singletonList(r1),
-        Collections.<ContainerId>emptyList(),
+        Collections.<ResourceRequest>singletonList(r1), null, Collections.<ContainerId>emptyList(),
         null, null, NULL_UPDATE_REQUESTS);
 
     //And this will result in container assignment for app1
@@ -1234,8 +1209,7 @@ public class TestCapacityScheduler {
     //Now, allocate for app2 (this would be the first/AM allocation)
     ResourceRequest r2 = TestUtils.createResourceRequest(ResourceRequest.ANY, 1*GB, 1, true, priority, recordFactory);
     cs.allocate(appAttemptId2,
-        Collections.<ResourceRequest>singletonList(r2),
-        Collections.<ContainerId>emptyList(),
+        Collections.<ResourceRequest>singletonList(r2), null, Collections.<ContainerId>emptyList(),
         null, null, NULL_UPDATE_REQUESTS);
 
     //In this case we do not perform container assignment because we want to
@@ -3481,12 +3455,6 @@ public class TestCapacityScheduler {
         + "queue-a's max capacity will be violated if container allocated");
   }
 
-  @SuppressWarnings("unchecked")
-  private <E> Set<E> toSet(E... elements) {
-    Set<E> set = Sets.newHashSet(elements);
-    return set;
-  }
-
   @Test
   public void testQueueHierarchyPendingResourceUpdate() throws Exception {
     Configuration conf =
@@ -3618,26 +3586,6 @@ public class TestCapacityScheduler {
     checkPendingResource(rm, "root", 0 * GB, "x");
   }
 
-  private void checkPendingResource(MockRM rm, String queueName, int memory,
-      String label) {
-    CapacityScheduler cs = (CapacityScheduler) rm.getResourceScheduler();
-    CSQueue queue = cs.getQueue(queueName);
-    Assert.assertEquals(
-        memory,
-        queue.getQueueResourceUsage()
-            .getPending(label == null ? RMNodeLabelsManager.NO_LABEL : label)
-            .getMemorySize());
-  }
-
-  private void checkPendingResourceGreaterThanZero(MockRM rm, String queueName,
-      String label) {
-    CapacityScheduler cs = (CapacityScheduler) rm.getResourceScheduler();
-    CSQueue queue = cs.getQueue(queueName);
-    Assert.assertTrue(queue.getQueueResourceUsage()
-        .getPending(label == null ? RMNodeLabelsManager.NO_LABEL : label)
-        .getMemorySize() > 0);
-  }
-
   // Test verifies AM Used resource for LeafQueue when AM ResourceRequest is
   // lesser than minimumAllocation
   @Test(timeout = 30000)
@@ -3707,7 +3655,7 @@ public class TestCapacityScheduler {
 
     Allocation allocate =
         cs.allocate(appAttemptId, Collections.<ResourceRequest> emptyList(),
-            Collections.<ContainerId> emptyList(), null, null,
+            null, Collections.<ContainerId> emptyList(), null, null,
             NULL_UPDATE_REQUESTS);
 
     Assert.assertNotNull(attempt);
@@ -3724,7 +3672,7 @@ public class TestCapacityScheduler {
 
     allocate =
         cs.allocate(appAttemptId, Collections.<ResourceRequest> emptyList(),
-            Collections.<ContainerId> emptyList(), null, null,
+            null, Collections.<ContainerId> emptyList(), null, null,
             NULL_UPDATE_REQUESTS);
 
     // All resources should be sent as headroom
@@ -4250,8 +4198,7 @@ public class TestCapacityScheduler {
       y1Req = TestUtils.createResourceRequest(
           ResourceRequest.ANY, 1 * GB, 1, true, priority, recordFactory);
       cs.allocate(appAttemptId3,
-          Collections.<ResourceRequest>singletonList(y1Req),
-          Collections.<ContainerId>emptyList(),
+          Collections.<ResourceRequest>singletonList(y1Req), null, Collections.<ContainerId>emptyList(),
           null, null, NULL_UPDATE_REQUESTS);
       CapacityScheduler.schedule(cs);
     }
@@ -4264,8 +4211,7 @@ public class TestCapacityScheduler {
       x1Req = TestUtils.createResourceRequest(
           ResourceRequest.ANY, 1 * GB, 1, true, priority, recordFactory);
       cs.allocate(appAttemptId1,
-          Collections.<ResourceRequest>singletonList(x1Req),
-          Collections.<ContainerId>emptyList(),
+          Collections.<ResourceRequest>singletonList(x1Req), null, Collections.<ContainerId>emptyList(),
           null, null, NULL_UPDATE_REQUESTS);
       CapacityScheduler.schedule(cs);
     }
@@ -4277,8 +4223,7 @@ public class TestCapacityScheduler {
     x2Req = TestUtils.createResourceRequest(
         ResourceRequest.ANY, 2 * GB, 1, true, priority, recordFactory);
     cs.allocate(appAttemptId2,
-        Collections.<ResourceRequest>singletonList(x2Req),
-        Collections.<ContainerId>emptyList(),
+        Collections.<ResourceRequest>singletonList(x2Req), null, Collections.<ContainerId>emptyList(),
         null, null, NULL_UPDATE_REQUESTS);
     CapacityScheduler.schedule(cs);
     assertEquals("X2 Used Resource should be 0", 0,
@@ -4289,8 +4234,7 @@ public class TestCapacityScheduler {
     x1Req = TestUtils.createResourceRequest(
         ResourceRequest.ANY, 1 * GB, 1, true, priority, recordFactory);
     cs.allocate(appAttemptId1,
-        Collections.<ResourceRequest>singletonList(x1Req),
-        Collections.<ContainerId>emptyList(),
+        Collections.<ResourceRequest>singletonList(x1Req), null, Collections.<ContainerId>emptyList(),
         null, null, NULL_UPDATE_REQUESTS);
     CapacityScheduler.schedule(cs);
     assertEquals("X1 Used Resource should be 7 GB", 7 * GB,
@@ -4303,8 +4247,7 @@ public class TestCapacityScheduler {
       y1Req = TestUtils.createResourceRequest(
           ResourceRequest.ANY, 1 * GB, 1, true, priority, recordFactory);
       cs.allocate(appAttemptId3,
-          Collections.<ResourceRequest>singletonList(y1Req),
-          Collections.<ContainerId>emptyList(),
+          Collections.<ResourceRequest>singletonList(y1Req), null, Collections.<ContainerId>emptyList(),
           null, null, NULL_UPDATE_REQUESTS);
       CapacityScheduler.schedule(cs);
     }
@@ -4363,7 +4306,7 @@ public class TestCapacityScheduler {
         ResourceRequest.ANY, 2 * GB, 1, true, priority, recordFactory);
     //This will allocate for app1
     cs.allocate(appAttemptId1, Collections.<ResourceRequest>singletonList(r1),
-        Collections.<ContainerId>emptyList(),
+        null, Collections.<ContainerId>emptyList(),
         null, null, NULL_UPDATE_REQUESTS).getContainers().size();
     CapacityScheduler.schedule(cs);
     ResourceRequest r2 = null;
@@ -4371,8 +4314,7 @@ public class TestCapacityScheduler {
       r2 = TestUtils.createResourceRequest(
           ResourceRequest.ANY, 1 * GB, 1, true, priority, recordFactory);
       cs.allocate(appAttemptId2,
-          Collections.<ResourceRequest>singletonList(r2),
-          Collections.<ContainerId>emptyList(),
+          Collections.<ResourceRequest>singletonList(r2), null, Collections.<ContainerId>emptyList(),
           null, null, NULL_UPDATE_REQUESTS);
       CapacityScheduler.schedule(cs);
     }
@@ -4385,12 +4327,12 @@ public class TestCapacityScheduler {
     r2 = TestUtils.createResourceRequest(
         ResourceRequest.ANY, 1 * GB, 1, true, priority, recordFactory);
     cs.allocate(appAttemptId1, Collections.<ResourceRequest>singletonList(r1),
-        Collections.<ContainerId>emptyList(),
+        null, Collections.<ContainerId>emptyList(),
         null, null, NULL_UPDATE_REQUESTS).getContainers().size();
     CapacityScheduler.schedule(cs);
 
     cs.allocate(appAttemptId2, Collections.<ResourceRequest>singletonList(r2),
-        Collections.<ContainerId>emptyList(), null, null, NULL_UPDATE_REQUESTS);
+        null, Collections.<ContainerId>emptyList(), null, null, NULL_UPDATE_REQUESTS);
     CapacityScheduler.schedule(cs);
     //Check blocked Resource
     assertEquals("A Used Resource should be 2 GB", 2 * GB,

http://git-wip-us.apache.org/repos/asf/hadoop/blob/0b9dffa1/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
index eddf8c8..18cd942 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/capacity/TestCapacitySchedulerAsyncScheduling.java
@@ -106,7 +106,7 @@ public class TestCapacitySchedulerAsyncScheduling {
         CapacitySchedulerConfiguration.SCHEDULE_ASYNCHRONOUSLY_MAXIMUM_THREAD,
         numThreads);
     conf.setInt(CapacitySchedulerConfiguration.SCHEDULE_ASYNCHRONOUSLY_PREFIX
-        + ".scheduling-interval-ms", 100);
+        + ".scheduling-interval-ms", 0);
 
     final RMNodeLabelsManager mgr = new NullRMNodeLabelsManager();
     mgr.init(conf);


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[47/50] [abbrv] hadoop git commit: YARN-7783. Add validation step to ensure constraints are not violated due to order in which a request is processed. (asuresh)

Posted by as...@apache.org.
YARN-7783. Add validation step to ensure constraints are not violated due to order in which a request is processed. (asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/d04ec492
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/d04ec492
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/d04ec492

Branch: refs/heads/YARN-6592
Commit: d04ec492f2d9e8a7d6ad1490ff6e13cf07d8fd7c
Parents: 416f2aa
Author: Arun Suresh <as...@apache.org>
Authored: Tue Jan 23 08:15:58 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:54:37 2018 -0800

----------------------------------------------------------------------
 .../algorithm/DefaultPlacementAlgorithm.java    | 119 +++++++++++++++++--
 .../constraint/TestPlacementProcessor.java      |  49 ++++++++
 2 files changed, 155 insertions(+), 13 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/d04ec492/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
index 9887749..4e6473f 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
@@ -22,6 +22,7 @@ import java.util.Iterator;
 import java.util.List;
 
 import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractYarnScheduler;
@@ -69,13 +70,9 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
   public boolean attemptPlacementOnNode(ApplicationId appId,
       SchedulingRequest schedulingRequest, SchedulerNode schedulerNode)
       throws InvalidAllocationTagsQueryException {
-    int numAllocs = schedulingRequest.getResourceSizing().getNumAllocations();
-    if (numAllocs > 0) {
-      if (PlacementConstraintsUtil.canSatisfyConstraints(appId,
-          schedulingRequest, schedulerNode,
-          constraintManager, tagsManager)) {
-        return true;
-      }
+    if (PlacementConstraintsUtil.canSatisfyConstraints(appId,
+        schedulingRequest, schedulerNode, constraintManager, tagsManager)) {
+      return true;
     }
     return false;
   }
@@ -93,6 +90,9 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
     int rePlacementCount = RE_ATTEMPT_COUNT;
     while (rePlacementCount > 0) {
       doPlacement(requests, resp, allNodes, rejectedRequests);
+      // Double check if placement constraints are really satisfied
+      validatePlacement(requests.getApplicationId(), resp,
+          rejectedRequests);
       if (rejectedRequests.size() == 0 || rePlacementCount == 1) {
         break;
       }
@@ -122,9 +122,14 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
         break;
       }
       SchedulingRequest schedulingRequest = requestIterator.next();
+      PlacedSchedulingRequest placedReq =
+          new PlacedSchedulingRequest(schedulingRequest);
+      placedReq.setPlacementAttempt(requests.getPlacementAttempt());
+      resp.getPlacedRequests().add(placedReq);
       CircularIterator<SchedulerNode> nodeIter =
           new CircularIterator(lastSatisfiedNode, nIter, allNodes);
-      int numAllocs = schedulingRequest.getResourceSizing().getNumAllocations();
+      int numAllocs =
+          schedulingRequest.getResourceSizing().getNumAllocations();
       while (nodeIter.hasNext() && numAllocs > 0) {
         SchedulerNode node = nodeIter.next();
         try {
@@ -135,11 +140,7 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
                   requests.getApplicationId(), schedulingRequest, node)) {
             schedulingRequest.getResourceSizing()
                 .setNumAllocations(--numAllocs);
-            PlacedSchedulingRequest placedReq =
-                new PlacedSchedulingRequest(schedulingRequest);
-            placedReq.setPlacementAttempt(requests.getPlacementAttempt());
             placedReq.getNodes().add(node);
-            resp.getPlacedRequests().add(placedReq);
             numAllocs =
                 schedulingRequest.getResourceSizing().getNumAllocations();
             // Add temp-container tags for current placement cycle
@@ -156,6 +157,98 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
     // Add all requests whose numAllocations still > 0 to rejected list.
     requests.getSchedulingRequests().stream()
         .filter(sReq -> sReq.getResourceSizing().getNumAllocations() > 0)
-        .forEach(rejReq -> rejectedRequests.add(rejReq));
+        .forEach(rejReq -> rejectedRequests.add(cloneReq(rejReq)));
   }
+
+  /**
+   * During the placement phase, allocation tags are added to the node if the
+   * constraint is satisfied, But depending on the order in which the
+   * algorithm sees the request, it is possible that a constraint that happened
+   * to be valid during placement of an earlier-seen request, might not be
+   * valid after all subsequent requests have been placed.
+   *
+   * For eg:
+   *   Assume nodes n1, n2, n3, n4 and n5
+   *
+   *   Consider the 2 constraints:
+   *   1) "foo", anti-affinity with "foo"
+   *   2) "bar", anti-affinity with "foo"
+   *
+   *   And 2 requests
+   *   req1: NumAllocations = 4, allocTags = [foo]
+   *   req2: NumAllocations = 1, allocTags = [bar]
+   *
+   *   If "req1" is seen first, the algorithm can place the 4 containers in
+   *   n1, n2, n3 and n4. And when it gets to "req2", it will see that 4 nodes
+   *   with the "foo" tag and will place on n5.
+   *   But if "req2" is seem first, then "bar" will be placed on any node,
+   *   since no node currently has "foo", and when it gets to "req1", since
+   *   "foo" has not anti-affinity with "bar", the algorithm can end up placing
+   *   "foo" on a node with "bar" violating the second constraint.
+   *
+   * To prevent the above, we need a validation step: after the placements for a
+   * batch of requests are made, for each req, we remove its tags from the node
+   * and try to see of constraints are still satisfied if the tag were to be
+   * added back on the node.
+   *
+   *   When applied to the example above, after "req2" and "req1" are placed,
+   *   we remove the "bar" tag from the node and try to add it back on the node.
+   *   This time, constraint satisfaction will fail, since there is now a "foo"
+   *   tag on the node and "bar" cannot be added. The algorithm will then
+   *   retry placing "req2" on another node.
+   *
+   * @param applicationId
+   * @param resp
+   * @param rejectedRequests
+   */
+  private void validatePlacement(ApplicationId applicationId,
+      ConstraintPlacementAlgorithmOutput resp,
+      List<SchedulingRequest> rejectedRequests) {
+    Iterator<PlacedSchedulingRequest> pReqIter =
+        resp.getPlacedRequests().iterator();
+    while (pReqIter.hasNext()) {
+      PlacedSchedulingRequest pReq = pReqIter.next();
+      Iterator<SchedulerNode> nodeIter = pReq.getNodes().iterator();
+      // Assuming all reqs were satisfied.
+      int num = 0;
+      while (nodeIter.hasNext()) {
+        SchedulerNode node = nodeIter.next();
+        try {
+          // Remove just the tags for this placement.
+          this.tagsManager.removeTempTags(node.getNodeID(),
+              applicationId, pReq.getSchedulingRequest().getAllocationTags());
+          if (!attemptPlacementOnNode(
+              applicationId, pReq.getSchedulingRequest(), node)) {
+            nodeIter.remove();
+            num++;
+          } else {
+            // Add back the tags if everything is fine.
+            this.tagsManager.addTempTags(node.getNodeID(),
+                applicationId, pReq.getSchedulingRequest().getAllocationTags());
+          }
+        } catch (InvalidAllocationTagsQueryException e) {
+          LOG.warn("Got exception from TagManager !", e);
+        }
+      }
+      if (num > 0) {
+        SchedulingRequest sReq = cloneReq(pReq.getSchedulingRequest());
+        sReq.getResourceSizing().setNumAllocations(num);
+        rejectedRequests.add(sReq);
+      }
+      if (pReq.getNodes().isEmpty()) {
+        pReqIter.remove();
+      }
+    }
+  }
+
+  private static SchedulingRequest cloneReq(SchedulingRequest sReq) {
+    return SchedulingRequest.newInstance(
+        sReq.getAllocationRequestId(), sReq.getPriority(),
+        sReq.getExecutionType(), sReq.getAllocationTags(),
+        ResourceSizing.newInstance(
+            sReq.getResourceSizing().getNumAllocations(),
+            sReq.getResourceSizing().getResources()),
+        sReq.getPlacementConstraint());
+  }
+
 }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/d04ec492/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
index 65daeb8..8426b20 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
@@ -151,6 +151,55 @@ public class TestPlacementProcessor {
   }
 
   @Test(timeout = 300000)
+  public void testMutualAntiAffinityPlacement() throws Exception {
+    HashMap<NodeId, MockNM> nodes = new HashMap<>();
+    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm1.getNodeId(), nm1);
+    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm2.getNodeId(), nm2);
+    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm3.getNodeId(), nm3);
+    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm4.getNodeId(), nm4);
+    MockNM nm5 = new MockNM("h5:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm5.getNodeId(), nm5);
+    nm1.registerNode();
+    nm2.registerNode();
+    nm3.registerNode();
+    nm4.registerNode();
+    nm5.registerNode();
+
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    // Containers with allocationTag 'foo' are restricted to 1 per NODE
+    Map<Set<String>, PlacementConstraint> pcMap = new HashMap<>();
+    pcMap.put(Collections.singleton("foo"),
+        PlacementConstraints.build(
+            PlacementConstraints.targetNotIn(NODE, allocationTag("foo"))));
+    pcMap.put(Collections.singleton("bar"),
+        PlacementConstraints.build(
+            PlacementConstraints.targetNotIn(NODE, allocationTag("foo"))));
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2, pcMap);
+    am1.addSchedulingRequest(
+        Arrays.asList(schedulingRequest(1, 1, 1, 512, "bar"),
+            schedulingRequest(1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            schedulingRequest(1, 4, 1, 512, "foo"),
+            schedulingRequest(1, 5, 1, 512, "foo")));
+    AllocateResponse allocResponse = am1.schedule(); // send the request
+    List<Container> allocatedContainers = new ArrayList<>();
+    allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+
+    // kick the scheduler
+    waitForContainerAllocation(nodes.values(), am1, allocatedContainers, 5);
+
+    Assert.assertEquals(5, allocatedContainers.size());
+    Set<NodeId> nodeIds = allocatedContainers.stream().map(x -> x.getNodeId())
+        .collect(Collectors.toSet());
+    // Ensure unique nodes (antiaffinity)
+    Assert.assertEquals(5, nodeIds.size());
+  }
+
+  @Test(timeout = 300000)
   public void testCardinalityPlacement() throws Exception {
     HashMap<NodeId, MockNM> nodes = new HashMap<>();
     MockNM nm1 = new MockNM("h1:1234", 8192, rm.getResourceTrackerService());


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org


[39/50] [abbrv] hadoop git commit: YARN-7682. Expose canSatisfyConstraints utility function to validate a placement against a constraint. (Panagiotis Garefalakis via asuresh)

Posted by as...@apache.org.
YARN-7682. Expose canSatisfyConstraints utility function to validate a placement against a constraint. (Panagiotis Garefalakis via asuresh)


Project: http://git-wip-us.apache.org/repos/asf/hadoop/repo
Commit: http://git-wip-us.apache.org/repos/asf/hadoop/commit/5df2556b
Tree: http://git-wip-us.apache.org/repos/asf/hadoop/tree/5df2556b
Diff: http://git-wip-us.apache.org/repos/asf/hadoop/diff/5df2556b

Branch: refs/heads/YARN-6592
Commit: 5df2556b5ad1e54a8a3a9d99b295dd764f5c801a
Parents: 1350094
Author: Arun Suresh <as...@apache.org>
Authored: Wed Jan 3 08:00:50 2018 -0800
Committer: Arun Suresh <as...@apache.org>
Committed: Tue Jan 30 07:53:34 2018 -0800

----------------------------------------------------------------------
 .../constraint/PlacementConstraintsUtil.java    | 132 +++++++++
 .../algorithm/DefaultPlacementAlgorithm.java    |  55 +---
 .../TestPlacementConstraintsUtil.java           | 287 +++++++++++++++++++
 .../constraint/TestPlacementProcessor.java      | 204 +++++++++++--
 4 files changed, 601 insertions(+), 77 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/hadoop/blob/5df2556b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
new file mode 100644
index 0000000..956a3c9
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/PlacementConstraintsUtil.java
@@ -0,0 +1,132 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import java.util.Iterator;
+import java.util.Set;
+
+import org.apache.hadoop.classification.InterfaceAudience.Public;
+import org.apache.hadoop.classification.InterfaceStability.Unstable;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.TargetExpression.TargetType;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.AbstractConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint.SingleConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations.SingleConstraintTransformer;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algorithm.DefaultPlacementAlgorithm;
+
+/**
+ * This class contains various static methods used by the Placement Algorithms
+ * to simplify constrained placement.
+ * (see also {@link DefaultPlacementAlgorithm}).
+ */
+@Public
+@Unstable
+public final class PlacementConstraintsUtil {
+
+  // Suppresses default constructor, ensuring non-instantiability.
+  private PlacementConstraintsUtil() {
+  }
+
+  /**
+   * Returns true if **single** application constraint with associated
+   * allocationTags and scope is satisfied by a specific scheduler Node.
+   *
+   * @param appId the application id
+   * @param sc the placement constraint
+   * @param te the target expression
+   * @param node the scheduler node
+   * @param tm the allocation tags store
+   * @return true if single application constraint is satisfied by node
+   * @throws InvalidAllocationTagsQueryException
+   */
+  private static boolean canSatisfySingleConstraintExpression(
+      ApplicationId appId, SingleConstraint sc, TargetExpression te,
+      SchedulerNode node, AllocationTagsManager tm)
+      throws InvalidAllocationTagsQueryException {
+    long minScopeCardinality = 0;
+    long maxScopeCardinality = 0;
+    if (sc.getScope() == PlacementConstraints.NODE) {
+      minScopeCardinality = tm.getNodeCardinalityByOp(node.getNodeID(), appId,
+          te.getTargetValues(), Long::max);
+      maxScopeCardinality = tm.getNodeCardinalityByOp(node.getNodeID(), appId,
+          te.getTargetValues(), Long::min);
+    } else if (sc.getScope() == PlacementConstraints.RACK) {
+      minScopeCardinality = tm.getRackCardinalityByOp(node.getRackName(), appId,
+          te.getTargetValues(), Long::max);
+      maxScopeCardinality = tm.getRackCardinalityByOp(node.getRackName(), appId,
+          te.getTargetValues(), Long::min);
+    }
+    // Make sure Anti-affinity satisfies hard upper limit
+    maxScopeCardinality = sc.getMaxCardinality() == 0 ? maxScopeCardinality - 1
+        : maxScopeCardinality;
+
+    return (minScopeCardinality >= sc.getMinCardinality()
+        && maxScopeCardinality < sc.getMaxCardinality());
+  }
+
+  /**
+   * Returns true if all application constraints with associated allocationTags
+   * are **currently** satisfied by a specific scheduler Node.
+   * To do so the method retrieves and goes through all application constraint
+   * expressions and checks if the specific allocation is between the allowed
+   * min-max cardinality values under the constraint scope (Node/Rack/etc).
+   *
+   * @param appId the application id
+   * @param allocationTags the allocation tags set
+   * @param node the scheduler node
+   * @param pcm the placement constraints store
+   * @param tagsManager the allocation tags store
+   * @return true if all application constraints are satisfied by node
+   * @throws InvalidAllocationTagsQueryException
+   */
+  public static boolean canSatisfyConstraints(ApplicationId appId,
+      Set<String> allocationTags, SchedulerNode node,
+      PlacementConstraintManager pcm, AllocationTagsManager tagsManager)
+      throws InvalidAllocationTagsQueryException {
+    PlacementConstraint constraint = pcm.getConstraint(appId, allocationTags);
+    if (constraint == null) {
+      return true;
+    }
+    // Transform to SimpleConstraint
+    SingleConstraintTransformer singleTransformer =
+        new SingleConstraintTransformer(constraint);
+    constraint = singleTransformer.transform();
+    AbstractConstraint sConstraintExpr = constraint.getConstraintExpr();
+    SingleConstraint single = (SingleConstraint) sConstraintExpr;
+    // Iterate through TargetExpressions
+    Iterator<TargetExpression> expIt = single.getTargetExpressions().iterator();
+    while (expIt.hasNext()) {
+      TargetExpression currentExp = expIt.next();
+      // Supporting AllocationTag Expressions for now
+      if (currentExp.getTargetType().equals(TargetType.ALLOCATION_TAG)) {
+        // Check if conditions are met
+        if (!canSatisfySingleConstraintExpression(appId, single, currentExp,
+            node, tagsManager)) {
+          return false;
+        }
+      }
+    }
+    // return true if all targetExpressions are satisfied
+    return true;
+  }
+
+}

http://git-wip-us.apache.org/repos/asf/hadoop/blob/5df2556b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
index 395c156..9ed9ab1 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/main/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/algorithm/DefaultPlacementAlgorithm.java
@@ -19,19 +19,16 @@ package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.algor
 
 import java.util.Iterator;
 import java.util.List;
-import java.util.Set;
 
 import org.apache.hadoop.yarn.api.records.ApplicationId;
-import org.apache.hadoop.yarn.api.records.NodeId;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
-import org.apache.hadoop.yarn.api.resource.PlacementConstraintTransformations;
 import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.AbstractYarnScheduler;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.SchedulerNode;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.AllocationTagsManager;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.InvalidAllocationTagsQueryException;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintManager;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.PlacementConstraintsUtil;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithm;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmInput;
 import org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint.api.ConstraintPlacementAlgorithmOutput;
@@ -65,58 +62,14 @@ public class DefaultPlacementAlgorithm implements ConstraintPlacementAlgorithm {
             .getNodes(filter);
   }
 
-  /**
-   * TODO: Method will be moved to PlacementConstraintsUtil class (YARN-7682)
-   * @param applicationId
-   * @param allocationTags
-   * @param nodeId
-   * @param tagsManager
-   * @return boolean
-   * @throws InvalidAllocationTagsQueryException
-   */
-  public boolean canAssign(ApplicationId applicationId,
-      Set<String> allocationTags, NodeId nodeId,
-      AllocationTagsManager tagsManager)
-      throws InvalidAllocationTagsQueryException {
-    PlacementConstraint constraint =
-        constraintManager.getConstraint(applicationId, allocationTags);
-    if (constraint == null) {
-      return true;
-    }
-    // TODO: proper transformations
-    // Currently works only for simple anti-affinity
-    // NODE scope target expressions
-    PlacementConstraintTransformations.SpecializedConstraintTransformer transformer =
-        new PlacementConstraintTransformations.SpecializedConstraintTransformer(
-            constraint);
-    PlacementConstraint transform = transformer.transform();
-    PlacementConstraint.TargetConstraint targetConstraint =
-        (PlacementConstraint.TargetConstraint) transform.getConstraintExpr();
-    // Assume a single target expression tag;
-    // The Sample Algorithm assumes a constraint will always be a simple
-    // Target Constraint with a single entry in the target set.
-    // As mentioned in the class javadoc - This algorithm should be
-    // used mostly for testing and validating end-2-end workflow.
-    String targetTag = targetConstraint.getTargetExpressions().iterator().next()
-        .getTargetValues().iterator().next();
-    // TODO: Assuming anti-affinity constraint
-    long nodeCardinality =
-        tagsManager.getNodeCardinality(nodeId, applicationId, targetTag);
-    if (nodeCardinality != 0) {
-      return false;
-    }
-    // return true if it is a valid placement
-    return true;
-  }
-
   public boolean attemptPlacementOnNode(ApplicationId appId,
       SchedulingRequest schedulingRequest, SchedulerNode schedulerNode)
       throws InvalidAllocationTagsQueryException {
     int numAllocs = schedulingRequest.getResourceSizing().getNumAllocations();
     if (numAllocs > 0) {
-      if (canAssign(appId,
-          schedulingRequest.getAllocationTags(), schedulerNode.getNodeID(),
-          tagsManager)) {
+      if (PlacementConstraintsUtil.canSatisfyConstraints(appId,
+          schedulingRequest.getAllocationTags(), schedulerNode,
+          constraintManager, tagsManager)) {
         return true;
       }
     }

http://git-wip-us.apache.org/repos/asf/hadoop/blob/5df2556b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
new file mode 100644
index 0000000..7492233
--- /dev/null
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementConstraintsUtil.java
@@ -0,0 +1,287 @@
+/**
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements.  See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership.  The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License.  You may obtain a copy of the License at
+ * <p>
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * <p>
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+package org.apache.hadoop.yarn.server.resourcemanager.scheduler.constraint;
+
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.RACK;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetNotIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.allocationTag;
+
+import java.util.AbstractMap;
+import java.util.Arrays;
+import java.util.HashSet;
+import java.util.Iterator;
+import java.util.List;
+import java.util.Map;
+import java.util.Set;
+import java.util.stream.Collectors;
+import java.util.stream.Stream;
+
+import org.apache.hadoop.yarn.api.records.ApplicationAttemptId;
+import org.apache.hadoop.yarn.api.records.ApplicationId;
+import org.apache.hadoop.yarn.api.records.ContainerId;
+import org.apache.hadoop.yarn.api.records.Resource;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
+import org.apache.hadoop.yarn.server.resourcemanager.MockNodes;
+import org.apache.hadoop.yarn.server.resourcemanager.MockRM;
+import org.apache.hadoop.yarn.server.resourcemanager.RMContext;
+import org.apache.hadoop.yarn.server.resourcemanager.rmnode.RMNode;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.capacity.TestUtils;
+import org.apache.hadoop.yarn.server.resourcemanager.scheduler.common.fica.FiCaSchedulerNode;
+import org.apache.hadoop.yarn.server.utils.BuilderUtils;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+
+import com.google.common.collect.ImmutableSet;
+
+/**
+ * Test the PlacementConstraint Utility class functionality.
+ */
+public class TestPlacementConstraintsUtil {
+
+  private List<RMNode> rmNodes;
+  private RMContext rmContext;
+  private static final int GB = 1024;
+  private ApplicationId appId1;
+  private PlacementConstraint c1, c2, c3, c4;
+  private Set<String> sourceTag1, sourceTag2;
+  private Map<Set<String>, PlacementConstraint> constraintMap1, constraintMap2;
+
+  @Before
+  public void setup() {
+    MockRM rm = new MockRM();
+    rm.start();
+    MockNodes.resetHostIds();
+    rmNodes = MockNodes.newNodes(2, 2, Resource.newInstance(4096, 4));
+    for (RMNode rmNode : rmNodes) {
+      rm.getRMContext().getRMNodes().putIfAbsent(rmNode.getNodeID(), rmNode);
+    }
+    rmContext = rm.getRMContext();
+
+    // Build appIDs, constraints, source tags, and constraint map.
+    long ts = System.currentTimeMillis();
+    appId1 = BuilderUtils.newApplicationId(ts, 123);
+
+    c1 = PlacementConstraints.build(targetIn(NODE, allocationTag("hbase-m")));
+    c2 = PlacementConstraints.build(targetIn(RACK, allocationTag("hbase-rs")));
+    c3 = PlacementConstraints
+        .build(targetNotIn(NODE, allocationTag("hbase-m")));
+    c4 = PlacementConstraints
+        .build(targetNotIn(RACK, allocationTag("hbase-rs")));
+
+    sourceTag1 = new HashSet<>(Arrays.asList("spark"));
+    sourceTag2 = new HashSet<>(Arrays.asList("zk"));
+
+    constraintMap1 = Stream
+        .of(new AbstractMap.SimpleEntry<>(sourceTag1, c1),
+            new AbstractMap.SimpleEntry<>(sourceTag2, c2))
+        .collect(Collectors.toMap(AbstractMap.SimpleEntry::getKey,
+            AbstractMap.SimpleEntry::getValue));
+    constraintMap2 = Stream
+        .of(new AbstractMap.SimpleEntry<>(sourceTag1, c3),
+            new AbstractMap.SimpleEntry<>(sourceTag2, c4))
+        .collect(Collectors.toMap(AbstractMap.SimpleEntry::getKey,
+            AbstractMap.SimpleEntry::getValue));
+  }
+
+  @Test
+  public void testNodeAffinityAssignment()
+      throws InvalidAllocationTagsQueryException {
+    PlacementConstraintManagerService pcm =
+        new MemoryPlacementConstraintManager();
+    AllocationTagsManager tm = new AllocationTagsManager(rmContext);
+    // Register App1 with affinity constraint map
+    pcm.registerApplication(appId1, constraintMap1);
+    // No containers are running so all 'zk' and 'spark' allocations should fail
+    // on every cluster NODE
+    Iterator<RMNode> nodeIterator = rmNodes.iterator();
+    while (nodeIterator.hasNext()) {
+      RMNode currentNode = nodeIterator.next();
+      FiCaSchedulerNode schedulerNode = TestUtils.getMockNode(
+          currentNode.getHostName(), currentNode.getRackName(), 123, 4 * GB);
+      Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+          sourceTag1, schedulerNode, pcm, tm));
+      Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+          sourceTag2, schedulerNode, pcm, tm));
+    }
+    /**
+     * Now place container:
+     * Node0:123 (Rack1):
+     *    container_app1_1 (hbase-m)
+     */
+    RMNode n0_r1 = rmNodes.get(0);
+    RMNode n1_r1 = rmNodes.get(1);
+    RMNode n2_r2 = rmNodes.get(2);
+    RMNode n3_r2 = rmNodes.get(3);
+    FiCaSchedulerNode schedulerNode0 = TestUtils
+        .getMockNode(n0_r1.getHostName(), n0_r1.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode1 = TestUtils
+        .getMockNode(n1_r1.getHostName(), n1_r1.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode2 = TestUtils
+        .getMockNode(n2_r2.getHostName(), n2_r2.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode3 = TestUtils
+        .getMockNode(n3_r2.getHostName(), n3_r2.getRackName(), 123, 4 * GB);
+    // 1 Containers on node 0 with allocationTag 'hbase-m'
+    ContainerId hbase_m = ContainerId
+        .newContainerId(ApplicationAttemptId.newInstance(appId1, 0), 0);
+    tm.addContainer(n0_r1.getNodeID(), hbase_m, ImmutableSet.of("hbase-m"));
+
+    // 'spark' placement on Node0 should now SUCCEED
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag1, schedulerNode0, pcm, tm));
+    // FAIL on the rest of the nodes
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag1, schedulerNode1, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag1, schedulerNode2, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag1, schedulerNode3, pcm, tm));
+  }
+
+  @Test
+  public void testRackAffinityAssignment()
+      throws InvalidAllocationTagsQueryException {
+    PlacementConstraintManagerService pcm =
+        new MemoryPlacementConstraintManager();
+    AllocationTagsManager tm = new AllocationTagsManager(rmContext);
+    // Register App1 with affinity constraint map
+    pcm.registerApplication(appId1, constraintMap1);
+    /**
+     * Now place container:
+     * Node0:123 (Rack1):
+     *    container_app1_1 (hbase-rs)
+     */
+    RMNode n0_r1 = rmNodes.get(0);
+    RMNode n1_r1 = rmNodes.get(1);
+    RMNode n2_r2 = rmNodes.get(2);
+    RMNode n3_r2 = rmNodes.get(3);
+    // 1 Containers on Node0-Rack1 with allocationTag 'hbase-rs'
+    ContainerId hbase_m = ContainerId
+        .newContainerId(ApplicationAttemptId.newInstance(appId1, 0), 0);
+    tm.addContainer(n0_r1.getNodeID(), hbase_m, ImmutableSet.of("hbase-rs"));
+
+    FiCaSchedulerNode schedulerNode0 = TestUtils
+        .getMockNode(n0_r1.getHostName(), n0_r1.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode1 = TestUtils
+        .getMockNode(n1_r1.getHostName(), n1_r1.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode2 = TestUtils
+        .getMockNode(n2_r2.getHostName(), n2_r2.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode3 = TestUtils
+        .getMockNode(n3_r2.getHostName(), n3_r2.getRackName(), 123, 4 * GB);
+    // 'zk' placement on Rack1 should now SUCCEED
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag2, schedulerNode0, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag2, schedulerNode1, pcm, tm));
+
+    // FAIL on the rest of the RACKs
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag2, schedulerNode2, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag2, schedulerNode3, pcm, tm));
+  }
+
+  @Test
+  public void testNodeAntiAffinityAssignment()
+      throws InvalidAllocationTagsQueryException {
+    PlacementConstraintManagerService pcm =
+        new MemoryPlacementConstraintManager();
+    AllocationTagsManager tm = new AllocationTagsManager(rmContext);
+    // Register App1 with anti-affinity constraint map
+    pcm.registerApplication(appId1, constraintMap2);
+    /**
+     * place container:
+     * Node0:123 (Rack1):
+     *    container_app1_1 (hbase-m)
+     */
+    RMNode n0_r1 = rmNodes.get(0);
+    RMNode n1_r1 = rmNodes.get(1);
+    RMNode n2_r2 = rmNodes.get(2);
+    RMNode n3_r2 = rmNodes.get(3);
+    FiCaSchedulerNode schedulerNode0 = TestUtils
+        .getMockNode(n0_r1.getHostName(), n0_r1.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode1 = TestUtils
+        .getMockNode(n1_r1.getHostName(), n1_r1.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode2 = TestUtils
+        .getMockNode(n2_r2.getHostName(), n2_r2.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode3 = TestUtils
+        .getMockNode(n3_r2.getHostName(), n3_r2.getRackName(), 123, 4 * GB);
+    // 1 Containers on node 0 with allocationTag 'hbase-m'
+    ContainerId hbase_m = ContainerId
+        .newContainerId(ApplicationAttemptId.newInstance(appId1, 0), 0);
+    tm.addContainer(n0_r1.getNodeID(), hbase_m, ImmutableSet.of("hbase-m"));
+
+    // 'spark' placement on Node0 should now FAIL
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag1, schedulerNode0, pcm, tm));
+    // SUCCEED on the rest of the nodes
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag1, schedulerNode1, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag1, schedulerNode2, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag1, schedulerNode3, pcm, tm));
+  }
+
+  @Test
+  public void testRackAntiAffinityAssignment()
+      throws InvalidAllocationTagsQueryException {
+    AllocationTagsManager tm = new AllocationTagsManager(rmContext);
+    PlacementConstraintManagerService pcm =
+        new MemoryPlacementConstraintManager();
+    // Register App1 with anti-affinity constraint map
+    pcm.registerApplication(appId1, constraintMap2);
+    /**
+     * Place container:
+     * Node0:123 (Rack1):
+     *    container_app1_1 (hbase-rs)
+     */
+    RMNode n0_r1 = rmNodes.get(0);
+    RMNode n1_r1 = rmNodes.get(1);
+    RMNode n2_r2 = rmNodes.get(2);
+    RMNode n3_r2 = rmNodes.get(3);
+    // 1 Containers on Node0-Rack1 with allocationTag 'hbase-rs'
+    ContainerId hbase_m = ContainerId
+        .newContainerId(ApplicationAttemptId.newInstance(appId1, 0), 0);
+    tm.addContainer(n0_r1.getNodeID(), hbase_m, ImmutableSet.of("hbase-rs"));
+
+    FiCaSchedulerNode schedulerNode0 = TestUtils
+        .getMockNode(n0_r1.getHostName(), n0_r1.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode1 = TestUtils
+        .getMockNode(n1_r1.getHostName(), n1_r1.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode2 = TestUtils
+        .getMockNode(n2_r2.getHostName(), n2_r2.getRackName(), 123, 4 * GB);
+    FiCaSchedulerNode schedulerNode3 = TestUtils
+        .getMockNode(n3_r2.getHostName(), n3_r2.getRackName(), 123, 4 * GB);
+
+    // 'zk' placement on Rack1 should FAIL
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag2, schedulerNode0, pcm, tm));
+    Assert.assertFalse(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag2, schedulerNode1, pcm, tm));
+
+    // SUCCEED on the rest of the RACKs
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag2, schedulerNode2, pcm, tm));
+    Assert.assertTrue(PlacementConstraintsUtil.canSatisfyConstraints(appId1,
+        sourceTag2, schedulerNode3, pcm, tm));
+  }
+}
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/hadoop/blob/5df2556b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
----------------------------------------------------------------------
diff --git a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
index 87dd5b7..c260fe0 100644
--- a/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
+++ b/hadoop-yarn-project/hadoop-yarn/hadoop-yarn-server/hadoop-yarn-server-resourcemanager/src/test/java/org/apache/hadoop/yarn/server/resourcemanager/scheduler/constraint/TestPlacementProcessor.java
@@ -30,6 +30,7 @@ import org.apache.hadoop.yarn.api.records.RejectionReason;
 import org.apache.hadoop.yarn.api.records.Resource;
 import org.apache.hadoop.yarn.api.records.ResourceSizing;
 import org.apache.hadoop.yarn.api.records.SchedulingRequest;
+import org.apache.hadoop.yarn.api.resource.PlacementConstraint;
 import org.apache.hadoop.yarn.api.resource.PlacementConstraints;
 import org.apache.hadoop.yarn.conf.YarnConfiguration;
 import org.apache.hadoop.yarn.event.Dispatcher;
@@ -48,16 +49,21 @@ import org.junit.Test;
 
 import java.util.ArrayList;
 import java.util.Arrays;
+import java.util.Collection;
 import java.util.Collections;
 import java.util.HashMap;
 import java.util.HashSet;
 import java.util.List;
+import java.util.Map;
 import java.util.Set;
 import java.util.stream.Collectors;
 
 import static java.lang.Thread.sleep;
 import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.NODE;
 import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.PlacementTargets.allocationTag;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetCardinality;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetIn;
+import static org.apache.hadoop.yarn.api.resource.PlacementConstraints.targetNotIn;
 
 /**
  * This tests end2end workflow of the constraint placement framework.
@@ -104,7 +110,7 @@ public class TestPlacementProcessor {
   }
 
   @Test(timeout = 300000)
-  public void testPlacement() throws Exception {
+  public void testAntiAffinityPlacement() throws Exception {
     HashMap<NodeId, MockNM> nodes = new HashMap<>();
     MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
     nodes.put(nm1.getNodeId(), nm1);
@@ -120,44 +126,174 @@ public class TestPlacementProcessor {
     nm4.registerNode();
 
     RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    // Containers with allocationTag 'foo' are restricted to 1 per NODE
     MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
-        Collections.singletonMap(
-            Collections.singleton("foo"),
+        Collections.singletonMap(Collections.singleton("foo"),
             PlacementConstraints.build(
-                PlacementConstraints.targetNotIn(NODE, allocationTag("foo")))
-        ));
+                PlacementConstraints.targetNotIn(NODE, allocationTag("foo")))));
     am1.addSchedulingRequest(
-        Arrays.asList(
-            schedulingRequest(1, 1, 1, 512, "foo"),
+        Arrays.asList(schedulingRequest(1, 1, 1, 512, "foo"),
             schedulingRequest(1, 2, 1, 512, "foo"),
             schedulingRequest(1, 3, 1, 512, "foo"),
-            schedulingRequest(1, 5, 1, 512, "foo"))
-    );
+            schedulingRequest(1, 5, 1, 512, "foo")));
     AllocateResponse allocResponse = am1.schedule(); // send the request
     List<Container> allocatedContainers = new ArrayList<>();
     allocatedContainers.addAll(allocResponse.getAllocatedContainers());
 
     // kick the scheduler
-
-    while (allocatedContainers.size() < 4) {
-      nm1.nodeHeartbeat(true);
-      nm2.nodeHeartbeat(true);
-      nm3.nodeHeartbeat(true);
-      nm4.nodeHeartbeat(true);
-      LOG.info("Waiting for containers to be created for app 1...");
-      sleep(1000);
-      allocResponse = am1.schedule();
-      allocatedContainers.addAll(allocResponse.getAllocatedContainers());
-    }
+    waitForContainerAllocation(nodes.values(), am1, allocatedContainers, 4);
 
     Assert.assertEquals(4, allocatedContainers.size());
-    Set<NodeId> nodeIds = allocatedContainers.stream()
-        .map(x -> x.getNodeId()).collect(Collectors.toSet());
-    // Ensure unique nodes
+    Set<NodeId> nodeIds = allocatedContainers.stream().map(x -> x.getNodeId())
+        .collect(Collectors.toSet());
+    // Ensure unique nodes (antiaffinity)
     Assert.assertEquals(4, nodeIds.size());
   }
 
   @Test(timeout = 300000)
+  public void testCardinalityPlacement() throws Exception {
+    HashMap<NodeId, MockNM> nodes = new HashMap<>();
+    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm1.getNodeId(), nm1);
+    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm2.getNodeId(), nm2);
+    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm3.getNodeId(), nm3);
+    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm4.getNodeId(), nm4);
+    nm1.registerNode();
+    nm2.registerNode();
+    nm3.registerNode();
+    nm4.registerNode();
+
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    // Containers with allocationTag 'foo' should not exceed 4 per NODE
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
+        Collections.singletonMap(Collections.singleton("foo"),
+            PlacementConstraints.build(PlacementConstraints
+                .targetCardinality(NODE, 0, 4, allocationTag("foo")))));
+    am1.addSchedulingRequest(
+        Arrays.asList(schedulingRequest(1, 1, 1, 512, "foo"),
+            schedulingRequest(1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            schedulingRequest(1, 4, 1, 512, "foo"),
+            schedulingRequest(1, 5, 1, 512, "foo"),
+            schedulingRequest(1, 6, 1, 512, "foo"),
+            schedulingRequest(1, 7, 1, 512, "foo"),
+            schedulingRequest(1, 8, 1, 512, "foo")));
+    AllocateResponse allocResponse = am1.schedule(); // send the request
+    List<Container> allocatedContainers = new ArrayList<>();
+    allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+
+    // kick the scheduler
+    waitForContainerAllocation(nodes.values(), am1, allocatedContainers, 8);
+
+    Assert.assertEquals(8, allocatedContainers.size());
+    Map<NodeId, Long> nodeIdContainerIdMap =
+        allocatedContainers.stream().collect(
+            Collectors.groupingBy(c -> c.getNodeId(), Collectors.counting()));
+    // Ensure no more than 4 containers per node
+    for (NodeId n : nodeIdContainerIdMap.keySet()) {
+      Assert.assertTrue(nodeIdContainerIdMap.get(n) < 5);
+    }
+  }
+
+  @Test(timeout = 300000)
+  public void testAffinityPlacement() throws Exception {
+    HashMap<NodeId, MockNM> nodes = new HashMap<>();
+    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm1.getNodeId(), nm1);
+    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm2.getNodeId(), nm2);
+    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm3.getNodeId(), nm3);
+    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm4.getNodeId(), nm4);
+    nm1.registerNode();
+    nm2.registerNode();
+    nm3.registerNode();
+    nm4.registerNode();
+
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    // Containers with allocationTag 'foo' should be placed where
+    // containers with allocationTag 'bar' are already running
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
+        Collections.singletonMap(Collections.singleton("foo"),
+            PlacementConstraints.build(
+                PlacementConstraints.targetIn(NODE, allocationTag("bar")))));
+    am1.addSchedulingRequest(
+        Arrays.asList(schedulingRequest(1, 1, 1, 512, "bar"),
+            schedulingRequest(1, 2, 1, 512, "foo"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            schedulingRequest(1, 4, 1, 512, "foo"),
+            schedulingRequest(1, 5, 1, 512, "foo")));
+    AllocateResponse allocResponse = am1.schedule(); // send the request
+    List<Container> allocatedContainers = new ArrayList<>();
+    allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+
+    // kick the scheduler
+    waitForContainerAllocation(nodes.values(), am1, allocatedContainers, 5);
+
+    Assert.assertEquals(5, allocatedContainers.size());
+    Set<NodeId> nodeIds = allocatedContainers.stream().map(x -> x.getNodeId())
+        .collect(Collectors.toSet());
+    // Ensure all containers end up on the same node (affinity)
+    Assert.assertEquals(1, nodeIds.size());
+  }
+
+  @Test(timeout = 300000)
+  public void testComplexPlacement() throws Exception {
+    HashMap<NodeId, MockNM> nodes = new HashMap<>();
+    MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm1.getNodeId(), nm1);
+    MockNM nm2 = new MockNM("h2:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm2.getNodeId(), nm2);
+    MockNM nm3 = new MockNM("h3:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm3.getNodeId(), nm3);
+    MockNM nm4 = new MockNM("h4:1234", 4096, rm.getResourceTrackerService());
+    nodes.put(nm4.getNodeId(), nm4);
+    nm1.registerNode();
+    nm2.registerNode();
+    nm3.registerNode();
+    nm4.registerNode();
+
+    RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    Map<Set<String>, PlacementConstraint> constraintMap = new HashMap<>();
+    // Containers with allocationTag 'bar' should not exceed 1 per NODE
+    constraintMap.put(Collections.singleton("bar"),
+        PlacementConstraints.build(targetNotIn(NODE, allocationTag("bar"))));
+    // Containers with allocationTag 'foo' should be placed where 'bar' exists
+    constraintMap.put(Collections.singleton("foo"),
+        PlacementConstraints.build(targetIn(NODE, allocationTag("bar"))));
+    // Containers with allocationTag 'foo' should not exceed 2 per NODE
+    constraintMap.put(Collections.singleton("foo"), PlacementConstraints
+        .build(targetCardinality(NODE, 0, 2, allocationTag("foo"))));
+    MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2, constraintMap);
+    am1.addSchedulingRequest(
+        Arrays.asList(schedulingRequest(1, 1, 1, 512, "bar"),
+            schedulingRequest(1, 2, 1, 512, "bar"),
+            schedulingRequest(1, 3, 1, 512, "foo"),
+            schedulingRequest(1, 4, 1, 512, "foo"),
+            schedulingRequest(1, 5, 1, 512, "foo"),
+            schedulingRequest(1, 6, 1, 512, "foo")));
+    AllocateResponse allocResponse = am1.schedule(); // send the request
+    List<Container> allocatedContainers = new ArrayList<>();
+    allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+
+    // kick the scheduler
+    waitForContainerAllocation(nodes.values(), am1, allocatedContainers, 6);
+
+    Assert.assertEquals(6, allocatedContainers.size());
+    Map<NodeId, Long> nodeIdContainerIdMap =
+        allocatedContainers.stream().collect(
+            Collectors.groupingBy(c -> c.getNodeId(), Collectors.counting()));
+    // Ensure no more than 3 containers per node (1 'bar', 2 'foo')
+    for (NodeId n : nodeIdContainerIdMap.keySet()) {
+      Assert.assertTrue(nodeIdContainerIdMap.get(n) < 4);
+    }
+  }
+
+  @Test(timeout = 300000)
   public void testSchedulerRejection() throws Exception {
     HashMap<NodeId, MockNM> nodes = new HashMap<>();
     MockNM nm1 = new MockNM("h1:1234", 4096, rm.getResourceTrackerService());
@@ -174,6 +310,7 @@ public class TestPlacementProcessor {
     nm4.registerNode();
 
     RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    // Containers with allocationTag 'foo' are restricted to 1 per NODE
     MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
         Collections.singletonMap(
             Collections.singleton("foo"),
@@ -196,7 +333,6 @@ public class TestPlacementProcessor {
     rejectedReqs.addAll(allocResponse.getRejectedSchedulingRequests());
 
     // kick the scheduler
-
     while (allocCount < 11) {
       nm1.nodeHeartbeat(true);
       nm2.nodeHeartbeat(true);
@@ -253,9 +389,10 @@ public class TestPlacementProcessor {
     nm2.registerNode();
     nm3.registerNode();
     nm4.registerNode();
-    // No not register nm5 yet..
+    // Do not register nm5 yet..
 
     RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    // Containers with allocationTag 'foo' are restricted to 1 per NODE
     MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
         Collections.singletonMap(
             Collections.singleton("foo"),
@@ -323,6 +460,7 @@ public class TestPlacementProcessor {
     nm4.registerNode();
 
     RMApp app1 = rm.submitApp(1 * GB, "app", "user", null, "default");
+    // Containers with allocationTag 'foo' are restricted to 1 per NODE
     MockAM am1 = MockRM.launchAndRegisterAM(app1, rm, nm2,
         Collections.singletonMap(
             Collections.singleton("foo"),
@@ -346,7 +484,6 @@ public class TestPlacementProcessor {
     rejectedReqs.addAll(allocResponse.getRejectedSchedulingRequests());
 
     // kick the scheduler
-
     while (allocCount < 11) {
       nm1.nodeHeartbeat(true);
       nm2.nodeHeartbeat(true);
@@ -373,6 +510,21 @@ public class TestPlacementProcessor {
         rej.getReason());
   }
 
+  private static void waitForContainerAllocation(Collection<MockNM> nodes,
+      MockAM am, List<Container> allocatedContainers, int containerNum)
+      throws Exception {
+    while (allocatedContainers.size() < containerNum) {
+      for (MockNM node : nodes) {
+        node.nodeHeartbeat(true);
+      }
+      LOG.info("Waiting for containers to be created for "
+          + am.getApplicationAttemptId().getApplicationId() + "...");
+      sleep(1000);
+      AllocateResponse allocResponse = am.schedule();
+      allocatedContainers.addAll(allocResponse.getAllocatedContainers());
+    }
+  }
+
   protected static SchedulingRequest schedulingRequest(
       int priority, long allocReqId, int cores, int mem, String... tags) {
     return schedulingRequest(priority, allocReqId, cores, mem,


---------------------------------------------------------------------
To unsubscribe, e-mail: common-commits-unsubscribe@hadoop.apache.org
For additional commands, e-mail: common-commits-help@hadoop.apache.org