You are viewing a plain text version of this content. The canonical link for it is here.
Posted to commits@nifi.apache.org by sc...@apache.org on 2018/06/15 19:27:08 UTC

[01/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Repository: nifi-fds
Updated Branches:
  refs/heads/gh-pages 6aea21ba4 -> 954e729fb


http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/socket.io/node_modules/debug/README.md b/node_modules/socket.io/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/socket.io/node_modules/debug/README.md
+++ b/node_modules/socket.io/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/socket.io/node_modules/debug/component.json b/node_modules/socket.io/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/socket.io/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/socket.io/node_modules/debug/package.json b/node_modules/socket.io/node_modules/debug/package.json
index 972e507..cfc62a6 100644
--- a/node_modules/socket.io/node_modules/debug/package.json
+++ b/node_modules/socket.io/node_modules/debug/package.json
@@ -1,32 +1,32 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/socket.io/debug",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/socket.io"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -36,12 +36,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -58,7 +52,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -88,5 +82,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/stringstream/.npmignore
----------------------------------------------------------------------
diff --git a/node_modules/stringstream/.npmignore b/node_modules/stringstream/.npmignore
deleted file mode 100644
index 7dccd97..0000000
--- a/node_modules/stringstream/.npmignore
+++ /dev/null
@@ -1,15 +0,0 @@
-lib-cov
-*.seed
-*.log
-*.csv
-*.dat
-*.out
-*.pid
-*.gz
-
-pids
-logs
-results
-
-node_modules
-npm-debug.log
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/stringstream/package.json
----------------------------------------------------------------------
diff --git a/node_modules/stringstream/package.json b/node_modules/stringstream/package.json
index ace4c34..4cfa52d 100644
--- a/node_modules/stringstream/package.json
+++ b/node_modules/stringstream/package.json
@@ -1,34 +1,34 @@
 {
   "_args": [
     [
-      "stringstream@0.0.5",
+      "stringstream@0.0.6",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "stringstream@0.0.5",
-  "_id": "stringstream@0.0.5",
+  "_from": "stringstream@0.0.6",
+  "_id": "stringstream@0.0.6",
   "_inBundle": false,
-  "_integrity": "sha1-TkhM1N5aC7vuGORjB3EKioFiGHg=",
+  "_integrity": "sha512-87GEBAkegbBcweToUrdzf3eLhWNg06FJTebl4BVJz/JgWy8CvEr9dRtX5qWphiynMSQlxxi+QqN0z5T32SLlhA==",
   "_location": "/stringstream",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "stringstream@0.0.5",
+    "raw": "stringstream@0.0.6",
     "name": "stringstream",
     "escapedName": "stringstream",
-    "rawSpec": "0.0.5",
+    "rawSpec": "0.0.6",
     "saveSpec": null,
-    "fetchSpec": "0.0.5"
+    "fetchSpec": "0.0.6"
   },
   "_requiredBy": [
     "/loggly/request",
     "/node-sass/request",
     "/request"
   ],
-  "_resolved": "https://registry.npmjs.org/stringstream/-/stringstream-0.0.5.tgz",
-  "_spec": "0.0.5",
+  "_resolved": "https://registry.npmjs.org/stringstream/-/stringstream-0.0.6.tgz",
+  "_spec": "0.0.6",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "Michael Hart",
@@ -53,5 +53,5 @@
     "type": "git",
     "url": "git+https://github.com/mhart/StringStream.git"
   },
-  "version": "0.0.5"
+  "version": "0.0.6"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/stringstream/stringstream.js
----------------------------------------------------------------------
diff --git a/node_modules/stringstream/stringstream.js b/node_modules/stringstream/stringstream.js
index 4ece127..6732b9d 100644
--- a/node_modules/stringstream/stringstream.js
+++ b/node_modules/stringstream/stringstream.js
@@ -28,7 +28,7 @@ StringStream.prototype.write = function(data) {
     return false
   }
   if (this.fromEncoding) {
-    if (Buffer.isBuffer(data)) data = data.toString()
+    if (Buffer.isBuffer(data) || typeof data === 'number') data = data.toString()
     data = new Buffer(data, this.fromEncoding)
   }
   var string = this.decoder.write(data)

[13/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
gh-pages update nifi-fds-0.1.0


Project: http://git-wip-us.apache.org/repos/asf/nifi-fds/repo
Commit: http://git-wip-us.apache.org/repos/asf/nifi-fds/commit/954e729f
Tree: http://git-wip-us.apache.org/repos/asf/nifi-fds/tree/954e729f
Diff: http://git-wip-us.apache.org/repos/asf/nifi-fds/diff/954e729f

Branch: refs/heads/gh-pages
Commit: 954e729fbbf531ccabbbc6d1c1c2ea6135b371eb
Parents: 6aea21b
Author: Scott Aslan <sc...@gmail.com>
Authored: Fri Jun 15 15:26:26 2018 -0400
Committer: Scott Aslan <sc...@gmail.com>
Committed: Fri Jun 15 15:26:26 2018 -0400

----------------------------------------------------------------------
 README.md                                       |   54 +-
 node_modules/@nifi-fds/core/README.md           |   54 +-
 .../@nifi-fds/core/common/styles/_inputs.scss   |    4 +-
 .../styles/css/flow-design-system.min.css       |    2 +-
 .../styles/css/flow-design-system.min.css.gz    |  Bin 3210 -> 3209 bytes
 .../styles/css/flow-design-system.min.css.map   |    2 +-
 node_modules/@nifi-fds/core/package.json        |    2 +-
 node_modules/agent-base/package.json            |    2 -
 node_modules/axios/node_modules/debug/.eslintrc |    3 +
 .../axios/node_modules/debug/.travis.yml        |   14 +-
 .../axios/node_modules/debug/CHANGELOG.md       |   35 +-
 node_modules/axios/node_modules/debug/Makefile  |   44 +-
 node_modules/axios/node_modules/debug/README.md |  180 ++-
 .../axios/node_modules/debug/component.json     |   19 -
 .../axios/node_modules/debug/package.json       |   28 +-
 .../body-parser/node_modules/debug/.eslintrc    |    3 +
 .../body-parser/node_modules/debug/.travis.yml  |   14 +-
 .../body-parser/node_modules/debug/CHANGELOG.md |   35 +-
 .../body-parser/node_modules/debug/Makefile     |   44 +-
 .../body-parser/node_modules/debug/README.md    |  180 ++-
 .../node_modules/debug/component.json           |   19 -
 .../body-parser/node_modules/debug/package.json |   28 +-
 .../connect/node_modules/debug/.eslintrc        |    3 +
 .../connect/node_modules/debug/.travis.yml      |   14 +-
 .../connect/node_modules/debug/CHANGELOG.md     |   35 +-
 .../connect/node_modules/debug/Makefile         |   44 +-
 .../connect/node_modules/debug/README.md        |  180 ++-
 .../connect/node_modules/debug/component.json   |   19 -
 .../connect/node_modules/debug/package.json     |   28 +-
 node_modules/debug/package.json                 |    2 +
 node_modules/es6-promisify/README.md            |   89 ++
 node_modules/es6-promisify/dist/promise.js      |   73 ++
 node_modules/es6-promisify/dist/promisify.js    |   85 ++
 .../node_modules/es6-promise/CHANGELOG.md       |  151 +++
 .../node_modules/es6-promise/LICENSE            |   19 +
 .../node_modules/es6-promise/README.md          |   97 ++
 .../node_modules/es6-promise/auto.js            |    4 +
 .../es6-promise/dist/es6-promise.auto.js        | 1181 ++++++++++++++++++
 .../es6-promise/dist/es6-promise.auto.map       |    1 +
 .../es6-promise/dist/es6-promise.auto.min.js    |    1 +
 .../es6-promise/dist/es6-promise.auto.min.map   |    1 +
 .../es6-promise/dist/es6-promise.js             | 1179 +++++++++++++++++
 .../es6-promise/dist/es6-promise.map            |    1 +
 .../es6-promise/dist/es6-promise.min.js         |    1 +
 .../es6-promise/dist/es6-promise.min.map        |    1 +
 .../node_modules/es6-promise/es6-promise.d.ts   |   81 ++
 .../es6-promise/lib/es6-promise.auto.js         |    3 +
 .../node_modules/es6-promise/lib/es6-promise.js |    7 +
 .../es6-promise/lib/es6-promise/-internal.js    |  266 ++++
 .../es6-promise/lib/es6-promise/asap.js         |  119 ++
 .../es6-promise/lib/es6-promise/enumerator.js   |  113 ++
 .../es6-promise/lib/es6-promise/polyfill.js     |   35 +
 .../es6-promise/lib/es6-promise/promise.js      |  427 +++++++
 .../es6-promise/lib/es6-promise/promise/all.js  |   52 +
 .../es6-promise/lib/es6-promise/promise/race.js |   84 ++
 .../lib/es6-promise/promise/reject.js           |   46 +
 .../lib/es6-promise/promise/resolve.js          |   48 +
 .../es6-promise/lib/es6-promise/then.js         |   32 +
 .../es6-promise/lib/es6-promise/utils.js        |   21 +
 .../node_modules/es6-promise/package.json       |  108 ++
 node_modules/es6-promisify/package.json         |   77 ++
 node_modules/extend/package.json                |    2 -
 .../finalhandler/node_modules/debug/.eslintrc   |    3 +
 .../finalhandler/node_modules/debug/.travis.yml |   14 +-
 .../node_modules/debug/CHANGELOG.md             |   35 +-
 .../finalhandler/node_modules/debug/Makefile    |   44 +-
 .../finalhandler/node_modules/debug/README.md   |  180 ++-
 .../node_modules/debug/component.json           |   19 -
 .../node_modules/debug/package.json             |   28 +-
 .../fsevents/node_modules/debug/.eslintrc       |    3 +
 .../fsevents/node_modules/debug/.travis.yml     |   14 +-
 .../fsevents/node_modules/debug/CHANGELOG.md    |   35 +-
 .../fsevents/node_modules/debug/Makefile        |   44 +-
 .../fsevents/node_modules/debug/README.md       |  180 ++-
 .../fsevents/node_modules/debug/component.json  |   19 -
 .../fsevents/node_modules/debug/package.json    |   30 +-
 .../get-uri/node_modules/debug/.eslintrc        |    3 +
 .../get-uri/node_modules/debug/.travis.yml      |   14 +-
 .../get-uri/node_modules/debug/CHANGELOG.md     |   35 +-
 .../get-uri/node_modules/debug/Makefile         |   44 +-
 .../get-uri/node_modules/debug/README.md        |  180 ++-
 .../get-uri/node_modules/debug/component.json   |   19 -
 .../get-uri/node_modules/debug/package.json     |   28 +-
 node_modules/http-proxy-agent/.npmignore        |    1 -
 node_modules/http-proxy-agent/.travis.yml       |   26 +-
 node_modules/http-proxy-agent/History.md        |   17 +
 .../http-proxy-agent/http-proxy-agent.js        |  110 --
 node_modules/http-proxy-agent/index.js          |  111 ++
 .../node_modules/agent-base/.travis.yml         |   23 +
 .../node_modules/agent-base/History.md          |  113 ++
 .../node_modules/agent-base/README.md           |  145 +++
 .../node_modules/agent-base/index.js            |  160 +++
 .../node_modules/agent-base/package.json        |   69 +
 .../node_modules/agent-base/patch-core.js       |   37 +
 .../node_modules/debug/.coveralls.yml           |    1 -
 .../node_modules/debug/.eslintrc                |   11 -
 .../node_modules/debug/.npmignore               |    9 -
 .../node_modules/debug/.travis.yml              |   14 -
 .../node_modules/debug/CHANGELOG.md             |  362 ------
 .../http-proxy-agent/node_modules/debug/LICENSE |   19 -
 .../node_modules/debug/Makefile                 |   50 -
 .../node_modules/debug/README.md                |  312 -----
 .../node_modules/debug/component.json           |   19 -
 .../node_modules/debug/karma.conf.js            |   70 --
 .../http-proxy-agent/node_modules/debug/node.js |    1 -
 .../node_modules/debug/package.json             |   92 --
 node_modules/http-proxy-agent/package.json      |   34 +-
 node_modules/https-proxy-agent/.npmignore       |    2 -
 node_modules/https-proxy-agent/.travis.yml      |   26 +-
 node_modules/https-proxy-agent/History.md       |   34 +
 node_modules/https-proxy-agent/README.md        |   20 +-
 .../https-proxy-agent/https-proxy-agent.js      |  202 ---
 node_modules/https-proxy-agent/index.js         |  228 ++++
 .../node_modules/agent-base/.travis.yml         |   23 +
 .../node_modules/agent-base/History.md          |  113 ++
 .../node_modules/agent-base/README.md           |  145 +++
 .../node_modules/agent-base/index.js            |  160 +++
 .../node_modules/agent-base/package.json        |   69 +
 .../node_modules/agent-base/patch-core.js       |   37 +
 .../node_modules/debug/.coveralls.yml           |    1 -
 .../node_modules/debug/.eslintrc                |   11 -
 .../node_modules/debug/.npmignore               |    9 -
 .../node_modules/debug/.travis.yml              |   14 -
 .../node_modules/debug/CHANGELOG.md             |  362 ------
 .../node_modules/debug/LICENSE                  |   19 -
 .../node_modules/debug/Makefile                 |   50 -
 .../node_modules/debug/README.md                |  312 -----
 .../node_modules/debug/component.json           |   19 -
 .../node_modules/debug/karma.conf.js            |   70 --
 .../node_modules/debug/node.js                  |    1 -
 .../node_modules/debug/package.json             |   92 --
 node_modules/https-proxy-agent/package.json     |   37 +-
 node_modules/iltorb/build/Release/iltorb.node   |  Bin 865768 -> 865768 bytes
 node_modules/iltorb/build/bindings/iltorb.node  |  Bin 865768 -> 865768 bytes
 node_modules/is-buffer/package.json             |    4 +-
 .../loggly/node_modules/tunnel-agent/index.js   |    9 +-
 .../node_modules/tunnel-agent/package.json      |   24 +-
 node_modules/loggly/package.json                |    3 +-
 .../node_modules/debug/.coveralls.yml           |    1 +
 .../mailgun-js/node_modules/debug/.eslintrc     |   14 +
 .../mailgun-js/node_modules/debug/.jshintrc     |    3 -
 .../mailgun-js/node_modules/debug/.npmignore    |    3 +
 .../mailgun-js/node_modules/debug/.travis.yml   |   20 +
 .../mailgun-js/node_modules/debug/CHANGELOG.md  |  395 ++++++
 .../mailgun-js/node_modules/debug/History.md    |  195 ---
 .../mailgun-js/node_modules/debug/LICENSE       |   19 +
 .../mailgun-js/node_modules/debug/Makefile      |   54 +-
 .../mailgun-js/node_modules/debug/Readme.md     |  276 +++-
 .../mailgun-js/node_modules/debug/bower.json    |   28 -
 .../mailgun-js/node_modules/debug/browser.js    |  168 ---
 .../node_modules/debug/component.json           |   19 -
 .../mailgun-js/node_modules/debug/debug.js      |  197 ---
 .../mailgun-js/node_modules/debug/karma.conf.js |   70 ++
 .../mailgun-js/node_modules/debug/node.js       |  210 +---
 .../node_modules/debug/node_modules/ms/index.js |  152 +++
 .../debug/node_modules/ms/license.md            |   21 +
 .../debug/node_modules/ms/package.json          |   74 ++
 .../debug/node_modules/ms/readme.md             |   51 +
 .../mailgun-js/node_modules/debug/package.json  |   54 +-
 .../mailgun-js/node_modules/ms/package.json     |    6 +-
 node_modules/math-random/.npmignore             |    1 +
 node_modules/math-random/.travis.yml            |    6 +
 node_modules/math-random/browser.js             |   17 +
 node_modules/math-random/node.js                |   13 +
 node_modules/math-random/package.json           |   62 +
 node_modules/math-random/readme.md              |   26 +
 node_modules/math-random/test.js                |   26 +
 node_modules/ms/package.json                    |    2 -
 .../node_modules/tunnel-agent/index.js          |    9 +-
 .../node_modules/tunnel-agent/package.json      |   24 +-
 node_modules/node-sass/package.json             |    3 +-
 .../node_modules/debug/.eslintrc                |    3 +
 .../node_modules/debug/.travis.yml              |   14 +-
 .../node_modules/debug/CHANGELOG.md             |   35 +-
 .../pac-proxy-agent/node_modules/debug/Makefile |   44 +-
 .../node_modules/debug/README.md                |  180 ++-
 .../node_modules/debug/component.json           |   19 -
 .../node_modules/debug/package.json             |   28 +-
 .../portfinder/node_modules/debug/.eslintrc     |    3 +
 .../portfinder/node_modules/debug/.travis.yml   |   14 +-
 .../portfinder/node_modules/debug/CHANGELOG.md  |   35 +-
 .../portfinder/node_modules/debug/Makefile      |   44 +-
 .../portfinder/node_modules/debug/README.md     |  180 ++-
 .../node_modules/debug/component.json           |   19 -
 .../portfinder/node_modules/debug/package.json  |   28 +-
 .../proxy-agent/node_modules/debug/.eslintrc    |    3 +
 .../proxy-agent/node_modules/debug/.travis.yml  |   14 +-
 .../proxy-agent/node_modules/debug/CHANGELOG.md |   35 +-
 .../proxy-agent/node_modules/debug/Makefile     |   44 +-
 .../proxy-agent/node_modules/debug/README.md    |  180 ++-
 .../node_modules/debug/component.json           |   19 -
 .../proxy-agent/node_modules/debug/package.json |   28 +-
 node_modules/randomatic/LICENSE                 |    2 +-
 node_modules/randomatic/README.md               |   68 +-
 node_modules/randomatic/index.js                |    8 +-
 .../randomatic/node_modules/is-number/LICENSE   |    2 +-
 .../randomatic/node_modules/is-number/README.md |   64 +-
 .../randomatic/node_modules/is-number/index.js  |   13 +-
 .../is-number/node_modules/kind-of/LICENSE      |   21 -
 .../is-number/node_modules/kind-of/README.md    |  261 ----
 .../is-number/node_modules/kind-of/index.js     |  116 --
 .../is-number/node_modules/kind-of/package.json |  143 ---
 .../node_modules/is-number/package.json         |   50 +-
 .../node_modules/kind-of/CHANGELOG.md           |  157 +++
 .../randomatic/node_modules/kind-of/LICENSE     |    2 +-
 .../randomatic/node_modules/kind-of/README.md   |  296 +++--
 .../randomatic/node_modules/kind-of/index.js    |  214 ++--
 .../node_modules/kind-of/package.json           |   60 +-
 node_modules/randomatic/package.json            |   59 +-
 node_modules/safe-buffer/package.json           |    2 +
 .../node_modules/debug/.eslintrc                |    3 +
 .../node_modules/debug/.travis.yml              |   14 +-
 .../node_modules/debug/CHANGELOG.md             |   35 +-
 .../node_modules/debug/Makefile                 |   44 +-
 .../node_modules/debug/README.md                |  180 ++-
 .../node_modules/debug/component.json           |   19 -
 .../node_modules/debug/package.json             |   28 +-
 .../socket.io/node_modules/debug/.eslintrc      |    3 +
 .../socket.io/node_modules/debug/.travis.yml    |   14 +-
 .../socket.io/node_modules/debug/CHANGELOG.md   |   35 +-
 .../socket.io/node_modules/debug/Makefile       |   44 +-
 .../socket.io/node_modules/debug/README.md      |  180 ++-
 .../socket.io/node_modules/debug/component.json |   19 -
 .../socket.io/node_modules/debug/package.json   |   28 +-
 node_modules/stringstream/.npmignore            |   15 -
 node_modules/stringstream/package.json          |   20 +-
 node_modules/stringstream/stringstream.js       |    2 +-
 227 files changed, 10197 insertions(+), 5581 deletions(-)
----------------------------------------------------------------------


http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/README.md
----------------------------------------------------------------------
diff --git a/README.md b/README.md
index 1e04a05..4451993 100644
--- a/README.md
+++ b/README.md
@@ -6,16 +6,14 @@ The demo application serves 2 main purposes
 * As a way for code reviewers to validate code changes as well as each `@nifi-fds/core` release 
 * Provides a working example of how an Angular application should leverage the `@nifi-fds/core`.
 
-## Consumers
-
-For developers not interested in building the FDS NgModule you can use **npm** to install the distribution files. (TBD: awaiting 0.1 release).
+## Quick Start
+For developers not interested in building the FDS NgModule you can use **npm** to install the distribution files.
 
 ```bash
 npm install @nifi-fds/core
 ```
 
-#### Setup
-
+#### SystemJS
 If your project is using the SystemJS module loader, you will need to add `@nifi-fds/core` to the configuration:
 
 ```javascript
@@ -100,16 +98,8 @@ You don't have to use Sass to style the rest of your application but you will ne
 
 NOTE: The theme file may be concatenated and minified with the rest of the application's CSS.
 
-## Developers
-The artifacts of the NiFi Flow Design System published to the npm repository are intended to be consumed. For developers interested in contributing to the `@nifi-fds/core` you should use **git** to clone the project:
-
-```bash
-git clone https://github.com/apache/nifi-fds.git
-```
-
 #### Building
-
-Developers can easily build this project using **npm** from the root nifi-fds directory via:
+Developers can perform code changes and easily build this project using **npm** from the root nifi-fds directory via:
 
 ```bash
 npm run clean:install
@@ -134,7 +124,6 @@ npm run dev:install:skipTests
 ```
 
 #### Running locally
-
 Once built you can start the application from the target directory via:
 
 ```bash
@@ -142,35 +131,10 @@ cd target
 npm start
 ```
 
-The demo application should now be availalbe at: [http://127.0.0.1:8080/](http://127.0.0.1:8080/). The port may differ if there is a conflict on 8080. See the output of the start command for the available URLs.
-
-#### Release Management
-
-For developers with permissions releasing a new version of the NiFi Flow Design System is simple with [grunt bump](https://github.com/vojtajina/grunt-bump).
+The demo application should now be available at: [http://127.0.0.1:8080/](http://127.0.0.1:8080/). The port may differ if there is a conflict on 8080. See the output of the start command for the available URLs.
 
-#### Deploying github.io demo
+## Contact us!
+The developer mailing list (dev@nifi.apache.org) is monitored pretty closely, and we tend to respond quickly.  If you have a question, don't hesitate to shoot us an e-mail - we're here to help! Unfortunately, though, e-mails can get lost in the shuffle, so if you do send an e-mail and don't get a response within a day or two, it's our fault - don't worry about bothering us. Just ping the mailing list again.
 
-Before deploying the demo-app to the gh-pages branch please make sure you have the following in your local repo:
- 
-* Configured the apache git repo as a remote
-* Created a local gh-pages branch
-
-```bash
-git remote add apache https://git-wip-us.apache.org/repos/asf/nifi-fds.git
-git branch -f gh-pages
-``` 
-
-Then you can deploy any branch (typically this should be the latest release version) to the nifi-fds github.io from the root nifi-fds directory via:
-
-```bash
-git checkout <branch_name>
-npm run deploy:ghpages
-```
-
-#### npm publish
-Developers can easily publish the latest release artifacts to the public npm registry from the root nifi-fds directory via:
-
-```bash
-npm run publish
-```
-NOTE: These artifacts are maintained under the nifi-fds npm organization.
+## Documentation
+* [Contributing Guidelines](docs/CONTRIBUTING.md)
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/@nifi-fds/core/README.md
----------------------------------------------------------------------
diff --git a/node_modules/@nifi-fds/core/README.md b/node_modules/@nifi-fds/core/README.md
index 1e04a05..4451993 100644
--- a/node_modules/@nifi-fds/core/README.md
+++ b/node_modules/@nifi-fds/core/README.md
@@ -6,16 +6,14 @@ The demo application serves 2 main purposes
 * As a way for code reviewers to validate code changes as well as each `@nifi-fds/core` release 
 * Provides a working example of how an Angular application should leverage the `@nifi-fds/core`.
 
-## Consumers
-
-For developers not interested in building the FDS NgModule you can use **npm** to install the distribution files. (TBD: awaiting 0.1 release).
+## Quick Start
+For developers not interested in building the FDS NgModule you can use **npm** to install the distribution files.
 
 ```bash
 npm install @nifi-fds/core
 ```
 
-#### Setup
-
+#### SystemJS
 If your project is using the SystemJS module loader, you will need to add `@nifi-fds/core` to the configuration:
 
 ```javascript
@@ -100,16 +98,8 @@ You don't have to use Sass to style the rest of your application but you will ne
 
 NOTE: The theme file may be concatenated and minified with the rest of the application's CSS.
 
-## Developers
-The artifacts of the NiFi Flow Design System published to the npm repository are intended to be consumed. For developers interested in contributing to the `@nifi-fds/core` you should use **git** to clone the project:
-
-```bash
-git clone https://github.com/apache/nifi-fds.git
-```
-
 #### Building
-
-Developers can easily build this project using **npm** from the root nifi-fds directory via:
+Developers can perform code changes and easily build this project using **npm** from the root nifi-fds directory via:
 
 ```bash
 npm run clean:install
@@ -134,7 +124,6 @@ npm run dev:install:skipTests
 ```
 
 #### Running locally
-
 Once built you can start the application from the target directory via:
 
 ```bash
@@ -142,35 +131,10 @@ cd target
 npm start
 ```
 
-The demo application should now be availalbe at: [http://127.0.0.1:8080/](http://127.0.0.1:8080/). The port may differ if there is a conflict on 8080. See the output of the start command for the available URLs.
-
-#### Release Management
-
-For developers with permissions releasing a new version of the NiFi Flow Design System is simple with [grunt bump](https://github.com/vojtajina/grunt-bump).
+The demo application should now be available at: [http://127.0.0.1:8080/](http://127.0.0.1:8080/). The port may differ if there is a conflict on 8080. See the output of the start command for the available URLs.
 
-#### Deploying github.io demo
+## Contact us!
+The developer mailing list (dev@nifi.apache.org) is monitored pretty closely, and we tend to respond quickly.  If you have a question, don't hesitate to shoot us an e-mail - we're here to help! Unfortunately, though, e-mails can get lost in the shuffle, so if you do send an e-mail and don't get a response within a day or two, it's our fault - don't worry about bothering us. Just ping the mailing list again.
 
-Before deploying the demo-app to the gh-pages branch please make sure you have the following in your local repo:
- 
-* Configured the apache git repo as a remote
-* Created a local gh-pages branch
-
-```bash
-git remote add apache https://git-wip-us.apache.org/repos/asf/nifi-fds.git
-git branch -f gh-pages
-``` 
-
-Then you can deploy any branch (typically this should be the latest release version) to the nifi-fds github.io from the root nifi-fds directory via:
-
-```bash
-git checkout <branch_name>
-npm run deploy:ghpages
-```
-
-#### npm publish
-Developers can easily publish the latest release artifacts to the public npm registry from the root nifi-fds directory via:
-
-```bash
-npm run publish
-```
-NOTE: These artifacts are maintained under the nifi-fds npm organization.
+## Documentation
+* [Contributing Guidelines](docs/CONTRIBUTING.md)
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/@nifi-fds/core/common/styles/_inputs.scss
----------------------------------------------------------------------
diff --git a/node_modules/@nifi-fds/core/common/styles/_inputs.scss b/node_modules/@nifi-fds/core/common/styles/_inputs.scss
index cbcd08e..c7131cf 100644
--- a/node_modules/@nifi-fds/core/common/styles/_inputs.scss
+++ b/node_modules/@nifi-fds/core/common/styles/_inputs.scss
@@ -19,6 +19,7 @@
 
 body[fds] .mat-input-container {
   min-width: 200px;
+  width: 100%;
 }
 
 body[fds] .mat-input-wrapper {
@@ -32,7 +33,7 @@ body[fds] input.mat-input-element, body[fds] textarea.mat-input-element {
   border: 1px solid $grey8;
   height: 32px;
   padding: 0px 10px;
-  width: calc(100% - 26px);
+  width: calc(100% - 20px);
 }
 
 body[fds] textarea.mat-input-element {
@@ -87,7 +88,6 @@ body[fds] .mat-form-field-can-float .mat-form-field-autofill-control:-webkit-aut
 
 body[fds] .input-button {
   top: 5px;
-  left: -4px;
   border-left: none !important;
 }
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css
----------------------------------------------------------------------
diff --git a/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css b/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css
index 26e7c54..23df3d8 100644
--- a/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css
+++ b/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css
@@ -1,3 +1,3 @@
-@font-face{font-family:'Roboto';font-style:normal;font-weight:300;src:local("Roboto Light"),local("Roboto-Light"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-Light.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:italic;font-weight:300;src:local("Roboto LightItalic"),local("Roboto-LightItalic"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-LightItalic.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:normal;font-weight:normal;src:local("Roboto Regular"),local("Roboto-Regular"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-Regular.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:normal;font-weight:500;src:local("Roboto Medium"),local("Roboto-Medium"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-Medium.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:normal;font-weight:bold;src:local("Roboto Bold"),local("Roboto-Bold"),url("../../../../../roboto-fontface/fonts/roboto/R
 oboto-Bold.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:italic;font-weight:normal;src:local("Roboto Italic"),local("Roboto-Italic"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-RegularItalic.ttf") format("truetype")}@font-face{font-family:'Roboto Slab';font-style:normal;font-weight:normal;src:local("RobotoSlab Regular"),local("RobotoSlab-Regular"),url("../../../../../roboto-fontface/fonts/roboto-slab/Roboto-Slab-Regular.ttf") format("truetype")}@font-face{font-family:'Roboto Slab';font-style:normal;font-weight:bold;src:local("RobotoSlab Bold"),local("RobotoSlab-Bold"),url("../../../../../roboto-fontface/fonts/roboto-slab/Roboto-Slab-Bold.ttf") format("truetype")}body,html{height:100%}body,button,input,label,select,td,textarea{font-family:"Roboto",sans-serif;font-size:14px}body{color:#333}strong{font-weight:bold}pre{overflow-x:auto}em{font-style:italic}h1,h2,h3,h4,h5,h6{font-family:"Roboto",sans-serif;font-weight:normal;font-style:normal;background:#
 FFFFFF}h1{color:#333}h2{color:#666}table{font-family:"Roboto",sans-serif;font-size:13px;color:#666}.camel-case{text-transform:capitalize}.header{font-family:"Roboto Medium",sans-serif;font-size:16px;color:#333;padding-bottom:10px}.help-icon{font-size:12px;color:#1491C1}.details-header{height:92px}.details-header-container{position:relative;top:22px;left:10px}.description{font-family:"Roboto Light",sans-serif;font-size:12px;color:#666}.description i{padding-right:5px}.label{font-family:"Roboto Medium",sans-serif;font-size:14px;color:#333;text-transform:uppercase}.units{font-family:"Roboto Light",sans-serif;font-size:14px;color:#333}.align-vertical{margin-top:auto;margin-bottom:auto}.align-horizontal{margin-left:auto;margin-right:auto}.fill-available-width{width:100%}.pointer{cursor:pointer}body[fds] .expansion-panel-filter-toggle-group{box-shadow:none !important}body[fds] .expansion-panel-filter-toggle-group .mat-button-toggle{height:75px;width:125px;border:1px solid #ccc}body[fds] .
 expansion-panel-filter-toggle-group .mat-button-toggle-label-content{height:100%;width:100%;padding:0;line-height:63px;text-align:center}body[fds] .expansion-panel-filter-toggle-group .mat-button-toggle-checked{background-color:#6B8791;color:white}body[fds] .expansion-panel-filter-toggle-group .mat-button-toggle-checked .md-display-1{color:white}body[fds] .expansion-panel-filter-toggle-group .md-display-1{color:#6B8791}body[fds] .expansion-panel-filter-toggle-group div{line-height:normal}body[fds] .tab-toggle-group{box-shadow:none !important}body[fds] .tab-toggle-group .mat-button-toggle-label-content{border-bottom:2px solid #eee}body[fds] .tab-toggle-group .mat-button-toggle-checked{background:transparent}body[fds] .tab-toggle-group .mat-button-toggle-checked .mat-button-toggle-label-content{border-bottom:2px solid #6B8791;background:transparent}body[fds] .on-off-toggle-group{box-shadow:none !important}body[fds] .on-off-toggle-group .mat-button-toggle{height:20px;width:35px;border:
 1px solid #ccc}body[fds] .on-off-toggle-group .mat-button-toggle-label-content{height:100%;width:100%;padding:0;line-height:20px;text-align:center}body[fds] .on-off-toggle-group .mat-button-toggle-checked{background-color:#6B8791;color:white;border:1px solid #6B8791}body[fds] .off-toggle.mat-button-toggle-checked{background-color:#ccc;color:#333;border:1px solid #ccc}body[fds] .mat-checkbox-inner-container{height:10px !important;width:10px !important}body[fds] .mat-checkbox-frame{height:10px;width:10px;border-color:#ddd}body[fds] .mat-checkbox-ripple{left:-7px;top:-7px;right:-7px;bottom:-7px}body[fds] .mat-checkbox-indeterminate.mat-accent .mat-checkbox-background,body[fds] .mat-checkbox-checked.mat-accent .mat-checkbox-background{background-color:#6B8791}body[fds] .mat-checkbox-inner-container:hover{background-color:#6B8791;border-radius:2px}body[fds] .mat-checkbox-background{height:10px;width:10px}body[fds] .mat-pseudo-checkbox{height:10px !important;width:10px !important;border:1
 px solid #ddd}body[fds] .mat-pseudo-checkbox:hover{background-color:#6B8791;border:1px solid #6B8791}body[fds] .mat-pseudo-checkbox-checked::after{content:'\f00c';font-size:8px;font-family:fontawesome;margin-top:-9px;margin-left:-1px;border:none;transform:initial}body[fds] .mat-pseudo-checkbox-checked,body[fds] .mat-pseudo-checkbox-indeterminate{background-color:#6B8791;border:1px solid #6B8791;height:10px;width:10px}body[fds] .mat-checkbox-disabled{cursor:not-allowed}body[fds] .mat-radio-container{height:12px;width:12px}body[fds] .mat-radio-outer-circle{height:12px;width:12px;background-color:#FFFFFF;border:1px solid #ddd}body[fds] .mat-radio-outer-circle:hover{background-color:#6B8791;border-color:#6B8791}body[fds] .mat-radio-checked .mat-radio-outer-circle{border:1px solid #6B8791;background-color:#6B8791}body[fds] .mat-radio-button.mat-accent.mat-radio-checked .mat-radio-outer-circle{border-color:#6B8791}body[fds] .mat-radio-inner-circle{height:10px;width:10px;left:1px;top:1px;b
 ackground-color:#FFFFFF}body[fds] .mat-radio-checked .mat-radio-inner-circle{background-color:#FFFFFF}body[fds] .mat-chip{border-radius:2px;font-size:10px;font-family:"Roboto",sans-serif;font-style:normal;font-weight:normal;padding:4px 12px 4px 12px}body[fds] .mat-chip i{margin-left:10px;float:right;margin-top:2px}body[fds] .mat-basic-chip{color:#666;height:24px;margin:22px 8px 0 0}body[fds] .mat-basic-chip.td-chip-after-pad{padding:4px 12px 4px 12px}body[fds] .mat-basic-chip i{margin-left:10px;float:right;margin-top:2px}body[fds] .mat-basic-chip .td-chip{font-size:10px;min-height:unset;line-height:20px;position:relative;top:-2px}body[fds] .td-chip span{white-space:nowrap;overflow:hidden;text-overflow:ellipsis;width:65px}body[fds] .td-chip-disabled .td-chip{padding:0px 0px 0px 12px}body[fds] .mat-basic-chip mat-icon.td-chip-removal{font-size:15px;margin-bottom:7px}body[fds] .mat-dialog-container{padding:20px;width:400px}body[fds] .mat-tab-label{line-height:72px;text-transform:upperc
 ase;color:#666}body[fds] .mat-tab-label:hover:not([disabled]){color:#333}body[fds] .mat-tab-label:focus:not([disabled]){background-color:#FFFFFF}body[fds] .mat-tab-label-active{color:#333}body[fds] .mat-tab-nav-bar,body[fds] .mat-tab-header{border-bottom:0px}body[fds] .mat-input-container{min-width:200px}body[fds] .mat-input-wrapper{margin:0;padding-bottom:0}body[fds] input.mat-input-element,body[fds] textarea.mat-input-element{border-radius:2px;color:#666;border:1px solid #CFD3D7;height:32px;padding:0px 10px;width:calc(100% - 26px)}body[fds] textarea.mat-input-element{padding:10px 10px}body[fds] input.mat-input-element[disabled],body[fds] textarea.mat-input-element[disabled]{background:#b2b8c1;color:#dbdee2;border:1px solid #b2b8c1}body[fds] .mat-input-subscript-wrapper{margin-top:18px;width:calc(100% - 23px)}body[fds] input.mat-input-element:focus,body[fds] textarea.mat-input-element:focus{border-color:#6B8791}body[fds] .mat-input-underline{display:none}body[fds] .mat-input-placeh
 older{font-size:14px;color:#999;font-weight:300}body[fds] .mat-input-placeholder{top:27px;left:10px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;width:calc(100% - 44px)}body[fds] mat-input-container.mat-focused .mat-input-placeholder{transform:translateY(-26px) translateX(-10px) scale(0.75)}body[fds] .mat-form-field-can-float.mat-form-field-should-float .mat-form-field-placeholder{transform:translateY(-26px) translateX(-10px) scale(0.75)}body[fds] .mat-form-field-can-float .mat-form-field-autofill-control:-webkit-autofill+.mat-form-field-placeholder-wrapper .mat-form-field-placeholder{transform:translateY(-26px) translateX(-10px) scale(0.75)}body[fds] .input-button{top:5px;left:-4px;border-left:none !important}body[fds] .input-button.mat-raised-button[disabled]{opacity:1}body[fds] td-chips .mat-input-placeholder-wrapper::after{content:'\f0b0';display:inline-table;font-family:FontAwesome;float:right;margin:15px 10px 0px 0px;color:#999}body[fds] .mat-hint{color:#999}body[
 fds] .md-card-title{font-size:20px;color:#333;margin-bottom:0px}body[fds] md-card-title{padding-top:20px;padding-left:20px;padding-right:20px}body[fds] .md-card-subtitle{padding-left:20px;padding-right:20px;padding-top:10px;margin-bottom:0px}body[fds] .md-card-content{color:#666;padding:10px 20px 20px 20px;margin:0px}body[fds] .md-card .md-card-actions:last-child,body[fds] .md-card .md-card .md-card-actions:last-child{padding:0px 20px 20px 20px;margin:0px}body[fds] .fds-panel-menu-button{position:absolute;right:0px;z-index:2}body[fds] .mat-progress-bar-buffer{background-color:#ccc}body[fds] .link{color:#6B8791;font-size:14px;text-decoration:none;line-height:24px;cursor:pointer}body[fds] .link:hover{text-decoration:underline}body[fds] .link .disabled{color:#333;text-decoration:none}body[fds] .mat-sidenav-container{height:100%}.td-step-header span{display:none}body[fds] .mat-tooltip{background:#666;opacity:.9;box-shadow:inset 0px 0px 3px 0px #1391c1}body[fds] .td-data-table-cell{font-
 size:13px;color:#666;padding:0 28px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;height:100%;line-height:30px}body[fds] .td-data-table-column{color:#999;font-weight:normal}body[fds] .td-data-table-row{height:34px;border-top:1px solid #fff;border-left:1px solid #fff;border-right:1px solid #fff;border-bottom:1px solid #eee}body[fds] .td-data-table-row.selected{background-color:#eee;border:1px solid #eee}body[fds] .td-data-table-row:hover{background-color:#F8F9F9;border:1px solid #B2C1C6}body[fds] .td-data-table-cell .mat-icon-button{color:#6B8791}body[fds] .td-data-table-cell .mat-icon-button:disabled{color:#808793;cursor:not-allowed}body[fds] .td-data-table-cell .mat-button,body[fds] .td-data-table-cell .mat-icon-button,body[fds] .td-data-table-cell .mat-raised-button{height:24px;width:24px;line-height:0}body[fds] .td-data-table-cell .mat-icon-button.badge{border-top-left-radius:0px;border-top-right-radius:0px}body[fds] .td-data-table-cell .mat-icon-button.badge[disabled
 ]{opacity:.3}body[fds] .td-data-table-column{font-size:12px;color:#999;height:34px;line-height:34px;padding:0 28px;white-space:nowrap;text-overflow:ellipsis;overflow:hidden}body[fds] .td-data-table-column .fa-caret-up,body[fds] .td-data-table-column .fa-caret-down{color:#6B8791;font-size:12px;margin-bottom:2px}body[fds] td-paging-bar{color:#999}body[fds] td-paging-bar mat-select .mat-select-value,body[fds] td-paging-bar mat-select .mat-select-arrow{color:#6B8791}body[fds] .table-title{font-size:20px;color:#333;min-width:250px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;max-width:50%;margin-right:10px}body[fds] div .td-data-table{border-bottom:2px solid #ddd;border-right:1px transparent;border-left:1px transparent}.fds-dialog-title{margin-top:0;margin-bottom:20px}body[fds] snack-bar-container{background:#FFFFFF;padding:0;box-shadow:0px 0px 3px 0px #1391c1}fds-snackbar-title mat-icon.mat-icon.mat-primary.material-icons{font-size:10px;height:10px;width:10px;line-height:10
 px;color:#999}.fds-coaster-message{font-size:12px}.fds-snackbar-title{font-size:14px}.fds-snackbar-title i{font-size:24px}.fds-coaster-icon{position:absolute;top:24px;left:15px}.coaster-close-icon{height:10px !important;width:10px !important;line-height:10px !important;right:10px;position:absolute !important;top:10px}.fds-snackbar-wrapper{border-radius:2px;border-width:1px;border-style:solid}
+@font-face{font-family:'Roboto';font-style:normal;font-weight:300;src:local("Roboto Light"),local("Roboto-Light"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-Light.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:italic;font-weight:300;src:local("Roboto LightItalic"),local("Roboto-LightItalic"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-LightItalic.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:normal;font-weight:normal;src:local("Roboto Regular"),local("Roboto-Regular"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-Regular.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:normal;font-weight:500;src:local("Roboto Medium"),local("Roboto-Medium"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-Medium.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:normal;font-weight:bold;src:local("Roboto Bold"),local("Roboto-Bold"),url("../../../../../roboto-fontface/fonts/roboto/R
 oboto-Bold.ttf") format("truetype")}@font-face{font-family:'Roboto';font-style:italic;font-weight:normal;src:local("Roboto Italic"),local("Roboto-Italic"),url("../../../../../roboto-fontface/fonts/roboto/Roboto-RegularItalic.ttf") format("truetype")}@font-face{font-family:'Roboto Slab';font-style:normal;font-weight:normal;src:local("RobotoSlab Regular"),local("RobotoSlab-Regular"),url("../../../../../roboto-fontface/fonts/roboto-slab/Roboto-Slab-Regular.ttf") format("truetype")}@font-face{font-family:'Roboto Slab';font-style:normal;font-weight:bold;src:local("RobotoSlab Bold"),local("RobotoSlab-Bold"),url("../../../../../roboto-fontface/fonts/roboto-slab/Roboto-Slab-Bold.ttf") format("truetype")}body,html{height:100%}body,button,input,label,select,td,textarea{font-family:"Roboto",sans-serif;font-size:14px}body{color:#333}strong{font-weight:bold}pre{overflow-x:auto}em{font-style:italic}h1,h2,h3,h4,h5,h6{font-family:"Roboto",sans-serif;font-weight:normal;font-style:normal;background:#
 FFFFFF}h1{color:#333}h2{color:#666}table{font-family:"Roboto",sans-serif;font-size:13px;color:#666}.camel-case{text-transform:capitalize}.header{font-family:"Roboto Medium",sans-serif;font-size:16px;color:#333;padding-bottom:10px}.help-icon{font-size:12px;color:#1491C1}.details-header{height:92px}.details-header-container{position:relative;top:22px;left:10px}.description{font-family:"Roboto Light",sans-serif;font-size:12px;color:#666}.description i{padding-right:5px}.label{font-family:"Roboto Medium",sans-serif;font-size:14px;color:#333;text-transform:uppercase}.units{font-family:"Roboto Light",sans-serif;font-size:14px;color:#333}.align-vertical{margin-top:auto;margin-bottom:auto}.align-horizontal{margin-left:auto;margin-right:auto}.fill-available-width{width:100%}.pointer{cursor:pointer}body[fds] .expansion-panel-filter-toggle-group{box-shadow:none !important}body[fds] .expansion-panel-filter-toggle-group .mat-button-toggle{height:75px;width:125px;border:1px solid #ccc}body[fds] .
 expansion-panel-filter-toggle-group .mat-button-toggle-label-content{height:100%;width:100%;padding:0;line-height:63px;text-align:center}body[fds] .expansion-panel-filter-toggle-group .mat-button-toggle-checked{background-color:#6B8791;color:white}body[fds] .expansion-panel-filter-toggle-group .mat-button-toggle-checked .md-display-1{color:white}body[fds] .expansion-panel-filter-toggle-group .md-display-1{color:#6B8791}body[fds] .expansion-panel-filter-toggle-group div{line-height:normal}body[fds] .tab-toggle-group{box-shadow:none !important}body[fds] .tab-toggle-group .mat-button-toggle-label-content{border-bottom:2px solid #eee}body[fds] .tab-toggle-group .mat-button-toggle-checked{background:transparent}body[fds] .tab-toggle-group .mat-button-toggle-checked .mat-button-toggle-label-content{border-bottom:2px solid #6B8791;background:transparent}body[fds] .on-off-toggle-group{box-shadow:none !important}body[fds] .on-off-toggle-group .mat-button-toggle{height:20px;width:35px;border:
 1px solid #ccc}body[fds] .on-off-toggle-group .mat-button-toggle-label-content{height:100%;width:100%;padding:0;line-height:20px;text-align:center}body[fds] .on-off-toggle-group .mat-button-toggle-checked{background-color:#6B8791;color:white;border:1px solid #6B8791}body[fds] .off-toggle.mat-button-toggle-checked{background-color:#ccc;color:#333;border:1px solid #ccc}body[fds] .mat-checkbox-inner-container{height:10px !important;width:10px !important}body[fds] .mat-checkbox-frame{height:10px;width:10px;border-color:#ddd}body[fds] .mat-checkbox-ripple{left:-7px;top:-7px;right:-7px;bottom:-7px}body[fds] .mat-checkbox-indeterminate.mat-accent .mat-checkbox-background,body[fds] .mat-checkbox-checked.mat-accent .mat-checkbox-background{background-color:#6B8791}body[fds] .mat-checkbox-inner-container:hover{background-color:#6B8791;border-radius:2px}body[fds] .mat-checkbox-background{height:10px;width:10px}body[fds] .mat-pseudo-checkbox{height:10px !important;width:10px !important;border:1
 px solid #ddd}body[fds] .mat-pseudo-checkbox:hover{background-color:#6B8791;border:1px solid #6B8791}body[fds] .mat-pseudo-checkbox-checked::after{content:'\f00c';font-size:8px;font-family:fontawesome;margin-top:-9px;margin-left:-1px;border:none;transform:initial}body[fds] .mat-pseudo-checkbox-checked,body[fds] .mat-pseudo-checkbox-indeterminate{background-color:#6B8791;border:1px solid #6B8791;height:10px;width:10px}body[fds] .mat-checkbox-disabled{cursor:not-allowed}body[fds] .mat-radio-container{height:12px;width:12px}body[fds] .mat-radio-outer-circle{height:12px;width:12px;background-color:#FFFFFF;border:1px solid #ddd}body[fds] .mat-radio-outer-circle:hover{background-color:#6B8791;border-color:#6B8791}body[fds] .mat-radio-checked .mat-radio-outer-circle{border:1px solid #6B8791;background-color:#6B8791}body[fds] .mat-radio-button.mat-accent.mat-radio-checked .mat-radio-outer-circle{border-color:#6B8791}body[fds] .mat-radio-inner-circle{height:10px;width:10px;left:1px;top:1px;b
 ackground-color:#FFFFFF}body[fds] .mat-radio-checked .mat-radio-inner-circle{background-color:#FFFFFF}body[fds] .mat-chip{border-radius:2px;font-size:10px;font-family:"Roboto",sans-serif;font-style:normal;font-weight:normal;padding:4px 12px 4px 12px}body[fds] .mat-chip i{margin-left:10px;float:right;margin-top:2px}body[fds] .mat-basic-chip{color:#666;height:24px;margin:22px 8px 0 0}body[fds] .mat-basic-chip.td-chip-after-pad{padding:4px 12px 4px 12px}body[fds] .mat-basic-chip i{margin-left:10px;float:right;margin-top:2px}body[fds] .mat-basic-chip .td-chip{font-size:10px;min-height:unset;line-height:20px;position:relative;top:-2px}body[fds] .td-chip span{white-space:nowrap;overflow:hidden;text-overflow:ellipsis;width:65px}body[fds] .td-chip-disabled .td-chip{padding:0px 0px 0px 12px}body[fds] .mat-basic-chip mat-icon.td-chip-removal{font-size:15px;margin-bottom:7px}body[fds] .mat-dialog-container{padding:20px;width:400px}body[fds] .mat-tab-label{line-height:72px;text-transform:upperc
 ase;color:#666}body[fds] .mat-tab-label:hover:not([disabled]){color:#333}body[fds] .mat-tab-label:focus:not([disabled]){background-color:#FFFFFF}body[fds] .mat-tab-label-active{color:#333}body[fds] .mat-tab-nav-bar,body[fds] .mat-tab-header{border-bottom:0px}body[fds] .mat-input-container{min-width:200px;width:100%}body[fds] .mat-input-wrapper{margin:0;padding-bottom:0}body[fds] input.mat-input-element,body[fds] textarea.mat-input-element{border-radius:2px;color:#666;border:1px solid #CFD3D7;height:32px;padding:0px 10px;width:calc(100% - 20px)}body[fds] textarea.mat-input-element{padding:10px 10px}body[fds] input.mat-input-element[disabled],body[fds] textarea.mat-input-element[disabled]{background:#b2b8c1;color:#dbdee2;border:1px solid #b2b8c1}body[fds] .mat-input-subscript-wrapper{margin-top:18px;width:calc(100% - 23px)}body[fds] input.mat-input-element:focus,body[fds] textarea.mat-input-element:focus{border-color:#6B8791}body[fds] .mat-input-underline{display:none}body[fds] .mat-i
 nput-placeholder{font-size:14px;color:#999;font-weight:300}body[fds] .mat-input-placeholder{top:27px;left:10px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;width:calc(100% - 44px)}body[fds] mat-input-container.mat-focused .mat-input-placeholder{transform:translateY(-26px) translateX(-10px) scale(0.75)}body[fds] .mat-form-field-can-float.mat-form-field-should-float .mat-form-field-placeholder{transform:translateY(-26px) translateX(-10px) scale(0.75)}body[fds] .mat-form-field-can-float .mat-form-field-autofill-control:-webkit-autofill+.mat-form-field-placeholder-wrapper .mat-form-field-placeholder{transform:translateY(-26px) translateX(-10px) scale(0.75)}body[fds] .input-button{top:5px;border-left:none !important}body[fds] .input-button.mat-raised-button[disabled]{opacity:1}body[fds] td-chips .mat-input-placeholder-wrapper::after{content:'\f0b0';display:inline-table;font-family:FontAwesome;float:right;margin:15px 10px 0px 0px;color:#999}body[fds] .mat-hint{color:#999}body
 [fds] .md-card-title{font-size:20px;color:#333;margin-bottom:0px}body[fds] md-card-title{padding-top:20px;padding-left:20px;padding-right:20px}body[fds] .md-card-subtitle{padding-left:20px;padding-right:20px;padding-top:10px;margin-bottom:0px}body[fds] .md-card-content{color:#666;padding:10px 20px 20px 20px;margin:0px}body[fds] .md-card .md-card-actions:last-child,body[fds] .md-card .md-card .md-card-actions:last-child{padding:0px 20px 20px 20px;margin:0px}body[fds] .fds-panel-menu-button{position:absolute;right:0px;z-index:2}body[fds] .mat-progress-bar-buffer{background-color:#ccc}body[fds] .link{color:#6B8791;font-size:14px;text-decoration:none;line-height:24px;cursor:pointer}body[fds] .link:hover{text-decoration:underline}body[fds] .link .disabled{color:#333;text-decoration:none}body[fds] .mat-sidenav-container{height:100%}.td-step-header span{display:none}body[fds] .mat-tooltip{background:#666;opacity:.9;box-shadow:inset 0px 0px 3px 0px #1391c1}body[fds] .td-data-table-cell{font
 -size:13px;color:#666;padding:0 28px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;height:100%;line-height:30px}body[fds] .td-data-table-column{color:#999;font-weight:normal}body[fds] .td-data-table-row{height:34px;border-top:1px solid #fff;border-left:1px solid #fff;border-right:1px solid #fff;border-bottom:1px solid #eee}body[fds] .td-data-table-row.selected{background-color:#eee;border:1px solid #eee}body[fds] .td-data-table-row:hover{background-color:#F8F9F9;border:1px solid #B2C1C6}body[fds] .td-data-table-cell .mat-icon-button{color:#6B8791}body[fds] .td-data-table-cell .mat-icon-button:disabled{color:#808793;cursor:not-allowed}body[fds] .td-data-table-cell .mat-button,body[fds] .td-data-table-cell .mat-icon-button,body[fds] .td-data-table-cell .mat-raised-button{height:24px;width:24px;line-height:0}body[fds] .td-data-table-cell .mat-icon-button.badge{border-top-left-radius:0px;border-top-right-radius:0px}body[fds] .td-data-table-cell .mat-icon-button.badge[disable
 d]{opacity:.3}body[fds] .td-data-table-column{font-size:12px;color:#999;height:34px;line-height:34px;padding:0 28px;white-space:nowrap;text-overflow:ellipsis;overflow:hidden}body[fds] .td-data-table-column .fa-caret-up,body[fds] .td-data-table-column .fa-caret-down{color:#6B8791;font-size:12px;margin-bottom:2px}body[fds] td-paging-bar{color:#999}body[fds] td-paging-bar mat-select .mat-select-value,body[fds] td-paging-bar mat-select .mat-select-arrow{color:#6B8791}body[fds] .table-title{font-size:20px;color:#333;min-width:250px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;max-width:50%;margin-right:10px}body[fds] div .td-data-table{border-bottom:2px solid #ddd;border-right:1px transparent;border-left:1px transparent}.fds-dialog-title{margin-top:0;margin-bottom:20px}body[fds] snack-bar-container{background:#FFFFFF;padding:0;box-shadow:0px 0px 3px 0px #1391c1}fds-snackbar-title mat-icon.mat-icon.mat-primary.material-icons{font-size:10px;height:10px;width:10px;line-height:1
 0px;color:#999}.fds-coaster-message{font-size:12px}.fds-snackbar-title{font-size:14px}.fds-snackbar-title i{font-size:24px}.fds-coaster-icon{position:absolute;top:24px;left:15px}.coaster-close-icon{height:10px !important;width:10px !important;line-height:10px !important;right:10px;position:absolute !important;top:10px}.fds-snackbar-wrapper{border-radius:2px;border-width:1px;border-style:solid}
 
 /*# sourceMappingURL=flow-design-system.min.css.map */
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.gz
----------------------------------------------------------------------
diff --git a/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.gz b/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.gz
index a482166..982cf4e 100644
Binary files a/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.gz and b/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.gz differ

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.map
----------------------------------------------------------------------
diff --git a/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.map b/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.map
index 4b20356..fc0901b 100644
--- a/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.map
+++ b/node_modules/@nifi-fds/core/common/styles/css/flow-design-system.min.css.map
@@ -24,5 +24,5 @@
 		"../../../snackbars/coaster/_coaster.component.scss"
 	],
 	"names": [],
-	"mappings": "AEiBA,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,GAAG,CAChB,GAAG,CAAE,qBAAqB,CAAE,qBAAqB,CAAE,mEAAmE,CAAC,kBAAkB,CAG3I,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,GAAG,CAChB,GAAG,CAAE,2BAA2B,CAAE,2BAA2B,CAAE,yEAAyE,CAAC,kBAAkB,CAG7J,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,MAAM,CACnB,GAAG,CAAE,uBAAuB,CAAE,uBAAuB,CAAE,qEAAqE,CAAC,kBAAkB,CAGjJ,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,GAAG,CAChB,GAAG,CAAE,sBAAsB,CAAE,sBAAsB,CAAE,oEAAoE,CAAC,kBAAkB,CAG9I,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,IAAI,CACjB,GAAG,CAAE,oBAAoB,CAAE,oBAAoB,CAAE,kEAAkE,CAAC,kBAAkB,CAGxI,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,MAAM,CACnB,GAAG,CAAE,sBAAsB,CAAE,sBAAsB,CAAE,2EAA2E,CAAC,kBAAkB,CAGrJ,UAAU,CACR,WAAW,CAAE,aAAa,CAC1B,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,MAAM,CACnB,GAAG,CAAE,2BAA2B,CAAE,2BAA2B,CAAE,+EAA+E,CAAC,kBAAkB,CAGnK,UAAU,CACR,WAAW,CAAE,aAAa,CAC1B,UAAU,CAAE,MAAM,CAClB,W
 AAW,CAAE,IAAI,CACjB,GAAG,CAAE,wBAAwB,CAAE,wBAAwB,CAAE,4EAA4E,CAAC,kBAAkB,CAG1J,AAAA,IAAI,CACJ,IAAI,AAAC,CACH,MAAM,CAAE,IAAI,CACb,AAED,AAAA,IAAI,CACJ,MAAM,CACN,KAAK,CACL,KAAK,CACL,MAAM,CACN,EAAE,CACF,QAAQ,AAAC,CACP,WAAW,CDlEC,QAAQ,CACtB,UAAU,CCkER,SAAS,CAAE,IAAI,CAChB,AAED,AAAA,IAAI,AAAC,CACH,KAAK,CD5DC,IAAO,CC6Dd,AAED,AAAA,MAAM,AAAC,CACL,WAAW,CAAE,IAAI,CAClB,AAED,AAAA,GAAG,AAAC,CACF,UAAU,CAAE,IAAI,CACjB,AAED,AAAA,EAAE,AAAC,CACD,UAAU,CAAE,MAAM,CACnB,AAED,AAAA,EAAE,CACF,EAAE,CACF,EAAE,CACF,EAAE,CACF,EAAE,CACF,EAAE,AAAC,CACD,WAAW,CD5FC,QAAQ,CACtB,UAAU,CC4FR,WAAW,CAAE,MAAM,CACnB,UAAU,CAAE,MAAM,CAClB,UAAU,CAAE,OAAO,CACpB,AAED,AAAA,EAAE,AAAC,CACD,KAAK,CDxFC,IAAO,CCyFd,AAED,AAAA,EAAE,AAAC,CACD,KAAK,CD3FC,IAAO,CC4Fd,AAED,AAAA,KAAK,AAAC,CACJ,WAAW,CD3GC,QAAQ,CACtB,UAAU,CC2GR,SAAS,CAAE,IAAI,CACf,KAAK,CDjGC,IAAO,CCkGd,AC9GD,AAAA,WAAW,AAAC,CACV,cAAc,CAAE,UAAU,CAC3B,AAED,AAAA,OAAO,AAAC,CACN,WAAW,CFDA,eAAe,CAC5B,UAAU,CECR,SAAS,CAAE,IAAI,CACf,KAAK,CFIC,IAAO,CEHb,cAAc,CAAE,IAAI,CACrB,AAED,AAAA,UAAU,
 AAAC,CACT,SAAS,CAAE,IAAI,CACf,KAAK,CFWC,OAAO,CEVd,AAED,AAAA,eAAe,AAAC,CACd,MAAM,CAAE,IAAI,CACb,AAED,AAAA,yBAAyB,AAAC,CACxB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,IAAI,CACX,AAED,AAAA,YAAY,AAAC,CACX,WAAW,CFrBD,cAAc,CAC1B,UAAU,CEqBR,SAAS,CAAE,IAAI,CACf,KAAK,CFjBC,IAAO,CEkBd,AAED,AAAA,YAAY,CAAC,CAAC,AAAC,CACb,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,MAAM,AAAC,CACL,WAAW,CFjCA,eAAe,CAC5B,UAAU,CEiCR,SAAS,CAAE,IAAI,CACf,KAAK,CF5BC,IAAO,CE6Bb,cAAc,CAAE,SAAS,CAC1B,AAED,AAAA,MAAM,AAAC,CACL,WAAW,CFtCD,cAAc,CAC1B,UAAU,CEsCR,SAAS,CAAE,IAAI,CACf,KAAK,CFnCC,IAAO,CEoCd,AAED,AAAA,eAAe,AAAC,CACd,UAAU,CAAE,IAAI,CAChB,aAAa,CAAE,IAAI,CACpB,AAED,AAAA,iBAAiB,AAAC,CAChB,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CACnB,AAED,AAAA,qBAAqB,AAAC,CACpB,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,QAAQ,AAAC,CACP,MAAM,CAAE,OAAO,CAChB,ACnED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,AAAC,CAC7C,UAAU,CAAE,eAAe,CAC5B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,kBAAkB,AAAC,CAChE,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,GAAG,
 CAAC,KAAK,CHSX,IAAO,CGRd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,gCAAgC,AAAC,CAC9E,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,CAAC,CACV,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,0BAA0B,AAAC,CACxE,gBAAgB,CHwBL,OAAO,CGvBlB,KAAK,CAAE,KAAK,CACb,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,0BAA0B,CAAC,aAAa,AAAC,CACtF,KAAK,CAAE,KAAK,CACb,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,aAAa,AAAC,CAC3D,KAAK,CHeM,OAAO,CGdnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,GAAG,AAAC,CACjD,WAAW,CAAE,MAAM,CACpB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,AAAC,CAC1B,UAAU,CAAE,eAAe,CAC5B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,CAAC,gCAAgC,AAAC,CAC3D,aAAa,CAAE,GAAG,CAAC,KAAK,CHvBlB,IAAO,CGwBd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,CAAC,0BAA0B,AAAC,CACrD,UAAU,CAAE,WAAW,CACxB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,CAAC,0BAA0B,CAAC,gCAAgC,AAAC,CACtF,aAAa,CAAE,GAAG,CAAC,KAAK,CHLb,OAAO,CGMlB,U
 AAU,CAAE,WAAW,CACxB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,UAAU,CAAE,eAAe,CAC5B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,CAAC,kBAAkB,AAAC,CAChD,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,GAAG,CAAC,KAAK,CH3CX,IAAO,CG4Cd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,CAAC,gCAAgC,AAAC,CAC9D,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,CAAC,CACV,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,CAAC,0BAA0B,AAAC,CACxD,gBAAgB,CH5BL,OAAO,CG6BlB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,GAAG,CAAC,KAAK,CH9BN,OAAO,CG+BnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,WAAW,AAAA,0BAA0B,AAAC,CAC9C,gBAAgB,CH7DV,IAAO,CG8Db,KAAK,CHjEC,IAAO,CGkEb,MAAM,CAAE,GAAG,CAAC,KAAK,CH/DX,IAAO,CGgEd,AC9ED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,6BAA6B,AAAC,CACtC,MAAM,CAAE,eAAe,CACvB,KAAK,CAAE,eAAe,CACvB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,AAAC,CAC5B,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,YAAY,CJSN,IAAO,CIRd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,o
 BAAoB,AAAC,CAC7B,IAAI,CAAE,IAAI,CACV,GAAG,CAAE,IAAI,CACT,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACb,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,2BAA2B,AAAA,WAAW,CAAC,wBAAwB,CACzE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAA,WAAW,CAAC,wBAAwB,AAAC,CAClE,gBAAgB,CJqBL,OAAO,CIpBnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,6BAA6B,AAAA,MAAM,AAAC,CAC5C,gBAAgB,CJiBL,OAAO,CIhBlB,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,wBAAwB,AAAC,CACjC,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACZ,AAID,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,MAAM,CAAE,eAAe,CACvB,KAAK,CAAE,eAAe,CACtB,MAAM,CAAE,GAAG,CAAC,KAAK,CJrBX,IAAO,CIsBd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAA,MAAM,AAAC,CACnC,gBAAgB,CJDL,OAAO,CIElB,MAAM,CAAE,GAAG,CAAC,KAAK,CJFN,OAAO,CIGnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,4BAA4B,AAAA,OAAO,AAAC,CAC5C,OAAO,CAAE,OAAO,CAChB,SAAS,CAAE,GAAG,CACd,WAAW,CAAE,WAAW,CACxB,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,IAAI,CACjB,MAAM,CAAE,IAAI,CACZ,SAAS,CAAE,OAAO,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,A
 AAA,EAAK,4BAA4B,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kCAAkC,AAAC,CACnF,gBAAgB,CJhBL,OAAO,CIiBlB,MAAM,CAAE,GAAG,CAAC,KAAK,CJjBN,OAAO,CIkBlB,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,MAAM,CAAE,WAAW,CACpB,ACjED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,uBAAuB,AAAC,CAChC,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,gBAAgB,CAAE,OAAO,CACzB,MAAM,CAAE,GAAG,CAAC,KAAK,CLQX,IAAO,CKPd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,uBAAuB,AAAA,MAAM,AAAC,CACtC,gBAAgB,CL4BL,OAAO,CK3BlB,YAAY,CL2BD,OAAO,CK1BnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,CAAC,uBAAuB,AAAC,CACnD,MAAM,CAAE,GAAG,CAAC,KAAK,CLuBN,OAAO,CKtBlB,gBAAgB,CLsBL,OAAO,CKrBnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,AAAA,WAAW,AAAA,kBAAkB,CAAC,uBAAuB,AAAC,CAC/E,YAAY,CLkBD,OAAO,CKjBnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,uBAAuB,AAAC,CAChC,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,IAAI,CAAE,GAAG
 ,CACT,GAAG,CAAE,GAAG,CACR,gBAAgB,CAAE,OAAO,CAC1B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,CAAC,uBAAuB,AAAC,CACnD,gBAAgB,CAAE,OAAO,CAC1B,ACpCD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,SAAS,AAAC,CAClB,aAAa,CAAE,GAAG,CAClB,SAAS,CAAE,IAAI,CACf,WAAW,CNHC,QAAQ,CACtB,UAAU,CMGR,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,MAAM,CACnB,OAAO,CAAE,iBAAiB,CAC3B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,SAAS,CAAC,CAAC,AAAC,CACpB,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,GAAG,CAChB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,AAAC,CACxB,KAAK,CNJC,IAAO,CMKb,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,YAAY,CACrB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,AAAA,kBAAkB,AAAC,CAC1C,OAAO,CAAE,iBAAiB,CAC3B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,CAAC,CAAC,AAAC,CAC1B,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,GAAG,CAChB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,CAAC,QAAQ,AAAC,CACjC,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,KAAK,CACjB,WAAW,CAAE,IAAI,CACjB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACV,AAED,AAAA,IAAI,CAAA,AAAA,GAA
 C,AAAA,EAAK,QAAQ,CAAC,IAAI,AAAC,CACtB,WAAW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CACvB,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,CAAC,QAAQ,AAAC,CACnC,OAAO,CAAE,gBAAgB,CAC1B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,CAAC,QAAQ,AAAA,gBAAgB,AAAC,CACjD,SAAS,CAAE,IAAI,CACf,aAAa,CAAE,GAAG,CACnB,ACrDD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAC,CAC9B,OAAO,CAAE,IAAI,CACb,KAAK,CAAE,KAAK,CACb,ACHD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,cAAc,AAAC,CACvB,WAAW,CAAE,IAAI,CACjB,cAAc,CAAE,SAAS,CACzB,KAAK,CRSC,IAAO,CQRd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,cAAc,AAAA,MAAM,AAAA,IAAK,EAAA,AAAA,QAAC,AAAA,EAAW,CAC7C,KAAK,CRIC,IAAO,CQHd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,cAAc,AAAA,MAAM,AAAA,IAAK,EAAA,AAAA,QAAC,AAAA,EAAW,CAC7C,gBAAgB,CAAE,OAAO,CAC1B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAC,CAC9B,KAAK,CRJC,IAAO,CQKd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,gBAAgB,CAC1B,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,AAAC,CACxB,aAAa,CAAE,GAAG,CACnB,ACrBD,AAAA,IAAI,
 CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,SAAS,CAAE,KAAK,CACjB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,AAAC,CAC3B,MAAM,CAAE,CAAC,CACT,cAAc,CAAE,CAAC,CAClB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAA,kBAAkB,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,AAAA,kBAAkB,AAAC,CACtE,aAAa,CAAE,GAAG,CAClB,KAAK,CTCC,IAAO,CSAb,MAAM,CAAE,GAAG,CAAC,KAAK,CTMX,OAAO,CSLb,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,QAAQ,CACjB,KAAK,CAAE,iBAAiB,CACzB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,AAAA,kBAAkB,AAAC,CACnC,OAAO,CAAE,SAAS,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAA,kBAAkB,CAAA,AAAA,QAAC,AAAA,EAAW,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,AAAA,kBAAkB,CAAA,AAAA,QAAC,AAAA,CAAU,CAC1F,UAAU,CTJJ,OAAO,CSKb,KAAK,CTJE,OAAO,CSKd,MAAM,CAAE,GAAG,CAAC,KAAK,CTNX,OAAO,CSOd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,4BAA4B,AAAC,CACrC,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,iBAAiB,CACzB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAA,kBAAkB,AAAA,MAAM,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,AAAA,kBAAkB,AAAA,MAAM,AAAC,CACl
 F,YAAY,CTOD,OAAO,CSNnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,OAAO,CAAE,IAAI,CACd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,SAAS,CAAE,IAAI,CACf,KAAK,CT9BC,IAAO,CS+Bb,WAAW,CAAE,GAAG,CACjB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,IAAI,CACV,WAAW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CACvB,KAAK,CAAE,iBAAiB,CACzB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,AAAA,YAAY,CAAC,sBAAsB,AAAC,CAC/D,SAAS,CAAE,iBAAiB,CAAC,iBAAiB,CAAC,WAAW,CAC3D,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,yBAAyB,AAAA,4BAA4B,CAAC,2BAA2B,AAAC,CAC1F,SAAS,CAAE,iBAAiB,CAAC,iBAAiB,CAAC,WAAU,CAC1D,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,yBAAyB,CAAC,gCAAgC,AAAA,iBAAiB,CAAC,mCAAmC,CAAC,2BAA2B,AAAC,CACpJ,SAAS,CAAE,iBAAiB,CAAC,iBAAiB,CAAC,WAAU,CAC1D,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,AAAC,CACtB,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,IAAI,CACV,WAAW,CAAE,eAAe,CAC7B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,AAAA,kBAAkB,CAAA,AAAA,QAAC
 ,AAAA,CAAU,CAClD,OAAO,CAAE,CAAC,CACX,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,CAAC,8BAA8B,AAAA,OAAO,AAAC,CACvD,OAAO,CAAE,OAAO,CAChB,OAAO,CAAE,YAAY,CACrB,WAAW,CAAE,WAAW,CACxB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,iBAAiB,CACzB,KAAK,CTvEC,IAAO,CSwEd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,SAAS,AAAC,CAClB,KAAK,CT3EC,IAAO,CS4Ed,ACzFD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,cAAc,AAAC,CACvB,SAAS,CAAE,IAAI,CACf,KAAK,CVSC,IAAO,CURb,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,AAAC,CACtB,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CAClB,aAAa,CAAE,IAAI,CACpB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,AAAC,CAC1B,YAAY,CAAE,IAAI,CAClB,aAAa,CAAE,IAAI,CACnB,WAAW,CAAE,IAAI,CACjB,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,gBAAgB,AAAC,CACzB,KAAK,CVRC,IAAO,CUSb,OAAO,CAAE,mBAAmB,CAC5B,MAAM,CAAE,GAAG,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,CAAC,gBAAgB,AAAA,WAAW,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,CAAC,QAAQ,CAAC,gBAAgB,AAAA,WAAW,AAAC,CACtG,OAAO,CAAE,kBAAkB,CAC3B,MAA
 M,CAAE,GAAG,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,GAAG,CACV,OAAO,CAAE,CAAC,CACX,ACpCD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,wBAAwB,AAAC,CAC/B,gBAAgB,CXeZ,IAAO,CWdd,ACAD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAC,CACd,KAAK,CZwCM,OAAO,CYvClB,SAAS,CAAE,IAAI,CACf,eAAe,CAAE,IAAI,CACrB,WAAW,CAAE,IAAI,CACjB,MAAM,CAAE,OAAO,CAChB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAA,MAAM,AAAC,CACpB,eAAe,CAAE,SAAS,CAC3B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,CAAC,SAAS,AAAC,CACxB,KAAK,CZFC,IAAO,CYGb,eAAe,CAAE,IAAI,CACtB,ACjBD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,MAAM,CAAE,IAAI,CACb,ACFD,AAAA,eAAe,CAAC,IAAI,AAAC,CACnB,OAAO,CAAE,IAAI,CACd,ACAD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,YAAY,AAAC,CACrB,UAAU,CfWJ,IAAO,CeVb,OAAO,CAAE,EAAE,CACX,UAAU,CAAE,KAAK,CAAC,GAAG,CAAC,GAAG,CAAC,GAAG,CAAC,GAAG,CAAC,OAAqB,CACxD,ACJD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,AAAC,CAC5B,SAAS,CAAE,IAAI,CACf,KAAK,ChBUC,IAAO,CgBTb,OAAO,CAAE,MAAM,CACf,WA
 AW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CACvB,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CAClB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAC,CAC9B,KAAK,ChBCC,IAAO,CgBAb,WAAW,CAAE,MAAM,CACpB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,AAAC,CAC3B,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,cAAc,CAC1B,WAAW,CAAE,cAAc,CAC3B,YAAY,CAAE,cAAc,CAC5B,aAAa,CAAE,GAAG,CAAC,KAAK,ChBNlB,IAAO,CgBOd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,AAAA,SAAS,AAAC,CACpC,gBAAgB,ChBVV,IAAO,CgBWb,MAAM,CAAE,GAAG,CAAC,KAAK,ChBXX,IAAO,CgBYd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,AAAA,MAAM,AAAC,CACjC,gBAAgB,ChBdV,OAAO,CgBeb,MAAM,CAAE,GAAG,CAAC,KAAK,ChBWN,OAAO,CgBVnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,AAAC,CAC7C,KAAK,ChBMM,OAAO,CgBLnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,AAAA,SAAS,AAAC,CACtD,KAAK,ChBhBE,OAAO,CgBiBd,MAAM,CAAE,WAAW,CACpB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,WAAW,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,CAAE,IAAI,CA
 AA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,kBAAkB,AAAC,CAC1I,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,CAAC,CACf,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,AAAA,MAAM,AAAC,CACnD,sBAAsB,CAAE,GAAG,CAC3B,uBAAuB,CAAE,GAAG,CAC7B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,AAAA,MAAM,CAAA,AAAA,QAAC,AAAA,CAAU,CAC7D,OAAO,CAAE,EAAE,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAC,CAC9B,SAAS,CAAE,IAAI,CACf,KAAK,ChB/CC,IAAO,CgBgDb,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,MAAM,CACf,WAAW,CAAE,MAAM,CACnB,aAAa,CAAE,QAAQ,CACvB,QAAQ,CAAE,MAAM,CACjB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,CAAC,YAAY,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,CAAC,cAAc,AAAC,CAC3F,KAAK,ChB7BM,OAAO,CgB8BlB,SAAS,CAAE,IAAI,CACf,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,AAAC,CACtB,KAAK,ChB/DC,IAAO,CgBgEd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,CAAC,UAAU,CAAC,iBAAiB,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,CAAC,UAAU,CAAC,iBAAiB,AAAC,CACzG,KAAK,C
 hBvCM,OAAO,CgBwCnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,YAAY,AAAC,CACrB,SAAS,CAAE,IAAI,CACf,KAAK,ChB1EC,IAAO,CgB2Eb,SAAS,CAAE,KAAK,CAChB,WAAW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CACvB,SAAS,CAAE,GAAG,CACd,YAAY,CAAE,IAAI,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,GAAG,CAAC,cAAc,AAAC,CAC3B,aAAa,CAAE,GAAG,CAAC,KAAK,ChB9ElB,IAAO,CgB+Eb,YAAY,CAAE,eAAe,CAC7B,WAAW,CAAE,eAAe,CAC7B,ACpGD,AAAA,iBAAiB,AAAC,CAChB,UAAU,CAAE,CAAC,CACb,aAAa,CAAE,IAAI,CACpB,ACHD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,AAAC,CAC5B,UAAU,CAAE,OAAO,CACnB,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,GAAG,CAAC,GAAG,CAAC,GAAG,CAAC,GAAG,CAAC,OAAqB,CAClD,AAED,AAAA,kBAAkB,CAAC,QAAQ,AAAA,SAAS,AAAA,YAAY,AAAA,eAAe,AAAC,CAC9D,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,IAAI,CACjB,KAAK,ClBIC,IAAO,CkBHd,AAED,AAAA,oBAAoB,AAAC,CACnB,SAAS,CAAE,IAAI,CAChB,AAED,AAAA,mBAAmB,AAAC,CAClB,SAAS,CAAE,IAAI,CAChB,AAED,AAAA,mBAAmB,CAAC,CAAC,AAAC,CACpB,SAAS,CAAE,IAAI,CAChB,AAED,AAAA,iBAAiB,AAAC,CAChB,QAAQ,CAAE,QAA
 Q,CAClB,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,IAAI,CACX,AAED,AAAA,mBAAmB,AAAC,CAClB,MAAM,CAAE,eAAe,CACvB,KAAK,CAAE,eAAe,CACtB,WAAW,CAAE,eAAe,CAC5B,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,mBAAmB,CAC7B,GAAG,CAAE,IAAI,CACV,AAED,AAAA,qBAAqB,AAAC,CACpB,aAAa,CAAE,GAAG,CAClB,YAAY,CAAE,GAAG,CACjB,YAAY,CAAE,KAAK,CACpB"
+	"mappings": "AEiBA,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,GAAG,CAChB,GAAG,CAAE,qBAAqB,CAAE,qBAAqB,CAAE,mEAAmE,CAAC,kBAAkB,CAG3I,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,GAAG,CAChB,GAAG,CAAE,2BAA2B,CAAE,2BAA2B,CAAE,yEAAyE,CAAC,kBAAkB,CAG7J,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,MAAM,CACnB,GAAG,CAAE,uBAAuB,CAAE,uBAAuB,CAAE,qEAAqE,CAAC,kBAAkB,CAGjJ,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,GAAG,CAChB,GAAG,CAAE,sBAAsB,CAAE,sBAAsB,CAAE,oEAAoE,CAAC,kBAAkB,CAG9I,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,IAAI,CACjB,GAAG,CAAE,oBAAoB,CAAE,oBAAoB,CAAE,kEAAkE,CAAC,kBAAkB,CAGxI,UAAU,CACR,WAAW,CAAE,QAAQ,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,MAAM,CACnB,GAAG,CAAE,sBAAsB,CAAE,sBAAsB,CAAE,2EAA2E,CAAC,kBAAkB,CAGrJ,UAAU,CACR,WAAW,CAAE,aAAa,CAC1B,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,MAAM,CACnB,GAAG,CAAE,2BAA2B,CAAE,2BAA2B,CAAE,+EAA+E,CAAC,kBAAkB,CAGnK,UAAU,CACR,WAAW,CAAE,aAAa,CAC1B,UAAU,CAAE,MAAM,CAClB,W
 AAW,CAAE,IAAI,CACjB,GAAG,CAAE,wBAAwB,CAAE,wBAAwB,CAAE,4EAA4E,CAAC,kBAAkB,CAG1J,AAAA,IAAI,CACJ,IAAI,AAAC,CACH,MAAM,CAAE,IAAI,CACb,AAED,AAAA,IAAI,CACJ,MAAM,CACN,KAAK,CACL,KAAK,CACL,MAAM,CACN,EAAE,CACF,QAAQ,AAAC,CACP,WAAW,CDlEC,QAAQ,CACtB,UAAU,CCkER,SAAS,CAAE,IAAI,CAChB,AAED,AAAA,IAAI,AAAC,CACH,KAAK,CD5DC,IAAO,CC6Dd,AAED,AAAA,MAAM,AAAC,CACL,WAAW,CAAE,IAAI,CAClB,AAED,AAAA,GAAG,AAAC,CACF,UAAU,CAAE,IAAI,CACjB,AAED,AAAA,EAAE,AAAC,CACD,UAAU,CAAE,MAAM,CACnB,AAED,AAAA,EAAE,CACF,EAAE,CACF,EAAE,CACF,EAAE,CACF,EAAE,CACF,EAAE,AAAC,CACD,WAAW,CD5FC,QAAQ,CACtB,UAAU,CC4FR,WAAW,CAAE,MAAM,CACnB,UAAU,CAAE,MAAM,CAClB,UAAU,CAAE,OAAO,CACpB,AAED,AAAA,EAAE,AAAC,CACD,KAAK,CDxFC,IAAO,CCyFd,AAED,AAAA,EAAE,AAAC,CACD,KAAK,CD3FC,IAAO,CC4Fd,AAED,AAAA,KAAK,AAAC,CACJ,WAAW,CD3GC,QAAQ,CACtB,UAAU,CC2GR,SAAS,CAAE,IAAI,CACf,KAAK,CDjGC,IAAO,CCkGd,AC9GD,AAAA,WAAW,AAAC,CACV,cAAc,CAAE,UAAU,CAC3B,AAED,AAAA,OAAO,AAAC,CACN,WAAW,CFDA,eAAe,CAC5B,UAAU,CECR,SAAS,CAAE,IAAI,CACf,KAAK,CFIC,IAAO,CEHb,cAAc,CAAE,IAAI,CACrB,AAED,AAAA,UAAU,
 AAAC,CACT,SAAS,CAAE,IAAI,CACf,KAAK,CFWC,OAAO,CEVd,AAED,AAAA,eAAe,AAAC,CACd,MAAM,CAAE,IAAI,CACb,AAED,AAAA,yBAAyB,AAAC,CACxB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,IAAI,CACX,AAED,AAAA,YAAY,AAAC,CACX,WAAW,CFrBD,cAAc,CAC1B,UAAU,CEqBR,SAAS,CAAE,IAAI,CACf,KAAK,CFjBC,IAAO,CEkBd,AAED,AAAA,YAAY,CAAC,CAAC,AAAC,CACb,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,MAAM,AAAC,CACL,WAAW,CFjCA,eAAe,CAC5B,UAAU,CEiCR,SAAS,CAAE,IAAI,CACf,KAAK,CF5BC,IAAO,CE6Bb,cAAc,CAAE,SAAS,CAC1B,AAED,AAAA,MAAM,AAAC,CACL,WAAW,CFtCD,cAAc,CAC1B,UAAU,CEsCR,SAAS,CAAE,IAAI,CACf,KAAK,CFnCC,IAAO,CEoCd,AAED,AAAA,eAAe,AAAC,CACd,UAAU,CAAE,IAAI,CAChB,aAAa,CAAE,IAAI,CACpB,AAED,AAAA,iBAAiB,AAAC,CAChB,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CACnB,AAED,AAAA,qBAAqB,AAAC,CACpB,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,QAAQ,AAAC,CACP,MAAM,CAAE,OAAO,CAChB,ACnED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,AAAC,CAC7C,UAAU,CAAE,eAAe,CAC5B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,kBAAkB,AAAC,CAChE,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,GAAG,
 CAAC,KAAK,CHSX,IAAO,CGRd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,gCAAgC,AAAC,CAC9E,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,CAAC,CACV,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,0BAA0B,AAAC,CACxE,gBAAgB,CHwBL,OAAO,CGvBlB,KAAK,CAAE,KAAK,CACb,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,0BAA0B,CAAC,aAAa,AAAC,CACtF,KAAK,CAAE,KAAK,CACb,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,aAAa,AAAC,CAC3D,KAAK,CHeM,OAAO,CGdnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oCAAoC,CAAC,GAAG,AAAC,CACjD,WAAW,CAAE,MAAM,CACpB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,AAAC,CAC1B,UAAU,CAAE,eAAe,CAC5B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,CAAC,gCAAgC,AAAC,CAC3D,aAAa,CAAE,GAAG,CAAC,KAAK,CHvBlB,IAAO,CGwBd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,CAAC,0BAA0B,AAAC,CACrD,UAAU,CAAE,WAAW,CACxB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,CAAC,0BAA0B,CAAC,gCAAgC,AAAC,CACtF,aAAa,CAAE,GAAG,CAAC,KAAK,CHLb,OAAO,CGMlB,U
 AAU,CAAE,WAAW,CACxB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,UAAU,CAAE,eAAe,CAC5B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,CAAC,kBAAkB,AAAC,CAChD,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,GAAG,CAAC,KAAK,CH3CX,IAAO,CG4Cd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,CAAC,gCAAgC,AAAC,CAC9D,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,CAAC,CACV,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,CAAC,0BAA0B,AAAC,CACxD,gBAAgB,CH5BL,OAAO,CG6BlB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,GAAG,CAAC,KAAK,CH9BN,OAAO,CG+BnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,WAAW,AAAA,0BAA0B,AAAC,CAC9C,gBAAgB,CH7DV,IAAO,CG8Db,KAAK,CHjEC,IAAO,CGkEb,MAAM,CAAE,GAAG,CAAC,KAAK,CH/DX,IAAO,CGgEd,AC9ED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,6BAA6B,AAAC,CACtC,MAAM,CAAE,eAAe,CACvB,KAAK,CAAE,eAAe,CACvB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,AAAC,CAC5B,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,YAAY,CJSN,IAAO,CIRd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,o
 BAAoB,AAAC,CAC7B,IAAI,CAAE,IAAI,CACV,GAAG,CAAE,IAAI,CACT,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACb,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,2BAA2B,AAAA,WAAW,CAAC,wBAAwB,CACzE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAA,WAAW,CAAC,wBAAwB,AAAC,CAClE,gBAAgB,CJqBL,OAAO,CIpBnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,6BAA6B,AAAA,MAAM,AAAC,CAC5C,gBAAgB,CJiBL,OAAO,CIhBlB,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,wBAAwB,AAAC,CACjC,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACZ,AAID,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,MAAM,CAAE,eAAe,CACvB,KAAK,CAAE,eAAe,CACtB,MAAM,CAAE,GAAG,CAAC,KAAK,CJrBX,IAAO,CIsBd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAA,MAAM,AAAC,CACnC,gBAAgB,CJDL,OAAO,CIElB,MAAM,CAAE,GAAG,CAAC,KAAK,CJFN,OAAO,CIGnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,4BAA4B,AAAA,OAAO,AAAC,CAC5C,OAAO,CAAE,OAAO,CAChB,SAAS,CAAE,GAAG,CACd,WAAW,CAAE,WAAW,CACxB,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,IAAI,CACjB,MAAM,CAAE,IAAI,CACZ,SAAS,CAAE,OAAO,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,A
 AAA,EAAK,4BAA4B,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kCAAkC,AAAC,CACnF,gBAAgB,CJhBL,OAAO,CIiBlB,MAAM,CAAE,GAAG,CAAC,KAAK,CJjBN,OAAO,CIkBlB,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,MAAM,CAAE,WAAW,CACpB,ACjED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,uBAAuB,AAAC,CAChC,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,gBAAgB,CAAE,OAAO,CACzB,MAAM,CAAE,GAAG,CAAC,KAAK,CLQX,IAAO,CKPd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,uBAAuB,AAAA,MAAM,AAAC,CACtC,gBAAgB,CL4BL,OAAO,CK3BlB,YAAY,CL2BD,OAAO,CK1BnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,CAAC,uBAAuB,AAAC,CACnD,MAAM,CAAE,GAAG,CAAC,KAAK,CLuBN,OAAO,CKtBlB,gBAAgB,CLsBL,OAAO,CKrBnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,AAAA,WAAW,AAAA,kBAAkB,CAAC,uBAAuB,AAAC,CAC/E,YAAY,CLkBD,OAAO,CKjBnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,uBAAuB,AAAC,CAChC,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,IAAI,CAAE,GAAG
 ,CACT,GAAG,CAAE,GAAG,CACR,gBAAgB,CAAE,OAAO,CAC1B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,CAAC,uBAAuB,AAAC,CACnD,gBAAgB,CAAE,OAAO,CAC1B,ACpCD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,SAAS,AAAC,CAClB,aAAa,CAAE,GAAG,CAClB,SAAS,CAAE,IAAI,CACf,WAAW,CNHC,QAAQ,CACtB,UAAU,CMGR,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,MAAM,CACnB,OAAO,CAAE,iBAAiB,CAC3B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,SAAS,CAAC,CAAC,AAAC,CACpB,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,GAAG,CAChB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,AAAC,CACxB,KAAK,CNJC,IAAO,CMKb,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,YAAY,CACrB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,AAAA,kBAAkB,AAAC,CAC1C,OAAO,CAAE,iBAAiB,CAC3B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,CAAC,CAAC,AAAC,CAC1B,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,GAAG,CAChB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,CAAC,QAAQ,AAAC,CACjC,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,KAAK,CACjB,WAAW,CAAE,IAAI,CACjB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACV,AAED,AAAA,IAAI,CAAA,AAAA,GAA
 C,AAAA,EAAK,QAAQ,CAAC,IAAI,AAAC,CACtB,WAAW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CACvB,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,CAAC,QAAQ,AAAC,CACnC,OAAO,CAAE,gBAAgB,CAC1B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,CAAC,QAAQ,AAAA,gBAAgB,AAAC,CACjD,SAAS,CAAE,IAAI,CACf,aAAa,CAAE,GAAG,CACnB,ACrDD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAC,CAC9B,OAAO,CAAE,IAAI,CACb,KAAK,CAAE,KAAK,CACb,ACHD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,cAAc,AAAC,CACvB,WAAW,CAAE,IAAI,CACjB,cAAc,CAAE,SAAS,CACzB,KAAK,CRSC,IAAO,CQRd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,cAAc,AAAA,MAAM,AAAA,IAAK,EAAA,AAAA,QAAC,AAAA,EAAW,CAC7C,KAAK,CRIC,IAAO,CQHd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,cAAc,AAAA,MAAM,AAAA,IAAK,EAAA,AAAA,QAAC,AAAA,EAAW,CAC7C,gBAAgB,CAAE,OAAO,CAC1B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAC,CAC9B,KAAK,CRJC,IAAO,CQKd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,gBAAgB,CAC1B,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,eAAe,AAAC,CACxB,aAAa,CAAE,GAAG,CACnB,ACrBD,AAAA,IAAI,
 CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,SAAS,CAAE,KAAK,CAChB,KAAK,CAAE,IAAI,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,AAAC,CAC3B,MAAM,CAAE,CAAC,CACT,cAAc,CAAE,CAAC,CAClB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAA,kBAAkB,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,AAAA,kBAAkB,AAAC,CACtE,aAAa,CAAE,GAAG,CAClB,KAAK,CTAC,IAAO,CSCb,MAAM,CAAE,GAAG,CAAC,KAAK,CTKX,OAAO,CSJb,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,QAAQ,CACjB,KAAK,CAAE,iBAAiB,CACzB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,AAAA,kBAAkB,AAAC,CACnC,OAAO,CAAE,SAAS,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAA,kBAAkB,CAAA,AAAA,QAAC,AAAA,EAAW,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,AAAA,kBAAkB,CAAA,AAAA,QAAC,AAAA,CAAU,CAC1F,UAAU,CTLJ,OAAO,CSMb,KAAK,CTLE,OAAO,CSMd,MAAM,CAAE,GAAG,CAAC,KAAK,CTPX,OAAO,CSQd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,4BAA4B,AAAC,CACrC,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,iBAAiB,CACzB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAA,kBAAkB,AAAA,MAAM,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,AAAA,kBAAkB
 ,AAAA,MAAM,AAAC,CAClF,YAAY,CTMD,OAAO,CSLnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,oBAAoB,AAAC,CAC7B,OAAO,CAAE,IAAI,CACd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,SAAS,CAAE,IAAI,CACf,KAAK,CT/BC,IAAO,CSgCb,WAAW,CAAE,GAAG,CACjB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,IAAI,CACV,WAAW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CACvB,KAAK,CAAE,iBAAiB,CACzB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,AAAA,YAAY,CAAC,sBAAsB,AAAC,CAC/D,SAAS,CAAE,iBAAiB,CAAC,iBAAiB,CAAC,WAAW,CAC3D,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,yBAAyB,AAAA,4BAA4B,CAAC,2BAA2B,AAAC,CAC1F,SAAS,CAAE,iBAAiB,CAAC,iBAAiB,CAAC,WAAU,CAC1D,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,yBAAyB,CAAC,gCAAgC,AAAA,iBAAiB,CAAC,mCAAmC,CAAC,2BAA2B,AAAC,CACpJ,SAAS,CAAE,iBAAiB,CAAC,iBAAiB,CAAC,WAAU,CAC1D,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,AAAC,CACtB,GAAG,CAAE,GAAG,CACR,WAAW,CAAE,eAAe,CAC7B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,AAAA,kBAAkB,CAAA,AAAA,QAAC
 ,AAAA,CAAU,CAClD,OAAO,CAAE,CAAC,CACX,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,CAAC,8BAA8B,AAAA,OAAO,AAAC,CACvD,OAAO,CAAE,OAAO,CAChB,OAAO,CAAE,YAAY,CACrB,WAAW,CAAE,WAAW,CACxB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,iBAAiB,CACzB,KAAK,CTvEC,IAAO,CSwEd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,SAAS,AAAC,CAClB,KAAK,CT3EC,IAAO,CS4Ed,ACzFD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,cAAc,AAAC,CACvB,SAAS,CAAE,IAAI,CACf,KAAK,CVSC,IAAO,CURb,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,AAAC,CACtB,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CAClB,aAAa,CAAE,IAAI,CACpB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,iBAAiB,AAAC,CAC1B,YAAY,CAAE,IAAI,CAClB,aAAa,CAAE,IAAI,CACnB,WAAW,CAAE,IAAI,CACjB,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,gBAAgB,AAAC,CACzB,KAAK,CVRC,IAAO,CUSb,OAAO,CAAE,mBAAmB,CAC5B,MAAM,CAAE,GAAG,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,CAAC,gBAAgB,AAAA,WAAW,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,QAAQ,CAAC,QAAQ,CAAC,gBAAgB,AAAA,WAAW,AAAC,CACtG,OAAO,CAAE,kBAAkB,CAC3B,MAA
 M,CAAE,GAAG,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,GAAG,CACV,OAAO,CAAE,CAAC,CACX,ACpCD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,wBAAwB,AAAC,CAC/B,gBAAgB,CXeZ,IAAO,CWdd,ACAD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAC,CACd,KAAK,CZwCM,OAAO,CYvClB,SAAS,CAAE,IAAI,CACf,eAAe,CAAE,IAAI,CACrB,WAAW,CAAE,IAAI,CACjB,MAAM,CAAE,OAAO,CAChB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,AAAA,MAAM,AAAC,CACpB,eAAe,CAAE,SAAS,CAC3B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,KAAK,CAAC,SAAS,AAAC,CACxB,KAAK,CZFC,IAAO,CYGb,eAAe,CAAE,IAAI,CACtB,ACjBD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,sBAAsB,AAAC,CAC/B,MAAM,CAAE,IAAI,CACb,ACFD,AAAA,eAAe,CAAC,IAAI,AAAC,CACnB,OAAO,CAAE,IAAI,CACd,ACAD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,YAAY,AAAC,CACrB,UAAU,CfWJ,IAAO,CeVb,OAAO,CAAE,EAAE,CACX,UAAU,CAAE,KAAK,CAAC,GAAG,CAAC,GAAG,CAAC,GAAG,CAAC,GAAG,CAAC,OAAqB,CACxD,ACJD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,AAAC,CAC5B,SAAS,CAAE,IAAI,CACf,KAAK,ChBUC,IAAO,CgBTb,OAAO,CAAE,MAAM,CACf,WA
 AW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CACvB,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CAClB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAC,CAC9B,KAAK,ChBCC,IAAO,CgBAb,WAAW,CAAE,MAAM,CACpB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,AAAC,CAC3B,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,cAAc,CAC1B,WAAW,CAAE,cAAc,CAC3B,YAAY,CAAE,cAAc,CAC5B,aAAa,CAAE,GAAG,CAAC,KAAK,ChBNlB,IAAO,CgBOd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,AAAA,SAAS,AAAC,CACpC,gBAAgB,ChBVV,IAAO,CgBWb,MAAM,CAAE,GAAG,CAAC,KAAK,ChBXX,IAAO,CgBYd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,kBAAkB,AAAA,MAAM,AAAC,CACjC,gBAAgB,ChBdV,OAAO,CgBeb,MAAM,CAAE,GAAG,CAAC,KAAK,ChBWN,OAAO,CgBVnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,AAAC,CAC7C,KAAK,ChBMM,OAAO,CgBLnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,AAAA,SAAS,AAAC,CACtD,KAAK,ChBhBE,OAAO,CgBiBd,MAAM,CAAE,WAAW,CACpB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,WAAW,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,CAAE,IAAI,CA
 AA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,kBAAkB,AAAC,CAC1I,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,CAAC,CACf,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,AAAA,MAAM,AAAC,CACnD,sBAAsB,CAAE,GAAG,CAC3B,uBAAuB,CAAE,GAAG,CAC7B,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,CAAC,gBAAgB,AAAA,MAAM,CAAA,AAAA,QAAC,AAAA,CAAU,CAC7D,OAAO,CAAE,EAAE,CACZ,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,AAAC,CAC9B,SAAS,CAAE,IAAI,CACf,KAAK,ChB/CC,IAAO,CgBgDb,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,MAAM,CACf,WAAW,CAAE,MAAM,CACnB,aAAa,CAAE,QAAQ,CACvB,QAAQ,CAAE,MAAM,CACjB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,CAAC,YAAY,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,qBAAqB,CAAC,cAAc,AAAC,CAC3F,KAAK,ChB7BM,OAAO,CgB8BlB,SAAS,CAAE,IAAI,CACf,aAAa,CAAE,GAAG,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,AAAC,CACtB,KAAK,ChB/DC,IAAO,CgBgEd,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,CAAC,UAAU,CAAC,iBAAiB,CAAE,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,aAAa,CAAC,UAAU,CAAC,iBAAiB,AAAC,CACzG,KAAK,C
 hBvCM,OAAO,CgBwCnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,YAAY,AAAC,CACrB,SAAS,CAAE,IAAI,CACf,KAAK,ChB1EC,IAAO,CgB2Eb,SAAS,CAAE,KAAK,CAChB,WAAW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CACvB,SAAS,CAAE,GAAG,CACd,YAAY,CAAE,IAAI,CACnB,AAED,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,GAAG,CAAC,cAAc,AAAC,CAC3B,aAAa,CAAE,GAAG,CAAC,KAAK,ChB9ElB,IAAO,CgB+Eb,YAAY,CAAE,eAAe,CAC7B,WAAW,CAAE,eAAe,CAC7B,ACpGD,AAAA,iBAAiB,AAAC,CAChB,UAAU,CAAE,CAAC,CACb,aAAa,CAAE,IAAI,CACpB,ACHD,AAAA,IAAI,CAAA,AAAA,GAAC,AAAA,EAAK,mBAAmB,AAAC,CAC5B,UAAU,CAAE,OAAO,CACnB,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,GAAG,CAAC,GAAG,CAAC,GAAG,CAAC,GAAG,CAAC,OAAqB,CAClD,AAED,AAAA,kBAAkB,CAAC,QAAQ,AAAA,SAAS,AAAA,YAAY,AAAA,eAAe,AAAC,CAC9D,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,IAAI,CACjB,KAAK,ClBIC,IAAO,CkBHd,AAED,AAAA,oBAAoB,AAAC,CACnB,SAAS,CAAE,IAAI,CAChB,AAED,AAAA,mBAAmB,AAAC,CAClB,SAAS,CAAE,IAAI,CAChB,AAED,AAAA,mBAAmB,CAAC,CAAC,AAAC,CACpB,SAAS,CAAE,IAAI,CAChB,AAED,AAAA,iBAAiB,AAAC,CAChB,QAAQ,CAAE,QAA
 Q,CAClB,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,IAAI,CACX,AAED,AAAA,mBAAmB,AAAC,CAClB,MAAM,CAAE,eAAe,CACvB,KAAK,CAAE,eAAe,CACtB,WAAW,CAAE,eAAe,CAC5B,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,mBAAmB,CAC7B,GAAG,CAAE,IAAI,CACV,AAED,AAAA,qBAAqB,AAAC,CACpB,aAAa,CAAE,GAAG,CAClB,YAAY,CAAE,GAAG,CACjB,YAAY,CAAE,KAAK,CACpB"
 }
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/@nifi-fds/core/package.json
----------------------------------------------------------------------
diff --git a/node_modules/@nifi-fds/core/package.json b/node_modules/@nifi-fds/core/package.json
index c59dc1e..e037a5d 100644
--- a/node_modules/@nifi-fds/core/package.json
+++ b/node_modules/@nifi-fds/core/package.json
@@ -1,6 +1,6 @@
 {
   "name": "@nifi-fds/core",
-  "version": "0.0.0",
+  "version": "0.1.0",
   "description": "Flow Design System —a subproject of Apache NiFi— is an atomic reusable platform for providing a common set of UI/UX components for Apache NiFi, Apache NiFi Registry, Apache NiFi MiNiFi, and any other open source web applications to consume.",
   "keywords": [
     "angular",

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/agent-base/package.json
----------------------------------------------------------------------
diff --git a/node_modules/agent-base/package.json b/node_modules/agent-base/package.json
index df3767a..5d41eaf 100644
--- a/node_modules/agent-base/package.json
+++ b/node_modules/agent-base/package.json
@@ -23,8 +23,6 @@
     "fetchSpec": "2.1.1"
   },
   "_requiredBy": [
-    "/http-proxy-agent",
-    "/https-proxy-agent",
     "/pac-proxy-agent",
     "/proxy-agent",
     "/socks-proxy-agent"

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/axios/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/axios/node_modules/debug/.eslintrc b/node_modules/axios/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/axios/node_modules/debug/.eslintrc
+++ b/node_modules/axios/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/axios/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/axios/node_modules/debug/.travis.yml b/node_modules/axios/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/axios/node_modules/debug/.travis.yml
+++ b/node_modules/axios/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/axios/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/axios/node_modules/debug/CHANGELOG.md b/node_modules/axios/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/axios/node_modules/debug/CHANGELOG.md
+++ b/node_modules/axios/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/axios/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/axios/node_modules/debug/Makefile b/node_modules/axios/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/axios/node_modules/debug/Makefile
+++ b/node_modules/axios/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

[12/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/axios/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/axios/node_modules/debug/README.md b/node_modules/axios/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/axios/node_modules/debug/README.md
+++ b/node_modules/axios/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/axios/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/axios/node_modules/debug/component.json b/node_modules/axios/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/axios/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/axios/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/axios/node_modules/debug/package.json b/node_modules/axios/node_modules/debug/package.json
index b2f9e4f..f9fec03 100644
--- a/node_modules/axios/node_modules/debug/package.json
+++ b/node_modules/axios/node_modules/debug/package.json
@@ -1,33 +1,33 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/axios/debug",
   "_optional": true,
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/axios/follow-redirects"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -37,12 +37,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -59,7 +53,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -89,5 +83,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/body-parser/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/body-parser/node_modules/debug/.eslintrc b/node_modules/body-parser/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/body-parser/node_modules/debug/.eslintrc
+++ b/node_modules/body-parser/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/body-parser/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/body-parser/node_modules/debug/.travis.yml b/node_modules/body-parser/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/body-parser/node_modules/debug/.travis.yml
+++ b/node_modules/body-parser/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/body-parser/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/body-parser/node_modules/debug/CHANGELOG.md b/node_modules/body-parser/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/body-parser/node_modules/debug/CHANGELOG.md
+++ b/node_modules/body-parser/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/body-parser/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/body-parser/node_modules/debug/Makefile b/node_modules/body-parser/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/body-parser/node_modules/debug/Makefile
+++ b/node_modules/body-parser/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/body-parser/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/body-parser/node_modules/debug/README.md b/node_modules/body-parser/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/body-parser/node_modules/debug/README.md
+++ b/node_modules/body-parser/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/body-parser/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/body-parser/node_modules/debug/component.json b/node_modules/body-parser/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/body-parser/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/body-parser/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/body-parser/node_modules/debug/package.json b/node_modules/body-parser/node_modules/debug/package.json
index dbcb1a1..387d495 100644
--- a/node_modules/body-parser/node_modules/debug/package.json
+++ b/node_modules/body-parser/node_modules/debug/package.json
@@ -1,32 +1,32 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/body-parser/debug",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/body-parser"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -36,12 +36,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -58,7 +52,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -88,5 +82,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/connect/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/connect/node_modules/debug/.eslintrc b/node_modules/connect/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/connect/node_modules/debug/.eslintrc
+++ b/node_modules/connect/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/connect/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/connect/node_modules/debug/.travis.yml b/node_modules/connect/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/connect/node_modules/debug/.travis.yml
+++ b/node_modules/connect/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/connect/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/connect/node_modules/debug/CHANGELOG.md b/node_modules/connect/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/connect/node_modules/debug/CHANGELOG.md
+++ b/node_modules/connect/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/connect/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/connect/node_modules/debug/Makefile b/node_modules/connect/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/connect/node_modules/debug/Makefile
+++ b/node_modules/connect/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/connect/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/connect/node_modules/debug/README.md b/node_modules/connect/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/connect/node_modules/debug/README.md
+++ b/node_modules/connect/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/connect/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/connect/node_modules/debug/component.json b/node_modules/connect/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/connect/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/connect/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/connect/node_modules/debug/package.json b/node_modules/connect/node_modules/debug/package.json
index c91b324..5537199 100644
--- a/node_modules/connect/node_modules/debug/package.json
+++ b/node_modules/connect/node_modules/debug/package.json
@@ -1,32 +1,32 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/connect/debug",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/connect"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -36,12 +36,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -58,7 +52,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -88,5 +82,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json
index cc1881c..c1d02ae 100644
--- a/node_modules/debug/package.json
+++ b/node_modules/debug/package.json
@@ -26,6 +26,8 @@
     "/engine.io",
     "/engine.io-client",
     "/follow-redirects",
+    "/http-proxy-agent",
+    "/https-proxy-agent",
     "/log4js",
     "/socket.io-parser",
     "/streamroller"

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/README.md
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/README.md b/node_modules/es6-promisify/README.md
new file mode 100644
index 0000000..4141cc8
--- /dev/null
+++ b/node_modules/es6-promisify/README.md
@@ -0,0 +1,89 @@
+[![Travis CI](https://travis-ci.org/digitaldesignlabs/es6-promisify.svg)](https://travis-ci.org/digitaldesignlabs/es6-promisify)
+
+# es6-promisify
+
+Converts callback-based functions to Promise-based functions.
+
+## Install
+
+Install with [npm](https://npmjs.org/package/es6-promisify)
+
+```bash
+npm install --save es6-promisify
+```
+
+## Example
+
+```js
+"use strict";
+
+// Declare variables
+const promisify = require("es6-promisify");
+const fs = require("fs");
+
+// Convert the stat function
+const stat = promisify(fs.stat);
+
+// Now usable as a promise!
+stat("example.txt").then(function (stats) {
+    console.log("Got stats", stats);
+}).catch(function (err) {
+    console.error("Yikes!", err);
+});
+```
+
+## Promisify methods
+```js
+"use strict";
+
+// Declare variables
+const promisify = require("es6-promisify");
+const redis = require("redis").createClient(6379, "localhost");
+
+// Create a promise-based version of send_command
+const client = promisify(redis.send_command, redis);
+
+// Send commands to redis and get a promise back
+client("ping").then(function (pong) {
+    console.log("Got", pong);
+}).catch(function (err) {
+    console.error("Unexpected error", err);
+}).then(function () {
+    redis.quit();
+});
+```
+
+## Handle callback multiple arguments
+```js
+"use strict";
+
+// Declare functions
+function test(cb) {
+    return cb(undefined, 1, 2, 3);
+}
+
+// Declare variables
+const promisify = require("es6-promisify");
+
+// Create promise-based version of test
+const single = promisify(test);
+const multi = promisify(test, {multiArgs: true});
+
+// Discards additional arguments
+single().then(function (result) {
+    console.log(result); // 1
+});
+
+// Returns all arguments as an array
+multi().then(function (result) {
+    console.log(result); // [1, 2, 3]
+});
+```
+
+### Tests
+Test with nodeunit
+```bash
+$ npm test
+```
+
+Published under the [MIT License](http://opensource.org/licenses/MIT).

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/dist/promise.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/dist/promise.js b/node_modules/es6-promisify/dist/promise.js
new file mode 100644
index 0000000..2fe5c61
--- /dev/null
+++ b/node_modules/es6-promisify/dist/promise.js
@@ -0,0 +1,73 @@
+"use strict";
+
+/* global self, window, module, global, require */
+module.exports = function () {
+
+    "use strict";
+
+    var globalObject = void 0;
+
+    function isFunction(x) {
+        return typeof x === "function";
+    }
+
+    // Seek the global object
+    if (global !== undefined) {
+        globalObject = global;
+    } else if (window !== undefined && window.document) {
+        globalObject = window;
+    } else {
+        globalObject = self;
+    }
+
+    // Test for any native promise implementation, and if that
+    // implementation appears to conform to the specificaton.
+    // This code mostly nicked from the es6-promise module polyfill
+    // and then fooled with.
+    var hasPromiseSupport = function () {
+
+        // No promise object at all, and it's a non-starter
+        if (!globalObject.hasOwnProperty("Promise")) {
+            return false;
+        }
+
+        // There is a Promise object. Does it conform to the spec?
+        var P = globalObject.Promise;
+
+        // Some of these methods are missing from
+        // Firefox/Chrome experimental implementations
+        if (!P.hasOwnProperty("resolve") || !P.hasOwnProperty("reject")) {
+            return false;
+        }
+
+        if (!P.hasOwnProperty("all") || !P.hasOwnProperty("race")) {
+            return false;
+        }
+
+        // Older version of the spec had a resolver object
+        // as the arg rather than a function
+        return function () {
+
+            var resolve = void 0;
+
+            var p = new globalObject.Promise(function (r) {
+                resolve = r;
+            });
+
+            if (p) {
+                return isFunction(resolve);
+            }
+
+            return false;
+        }();
+    }();
+
+    // Export the native Promise implementation if it
+    // looks like it matches the spec
+    if (hasPromiseSupport) {
+        return globalObject.Promise;
+    }
+
+    //  Otherwise, return the es6-promise polyfill by @jaffathecake.
+    return require("es6-promise").Promise;
+}();
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/dist/promisify.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/dist/promisify.js b/node_modules/es6-promisify/dist/promisify.js
new file mode 100644
index 0000000..ce38041
--- /dev/null
+++ b/node_modules/es6-promisify/dist/promisify.js
@@ -0,0 +1,85 @@
+"use strict";
+
+/* global module, require */
+module.exports = function () {
+
+    "use strict";
+
+    // Get a promise object. This may be native, or it may be polyfilled
+
+    var ES6Promise = require("./promise.js");
+
+    /**
+     * thatLooksLikeAPromiseToMe()
+     *
+     * Duck-types a promise.
+     *
+     * @param {object} o
+     * @return {bool} True if this resembles a promise
+     */
+    function thatLooksLikeAPromiseToMe(o) {
+        return o && typeof o.then === "function" && typeof o.catch === "function";
+    }
+
+    /**
+     * promisify()
+     *
+     * Transforms callback-based function -- func(arg1, arg2 .. argN, callback) -- into
+     * an ES6-compatible Promise. Promisify provides a default callback of the form (error, result)
+     * and rejects when `error` is truthy. You can also supply settings object as the second argument.
+     *
+     * @param {function} original - The function to promisify
+     * @param {object} settings - Settings object
+     * @param {object} settings.thisArg - A `this` context to use. If not set, assume `settings` _is_ `thisArg`
+     * @param {bool} settings.multiArgs - Should multiple arguments be returned as an array?
+     * @return {function} A promisified version of `original`
+     */
+    return function promisify(original, settings) {
+
+        return function () {
+            for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
+                args[_key] = arguments[_key];
+            }
+
+            var returnMultipleArguments = settings && settings.multiArgs;
+
+            var target = void 0;
+            if (settings && settings.thisArg) {
+                target = settings.thisArg;
+            } else if (settings) {
+                target = settings;
+            }
+
+            // Return the promisified function
+            return new ES6Promise(function (resolve, reject) {
+
+                // Append the callback bound to the context
+                args.push(function callback(err) {
+
+                    if (err) {
+                        return reject(err);
+                    }
+
+                    for (var _len2 = arguments.length, values = Array(_len2 > 1 ? _len2 - 1 : 0), _key2 = 1; _key2 < _len2; _key2++) {
+                        values[_key2 - 1] = arguments[_key2];
+                    }
+
+                    if (false === !!returnMultipleArguments) {
+                        return resolve(values[0]);
+                    }
+
+                    resolve(values);
+                });
+
+                // Call the function
+                var response = original.apply(target, args);
+
+                // If it looks like original already returns a promise,
+                // then just resolve with that promise. Hopefully, the callback function we added will just be ignored.
+                if (thatLooksLikeAPromiseToMe(response)) {
+                    resolve(response);
+                }
+            });
+        };
+    };
+}();
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/CHANGELOG.md b/node_modules/es6-promisify/node_modules/es6-promise/CHANGELOG.md
new file mode 100644
index 0000000..5158205
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/CHANGELOG.md
@@ -0,0 +1,151 @@
+# Master
+
+# 4.2.4
+
+* [Fixes #305] Confuse webpack
+
+# 4.2.3
+
+* Cleanup testem related build configuration
+* Use `prepublishOnly` instead of `prepublish` (thanks @rhysd)
+* Add Node.js 9, 8 to testing matrix
+* drop now unused s3 deployment files
+* internal cleanup (thanks to @bekzod, @mariusschulz)
+* Fixup Changelog
+
+# 4.2.2
+
+* Ensure PROMISE_ID works correctly
+* internal cleanup (thanks yo @mariusschulz)
+
+# 4.2.1
+
+* drop bower support
+
+# 4.2.0
+
+* drop `dist` from git repo
+* add `Promise.prototype.finally`
+* update various build related dependencies
+* add CDN links
+
+# 4.1.0
+
+* [BUGFIX] Fix memory leak [#269]
+* [BUGFIX] Auto Bundles within an AMD Environment [#263]
+
+# 4.0.5
+
+* fix require('es6-promise/auto') for Node < 4
+
+# 4.0.4
+
+* fix asap when using https://github.com/Kinvey/titanium-sdk
+
+# 4.0.3
+
+* fix Readme links
+
+# 4.0.2
+
+* fix require('es6-promise/auto');
+
+# 4.0.0
+
+* no longer polyfill automatically, if needed one can still invoke
+  `require('es6-promise/auto')` directly.
+
+# 3.3.1
+
+* fix links in readme
+
+# 3.3.0
+
+* support polyfil on WebMAF (playstation env)
+* fix tampering related bug global `constructor` was referenced by mistake.
+* provide TS Typings
+* increase compatibliity with sinon.useFakeTimers();
+* update build tools (use rollup)
+* directly export promise;
+
+# 3.2.2
+
+* IE8: use isArray
+* update build dependencies
+
+# 3.2.1
+
+* fix race tampering issue
+* use eslint
+* fix Promise.all tampering
+* remove unused code
+* fix issues with NWJS/electron
+
+# 3.2.0
+
+* improve tamper resistence of Promise.all Promise.race and
+  Promise.prototype.then (note, this isn't complete, but addresses an exception
+  when used \w core-js, follow up work will address entirely)
+* remove spec incompatible then chaining fast-path
+* add eslint
+* update build deps
+
+# 3.1.2
+
+* fix node detection issues with NWJS/electron
+
+# 3.1.0
+
+* improve performance of Promise.all when it encounters a non-promise input object input
+* then/resolve tamper protection
+* reduce AST size of promise constructor, to facilitate more inlining
+* Update README.md with details about PhantomJS requirement for running tests
+* Mangle and compress the minified version
+
+# 3.0.2
+
+* correctly bump both bower and package.json versions
+
+# 3.0.1
+
+* no longer include dist/test in npm releases
+
+# 3.0.0
+
+* use nextTick() instead of setImmediate() to schedule microtasks with node 0.10. Later versions of
+  nodes are not affected as they were already using nextTick(). Note that using nextTick() might
+  trigger a depreciation warning on 0.10 as described at https://github.com/cujojs/when/issues/410.
+  The reason why nextTick() is preferred is that is setImmediate() would schedule a macrotask
+  instead of a microtask and might result in a different scheduling.
+  If needed you can revert to the former behavior as follow:
+
+    var Promise = require('es6-promise').Promise;
+    Promise._setScheduler(setImmediate);
+
+# 2.3.0
+
+* #121: Ability to override the internal asap implementation
+* #120: Use an ascii character for an apostrophe, for source maps
+
+# 2.2.0
+
+* #116: Expose asap() and a way to override the scheduling mechanism on Promise
+* Lock to v0.2.3 of ember-cli
+
+# 2.1.1
+
+* Fix #100 via #105: tell browserify to ignore vertx require
+* Fix #101 via #102: "follow thenable state, not own state"
+
+# 2.1.0
+
+* #59: Automatic polyfill. No need to invoke `ES6Promise.polyfill()` anymore.
+* ... (see the commit log)
+
+# 2.0.0
+
+* re-sync with RSVP. Many large performance improvements and bugfixes.
+
+# 1.0.0
+
+* first subset of RSVP

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/LICENSE
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/LICENSE b/node_modules/es6-promisify/node_modules/es6-promise/LICENSE
new file mode 100644
index 0000000..954ec59
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/README.md
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/README.md b/node_modules/es6-promisify/node_modules/es6-promise/README.md
new file mode 100644
index 0000000..951db75
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/README.md
@@ -0,0 +1,97 @@
+# ES6-Promise (subset of [rsvp.js](https://github.com/tildeio/rsvp.js)) [![Build Status](https://travis-ci.org/stefanpenner/es6-promise.svg?branch=master)](https://travis-ci.org/stefanpenner/es6-promise)
+
+This is a polyfill of the [ES6 Promise](http://www.ecma-international.org/ecma-262/6.0/#sec-promise-constructor). The implementation is a subset of [rsvp.js](https://github.com/tildeio/rsvp.js) extracted by @jakearchibald, if you're wanting extra features and more debugging options, check out the [full library](https://github.com/tildeio/rsvp.js).
+
+For API details and how to use promises, see the <a href="http://www.html5rocks.com/en/tutorials/es6/promises/">JavaScript Promises HTML5Rocks article</a>.
+
+## Downloads
+
+* [es6-promise 27.86 KB (7.33 KB gzipped)](https://cdn.jsdelivr.net/npm/es6-promise/dist/es6-promise.js)
+* [es6-promise-auto 27.78 KB (7.3 KB gzipped)](https://cdn.jsdelivr.net/npm/es6-promise/dist/es6-promise.auto.js) - Automatically provides/replaces `Promise` if missing or broken.
+* [es6-promise-min 6.17 KB (2.4 KB gzipped)](https://cdn.jsdelivr.net/npm/es6-promise/dist/es6-promise.min.js)
+* [es6-promise-auto-min 6.19 KB (2.4 KB gzipped)](https://cdn.jsdelivr.net/npm/es6-promise/dist/es6-promise.auto.min.js) - Minified version of `es6-promise-auto` above.
+
+## CDN 
+
+To use via a CDN include this in your html:
+
+```html
+<!-- Automatically provides/replaces `Promise` if missing or broken. -->
+<script src="https://cdn.jsdelivr.net/npm/es6-promise@4/dist/es6-promise.js"></script>
+<script src="https://cdn.jsdelivr.net/npm/es6-promise@4/dist/es6-promise.auto.js"></script> 
+
+<!-- Minified version of `es6-promise-auto` below. -->
+<script src="https://cdn.jsdelivr.net/npm/es6-promise@4/dist/es6-promise.min.js"></script>
+<script src="https://cdn.jsdelivr.net/npm/es6-promise@4/dist/es6-promise.auto.min.js"></script> 
+
+```
+
+## Node.js
+
+To install:
+
+```sh
+yarn add es6-promise
+```
+
+or
+
+```sh
+npm install es6-promise
+```
+
+To use:
+
+```js
+var Promise = require('es6-promise').Promise;
+```
+
+
+## Usage in IE<9
+
+`catch` and `finally` are reserved keywords in IE<9, meaning
+`promise.catch(func)` or `promise.finally(func)` throw a syntax error. To work
+around this, you can use a string to access the property as shown in the
+following example.
+
+However most minifiers will automatically fix this for you, making the
+resulting code safe for old browsers and production:
+
+```js
+promise['catch'](function(err) {
+  // ...
+});
+```
+
+```js
+promise['finally'](function() {
+  // ...
+});
+```
+
+## Auto-polyfill
+
+To polyfill the global environment (either in Node or in the browser via CommonJS) use the following code snippet:
+
+```js
+require('es6-promise').polyfill();
+```
+
+Alternatively
+
+```js
+require('es6-promise/auto');
+```
+
+Notice that we don't assign the result of `polyfill()` to any variable. The `polyfill()` method will patch the global environment (in this case to the `Promise` name) when called.
+
+## Building & Testing
+
+You will need to have PhantomJS installed globally in order to run the tests.
+
+`npm install -g phantomjs`
+
+* `npm run build` to build
+* `npm test` to run tests
+* `npm start` to run a build watcher, and webserver to test
+* `npm run test:server` for a testem test runner and watching builder

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/auto.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/auto.js b/node_modules/es6-promisify/node_modules/es6-promise/auto.js
new file mode 100644
index 0000000..92bbf36
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/auto.js
@@ -0,0 +1,4 @@
+// This file can be required in Browserify and Node.js for automatic polyfill
+// To use it:  require('es6-promise/auto');
+'use strict';
+module.exports = require('./').polyfill();

[10/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.min.map
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.min.map b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.min.map
new file mode 100644
index 0000000..aaa7536
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.min.map
@@ -0,0 +1 @@
+{"version":3,"sources":["config/versionTemplate.txt","lib/es6-promise/utils.js","lib/es6-promise/asap.js","lib/es6-promise/then.js","lib/es6-promise/promise/resolve.js","lib/es6-promise/-internal.js","lib/es6-promise/enumerator.js","lib/es6-promise/promise/all.js","lib/es6-promise/promise/race.js","lib/es6-promise/promise/reject.js","lib/es6-promise/promise.js","lib/es6-promise/polyfill.js","lib/es6-promise.js","lib/es6-promise.auto.js"],"sourcesContent":["/*!\n * @overview es6-promise - a tiny implementation of Promises/A+.\n * @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald)\n * @license   Licensed under MIT license\n *            See https://raw.githubusercontent.com/stefanpenner/es6-promise/master/LICENSE\n * @version   v4.2.4+314e4831\n */\n","export function objectOrFunction(x) {\n  var type = typeof x;\n  return x !== null && (type === 'object' || type === 'function');\n}\n\nexport function isFunctio
 n(x) {\n  return typeof x === 'function';\n}\n\nexport function isMaybeThenable(x) {\n  return x !== null && typeof x === 'object';\n}\n\nvar _isArray = void 0;\nif (Array.isArray) {\n  _isArray = Array.isArray;\n} else {\n  _isArray = function (x) {\n    return Object.prototype.toString.call(x) === '[object Array]';\n  };\n}\n\nexport var isArray = _isArray;","var len = 0;\nvar vertxNext = void 0;\nvar customSchedulerFn = void 0;\n\nexport var asap = function asap(callback, arg) {\n  queue[len] = callback;\n  queue[len + 1] = arg;\n  len += 2;\n  if (len === 2) {\n    // If len is 2, that means that we need to schedule an async flush.\n    // If additional callbacks are queued before the queue is flushed, they\n    // will be processed by this flush that we are scheduling.\n    if (customSchedulerFn) {\n      customSchedulerFn(flush);\n    } else {\n      scheduleFlush();\n    }\n  }\n};\n\nexport function setScheduler(scheduleFn) {\n  customSchedulerFn = scheduleFn;\n}\n\nexport f
 unction setAsap(asapFn) {\n  asap = asapFn;\n}\n\nvar browserWindow = typeof window !== 'undefined' ? window : undefined;\nvar browserGlobal = browserWindow || {};\nvar BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;\nvar isNode = typeof self === 'undefined' && typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n\n// test for web worker but not in IE10\nvar isWorker = typeof Uint8ClampedArray !== 'undefined' && typeof importScripts !== 'undefined' && typeof MessageChannel !== 'undefined';\n\n// node\nfunction useNextTick() {\n  // node version 0.10.x displays a deprecation warning when nextTick is used recursively\n  // see https://github.com/cujojs/when/issues/410 for details\n  return function () {\n    return process.nextTick(flush);\n  };\n}\n\n// vertx\nfunction useVertxTimer() {\n  if (typeof vertxNext !== 'undefined') {\n    return function () {\n      vertxNext(flush);\n    };\n  }\n\n  return
  useSetTimeout();\n}\n\nfunction useMutationObserver() {\n  var iterations = 0;\n  var observer = new BrowserMutationObserver(flush);\n  var node = document.createTextNode('');\n  observer.observe(node, { characterData: true });\n\n  return function () {\n    node.data = iterations = ++iterations % 2;\n  };\n}\n\n// web worker\nfunction useMessageChannel() {\n  var channel = new MessageChannel();\n  channel.port1.onmessage = flush;\n  return function () {\n    return channel.port2.postMessage(0);\n  };\n}\n\nfunction useSetTimeout() {\n  // Store setTimeout reference so es6-promise will be unaffected by\n  // other code modifying setTimeout (like sinon.useFakeTimers())\n  var globalSetTimeout = setTimeout;\n  return function () {\n    return globalSetTimeout(flush, 1);\n  };\n}\n\nvar queue = new Array(1000);\nfunction flush() {\n  for (var i = 0; i < len; i += 2) {\n    var callback = queue[i];\n    var arg = queue[i + 1];\n\n    callback(arg);\n\n    queue[i] = undefined;\n    que
 ue[i + 1] = undefined;\n  }\n\n  len = 0;\n}\n\nfunction attemptVertx() {\n  try {\n    var vertx = Function('return this')().require('vertx');\n    vertxNext = vertx.runOnLoop || vertx.runOnContext;\n    return useVertxTimer();\n  } catch (e) {\n    return useSetTimeout();\n  }\n}\n\nvar scheduleFlush = void 0;\n// Decide what async method to use to triggering processing of queued callbacks:\nif (isNode) {\n  scheduleFlush = useNextTick();\n} else if (BrowserMutationObserver) {\n  scheduleFlush = useMutationObserver();\n} else if (isWorker) {\n  scheduleFlush = useMessageChannel();\n} else if (browserWindow === undefined && typeof require === 'function') {\n  scheduleFlush = attemptVertx();\n} else {\n  scheduleFlush = useSetTimeout();\n}","import { invokeCallback, subscribe, FULFILLED, REJECTED, noop, makePromise, PROMISE_ID } from './-internal';\n\nimport { asap } from './asap';\n\nexport default function then(onFulfillment, onRejection) {\n  var parent = this;\n\n  var child = n
 ew this.constructor(noop);\n\n  if (child[PROMISE_ID] === undefined) {\n    makePromise(child);\n  }\n\n  var _state = parent._state;\n\n\n  if (_state) {\n    var callback = arguments[_state - 1];\n    asap(function () {\n      return invokeCallback(_state, child, callback, parent._result);\n    });\n  } else {\n    subscribe(parent, child, onFulfillment, onRejection);\n  }\n\n  return child;\n}","import { noop, resolve as _resolve } from '../-internal';\n\n/**\n  `Promise.resolve` returns a promise that will become resolved with the\n  passed `value`. It is shorthand for the following:\n\n  ```javascript\n  let promise = new Promise(function(resolve, reject){\n    resolve(1);\n  });\n\n  promise.then(function(value){\n    // value === 1\n  });\n  ```\n\n  Instead of writing the above, your code now simply becomes the following:\n\n  ```javascript\n  let promise = Promise.resolve(1);\n\n  promise.then(function(value){\n    // value === 1\n  });\n  ```\n\n  @method resolve\n  @stati
 c\n  @param {Any} value value that the returned promise will be resolved with\n  Useful for tooling.\n  @return {Promise} a promise that will become fulfilled with the given\n  `value`\n*/\nexport default function resolve(object) {\n  /*jshint validthis:true */\n  var Constructor = this;\n\n  if (object && typeof object === 'object' && object.constructor === Constructor) {\n    return object;\n  }\n\n  var promise = new Constructor(noop);\n  _resolve(promise, object);\n  return promise;\n}","import { objectOrFunction, isFunction } from './utils';\n\nimport { asap } from './asap';\n\nimport originalThen from './then';\nimport originalResolve from './promise/resolve';\n\nexport var PROMISE_ID = Math.random().toString(36).substring(2);\n\nfunction noop() {}\n\nvar PENDING = void 0;\nvar FULFILLED = 1;\nvar REJECTED = 2;\n\nvar TRY_CATCH_ERROR = { error: null };\n\nfunction selfFulfillment() {\n  return new TypeError(\"You cannot resolve a promise with itself\");\n}\n\nfunction cannotRe
 turnOwn() {\n  return new TypeError('A promises callback cannot return that same promise.');\n}\n\nfunction getThen(promise) {\n  try {\n    return promise.then;\n  } catch (error) {\n    TRY_CATCH_ERROR.error = error;\n    return TRY_CATCH_ERROR;\n  }\n}\n\nfunction tryThen(then, value, fulfillmentHandler, rejectionHandler) {\n  try {\n    then.call(value, fulfillmentHandler, rejectionHandler);\n  } catch (e) {\n    return e;\n  }\n}\n\nfunction handleForeignThenable(promise, thenable, then) {\n  asap(function (promise) {\n    var sealed = false;\n    var error = tryThen(then, thenable, function (value) {\n      if (sealed) {\n        return;\n      }\n      sealed = true;\n      if (thenable !== value) {\n        resolve(promise, value);\n      } else {\n        fulfill(promise, value);\n      }\n    }, function (reason) {\n      if (sealed) {\n        return;\n      }\n      sealed = true;\n\n      reject(promise, reason);\n    }, 'Settle: ' + (promise._label || ' unknown promise
 '));\n\n    if (!sealed && error) {\n      sealed = true;\n      reject(promise, error);\n    }\n  }, promise);\n}\n\nfunction handleOwnThenable(promise, thenable) {\n  if (thenable._state === FULFILLED) {\n    fulfill(promise, thenable._result);\n  } else if (thenable._state === REJECTED) {\n    reject(promise, thenable._result);\n  } else {\n    subscribe(thenable, undefined, function (value) {\n      return resolve(promise, value);\n    }, function (reason) {\n      return reject(promise, reason);\n    });\n  }\n}\n\nfunction handleMaybeThenable(promise, maybeThenable, then) {\n  if (maybeThenable.constructor === promise.constructor && then === originalThen && maybeThenable.constructor.resolve === originalResolve) {\n    handleOwnThenable(promise, maybeThenable);\n  } else {\n    if (then === TRY_CATCH_ERROR) {\n      reject(promise, TRY_CATCH_ERROR.error);\n      TRY_CATCH_ERROR.error = null;\n    } else if (then === undefined) {\n      fulfill(promise, maybeThenable);\n    } el
 se if (isFunction(then)) {\n      handleForeignThenable(promise, maybeThenable, then);\n    } else {\n      fulfill(promise, maybeThenable);\n    }\n  }\n}\n\nfunction resolve(promise, value) {\n  if (promise === value) {\n    reject(promise, selfFulfillment());\n  } else if (objectOrFunction(value)) {\n    handleMaybeThenable(promise, value, getThen(value));\n  } else {\n    fulfill(promise, value);\n  }\n}\n\nfunction publishRejection(promise) {\n  if (promise._onerror) {\n    promise._onerror(promise._result);\n  }\n\n  publish(promise);\n}\n\nfunction fulfill(promise, value) {\n  if (promise._state !== PENDING) {\n    return;\n  }\n\n  promise._result = value;\n  promise._state = FULFILLED;\n\n  if (promise._subscribers.length !== 0) {\n    asap(publish, promise);\n  }\n}\n\nfunction reject(promise, reason) {\n  if (promise._state !== PENDING) {\n    return;\n  }\n  promise._state = REJECTED;\n  promise._result = reason;\n\n  asap(publishRejection, promise);\n}\n\nfunction subsc
 ribe(parent, child, onFulfillment, onRejection) {\n  var _subscribers = parent._subscribers;\n  var length = _subscribers.length;\n\n\n  parent._onerror = null;\n\n  _subscribers[length] = child;\n  _subscribers[length + FULFILLED] = onFulfillment;\n  _subscribers[length + REJECTED] = onRejection;\n\n  if (length === 0 && parent._state) {\n    asap(publish, parent);\n  }\n}\n\nfunction publish(promise) {\n  var subscribers = promise._subscribers;\n  var settled = promise._state;\n\n  if (subscribers.length === 0) {\n    return;\n  }\n\n  var child = void 0,\n      callback = void 0,\n      detail = promise._result;\n\n  for (var i = 0; i < subscribers.length; i += 3) {\n    child = subscribers[i];\n    callback = subscribers[i + settled];\n\n    if (child) {\n      invokeCallback(settled, child, callback, detail);\n    } else {\n      callback(detail);\n    }\n  }\n\n  promise._subscribers.length = 0;\n}\n\nfunction tryCatch(callback, detail) {\n  try {\n    return callback(detail);
 \n  } catch (e) {\n    TRY_CATCH_ERROR.error = e;\n    return TRY_CATCH_ERROR;\n  }\n}\n\nfunction invokeCallback(settled, promise, callback, detail) {\n  var hasCallback = isFunction(callback),\n      value = void 0,\n      error = void 0,\n      succeeded = void 0,\n      failed = void 0;\n\n  if (hasCallback) {\n    value = tryCatch(callback, detail);\n\n    if (value === TRY_CATCH_ERROR) {\n      failed = true;\n      error = value.error;\n      value.error = null;\n    } else {\n      succeeded = true;\n    }\n\n    if (promise === value) {\n      reject(promise, cannotReturnOwn());\n      return;\n    }\n  } else {\n    value = detail;\n    succeeded = true;\n  }\n\n  if (promise._state !== PENDING) {\n    // noop\n  } else if (hasCallback && succeeded) {\n    resolve(promise, value);\n  } else if (failed) {\n    reject(promise, error);\n  } else if (settled === FULFILLED) {\n    fulfill(promise, value);\n  } else if (settled === REJECTED) {\n    reject(promise, value);\n  }\n
 }\n\nfunction initializePromise(promise, resolver) {\n  try {\n    resolver(function resolvePromise(value) {\n      resolve(promise, value);\n    }, function rejectPromise(reason) {\n      reject(promise, reason);\n    });\n  } catch (e) {\n    reject(promise, e);\n  }\n}\n\nvar id = 0;\nfunction nextId() {\n  return id++;\n}\n\nfunction makePromise(promise) {\n  promise[PROMISE_ID] = id++;\n  promise._state = undefined;\n  promise._result = undefined;\n  promise._subscribers = [];\n}\n\nexport { nextId, makePromise, getThen, noop, resolve, reject, fulfill, subscribe, publish, publishRejection, initializePromise, invokeCallback, FULFILLED, REJECTED, PENDING, handleMaybeThenable };","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nimport { isArray, isMaybeThenable } from './utils';\nimport { noop, reject, fulfill, subscribe, FULFILLED, REJECTED, PENDING, getThen, handleMaybe
 Thenable } from './-internal';\n\nimport then from './then';\nimport Promise from './promise';\nimport originalResolve from './promise/resolve';\nimport originalThen from './then';\nimport { makePromise, PROMISE_ID } from './-internal';\n\nfunction validationError() {\n  return new Error('Array Methods must be provided an Array');\n};\n\nvar Enumerator = function () {\n  function Enumerator(Constructor, input) {\n    this._instanceConstructor = Constructor;\n    this.promise = new Constructor(noop);\n\n    if (!this.promise[PROMISE_ID]) {\n      makePromise(this.promise);\n    }\n\n    if (isArray(input)) {\n      this.length = input.length;\n      this._remaining = input.length;\n\n      this._result = new Array(this.length);\n\n      if (this.length === 0) {\n        fulfill(this.promise, this._result);\n      } else {\n        this.length = this.length || 0;\n        this._enumerate(input);\n        if (this._remaining === 0) {\n          fulfill(this.promise, this._result);\n   
      }\n      }\n    } else {\n      reject(this.promise, validationError());\n    }\n  }\n\n  Enumerator.prototype._enumerate = function _enumerate(input) {\n    for (var i = 0; this._state === PENDING && i < input.length; i++) {\n      this._eachEntry(input[i], i);\n    }\n  };\n\n  Enumerator.prototype._eachEntry = function _eachEntry(entry, i) {\n    var c = this._instanceConstructor;\n    var resolve = c.resolve;\n\n\n    if (resolve === originalResolve) {\n      var _then = getThen(entry);\n\n      if (_then === originalThen && entry._state !== PENDING) {\n        this._settledAt(entry._state, i, entry._result);\n      } else if (typeof _then !== 'function') {\n        this._remaining--;\n        this._result[i] = entry;\n      } else if (c === Promise) {\n        var promise = new c(noop);\n        handleMaybeThenable(promise, entry, _then);\n        this._willSettleAt(promise, i);\n      } else {\n        this._willSettleAt(new c(function (resolve) {\n          return resolv
 e(entry);\n        }), i);\n      }\n    } else {\n      this._willSettleAt(resolve(entry), i);\n    }\n  };\n\n  Enumerator.prototype._settledAt = function _settledAt(state, i, value) {\n    var promise = this.promise;\n\n\n    if (promise._state === PENDING) {\n      this._remaining--;\n\n      if (state === REJECTED) {\n        reject(promise, value);\n      } else {\n        this._result[i] = value;\n      }\n    }\n\n    if (this._remaining === 0) {\n      fulfill(promise, this._result);\n    }\n  };\n\n  Enumerator.prototype._willSettleAt = function _willSettleAt(promise, i) {\n    var enumerator = this;\n\n    subscribe(promise, undefined, function (value) {\n      return enumerator._settledAt(FULFILLED, i, value);\n    }, function (reason) {\n      return enumerator._settledAt(REJECTED, i, reason);\n    });\n  };\n\n  return Enumerator;\n}();\n\nexport default Enumerator;\n;","import Enumerator from '../enumerator';\n\n/**\n  `Promise.all` accepts an array of promises, and r
 eturns a new promise which\n  is fulfilled with an array of fulfillment values for the passed promises, or\n  rejected with the reason of the first passed promise to be rejected. It casts all\n  elements of the passed iterable to promises as it runs this algorithm.\n\n  Example:\n\n  ```javascript\n  let promise1 = resolve(1);\n  let promise2 = resolve(2);\n  let promise3 = resolve(3);\n  let promises = [ promise1, promise2, promise3 ];\n\n  Promise.all(promises).then(function(array){\n    // The array here would be [ 1, 2, 3 ];\n  });\n  ```\n\n  If any of the `promises` given to `all` are rejected, the first promise\n  that is rejected will be given as an argument to the returned promises's\n  rejection handler. For example:\n\n  Example:\n\n  ```javascript\n  let promise1 = resolve(1);\n  let promise2 = reject(new Error(\"2\"));\n  let promise3 = reject(new Error(\"3\"));\n  let promises = [ promise1, promise2, promise3 ];\n\n  Promise.all(promises).then(function(array){\n    // 
 Code here never runs because there are rejected promises!\n  }, function(error) {\n    // error.message === \"2\"\n  });\n  ```\n\n  @method all\n  @static\n  @param {Array} entries array of promises\n  @param {String} label optional string for labeling the promise.\n  Useful for tooling.\n  @return {Promise} promise that is fulfilled when all `promises` have been\n  fulfilled, or rejected if any of them become rejected.\n  @static\n*/\nexport default function all(entries) {\n  return new Enumerator(this, entries).promise;\n}","import { isArray } from \"../utils\";\n\n/**\n  `Promise.race` returns a new promise which is settled in the same way as the\n  first passed promise to settle.\n\n  Example:\n\n  ```javascript\n  let promise1 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 1');\n    }, 200);\n  });\n\n  let promise2 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 2');\n    }, 100);\n  })
 ;\n\n  Promise.race([promise1, promise2]).then(function(result){\n    // result === 'promise 2' because it was resolved before promise1\n    // was resolved.\n  });\n  ```\n\n  `Promise.race` is deterministic in that only the state of the first\n  settled promise matters. For example, even if other promises given to the\n  `promises` array argument are resolved, but the first settled promise has\n  become rejected before the other promises became fulfilled, the returned\n  promise will become rejected:\n\n  ```javascript\n  let promise1 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 1');\n    }, 200);\n  });\n\n  let promise2 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      reject(new Error('promise 2'));\n    }, 100);\n  });\n\n  Promise.race([promise1, promise2]).then(function(result){\n    // Code here never runs\n  }, function(reason){\n    // reason.message === 'promise 2' because promise 2 became rejected
  before\n    // promise 1 became fulfilled\n  });\n  ```\n\n  An example real-world use case is implementing timeouts:\n\n  ```javascript\n  Promise.race([ajax('foo.json'), timeout(5000)])\n  ```\n\n  @method race\n  @static\n  @param {Array} promises array of promises to observe\n  Useful for tooling.\n  @return {Promise} a promise which settles in the same way as the first passed\n  promise to settle.\n*/\nexport default function race(entries) {\n  /*jshint validthis:true */\n  var Constructor = this;\n\n  if (!isArray(entries)) {\n    return new Constructor(function (_, reject) {\n      return reject(new TypeError('You must pass an array to race.'));\n    });\n  } else {\n    return new Constructor(function (resolve, reject) {\n      var length = entries.length;\n      for (var i = 0; i < length; i++) {\n        Constructor.resolve(entries[i]).then(resolve, reject);\n      }\n    });\n  }\n}","import { noop, reject as _reject } from '../-internal';\n\n/**\n  `Promise.reject` retu
 rns a promise rejected with the passed `reason`.\n  It is shorthand for the following:\n\n  ```javascript\n  let promise = new Promise(function(resolve, reject){\n    reject(new Error('WHOOPS'));\n  });\n\n  promise.then(function(value){\n    // Code here doesn't run because the promise is rejected!\n  }, function(reason){\n    // reason.message === 'WHOOPS'\n  });\n  ```\n\n  Instead of writing the above, your code now simply becomes the following:\n\n  ```javascript\n  let promise = Promise.reject(new Error('WHOOPS'));\n\n  promise.then(function(value){\n    // Code here doesn't run because the promise is rejected!\n  }, function(reason){\n    // reason.message === 'WHOOPS'\n  });\n  ```\n\n  @method reject\n  @static\n  @param {Any} reason value that the returned promise will be rejected with.\n  Useful for tooling.\n  @return {Promise} a promise rejected with the given `reason`.\n*/\nexport default function reject(reason) {\n  /*jshint validthis:true */\n  var Constructor = this
 ;\n  var promise = new Constructor(noop);\n  _reject(promise, reason);\n  return promise;\n}","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nimport { isFunction } from './utils';\nimport { noop, nextId, PROMISE_ID, initializePromise } from './-internal';\nimport { asap, setAsap, setScheduler } from './asap';\n\nimport all from './promise/all';\nimport race from './promise/race';\nimport Resolve from './promise/resolve';\nimport Reject from './promise/reject';\nimport then from './then';\n\nfunction needsResolver() {\n  throw new TypeError('You must pass a resolver function as the first argument to the promise constructor');\n}\n\nfunction needsNew() {\n  throw new TypeError(\"Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.\");\n}\n\n/**\n  Promise objects represent the eventual result of an asynchronous
  operation. The\n  primary way of interacting with a promise is through its `then` method, which\n  registers callbacks to receive either a promise's eventual value or the reason\n  why the promise cannot be fulfilled.\n\n  Terminology\n  -----------\n\n  - `promise` is an object or function with a `then` method whose behavior conforms to this specification.\n  - `thenable` is an object or function that defines a `then` method.\n  - `value` is any legal JavaScript value (including undefined, a thenable, or a promise).\n  - `exception` is a value that is thrown using the throw statement.\n  - `reason` is a value that indicates why a promise was rejected.\n  - `settled` the final resting state of a promise, fulfilled or rejected.\n\n  A promise can be in one of three states: pending, fulfilled, or rejected.\n\n  Promises that are fulfilled have a fulfillment value and are in the fulfilled\n  state.  Promises that are rejected have a rejection reason and are in the\n  rejected state.  
 A fulfillment value is never a thenable.\n\n  Promises can also be said to *resolve* a value.  If this value is also a\n  promise, then the original promise's settled state will match the value's\n  settled state.  So a promise that *resolves* a promise that rejects will\n  itself reject, and a promise that *resolves* a promise that fulfills will\n  itself fulfill.\n\n\n  Basic Usage:\n  ------------\n\n  ```js\n  let promise = new Promise(function(resolve, reject) {\n    // on success\n    resolve(value);\n\n    // on failure\n    reject(reason);\n  });\n\n  promise.then(function(value) {\n    // on fulfillment\n  }, function(reason) {\n    // on rejection\n  });\n  ```\n\n  Advanced Usage:\n  ---------------\n\n  Promises shine when abstracting away asynchronous interactions such as\n  `XMLHttpRequest`s.\n\n  ```js\n  function getJSON(url) {\n    return new Promise(function(resolve, reject){\n      let xhr = new XMLHttpRequest();\n\n      xhr.open('GET', url);\n      xhr.onreadyst
 atechange = handler;\n      xhr.responseType = 'json';\n      xhr.setRequestHeader('Accept', 'application/json');\n      xhr.send();\n\n      function handler() {\n        if (this.readyState === this.DONE) {\n          if (this.status === 200) {\n            resolve(this.response);\n          } else {\n            reject(new Error('getJSON: `' + url + '` failed with status: [' + this.status + ']'));\n          }\n        }\n      };\n    });\n  }\n\n  getJSON('/posts.json').then(function(json) {\n    // on fulfillment\n  }, function(reason) {\n    // on rejection\n  });\n  ```\n\n  Unlike callbacks, promises are great composable primitives.\n\n  ```js\n  Promise.all([\n    getJSON('/posts'),\n    getJSON('/comments')\n  ]).then(function(values){\n    values[0] // => postsJSON\n    values[1] // => commentsJSON\n\n    return values;\n  });\n  ```\n\n  @class Promise\n  @param {Function} resolver\n  Useful for tooling.\n  @constructor\n*/\n\nvar Promise = function () {\n  function Pro
 mise(resolver) {\n    this[PROMISE_ID] = nextId();\n    this._result = this._state = undefined;\n    this._subscribers = [];\n\n    if (noop !== resolver) {\n      typeof resolver !== 'function' && needsResolver();\n      this instanceof Promise ? initializePromise(this, resolver) : needsNew();\n    }\n  }\n\n  /**\n  The primary way of interacting with a promise is through its `then` method,\n  which registers callbacks to receive either a promise's eventual value or the\n  reason why the promise cannot be fulfilled.\n   ```js\n  findUser().then(function(user){\n    // user is available\n  }, function(reason){\n    // user is unavailable, and you are given the reason why\n  });\n  ```\n   Chaining\n  --------\n   The return value of `then` is itself a promise.  This second, 'downstream'\n  promise is resolved with the return value of the first promise's fulfillment\n  or rejection handler, or rejected if the handler throws an exception.\n   ```js\n  findUser().then(function (user) 
 {\n    return user.name;\n  }, function (reason) {\n    return 'default name';\n  }).then(function (userName) {\n    // If `findUser` fulfilled, `userName` will be the user's name, otherwise it\n    // will be `'default name'`\n  });\n   findUser().then(function (user) {\n    throw new Error('Found user, but still unhappy');\n  }, function (reason) {\n    throw new Error('`findUser` rejected and we're unhappy');\n  }).then(function (value) {\n    // never reached\n  }, function (reason) {\n    // if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.\n    // If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.\n  });\n  ```\n  If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.\n   ```js\n  findUser().then(function (user) {\n    throw new PedagogicalException('Upstream error');\n  }).then(function (value) {\n    // never reached\n  }).then(function (value) {\n    // 
 never reached\n  }, function (reason) {\n    // The `PedgagocialException` is propagated all the way down to here\n  });\n  ```\n   Assimilation\n  ------------\n   Sometimes the value you want to propagate to a downstream promise can only be\n  retrieved asynchronously. This can be achieved by returning a promise in the\n  fulfillment or rejection handler. The downstream promise will then be pending\n  until the returned promise is settled. This is called *assimilation*.\n   ```js\n  findUser().then(function (user) {\n    return findCommentsByAuthor(user);\n  }).then(function (comments) {\n    // The user's comments are now available\n  });\n  ```\n   If the assimliated promise rejects, then the downstream promise will also reject.\n   ```js\n  findUser().then(function (user) {\n    return findCommentsByAuthor(user);\n  }).then(function (comments) {\n    // If `findCommentsByAuthor` fulfills, we'll have the value here\n  }, function (reason) {\n    // If `findCommentsByAuthor` reje
 cts, we'll have the reason here\n  });\n  ```\n   Simple Example\n  --------------\n   Synchronous Example\n   ```javascript\n  let result;\n   try {\n    result = findResult();\n    // success\n  } catch(reason) {\n    // failure\n  }\n  ```\n   Errback Example\n   ```js\n  findResult(function(result, err){\n    if (err) {\n      // failure\n    } else {\n      // success\n    }\n  });\n  ```\n   Promise Example;\n   ```javascript\n  findResult().then(function(result){\n    // success\n  }, function(reason){\n    // failure\n  });\n  ```\n   Advanced Example\n  --------------\n   Synchronous Example\n   ```javascript\n  let author, books;\n   try {\n    author = findAuthor();\n    books  = findBooksByAuthor(author);\n    // success\n  } catch(reason) {\n    // failure\n  }\n  ```\n   Errback Example\n   ```js\n   function foundBooks(books) {\n   }\n   function failure(reason) {\n   }\n   findAuthor(function(author, err){\n    if (err) {\n      failure(err);\n      // failure\n    }
  else {\n      try {\n        findBoooksByAuthor(author, function(books, err) {\n          if (err) {\n            failure(err);\n          } else {\n            try {\n              foundBooks(books);\n            } catch(reason) {\n              failure(reason);\n            }\n          }\n        });\n      } catch(error) {\n        failure(err);\n      }\n      // success\n    }\n  });\n  ```\n   Promise Example;\n   ```javascript\n  findAuthor().\n    then(findBooksByAuthor).\n    then(function(books){\n      // found books\n  }).catch(function(reason){\n    // something went wrong\n  });\n  ```\n   @method then\n  @param {Function} onFulfilled\n  @param {Function} onRejected\n  Useful for tooling.\n  @return {Promise}\n  */\n\n  /**\n  `catch` is simply sugar for `then(undefined, onRejection)` which makes it the same\n  as the catch block of a try/catch statement.\n  ```js\n  function findAuthor(){\n  throw new Error('couldn't find that author');\n  }\n  // synchronous\n  try
  {\n  findAuthor();\n  } catch(reason) {\n  // something went wrong\n  }\n  // async with promises\n  findAuthor().catch(function(reason){\n  // something went wrong\n  });\n  ```\n  @method catch\n  @param {Function} onRejection\n  Useful for tooling.\n  @return {Promise}\n  */\n\n\n  Promise.prototype.catch = function _catch(onRejection) {\n    return this.then(null, onRejection);\n  };\n\n  /**\n    `finally` will be invoked regardless of the promise's fate just as native\n    try/catch/finally behaves\n  \n    Synchronous example:\n  \n    ```js\n    findAuthor() {\n      if (Math.random() > 0.5) {\n        throw new Error();\n      }\n      return new Author();\n    }\n  \n    try {\n      return findAuthor(); // succeed or fail\n    } catch(error) {\n      return findOtherAuther();\n    } finally {\n      // always runs\n      // doesn't affect the return value\n    }\n    ```\n  \n    Asynchronous example:\n  \n    ```js\n    findAuthor().catch(function(reason){\n      return
  findOtherAuther();\n    }).finally(function(){\n      // author was either found, or not\n    });\n    ```\n  \n    @method finally\n    @param {Function} callback\n    @return {Promise}\n  */\n\n\n  Promise.prototype.finally = function _finally(callback) {\n    var promise = this;\n    var constructor = promise.constructor;\n\n    return promise.then(function (value) {\n      return constructor.resolve(callback()).then(function () {\n        return value;\n      });\n    }, function (reason) {\n      return constructor.resolve(callback()).then(function () {\n        throw reason;\n      });\n    });\n  };\n\n  return Promise;\n}();\n\nPromise.prototype.then = then;\nexport default Promise;\nPromise.all = all;\nPromise.race = race;\nPromise.resolve = Resolve;\nPromise.reject = Reject;\nPromise._setScheduler = setScheduler;\nPromise._setAsap = setAsap;\nPromise._asap = asap;","/*global self*/\nimport Promise from './promise';\n\nexport default function polyfill() {\n  var local = vo
 id 0;\n\n  if (typeof global !== 'undefined') {\n    local = global;\n  } else if (typeof self !== 'undefined') {\n    local = self;\n  } else {\n    try {\n      local = Function('return this')();\n    } catch (e) {\n      throw new Error('polyfill failed because global object is unavailable in this environment');\n    }\n  }\n\n  var P = local.Promise;\n\n  if (P) {\n    var promiseToString = null;\n    try {\n      promiseToString = Object.prototype.toString.call(P.resolve());\n    } catch (e) {\n      // silently ignored\n    }\n\n    if (promiseToString === '[object Promise]' && !P.cast) {\n      return;\n    }\n  }\n\n  local.Promise = Promise;\n}","import Promise from './es6-promise/promise';\nimport polyfill from './es6-promise/polyfill';\n\n// Strange compat..\nPromise.polyfill = polyfill;\nPromise.Promise = Promise;\nexport default Promise;","import Promise from './es6-promise';\nPromise.polyfill();\nexport default Promise;"],"names":["resolve","_resolve","then","originalT
 hen","originalResolve","Promise","reject","_reject","Resolve","Reject"],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;ACNO,SAAS,gBAAgB,CAAC,CAAC,EAAE;EAClC,IAAI,IAAI,GAAG,OAAO,CAAC,CAAC;EACpB,OAAO,CAAC,KAAK,IAAI,KAAK,IAAI,KAAK,QAAQ,IAAI,IAAI,KAAK,UAAU,CAAC,CAAC;CACjE;;AAED,AAAO,SAAS,UAAU,CAAC,CAAC,EAAE;EAC5B,OAAO,OAAO,CAAC,KAAK,UAAU,CAAC;CAChC;;AAED,AAEC;;AAED,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC;AACtB,IAAI,KAAK,CAAC,OAAO,EAAE;EACjB,QAAQ,GAAG,KAAK,CAAC,OAAO,CAAC;CAC1B,MAAM;EACL,QAAQ,GAAG,UAAU,CAAC,EAAE;IACtB,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC,KAAK,gBAAgB,CAAC;GAC/D,CAAC;CACH;;AAED,AAAO,IAAI,OAAO,GAAG,QAAQ;;ACtB7B,IAAI,GAAG,GAAG,CAAC,CAAC;AACZ,IAAI,SAAS,GAAG,KAAK,CAAC,CAAC;AACvB,IAAI,iBAAiB,GAAG,KAAK,CAAC,CAAC;;AAE/B,AAAO,IAAI,IAAI,GAAG,SAAS,IAAI,CAAC,QAAQ,EAAE,GAAG,EAAE;EAC7C,KAAK,CAAC,GAAG,CAAC,GAAG,QAAQ,CAAC;EACtB,KAAK,CAAC,GAAG,GAAG,CAAC,CAAC,GAAG,GAAG,CAAC;EACrB,GAAG,IAAI,CAAC,CAAC;EACT,IAAI,GAAG,KAAK,CAAC,EAAE;;;;IAIb,IAAI,iBAAiB,EAAE;MACrB,iBAAiB,CAAC,KAAK
 ,CAAC,CAAC;KAC1B,MAAM;MACL,aAAa,EAAE,CAAC;KACjB;GACF;CACF,CAAC;;AAEF,AAAO,SAAS,YAAY,CAAC,UAAU,EAAE;EACvC,iBAAiB,GAAG,UAAU,CAAC;CAChC;;AAED,AAAO,SAAS,OAAO,CAAC,MAAM,EAAE;EAC9B,IAAI,GAAG,MAAM,CAAC;CACf;;AAED,IAAI,aAAa,GAAG,OAAO,MAAM,KAAK,WAAW,GAAG,MAAM,GAAG,SAAS,CAAC;AACvE,IAAI,aAAa,GAAG,aAAa,IAAI,EAAE,CAAC;AACxC,IAAI,uBAAuB,GAAG,aAAa,CAAC,gBAAgB,IAAI,aAAa,CAAC,sBAAsB,CAAC;AACrG,IAAI,MAAM,GAAG,OAAO,IAAI,KAAK,WAAW,IAAI,OAAO,OAAO,KAAK,WAAW,IAAI,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,OAAO,CAAC,KAAK,kBAAkB,CAAC;;;AAG/H,IAAI,QAAQ,GAAG,OAAO,iBAAiB,KAAK,WAAW,IAAI,OAAO,aAAa,KAAK,WAAW,IAAI,OAAO,cAAc,KAAK,WAAW,CAAC;;;AAGzI,SAAS,WAAW,GAAG;;;EAGrB,OAAO,YAAY;IACjB,OAAO,OAAO,CAAC,QAAQ,CAAC,KAAK,CAAC,CAAC;GAChC,CAAC;CACH;;;AAGD,SAAS,aAAa,GAAG;EACvB,IAAI,OAAO,SAAS,KAAK,WAAW,EAAE;IACpC,OAAO,YAAY;MACjB,SAAS,CAAC,KAAK,CAAC,CAAC;KAClB,CAAC;GACH;;EAED,OAAO,aAAa,EAAE,CAAC;CACxB;;AAED,SAAS,mBAAmB,GAAG;EAC7B,IAAI,UAAU,GAAG,CAAC,CAAC;EACnB,IAAI,QAAQ,GAAG,IAAI,uBAAuB,CAAC,KAAK,CAAC,CAAC;EAClD,IAAI,IAAI,GAAG,QAAQ,CAAC,c
 AAc,CAAC,EAAE,CAAC,CAAC;EACvC,QAAQ,CAAC,OAAO,CAAC,IAAI,EAAE,EAAE,aAAa,EAAE,IAAI,EAAE,CAAC,CAAC;;EAEhD,OAAO,YAAY;IACjB,IAAI,CAAC,IAAI,GAAG,UAAU,GAAG,EAAE,UAAU,GAAG,CAAC,CAAC;GAC3C,CAAC;CACH;;;AAGD,SAAS,iBAAiB,GAAG;EAC3B,IAAI,OAAO,GAAG,IAAI,cAAc,EAAE,CAAC;EACnC,OAAO,CAAC,KAAK,CAAC,SAAS,GAAG,KAAK,CAAC;EAChC,OAAO,YAAY;IACjB,OAAO,OAAO,CAAC,KAAK,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC;GACrC,CAAC;CACH;;AAED,SAAS,aAAa,GAAG;;;EAGvB,IAAI,gBAAgB,GAAG,UAAU,CAAC;EAClC,OAAO,YAAY;IACjB,OAAO,gBAAgB,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;GACnC,CAAC;CACH;;AAED,IAAI,KAAK,GAAG,IAAI,KAAK,CAAC,IAAI,CAAC,CAAC;AAC5B,SAAS,KAAK,GAAG;EACf,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,GAAG,EAAE,CAAC,IAAI,CAAC,EAAE;IAC/B,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC,CAAC,CAAC;IACxB,IAAI,GAAG,GAAG,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC;;IAEvB,QAAQ,CAAC,GAAG,CAAC,CAAC;;IAEd,KAAK,CAAC,CAAC,CAAC,GAAG,SAAS,CAAC;IACrB,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,GAAG,SAAS,CAAC;GAC1B;;EAED,GAAG,GAAG,CAAC,CAAC;CACT;;AAED,SAAS,YAAY,GAAG;EACtB,IAAI;IACF,IAAI,KAAK,GAAG,QAAQ,CAAC,a
 AAa,CAAC,EAAE,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;IACvD,SAAS,GAAG,KAAK,CAAC,SAAS,IAAI,KAAK,CAAC,YAAY,CAAC;IAClD,OAAO,aAAa,EAAE,CAAC;GACxB,CAAC,OAAO,CAAC,EAAE;IACV,OAAO,aAAa,EAAE,CAAC;GACxB;CACF;;AAED,IAAI,aAAa,GAAG,KAAK,CAAC,CAAC;;AAE3B,IAAI,MAAM,EAAE;EACV,aAAa,GAAG,WAAW,EAAE,CAAC;CAC/B,MAAM,IAAI,uBAAuB,EAAE;EAClC,aAAa,GAAG,mBAAmB,EAAE,CAAC;CACvC,MAAM,IAAI,QAAQ,EAAE;EACnB,aAAa,GAAG,iBAAiB,EAAE,CAAC;CACrC,MAAM,IAAI,aAAa,KAAK,SAAS,IAAI,OAAO,OAAO,KAAK,UAAU,EAAE;EACvE,aAAa,GAAG,YAAY,EAAE,CAAC;CAChC,MAAM;EACL,aAAa,GAAG,aAAa,EAAE,CAAC;;;CACjC,DCtHc,SAAS,IAAI,CAAC,aAAa,EAAE,WAAW,EAAE;EACvD,IAAI,MAAM,GAAG,IAAI,CAAC;;EAElB,IAAI,KAAK,GAAG,IAAI,IAAI,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC;;EAEvC,IAAI,KAAK,CAAC,UAAU,CAAC,KAAK,SAAS,EAAE;IACnC,WAAW,CAAC,KAAK,CAAC,CAAC;GACpB;;EAED,IAAI,MAAM,GAAG,MAAM,CAAC,MAAM,CAAC;;;EAG3B,IAAI,MAAM,EAAE;IACV,IAAI,QAAQ,GAAG,SAAS,CAAC,MAAM,GAAG,CAAC,CAAC,CAAC;IACrC,IAAI,CAAC,YAAY;MACf,OAAO,cAAc,CAAC,MAAM,EAAE,KAAK,EAAE,QAAQ,EAAE,MAAM,CAAC,OAAO,CAAC,CAAC;KAChE,CAAC,CAAC;GACJ,MAAM;I
 ACL,SAAS,CAAC,MAAM,EAAE,KAAK,EAAE,aAAa,EAAE,WAAW,CAAC,CAAC;GACtD;;EAED,OAAO,KAAK,CAAC;;;CACd,DCxBD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA+BA,AAAe,SAASA,SAAO,CAAC,MAAM,EAAE;;EAEtC,IAAI,WAAW,GAAG,IAAI,CAAC;;EAEvB,IAAI,MAAM,IAAI,OAAO,MAAM,KAAK,QAAQ,IAAI,MAAM,CAAC,WAAW,KAAK,WAAW,EAAE;IAC9E,OAAO,MAAM,CAAC;GACf;;EAED,IAAI,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;EACpCC,OAAQ,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;EAC1B,OAAO,OAAO,CAAC;;;CAChB,DCrCM,IAAI,UAAU,GAAG,IAAI,CAAC,MAAM,EAAE,CAAC,QAAQ,CAAC,EAAE,CAAC,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC;;AAEhE,SAAS,IAAI,GAAG,EAAE;;AAElB,IAAI,OAAO,GAAG,KAAK,CAAC,CAAC;AACrB,IAAI,SAAS,GAAG,CAAC,CAAC;AAClB,IAAI,QAAQ,GAAG,CAAC,CAAC;;AAEjB,IAAI,eAAe,GAAG,EAAE,KAAK,EAAE,IAAI,EAAE,CAAC;;AAEtC,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,SAAS,CAAC,0CAA0C,CAAC,CAAC;CAClE;;AAED,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,SAAS,CAAC,sDAAsD,CAAC,CAAC;CAC9E;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE;EACxB,IAAI;IACF,OAAO,OAAO,CAAC,IAAI,CAAC;GACrB,CAAC,OAAO,KAAK,EAAE;IACd,eAAe,CAAC,KAAK,GAAG,KAAK,CAAC;IAC9B,OAAO,eAAe,CAAC;GACxB
 ;CACF;;AAED,SAAS,OAAO,CAACC,OAAI,EAAE,KAAK,EAAE,kBAAkB,EAAE,gBAAgB,EAAE;EAClE,IAAI;IACFA,OAAI,CAAC,IAAI,CAAC,KAAK,EAAE,kBAAkB,EAAE,gBAAgB,CAAC,CAAC;GACxD,CAAC,OAAO,CAAC,EAAE;IACV,OAAO,CAAC,CAAC;GACV;CACF;;AAED,SAAS,qBAAqB,CAAC,OAAO,EAAE,QAAQ,EAAEA,OAAI,EAAE;EACtD,IAAI,CAAC,UAAU,OAAO,EAAE;IACtB,IAAI,MAAM,GAAG,KAAK,CAAC;IACnB,IAAI,KAAK,GAAG,OAAO,CAACA,OAAI,EAAE,QAAQ,EAAE,UAAU,KAAK,EAAE;MACnD,IAAI,MAAM,EAAE;QACV,OAAO;OACR;MACD,MAAM,GAAG,IAAI,CAAC;MACd,IAAI,QAAQ,KAAK,KAAK,EAAE;QACtB,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACzB,MAAM;QACL,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACzB;KACF,EAAE,UAAU,MAAM,EAAE;MACnB,IAAI,MAAM,EAAE;QACV,OAAO;OACR;MACD,MAAM,GAAG,IAAI,CAAC;;MAEd,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KACzB,EAAE,UAAU,IAAI,OAAO,CAAC,MAAM,IAAI,kBAAkB,CAAC,CAAC,CAAC;;IAExD,IAAI,CAAC,MAAM,IAAI,KAAK,EAAE;MACpB,MAAM,GAAG,IAAI,CAAC;MACd,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KACxB;GACF,EAAE,OAAO,CAAC,CAAC;CACb;;AAED,SAAS,iBAAiB,CAAC,OAAO,EAAE,QAAQ,EAAE;EAC5C,IAAI,QAAQ,CAAC,MAAM,KAAK,SAAS,EAAE;IACjC,OA
 AO,CAAC,OAAO,EAAE,QAAQ,CAAC,OAAO,CAAC,CAAC;GACpC,MAAM,IAAI,QAAQ,CAAC,MAAM,KAAK,QAAQ,EAAE;IACvC,MAAM,CAAC,OAAO,EAAE,QAAQ,CAAC,OAAO,CAAC,CAAC;GACnC,MAAM;IACL,SAAS,CAAC,QAAQ,EAAE,SAAS,EAAE,UAAU,KAAK,EAAE;MAC9C,OAAO,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KAChC,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KAChC,CAAC,CAAC;GACJ;CACF;;AAED,SAAS,mBAAmB,CAAC,OAAO,EAAE,aAAa,EAAEA,OAAI,EAAE;EACzD,IAAI,aAAa,CAAC,WAAW,KAAK,OAAO,CAAC,WAAW,IAAIA,OAAI,KAAKC,IAAY,IAAI,aAAa,CAAC,WAAW,CAAC,OAAO,KAAKC,SAAe,EAAE;IACvI,iBAAiB,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;GAC3C,MAAM;IACL,IAAIF,OAAI,KAAK,eAAe,EAAE;MAC5B,MAAM,CAAC,OAAO,EAAE,eAAe,CAAC,KAAK,CAAC,CAAC;MACvC,eAAe,CAAC,KAAK,GAAG,IAAI,CAAC;KAC9B,MAAM,IAAIA,OAAI,KAAK,SAAS,EAAE;MAC7B,OAAO,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;KACjC,MAAM,IAAI,UAAU,CAACA,OAAI,CAAC,EAAE;MAC3B,qBAAqB,CAAC,OAAO,EAAE,aAAa,EAAEA,OAAI,CAAC,CAAC;KACrD,MAAM;MACL,OAAO,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;KACjC;GACF;CACF;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE,KAAK,EAAE;EAC/B,IAAI,OAAO,KAAK,KAAK,EAAE
 ;IACrB,MAAM,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;GACpC,MAAM,IAAI,gBAAgB,CAAC,KAAK,CAAC,EAAE;IAClC,mBAAmB,CAAC,OAAO,EAAE,KAAK,EAAE,OAAO,CAAC,KAAK,CAAC,CAAC,CAAC;GACrD,MAAM;IACL,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB;CACF;;AAED,SAAS,gBAAgB,CAAC,OAAO,EAAE;EACjC,IAAI,OAAO,CAAC,QAAQ,EAAE;IACpB,OAAO,CAAC,QAAQ,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;GACnC;;EAED,OAAO,CAAC,OAAO,CAAC,CAAC;CAClB;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE,KAAK,EAAE;EAC/B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;IAC9B,OAAO;GACR;;EAED,OAAO,CAAC,OAAO,GAAG,KAAK,CAAC;EACxB,OAAO,CAAC,MAAM,GAAG,SAAS,CAAC;;EAE3B,IAAI,OAAO,CAAC,YAAY,CAAC,MAAM,KAAK,CAAC,EAAE;IACrC,IAAI,CAAC,OAAO,EAAE,OAAO,CAAC,CAAC;GACxB;CACF;;AAED,SAAS,MAAM,CAAC,OAAO,EAAE,MAAM,EAAE;EAC/B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;IAC9B,OAAO;GACR;EACD,OAAO,CAAC,MAAM,GAAG,QAAQ,CAAC;EAC1B,OAAO,CAAC,OAAO,GAAG,MAAM,CAAC;;EAEzB,IAAI,CAAC,gBAAgB,EAAE,OAAO,CAAC,CAAC;CACjC;;AAED,SAAS,SAAS,CAAC,MAAM,EAAE,KAAK,EAAE,aAAa,EAAE,WAAW,EAAE;EAC5D,IAAI,YAAY,GAAG,MAAM,CAAC,YAAY,CAAC;EACvC,IAAI,MAAM,GAAG,YAA
 Y,CAAC,MAAM,CAAC;;;EAGjC,MAAM,CAAC,QAAQ,GAAG,IAAI,CAAC;;EAEvB,YAAY,CAAC,MAAM,CAAC,GAAG,KAAK,CAAC;EAC7B,YAAY,CAAC,MAAM,GAAG,SAAS,CAAC,GAAG,aAAa,CAAC;EACjD,YAAY,CAAC,MAAM,GAAG,QAAQ,CAAC,GAAG,WAAW,CAAC;;EAE9C,IAAI,MAAM,KAAK,CAAC,IAAI,MAAM,CAAC,MAAM,EAAE;IACjC,IAAI,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;GACvB;CACF;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE;EACxB,IAAI,WAAW,GAAG,OAAO,CAAC,YAAY,CAAC;EACvC,IAAI,OAAO,GAAG,OAAO,CAAC,MAAM,CAAC;;EAE7B,IAAI,WAAW,CAAC,MAAM,KAAK,CAAC,EAAE;IAC5B,OAAO;GACR;;EAED,IAAI,KAAK,GAAG,KAAK,CAAC;MACd,QAAQ,GAAG,KAAK,CAAC;MACjB,MAAM,GAAG,OAAO,CAAC,OAAO,CAAC;;EAE7B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,WAAW,CAAC,MAAM,EAAE,CAAC,IAAI,CAAC,EAAE;IAC9C,KAAK,GAAG,WAAW,CAAC,CAAC,CAAC,CAAC;IACvB,QAAQ,GAAG,WAAW,CAAC,CAAC,GAAG,OAAO,CAAC,CAAC;;IAEpC,IAAI,KAAK,EAAE;MACT,cAAc,CAAC,OAAO,EAAE,KAAK,EAAE,QAAQ,EAAE,MAAM,CAAC,CAAC;KAClD,MAAM;MACL,QAAQ,CAAC,MAAM,CAAC,CAAC;KAClB;GACF;;EAED,OAAO,CAAC,YAAY,CAAC,MAAM,GAAG,CAAC,CAAC;CACjC;;AAED,SAAS,QAAQ,CAAC,QAAQ,EAAE,MAAM,EAAE;EAClC,IAAI;IACF,OAAO,QAAQ
 ,CAAC,MAAM,CAAC,CAAC;GACzB,CAAC,OAAO,CAAC,EAAE;IACV,eAAe,CAAC,KAAK,GAAG,CAAC,CAAC;IAC1B,OAAO,eAAe,CAAC;GACxB;CACF;;AAED,SAAS,cAAc,CAAC,OAAO,EAAE,OAAO,EAAE,QAAQ,EAAE,MAAM,EAAE;EAC1D,IAAI,WAAW,GAAG,UAAU,CAAC,QAAQ,CAAC;MAClC,KAAK,GAAG,KAAK,CAAC;MACd,KAAK,GAAG,KAAK,CAAC;MACd,SAAS,GAAG,KAAK,CAAC;MAClB,MAAM,GAAG,KAAK,CAAC,CAAC;;EAEpB,IAAI,WAAW,EAAE;IACf,KAAK,GAAG,QAAQ,CAAC,QAAQ,EAAE,MAAM,CAAC,CAAC;;IAEnC,IAAI,KAAK,KAAK,eAAe,EAAE;MAC7B,MAAM,GAAG,IAAI,CAAC;MACd,KAAK,GAAG,KAAK,CAAC,KAAK,CAAC;MACpB,KAAK,CAAC,KAAK,GAAG,IAAI,CAAC;KACpB,MAAM;MACL,SAAS,GAAG,IAAI,CAAC;KAClB;;IAED,IAAI,OAAO,KAAK,KAAK,EAAE;MACrB,MAAM,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;MACnC,OAAO;KACR;GACF,MAAM;IACL,KAAK,GAAG,MAAM,CAAC;IACf,SAAS,GAAG,IAAI,CAAC;GAClB;;EAED,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;;GAE/B,MAAM,IAAI,WAAW,IAAI,SAAS,EAAE;IACnC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB,MAAM,IAAI,MAAM,EAAE;IACjB,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACxB,MAAM,IAAI,OAAO,KAAK,SAAS,EAAE;IAChC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB,MAA
 M,IAAI,OAAO,KAAK,QAAQ,EAAE;IAC/B,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACxB;CACF;;AAED,SAAS,iBAAiB,CAAC,OAAO,EAAE,QAAQ,EAAE;EAC5C,IAAI;IACF,QAAQ,CAAC,SAAS,cAAc,CAAC,KAAK,EAAE;MACtC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KACzB,EAAE,SAAS,aAAa,CAAC,MAAM,EAAE;MAChC,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KACzB,CAAC,CAAC;GACJ,CAAC,OAAO,CAAC,EAAE;IACV,MAAM,CAAC,OAAO,EAAE,CAAC,CAAC,CAAC;GACpB;CACF;;AAED,IAAI,EAAE,GAAG,CAAC,CAAC;AACX,SAAS,MAAM,GAAG;EAChB,OAAO,EAAE,EAAE,CAAC;CACb;;AAED,SAAS,WAAW,CAAC,OAAO,EAAE;EAC5B,OAAO,CAAC,UAAU,CAAC,GAAG,EAAE,EAAE,CAAC;EAC3B,OAAO,CAAC,MAAM,GAAG,SAAS,CAAC;EAC3B,OAAO,CAAC,OAAO,GAAG,SAAS,CAAC;EAC5B,OAAO,CAAC,YAAY,GAAG,EAAE,CAAC;CAC3B;;ACrPD,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,KAAK,CAAC,yCAAyC,CAAC,CAAC;CAC7D,AAAC;;AAEF,IAAI,UAAU,GAAG,YAAY;EAC3B,SAAS,UAAU,CAAC,WAAW,EAAE,KAAK,EAAE;IACtC,IAAI,CAAC,oBAAoB,GAAG,WAAW,CAAC;IACxC,IAAI,CAAC,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;;IAErC,IAAI,CAAC,IAAI,CAAC,OAAO,CAAC,UAAU,CAAC,EAAE;MAC7B,WAAW,CAAC,IAAI,CAAC,OAAO,CAAC,CAAC;KAC3B;;IAED
 ,IAAI,OAAO,CAAC,KAAK,CAAC,EAAE;MAClB,IAAI,CAAC,MAAM,GAAG,KAAK,CAAC,MAAM,CAAC;MAC3B,IAAI,CAAC,UAAU,GAAG,KAAK,CAAC,MAAM,CAAC;;MAE/B,IAAI,CAAC,OAAO,GAAG,IAAI,KAAK,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;;MAEtC,IAAI,IAAI,CAAC,MAAM,KAAK,CAAC,EAAE;QACrB,OAAO,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;OACrC,MAAM;QACL,IAAI,CAAC,MAAM,GAAG,IAAI,CAAC,MAAM,IAAI,CAAC,CAAC;QAC/B,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC;QACvB,IAAI,IAAI,CAAC,UAAU,KAAK,CAAC,EAAE;UACzB,OAAO,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;SACrC;OACF;KACF,MAAM;MACL,MAAM,CAAC,IAAI,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;KACzC;GACF;;EAED,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE;IAC3D,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,IAAI,CAAC,MAAM,KAAK,OAAO,IAAI,CAAC,GAAG,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;MAChE,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC;KAC9B;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE,CAAC,EAAE;IAC9D,IAAI,CAAC,GAAG,IAAI,CAAC,oBAAoB,CAAC;IAClC,IAAIF,UAAO,GAAG,CAAC,CAAC,OAAO,CAA
 C;;;IAGxB,IAAIA,UAAO,KAAKI,SAAe,EAAE;MAC/B,IAAI,KAAK,GAAG,OAAO,CAAC,KAAK,CAAC,CAAC;;MAE3B,IAAI,KAAK,KAAKD,IAAY,IAAI,KAAK,CAAC,MAAM,KAAK,OAAO,EAAE;QACtD,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,KAAK,CAAC,OAAO,CAAC,CAAC;OACjD,MAAM,IAAI,OAAO,KAAK,KAAK,UAAU,EAAE;QACtC,IAAI,CAAC,UAAU,EAAE,CAAC;QAClB,IAAI,CAAC,OAAO,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC;OACzB,MAAM,IAAI,CAAC,KAAKE,SAAO,EAAE;QACxB,IAAI,OAAO,GAAG,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC;QAC1B,mBAAmB,CAAC,OAAO,EAAE,KAAK,EAAE,KAAK,CAAC,CAAC;QAC3C,IAAI,CAAC,aAAa,CAAC,OAAO,EAAE,CAAC,CAAC,CAAC;OAChC,MAAM;QACL,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,CAAC,UAAUL,UAAO,EAAE;UAC1C,OAAOA,UAAO,CAAC,KAAK,CAAC,CAAC;SACvB,CAAC,EAAE,CAAC,CAAC,CAAC;OACR;KACF,MAAM;MACL,IAAI,CAAC,aAAa,CAACA,UAAO,CAAC,KAAK,CAAC,EAAE,CAAC,CAAC,CAAC;KACvC;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE,CAAC,EAAE,KAAK,EAAE;IACrE,IAAI,OAAO,GAAG,IAAI,CAAC,OAAO,CAAC;;;IAG3B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;MAC9B,IAAI,CAAC,UAAU,EAAE,CAAC;;MAElB,IAAI,KAAK,KAAK,QAAQ,
 EAAE;QACtB,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACxB,MAAM;QACL,IAAI,CAAC,OAAO,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC;OACzB;KACF;;IAED,IAAI,IAAI,CAAC,UAAU,KAAK,CAAC,EAAE;MACzB,OAAO,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;KAChC;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,aAAa,GAAG,SAAS,aAAa,CAAC,OAAO,EAAE,CAAC,EAAE;IACtE,IAAI,UAAU,GAAG,IAAI,CAAC;;IAEtB,SAAS,CAAC,OAAO,EAAE,SAAS,EAAE,UAAU,KAAK,EAAE;MAC7C,OAAO,UAAU,CAAC,UAAU,CAAC,SAAS,EAAE,CAAC,EAAE,KAAK,CAAC,CAAC;KACnD,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,UAAU,CAAC,UAAU,CAAC,QAAQ,EAAE,CAAC,EAAE,MAAM,CAAC,CAAC;KACnD,CAAC,CAAC;GACJ,CAAC;;EAEF,OAAO,UAAU,CAAC;CACnB,EAAE;;ACzGH;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA+CA,AAAe,SAAS,GAAG,CAAC,OAAO,EAAE;EACnC,OAAO,IAAI,UAAU,CAAC,IAAI,EAAE,OAAO,CAAC,CAAC,OAAO,CAAC;;;CAC9C,DCjDD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAiEA,AAAe,SAAS,IAAI,CAAC,OAAO,EAAE;;EAEpC,IAAI,WAAW,GAAG,IAAI,CAAC;;EAEvB,IAAI,CAAC,OAAO,CAAC,OAAO,CAAC,EAAE;IACrB,OAAO,IAAI,WAAW,CAAC,UAAU,CAAC,EAAE,MAAM,EAAE;MAC1C,OAAO,M
 AAM,CAAC,IAAI,SAAS,CAAC,iCAAiC,CAAC,CAAC,CAAC;KACjE,CAAC,CAAC;GACJ,MAAM;IACL,OAAO,IAAI,WAAW,CAAC,UAAU,OAAO,EAAE,MAAM,EAAE;MAChD,IAAI,MAAM,GAAG,OAAO,CAAC,MAAM,CAAC;MAC5B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,MAAM,EAAE,CAAC,EAAE,EAAE;QAC/B,WAAW,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,CAAC,IAAI,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;OACvD;KACF,CAAC,CAAC;GACJ;;;CACF,DCjFD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAkCA,AAAe,SAASM,QAAM,CAAC,MAAM,EAAE;;EAErC,IAAI,WAAW,GAAG,IAAI,CAAC;EACvB,IAAI,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;EACpCC,MAAO,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;EACzB,OAAO,OAAO,CAAC;;;CAChB,DC9BD,SAAS,aAAa,GAAG;EACvB,MAAM,IAAI,SAAS,CAAC,oFAAoF,CAAC,CAAC;CAC3G;;AAED,SAAS,QAAQ,GAAG;EAClB,MAAM,IAAI,SAAS,CAAC,uHAAuH,CAAC,CAAC;CAC9I;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA0GD,IAAIF,SAAO,GAAG,YAAY;EACxB,SAAS,OAAO,CAAC,QAAQ,EAAE;IACzB,IAAI,CAAC,UAAU,CAAC,GAAG,MAAM,EAAE,CAAC;IAC5B,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC,MAAM,GAAG,SAAS,CAAC;IACv
 C,IAAI,CAAC,YAAY,GAAG,EAAE,CAAC;;IAEvB,IAAI,IAAI,KAAK,QAAQ,EAAE;MACrB,OAAO,QAAQ,KAAK,UAAU,IAAI,aAAa,EAAE,CAAC;MAClD,IAAI,YAAY,OAAO,GAAG,iBAAiB,CAAC,IAAI,EAAE,QAAQ,CAAC,GAAG,QAAQ,EAAE,CAAC;KAC1E;GACF;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;EA4LD,OAAO,CAAC,SAAS,CAAC,KAAK,GAAG,SAAS,MAAM,CAAC,WAAW,EAAE;IACrD,OAAO,IAAI,CAAC,IAAI,CAAC,IAAI,EAAE,WAAW,CAAC,CAAC;GACrC,CAAC;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;EA0CF,OAAO,CAAC,SAAS,CAAC,OAAO,GAAG,SAAS,QAAQ,CAAC,QAAQ,EAAE;IACtD,IAAI,OAAO,GAAG,IAAI,CAAC;IACnB,IAAI,WAAW,GAAG,OAAO,CAAC,WAAW,CAAC;;IAEtC,OAAO,OAAO,CAAC,IAAI,CAAC,UAAU,KAAK,EAAE;MACnC,OAAO,WAAW,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,IAAI,CAAC,YAAY;QACtD,OAAO,KAAK,CAAC;OACd,CAAC,CAAC;KACJ,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,WAAW,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,IAAI,CAAC,YAAY;QACtD,MAAM,MAAM,CAAC;OACd,CAAC,CAAC;KACJ,CAAC,CAAC;GACJ,CAAC;;EAEF,OA
 AO,OAAO,CAAC;CAChB,EAAE,CAAC;;AAEJA,SAAO,CAAC,SAAS,CAAC,IAAI,GAAG,IAAI,CAAC;AAC9B,AACAA,SAAO,CAAC,GAAG,GAAG,GAAG,CAAC;AAClBA,SAAO,CAAC,IAAI,GAAG,IAAI,CAAC;AACpBA,SAAO,CAAC,OAAO,GAAGG,SAAO,CAAC;AAC1BH,SAAO,CAAC,MAAM,GAAGI,QAAM,CAAC;AACxBJ,SAAO,CAAC,aAAa,GAAG,YAAY,CAAC;AACrCA,SAAO,CAAC,QAAQ,GAAG,OAAO,CAAC;AAC3BA,SAAO,CAAC,KAAK,GAAG,IAAI;;ACxYpB;AACA,AAEe,SAAS,QAAQ,GAAG;EACjC,IAAI,KAAK,GAAG,KAAK,CAAC,CAAC;;EAEnB,IAAI,OAAO,MAAM,KAAK,WAAW,EAAE;IACjC,KAAK,GAAG,MAAM,CAAC;GAChB,MAAM,IAAI,OAAO,IAAI,KAAK,WAAW,EAAE;IACtC,KAAK,GAAG,IAAI,CAAC;GACd,MAAM;IACL,IAAI;MACF,KAAK,GAAG,QAAQ,CAAC,aAAa,CAAC,EAAE,CAAC;KACnC,CAAC,OAAO,CAAC,EAAE;MACV,MAAM,IAAI,KAAK,CAAC,0EAA0E,CAAC,CAAC;KAC7F;GACF;;EAED,IAAI,CAAC,GAAG,KAAK,CAAC,OAAO,CAAC;;EAEtB,IAAI,CAAC,EAAE;IACL,IAAI,eAAe,GAAG,IAAI,CAAC;IAC3B,IAAI;MACF,eAAe,GAAG,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC,OAAO,EAAE,CAAC,CAAC;KAC/D,CAAC,OAAO,CAAC,EAAE;;KAEX;;IAED,IAAI,eAAe,KAAK,kBAAkB,IAAI,CAAC,CAAC,CAAC,IAAI,EAAE;MACrD,OAAO;KACR;GACF;;EAED,KAAK,CAAC,O
 AAO,GAAGA,SAAO,CAAC;;;CACzB,DC/BD;AACAA,SAAO,CAAC,QAAQ,GAAG,QAAQ,CAAC;AAC5BA,SAAO,CAAC,OAAO,GAAGA,SAAO,CAAC;;ACJ1BA,SAAO,CAAC,QAAQ,EAAE,CAAC;;;;;;;;","file":"es6-promise.auto.min.js"}
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.js b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.js
new file mode 100644
index 0000000..de8392f
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.js
@@ -0,0 +1,1179 @@
+/*!
+ * @overview es6-promise - a tiny implementation of Promises/A+.
+ * @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald)
+ * @license   Licensed under MIT license
+ *            See https://raw.githubusercontent.com/stefanpenner/es6-promise/master/LICENSE
+ * @version   v4.2.4+314e4831
+ */
+
+(function (global, factory) {
+	typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :
+	typeof define === 'function' && define.amd ? define(factory) :
+	(global.ES6Promise = factory());
+}(this, (function () { 'use strict';
+
+function objectOrFunction(x) {
+  var type = typeof x;
+  return x !== null && (type === 'object' || type === 'function');
+}
+
+function isFunction(x) {
+  return typeof x === 'function';
+}
+
+
+
+var _isArray = void 0;
+if (Array.isArray) {
+  _isArray = Array.isArray;
+} else {
+  _isArray = function (x) {
+    return Object.prototype.toString.call(x) === '[object Array]';
+  };
+}
+
+var isArray = _isArray;
+
+var len = 0;
+var vertxNext = void 0;
+var customSchedulerFn = void 0;
+
+var asap = function asap(callback, arg) {
+  queue[len] = callback;
+  queue[len + 1] = arg;
+  len += 2;
+  if (len === 2) {
+    // If len is 2, that means that we need to schedule an async flush.
+    // If additional callbacks are queued before the queue is flushed, they
+    // will be processed by this flush that we are scheduling.
+    if (customSchedulerFn) {
+      customSchedulerFn(flush);
+    } else {
+      scheduleFlush();
+    }
+  }
+};
+
+function setScheduler(scheduleFn) {
+  customSchedulerFn = scheduleFn;
+}
+
+function setAsap(asapFn) {
+  asap = asapFn;
+}
+
+var browserWindow = typeof window !== 'undefined' ? window : undefined;
+var browserGlobal = browserWindow || {};
+var BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;
+var isNode = typeof self === 'undefined' && typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';
+
+// test for web worker but not in IE10
+var isWorker = typeof Uint8ClampedArray !== 'undefined' && typeof importScripts !== 'undefined' && typeof MessageChannel !== 'undefined';
+
+// node
+function useNextTick() {
+  // node version 0.10.x displays a deprecation warning when nextTick is used recursively
+  // see https://github.com/cujojs/when/issues/410 for details
+  return function () {
+    return process.nextTick(flush);
+  };
+}
+
+// vertx
+function useVertxTimer() {
+  if (typeof vertxNext !== 'undefined') {
+    return function () {
+      vertxNext(flush);
+    };
+  }
+
+  return useSetTimeout();
+}
+
+function useMutationObserver() {
+  var iterations = 0;
+  var observer = new BrowserMutationObserver(flush);
+  var node = document.createTextNode('');
+  observer.observe(node, { characterData: true });
+
+  return function () {
+    node.data = iterations = ++iterations % 2;
+  };
+}
+
+// web worker
+function useMessageChannel() {
+  var channel = new MessageChannel();
+  channel.port1.onmessage = flush;
+  return function () {
+    return channel.port2.postMessage(0);
+  };
+}
+
+function useSetTimeout() {
+  // Store setTimeout reference so es6-promise will be unaffected by
+  // other code modifying setTimeout (like sinon.useFakeTimers())
+  var globalSetTimeout = setTimeout;
+  return function () {
+    return globalSetTimeout(flush, 1);
+  };
+}
+
+var queue = new Array(1000);
+function flush() {
+  for (var i = 0; i < len; i += 2) {
+    var callback = queue[i];
+    var arg = queue[i + 1];
+
+    callback(arg);
+
+    queue[i] = undefined;
+    queue[i + 1] = undefined;
+  }
+
+  len = 0;
+}
+
+function attemptVertx() {
+  try {
+    var vertx = Function('return this')().require('vertx');
+    vertxNext = vertx.runOnLoop || vertx.runOnContext;
+    return useVertxTimer();
+  } catch (e) {
+    return useSetTimeout();
+  }
+}
+
+var scheduleFlush = void 0;
+// Decide what async method to use to triggering processing of queued callbacks:
+if (isNode) {
+  scheduleFlush = useNextTick();
+} else if (BrowserMutationObserver) {
+  scheduleFlush = useMutationObserver();
+} else if (isWorker) {
+  scheduleFlush = useMessageChannel();
+} else if (browserWindow === undefined && typeof require === 'function') {
+  scheduleFlush = attemptVertx();
+} else {
+  scheduleFlush = useSetTimeout();
+}
+
+function then(onFulfillment, onRejection) {
+  var parent = this;
+
+  var child = new this.constructor(noop);
+
+  if (child[PROMISE_ID] === undefined) {
+    makePromise(child);
+  }
+
+  var _state = parent._state;
+
+
+  if (_state) {
+    var callback = arguments[_state - 1];
+    asap(function () {
+      return invokeCallback(_state, child, callback, parent._result);
+    });
+  } else {
+    subscribe(parent, child, onFulfillment, onRejection);
+  }
+
+  return child;
+}
+
+/**
+  `Promise.resolve` returns a promise that will become resolved with the
+  passed `value`. It is shorthand for the following:
+
+  ```javascript
+  let promise = new Promise(function(resolve, reject){
+    resolve(1);
+  });
+
+  promise.then(function(value){
+    // value === 1
+  });
+  ```
+
+  Instead of writing the above, your code now simply becomes the following:
+
+  ```javascript
+  let promise = Promise.resolve(1);
+
+  promise.then(function(value){
+    // value === 1
+  });
+  ```
+
+  @method resolve
+  @static
+  @param {Any} value value that the returned promise will be resolved with
+  Useful for tooling.
+  @return {Promise} a promise that will become fulfilled with the given
+  `value`
+*/
+function resolve$1(object) {
+  /*jshint validthis:true */
+  var Constructor = this;
+
+  if (object && typeof object === 'object' && object.constructor === Constructor) {
+    return object;
+  }
+
+  var promise = new Constructor(noop);
+  resolve(promise, object);
+  return promise;
+}
+
+var PROMISE_ID = Math.random().toString(36).substring(2);
+
+function noop() {}
+
+var PENDING = void 0;
+var FULFILLED = 1;
+var REJECTED = 2;
+
+var TRY_CATCH_ERROR = { error: null };
+
+function selfFulfillment() {
+  return new TypeError("You cannot resolve a promise with itself");
+}
+
+function cannotReturnOwn() {
+  return new TypeError('A promises callback cannot return that same promise.');
+}
+
+function getThen(promise) {
+  try {
+    return promise.then;
+  } catch (error) {
+    TRY_CATCH_ERROR.error = error;
+    return TRY_CATCH_ERROR;
+  }
+}
+
+function tryThen(then$$1, value, fulfillmentHandler, rejectionHandler) {
+  try {
+    then$$1.call(value, fulfillmentHandler, rejectionHandler);
+  } catch (e) {
+    return e;
+  }
+}
+
+function handleForeignThenable(promise, thenable, then$$1) {
+  asap(function (promise) {
+    var sealed = false;
+    var error = tryThen(then$$1, thenable, function (value) {
+      if (sealed) {
+        return;
+      }
+      sealed = true;
+      if (thenable !== value) {
+        resolve(promise, value);
+      } else {
+        fulfill(promise, value);
+      }
+    }, function (reason) {
+      if (sealed) {
+        return;
+      }
+      sealed = true;
+
+      reject(promise, reason);
+    }, 'Settle: ' + (promise._label || ' unknown promise'));
+
+    if (!sealed && error) {
+      sealed = true;
+      reject(promise, error);
+    }
+  }, promise);
+}
+
+function handleOwnThenable(promise, thenable) {
+  if (thenable._state === FULFILLED) {
+    fulfill(promise, thenable._result);
+  } else if (thenable._state === REJECTED) {
+    reject(promise, thenable._result);
+  } else {
+    subscribe(thenable, undefined, function (value) {
+      return resolve(promise, value);
+    }, function (reason) {
+      return reject(promise, reason);
+    });
+  }
+}
+
+function handleMaybeThenable(promise, maybeThenable, then$$1) {
+  if (maybeThenable.constructor === promise.constructor && then$$1 === then && maybeThenable.constructor.resolve === resolve$1) {
+    handleOwnThenable(promise, maybeThenable);
+  } else {
+    if (then$$1 === TRY_CATCH_ERROR) {
+      reject(promise, TRY_CATCH_ERROR.error);
+      TRY_CATCH_ERROR.error = null;
+    } else if (then$$1 === undefined) {
+      fulfill(promise, maybeThenable);
+    } else if (isFunction(then$$1)) {
+      handleForeignThenable(promise, maybeThenable, then$$1);
+    } else {
+      fulfill(promise, maybeThenable);
+    }
+  }
+}
+
+function resolve(promise, value) {
+  if (promise === value) {
+    reject(promise, selfFulfillment());
+  } else if (objectOrFunction(value)) {
+    handleMaybeThenable(promise, value, getThen(value));
+  } else {
+    fulfill(promise, value);
+  }
+}
+
+function publishRejection(promise) {
+  if (promise._onerror) {
+    promise._onerror(promise._result);
+  }
+
+  publish(promise);
+}
+
+function fulfill(promise, value) {
+  if (promise._state !== PENDING) {
+    return;
+  }
+
+  promise._result = value;
+  promise._state = FULFILLED;
+
+  if (promise._subscribers.length !== 0) {
+    asap(publish, promise);
+  }
+}
+
+function reject(promise, reason) {
+  if (promise._state !== PENDING) {
+    return;
+  }
+  promise._state = REJECTED;
+  promise._result = reason;
+
+  asap(publishRejection, promise);
+}
+
+function subscribe(parent, child, onFulfillment, onRejection) {
+  var _subscribers = parent._subscribers;
+  var length = _subscribers.length;
+
+
+  parent._onerror = null;
+
+  _subscribers[length] = child;
+  _subscribers[length + FULFILLED] = onFulfillment;
+  _subscribers[length + REJECTED] = onRejection;
+
+  if (length === 0 && parent._state) {
+    asap(publish, parent);
+  }
+}
+
+function publish(promise) {
+  var subscribers = promise._subscribers;
+  var settled = promise._state;
+
+  if (subscribers.length === 0) {
+    return;
+  }
+
+  var child = void 0,
+      callback = void 0,
+      detail = promise._result;
+
+  for (var i = 0; i < subscribers.length; i += 3) {
+    child = subscribers[i];
+    callback = subscribers[i + settled];
+
+    if (child) {
+      invokeCallback(settled, child, callback, detail);
+    } else {
+      callback(detail);
+    }
+  }
+
+  promise._subscribers.length = 0;
+}
+
+function tryCatch(callback, detail) {
+  try {
+    return callback(detail);
+  } catch (e) {
+    TRY_CATCH_ERROR.error = e;
+    return TRY_CATCH_ERROR;
+  }
+}
+
+function invokeCallback(settled, promise, callback, detail) {
+  var hasCallback = isFunction(callback),
+      value = void 0,
+      error = void 0,
+      succeeded = void 0,
+      failed = void 0;
+
+  if (hasCallback) {
+    value = tryCatch(callback, detail);
+
+    if (value === TRY_CATCH_ERROR) {
+      failed = true;
+      error = value.error;
+      value.error = null;
+    } else {
+      succeeded = true;
+    }
+
+    if (promise === value) {
+      reject(promise, cannotReturnOwn());
+      return;
+    }
+  } else {
+    value = detail;
+    succeeded = true;
+  }
+
+  if (promise._state !== PENDING) {
+    // noop
+  } else if (hasCallback && succeeded) {
+    resolve(promise, value);
+  } else if (failed) {
+    reject(promise, error);
+  } else if (settled === FULFILLED) {
+    fulfill(promise, value);
+  } else if (settled === REJECTED) {
+    reject(promise, value);
+  }
+}
+
+function initializePromise(promise, resolver) {
+  try {
+    resolver(function resolvePromise(value) {
+      resolve(promise, value);
+    }, function rejectPromise(reason) {
+      reject(promise, reason);
+    });
+  } catch (e) {
+    reject(promise, e);
+  }
+}
+
+var id = 0;
+function nextId() {
+  return id++;
+}
+
+function makePromise(promise) {
+  promise[PROMISE_ID] = id++;
+  promise._state = undefined;
+  promise._result = undefined;
+  promise._subscribers = [];
+}
+
+function validationError() {
+  return new Error('Array Methods must be provided an Array');
+}
+
+var Enumerator = function () {
+  function Enumerator(Constructor, input) {
+    this._instanceConstructor = Constructor;
+    this.promise = new Constructor(noop);
+
+    if (!this.promise[PROMISE_ID]) {
+      makePromise(this.promise);
+    }
+
+    if (isArray(input)) {
+      this.length = input.length;
+      this._remaining = input.length;
+
+      this._result = new Array(this.length);
+
+      if (this.length === 0) {
+        fulfill(this.promise, this._result);
+      } else {
+        this.length = this.length || 0;
+        this._enumerate(input);
+        if (this._remaining === 0) {
+          fulfill(this.promise, this._result);
+        }
+      }
+    } else {
+      reject(this.promise, validationError());
+    }
+  }
+
+  Enumerator.prototype._enumerate = function _enumerate(input) {
+    for (var i = 0; this._state === PENDING && i < input.length; i++) {
+      this._eachEntry(input[i], i);
+    }
+  };
+
+  Enumerator.prototype._eachEntry = function _eachEntry(entry, i) {
+    var c = this._instanceConstructor;
+    var resolve$$1 = c.resolve;
+
+
+    if (resolve$$1 === resolve$1) {
+      var _then = getThen(entry);
+
+      if (_then === then && entry._state !== PENDING) {
+        this._settledAt(entry._state, i, entry._result);
+      } else if (typeof _then !== 'function') {
+        this._remaining--;
+        this._result[i] = entry;
+      } else if (c === Promise$1) {
+        var promise = new c(noop);
+        handleMaybeThenable(promise, entry, _then);
+        this._willSettleAt(promise, i);
+      } else {
+        this._willSettleAt(new c(function (resolve$$1) {
+          return resolve$$1(entry);
+        }), i);
+      }
+    } else {
+      this._willSettleAt(resolve$$1(entry), i);
+    }
+  };
+
+  Enumerator.prototype._settledAt = function _settledAt(state, i, value) {
+    var promise = this.promise;
+
+
+    if (promise._state === PENDING) {
+      this._remaining--;
+
+      if (state === REJECTED) {
+        reject(promise, value);
+      } else {
+        this._result[i] = value;
+      }
+    }
+
+    if (this._remaining === 0) {
+      fulfill(promise, this._result);
+    }
+  };
+
+  Enumerator.prototype._willSettleAt = function _willSettleAt(promise, i) {
+    var enumerator = this;
+
+    subscribe(promise, undefined, function (value) {
+      return enumerator._settledAt(FULFILLED, i, value);
+    }, function (reason) {
+      return enumerator._settledAt(REJECTED, i, reason);
+    });
+  };
+
+  return Enumerator;
+}();
+
+/**
+  `Promise.all` accepts an array of promises, and returns a new promise which
+  is fulfilled with an array of fulfillment values for the passed promises, or
+  rejected with the reason of the first passed promise to be rejected. It casts all
+  elements of the passed iterable to promises as it runs this algorithm.
+
+  Example:
+
+  ```javascript
+  let promise1 = resolve(1);
+  let promise2 = resolve(2);
+  let promise3 = resolve(3);
+  let promises = [ promise1, promise2, promise3 ];
+
+  Promise.all(promises).then(function(array){
+    // The array here would be [ 1, 2, 3 ];
+  });
+  ```
+
+  If any of the `promises` given to `all` are rejected, the first promise
+  that is rejected will be given as an argument to the returned promises's
+  rejection handler. For example:
+
+  Example:
+
+  ```javascript
+  let promise1 = resolve(1);
+  let promise2 = reject(new Error("2"));
+  let promise3 = reject(new Error("3"));
+  let promises = [ promise1, promise2, promise3 ];
+
+  Promise.all(promises).then(function(array){
+    // Code here never runs because there are rejected promises!
+  }, function(error) {
+    // error.message === "2"
+  });
+  ```
+
+  @method all
+  @static
+  @param {Array} entries array of promises
+  @param {String} label optional string for labeling the promise.
+  Useful for tooling.
+  @return {Promise} promise that is fulfilled when all `promises` have been
+  fulfilled, or rejected if any of them become rejected.
+  @static
+*/
+function all(entries) {
+  return new Enumerator(this, entries).promise;
+}
+
+/**
+  `Promise.race` returns a new promise which is settled in the same way as the
+  first passed promise to settle.
+
+  Example:
+
+  ```javascript
+  let promise1 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 1');
+    }, 200);
+  });
+
+  let promise2 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 2');
+    }, 100);
+  });
+
+  Promise.race([promise1, promise2]).then(function(result){
+    // result === 'promise 2' because it was resolved before promise1
+    // was resolved.
+  });
+  ```
+
+  `Promise.race` is deterministic in that only the state of the first
+  settled promise matters. For example, even if other promises given to the
+  `promises` array argument are resolved, but the first settled promise has
+  become rejected before the other promises became fulfilled, the returned
+  promise will become rejected:
+
+  ```javascript
+  let promise1 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 1');
+    }, 200);
+  });
+
+  let promise2 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      reject(new Error('promise 2'));
+    }, 100);
+  });
+
+  Promise.race([promise1, promise2]).then(function(result){
+    // Code here never runs
+  }, function(reason){
+    // reason.message === 'promise 2' because promise 2 became rejected before
+    // promise 1 became fulfilled
+  });
+  ```
+
+  An example real-world use case is implementing timeouts:
+
+  ```javascript
+  Promise.race([ajax('foo.json'), timeout(5000)])
+  ```
+
+  @method race
+  @static
+  @param {Array} promises array of promises to observe
+  Useful for tooling.
+  @return {Promise} a promise which settles in the same way as the first passed
+  promise to settle.
+*/
+function race(entries) {
+  /*jshint validthis:true */
+  var Constructor = this;
+
+  if (!isArray(entries)) {
+    return new Constructor(function (_, reject) {
+      return reject(new TypeError('You must pass an array to race.'));
+    });
+  } else {
+    return new Constructor(function (resolve, reject) {
+      var length = entries.length;
+      for (var i = 0; i < length; i++) {
+        Constructor.resolve(entries[i]).then(resolve, reject);
+      }
+    });
+  }
+}
+
+/**
+  `Promise.reject` returns a promise rejected with the passed `reason`.
+  It is shorthand for the following:
+
+  ```javascript
+  let promise = new Promise(function(resolve, reject){
+    reject(new Error('WHOOPS'));
+  });
+
+  promise.then(function(value){
+    // Code here doesn't run because the promise is rejected!
+  }, function(reason){
+    // reason.message === 'WHOOPS'
+  });
+  ```
+
+  Instead of writing the above, your code now simply becomes the following:
+
+  ```javascript
+  let promise = Promise.reject(new Error('WHOOPS'));
+
+  promise.then(function(value){
+    // Code here doesn't run because the promise is rejected!
+  }, function(reason){
+    // reason.message === 'WHOOPS'
+  });
+  ```
+
+  @method reject
+  @static
+  @param {Any} reason value that the returned promise will be rejected with.
+  Useful for tooling.
+  @return {Promise} a promise rejected with the given `reason`.
+*/
+function reject$1(reason) {
+  /*jshint validthis:true */
+  var Constructor = this;
+  var promise = new Constructor(noop);
+  reject(promise, reason);
+  return promise;
+}
+
+function needsResolver() {
+  throw new TypeError('You must pass a resolver function as the first argument to the promise constructor');
+}
+
+function needsNew() {
+  throw new TypeError("Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.");
+}
+
+/**
+  Promise objects represent the eventual result of an asynchronous operation. The
+  primary way of interacting with a promise is through its `then` method, which
+  registers callbacks to receive either a promise's eventual value or the reason
+  why the promise cannot be fulfilled.
+
+  Terminology
+  -----------
+
+  - `promise` is an object or function with a `then` method whose behavior conforms to this specification.
+  - `thenable` is an object or function that defines a `then` method.
+  - `value` is any legal JavaScript value (including undefined, a thenable, or a promise).
+  - `exception` is a value that is thrown using the throw statement.
+  - `reason` is a value that indicates why a promise was rejected.
+  - `settled` the final resting state of a promise, fulfilled or rejected.
+
+  A promise can be in one of three states: pending, fulfilled, or rejected.
+
+  Promises that are fulfilled have a fulfillment value and are in the fulfilled
+  state.  Promises that are rejected have a rejection reason and are in the
+  rejected state.  A fulfillment value is never a thenable.
+
+  Promises can also be said to *resolve* a value.  If this value is also a
+  promise, then the original promise's settled state will match the value's
+  settled state.  So a promise that *resolves* a promise that rejects will
+  itself reject, and a promise that *resolves* a promise that fulfills will
+  itself fulfill.
+
+
+  Basic Usage:
+  ------------
+
+  ```js
+  let promise = new Promise(function(resolve, reject) {
+    // on success
+    resolve(value);
+
+    // on failure
+    reject(reason);
+  });
+
+  promise.then(function(value) {
+    // on fulfillment
+  }, function(reason) {
+    // on rejection
+  });
+  ```
+
+  Advanced Usage:
+  ---------------
+
+  Promises shine when abstracting away asynchronous interactions such as
+  `XMLHttpRequest`s.
+
+  ```js
+  function getJSON(url) {
+    return new Promise(function(resolve, reject){
+      let xhr = new XMLHttpRequest();
+
+      xhr.open('GET', url);
+      xhr.onreadystatechange = handler;
+      xhr.responseType = 'json';
+      xhr.setRequestHeader('Accept', 'application/json');
+      xhr.send();
+
+      function handler() {
+        if (this.readyState === this.DONE) {
+          if (this.status === 200) {
+            resolve(this.response);
+          } else {
+            reject(new Error('getJSON: `' + url + '` failed with status: [' + this.status + ']'));
+          }
+        }
+      };
+    });
+  }
+
+  getJSON('/posts.json').then(function(json) {
+    // on fulfillment
+  }, function(reason) {
+    // on rejection
+  });
+  ```
+
+  Unlike callbacks, promises are great composable primitives.
+
+  ```js
+  Promise.all([
+    getJSON('/posts'),
+    getJSON('/comments')
+  ]).then(function(values){
+    values[0] // => postsJSON
+    values[1] // => commentsJSON
+
+    return values;
+  });
+  ```
+
+  @class Promise
+  @param {Function} resolver
+  Useful for tooling.
+  @constructor
+*/
+
+var Promise$1 = function () {
+  function Promise(resolver) {
+    this[PROMISE_ID] = nextId();
+    this._result = this._state = undefined;
+    this._subscribers = [];
+
+    if (noop !== resolver) {
+      typeof resolver !== 'function' && needsResolver();
+      this instanceof Promise ? initializePromise(this, resolver) : needsNew();
+    }
+  }
+
+  /**
+  The primary way of interacting with a promise is through its `then` method,
+  which registers callbacks to receive either a promise's eventual value or the
+  reason why the promise cannot be fulfilled.
+   ```js
+  findUser().then(function(user){
+    // user is available
+  }, function(reason){
+    // user is unavailable, and you are given the reason why
+  });
+  ```
+   Chaining
+  --------
+   The return value of `then` is itself a promise.  This second, 'downstream'
+  promise is resolved with the return value of the first promise's fulfillment
+  or rejection handler, or rejected if the handler throws an exception.
+   ```js
+  findUser().then(function (user) {
+    return user.name;
+  }, function (reason) {
+    return 'default name';
+  }).then(function (userName) {
+    // If `findUser` fulfilled, `userName` will be the user's name, otherwise it
+    // will be `'default name'`
+  });
+   findUser().then(function (user) {
+    throw new Error('Found user, but still unhappy');
+  }, function (reason) {
+    throw new Error('`findUser` rejected and we're unhappy');
+  }).then(function (value) {
+    // never reached
+  }, function (reason) {
+    // if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.
+    // If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.
+  });
+  ```
+  If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.
+   ```js
+  findUser().then(function (user) {
+    throw new PedagogicalException('Upstream error');
+  }).then(function (value) {
+    // never reached
+  }).then(function (value) {
+    // never reached
+  }, function (reason) {
+    // The `PedgagocialException` is propagated all the way down to here
+  });
+  ```
+   Assimilation
+  ------------
+   Sometimes the value you want to propagate to a downstream promise can only be
+  retrieved asynchronously. This can be achieved by returning a promise in the
+  fulfillment or rejection handler. The downstream promise will then be pending
+  until the returned promise is settled. This is called *assimilation*.
+   ```js
+  findUser().then(function (user) {
+    return findCommentsByAuthor(user);
+  }).then(function (comments) {
+    // The user's comments are now available
+  });
+  ```
+   If the assimliated promise rejects, then the downstream promise will also reject.
+   ```js
+  findUser().then(function (user) {
+    return findCommentsByAuthor(user);
+  }).then(function (comments) {
+    // If `findCommentsByAuthor` fulfills, we'll have the value here
+  }, function (reason) {
+    // If `findCommentsByAuthor` rejects, we'll have the reason here
+  });
+  ```
+   Simple Example
+  --------------
+   Synchronous Example
+   ```javascript
+  let result;
+   try {
+    result = findResult();
+    // success
+  } catch(reason) {
+    // failure
+  }
+  ```
+   Errback Example
+   ```js
+  findResult(function(result, err){
+    if (err) {
+      // failure
+    } else {
+      // success
+    }
+  });
+  ```
+   Promise Example;
+   ```javascript
+  findResult().then(function(result){
+    // success
+  }, function(reason){
+    // failure
+  });
+  ```
+   Advanced Example
+  --------------
+   Synchronous Example
+   ```javascript
+  let author, books;
+   try {
+    author = findAuthor();
+    books  = findBooksByAuthor(author);
+    // success
+  } catch(reason) {
+    // failure
+  }
+  ```
+   Errback Example
+   ```js
+   function foundBooks(books) {
+   }
+   function failure(reason) {
+   }
+   findAuthor(function(author, err){
+    if (err) {
+      failure(err);
+      // failure
+    } else {
+      try {
+        findBoooksByAuthor(author, function(books, err) {
+          if (err) {
+            failure(err);
+          } else {
+            try {
+              foundBooks(books);
+            } catch(reason) {
+              failure(reason);
+            }
+          }
+        });
+      } catch(error) {
+        failure(err);
+      }
+      // success
+    }
+  });
+  ```
+   Promise Example;
+   ```javascript
+  findAuthor().
+    then(findBooksByAuthor).
+    then(function(books){
+      // found books
+  }).catch(function(reason){
+    // something went wrong
+  });
+  ```
+   @method then
+  @param {Function} onFulfilled
+  @param {Function} onRejected
+  Useful for tooling.
+  @return {Promise}
+  */
+
+  /**
+  `catch` is simply sugar for `then(undefined, onRejection)` which makes it the same
+  as the catch block of a try/catch statement.
+  ```js
+  function findAuthor(){
+  throw new Error('couldn't find that author');
+  }
+  // synchronous
+  try {
+  findAuthor();
+  } catch(reason) {
+  // something went wrong
+  }
+  // async with promises
+  findAuthor().catch(function(reason){
+  // something went wrong
+  });
+  ```
+  @method catch
+  @param {Function} onRejection
+  Useful for tooling.
+  @return {Promise}
+  */
+
+
+  Promise.prototype.catch = function _catch(onRejection) {
+    return this.then(null, onRejection);
+  };
+
+  /**
+    `finally` will be invoked regardless of the promise's fate just as native
+    try/catch/finally behaves
+  
+    Synchronous example:
+  
+    ```js
+    findAuthor() {
+      if (Math.random() > 0.5) {
+        throw new Error();
+      }
+      return new Author();
+    }
+  
+    try {
+      return findAuthor(); // succeed or fail
+    } catch(error) {
+      return findOtherAuther();
+    } finally {
+      // always runs
+      // doesn't affect the return value
+    }
+    ```
+  
+    Asynchronous example:
+  
+    ```js
+    findAuthor().catch(function(reason){
+      return findOtherAuther();
+    }).finally(function(){
+      // author was either found, or not
+    });
+    ```
+  
+    @method finally
+    @param {Function} callback
+    @return {Promise}
+  */
+
+
+  Promise.prototype.finally = function _finally(callback) {
+    var promise = this;
+    var constructor = promise.constructor;
+
+    return promise.then(function (value) {
+      return constructor.resolve(callback()).then(function () {
+        return value;
+      });
+    }, function (reason) {
+      return constructor.resolve(callback()).then(function () {
+        throw reason;
+      });
+    });
+  };
+
+  return Promise;
+}();
+
+Promise$1.prototype.then = then;
+Promise$1.all = all;
+Promise$1.race = race;
+Promise$1.resolve = resolve$1;
+Promise$1.reject = reject$1;
+Promise$1._setScheduler = setScheduler;
+Promise$1._setAsap = setAsap;
+Promise$1._asap = asap;
+
+/*global self*/
+function polyfill() {
+  var local = void 0;
+
+  if (typeof global !== 'undefined') {
+    local = global;
+  } else if (typeof self !== 'undefined') {
+    local = self;
+  } else {
+    try {
+      local = Function('return this')();
+    } catch (e) {
+      throw new Error('polyfill failed because global object is unavailable in this environment');
+    }
+  }
+
+  var P = local.Promise;
+
+  if (P) {
+    var promiseToString = null;
+    try {
+      promiseToString = Object.prototype.toString.call(P.resolve());
+    } catch (e) {
+      // silently ignored
+    }
+
+    if (promiseToString === '[object Promise]' && !P.cast) {
+      return;
+    }
+  }
+
+  local.Promise = Promise$1;
+}
+
+// Strange compat..
+Promise$1.polyfill = polyfill;
+Promise$1.Promise = Promise$1;
+
+return Promise$1;
+
+})));
+
+
+
+//# sourceMappingURL=es6-promise.map

[08/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.min.map
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.min.map b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.min.map
new file mode 100644
index 0000000..0488c1d
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.min.map
@@ -0,0 +1 @@
+{"version":3,"sources":["config/versionTemplate.txt","lib/es6-promise/utils.js","lib/es6-promise/asap.js","lib/es6-promise/then.js","lib/es6-promise/promise/resolve.js","lib/es6-promise/-internal.js","lib/es6-promise/enumerator.js","lib/es6-promise/promise/all.js","lib/es6-promise/promise/race.js","lib/es6-promise/promise/reject.js","lib/es6-promise/promise.js","lib/es6-promise/polyfill.js","lib/es6-promise.js"],"sourcesContent":["/*!\n * @overview es6-promise - a tiny implementation of Promises/A+.\n * @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald)\n * @license   Licensed under MIT license\n *            See https://raw.githubusercontent.com/stefanpenner/es6-promise/master/LICENSE\n * @version   v4.2.4+314e4831\n */\n","export function objectOrFunction(x) {\n  var type = typeof x;\n  return x !== null && (type === 'object' || type === 'function');\n}\n\nexport function isFunction(x) {\n  return typeof x 
 === 'function';\n}\n\nexport function isMaybeThenable(x) {\n  return x !== null && typeof x === 'object';\n}\n\nvar _isArray = void 0;\nif (Array.isArray) {\n  _isArray = Array.isArray;\n} else {\n  _isArray = function (x) {\n    return Object.prototype.toString.call(x) === '[object Array]';\n  };\n}\n\nexport var isArray = _isArray;","var len = 0;\nvar vertxNext = void 0;\nvar customSchedulerFn = void 0;\n\nexport var asap = function asap(callback, arg) {\n  queue[len] = callback;\n  queue[len + 1] = arg;\n  len += 2;\n  if (len === 2) {\n    // If len is 2, that means that we need to schedule an async flush.\n    // If additional callbacks are queued before the queue is flushed, they\n    // will be processed by this flush that we are scheduling.\n    if (customSchedulerFn) {\n      customSchedulerFn(flush);\n    } else {\n      scheduleFlush();\n    }\n  }\n};\n\nexport function setScheduler(scheduleFn) {\n  customSchedulerFn = scheduleFn;\n}\n\nexport function setAsap(asapFn) {\
 n  asap = asapFn;\n}\n\nvar browserWindow = typeof window !== 'undefined' ? window : undefined;\nvar browserGlobal = browserWindow || {};\nvar BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;\nvar isNode = typeof self === 'undefined' && typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n\n// test for web worker but not in IE10\nvar isWorker = typeof Uint8ClampedArray !== 'undefined' && typeof importScripts !== 'undefined' && typeof MessageChannel !== 'undefined';\n\n// node\nfunction useNextTick() {\n  // node version 0.10.x displays a deprecation warning when nextTick is used recursively\n  // see https://github.com/cujojs/when/issues/410 for details\n  return function () {\n    return process.nextTick(flush);\n  };\n}\n\n// vertx\nfunction useVertxTimer() {\n  if (typeof vertxNext !== 'undefined') {\n    return function () {\n      vertxNext(flush);\n    };\n  }\n\n  return useSetTimeout();\n}\n\nfu
 nction useMutationObserver() {\n  var iterations = 0;\n  var observer = new BrowserMutationObserver(flush);\n  var node = document.createTextNode('');\n  observer.observe(node, { characterData: true });\n\n  return function () {\n    node.data = iterations = ++iterations % 2;\n  };\n}\n\n// web worker\nfunction useMessageChannel() {\n  var channel = new MessageChannel();\n  channel.port1.onmessage = flush;\n  return function () {\n    return channel.port2.postMessage(0);\n  };\n}\n\nfunction useSetTimeout() {\n  // Store setTimeout reference so es6-promise will be unaffected by\n  // other code modifying setTimeout (like sinon.useFakeTimers())\n  var globalSetTimeout = setTimeout;\n  return function () {\n    return globalSetTimeout(flush, 1);\n  };\n}\n\nvar queue = new Array(1000);\nfunction flush() {\n  for (var i = 0; i < len; i += 2) {\n    var callback = queue[i];\n    var arg = queue[i + 1];\n\n    callback(arg);\n\n    queue[i] = undefined;\n    queue[i + 1] = undefined;\n  
 }\n\n  len = 0;\n}\n\nfunction attemptVertx() {\n  try {\n    var vertx = Function('return this')().require('vertx');\n    vertxNext = vertx.runOnLoop || vertx.runOnContext;\n    return useVertxTimer();\n  } catch (e) {\n    return useSetTimeout();\n  }\n}\n\nvar scheduleFlush = void 0;\n// Decide what async method to use to triggering processing of queued callbacks:\nif (isNode) {\n  scheduleFlush = useNextTick();\n} else if (BrowserMutationObserver) {\n  scheduleFlush = useMutationObserver();\n} else if (isWorker) {\n  scheduleFlush = useMessageChannel();\n} else if (browserWindow === undefined && typeof require === 'function') {\n  scheduleFlush = attemptVertx();\n} else {\n  scheduleFlush = useSetTimeout();\n}","import { invokeCallback, subscribe, FULFILLED, REJECTED, noop, makePromise, PROMISE_ID } from './-internal';\n\nimport { asap } from './asap';\n\nexport default function then(onFulfillment, onRejection) {\n  var parent = this;\n\n  var child = new this.constructor(noop);
 \n\n  if (child[PROMISE_ID] === undefined) {\n    makePromise(child);\n  }\n\n  var _state = parent._state;\n\n\n  if (_state) {\n    var callback = arguments[_state - 1];\n    asap(function () {\n      return invokeCallback(_state, child, callback, parent._result);\n    });\n  } else {\n    subscribe(parent, child, onFulfillment, onRejection);\n  }\n\n  return child;\n}","import { noop, resolve as _resolve } from '../-internal';\n\n/**\n  `Promise.resolve` returns a promise that will become resolved with the\n  passed `value`. It is shorthand for the following:\n\n  ```javascript\n  let promise = new Promise(function(resolve, reject){\n    resolve(1);\n  });\n\n  promise.then(function(value){\n    // value === 1\n  });\n  ```\n\n  Instead of writing the above, your code now simply becomes the following:\n\n  ```javascript\n  let promise = Promise.resolve(1);\n\n  promise.then(function(value){\n    // value === 1\n  });\n  ```\n\n  @method resolve\n  @static\n  @param {Any} value va
 lue that the returned promise will be resolved with\n  Useful for tooling.\n  @return {Promise} a promise that will become fulfilled with the given\n  `value`\n*/\nexport default function resolve(object) {\n  /*jshint validthis:true */\n  var Constructor = this;\n\n  if (object && typeof object === 'object' && object.constructor === Constructor) {\n    return object;\n  }\n\n  var promise = new Constructor(noop);\n  _resolve(promise, object);\n  return promise;\n}","import { objectOrFunction, isFunction } from './utils';\n\nimport { asap } from './asap';\n\nimport originalThen from './then';\nimport originalResolve from './promise/resolve';\n\nexport var PROMISE_ID = Math.random().toString(36).substring(2);\n\nfunction noop() {}\n\nvar PENDING = void 0;\nvar FULFILLED = 1;\nvar REJECTED = 2;\n\nvar TRY_CATCH_ERROR = { error: null };\n\nfunction selfFulfillment() {\n  return new TypeError(\"You cannot resolve a promise with itself\");\n}\n\nfunction cannotReturnOwn() {\n  return new 
 TypeError('A promises callback cannot return that same promise.');\n}\n\nfunction getThen(promise) {\n  try {\n    return promise.then;\n  } catch (error) {\n    TRY_CATCH_ERROR.error = error;\n    return TRY_CATCH_ERROR;\n  }\n}\n\nfunction tryThen(then, value, fulfillmentHandler, rejectionHandler) {\n  try {\n    then.call(value, fulfillmentHandler, rejectionHandler);\n  } catch (e) {\n    return e;\n  }\n}\n\nfunction handleForeignThenable(promise, thenable, then) {\n  asap(function (promise) {\n    var sealed = false;\n    var error = tryThen(then, thenable, function (value) {\n      if (sealed) {\n        return;\n      }\n      sealed = true;\n      if (thenable !== value) {\n        resolve(promise, value);\n      } else {\n        fulfill(promise, value);\n      }\n    }, function (reason) {\n      if (sealed) {\n        return;\n      }\n      sealed = true;\n\n      reject(promise, reason);\n    }, 'Settle: ' + (promise._label || ' unknown promise'));\n\n    if (!sealed &&
  error) {\n      sealed = true;\n      reject(promise, error);\n    }\n  }, promise);\n}\n\nfunction handleOwnThenable(promise, thenable) {\n  if (thenable._state === FULFILLED) {\n    fulfill(promise, thenable._result);\n  } else if (thenable._state === REJECTED) {\n    reject(promise, thenable._result);\n  } else {\n    subscribe(thenable, undefined, function (value) {\n      return resolve(promise, value);\n    }, function (reason) {\n      return reject(promise, reason);\n    });\n  }\n}\n\nfunction handleMaybeThenable(promise, maybeThenable, then) {\n  if (maybeThenable.constructor === promise.constructor && then === originalThen && maybeThenable.constructor.resolve === originalResolve) {\n    handleOwnThenable(promise, maybeThenable);\n  } else {\n    if (then === TRY_CATCH_ERROR) {\n      reject(promise, TRY_CATCH_ERROR.error);\n      TRY_CATCH_ERROR.error = null;\n    } else if (then === undefined) {\n      fulfill(promise, maybeThenable);\n    } else if (isFunction(then)) {
 \n      handleForeignThenable(promise, maybeThenable, then);\n    } else {\n      fulfill(promise, maybeThenable);\n    }\n  }\n}\n\nfunction resolve(promise, value) {\n  if (promise === value) {\n    reject(promise, selfFulfillment());\n  } else if (objectOrFunction(value)) {\n    handleMaybeThenable(promise, value, getThen(value));\n  } else {\n    fulfill(promise, value);\n  }\n}\n\nfunction publishRejection(promise) {\n  if (promise._onerror) {\n    promise._onerror(promise._result);\n  }\n\n  publish(promise);\n}\n\nfunction fulfill(promise, value) {\n  if (promise._state !== PENDING) {\n    return;\n  }\n\n  promise._result = value;\n  promise._state = FULFILLED;\n\n  if (promise._subscribers.length !== 0) {\n    asap(publish, promise);\n  }\n}\n\nfunction reject(promise, reason) {\n  if (promise._state !== PENDING) {\n    return;\n  }\n  promise._state = REJECTED;\n  promise._result = reason;\n\n  asap(publishRejection, promise);\n}\n\nfunction subscribe(parent, child, onFulf
 illment, onRejection) {\n  var _subscribers = parent._subscribers;\n  var length = _subscribers.length;\n\n\n  parent._onerror = null;\n\n  _subscribers[length] = child;\n  _subscribers[length + FULFILLED] = onFulfillment;\n  _subscribers[length + REJECTED] = onRejection;\n\n  if (length === 0 && parent._state) {\n    asap(publish, parent);\n  }\n}\n\nfunction publish(promise) {\n  var subscribers = promise._subscribers;\n  var settled = promise._state;\n\n  if (subscribers.length === 0) {\n    return;\n  }\n\n  var child = void 0,\n      callback = void 0,\n      detail = promise._result;\n\n  for (var i = 0; i < subscribers.length; i += 3) {\n    child = subscribers[i];\n    callback = subscribers[i + settled];\n\n    if (child) {\n      invokeCallback(settled, child, callback, detail);\n    } else {\n      callback(detail);\n    }\n  }\n\n  promise._subscribers.length = 0;\n}\n\nfunction tryCatch(callback, detail) {\n  try {\n    return callback(detail);\n  } catch (e) {\n    TRY
 _CATCH_ERROR.error = e;\n    return TRY_CATCH_ERROR;\n  }\n}\n\nfunction invokeCallback(settled, promise, callback, detail) {\n  var hasCallback = isFunction(callback),\n      value = void 0,\n      error = void 0,\n      succeeded = void 0,\n      failed = void 0;\n\n  if (hasCallback) {\n    value = tryCatch(callback, detail);\n\n    if (value === TRY_CATCH_ERROR) {\n      failed = true;\n      error = value.error;\n      value.error = null;\n    } else {\n      succeeded = true;\n    }\n\n    if (promise === value) {\n      reject(promise, cannotReturnOwn());\n      return;\n    }\n  } else {\n    value = detail;\n    succeeded = true;\n  }\n\n  if (promise._state !== PENDING) {\n    // noop\n  } else if (hasCallback && succeeded) {\n    resolve(promise, value);\n  } else if (failed) {\n    reject(promise, error);\n  } else if (settled === FULFILLED) {\n    fulfill(promise, value);\n  } else if (settled === REJECTED) {\n    reject(promise, value);\n  }\n}\n\nfunction initializePr
 omise(promise, resolver) {\n  try {\n    resolver(function resolvePromise(value) {\n      resolve(promise, value);\n    }, function rejectPromise(reason) {\n      reject(promise, reason);\n    });\n  } catch (e) {\n    reject(promise, e);\n  }\n}\n\nvar id = 0;\nfunction nextId() {\n  return id++;\n}\n\nfunction makePromise(promise) {\n  promise[PROMISE_ID] = id++;\n  promise._state = undefined;\n  promise._result = undefined;\n  promise._subscribers = [];\n}\n\nexport { nextId, makePromise, getThen, noop, resolve, reject, fulfill, subscribe, publish, publishRejection, initializePromise, invokeCallback, FULFILLED, REJECTED, PENDING, handleMaybeThenable };","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nimport { isArray, isMaybeThenable } from './utils';\nimport { noop, reject, fulfill, subscribe, FULFILLED, REJECTED, PENDING, getThen, handleMaybeThenable } from './-intern
 al';\n\nimport then from './then';\nimport Promise from './promise';\nimport originalResolve from './promise/resolve';\nimport originalThen from './then';\nimport { makePromise, PROMISE_ID } from './-internal';\n\nfunction validationError() {\n  return new Error('Array Methods must be provided an Array');\n};\n\nvar Enumerator = function () {\n  function Enumerator(Constructor, input) {\n    this._instanceConstructor = Constructor;\n    this.promise = new Constructor(noop);\n\n    if (!this.promise[PROMISE_ID]) {\n      makePromise(this.promise);\n    }\n\n    if (isArray(input)) {\n      this.length = input.length;\n      this._remaining = input.length;\n\n      this._result = new Array(this.length);\n\n      if (this.length === 0) {\n        fulfill(this.promise, this._result);\n      } else {\n        this.length = this.length || 0;\n        this._enumerate(input);\n        if (this._remaining === 0) {\n          fulfill(this.promise, this._result);\n        }\n      }\n    } els
 e {\n      reject(this.promise, validationError());\n    }\n  }\n\n  Enumerator.prototype._enumerate = function _enumerate(input) {\n    for (var i = 0; this._state === PENDING && i < input.length; i++) {\n      this._eachEntry(input[i], i);\n    }\n  };\n\n  Enumerator.prototype._eachEntry = function _eachEntry(entry, i) {\n    var c = this._instanceConstructor;\n    var resolve = c.resolve;\n\n\n    if (resolve === originalResolve) {\n      var _then = getThen(entry);\n\n      if (_then === originalThen && entry._state !== PENDING) {\n        this._settledAt(entry._state, i, entry._result);\n      } else if (typeof _then !== 'function') {\n        this._remaining--;\n        this._result[i] = entry;\n      } else if (c === Promise) {\n        var promise = new c(noop);\n        handleMaybeThenable(promise, entry, _then);\n        this._willSettleAt(promise, i);\n      } else {\n        this._willSettleAt(new c(function (resolve) {\n          return resolve(entry);\n        }), i);
 \n      }\n    } else {\n      this._willSettleAt(resolve(entry), i);\n    }\n  };\n\n  Enumerator.prototype._settledAt = function _settledAt(state, i, value) {\n    var promise = this.promise;\n\n\n    if (promise._state === PENDING) {\n      this._remaining--;\n\n      if (state === REJECTED) {\n        reject(promise, value);\n      } else {\n        this._result[i] = value;\n      }\n    }\n\n    if (this._remaining === 0) {\n      fulfill(promise, this._result);\n    }\n  };\n\n  Enumerator.prototype._willSettleAt = function _willSettleAt(promise, i) {\n    var enumerator = this;\n\n    subscribe(promise, undefined, function (value) {\n      return enumerator._settledAt(FULFILLED, i, value);\n    }, function (reason) {\n      return enumerator._settledAt(REJECTED, i, reason);\n    });\n  };\n\n  return Enumerator;\n}();\n\nexport default Enumerator;\n;","import Enumerator from '../enumerator';\n\n/**\n  `Promise.all` accepts an array of promises, and returns a new promise which
 \n  is fulfilled with an array of fulfillment values for the passed promises, or\n  rejected with the reason of the first passed promise to be rejected. It casts all\n  elements of the passed iterable to promises as it runs this algorithm.\n\n  Example:\n\n  ```javascript\n  let promise1 = resolve(1);\n  let promise2 = resolve(2);\n  let promise3 = resolve(3);\n  let promises = [ promise1, promise2, promise3 ];\n\n  Promise.all(promises).then(function(array){\n    // The array here would be [ 1, 2, 3 ];\n  });\n  ```\n\n  If any of the `promises` given to `all` are rejected, the first promise\n  that is rejected will be given as an argument to the returned promises's\n  rejection handler. For example:\n\n  Example:\n\n  ```javascript\n  let promise1 = resolve(1);\n  let promise2 = reject(new Error(\"2\"));\n  let promise3 = reject(new Error(\"3\"));\n  let promises = [ promise1, promise2, promise3 ];\n\n  Promise.all(promises).then(function(array){\n    // Code here never runs becau
 se there are rejected promises!\n  }, function(error) {\n    // error.message === \"2\"\n  });\n  ```\n\n  @method all\n  @static\n  @param {Array} entries array of promises\n  @param {String} label optional string for labeling the promise.\n  Useful for tooling.\n  @return {Promise} promise that is fulfilled when all `promises` have been\n  fulfilled, or rejected if any of them become rejected.\n  @static\n*/\nexport default function all(entries) {\n  return new Enumerator(this, entries).promise;\n}","import { isArray } from \"../utils\";\n\n/**\n  `Promise.race` returns a new promise which is settled in the same way as the\n  first passed promise to settle.\n\n  Example:\n\n  ```javascript\n  let promise1 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 1');\n    }, 200);\n  });\n\n  let promise2 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 2');\n    }, 100);\n  });\n\n  Promise.race([promi
 se1, promise2]).then(function(result){\n    // result === 'promise 2' because it was resolved before promise1\n    // was resolved.\n  });\n  ```\n\n  `Promise.race` is deterministic in that only the state of the first\n  settled promise matters. For example, even if other promises given to the\n  `promises` array argument are resolved, but the first settled promise has\n  become rejected before the other promises became fulfilled, the returned\n  promise will become rejected:\n\n  ```javascript\n  let promise1 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 1');\n    }, 200);\n  });\n\n  let promise2 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      reject(new Error('promise 2'));\n    }, 100);\n  });\n\n  Promise.race([promise1, promise2]).then(function(result){\n    // Code here never runs\n  }, function(reason){\n    // reason.message === 'promise 2' because promise 2 became rejected before\n    // promise 1 
 became fulfilled\n  });\n  ```\n\n  An example real-world use case is implementing timeouts:\n\n  ```javascript\n  Promise.race([ajax('foo.json'), timeout(5000)])\n  ```\n\n  @method race\n  @static\n  @param {Array} promises array of promises to observe\n  Useful for tooling.\n  @return {Promise} a promise which settles in the same way as the first passed\n  promise to settle.\n*/\nexport default function race(entries) {\n  /*jshint validthis:true */\n  var Constructor = this;\n\n  if (!isArray(entries)) {\n    return new Constructor(function (_, reject) {\n      return reject(new TypeError('You must pass an array to race.'));\n    });\n  } else {\n    return new Constructor(function (resolve, reject) {\n      var length = entries.length;\n      for (var i = 0; i < length; i++) {\n        Constructor.resolve(entries[i]).then(resolve, reject);\n      }\n    });\n  }\n}","import { noop, reject as _reject } from '../-internal';\n\n/**\n  `Promise.reject` returns a promise rejected wit
 h the passed `reason`.\n  It is shorthand for the following:\n\n  ```javascript\n  let promise = new Promise(function(resolve, reject){\n    reject(new Error('WHOOPS'));\n  });\n\n  promise.then(function(value){\n    // Code here doesn't run because the promise is rejected!\n  }, function(reason){\n    // reason.message === 'WHOOPS'\n  });\n  ```\n\n  Instead of writing the above, your code now simply becomes the following:\n\n  ```javascript\n  let promise = Promise.reject(new Error('WHOOPS'));\n\n  promise.then(function(value){\n    // Code here doesn't run because the promise is rejected!\n  }, function(reason){\n    // reason.message === 'WHOOPS'\n  });\n  ```\n\n  @method reject\n  @static\n  @param {Any} reason value that the returned promise will be rejected with.\n  Useful for tooling.\n  @return {Promise} a promise rejected with the given `reason`.\n*/\nexport default function reject(reason) {\n  /*jshint validthis:true */\n  var Constructor = this;\n  var promise = new Con
 structor(noop);\n  _reject(promise, reason);\n  return promise;\n}","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nimport { isFunction } from './utils';\nimport { noop, nextId, PROMISE_ID, initializePromise } from './-internal';\nimport { asap, setAsap, setScheduler } from './asap';\n\nimport all from './promise/all';\nimport race from './promise/race';\nimport Resolve from './promise/resolve';\nimport Reject from './promise/reject';\nimport then from './then';\n\nfunction needsResolver() {\n  throw new TypeError('You must pass a resolver function as the first argument to the promise constructor');\n}\n\nfunction needsNew() {\n  throw new TypeError(\"Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.\");\n}\n\n/**\n  Promise objects represent the eventual result of an asynchronous operation. The\n  primary
  way of interacting with a promise is through its `then` method, which\n  registers callbacks to receive either a promise's eventual value or the reason\n  why the promise cannot be fulfilled.\n\n  Terminology\n  -----------\n\n  - `promise` is an object or function with a `then` method whose behavior conforms to this specification.\n  - `thenable` is an object or function that defines a `then` method.\n  - `value` is any legal JavaScript value (including undefined, a thenable, or a promise).\n  - `exception` is a value that is thrown using the throw statement.\n  - `reason` is a value that indicates why a promise was rejected.\n  - `settled` the final resting state of a promise, fulfilled or rejected.\n\n  A promise can be in one of three states: pending, fulfilled, or rejected.\n\n  Promises that are fulfilled have a fulfillment value and are in the fulfilled\n  state.  Promises that are rejected have a rejection reason and are in the\n  rejected state.  A fulfillment value is nev
 er a thenable.\n\n  Promises can also be said to *resolve* a value.  If this value is also a\n  promise, then the original promise's settled state will match the value's\n  settled state.  So a promise that *resolves* a promise that rejects will\n  itself reject, and a promise that *resolves* a promise that fulfills will\n  itself fulfill.\n\n\n  Basic Usage:\n  ------------\n\n  ```js\n  let promise = new Promise(function(resolve, reject) {\n    // on success\n    resolve(value);\n\n    // on failure\n    reject(reason);\n  });\n\n  promise.then(function(value) {\n    // on fulfillment\n  }, function(reason) {\n    // on rejection\n  });\n  ```\n\n  Advanced Usage:\n  ---------------\n\n  Promises shine when abstracting away asynchronous interactions such as\n  `XMLHttpRequest`s.\n\n  ```js\n  function getJSON(url) {\n    return new Promise(function(resolve, reject){\n      let xhr = new XMLHttpRequest();\n\n      xhr.open('GET', url);\n      xhr.onreadystatechange = handler;\n    
   xhr.responseType = 'json';\n      xhr.setRequestHeader('Accept', 'application/json');\n      xhr.send();\n\n      function handler() {\n        if (this.readyState === this.DONE) {\n          if (this.status === 200) {\n            resolve(this.response);\n          } else {\n            reject(new Error('getJSON: `' + url + '` failed with status: [' + this.status + ']'));\n          }\n        }\n      };\n    });\n  }\n\n  getJSON('/posts.json').then(function(json) {\n    // on fulfillment\n  }, function(reason) {\n    // on rejection\n  });\n  ```\n\n  Unlike callbacks, promises are great composable primitives.\n\n  ```js\n  Promise.all([\n    getJSON('/posts'),\n    getJSON('/comments')\n  ]).then(function(values){\n    values[0] // => postsJSON\n    values[1] // => commentsJSON\n\n    return values;\n  });\n  ```\n\n  @class Promise\n  @param {Function} resolver\n  Useful for tooling.\n  @constructor\n*/\n\nvar Promise = function () {\n  function Promise(resolver) {\n    this
 [PROMISE_ID] = nextId();\n    this._result = this._state = undefined;\n    this._subscribers = [];\n\n    if (noop !== resolver) {\n      typeof resolver !== 'function' && needsResolver();\n      this instanceof Promise ? initializePromise(this, resolver) : needsNew();\n    }\n  }\n\n  /**\n  The primary way of interacting with a promise is through its `then` method,\n  which registers callbacks to receive either a promise's eventual value or the\n  reason why the promise cannot be fulfilled.\n   ```js\n  findUser().then(function(user){\n    // user is available\n  }, function(reason){\n    // user is unavailable, and you are given the reason why\n  });\n  ```\n   Chaining\n  --------\n   The return value of `then` is itself a promise.  This second, 'downstream'\n  promise is resolved with the return value of the first promise's fulfillment\n  or rejection handler, or rejected if the handler throws an exception.\n   ```js\n  findUser().then(function (user) {\n    return user.name;\n
   }, function (reason) {\n    return 'default name';\n  }).then(function (userName) {\n    // If `findUser` fulfilled, `userName` will be the user's name, otherwise it\n    // will be `'default name'`\n  });\n   findUser().then(function (user) {\n    throw new Error('Found user, but still unhappy');\n  }, function (reason) {\n    throw new Error('`findUser` rejected and we're unhappy');\n  }).then(function (value) {\n    // never reached\n  }, function (reason) {\n    // if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.\n    // If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.\n  });\n  ```\n  If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.\n   ```js\n  findUser().then(function (user) {\n    throw new PedagogicalException('Upstream error');\n  }).then(function (value) {\n    // never reached\n  }).then(function (value) {\n    // never reached\n  }, functi
 on (reason) {\n    // The `PedgagocialException` is propagated all the way down to here\n  });\n  ```\n   Assimilation\n  ------------\n   Sometimes the value you want to propagate to a downstream promise can only be\n  retrieved asynchronously. This can be achieved by returning a promise in the\n  fulfillment or rejection handler. The downstream promise will then be pending\n  until the returned promise is settled. This is called *assimilation*.\n   ```js\n  findUser().then(function (user) {\n    return findCommentsByAuthor(user);\n  }).then(function (comments) {\n    // The user's comments are now available\n  });\n  ```\n   If the assimliated promise rejects, then the downstream promise will also reject.\n   ```js\n  findUser().then(function (user) {\n    return findCommentsByAuthor(user);\n  }).then(function (comments) {\n    // If `findCommentsByAuthor` fulfills, we'll have the value here\n  }, function (reason) {\n    // If `findCommentsByAuthor` rejects, we'll have the reason
  here\n  });\n  ```\n   Simple Example\n  --------------\n   Synchronous Example\n   ```javascript\n  let result;\n   try {\n    result = findResult();\n    // success\n  } catch(reason) {\n    // failure\n  }\n  ```\n   Errback Example\n   ```js\n  findResult(function(result, err){\n    if (err) {\n      // failure\n    } else {\n      // success\n    }\n  });\n  ```\n   Promise Example;\n   ```javascript\n  findResult().then(function(result){\n    // success\n  }, function(reason){\n    // failure\n  });\n  ```\n   Advanced Example\n  --------------\n   Synchronous Example\n   ```javascript\n  let author, books;\n   try {\n    author = findAuthor();\n    books  = findBooksByAuthor(author);\n    // success\n  } catch(reason) {\n    // failure\n  }\n  ```\n   Errback Example\n   ```js\n   function foundBooks(books) {\n   }\n   function failure(reason) {\n   }\n   findAuthor(function(author, err){\n    if (err) {\n      failure(err);\n      // failure\n    } else {\n      try {\n    
     findBoooksByAuthor(author, function(books, err) {\n          if (err) {\n            failure(err);\n          } else {\n            try {\n              foundBooks(books);\n            } catch(reason) {\n              failure(reason);\n            }\n          }\n        });\n      } catch(error) {\n        failure(err);\n      }\n      // success\n    }\n  });\n  ```\n   Promise Example;\n   ```javascript\n  findAuthor().\n    then(findBooksByAuthor).\n    then(function(books){\n      // found books\n  }).catch(function(reason){\n    // something went wrong\n  });\n  ```\n   @method then\n  @param {Function} onFulfilled\n  @param {Function} onRejected\n  Useful for tooling.\n  @return {Promise}\n  */\n\n  /**\n  `catch` is simply sugar for `then(undefined, onRejection)` which makes it the same\n  as the catch block of a try/catch statement.\n  ```js\n  function findAuthor(){\n  throw new Error('couldn't find that author');\n  }\n  // synchronous\n  try {\n  findAuthor();\n  } c
 atch(reason) {\n  // something went wrong\n  }\n  // async with promises\n  findAuthor().catch(function(reason){\n  // something went wrong\n  });\n  ```\n  @method catch\n  @param {Function} onRejection\n  Useful for tooling.\n  @return {Promise}\n  */\n\n\n  Promise.prototype.catch = function _catch(onRejection) {\n    return this.then(null, onRejection);\n  };\n\n  /**\n    `finally` will be invoked regardless of the promise's fate just as native\n    try/catch/finally behaves\n  \n    Synchronous example:\n  \n    ```js\n    findAuthor() {\n      if (Math.random() > 0.5) {\n        throw new Error();\n      }\n      return new Author();\n    }\n  \n    try {\n      return findAuthor(); // succeed or fail\n    } catch(error) {\n      return findOtherAuther();\n    } finally {\n      // always runs\n      // doesn't affect the return value\n    }\n    ```\n  \n    Asynchronous example:\n  \n    ```js\n    findAuthor().catch(function(reason){\n      return findOtherAuther();\n    }
 ).finally(function(){\n      // author was either found, or not\n    });\n    ```\n  \n    @method finally\n    @param {Function} callback\n    @return {Promise}\n  */\n\n\n  Promise.prototype.finally = function _finally(callback) {\n    var promise = this;\n    var constructor = promise.constructor;\n\n    return promise.then(function (value) {\n      return constructor.resolve(callback()).then(function () {\n        return value;\n      });\n    }, function (reason) {\n      return constructor.resolve(callback()).then(function () {\n        throw reason;\n      });\n    });\n  };\n\n  return Promise;\n}();\n\nPromise.prototype.then = then;\nexport default Promise;\nPromise.all = all;\nPromise.race = race;\nPromise.resolve = Resolve;\nPromise.reject = Reject;\nPromise._setScheduler = setScheduler;\nPromise._setAsap = setAsap;\nPromise._asap = asap;","/*global self*/\nimport Promise from './promise';\n\nexport default function polyfill() {\n  var local = void 0;\n\n  if (typeof glob
 al !== 'undefined') {\n    local = global;\n  } else if (typeof self !== 'undefined') {\n    local = self;\n  } else {\n    try {\n      local = Function('return this')();\n    } catch (e) {\n      throw new Error('polyfill failed because global object is unavailable in this environment');\n    }\n  }\n\n  var P = local.Promise;\n\n  if (P) {\n    var promiseToString = null;\n    try {\n      promiseToString = Object.prototype.toString.call(P.resolve());\n    } catch (e) {\n      // silently ignored\n    }\n\n    if (promiseToString === '[object Promise]' && !P.cast) {\n      return;\n    }\n  }\n\n  local.Promise = Promise;\n}","import Promise from './es6-promise/promise';\nimport polyfill from './es6-promise/polyfill';\n\n// Strange compat..\nPromise.polyfill = polyfill;\nPromise.Promise = Promise;\nexport default Promise;"],"names":["resolve","_resolve","then","originalThen","originalResolve","Promise","reject","_reject","Resolve","Reject"],"mappings":"AAAA;AACA;AACA;AACA;AACA;AA
 CA;AACA;;;;;;;;ACNO,SAAS,gBAAgB,CAAC,CAAC,EAAE;EAClC,IAAI,IAAI,GAAG,OAAO,CAAC,CAAC;EACpB,OAAO,CAAC,KAAK,IAAI,KAAK,IAAI,KAAK,QAAQ,IAAI,IAAI,KAAK,UAAU,CAAC,CAAC;CACjE;;AAED,AAAO,SAAS,UAAU,CAAC,CAAC,EAAE;EAC5B,OAAO,OAAO,CAAC,KAAK,UAAU,CAAC;CAChC;;AAED,AAEC;;AAED,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC;AACtB,IAAI,KAAK,CAAC,OAAO,EAAE;EACjB,QAAQ,GAAG,KAAK,CAAC,OAAO,CAAC;CAC1B,MAAM;EACL,QAAQ,GAAG,UAAU,CAAC,EAAE;IACtB,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC,KAAK,gBAAgB,CAAC;GAC/D,CAAC;CACH;;AAED,AAAO,IAAI,OAAO,GAAG,QAAQ;;ACtB7B,IAAI,GAAG,GAAG,CAAC,CAAC;AACZ,IAAI,SAAS,GAAG,KAAK,CAAC,CAAC;AACvB,IAAI,iBAAiB,GAAG,KAAK,CAAC,CAAC;;AAE/B,AAAO,IAAI,IAAI,GAAG,SAAS,IAAI,CAAC,QAAQ,EAAE,GAAG,EAAE;EAC7C,KAAK,CAAC,GAAG,CAAC,GAAG,QAAQ,CAAC;EACtB,KAAK,CAAC,GAAG,GAAG,CAAC,CAAC,GAAG,GAAG,CAAC;EACrB,GAAG,IAAI,CAAC,CAAC;EACT,IAAI,GAAG,KAAK,CAAC,EAAE;;;;IAIb,IAAI,iBAAiB,EAAE;MACrB,iBAAiB,CAAC,KAAK,CAAC,CAAC;KAC1B,MAAM;MACL,aAAa,EAAE,CAAC;KACjB;GACF;CACF,CAAC;;AAEF,AAAO,SAAS,YAAY,CAAC,UAAU,EAAE;EACvC,iBAAiB
 ,GAAG,UAAU,CAAC;CAChC;;AAED,AAAO,SAAS,OAAO,CAAC,MAAM,EAAE;EAC9B,IAAI,GAAG,MAAM,CAAC;CACf;;AAED,IAAI,aAAa,GAAG,OAAO,MAAM,KAAK,WAAW,GAAG,MAAM,GAAG,SAAS,CAAC;AACvE,IAAI,aAAa,GAAG,aAAa,IAAI,EAAE,CAAC;AACxC,IAAI,uBAAuB,GAAG,aAAa,CAAC,gBAAgB,IAAI,aAAa,CAAC,sBAAsB,CAAC;AACrG,IAAI,MAAM,GAAG,OAAO,IAAI,KAAK,WAAW,IAAI,OAAO,OAAO,KAAK,WAAW,IAAI,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,OAAO,CAAC,KAAK,kBAAkB,CAAC;;;AAG/H,IAAI,QAAQ,GAAG,OAAO,iBAAiB,KAAK,WAAW,IAAI,OAAO,aAAa,KAAK,WAAW,IAAI,OAAO,cAAc,KAAK,WAAW,CAAC;;;AAGzI,SAAS,WAAW,GAAG;;;EAGrB,OAAO,YAAY;IACjB,OAAO,OAAO,CAAC,QAAQ,CAAC,KAAK,CAAC,CAAC;GAChC,CAAC;CACH;;;AAGD,SAAS,aAAa,GAAG;EACvB,IAAI,OAAO,SAAS,KAAK,WAAW,EAAE;IACpC,OAAO,YAAY;MACjB,SAAS,CAAC,KAAK,CAAC,CAAC;KAClB,CAAC;GACH;;EAED,OAAO,aAAa,EAAE,CAAC;CACxB;;AAED,SAAS,mBAAmB,GAAG;EAC7B,IAAI,UAAU,GAAG,CAAC,CAAC;EACnB,IAAI,QAAQ,GAAG,IAAI,uBAAuB,CAAC,KAAK,CAAC,CAAC;EAClD,IAAI,IAAI,GAAG,QAAQ,CAAC,cAAc,CAAC,EAAE,CAAC,CAAC;EACvC,QAAQ,CAAC,OAAO,CAAC,IAAI,EAAE,EAAE,aAAa,EAAE,IAAI,EAAE,CAAC,CAAC;;EAEhD,OAAO,YAAY
 ;IACjB,IAAI,CAAC,IAAI,GAAG,UAAU,GAAG,EAAE,UAAU,GAAG,CAAC,CAAC;GAC3C,CAAC;CACH;;;AAGD,SAAS,iBAAiB,GAAG;EAC3B,IAAI,OAAO,GAAG,IAAI,cAAc,EAAE,CAAC;EACnC,OAAO,CAAC,KAAK,CAAC,SAAS,GAAG,KAAK,CAAC;EAChC,OAAO,YAAY;IACjB,OAAO,OAAO,CAAC,KAAK,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC;GACrC,CAAC;CACH;;AAED,SAAS,aAAa,GAAG;;;EAGvB,IAAI,gBAAgB,GAAG,UAAU,CAAC;EAClC,OAAO,YAAY;IACjB,OAAO,gBAAgB,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;GACnC,CAAC;CACH;;AAED,IAAI,KAAK,GAAG,IAAI,KAAK,CAAC,IAAI,CAAC,CAAC;AAC5B,SAAS,KAAK,GAAG;EACf,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,GAAG,EAAE,CAAC,IAAI,CAAC,EAAE;IAC/B,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC,CAAC,CAAC;IACxB,IAAI,GAAG,GAAG,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC;;IAEvB,QAAQ,CAAC,GAAG,CAAC,CAAC;;IAEd,KAAK,CAAC,CAAC,CAAC,GAAG,SAAS,CAAC;IACrB,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,GAAG,SAAS,CAAC;GAC1B;;EAED,GAAG,GAAG,CAAC,CAAC;CACT;;AAED,SAAS,YAAY,GAAG;EACtB,IAAI;IACF,IAAI,KAAK,GAAG,QAAQ,CAAC,aAAa,CAAC,EAAE,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;IACvD,SAAS,GAAG,KAAK,CAAC,SAAS,IAAI,KAAK,CAAC,YAAY,CAAC;IAClD,OAAO,
 aAAa,EAAE,CAAC;GACxB,CAAC,OAAO,CAAC,EAAE;IACV,OAAO,aAAa,EAAE,CAAC;GACxB;CACF;;AAED,IAAI,aAAa,GAAG,KAAK,CAAC,CAAC;;AAE3B,IAAI,MAAM,EAAE;EACV,aAAa,GAAG,WAAW,EAAE,CAAC;CAC/B,MAAM,IAAI,uBAAuB,EAAE;EAClC,aAAa,GAAG,mBAAmB,EAAE,CAAC;CACvC,MAAM,IAAI,QAAQ,EAAE;EACnB,aAAa,GAAG,iBAAiB,EAAE,CAAC;CACrC,MAAM,IAAI,aAAa,KAAK,SAAS,IAAI,OAAO,OAAO,KAAK,UAAU,EAAE;EACvE,aAAa,GAAG,YAAY,EAAE,CAAC;CAChC,MAAM;EACL,aAAa,GAAG,aAAa,EAAE,CAAC;;;CACjC,DCtHc,SAAS,IAAI,CAAC,aAAa,EAAE,WAAW,EAAE;EACvD,IAAI,MAAM,GAAG,IAAI,CAAC;;EAElB,IAAI,KAAK,GAAG,IAAI,IAAI,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC;;EAEvC,IAAI,KAAK,CAAC,UAAU,CAAC,KAAK,SAAS,EAAE;IACnC,WAAW,CAAC,KAAK,CAAC,CAAC;GACpB;;EAED,IAAI,MAAM,GAAG,MAAM,CAAC,MAAM,CAAC;;;EAG3B,IAAI,MAAM,EAAE;IACV,IAAI,QAAQ,GAAG,SAAS,CAAC,MAAM,GAAG,CAAC,CAAC,CAAC;IACrC,IAAI,CAAC,YAAY;MACf,OAAO,cAAc,CAAC,MAAM,EAAE,KAAK,EAAE,QAAQ,EAAE,MAAM,CAAC,OAAO,CAAC,CAAC;KAChE,CAAC,CAAC;GACJ,MAAM;IACL,SAAS,CAAC,MAAM,EAAE,KAAK,EAAE,aAAa,EAAE,WAAW,CAAC,CAAC;GACtD;;EAED,OAAO,KAAK,CAAC;;;CACd,DCxBD;;;;;;;;;;;;;
 ;;;;;;;;;;;;;;;;;;AA+BA,AAAe,SAASA,SAAO,CAAC,MAAM,EAAE;;EAEtC,IAAI,WAAW,GAAG,IAAI,CAAC;;EAEvB,IAAI,MAAM,IAAI,OAAO,MAAM,KAAK,QAAQ,IAAI,MAAM,CAAC,WAAW,KAAK,WAAW,EAAE;IAC9E,OAAO,MAAM,CAAC;GACf;;EAED,IAAI,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;EACpCC,OAAQ,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;EAC1B,OAAO,OAAO,CAAC;;;CAChB,DCrCM,IAAI,UAAU,GAAG,IAAI,CAAC,MAAM,EAAE,CAAC,QAAQ,CAAC,EAAE,CAAC,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC;;AAEhE,SAAS,IAAI,GAAG,EAAE;;AAElB,IAAI,OAAO,GAAG,KAAK,CAAC,CAAC;AACrB,IAAI,SAAS,GAAG,CAAC,CAAC;AAClB,IAAI,QAAQ,GAAG,CAAC,CAAC;;AAEjB,IAAI,eAAe,GAAG,EAAE,KAAK,EAAE,IAAI,EAAE,CAAC;;AAEtC,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,SAAS,CAAC,0CAA0C,CAAC,CAAC;CAClE;;AAED,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,SAAS,CAAC,sDAAsD,CAAC,CAAC;CAC9E;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE;EACxB,IAAI;IACF,OAAO,OAAO,CAAC,IAAI,CAAC;GACrB,CAAC,OAAO,KAAK,EAAE;IACd,eAAe,CAAC,KAAK,GAAG,KAAK,CAAC;IAC9B,OAAO,eAAe,CAAC;GACxB;CACF;;AAED,SAAS,OAAO,CAACC,OAAI,EAAE,KAAK,EAAE,kBAAkB,EAAE,gBAAgB,EAAE;EAClE,IAAI;IACFA,OAAI,CAAC,IAAI,CAAC,KA
 AK,EAAE,kBAAkB,EAAE,gBAAgB,CAAC,CAAC;GACxD,CAAC,OAAO,CAAC,EAAE;IACV,OAAO,CAAC,CAAC;GACV;CACF;;AAED,SAAS,qBAAqB,CAAC,OAAO,EAAE,QAAQ,EAAEA,OAAI,EAAE;EACtD,IAAI,CAAC,UAAU,OAAO,EAAE;IACtB,IAAI,MAAM,GAAG,KAAK,CAAC;IACnB,IAAI,KAAK,GAAG,OAAO,CAACA,OAAI,EAAE,QAAQ,EAAE,UAAU,KAAK,EAAE;MACnD,IAAI,MAAM,EAAE;QACV,OAAO;OACR;MACD,MAAM,GAAG,IAAI,CAAC;MACd,IAAI,QAAQ,KAAK,KAAK,EAAE;QACtB,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACzB,MAAM;QACL,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACzB;KACF,EAAE,UAAU,MAAM,EAAE;MACnB,IAAI,MAAM,EAAE;QACV,OAAO;OACR;MACD,MAAM,GAAG,IAAI,CAAC;;MAEd,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KACzB,EAAE,UAAU,IAAI,OAAO,CAAC,MAAM,IAAI,kBAAkB,CAAC,CAAC,CAAC;;IAExD,IAAI,CAAC,MAAM,IAAI,KAAK,EAAE;MACpB,MAAM,GAAG,IAAI,CAAC;MACd,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KACxB;GACF,EAAE,OAAO,CAAC,CAAC;CACb;;AAED,SAAS,iBAAiB,CAAC,OAAO,EAAE,QAAQ,EAAE;EAC5C,IAAI,QAAQ,CAAC,MAAM,KAAK,SAAS,EAAE;IACjC,OAAO,CAAC,OAAO,EAAE,QAAQ,CAAC,OAAO,CAAC,CAAC;GACpC,MAAM,IAAI,QAAQ,CAAC,MAAM,KAAK,QAAQ,EAAE;IACvC,MAAM,CAAC,OAAO,E
 AAE,QAAQ,CAAC,OAAO,CAAC,CAAC;GACnC,MAAM;IACL,SAAS,CAAC,QAAQ,EAAE,SAAS,EAAE,UAAU,KAAK,EAAE;MAC9C,OAAO,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KAChC,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KAChC,CAAC,CAAC;GACJ;CACF;;AAED,SAAS,mBAAmB,CAAC,OAAO,EAAE,aAAa,EAAEA,OAAI,EAAE;EACzD,IAAI,aAAa,CAAC,WAAW,KAAK,OAAO,CAAC,WAAW,IAAIA,OAAI,KAAKC,IAAY,IAAI,aAAa,CAAC,WAAW,CAAC,OAAO,KAAKC,SAAe,EAAE;IACvI,iBAAiB,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;GAC3C,MAAM;IACL,IAAIF,OAAI,KAAK,eAAe,EAAE;MAC5B,MAAM,CAAC,OAAO,EAAE,eAAe,CAAC,KAAK,CAAC,CAAC;MACvC,eAAe,CAAC,KAAK,GAAG,IAAI,CAAC;KAC9B,MAAM,IAAIA,OAAI,KAAK,SAAS,EAAE;MAC7B,OAAO,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;KACjC,MAAM,IAAI,UAAU,CAACA,OAAI,CAAC,EAAE;MAC3B,qBAAqB,CAAC,OAAO,EAAE,aAAa,EAAEA,OAAI,CAAC,CAAC;KACrD,MAAM;MACL,OAAO,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;KACjC;GACF;CACF;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE,KAAK,EAAE;EAC/B,IAAI,OAAO,KAAK,KAAK,EAAE;IACrB,MAAM,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;GACpC,MAAM,IAAI,gBAAgB,CAAC,KAAK,CAAC,EAAE;IAClC,mBAAmB,CAAC,OAA
 O,EAAE,KAAK,EAAE,OAAO,CAAC,KAAK,CAAC,CAAC,CAAC;GACrD,MAAM;IACL,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB;CACF;;AAED,SAAS,gBAAgB,CAAC,OAAO,EAAE;EACjC,IAAI,OAAO,CAAC,QAAQ,EAAE;IACpB,OAAO,CAAC,QAAQ,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;GACnC;;EAED,OAAO,CAAC,OAAO,CAAC,CAAC;CAClB;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE,KAAK,EAAE;EAC/B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;IAC9B,OAAO;GACR;;EAED,OAAO,CAAC,OAAO,GAAG,KAAK,CAAC;EACxB,OAAO,CAAC,MAAM,GAAG,SAAS,CAAC;;EAE3B,IAAI,OAAO,CAAC,YAAY,CAAC,MAAM,KAAK,CAAC,EAAE;IACrC,IAAI,CAAC,OAAO,EAAE,OAAO,CAAC,CAAC;GACxB;CACF;;AAED,SAAS,MAAM,CAAC,OAAO,EAAE,MAAM,EAAE;EAC/B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;IAC9B,OAAO;GACR;EACD,OAAO,CAAC,MAAM,GAAG,QAAQ,CAAC;EAC1B,OAAO,CAAC,OAAO,GAAG,MAAM,CAAC;;EAEzB,IAAI,CAAC,gBAAgB,EAAE,OAAO,CAAC,CAAC;CACjC;;AAED,SAAS,SAAS,CAAC,MAAM,EAAE,KAAK,EAAE,aAAa,EAAE,WAAW,EAAE;EAC5D,IAAI,YAAY,GAAG,MAAM,CAAC,YAAY,CAAC;EACvC,IAAI,MAAM,GAAG,YAAY,CAAC,MAAM,CAAC;;;EAGjC,MAAM,CAAC,QAAQ,GAAG,IAAI,CAAC;;EAEvB,YAAY,CAAC,MAAM,CAAC,GAAG,KAAK,CAAC;EAC7B,YAAY,CAA
 C,MAAM,GAAG,SAAS,CAAC,GAAG,aAAa,CAAC;EACjD,YAAY,CAAC,MAAM,GAAG,QAAQ,CAAC,GAAG,WAAW,CAAC;;EAE9C,IAAI,MAAM,KAAK,CAAC,IAAI,MAAM,CAAC,MAAM,EAAE;IACjC,IAAI,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;GACvB;CACF;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE;EACxB,IAAI,WAAW,GAAG,OAAO,CAAC,YAAY,CAAC;EACvC,IAAI,OAAO,GAAG,OAAO,CAAC,MAAM,CAAC;;EAE7B,IAAI,WAAW,CAAC,MAAM,KAAK,CAAC,EAAE;IAC5B,OAAO;GACR;;EAED,IAAI,KAAK,GAAG,KAAK,CAAC;MACd,QAAQ,GAAG,KAAK,CAAC;MACjB,MAAM,GAAG,OAAO,CAAC,OAAO,CAAC;;EAE7B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,WAAW,CAAC,MAAM,EAAE,CAAC,IAAI,CAAC,EAAE;IAC9C,KAAK,GAAG,WAAW,CAAC,CAAC,CAAC,CAAC;IACvB,QAAQ,GAAG,WAAW,CAAC,CAAC,GAAG,OAAO,CAAC,CAAC;;IAEpC,IAAI,KAAK,EAAE;MACT,cAAc,CAAC,OAAO,EAAE,KAAK,EAAE,QAAQ,EAAE,MAAM,CAAC,CAAC;KAClD,MAAM;MACL,QAAQ,CAAC,MAAM,CAAC,CAAC;KAClB;GACF;;EAED,OAAO,CAAC,YAAY,CAAC,MAAM,GAAG,CAAC,CAAC;CACjC;;AAED,SAAS,QAAQ,CAAC,QAAQ,EAAE,MAAM,EAAE;EAClC,IAAI;IACF,OAAO,QAAQ,CAAC,MAAM,CAAC,CAAC;GACzB,CAAC,OAAO,CAAC,EAAE;IACV,eAAe,CAAC,KAAK,GAAG,CAAC,CAAC;IAC1B,OAAO,eAAe,CAAC;GACxB;CA
 CF;;AAED,SAAS,cAAc,CAAC,OAAO,EAAE,OAAO,EAAE,QAAQ,EAAE,MAAM,EAAE;EAC1D,IAAI,WAAW,GAAG,UAAU,CAAC,QAAQ,CAAC;MAClC,KAAK,GAAG,KAAK,CAAC;MACd,KAAK,GAAG,KAAK,CAAC;MACd,SAAS,GAAG,KAAK,CAAC;MAClB,MAAM,GAAG,KAAK,CAAC,CAAC;;EAEpB,IAAI,WAAW,EAAE;IACf,KAAK,GAAG,QAAQ,CAAC,QAAQ,EAAE,MAAM,CAAC,CAAC;;IAEnC,IAAI,KAAK,KAAK,eAAe,EAAE;MAC7B,MAAM,GAAG,IAAI,CAAC;MACd,KAAK,GAAG,KAAK,CAAC,KAAK,CAAC;MACpB,KAAK,CAAC,KAAK,GAAG,IAAI,CAAC;KACpB,MAAM;MACL,SAAS,GAAG,IAAI,CAAC;KAClB;;IAED,IAAI,OAAO,KAAK,KAAK,EAAE;MACrB,MAAM,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;MACnC,OAAO;KACR;GACF,MAAM;IACL,KAAK,GAAG,MAAM,CAAC;IACf,SAAS,GAAG,IAAI,CAAC;GAClB;;EAED,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;;GAE/B,MAAM,IAAI,WAAW,IAAI,SAAS,EAAE;IACnC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB,MAAM,IAAI,MAAM,EAAE;IACjB,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACxB,MAAM,IAAI,OAAO,KAAK,SAAS,EAAE;IAChC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB,MAAM,IAAI,OAAO,KAAK,QAAQ,EAAE;IAC/B,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACxB;CACF;;AAED,SAAS,iBAAiB,CAAC,OAAO,EAAE
 ,QAAQ,EAAE;EAC5C,IAAI;IACF,QAAQ,CAAC,SAAS,cAAc,CAAC,KAAK,EAAE;MACtC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KACzB,EAAE,SAAS,aAAa,CAAC,MAAM,EAAE;MAChC,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KACzB,CAAC,CAAC;GACJ,CAAC,OAAO,CAAC,EAAE;IACV,MAAM,CAAC,OAAO,EAAE,CAAC,CAAC,CAAC;GACpB;CACF;;AAED,IAAI,EAAE,GAAG,CAAC,CAAC;AACX,SAAS,MAAM,GAAG;EAChB,OAAO,EAAE,EAAE,CAAC;CACb;;AAED,SAAS,WAAW,CAAC,OAAO,EAAE;EAC5B,OAAO,CAAC,UAAU,CAAC,GAAG,EAAE,EAAE,CAAC;EAC3B,OAAO,CAAC,MAAM,GAAG,SAAS,CAAC;EAC3B,OAAO,CAAC,OAAO,GAAG,SAAS,CAAC;EAC5B,OAAO,CAAC,YAAY,GAAG,EAAE,CAAC;CAC3B;;ACrPD,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,KAAK,CAAC,yCAAyC,CAAC,CAAC;CAC7D,AAAC;;AAEF,IAAI,UAAU,GAAG,YAAY;EAC3B,SAAS,UAAU,CAAC,WAAW,EAAE,KAAK,EAAE;IACtC,IAAI,CAAC,oBAAoB,GAAG,WAAW,CAAC;IACxC,IAAI,CAAC,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;;IAErC,IAAI,CAAC,IAAI,CAAC,OAAO,CAAC,UAAU,CAAC,EAAE;MAC7B,WAAW,CAAC,IAAI,CAAC,OAAO,CAAC,CAAC;KAC3B;;IAED,IAAI,OAAO,CAAC,KAAK,CAAC,EAAE;MAClB,IAAI,CAAC,MAAM,GAAG,KAAK,CAAC,MAAM,CAAC;MAC3B,IAAI,CAAC,UAAU,GAAG,KAAK,CAA
 C,MAAM,CAAC;;MAE/B,IAAI,CAAC,OAAO,GAAG,IAAI,KAAK,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;;MAEtC,IAAI,IAAI,CAAC,MAAM,KAAK,CAAC,EAAE;QACrB,OAAO,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;OACrC,MAAM;QACL,IAAI,CAAC,MAAM,GAAG,IAAI,CAAC,MAAM,IAAI,CAAC,CAAC;QAC/B,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC;QACvB,IAAI,IAAI,CAAC,UAAU,KAAK,CAAC,EAAE;UACzB,OAAO,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;SACrC;OACF;KACF,MAAM;MACL,MAAM,CAAC,IAAI,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;KACzC;GACF;;EAED,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE;IAC3D,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,IAAI,CAAC,MAAM,KAAK,OAAO,IAAI,CAAC,GAAG,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;MAChE,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC;KAC9B;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE,CAAC,EAAE;IAC9D,IAAI,CAAC,GAAG,IAAI,CAAC,oBAAoB,CAAC;IAClC,IAAIF,UAAO,GAAG,CAAC,CAAC,OAAO,CAAC;;;IAGxB,IAAIA,UAAO,KAAKI,SAAe,EAAE;MAC/B,IAAI,KAAK,GAAG,OAAO,CAAC,KAAK,CAAC,CAAC;;MAE3B,IAAI,KAAK,KAAKD,IAAY,
 IAAI,KAAK,CAAC,MAAM,KAAK,OAAO,EAAE;QACtD,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,KAAK,CAAC,OAAO,CAAC,CAAC;OACjD,MAAM,IAAI,OAAO,KAAK,KAAK,UAAU,EAAE;QACtC,IAAI,CAAC,UAAU,EAAE,CAAC;QAClB,IAAI,CAAC,OAAO,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC;OACzB,MAAM,IAAI,CAAC,KAAKE,SAAO,EAAE;QACxB,IAAI,OAAO,GAAG,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC;QAC1B,mBAAmB,CAAC,OAAO,EAAE,KAAK,EAAE,KAAK,CAAC,CAAC;QAC3C,IAAI,CAAC,aAAa,CAAC,OAAO,EAAE,CAAC,CAAC,CAAC;OAChC,MAAM;QACL,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,CAAC,UAAUL,UAAO,EAAE;UAC1C,OAAOA,UAAO,CAAC,KAAK,CAAC,CAAC;SACvB,CAAC,EAAE,CAAC,CAAC,CAAC;OACR;KACF,MAAM;MACL,IAAI,CAAC,aAAa,CAACA,UAAO,CAAC,KAAK,CAAC,EAAE,CAAC,CAAC,CAAC;KACvC;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE,CAAC,EAAE,KAAK,EAAE;IACrE,IAAI,OAAO,GAAG,IAAI,CAAC,OAAO,CAAC;;;IAG3B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;MAC9B,IAAI,CAAC,UAAU,EAAE,CAAC;;MAElB,IAAI,KAAK,KAAK,QAAQ,EAAE;QACtB,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACxB,MAAM;QACL,IAAI,CAAC,OAAO,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC;OACz
 B;KACF;;IAED,IAAI,IAAI,CAAC,UAAU,KAAK,CAAC,EAAE;MACzB,OAAO,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;KAChC;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,aAAa,GAAG,SAAS,aAAa,CAAC,OAAO,EAAE,CAAC,EAAE;IACtE,IAAI,UAAU,GAAG,IAAI,CAAC;;IAEtB,SAAS,CAAC,OAAO,EAAE,SAAS,EAAE,UAAU,KAAK,EAAE;MAC7C,OAAO,UAAU,CAAC,UAAU,CAAC,SAAS,EAAE,CAAC,EAAE,KAAK,CAAC,CAAC;KACnD,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,UAAU,CAAC,UAAU,CAAC,QAAQ,EAAE,CAAC,EAAE,MAAM,CAAC,CAAC;KACnD,CAAC,CAAC;GACJ,CAAC;;EAEF,OAAO,UAAU,CAAC;CACnB,EAAE;;ACzGH;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA+CA,AAAe,SAAS,GAAG,CAAC,OAAO,EAAE;EACnC,OAAO,IAAI,UAAU,CAAC,IAAI,EAAE,OAAO,CAAC,CAAC,OAAO,CAAC;;;CAC9C,DCjDD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAiEA,AAAe,SAAS,IAAI,CAAC,OAAO,EAAE;;EAEpC,IAAI,WAAW,GAAG,IAAI,CAAC;;EAEvB,IAAI,CAAC,OAAO,CAAC,OAAO,CAAC,EAAE;IACrB,OAAO,IAAI,WAAW,CAAC,UAAU,CAAC,EAAE,MAAM,EAAE;MAC1C,OAAO,MAAM,CAAC,IAAI,SAAS,CAAC,iCAAiC,CAAC,CAAC,CAAC;KACjE,CAAC,CAAC;GACJ,MAAM;IACL,OAAO,IAAI,WAAW,CAAC,UAAU,OAAO,EAAE
 ,MAAM,EAAE;MAChD,IAAI,MAAM,GAAG,OAAO,CAAC,MAAM,CAAC;MAC5B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,MAAM,EAAE,CAAC,EAAE,EAAE;QAC/B,WAAW,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,CAAC,IAAI,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;OACvD;KACF,CAAC,CAAC;GACJ;;;CACF,DCjFD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAkCA,AAAe,SAASM,QAAM,CAAC,MAAM,EAAE;;EAErC,IAAI,WAAW,GAAG,IAAI,CAAC;EACvB,IAAI,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;EACpCC,MAAO,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;EACzB,OAAO,OAAO,CAAC;;;CAChB,DC9BD,SAAS,aAAa,GAAG;EACvB,MAAM,IAAI,SAAS,CAAC,oFAAoF,CAAC,CAAC;CAC3G;;AAED,SAAS,QAAQ,GAAG;EAClB,MAAM,IAAI,SAAS,CAAC,uHAAuH,CAAC,CAAC;CAC9I;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA0GD,IAAIF,SAAO,GAAG,YAAY;EACxB,SAAS,OAAO,CAAC,QAAQ,EAAE;IACzB,IAAI,CAAC,UAAU,CAAC,GAAG,MAAM,EAAE,CAAC;IAC5B,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC,MAAM,GAAG,SAAS,CAAC;IACvC,IAAI,CAAC,YAAY,GAAG,EAAE,CAAC;;IAEvB,IAAI,IAAI,KAAK,QAAQ,EAAE;MACrB,OAAO,QAAQ,KAAK,UAAU,IAAI,aAAa,EAAE,CAAC;M
 AClD,IAAI,YAAY,OAAO,GAAG,iBAAiB,CAAC,IAAI,EAAE,QAAQ,CAAC,GAAG,QAAQ,EAAE,CAAC;KAC1E;GACF;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;EA4LD,OAAO,CAAC,SAAS,CAAC,KAAK,GAAG,SAAS,MAAM,CAAC,WAAW,EAAE;IACrD,OAAO,IAAI,CAAC,IAAI,CAAC,IAAI,EAAE,WAAW,CAAC,CAAC;GACrC,CAAC;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;EA0CF,OAAO,CAAC,SAAS,CAAC,OAAO,GAAG,SAAS,QAAQ,CAAC,QAAQ,EAAE;IACtD,IAAI,OAAO,GAAG,IAAI,CAAC;IACnB,IAAI,WAAW,GAAG,OAAO,CAAC,WAAW,CAAC;;IAEtC,OAAO,OAAO,CAAC,IAAI,CAAC,UAAU,KAAK,EAAE;MACnC,OAAO,WAAW,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,IAAI,CAAC,YAAY;QACtD,OAAO,KAAK,CAAC;OACd,CAAC,CAAC;KACJ,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,WAAW,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,IAAI,CAAC,YAAY;QACtD,MAAM,MAAM,CAAC;OACd,CAAC,CAAC;KACJ,CAAC,CAAC;GACJ,CAAC;;EAEF,OAAO,OAAO,CAAC;CAChB,EAAE,CAAC;;AAEJA,SAAO,CAAC,SAAS,CAAC,IAAI,GAAG,IAAI,CAAC;AAC9B,AACAA,SAAO,CAAC,GAAG,GAAG,GAA
 G,CAAC;AAClBA,SAAO,CAAC,IAAI,GAAG,IAAI,CAAC;AACpBA,SAAO,CAAC,OAAO,GAAGG,SAAO,CAAC;AAC1BH,SAAO,CAAC,MAAM,GAAGI,QAAM,CAAC;AACxBJ,SAAO,CAAC,aAAa,GAAG,YAAY,CAAC;AACrCA,SAAO,CAAC,QAAQ,GAAG,OAAO,CAAC;AAC3BA,SAAO,CAAC,KAAK,GAAG,IAAI;;ACxYpB;AACA,AAEe,SAAS,QAAQ,GAAG;EACjC,IAAI,KAAK,GAAG,KAAK,CAAC,CAAC;;EAEnB,IAAI,OAAO,MAAM,KAAK,WAAW,EAAE;IACjC,KAAK,GAAG,MAAM,CAAC;GAChB,MAAM,IAAI,OAAO,IAAI,KAAK,WAAW,EAAE;IACtC,KAAK,GAAG,IAAI,CAAC;GACd,MAAM;IACL,IAAI;MACF,KAAK,GAAG,QAAQ,CAAC,aAAa,CAAC,EAAE,CAAC;KACnC,CAAC,OAAO,CAAC,EAAE;MACV,MAAM,IAAI,KAAK,CAAC,0EAA0E,CAAC,CAAC;KAC7F;GACF;;EAED,IAAI,CAAC,GAAG,KAAK,CAAC,OAAO,CAAC;;EAEtB,IAAI,CAAC,EAAE;IACL,IAAI,eAAe,GAAG,IAAI,CAAC;IAC3B,IAAI;MACF,eAAe,GAAG,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC,OAAO,EAAE,CAAC,CAAC;KAC/D,CAAC,OAAO,CAAC,EAAE;;KAEX;;IAED,IAAI,eAAe,KAAK,kBAAkB,IAAI,CAAC,CAAC,CAAC,IAAI,EAAE;MACrD,OAAO;KACR;GACF;;EAED,KAAK,CAAC,OAAO,GAAGA,SAAO,CAAC;;;CACzB,DC/BD;AACAA,SAAO,CAAC,QAAQ,GAAG,QAAQ,CAAC;AAC5BA,SAAO,CAAC,OAAO,GAAGA,SAAO,CAAC;;;;
 ;;;;","file":"es6-promise.min.js"}
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/es6-promise.d.ts
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/es6-promise.d.ts b/node_modules/es6-promisify/node_modules/es6-promise/es6-promise.d.ts
new file mode 100644
index 0000000..cce5b36
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/es6-promise.d.ts
@@ -0,0 +1,81 @@
+export interface Thenable <R> {
+  then <U> (onFulfilled?: (value: R) => U | Thenable<U>, onRejected?: (error: any) => U | Thenable<U>): Thenable<U>;
+  then <U> (onFulfilled?: (value: R) => U | Thenable<U>, onRejected?: (error: any) => void): Thenable<U>;
+}
+
+export class Promise <R> implements Thenable <R> {
+  /**
+   * If you call resolve in the body of the callback passed to the constructor,
+   * your promise is fulfilled with result object passed to resolve.
+   * If you call reject your promise is rejected with the object passed to resolve.
+   * For consistency and debugging (eg stack traces), obj should be an instanceof Error.
+   * Any errors thrown in the constructor callback will be implicitly passed to reject().
+   */
+  constructor (callback: (resolve : (value?: R | Thenable<R>) => void, reject: (error?: any) => void) => void);
+
+  /**
+   * onFulfilled is called when/if "promise" resolves. onRejected is called when/if "promise" rejects.
+   * Both are optional, if either/both are omitted the next onFulfilled/onRejected in the chain is called.
+   * Both callbacks have a single parameter , the fulfillment value or rejection reason.
+   * "then" returns a new promise equivalent to the value you return from onFulfilled/onRejected after being passed through Promise.resolve.
+   * If an error is thrown in the callback, the returned promise rejects with that error.
+   *
+   * @param onFulfilled called when/if "promise" resolves
+   * @param onRejected called when/if "promise" rejects
+   */
+  then <U> (onFulfilled?: (value: R) => U | Thenable<U>, onRejected?: (error: any) => U | Thenable<U>): Promise<U>;
+  then <U> (onFulfilled?: (value: R) => U | Thenable<U>, onRejected?: (error: any) => void): Promise<U>;
+
+  /**
+   * Sugar for promise.then(undefined, onRejected)
+   *
+   * @param onRejected called when/if "promise" rejects
+   */
+  catch <U> (onRejected?: (error: any) => U | Thenable<U>): Promise<U>;
+
+  /**
+   * onSettled is invoked when/if the "promise" settles (either rejects or fulfills);
+   *
+   * @param onFinally called when/if "promise" settles
+   */
+  finally <U> (onFinally?: (callback: any) => U | Thenable<U>): Promise<U>;
+
+  /**
+   * Make a new promise from the thenable.
+   * A thenable is promise-like in as far as it has a "then" method.
+   */
+  static resolve (): Promise<void>;
+  static resolve <R> (value: R | Thenable<R>): Promise<R>;
+
+  /**
+   * Make a promise that rejects to obj. For consistency and debugging (eg stack traces), obj should be an instanceof Error
+   */
+  static reject <R> (error: any): Promise<R>;
+
+  /**
+   * Make a promise that fulfills when every item in the array fulfills, and rejects if (and when) any item rejects.
+   * the array passed to all can be a mixture of promise-like objects and other objects.
+   * The fulfillment value is an array (in order) of fulfillment values. The rejection value is the first rejection value.
+   */
+  static all<T1, T2, T3, T4, T5, T6, T7, T8, T9, T10>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>, T3 | Thenable<T3>, T4 | Thenable <T4>, T5 | Thenable<T5>, T6 | Thenable<T6>, T7 | Thenable<T7>, T8 | Thenable<T8>, T9 | Thenable<T9>, T10 | Thenable<T10>]): Promise<[T1, T2, T3, T4, T5, T6, T7, T8, T9, T10]>;
+  static all<T1, T2, T3, T4, T5, T6, T7, T8, T9>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>, T3 | Thenable<T3>, T4 | Thenable <T4>, T5 | Thenable<T5>, T6 | Thenable<T6>, T7 | Thenable<T7>, T8 | Thenable<T8>, T9 | Thenable<T9>]): Promise<[T1, T2, T3, T4, T5, T6, T7, T8, T9]>;
+  static all<T1, T2, T3, T4, T5, T6, T7, T8>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>, T3 | Thenable<T3>, T4 | Thenable <T4>, T5 | Thenable<T5>, T6 | Thenable<T6>, T7 | Thenable<T7>, T8 | Thenable<T8>]): Promise<[T1, T2, T3, T4, T5, T6, T7, T8]>;
+  static all<T1, T2, T3, T4, T5, T6, T7>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>, T3 | Thenable<T3>, T4 | Thenable <T4>, T5 | Thenable<T5>, T6 | Thenable<T6>, T7 | Thenable<T7>]): Promise<[T1, T2, T3, T4, T5, T6, T7]>;
+  static all<T1, T2, T3, T4, T5, T6>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>, T3 | Thenable<T3>, T4 | Thenable <T4>, T5 | Thenable<T5>, T6 | Thenable<T6>]): Promise<[T1, T2, T3, T4, T5, T6]>;
+  static all<T1, T2, T3, T4, T5>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>, T3 | Thenable<T3>, T4 | Thenable <T4>, T5 | Thenable<T5>]): Promise<[T1, T2, T3, T4, T5]>;
+  static all<T1, T2, T3, T4>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>, T3 | Thenable<T3>, T4 | Thenable <T4>]): Promise<[T1, T2, T3, T4]>;
+  static all<T1, T2, T3>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>, T3 | Thenable<T3>]): Promise<[T1, T2, T3]>;
+  static all<T1, T2>(values: [T1 | Thenable<T1>, T2 | Thenable<T2>]): Promise<[T1, T2]>;
+  static all<T1>(values: [T1 | Thenable<T1>]): Promise<[T1]>;
+  static all<TAll>(values: Array<TAll | Thenable<TAll>>): Promise<TAll[]>;
+
+  /**
+   * Make a Promise that fulfills when any item fulfills, and rejects if any item rejects.
+   */
+  static race <R> (promises: (R | Thenable<R>)[]): Promise<R>;
+}
+
+/**
+ * The polyfill method will patch the global environment (in this case to the Promise name) when called.
+ */
+export function polyfill (): void;

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise.auto.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise.auto.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise.auto.js
new file mode 100644
index 0000000..7799786
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise.auto.js
@@ -0,0 +1,3 @@
+import Promise from './es6-promise';
+Promise.polyfill();
+export default Promise;

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise.js
new file mode 100644
index 0000000..4f4d840
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise.js
@@ -0,0 +1,7 @@
+import Promise from './es6-promise/promise';
+import polyfill from './es6-promise/polyfill';
+
+// Strange compat..
+Promise.polyfill = polyfill;
+Promise.Promise = Promise;
+export default Promise;

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/-internal.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/-internal.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/-internal.js
new file mode 100644
index 0000000..925776f
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/-internal.js
@@ -0,0 +1,266 @@
+import {
+  objectOrFunction,
+  isFunction
+} from './utils';
+
+import {
+  asap
+} from './asap';
+
+import originalThen from './then';
+import originalResolve from './promise/resolve';
+
+export const PROMISE_ID = Math.random().toString(36).substring(2);
+
+function noop() {}
+
+const PENDING   = void 0;
+const FULFILLED = 1;
+const REJECTED  = 2;
+
+const TRY_CATCH_ERROR = { error: null };
+
+function selfFulfillment() {
+  return new TypeError("You cannot resolve a promise with itself");
+}
+
+function cannotReturnOwn() {
+  return new TypeError('A promises callback cannot return that same promise.');
+}
+
+function getThen(promise) {
+  try {
+    return promise.then;
+  } catch(error) {
+    TRY_CATCH_ERROR.error = error;
+    return TRY_CATCH_ERROR;
+  }
+}
+
+function tryThen(then, value, fulfillmentHandler, rejectionHandler) {
+  try {
+    then.call(value, fulfillmentHandler, rejectionHandler);
+  } catch(e) {
+    return e;
+  }
+}
+
+function handleForeignThenable(promise, thenable, then) {
+   asap(promise => {
+    var sealed = false;
+    var error = tryThen(then, thenable, value => {
+      if (sealed) { return; }
+      sealed = true;
+      if (thenable !== value) {
+        resolve(promise, value);
+      } else {
+        fulfill(promise, value);
+      }
+    }, reason => {
+      if (sealed) { return; }
+      sealed = true;
+
+      reject(promise, reason);
+    }, 'Settle: ' + (promise._label || ' unknown promise'));
+
+    if (!sealed && error) {
+      sealed = true;
+      reject(promise, error);
+    }
+  }, promise);
+}
+
+function handleOwnThenable(promise, thenable) {
+  if (thenable._state === FULFILLED) {
+    fulfill(promise, thenable._result);
+  } else if (thenable._state === REJECTED) {
+    reject(promise, thenable._result);
+  } else {
+    subscribe(thenable, undefined, value  => resolve(promise, value),
+                                   reason => reject(promise, reason))
+  }
+}
+
+function handleMaybeThenable(promise, maybeThenable, then) {
+  if (maybeThenable.constructor === promise.constructor &&
+      then === originalThen &&
+      maybeThenable.constructor.resolve === originalResolve) {
+    handleOwnThenable(promise, maybeThenable);
+  } else {
+    if (then === TRY_CATCH_ERROR) {
+      reject(promise, TRY_CATCH_ERROR.error);
+      TRY_CATCH_ERROR.error = null;
+    } else if (then === undefined) {
+      fulfill(promise, maybeThenable);
+    } else if (isFunction(then)) {
+      handleForeignThenable(promise, maybeThenable, then);
+    } else {
+      fulfill(promise, maybeThenable);
+    }
+  }
+}
+
+function resolve(promise, value) {
+  if (promise === value) {
+    reject(promise, selfFulfillment());
+  } else if (objectOrFunction(value)) {
+    handleMaybeThenable(promise, value, getThen(value));
+  } else {
+    fulfill(promise, value);
+  }
+}
+
+function publishRejection(promise) {
+  if (promise._onerror) {
+    promise._onerror(promise._result);
+  }
+
+  publish(promise);
+}
+
+function fulfill(promise, value) {
+  if (promise._state !== PENDING) { return; }
+
+  promise._result = value;
+  promise._state = FULFILLED;
+
+  if (promise._subscribers.length !== 0) {
+    asap(publish, promise);
+  }
+}
+
+function reject(promise, reason) {
+  if (promise._state !== PENDING) { return; }
+  promise._state = REJECTED;
+  promise._result = reason;
+
+  asap(publishRejection, promise);
+}
+
+function subscribe(parent, child, onFulfillment, onRejection) {
+  let { _subscribers } = parent;
+  let { length } = _subscribers;
+
+  parent._onerror = null;
+
+  _subscribers[length] = child;
+  _subscribers[length + FULFILLED] = onFulfillment;
+  _subscribers[length + REJECTED]  = onRejection;
+
+  if (length === 0 && parent._state) {
+    asap(publish, parent);
+  }
+}
+
+function publish(promise) {
+  let subscribers = promise._subscribers;
+  let settled = promise._state;
+
+  if (subscribers.length === 0) { return; }
+
+  let child, callback, detail = promise._result;
+
+  for (let i = 0; i < subscribers.length; i += 3) {
+    child = subscribers[i];
+    callback = subscribers[i + settled];
+
+    if (child) {
+      invokeCallback(settled, child, callback, detail);
+    } else {
+      callback(detail);
+    }
+  }
+
+  promise._subscribers.length = 0;
+}
+
+
+function tryCatch(callback, detail) {
+  try {
+    return callback(detail);
+  } catch(e) {
+    TRY_CATCH_ERROR.error = e;
+    return TRY_CATCH_ERROR;
+  }
+}
+
+function invokeCallback(settled, promise, callback, detail) {
+  let hasCallback = isFunction(callback),
+      value, error, succeeded, failed;
+
+  if (hasCallback) {
+    value = tryCatch(callback, detail);
+
+    if (value === TRY_CATCH_ERROR) {
+      failed = true;
+      error = value.error;
+      value.error = null;
+    } else {
+      succeeded = true;
+    }
+
+    if (promise === value) {
+      reject(promise, cannotReturnOwn());
+      return;
+    }
+
+  } else {
+    value = detail;
+    succeeded = true;
+  }
+
+  if (promise._state !== PENDING) {
+    // noop
+  } else if (hasCallback && succeeded) {
+    resolve(promise, value);
+  } else if (failed) {
+    reject(promise, error);
+  } else if (settled === FULFILLED) {
+    fulfill(promise, value);
+  } else if (settled === REJECTED) {
+    reject(promise, value);
+  }
+}
+
+function initializePromise(promise, resolver) {
+  try {
+    resolver(function resolvePromise(value){
+      resolve(promise, value);
+    }, function rejectPromise(reason) {
+      reject(promise, reason);
+    });
+  } catch(e) {
+    reject(promise, e);
+  }
+}
+
+let id = 0;
+function nextId() {
+  return id++;
+}
+
+function makePromise(promise) {
+  promise[PROMISE_ID] = id++;
+  promise._state = undefined;
+  promise._result = undefined;
+  promise._subscribers = [];
+}
+
+export {
+  nextId,
+  makePromise,
+  getThen,
+  noop,
+  resolve,
+  reject,
+  fulfill,
+  subscribe,
+  publish,
+  publishRejection,
+  initializePromise,
+  invokeCallback,
+  FULFILLED,
+  REJECTED,
+  PENDING,
+  handleMaybeThenable
+};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/asap.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/asap.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/asap.js
new file mode 100644
index 0000000..0483201
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/asap.js
@@ -0,0 +1,119 @@
+let len = 0;
+let vertxNext;
+let customSchedulerFn;
+
+export var asap = function asap(callback, arg) {
+  queue[len] = callback;
+  queue[len + 1] = arg;
+  len += 2;
+  if (len === 2) {
+    // If len is 2, that means that we need to schedule an async flush.
+    // If additional callbacks are queued before the queue is flushed, they
+    // will be processed by this flush that we are scheduling.
+    if (customSchedulerFn) {
+      customSchedulerFn(flush);
+    } else {
+      scheduleFlush();
+    }
+  }
+}
+
+export function setScheduler(scheduleFn) {
+  customSchedulerFn = scheduleFn;
+}
+
+export function setAsap(asapFn) {
+  asap = asapFn;
+}
+
+const browserWindow = (typeof window !== 'undefined') ? window : undefined;
+const browserGlobal = browserWindow || {};
+const BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;
+const isNode = typeof self === 'undefined' && typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';
+
+// test for web worker but not in IE10
+const isWorker = typeof Uint8ClampedArray !== 'undefined' &&
+  typeof importScripts !== 'undefined' &&
+  typeof MessageChannel !== 'undefined';
+
+// node
+function useNextTick() {
+  // node version 0.10.x displays a deprecation warning when nextTick is used recursively
+  // see https://github.com/cujojs/when/issues/410 for details
+  return () => process.nextTick(flush);
+}
+
+// vertx
+function useVertxTimer() {
+  if (typeof vertxNext !== 'undefined') {
+    return function() {
+      vertxNext(flush);
+    };
+  }
+
+  return useSetTimeout();
+}
+
+function useMutationObserver() {
+  let iterations = 0;
+  const observer = new BrowserMutationObserver(flush);
+  const node = document.createTextNode('');
+  observer.observe(node, { characterData: true });
+
+  return () => {
+    node.data = (iterations = ++iterations % 2);
+  };
+}
+
+// web worker
+function useMessageChannel() {
+  const channel = new MessageChannel();
+  channel.port1.onmessage = flush;
+  return () => channel.port2.postMessage(0);
+}
+
+function useSetTimeout() {
+  // Store setTimeout reference so es6-promise will be unaffected by
+  // other code modifying setTimeout (like sinon.useFakeTimers())
+  const globalSetTimeout = setTimeout;
+  return () => globalSetTimeout(flush, 1);
+}
+
+const queue = new Array(1000);
+function flush() {
+  for (let i = 0; i < len; i+=2) {
+    let callback = queue[i];
+    let arg = queue[i+1];
+
+    callback(arg);
+
+    queue[i] = undefined;
+    queue[i+1] = undefined;
+  }
+
+  len = 0;
+}
+
+function attemptVertx() {
+  try {
+    const vertx = Function('return this')().require('vertx');
+    vertxNext = vertx.runOnLoop || vertx.runOnContext;
+    return useVertxTimer();
+  } catch(e) {
+    return useSetTimeout();
+  }
+}
+
+let scheduleFlush;
+// Decide what async method to use to triggering processing of queued callbacks:
+if (isNode) {
+  scheduleFlush = useNextTick();
+} else if (BrowserMutationObserver) {
+  scheduleFlush = useMutationObserver();
+} else if (isWorker) {
+  scheduleFlush = useMessageChannel();
+} else if (browserWindow === undefined && typeof require === 'function') {
+  scheduleFlush = attemptVertx();
+} else {
+  scheduleFlush = useSetTimeout();
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/enumerator.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/enumerator.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/enumerator.js
new file mode 100644
index 0000000..b0eaa93
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/enumerator.js
@@ -0,0 +1,113 @@
+import {
+  isArray,
+  isMaybeThenable
+} from './utils';
+import {
+  noop,
+  reject,
+  fulfill,
+  subscribe,
+  FULFILLED,
+  REJECTED,
+  PENDING,
+  getThen,
+  handleMaybeThenable
+} from './-internal';
+
+import then from './then';
+import Promise from './promise';
+import originalResolve from './promise/resolve';
+import originalThen from './then';
+import { makePromise, PROMISE_ID } from './-internal';
+
+function validationError() {
+  return new Error('Array Methods must be provided an Array');
+};
+
+export default class Enumerator {
+  constructor(Constructor, input) {
+    this._instanceConstructor = Constructor;
+    this.promise = new Constructor(noop);
+
+    if (!this.promise[PROMISE_ID]) {
+      makePromise(this.promise);
+    }
+
+    if (isArray(input)) {
+      this.length     = input.length;
+      this._remaining = input.length;
+
+      this._result = new Array(this.length);
+
+      if (this.length === 0) {
+        fulfill(this.promise, this._result);
+      } else {
+        this.length = this.length || 0;
+        this._enumerate(input);
+        if (this._remaining === 0) {
+          fulfill(this.promise, this._result);
+        }
+      }
+    } else {
+      reject(this.promise, validationError());
+    }
+  }
+  _enumerate(input) {
+    for (let i = 0; this._state === PENDING && i < input.length; i++) {
+      this._eachEntry(input[i], i);
+    }
+  }
+
+  _eachEntry(entry, i) {
+    let c = this._instanceConstructor;
+    let { resolve } = c;
+
+    if (resolve === originalResolve) {
+      let then = getThen(entry);
+
+      if (then === originalThen &&
+        entry._state !== PENDING) {
+        this._settledAt(entry._state, i, entry._result);
+      } else if (typeof then !== 'function') {
+        this._remaining--;
+        this._result[i] = entry;
+      } else if (c === Promise) {
+        let promise = new c(noop);
+        handleMaybeThenable(promise, entry, then);
+        this._willSettleAt(promise, i);
+      } else {
+        this._willSettleAt(new c(resolve => resolve(entry)), i);
+      }
+    } else {
+      this._willSettleAt(resolve(entry), i);
+    }
+  }
+
+  _settledAt(state, i, value) {
+    let { promise } = this;
+
+    if (promise._state === PENDING) {
+      this._remaining--;
+
+      if (state === REJECTED) {
+        reject(promise, value);
+      } else {
+        this._result[i] = value;
+      }
+    }
+
+    if (this._remaining === 0) {
+      fulfill(promise, this._result);
+    }
+  }
+
+  _willSettleAt(promise, i) {
+    let enumerator = this;
+
+    subscribe(
+      promise, undefined,
+      value => enumerator._settledAt(FULFILLED, i, value),
+      reason => enumerator._settledAt(REJECTED, i, reason)
+    );
+  }
+};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/polyfill.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/polyfill.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/polyfill.js
new file mode 100644
index 0000000..30db73c
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/polyfill.js
@@ -0,0 +1,35 @@
+/*global self*/
+import Promise from './promise';
+
+export default function polyfill() {
+  let local;
+
+  if (typeof global !== 'undefined') {
+    local = global;
+  } else if (typeof self !== 'undefined') {
+    local = self;
+  } else {
+    try {
+      local = Function('return this')();
+    } catch (e) {
+      throw new Error('polyfill failed because global object is unavailable in this environment');
+    }
+  }
+
+  let P = local.Promise;
+
+  if (P) {
+    var promiseToString = null;
+    try {
+      promiseToString = Object.prototype.toString.call(P.resolve());
+    } catch(e) {
+      // silently ignored
+    }
+
+    if (promiseToString === '[object Promise]' && !P.cast){
+      return;
+    }
+  }
+
+  local.Promise = Promise;
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise.js
new file mode 100644
index 0000000..8c21b6f
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise.js
@@ -0,0 +1,427 @@
+import {
+  isFunction
+} from './utils';
+import {
+  noop,
+  nextId,
+  PROMISE_ID,
+  initializePromise
+} from './-internal';
+import {
+  asap,
+  setAsap,
+  setScheduler
+} from './asap';
+
+import all from './promise/all';
+import race from './promise/race';
+import Resolve from './promise/resolve';
+import Reject from './promise/reject';
+import then from './then';
+
+function needsResolver() {
+  throw new TypeError('You must pass a resolver function as the first argument to the promise constructor');
+}
+
+function needsNew() {
+  throw new TypeError("Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.");
+}
+
+/**
+  Promise objects represent the eventual result of an asynchronous operation. The
+  primary way of interacting with a promise is through its `then` method, which
+  registers callbacks to receive either a promise's eventual value or the reason
+  why the promise cannot be fulfilled.
+
+  Terminology
+  -----------
+
+  - `promise` is an object or function with a `then` method whose behavior conforms to this specification.
+  - `thenable` is an object or function that defines a `then` method.
+  - `value` is any legal JavaScript value (including undefined, a thenable, or a promise).
+  - `exception` is a value that is thrown using the throw statement.
+  - `reason` is a value that indicates why a promise was rejected.
+  - `settled` the final resting state of a promise, fulfilled or rejected.
+
+  A promise can be in one of three states: pending, fulfilled, or rejected.
+
+  Promises that are fulfilled have a fulfillment value and are in the fulfilled
+  state.  Promises that are rejected have a rejection reason and are in the
+  rejected state.  A fulfillment value is never a thenable.
+
+  Promises can also be said to *resolve* a value.  If this value is also a
+  promise, then the original promise's settled state will match the value's
+  settled state.  So a promise that *resolves* a promise that rejects will
+  itself reject, and a promise that *resolves* a promise that fulfills will
+  itself fulfill.
+
+
+  Basic Usage:
+  ------------
+
+  ```js
+  let promise = new Promise(function(resolve, reject) {
+    // on success
+    resolve(value);
+
+    // on failure
+    reject(reason);
+  });
+
+  promise.then(function(value) {
+    // on fulfillment
+  }, function(reason) {
+    // on rejection
+  });
+  ```
+
+  Advanced Usage:
+  ---------------
+
+  Promises shine when abstracting away asynchronous interactions such as
+  `XMLHttpRequest`s.
+
+  ```js
+  function getJSON(url) {
+    return new Promise(function(resolve, reject){
+      let xhr = new XMLHttpRequest();
+
+      xhr.open('GET', url);
+      xhr.onreadystatechange = handler;
+      xhr.responseType = 'json';
+      xhr.setRequestHeader('Accept', 'application/json');
+      xhr.send();
+
+      function handler() {
+        if (this.readyState === this.DONE) {
+          if (this.status === 200) {
+            resolve(this.response);
+          } else {
+            reject(new Error('getJSON: `' + url + '` failed with status: [' + this.status + ']'));
+          }
+        }
+      };
+    });
+  }
+
+  getJSON('/posts.json').then(function(json) {
+    // on fulfillment
+  }, function(reason) {
+    // on rejection
+  });
+  ```
+
+  Unlike callbacks, promises are great composable primitives.
+
+  ```js
+  Promise.all([
+    getJSON('/posts'),
+    getJSON('/comments')
+  ]).then(function(values){
+    values[0] // => postsJSON
+    values[1] // => commentsJSON
+
+    return values;
+  });
+  ```
+
+  @class Promise
+  @param {Function} resolver
+  Useful for tooling.
+  @constructor
+*/
+
+class Promise {
+  constructor(resolver) {
+    this[PROMISE_ID] = nextId();
+    this._result = this._state = undefined;
+    this._subscribers = [];
+
+    if (noop !== resolver) {
+      typeof resolver !== 'function' && needsResolver();
+      this instanceof Promise ? initializePromise(this, resolver) : needsNew();
+    }
+  }
+
+  /**
+  The primary way of interacting with a promise is through its `then` method,
+  which registers callbacks to receive either a promise's eventual value or the
+  reason why the promise cannot be fulfilled.
+
+  ```js
+  findUser().then(function(user){
+    // user is available
+  }, function(reason){
+    // user is unavailable, and you are given the reason why
+  });
+  ```
+
+  Chaining
+  --------
+
+  The return value of `then` is itself a promise.  This second, 'downstream'
+  promise is resolved with the return value of the first promise's fulfillment
+  or rejection handler, or rejected if the handler throws an exception.
+
+  ```js
+  findUser().then(function (user) {
+    return user.name;
+  }, function (reason) {
+    return 'default name';
+  }).then(function (userName) {
+    // If `findUser` fulfilled, `userName` will be the user's name, otherwise it
+    // will be `'default name'`
+  });
+
+  findUser().then(function (user) {
+    throw new Error('Found user, but still unhappy');
+  }, function (reason) {
+    throw new Error('`findUser` rejected and we're unhappy');
+  }).then(function (value) {
+    // never reached
+  }, function (reason) {
+    // if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.
+    // If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.
+  });
+  ```
+  If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.
+
+  ```js
+  findUser().then(function (user) {
+    throw new PedagogicalException('Upstream error');
+  }).then(function (value) {
+    // never reached
+  }).then(function (value) {
+    // never reached
+  }, function (reason) {
+    // The `PedgagocialException` is propagated all the way down to here
+  });
+  ```
+
+  Assimilation
+  ------------
+
+  Sometimes the value you want to propagate to a downstream promise can only be
+  retrieved asynchronously. This can be achieved by returning a promise in the
+  fulfillment or rejection handler. The downstream promise will then be pending
+  until the returned promise is settled. This is called *assimilation*.
+
+  ```js
+  findUser().then(function (user) {
+    return findCommentsByAuthor(user);
+  }).then(function (comments) {
+    // The user's comments are now available
+  });
+  ```
+
+  If the assimliated promise rejects, then the downstream promise will also reject.
+
+  ```js
+  findUser().then(function (user) {
+    return findCommentsByAuthor(user);
+  }).then(function (comments) {
+    // If `findCommentsByAuthor` fulfills, we'll have the value here
+  }, function (reason) {
+    // If `findCommentsByAuthor` rejects, we'll have the reason here
+  });
+  ```
+
+  Simple Example
+  --------------
+
+  Synchronous Example
+
+  ```javascript
+  let result;
+
+  try {
+    result = findResult();
+    // success
+  } catch(reason) {
+    // failure
+  }
+  ```
+
+  Errback Example
+
+  ```js
+  findResult(function(result, err){
+    if (err) {
+      // failure
+    } else {
+      // success
+    }
+  });
+  ```
+
+  Promise Example;
+
+  ```javascript
+  findResult().then(function(result){
+    // success
+  }, function(reason){
+    // failure
+  });
+  ```
+
+  Advanced Example
+  --------------
+
+  Synchronous Example
+
+  ```javascript
+  let author, books;
+
+  try {
+    author = findAuthor();
+    books  = findBooksByAuthor(author);
+    // success
+  } catch(reason) {
+    // failure
+  }
+  ```
+
+  Errback Example
+
+  ```js
+
+  function foundBooks(books) {
+
+  }
+
+  function failure(reason) {
+
+  }
+
+  findAuthor(function(author, err){
+    if (err) {
+      failure(err);
+      // failure
+    } else {
+      try {
+        findBoooksByAuthor(author, function(books, err) {
+          if (err) {
+            failure(err);
+          } else {
+            try {
+              foundBooks(books);
+            } catch(reason) {
+              failure(reason);
+            }
+          }
+        });
+      } catch(error) {
+        failure(err);
+      }
+      // success
+    }
+  });
+  ```
+
+  Promise Example;
+
+  ```javascript
+  findAuthor().
+    then(findBooksByAuthor).
+    then(function(books){
+      // found books
+  }).catch(function(reason){
+    // something went wrong
+  });
+  ```
+
+  @method then
+  @param {Function} onFulfilled
+  @param {Function} onRejected
+  Useful for tooling.
+  @return {Promise}
+  */
+
+    /**
+  `catch` is simply sugar for `then(undefined, onRejection)` which makes it the same
+  as the catch block of a try/catch statement.
+
+  ```js
+  function findAuthor(){
+    throw new Error('couldn't find that author');
+  }
+
+  // synchronous
+  try {
+    findAuthor();
+  } catch(reason) {
+    // something went wrong
+  }
+
+  // async with promises
+  findAuthor().catch(function(reason){
+    // something went wrong
+  });
+  ```
+
+  @method catch
+  @param {Function} onRejection
+  Useful for tooling.
+  @return {Promise}
+  */
+  catch(onRejection) {
+    return this.then(null, onRejection);
+  }
+
+/**
+  `finally` will be invoked regardless of the promise's fate just as native
+  try/catch/finally behaves
+
+  Synchronous example:
+
+  ```js
+  findAuthor() {
+    if (Math.random() > 0.5) {
+      throw new Error();
+    }
+    return new Author();
+  }
+
+  try {
+    return findAuthor(); // succeed or fail
+  } catch(error) {
+    return findOtherAuther();
+  } finally {
+    // always runs
+    // doesn't affect the return value
+  }
+  ```
+
+  Asynchronous example:
+
+  ```js
+  findAuthor().catch(function(reason){
+    return findOtherAuther();
+  }).finally(function(){
+    // author was either found, or not
+  });
+  ```
+
+  @method finally
+  @param {Function} callback
+  @return {Promise}
+*/
+  finally(callback) {
+    let promise = this;
+    let constructor = promise.constructor;
+
+    return promise.then(value => constructor.resolve(callback()).then(() => value),
+                       reason => constructor.resolve(callback()).then(() => { throw reason; }));
+  }
+}
+
+Promise.prototype.then = then;
+export default Promise;
+Promise.all = all;
+Promise.race = race;
+Promise.resolve = Resolve;
+Promise.reject = Reject;
+Promise._setScheduler = setScheduler;
+Promise._setAsap = setAsap;
+Promise._asap = asap;
+

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/all.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/all.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/all.js
new file mode 100644
index 0000000..9ca3c06
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/all.js
@@ -0,0 +1,52 @@
+import Enumerator from '../enumerator';
+
+/**
+  `Promise.all` accepts an array of promises, and returns a new promise which
+  is fulfilled with an array of fulfillment values for the passed promises, or
+  rejected with the reason of the first passed promise to be rejected. It casts all
+  elements of the passed iterable to promises as it runs this algorithm.
+
+  Example:
+
+  ```javascript
+  let promise1 = resolve(1);
+  let promise2 = resolve(2);
+  let promise3 = resolve(3);
+  let promises = [ promise1, promise2, promise3 ];
+
+  Promise.all(promises).then(function(array){
+    // The array here would be [ 1, 2, 3 ];
+  });
+  ```
+
+  If any of the `promises` given to `all` are rejected, the first promise
+  that is rejected will be given as an argument to the returned promises's
+  rejection handler. For example:
+
+  Example:
+
+  ```javascript
+  let promise1 = resolve(1);
+  let promise2 = reject(new Error("2"));
+  let promise3 = reject(new Error("3"));
+  let promises = [ promise1, promise2, promise3 ];
+
+  Promise.all(promises).then(function(array){
+    // Code here never runs because there are rejected promises!
+  }, function(error) {
+    // error.message === "2"
+  });
+  ```
+
+  @method all
+  @static
+  @param {Array} entries array of promises
+  @param {String} label optional string for labeling the promise.
+  Useful for tooling.
+  @return {Promise} promise that is fulfilled when all `promises` have been
+  fulfilled, or rejected if any of them become rejected.
+  @static
+*/
+export default function all(entries) {
+  return new Enumerator(this, entries).promise;
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/race.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/race.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/race.js
new file mode 100644
index 0000000..166dc82
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/race.js
@@ -0,0 +1,84 @@
+import {
+  isArray
+} from "../utils";
+
+/**
+  `Promise.race` returns a new promise which is settled in the same way as the
+  first passed promise to settle.
+
+  Example:
+
+  ```javascript
+  let promise1 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 1');
+    }, 200);
+  });
+
+  let promise2 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 2');
+    }, 100);
+  });
+
+  Promise.race([promise1, promise2]).then(function(result){
+    // result === 'promise 2' because it was resolved before promise1
+    // was resolved.
+  });
+  ```
+
+  `Promise.race` is deterministic in that only the state of the first
+  settled promise matters. For example, even if other promises given to the
+  `promises` array argument are resolved, but the first settled promise has
+  become rejected before the other promises became fulfilled, the returned
+  promise will become rejected:
+
+  ```javascript
+  let promise1 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 1');
+    }, 200);
+  });
+
+  let promise2 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      reject(new Error('promise 2'));
+    }, 100);
+  });
+
+  Promise.race([promise1, promise2]).then(function(result){
+    // Code here never runs
+  }, function(reason){
+    // reason.message === 'promise 2' because promise 2 became rejected before
+    // promise 1 became fulfilled
+  });
+  ```
+
+  An example real-world use case is implementing timeouts:
+
+  ```javascript
+  Promise.race([ajax('foo.json'), timeout(5000)])
+  ```
+
+  @method race
+  @static
+  @param {Array} promises array of promises to observe
+  Useful for tooling.
+  @return {Promise} a promise which settles in the same way as the first passed
+  promise to settle.
+*/
+export default function race(entries) {
+  /*jshint validthis:true */
+  let Constructor = this;
+
+  if (!isArray(entries)) {
+    return new Constructor((_, reject) => reject(new TypeError('You must pass an array to race.')));
+  } else {
+    return new Constructor((resolve, reject) => {
+      let length = entries.length;
+      for (let i = 0; i < length; i++) {
+        Constructor.resolve(entries[i]).then(resolve, reject);
+      }
+    });
+  }
+}

[02/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/README.md
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/README.md b/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/README.md
deleted file mode 100644
index 6a9df36..0000000
--- a/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/README.md
+++ /dev/null
@@ -1,261 +0,0 @@
-# kind-of [![NPM version](https://img.shields.io/npm/v/kind-of.svg?style=flat)](https://www.npmjs.com/package/kind-of) [![NPM monthly downloads](https://img.shields.io/npm/dm/kind-of.svg?style=flat)](https://npmjs.org/package/kind-of) [![NPM total downloads](https://img.shields.io/npm/dt/kind-of.svg?style=flat)](https://npmjs.org/package/kind-of) [![Linux Build Status](https://img.shields.io/travis/jonschlinkert/kind-of.svg?style=flat&label=Travis)](https://travis-ci.org/jonschlinkert/kind-of)
-
-> Get the native type of a value.
-
-## Install
-
-Install with [npm](https://www.npmjs.com/):
-
-```sh
-$ npm install --save kind-of
-```
-
-## Install
-
-Install with [bower](https://bower.io/)
-
-```sh
-$ bower install kind-of --save
-```
-
-## Usage
-
-> es5, browser and es6 ready
-
-```js
-var kindOf = require('kind-of');
-
-kindOf(undefined);
-//=> 'undefined'
-
-kindOf(null);
-//=> 'null'
-
-kindOf(true);
-//=> 'boolean'
-
-kindOf(false);
-//=> 'boolean'
-
-kindOf(new Boolean(true));
-//=> 'boolean'
-
-kindOf(new Buffer(''));
-//=> 'buffer'
-
-kindOf(42);
-//=> 'number'
-
-kindOf(new Number(42));
-//=> 'number'
-
-kindOf('str');
-//=> 'string'
-
-kindOf(new String('str'));
-//=> 'string'
-
-kindOf(arguments);
-//=> 'arguments'
-
-kindOf({});
-//=> 'object'
-
-kindOf(Object.create(null));
-//=> 'object'
-
-kindOf(new Test());
-//=> 'object'
-
-kindOf(new Date());
-//=> 'date'
-
-kindOf([]);
-//=> 'array'
-
-kindOf([1, 2, 3]);
-//=> 'array'
-
-kindOf(new Array());
-//=> 'array'
-
-kindOf(/foo/);
-//=> 'regexp'
-
-kindOf(new RegExp('foo'));
-//=> 'regexp'
-
-kindOf(function () {});
-//=> 'function'
-
-kindOf(function * () {});
-//=> 'function'
-
-kindOf(new Function());
-//=> 'function'
-
-kindOf(new Map());
-//=> 'map'
-
-kindOf(new WeakMap());
-//=> 'weakmap'
-
-kindOf(new Set());
-//=> 'set'
-
-kindOf(new WeakSet());
-//=> 'weakset'
-
-kindOf(Symbol('str'));
-//=> 'symbol'
-
-kindOf(new Int8Array());
-//=> 'int8array'
-
-kindOf(new Uint8Array());
-//=> 'uint8array'
-
-kindOf(new Uint8ClampedArray());
-//=> 'uint8clampedarray'
-
-kindOf(new Int16Array());
-//=> 'int16array'
-
-kindOf(new Uint16Array());
-//=> 'uint16array'
-
-kindOf(new Int32Array());
-//=> 'int32array'
-
-kindOf(new Uint32Array());
-//=> 'uint32array'
-
-kindOf(new Float32Array());
-//=> 'float32array'
-
-kindOf(new Float64Array());
-//=> 'float64array'
-```
-
-## Benchmarks
-
-Benchmarked against [typeof](http://github.com/CodingFu/typeof) and [type-of](https://github.com/ForbesLindesay/type-of).
-Note that performaces is slower for es6 features `Map`, `WeakMap`, `Set` and `WeakSet`.
-
-```bash
-#1: array
-  current x 23,329,397 ops/sec ±0.82% (94 runs sampled)
-  lib-type-of x 4,170,273 ops/sec ±0.55% (94 runs sampled)
-  lib-typeof x 9,686,935 ops/sec ±0.59% (98 runs sampled)
-
-#2: boolean
-  current x 27,197,115 ops/sec ±0.85% (94 runs sampled)
-  lib-type-of x 3,145,791 ops/sec ±0.73% (97 runs sampled)
-  lib-typeof x 9,199,562 ops/sec ±0.44% (99 runs sampled)
-
-#3: date
-  current x 20,190,117 ops/sec ±0.86% (92 runs sampled)
-  lib-type-of x 5,166,970 ops/sec ±0.74% (94 runs sampled)
-  lib-typeof x 9,610,821 ops/sec ±0.50% (96 runs sampled)
-
-#4: function
-  current x 23,855,460 ops/sec ±0.60% (97 runs sampled)
-  lib-type-of x 5,667,740 ops/sec ±0.54% (100 runs sampled)
-  lib-typeof x 10,010,644 ops/sec ±0.44% (100 runs sampled)
-
-#5: null
-  current x 27,061,047 ops/sec ±0.97% (96 runs sampled)
-  lib-type-of x 13,965,573 ops/sec ±0.62% (97 runs sampled)
-  lib-typeof x 8,460,194 ops/sec ±0.61% (97 runs sampled)
-
-#6: number
-  current x 25,075,682 ops/sec ±0.53% (99 runs sampled)
-  lib-type-of x 2,266,405 ops/sec ±0.41% (98 runs sampled)
-  lib-typeof x 9,821,481 ops/sec ±0.45% (99 runs sampled)
-
-#7: object
-  current x 3,348,980 ops/sec ±0.49% (99 runs sampled)
-  lib-type-of x 3,245,138 ops/sec ±0.60% (94 runs sampled)
-  lib-typeof x 9,262,952 ops/sec ±0.59% (99 runs sampled)
-
-#8: regex
-  current x 21,284,827 ops/sec ±0.72% (96 runs sampled)
-  lib-type-of x 4,689,241 ops/sec ±0.43% (100 runs sampled)
-  lib-typeof x 8,957,593 ops/sec ±0.62% (98 runs sampled)
-
-#9: string
-  current x 25,379,234 ops/sec ±0.58% (96 runs sampled)
-  lib-type-of x 3,635,148 ops/sec ±0.76% (93 runs sampled)
-  lib-typeof x 9,494,134 ops/sec ±0.49% (98 runs sampled)
-
-#10: undef
-  current x 27,459,221 ops/sec ±1.01% (93 runs sampled)
-  lib-type-of x 14,360,433 ops/sec ±0.52% (99 runs sampled)
-  lib-typeof x 23,202,868 ops/sec ±0.59% (94 runs sampled)
-
-```
-
-## Optimizations
-
-In 7 out of 8 cases, this library is 2x-10x faster than other top libraries included in the benchmarks. There are a few things that lead to this performance advantage, none of them hard and fast rules, but all of them simple and repeatable in almost any code library:
-
-1. Optimize around the fastest and most common use cases first. Of course, this will change from project-to-project, but I took some time to understand how and why `typeof` checks were being used in my own libraries and other libraries I use a lot.
-2. Optimize around bottlenecks - In other words, the order in which conditionals are implemented is significant, because each check is only as fast as the failing checks that came before it. Here, the biggest bottleneck by far is checking for plain objects (an object that was created by the `Object` constructor). I opted to make this check happen by process of elimination rather than brute force up front (e.g. by using something like `val.constructor.name`), so that every other type check would not be penalized it.
-3. Don't do uneccessary processing - why do `.slice(8, -1).toLowerCase();` just to get the word `regex`? It's much faster to do `if (type === '[object RegExp]') return 'regex'`
-
-## About
-
-### Related projects
-
-* [is-glob](https://www.npmjs.com/package/is-glob): Returns `true` if the given string looks like a glob pattern or an extglob pattern… [more](https://github.com/jonschlinkert/is-glob) | [homepage](https://github.com/jonschlinkert/is-glob "Returns `true` if the given string looks like a glob pattern or an extglob pattern. This makes it easy to create code that only uses external modules like node-glob when necessary, resulting in much faster code execution and initialization time, and a bet")
-* [is-number](https://www.npmjs.com/package/is-number): Returns true if the value is a number. comprehensive tests. | [homepage](https://github.com/jonschlinkert/is-number "Returns true if the value is a number. comprehensive tests.")
-* [is-primitive](https://www.npmjs.com/package/is-primitive): Returns `true` if the value is a primitive.  | [homepage](https://github.com/jonschlinkert/is-primitive "Returns `true` if the value is a primitive. ")
-
-### Contributing
-
-Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
-
-### Contributors
-
-| **Commits** | **Contributor** | 
-| --- | --- |
-| 59 | [jonschlinkert](https://github.com/jonschlinkert) |
-| 2 | [miguelmota](https://github.com/miguelmota) |
-| 1 | [dtothefp](https://github.com/dtothefp) |
-| 1 | [ksheedlo](https://github.com/ksheedlo) |
-| 1 | [pdehaan](https://github.com/pdehaan) |
-| 1 | [laggingreflex](https://github.com/laggingreflex) |
-
-### Building docs
-
-_(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_
-
-To generate the readme, run the following command:
-
-```sh
-$ npm install -g verbose/verb#dev verb-generate-readme && verb
-```
-
-### Running tests
-
-Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command:
-
-```sh
-$ npm install && npm test
-```
-
-### Author
-
-**Jon Schlinkert**
-
-* [github/jonschlinkert](https://github.com/jonschlinkert)
-* [twitter/jonschlinkert](https://twitter.com/jonschlinkert)
-
-### License
-
-Copyright © 2017, [Jon Schlinkert](https://github.com/jonschlinkert).
-Released under the [MIT License](LICENSE).
-
-***
-
-_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.6.0, on May 16, 2017._
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/index.js
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/index.js b/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/index.js
deleted file mode 100644
index b52c291..0000000
--- a/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/index.js
+++ /dev/null
@@ -1,116 +0,0 @@
-var isBuffer = require('is-buffer');
-var toString = Object.prototype.toString;
-
-/**
- * Get the native `typeof` a value.
- *
- * @param  {*} `val`
- * @return {*} Native javascript type
- */
-
-module.exports = function kindOf(val) {
-  // primitivies
-  if (typeof val === 'undefined') {
-    return 'undefined';
-  }
-  if (val === null) {
-    return 'null';
-  }
-  if (val === true || val === false || val instanceof Boolean) {
-    return 'boolean';
-  }
-  if (typeof val === 'string' || val instanceof String) {
-    return 'string';
-  }
-  if (typeof val === 'number' || val instanceof Number) {
-    return 'number';
-  }
-
-  // functions
-  if (typeof val === 'function' || val instanceof Function) {
-    return 'function';
-  }
-
-  // array
-  if (typeof Array.isArray !== 'undefined' && Array.isArray(val)) {
-    return 'array';
-  }
-
-  // check for instances of RegExp and Date before calling `toString`
-  if (val instanceof RegExp) {
-    return 'regexp';
-  }
-  if (val instanceof Date) {
-    return 'date';
-  }
-
-  // other objects
-  var type = toString.call(val);
-
-  if (type === '[object RegExp]') {
-    return 'regexp';
-  }
-  if (type === '[object Date]') {
-    return 'date';
-  }
-  if (type === '[object Arguments]') {
-    return 'arguments';
-  }
-  if (type === '[object Error]') {
-    return 'error';
-  }
-
-  // buffer
-  if (isBuffer(val)) {
-    return 'buffer';
-  }
-
-  // es6: Map, WeakMap, Set, WeakSet
-  if (type === '[object Set]') {
-    return 'set';
-  }
-  if (type === '[object WeakSet]') {
-    return 'weakset';
-  }
-  if (type === '[object Map]') {
-    return 'map';
-  }
-  if (type === '[object WeakMap]') {
-    return 'weakmap';
-  }
-  if (type === '[object Symbol]') {
-    return 'symbol';
-  }
-
-  // typed arrays
-  if (type === '[object Int8Array]') {
-    return 'int8array';
-  }
-  if (type === '[object Uint8Array]') {
-    return 'uint8array';
-  }
-  if (type === '[object Uint8ClampedArray]') {
-    return 'uint8clampedarray';
-  }
-  if (type === '[object Int16Array]') {
-    return 'int16array';
-  }
-  if (type === '[object Uint16Array]') {
-    return 'uint16array';
-  }
-  if (type === '[object Int32Array]') {
-    return 'int32array';
-  }
-  if (type === '[object Uint32Array]') {
-    return 'uint32array';
-  }
-  if (type === '[object Float32Array]') {
-    return 'float32array';
-  }
-  if (type === '[object Float64Array]') {
-    return 'float64array';
-  }
-
-  // must be a plain object
-  return 'object';
-};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/package.json
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/package.json b/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/package.json
deleted file mode 100644
index 05ec47b..0000000
--- a/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/package.json
+++ /dev/null
@@ -1,143 +0,0 @@
-{
-  "_args": [
-    [
-      "kind-of@3.2.2",
-      "/Users/scottyaslan/Development/nifi-fds/target"
-    ]
-  ],
-  "_development": true,
-  "_from": "kind-of@3.2.2",
-  "_id": "kind-of@3.2.2",
-  "_inBundle": false,
-  "_integrity": "sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ=",
-  "_location": "/randomatic/is-number/kind-of",
-  "_phantomChildren": {},
-  "_requested": {
-    "type": "version",
-    "registry": true,
-    "raw": "kind-of@3.2.2",
-    "name": "kind-of",
-    "escapedName": "kind-of",
-    "rawSpec": "3.2.2",
-    "saveSpec": null,
-    "fetchSpec": "3.2.2"
-  },
-  "_requiredBy": [
-    "/randomatic/is-number"
-  ],
-  "_resolved": "https://registry.npmjs.org/kind-of/-/kind-of-3.2.2.tgz",
-  "_spec": "3.2.2",
-  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
-  "author": {
-    "name": "Jon Schlinkert",
-    "url": "https://github.com/jonschlinkert"
-  },
-  "bugs": {
-    "url": "https://github.com/jonschlinkert/kind-of/issues"
-  },
-  "contributors": [
-    {
-      "name": "David Fox-Powell",
-      "url": "https://dtothefp.github.io/me"
-    },
-    {
-      "name": "Jon Schlinkert",
-      "url": "http://twitter.com/jonschlinkert"
-    },
-    {
-      "name": "Ken Sheedlo",
-      "url": "kensheedlo.com"
-    },
-    {
-      "name": "laggingreflex",
-      "url": "https://github.com/laggingreflex"
-    },
-    {
-      "name": "Miguel Mota",
-      "url": "https://miguelmota.com"
-    },
-    {
-      "name": "Peter deHaan",
-      "url": "http://about.me/peterdehaan"
-    }
-  ],
-  "dependencies": {
-    "is-buffer": "^1.1.5"
-  },
-  "description": "Get the native type of a value.",
-  "devDependencies": {
-    "ansi-bold": "^0.1.1",
-    "benchmarked": "^1.0.0",
-    "browserify": "^14.3.0",
-    "glob": "^7.1.1",
-    "gulp-format-md": "^0.1.12",
-    "mocha": "^3.3.0",
-    "type-of": "^2.0.1",
-    "typeof": "^1.0.0"
-  },
-  "engines": {
-    "node": ">=0.10.0"
-  },
-  "files": [
-    "index.js"
-  ],
-  "homepage": "https://github.com/jonschlinkert/kind-of",
-  "keywords": [
-    "arguments",
-    "array",
-    "boolean",
-    "check",
-    "date",
-    "function",
-    "is",
-    "is-type",
-    "is-type-of",
-    "kind",
-    "kind-of",
-    "number",
-    "object",
-    "of",
-    "regexp",
-    "string",
-    "test",
-    "type",
-    "type-of",
-    "typeof",
-    "types"
-  ],
-  "license": "MIT",
-  "main": "index.js",
-  "name": "kind-of",
-  "repository": {
-    "type": "git",
-    "url": "git+https://github.com/jonschlinkert/kind-of.git"
-  },
-  "scripts": {
-    "prepublish": "browserify -o browser.js -e index.js -s index --bare",
-    "test": "mocha"
-  },
-  "verb": {
-    "related": {
-      "list": [
-        "is-glob",
-        "is-number",
-        "is-primitive"
-      ]
-    },
-    "toc": false,
-    "layout": "default",
-    "tasks": [
-      "readme"
-    ],
-    "plugins": [
-      "gulp-format-md"
-    ],
-    "lint": {
-      "reflinks": true
-    },
-    "reflinks": [
-      "verb"
-    ]
-  },
-  "version": "3.2.2"
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/is-number/package.json
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/is-number/package.json b/node_modules/randomatic/node_modules/is-number/package.json
index a3a74fc..71932e9 100644
--- a/node_modules/randomatic/node_modules/is-number/package.json
+++ b/node_modules/randomatic/node_modules/is-number/package.json
@@ -1,34 +1,32 @@
 {
   "_args": [
     [
-      "is-number@3.0.0",
+      "is-number@4.0.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "is-number@3.0.0",
-  "_id": "is-number@3.0.0",
+  "_from": "is-number@4.0.0",
+  "_id": "is-number@4.0.0",
   "_inBundle": false,
-  "_integrity": "sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU=",
+  "_integrity": "sha512-rSklcAIlf1OmFdyAqbnWTLVelsQ58uvZ66S/ZyawjWqIviTWCjg2PzVGw8WUA+nNuPTqb4wgA+NszrJ+08LlgQ==",
   "_location": "/randomatic/is-number",
-  "_phantomChildren": {
-    "is-buffer": "1.1.6"
-  },
+  "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "is-number@3.0.0",
+    "raw": "is-number@4.0.0",
     "name": "is-number",
     "escapedName": "is-number",
-    "rawSpec": "3.0.0",
+    "rawSpec": "4.0.0",
     "saveSpec": null,
-    "fetchSpec": "3.0.0"
+    "fetchSpec": "4.0.0"
   },
   "_requiredBy": [
     "/randomatic"
   ],
-  "_resolved": "https://registry.npmjs.org/is-number/-/is-number-3.0.0.tgz",
-  "_spec": "3.0.0",
+  "_resolved": "https://registry.npmjs.org/is-number/-/is-number-4.0.0.tgz",
+  "_spec": "4.0.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "Jon Schlinkert",
@@ -39,24 +37,20 @@
   },
   "contributors": [
     {
-      "name": "Charlike Mike Reagent",
-      "url": "http://www.tunnckocore.tk"
-    },
-    {
       "name": "Jon Schlinkert",
-      "email": "jon.schlinkert@sellside.com",
       "url": "http://twitter.com/jonschlinkert"
+    },
+    {
+      "name": "tunnckoCore",
+      "url": "https://i.am.charlike.online"
     }
   ],
-  "dependencies": {
-    "kind-of": "^3.0.2"
-  },
   "description": "Returns true if the value is a number. comprehensive tests.",
   "devDependencies": {
-    "benchmarked": "^0.2.5",
-    "chalk": "^1.1.3",
-    "gulp-format-md": "^0.1.10",
-    "mocha": "^3.0.2"
+    "benchmarked": "^2.0.0",
+    "chalk": "^2.1.0",
+    "gulp-format-md": "^1.0.0",
+    "mocha": "^3.0.1"
   },
   "engines": {
     "node": ">=0.10.0"
@@ -117,11 +111,7 @@
     ],
     "lint": {
       "reflinks": true
-    },
-    "reflinks": [
-      "verb",
-      "verb-generate-readme"
-    ]
+    }
   },
-  "version": "3.0.0"
+  "version": "4.0.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/kind-of/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/kind-of/CHANGELOG.md b/node_modules/randomatic/node_modules/kind-of/CHANGELOG.md
new file mode 100644
index 0000000..fb30b06
--- /dev/null
+++ b/node_modules/randomatic/node_modules/kind-of/CHANGELOG.md
@@ -0,0 +1,157 @@
+# Release history
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](http://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](http://semver.org/spec/v2.0.0.html).
+
+<details>
+  <summary><strong>Guiding Principles</strong></summary>
+
+- Changelogs are for humans, not machines.
+- There should be an entry for every single version.
+- The same types of changes should be grouped.
+- Versions and sections should be linkable.
+- The latest version comes first.
+- The release date of each versions is displayed.
+- Mention whether you follow Semantic Versioning.
+
+</details>
+
+<details>
+  <summary><strong>Types of changes</strong></summary>
+
+Changelog entries are classified using the following labels _(from [keep-a-changelog](http://keepachangelog.com/)_):
+
+- `Added` for new features.
+- `Changed` for changes in existing functionality.
+- `Deprecated` for soon-to-be removed features.
+- `Removed` for now removed features.
+- `Fixed` for any bug fixes.
+- `Security` in case of vulnerabilities.
+
+</details>
+
+## [6.0.0] - 2017-10-13
+
+- refactor code to be more performant
+- refactor benchmarks
+
+## [5.1.0] - 2017-10-13
+
+**Added**
+
+- Merge pull request #15 from aretecode/patch-1
+- adds support and tests for string & array iterators
+
+**Changed**
+
+- updates benchmarks
+
+## [5.0.2] - 2017-08-02
+
+- Merge pull request #14 from struct78/master
+- Added `undefined` check
+
+## [5.0.0] - 2017-06-21
+
+- Merge pull request #12 from aretecode/iterator
+- Set Iterator + Map Iterator
+- streamline `isbuffer`, minor edits
+
+## [4.0.0] - 2017-05-19
+
+- Merge pull request #8 from tunnckoCore/master
+- update deps
+
+## [3.2.2] - 2017-05-16
+
+- fix version
+
+## [3.2.1] - 2017-05-16
+
+- add browserify
+
+## [3.2.0] - 2017-04-25
+
+- Merge pull request #10 from ksheedlo/unrequire-buffer
+- add `promise` support and tests
+- Remove unnecessary `Buffer` check
+
+## [3.1.0] - 2016-12-07
+
+- Merge pull request #7 from laggingreflex/err
+- add support for `error` and tests
+- run update
+
+## [3.0.4] - 2016-07-29
+
+- move tests
+- run update
+
+## [3.0.3] - 2016-05-03
+
+- fix prepublish script
+- remove unused dep
+
+## [3.0.0] - 2015-11-17
+
+- add typed array support
+- Merge pull request #5 from miguelmota/typed-arrays
+- adds new tests
+
+## [2.0.1] - 2015-08-21
+
+- use `is-buffer` module
+
+## [2.0.0] - 2015-05-31
+
+- Create fallback for `Array.isArray` if used as a browser package
+- Merge pull request #2 from dtothefp/patch-1
+- Merge pull request #3 from pdehaan/patch-1
+- Merge branch 'master' of https://github.com/chorks/kind-of into chorks-master
+- optimizations, mostly date and regex
+
+## [1.1.0] - 2015-02-09
+
+- adds `buffer` support
+- adds tests for `buffer`
+
+## [1.0.0] - 2015-01-19
+
+- update benchmarks
+- optimizations based on benchmarks
+
+## [0.1.2] - 2014-10-26
+
+- return `typeof` value if it's not an object. very slight speed improvement
+- use `.slice`
+- adds benchmarks
+
+## [0.1.0] - 2014-9-26
+
+- first commit
+
+[6.0.0]: https://github.com/jonschlinkert/kind-of/compare/5.1.0...6.0.0
+[5.1.0]: https://github.com/jonschlinkert/kind-of/compare/5.0.2...5.1.0
+[5.0.2]: https://github.com/jonschlinkert/kind-of/compare/5.0.1...5.0.2
+[5.0.1]: https://github.com/jonschlinkert/kind-of/compare/5.0.0...5.0.1
+[5.0.0]: https://github.com/jonschlinkert/kind-of/compare/4.0.0...5.0.0
+[4.0.0]: https://github.com/jonschlinkert/kind-of/compare/3.2.2...4.0.0
+[3.2.2]: https://github.com/jonschlinkert/kind-of/compare/3.2.1...3.2.2
+[3.2.1]: https://github.com/jonschlinkert/kind-of/compare/3.2.0...3.2.1
+[3.2.0]: https://github.com/jonschlinkert/kind-of/compare/3.1.0...3.2.0
+[3.1.0]: https://github.com/jonschlinkert/kind-of/compare/3.0.4...3.1.0
+[3.0.4]: https://github.com/jonschlinkert/kind-of/compare/3.0.3...3.0.4
+[3.0.3]: https://github.com/jonschlinkert/kind-of/compare/3.0.0...3.0.3
+[3.0.0]: https://github.com/jonschlinkert/kind-of/compare/2.0.1...3.0.0
+[2.0.1]: https://github.com/jonschlinkert/kind-of/compare/2.0.0...2.0.1
+[2.0.0]: https://github.com/jonschlinkert/kind-of/compare/1.1.0...2.0.0
+[1.1.0]: https://github.com/jonschlinkert/kind-of/compare/1.0.0...1.1.0
+[1.0.0]: https://github.com/jonschlinkert/kind-of/compare/0.1.2...1.0.0
+[0.1.2]: https://github.com/jonschlinkert/kind-of/compare/0.1.0...0.1.2
+[0.1.0]: https://github.com/jonschlinkert/kind-of/commit/2fae09b0b19b1aadb558e9be39f0c3ef6034eb87
+
+[Unreleased]: https://github.com/jonschlinkert/kind-of/compare/0.1.2...HEAD
+[keep-a-changelog]: https://github.com/olivierlacan/keep-a-changelog
+

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/kind-of/LICENSE
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/kind-of/LICENSE b/node_modules/randomatic/node_modules/kind-of/LICENSE
index d734237..3f2eca1 100644
--- a/node_modules/randomatic/node_modules/kind-of/LICENSE
+++ b/node_modules/randomatic/node_modules/kind-of/LICENSE
@@ -1,6 +1,6 @@
 The MIT License (MIT)
 
-Copyright (c) 2014-2017, Jon Schlinkert
+Copyright (c) 2014-2017, Jon Schlinkert.
 
 Permission is hereby granted, free of charge, to any person obtaining a copy
 of this software and associated documentation files (the "Software"), to deal

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/kind-of/README.md
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/kind-of/README.md b/node_modules/randomatic/node_modules/kind-of/README.md
index 83469b0..4b0d4a8 100644
--- a/node_modules/randomatic/node_modules/kind-of/README.md
+++ b/node_modules/randomatic/node_modules/kind-of/README.md
@@ -2,6 +2,8 @@
 
 > Get the native type of a value.
 
+Please consider following this project's author, [Jon Schlinkert](https://github.com/jonschlinkert), and consider starring the project to show your :heart: and support.
+
 ## Install
 
 Install with [npm](https://www.npmjs.com/):
@@ -16,9 +18,14 @@ Install with [bower](https://bower.io/)
 $ bower install kind-of --save
 ```
 
+## Why use this?
+
+1. [it's fast](#benchmarks) | [optimizations](#optimizations)
+2. [better type checking](#better-type-checking)
+
 ## Usage
 
-> es5, browser and es6 ready
+> es5, es6, and browser ready
 
 ```js
 var kindOf = require('kind-of');
@@ -35,24 +42,15 @@ kindOf(true);
 kindOf(false);
 //=> 'boolean'
 
-kindOf(new Boolean(true));
-//=> 'boolean'
-
 kindOf(new Buffer(''));
 //=> 'buffer'
 
 kindOf(42);
 //=> 'number'
 
-kindOf(new Number(42));
-//=> 'number'
-
 kindOf('str');
 //=> 'string'
 
-kindOf(new String('str'));
-//=> 'string'
-
 kindOf(arguments);
 //=> 'arguments'
 
@@ -68,29 +66,26 @@ kindOf(new Test());
 kindOf(new Date());
 //=> 'date'
 
-kindOf([]);
-//=> 'array'
-
 kindOf([1, 2, 3]);
 //=> 'array'
 
-kindOf(new Array());
-//=> 'array'
-
 kindOf(/foo/);
 //=> 'regexp'
 
 kindOf(new RegExp('foo'));
 //=> 'regexp'
 
+kindOf(new Error('error'));
+//=> 'error'
+
 kindOf(function () {});
 //=> 'function'
 
 kindOf(function * () {});
-//=> 'function'
+//=> 'generatorfunction'
 
-kindOf(new Function());
-//=> 'function'
+kindOf(Symbol('str'));
+//=> 'symbol'
 
 kindOf(new Map());
 //=> 'map'
@@ -104,9 +99,6 @@ kindOf(new Set());
 kindOf(new WeakSet());
 //=> 'weakset'
 
-kindOf(Symbol('str'));
-//=> 'symbol'
-
 kindOf(new Int8Array());
 //=> 'int8array'
 
@@ -138,68 +130,114 @@ kindOf(new Float64Array());
 ## Benchmarks
 
 Benchmarked against [typeof](http://github.com/CodingFu/typeof) and [type-of](https://github.com/ForbesLindesay/type-of).
-Note that performaces is slower for es6 features `Map`, `WeakMap`, `Set` and `WeakSet`.
 
 ```bash
-#1: array
-  current x 23,329,397 ops/sec ±0.82% (94 runs sampled)
-  lib-type-of x 4,170,273 ops/sec ±0.55% (94 runs sampled)
-  lib-typeof x 9,686,935 ops/sec ±0.59% (98 runs sampled)
-
-#2: boolean
-  current x 27,197,115 ops/sec ±0.85% (94 runs sampled)
-  lib-type-of x 3,145,791 ops/sec ±0.73% (97 runs sampled)
-  lib-typeof x 9,199,562 ops/sec ±0.44% (99 runs sampled)
-
-#3: date
-  current x 20,190,117 ops/sec ±0.86% (92 runs sampled)
-  lib-type-of x 5,166,970 ops/sec ±0.74% (94 runs sampled)
-  lib-typeof x 9,610,821 ops/sec ±0.50% (96 runs sampled)
-
-#4: function
-  current x 23,855,460 ops/sec ±0.60% (97 runs sampled)
-  lib-type-of x 5,667,740 ops/sec ±0.54% (100 runs sampled)
-  lib-typeof x 10,010,644 ops/sec ±0.44% (100 runs sampled)
-
-#5: null
-  current x 27,061,047 ops/sec ±0.97% (96 runs sampled)
-  lib-type-of x 13,965,573 ops/sec ±0.62% (97 runs sampled)
-  lib-typeof x 8,460,194 ops/sec ±0.61% (97 runs sampled)
-
-#6: number
-  current x 25,075,682 ops/sec ±0.53% (99 runs sampled)
-  lib-type-of x 2,266,405 ops/sec ±0.41% (98 runs sampled)
-  lib-typeof x 9,821,481 ops/sec ±0.45% (99 runs sampled)
-
-#7: object
-  current x 3,348,980 ops/sec ±0.49% (99 runs sampled)
-  lib-type-of x 3,245,138 ops/sec ±0.60% (94 runs sampled)
-  lib-typeof x 9,262,952 ops/sec ±0.59% (99 runs sampled)
-
-#8: regex
-  current x 21,284,827 ops/sec ±0.72% (96 runs sampled)
-  lib-type-of x 4,689,241 ops/sec ±0.43% (100 runs sampled)
-  lib-typeof x 8,957,593 ops/sec ±0.62% (98 runs sampled)
-
-#9: string
-  current x 25,379,234 ops/sec ±0.58% (96 runs sampled)
-  lib-type-of x 3,635,148 ops/sec ±0.76% (93 runs sampled)
-  lib-typeof x 9,494,134 ops/sec ±0.49% (98 runs sampled)
-
-#10: undef
-  current x 27,459,221 ops/sec ±1.01% (93 runs sampled)
-  lib-type-of x 14,360,433 ops/sec ±0.52% (99 runs sampled)
-  lib-typeof x 23,202,868 ops/sec ±0.59% (94 runs sampled)
+# arguments (32 bytes)
+  kind-of x 17,024,098 ops/sec ±1.90% (86 runs sampled)
+  lib-type-of x 11,926,235 ops/sec ±1.34% (83 runs sampled)
+  lib-typeof x 9,245,257 ops/sec ±1.22% (87 runs sampled)
 
-```
+  fastest is kind-of (by 161% avg)
+
+# array (22 bytes)
+  kind-of x 17,196,492 ops/sec ±1.07% (88 runs sampled)
+  lib-type-of x 8,838,283 ops/sec ±1.02% (87 runs sampled)
+  lib-typeof x 8,677,848 ops/sec ±0.87% (87 runs sampled)
+
+  fastest is kind-of (by 196% avg)
+
+# boolean (24 bytes)
+  kind-of x 16,841,600 ops/sec ±1.10% (86 runs sampled)
+  lib-type-of x 8,096,787 ops/sec ±0.95% (87 runs sampled)
+  lib-typeof x 8,423,345 ops/sec ±1.15% (86 runs sampled)
+
+  fastest is kind-of (by 204% avg)
+
+# buffer (38 bytes)
+  kind-of x 14,848,060 ops/sec ±1.05% (86 runs sampled)
+  lib-type-of x 3,671,577 ops/sec ±1.49% (87 runs sampled)
+  lib-typeof x 8,360,236 ops/sec ±1.24% (86 runs sampled)
 
-## Release history
+  fastest is kind-of (by 247% avg)
 
-### v4.0.0
+# date (30 bytes)
+  kind-of x 16,067,761 ops/sec ±1.58% (86 runs sampled)
+  lib-type-of x 8,954,436 ops/sec ±1.40% (87 runs sampled)
+  lib-typeof x 8,488,307 ops/sec ±1.51% (84 runs sampled)
 
-**Added**
+  fastest is kind-of (by 184% avg)
 
-* `promise` support
+# error (36 bytes)
+  kind-of x 9,634,090 ops/sec ±1.12% (89 runs sampled)
+  lib-type-of x 7,735,624 ops/sec ±1.32% (86 runs sampled)
+  lib-typeof x 7,442,160 ops/sec ±1.11% (90 runs sampled)
+
+  fastest is kind-of (by 127% avg)
+
+# function (34 bytes)
+  kind-of x 10,031,494 ops/sec ±1.27% (86 runs sampled)
+  lib-type-of x 9,502,757 ops/sec ±1.17% (89 runs sampled)
+  lib-typeof x 8,278,985 ops/sec ±1.08% (88 runs sampled)
+
+  fastest is kind-of (by 113% avg)
+
+# null (24 bytes)
+  kind-of x 18,159,808 ops/sec ±1.92% (86 runs sampled)
+  lib-type-of x 12,927,635 ops/sec ±1.01% (88 runs sampled)
+  lib-typeof x 7,958,234 ops/sec ±1.21% (89 runs sampled)
+
+  fastest is kind-of (by 174% avg)
+
+# number (22 bytes)
+  kind-of x 17,846,779 ops/sec ±0.91% (85 runs sampled)
+  lib-type-of x 3,316,636 ops/sec ±1.19% (86 runs sampled)
+  lib-typeof x 2,329,477 ops/sec ±2.21% (85 runs sampled)
+
+  fastest is kind-of (by 632% avg)
+
+# object-plain (47 bytes)
+  kind-of x 7,085,155 ops/sec ±1.05% (88 runs sampled)
+  lib-type-of x 8,870,930 ops/sec ±1.06% (83 runs sampled)
+  lib-typeof x 8,716,024 ops/sec ±1.05% (87 runs sampled)
+
+  fastest is lib-type-of (by 112% avg)
+
+# regex (25 bytes)
+  kind-of x 14,196,052 ops/sec ±1.65% (84 runs sampled)
+  lib-type-of x 9,554,164 ops/sec ±1.25% (88 runs sampled)
+  lib-typeof x 8,359,691 ops/sec ±1.07% (87 runs sampled)
+
+  fastest is kind-of (by 158% avg)
+
+# string (33 bytes)
+  kind-of x 16,131,428 ops/sec ±1.41% (85 runs sampled)
+  lib-type-of x 7,273,172 ops/sec ±1.05% (87 runs sampled)
+  lib-typeof x 7,382,635 ops/sec ±1.17% (85 runs sampled)
+
+  fastest is kind-of (by 220% avg)
+
+# symbol (34 bytes)
+  kind-of x 17,011,537 ops/sec ±1.24% (86 runs sampled)
+  lib-type-of x 3,492,454 ops/sec ±1.23% (89 runs sampled)
+  lib-typeof x 7,471,235 ops/sec ±2.48% (87 runs sampled)
+
+  fastest is kind-of (by 310% avg)
+
+# template-strings (36 bytes)
+  kind-of x 15,434,250 ops/sec ±1.46% (83 runs sampled)
+  lib-type-of x 7,157,907 ops/sec ±0.97% (87 runs sampled)
+  lib-typeof x 7,517,986 ops/sec ±0.92% (86 runs sampled)
+
+  fastest is kind-of (by 210% avg)
+
+# undefined (29 bytes)
+  kind-of x 19,167,115 ops/sec ±1.71% (87 runs sampled)
+  lib-type-of x 15,477,740 ops/sec ±1.63% (85 runs sampled)
+  lib-typeof x 19,075,495 ops/sec ±1.17% (83 runs sampled)
+
+  fastest is lib-typeof,kind-of
+
+```
 
 ## Optimizations
 
@@ -208,31 +246,74 @@ In 7 out of 8 cases, this library is 2x-10x faster than other top libraries incl
 1. Optimize around the fastest and most common use cases first. Of course, this will change from project-to-project, but I took some time to understand how and why `typeof` checks were being used in my own libraries and other libraries I use a lot.
 2. Optimize around bottlenecks - In other words, the order in which conditionals are implemented is significant, because each check is only as fast as the failing checks that came before it. Here, the biggest bottleneck by far is checking for plain objects (an object that was created by the `Object` constructor). I opted to make this check happen by process of elimination rather than brute force up front (e.g. by using something like `val.constructor.name`), so that every other type check would not be penalized it.
 3. Don't do uneccessary processing - why do `.slice(8, -1).toLowerCase();` just to get the word `regex`? It's much faster to do `if (type === '[object RegExp]') return 'regex'`
+4. There is no reason to make the code in a microlib as terse as possible, just to win points for making it shorter. It's always better to favor performant code over terse code. You will always only be using a single `require()` statement to use the library anyway, regardless of how the code is written.
 
-## About
+## Better type checking
 
-### Related projects
+kind-of seems to be more consistently "correct" than other type checking libs I've looked at. For example, here are some differing results from other popular libs:
 
-* [is-glob](https://www.npmjs.com/package/is-glob): Returns `true` if the given string looks like a glob pattern or an extglob pattern… [more](https://github.com/jonschlinkert/is-glob) | [homepage](https://github.com/jonschlinkert/is-glob "Returns `true` if the given string looks like a glob pattern or an extglob pattern. This makes it easy to create code that only uses external modules like node-glob when necessary, resulting in much faster code execution and initialization time, and a bet")
-* [is-number](https://www.npmjs.com/package/is-number): Returns true if the value is a number. comprehensive tests. | [homepage](https://github.com/jonschlinkert/is-number "Returns true if the value is a number. comprehensive tests.")
-* [is-primitive](https://www.npmjs.com/package/is-primitive): Returns `true` if the value is a primitive.  | [homepage](https://github.com/jonschlinkert/is-primitive "Returns `true` if the value is a primitive. ")
+### [typeof](https://github.com/CodingFu/typeof) lib
+
+Incorrectly identifies instances of custom constructors (pretty common):
 
-### Contributing
+```js
+var typeOf = require('typeof');
+function Test() {}
+console.log(typeOf(new Test()));
+//=> 'test'
+```
+
+Returns `object` instead of `arguments`:
+
+```js
+function foo() {
+  console.log(typeOf(arguments)) //=> 'object'
+}
+foo();
+```
+
+### [type-of](https://github.com/ForbesLindesay/type-of) lib
+
+Incorrectly returns `object` for generator functions, buffers, `Map`, `Set`, `WeakMap` and `WeakSet`:
+
+```js
+function * foo() {}
+console.log(typeOf(foo));
+//=> 'object'
+console.log(typeOf(new Buffer('')));
+//=> 'object'
+console.log(typeOf(new Map()));
+//=> 'object'
+console.log(typeOf(new Set()));
+//=> 'object'
+console.log(typeOf(new WeakMap()));
+//=> 'object'
+console.log(typeOf(new WeakSet()));
+//=> 'object'
+```
+
+## About
+
+<details>
+<summary><strong>Contributing</strong></summary>
 
 Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
 
-### Contributors
+</details>
 
-| **Commits** | **Contributor** | 
-| --- | --- |
-| 64 | [jonschlinkert](https://github.com/jonschlinkert) |
-| 2 | [miguelmota](https://github.com/miguelmota) |
-| 1 | [dtothefp](https://github.com/dtothefp) |
-| 1 | [ksheedlo](https://github.com/ksheedlo) |
-| 1 | [pdehaan](https://github.com/pdehaan) |
-| 1 | [laggingreflex](https://github.com/laggingreflex) |
+<details>
+<summary><strong>Running Tests</strong></summary>
+
+Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command:
+
+```sh
+$ npm install && npm test
+```
 
-### Building docs
+</details>
+
+<details>
+<summary><strong>Building docs</strong></summary>
 
 _(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_
 
@@ -242,18 +323,35 @@ To generate the readme, run the following command:
 $ npm install -g verbose/verb#dev verb-generate-readme && verb
 ```
 
-### Running tests
+</details>
 
-Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command:
+### Related projects
 
-```sh
-$ npm install && npm test
-```
+You might also be interested in these projects:
+
+* [is-glob](https://www.npmjs.com/package/is-glob): Returns `true` if the given string looks like a glob pattern or an extglob pattern… [more](https://github.com/jonschlinkert/is-glob) | [homepage](https://github.com/jonschlinkert/is-glob "Returns `true` if the given string looks like a glob pattern or an extglob pattern. This makes it easy to create code that only uses external modules like node-glob when necessary, resulting in much faster code execution and initialization time, and a bet")
+* [is-number](https://www.npmjs.com/package/is-number): Returns true if the value is a number. comprehensive tests. | [homepage](https://github.com/jonschlinkert/is-number "Returns true if the value is a number. comprehensive tests.")
+* [is-primitive](https://www.npmjs.com/package/is-primitive): Returns `true` if the value is a primitive.  | [homepage](https://github.com/jonschlinkert/is-primitive "Returns `true` if the value is a primitive. ")
+
+### Contributors
+
+| **Commits** | **Contributor** | 
+| --- | --- |
+| 98 | [jonschlinkert](https://github.com/jonschlinkert) |
+| 3 | [aretecode](https://github.com/aretecode) |
+| 2 | [miguelmota](https://github.com/miguelmota) |
+| 1 | [dtothefp](https://github.com/dtothefp) |
+| 1 | [ianstormtaylor](https://github.com/ianstormtaylor) |
+| 1 | [ksheedlo](https://github.com/ksheedlo) |
+| 1 | [pdehaan](https://github.com/pdehaan) |
+| 1 | [laggingreflex](https://github.com/laggingreflex) |
+| 1 | [charlike-old](https://github.com/charlike-old) |
 
 ### Author
 
 **Jon Schlinkert**
 
+* [linkedin/in/jonschlinkert](https://linkedin.com/in/jonschlinkert)
 * [github/jonschlinkert](https://github.com/jonschlinkert)
 * [twitter/jonschlinkert](https://twitter.com/jonschlinkert)
 
@@ -264,4 +362,4 @@ Released under the [MIT License](LICENSE).
 
 ***
 
-_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.6.0, on May 19, 2017._
\ No newline at end of file
+_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.6.0, on December 01, 2017._
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/kind-of/index.js
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/kind-of/index.js b/node_modules/randomatic/node_modules/kind-of/index.js
index 4c0233b..aa2bb39 100644
--- a/node_modules/randomatic/node_modules/kind-of/index.js
+++ b/node_modules/randomatic/node_modules/kind-of/index.js
@@ -1,119 +1,129 @@
-var isBuffer = require('is-buffer');
 var toString = Object.prototype.toString;
 
-/**
- * Get the native `typeof` a value.
- *
- * @param  {*} `val`
- * @return {*} Native javascript type
- */
-
 module.exports = function kindOf(val) {
-  // primitivies
-  if (typeof val === 'undefined') {
-    return 'undefined';
-  }
-  if (val === null) {
-    return 'null';
-  }
-  if (val === true || val === false || val instanceof Boolean) {
-    return 'boolean';
-  }
-  if (typeof val === 'string' || val instanceof String) {
-    return 'string';
-  }
-  if (typeof val === 'number' || val instanceof Number) {
-    return 'number';
-  }
+  if (val === void 0) return 'undefined';
+  if (val === null) return 'null';
 
-  // functions
-  if (typeof val === 'function' || val instanceof Function) {
-    return 'function';
+  var type = typeof val;
+  if (type === 'boolean') return 'boolean';
+  if (type === 'string') return 'string';
+  if (type === 'number') return 'number';
+  if (type === 'symbol') return 'symbol';
+  if (type === 'function') {
+    return isGeneratorFn(val) ? 'generatorfunction' : 'function';
   }
 
-  // array
-  if (typeof Array.isArray !== 'undefined' && Array.isArray(val)) {
-    return 'array';
-  }
+  if (isArray(val)) return 'array';
+  if (isBuffer(val)) return 'buffer';
+  if (isArguments(val)) return 'arguments';
+  if (isDate(val)) return 'date';
+  if (isError(val)) return 'error';
+  if (isRegexp(val)) return 'regexp';
 
-  // check for instances of RegExp and Date before calling `toString`
-  if (val instanceof RegExp) {
-    return 'regexp';
-  }
-  if (val instanceof Date) {
-    return 'date';
-  }
+  switch (ctorName(val)) {
+    case 'Symbol': return 'symbol';
+    case 'Promise': return 'promise';
 
-  // other objects
-  var type = toString.call(val);
+    // Set, Map, WeakSet, WeakMap
+    case 'WeakMap': return 'weakmap';
+    case 'WeakSet': return 'weakset';
+    case 'Map': return 'map';
+    case 'Set': return 'set';
 
-  if (type === '[object RegExp]') {
-    return 'regexp';
-  }
-  if (type === '[object Date]') {
-    return 'date';
-  }
-  if (type === '[object Arguments]') {
-    return 'arguments';
-  }
-  if (type === '[object Error]') {
-    return 'error';
-  }
-  if (type === '[object Promise]') {
-    return 'promise';
-  }
+    // 8-bit typed arrays
+    case 'Int8Array': return 'int8array';
+    case 'Uint8Array': return 'uint8array';
+    case 'Uint8ClampedArray': return 'uint8clampedarray';
 
-  // buffer
-  if (isBuffer(val)) {
-    return 'buffer';
-  }
+    // 16-bit typed arrays
+    case 'Int16Array': return 'int16array';
+    case 'Uint16Array': return 'uint16array';
 
-  // es6: Map, WeakMap, Set, WeakSet
-  if (type === '[object Set]') {
-    return 'set';
-  }
-  if (type === '[object WeakSet]') {
-    return 'weakset';
-  }
-  if (type === '[object Map]') {
-    return 'map';
-  }
-  if (type === '[object WeakMap]') {
-    return 'weakmap';
-  }
-  if (type === '[object Symbol]') {
-    return 'symbol';
+    // 32-bit typed arrays
+    case 'Int32Array': return 'int32array';
+    case 'Uint32Array': return 'uint32array';
+    case 'Float32Array': return 'float32array';
+    case 'Float64Array': return 'float64array';
   }
 
-  // typed arrays
-  if (type === '[object Int8Array]') {
-    return 'int8array';
+  if (isGeneratorObj(val)) {
+    return 'generator';
   }
-  if (type === '[object Uint8Array]') {
-    return 'uint8array';
-  }
-  if (type === '[object Uint8ClampedArray]') {
-    return 'uint8clampedarray';
-  }
-  if (type === '[object Int16Array]') {
-    return 'int16array';
-  }
-  if (type === '[object Uint16Array]') {
-    return 'uint16array';
-  }
-  if (type === '[object Int32Array]') {
-    return 'int32array';
-  }
-  if (type === '[object Uint32Array]') {
-    return 'uint32array';
-  }
-  if (type === '[object Float32Array]') {
-    return 'float32array';
-  }
-  if (type === '[object Float64Array]') {
-    return 'float64array';
+
+  // Non-plain objects
+  type = toString.call(val);
+  switch (type) {
+    case '[object Object]': return 'object';
+    // iterators
+    case '[object Map Iterator]': return 'mapiterator';
+    case '[object Set Iterator]': return 'setiterator';
+    case '[object String Iterator]': return 'stringiterator';
+    case '[object Array Iterator]': return 'arrayiterator';
   }
 
-  // must be a plain object
-  return 'object';
+  // other
+  return type.slice(8, -1).toLowerCase().replace(/\s/g, '');
 };
+
+function ctorName(val) {
+  return val.constructor ? val.constructor.name : null;
+}
+
+function isArray(val) {
+  if (Array.isArray) return Array.isArray(val);
+  return val instanceof Array;
+}
+
+function isError(val) {
+  return val instanceof Error || (typeof val.message === 'string' && val.constructor && typeof val.constructor.stackTraceLimit === 'number');
+}
+
+function isDate(val) {
+  if (val instanceof Date) return true;
+  return typeof val.toDateString === 'function'
+    && typeof val.getDate === 'function'
+    && typeof val.setDate === 'function';
+}
+
+function isRegexp(val) {
+  if (val instanceof RegExp) return true;
+  return typeof val.flags === 'string'
+    && typeof val.ignoreCase === 'boolean'
+    && typeof val.multiline === 'boolean'
+    && typeof val.global === 'boolean';
+}
+
+function isGeneratorFn(name, val) {
+  return ctorName(name) === 'GeneratorFunction';
+}
+
+function isGeneratorObj(val) {
+  return typeof val.throw === 'function'
+    && typeof val.return === 'function'
+    && typeof val.next === 'function';
+}
+
+function isArguments(val) {
+  try {
+    if (typeof val.length === 'number' && typeof val.callee === 'function') {
+      return true;
+    }
+  } catch (err) {
+    if (err.message.indexOf('callee') !== -1) {
+      return true;
+    }
+  }
+  return false;
+}
+
+/**
+ * If you need to support Safari 5-7 (8-10 yr-old browser),
+ * take a look at https://github.com/feross/is-buffer
+ */
+
+function isBuffer(val) {
+  if (val.constructor && typeof val.constructor.isBuffer === 'function') {
+    return val.constructor.isBuffer(val);
+  }
+  return false;
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/kind-of/package.json
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/kind-of/package.json b/node_modules/randomatic/node_modules/kind-of/package.json
index 98cd539..774d3ac 100644
--- a/node_modules/randomatic/node_modules/kind-of/package.json
+++ b/node_modules/randomatic/node_modules/kind-of/package.json
@@ -1,32 +1,32 @@
 {
   "_args": [
     [
-      "kind-of@4.0.0",
+      "kind-of@6.0.2",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "kind-of@4.0.0",
-  "_id": "kind-of@4.0.0",
+  "_from": "kind-of@6.0.2",
+  "_id": "kind-of@6.0.2",
   "_inBundle": false,
-  "_integrity": "sha1-IIE989cSkosgc3hpGkUGb65y3Vc=",
+  "_integrity": "sha512-s5kLOcnH0XqDO+FvuaLX8DDjZ18CGFk7VygH40QoKPUQhW4e2rvM0rwUq0t8IQDOwYSeLK01U90OjzBTme2QqA==",
   "_location": "/randomatic/kind-of",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "kind-of@4.0.0",
+    "raw": "kind-of@6.0.2",
     "name": "kind-of",
     "escapedName": "kind-of",
-    "rawSpec": "4.0.0",
+    "rawSpec": "6.0.2",
     "saveSpec": null,
-    "fetchSpec": "4.0.0"
+    "fetchSpec": "6.0.2"
   },
   "_requiredBy": [
     "/randomatic"
   ],
-  "_resolved": "https://registry.npmjs.org/kind-of/-/kind-of-4.0.0.tgz",
-  "_spec": "4.0.0",
+  "_resolved": "https://registry.npmjs.org/kind-of/-/kind-of-6.0.2.tgz",
+  "_spec": "6.0.2",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "Jon Schlinkert",
@@ -41,6 +41,10 @@
       "url": "https://dtothefp.github.io/me"
     },
     {
+      "name": "James",
+      "url": "https://twitter.com/aretecode"
+    },
+    {
       "name": "Jon Schlinkert",
       "url": "http://twitter.com/jonschlinkert"
     },
@@ -59,21 +63,19 @@
     {
       "name": "Peter deHaan",
       "url": "http://about.me/peterdehaan"
+    },
+    {
+      "name": "tunnckoCore",
+      "url": "https://i.am.charlike.online"
     }
   ],
-  "dependencies": {
-    "is-buffer": "^1.1.5"
-  },
   "description": "Get the native type of a value.",
   "devDependencies": {
-    "ansi-bold": "^0.1.1",
-    "benchmarked": "^1.1.1",
-    "browserify": "^14.3.0",
-    "glob": "^7.1.1",
-    "gulp-format-md": "^0.1.12",
-    "mocha": "^3.4.1",
-    "type-of": "^2.0.1",
-    "typeof": "^1.0.0"
+    "benchmarked": "^2.0.0",
+    "browserify": "^14.4.0",
+    "gulp-format-md": "^1.0.0",
+    "mocha": "^4.0.1",
+    "write": "^1.0.3"
   },
   "engines": {
     "node": ">=0.10.0"
@@ -117,13 +119,6 @@
     "test": "mocha"
   },
   "verb": {
-    "related": {
-      "list": [
-        "is-glob",
-        "is-number",
-        "is-primitive"
-      ]
-    },
     "toc": false,
     "layout": "default",
     "tasks": [
@@ -135,9 +130,18 @@
     "lint": {
       "reflinks": true
     },
+    "related": {
+      "list": [
+        "is-glob",
+        "is-number",
+        "is-primitive"
+      ]
+    },
     "reflinks": [
+      "type-of",
+      "typeof",
       "verb"
     ]
   },
-  "version": "4.0.0"
+  "version": "6.0.2"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/package.json
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/package.json b/node_modules/randomatic/package.json
index 7b5a3b5..cf8a5fa 100644
--- a/node_modules/randomatic/package.json
+++ b/node_modules/randomatic/package.json
@@ -1,34 +1,32 @@
 {
   "_args": [
     [
-      "randomatic@1.1.7",
+      "randomatic@3.0.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "randomatic@1.1.7",
-  "_id": "randomatic@1.1.7",
+  "_from": "randomatic@3.0.0",
+  "_id": "randomatic@3.0.0",
   "_inBundle": false,
-  "_integrity": "sha512-D5JUjPyJbaJDkuAazpVnSfVkLlpeO3wDlPROTMLGKG1zMFNFRgrciKo1ltz/AzNTkqE0HzDx655QOL51N06how==",
+  "_integrity": "sha512-VdxFOIEY3mNO5PtSRkkle/hPJDHvQhK21oa73K4yAc9qmp6N429gAyF1gZMOTMeS0/AYzaV/2Trcef+NaIonSA==",
   "_location": "/randomatic",
-  "_phantomChildren": {
-    "is-buffer": "1.1.6"
-  },
+  "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "randomatic@1.1.7",
+    "raw": "randomatic@3.0.0",
     "name": "randomatic",
     "escapedName": "randomatic",
-    "rawSpec": "1.1.7",
+    "rawSpec": "3.0.0",
     "saveSpec": null,
-    "fetchSpec": "1.1.7"
+    "fetchSpec": "3.0.0"
   },
   "_requiredBy": [
     "/fill-range"
   ],
-  "_resolved": "https://registry.npmjs.org/randomatic/-/randomatic-1.1.7.tgz",
-  "_spec": "1.1.7",
+  "_resolved": "https://registry.npmjs.org/randomatic/-/randomatic-3.0.0.tgz",
+  "_spec": "3.0.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "Jon Schlinkert",
@@ -47,30 +45,42 @@
       "url": "http://dragosfotescu.com"
     },
     {
+      "name": "Faiz ul haque",
+      "url": "http://www.10pearls.com"
+    },
+    {
       "name": "Jon Schlinkert",
       "url": "http://twitter.com/jonschlinkert"
     },
     {
+      "name": "Michael Rhodes",
+      "url": "http://michaelrhod.es"
+    },
+    {
       "name": "Paul Miller",
-      "url": "paulmillr.com"
+      "url": "https://paulmillr.com"
+    },
+    {
+      "name": "Rouven Weßling",
+      "url": "www.rouvenwessling.de"
     },
     {
       "name": "Sun Knudsen",
-      "url": "http://sunknudsen.com"
+      "url": "https://sunknudsen.com"
     }
   ],
   "dependencies": {
-    "is-number": "^3.0.0",
-    "kind-of": "^4.0.0"
+    "is-number": "^4.0.0",
+    "kind-of": "^6.0.0",
+    "math-random": "^1.0.1"
   },
-  "description": "Generate randomized strings of a specified length, fast. Only the length is necessary, but you can optionally generate patterns using any combination of numeric, alpha-numeric, alphabetical, special or custom characters.",
+  "description": "Generate randomized strings of a specified length using simple character sequences. The original generate-password.",
   "devDependencies": {
     "ansi-bold": "^0.1.1",
     "benchmarked": "^1.1.1",
     "glob": "^7.1.2",
     "gulp-format-md": "^0.1.12",
-    "mocha": "^3.4.2",
-    "should": "^11.2.1"
+    "mocha": "^3.4.2"
   },
   "engines": {
     "node": ">= 0.10.0"
@@ -85,7 +95,10 @@
     "alphanumeric",
     "characters",
     "chars",
+    "generate",
+    "generate-password",
     "numeric",
+    "password",
     "rand",
     "random",
     "randomatic",
@@ -120,11 +133,7 @@
     },
     "lint": {
       "reflinks": true
-    },
-    "reflinks": [
-      "verb",
-      "verb-generate-readme"
-    ]
+    }
   },
-  "version": "1.1.7"
+  "version": "3.0.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/safe-buffer/package.json
----------------------------------------------------------------------
diff --git a/node_modules/safe-buffer/package.json b/node_modules/safe-buffer/package.json
index 19ce7df..2a84356 100644
--- a/node_modules/safe-buffer/package.json
+++ b/node_modules/safe-buffer/package.json
@@ -26,6 +26,8 @@
     "/amqplib",
     "/bl",
     "/karma",
+    "/loggly/tunnel-agent",
+    "/node-sass/tunnel-agent",
     "/readable-stream",
     "/request",
     "/string_decoder",

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io-client/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/socket.io-client/node_modules/debug/.eslintrc b/node_modules/socket.io-client/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/socket.io-client/node_modules/debug/.eslintrc
+++ b/node_modules/socket.io-client/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io-client/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/socket.io-client/node_modules/debug/.travis.yml b/node_modules/socket.io-client/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/socket.io-client/node_modules/debug/.travis.yml
+++ b/node_modules/socket.io-client/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io-client/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/socket.io-client/node_modules/debug/CHANGELOG.md b/node_modules/socket.io-client/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/socket.io-client/node_modules/debug/CHANGELOG.md
+++ b/node_modules/socket.io-client/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io-client/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/socket.io-client/node_modules/debug/Makefile b/node_modules/socket.io-client/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/socket.io-client/node_modules/debug/Makefile
+++ b/node_modules/socket.io-client/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io-client/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/socket.io-client/node_modules/debug/README.md b/node_modules/socket.io-client/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/socket.io-client/node_modules/debug/README.md
+++ b/node_modules/socket.io-client/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io-client/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/socket.io-client/node_modules/debug/component.json b/node_modules/socket.io-client/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/socket.io-client/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io-client/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/socket.io-client/node_modules/debug/package.json b/node_modules/socket.io-client/node_modules/debug/package.json
index 90fd2cd..0c85e53 100644
--- a/node_modules/socket.io-client/node_modules/debug/package.json
+++ b/node_modules/socket.io-client/node_modules/debug/package.json
@@ -1,32 +1,32 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/socket.io-client/debug",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/socket.io-client"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -36,12 +36,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -58,7 +52,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -88,5 +82,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/socket.io/node_modules/debug/.eslintrc b/node_modules/socket.io/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/socket.io/node_modules/debug/.eslintrc
+++ b/node_modules/socket.io/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/socket.io/node_modules/debug/.travis.yml b/node_modules/socket.io/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/socket.io/node_modules/debug/.travis.yml
+++ b/node_modules/socket.io/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/socket.io/node_modules/debug/CHANGELOG.md b/node_modules/socket.io/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/socket.io/node_modules/debug/CHANGELOG.md
+++ b/node_modules/socket.io/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/socket.io/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/socket.io/node_modules/debug/Makefile b/node_modules/socket.io/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/socket.io/node_modules/debug/Makefile
+++ b/node_modules/socket.io/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

[04/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/History.md
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/History.md b/node_modules/mailgun-js/node_modules/debug/History.md
deleted file mode 100644
index 854c971..0000000
--- a/node_modules/mailgun-js/node_modules/debug/History.md
+++ /dev/null
@@ -1,195 +0,0 @@
-
-2.2.0 / 2015-05-09
-==================
-
-  * package: update "ms" to v0.7.1 (#202, @dougwilson)
-  * README: add logging to file example (#193, @DanielOchoa)
-  * README: fixed a typo (#191, @amir-s)
-  * browser: expose `storage` (#190, @stephenmathieson)
-  * Makefile: add a `distclean` target (#189, @stephenmathieson)
-
-2.1.3 / 2015-03-13
-==================
-
-  * Updated stdout/stderr example (#186)
-  * Updated example/stdout.js to match debug current behaviour
-  * Renamed example/stderr.js to stdout.js
-  * Update Readme.md (#184)
-  * replace high intensity foreground color for bold (#182, #183)
-
-2.1.2 / 2015-03-01
-==================
-
-  * dist: recompile
-  * update "ms" to v0.7.0
-  * package: update "browserify" to v9.0.3
-  * component: fix "ms.js" repo location
-  * changed bower package name
-  * updated documentation about using debug in a browser
-  * fix: security error on safari (#167, #168, @yields)
-
-2.1.1 / 2014-12-29
-==================
-
-  * browser: use `typeof` to check for `console` existence
-  * browser: check for `console.log` truthiness (fix IE 8/9)
-  * browser: add support for Chrome apps
-  * Readme: added Windows usage remarks
-  * Add `bower.json` to properly support bower install
-
-2.1.0 / 2014-10-15
-==================
-
-  * node: implement `DEBUG_FD` env variable support
-  * package: update "browserify" to v6.1.0
-  * package: add "license" field to package.json (#135, @panuhorsmalahti)
-
-2.0.0 / 2014-09-01
-==================
-
-  * package: update "browserify" to v5.11.0
-  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
-
-1.0.4 / 2014-07-15
-==================
-
-  * dist: recompile
-  * example: remove `console.info()` log usage
-  * example: add "Content-Type" UTF-8 header to browser example
-  * browser: place %c marker after the space character
-  * browser: reset the "content" color via `color: inherit`
-  * browser: add colors support for Firefox >= v31
-  * debug: prefer an instance `log()` function over the global one (#119)
-  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
-
-1.0.3 / 2014-07-09
-==================
-
-  * Add support for multiple wildcards in namespaces (#122, @seegno)
-  * browser: fix lint
-
-1.0.2 / 2014-06-10
-==================
-
-  * browser: update color palette (#113, @gscottolson)
-  * common: make console logging function configurable (#108, @timoxley)
-  * node: fix %o colors on old node <= 0.8.x
-  * Makefile: find node path using shell/which (#109, @timoxley)
-
-1.0.1 / 2014-06-06
-==================
-
-  * browser: use `removeItem()` to clear localStorage
-  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
-  * package: add "contributors" section
-  * node: fix comment typo
-  * README: list authors
-
-1.0.0 / 2014-06-04
-==================
-
-  * make ms diff be global, not be scope
-  * debug: ignore empty strings in enable()
-  * node: make DEBUG_COLORS able to disable coloring
-  * *: export the `colors` array
-  * npmignore: don't publish the `dist` dir
-  * Makefile: refactor to use browserify
-  * package: add "browserify" as a dev dependency
-  * Readme: add Web Inspector Colors section
-  * node: reset terminal color for the debug content
-  * node: map "%o" to `util.inspect()`
-  * browser: map "%j" to `JSON.stringify()`
-  * debug: add custom "formatters"
-  * debug: use "ms" module for humanizing the diff
-  * Readme: add "bash" syntax highlighting
-  * browser: add Firebug color support
-  * browser: add colors for WebKit browsers
-  * node: apply log to `console`
-  * rewrite: abstract common logic for Node & browsers
-  * add .jshintrc file
-
-0.8.1 / 2014-04-14
-==================
-
-  * package: re-add the "component" section
-
-0.8.0 / 2014-03-30
-==================
-
-  * add `enable()` method for nodejs. Closes #27
-  * change from stderr to stdout
-  * remove unnecessary index.js file
-
-0.7.4 / 2013-11-13
-==================
-
-  * remove "browserify" key from package.json (fixes something in browserify)
-
-0.7.3 / 2013-10-30
-==================
-
-  * fix: catch localStorage security error when cookies are blocked (Chrome)
-  * add debug(err) support. Closes #46
-  * add .browser prop to package.json. Closes #42
-
-0.7.2 / 2013-02-06
-==================
-
-  * fix package.json
-  * fix: Mobile Safari (private mode) is broken with debug
-  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
-
-0.7.1 / 2013-02-05
-==================
-
-  * add repository URL to package.json
-  * add DEBUG_COLORED to force colored output
-  * add browserify support
-  * fix component. Closes #24
-
-0.7.0 / 2012-05-04
-==================
-
-  * Added .component to package.json
-  * Added debug.component.js build
-
-0.6.0 / 2012-03-16
-==================
-
-  * Added support for "-" prefix in DEBUG [Vinay Pulim]
-  * Added `.enabled` flag to the node version [TooTallNate]
-
-0.5.0 / 2012-02-02
-==================
-
-  * Added: humanize diffs. Closes #8
-  * Added `debug.disable()` to the CS variant
-  * Removed padding. Closes #10
-  * Fixed: persist client-side variant again. Closes #9
-
-0.4.0 / 2012-02-01
-==================
-
-  * Added browser variant support for older browsers [TooTallNate]
-  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
-  * Added padding to diff (moved it to the right)
-
-0.3.0 / 2012-01-26
-==================
-
-  * Added millisecond diff when isatty, otherwise UTC string
-
-0.2.0 / 2012-01-22
-==================
-
-  * Added wildcard support
-
-0.1.0 / 2011-12-02
-==================
-
-  * Added: remove colors unless stderr isatty [TooTallNate]
-
-0.0.1 / 2010-01-03
-==================
-
-  * Initial release

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/LICENSE
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/LICENSE b/node_modules/mailgun-js/node_modules/debug/LICENSE
new file mode 100644
index 0000000..658c933
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj...@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
+and associated documentation files (the 'Software'), to deal in the Software without restriction, 
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial 
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/Makefile b/node_modules/mailgun-js/node_modules/debug/Makefile
index 5cf4a59..3ddd136 100644
--- a/node_modules/mailgun-js/node_modules/debug/Makefile
+++ b/node_modules/mailgun-js/node_modules/debug/Makefile
@@ -1,4 +1,3 @@
-
 # get Makefile directory name: http://stackoverflow.com/a/5982798/376773
 THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
 THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
@@ -6,31 +5,54 @@ THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
 # BIN directory
 BIN := $(THIS_DIR)/node_modules/.bin
 
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
 # applications
 NODE ?= $(shell which node)
-NPM ?= $(NODE) $(shell which npm)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-all: dist/debug.js
-
 install: node_modules
 
-clean:
-	@rm -rf dist
+browser: dist/debug.js
 
-dist:
-	@mkdir -p $@
+node_modules: package.json
+	@NODE_ENV= $(PKG) install
+	@touch node_modules
 
-dist/debug.js: node_modules browser.js debug.js dist
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
-		. > $@
+		. > dist/debug.js
 
-distclean: clean
-	@rm -rf node_modules
+lint:
+	@eslint *.js src/*.js
 
-node_modules: package.json
-	@NODE_ENV= $(NPM) install
-	@touch node_modules
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
+		"make test-node" \
+		"make test-browser"
+
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/Readme.md
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/Readme.md b/node_modules/mailgun-js/node_modules/debug/Readme.md
index b4f45e3..8e754d1 100644
--- a/node_modules/mailgun-js/node_modules/debug/Readme.md
+++ b/node_modules/mailgun-js/node_modules/debug/Readme.md
@@ -1,6 +1,11 @@
 # debug
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
-  tiny node.js debugging utility modelled after node core's debugging technique.
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -10,9 +15,9 @@ $ npm install debug
 
 ## Usage
 
- With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility.
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -21,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -35,67 +40,173 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
- If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
-## Browser support
 
-  Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include:
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
-window.myDebug = require("debug");
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-  ("debug" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console:
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
-myDebug.enable("worker:*")
+localStorage.debug = 'worker:*'
 ```
 
-  Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console.
+And then refresh the page.
 
 ```js
 a = debug('worker:a');
@@ -110,22 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
 
-  Colored output looks something like:
+## Output streams
 
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-### stderr vs stdout
-
-You can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally:
-
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -147,26 +248,105 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
-### Save debug output to a file
+## Checking whether a debug target is enabled
 
-You can save all debug statements to a file by piping them.
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
 
-Example:
+```javascript
+const debug = require('debug')('http');
 
-```bash
-$ DEBUG_FD=3 node your-app.js 3> whatever.log
+if (debug.enabled) {
+  // do stuff...
+}
 ```
 
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
 
 ## License
 
 (The MIT License)
 
-Copyright (c) 2014 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/bower.json
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/bower.json b/node_modules/mailgun-js/node_modules/debug/bower.json
deleted file mode 100644
index 6af573f..0000000
--- a/node_modules/mailgun-js/node_modules/debug/bower.json
+++ /dev/null
@@ -1,28 +0,0 @@
-{
-  "name": "visionmedia-debug",
-  "main": "dist/debug.js",
-  "version": "2.2.0",
-  "homepage": "https://github.com/visionmedia/debug",
-  "authors": [
-    "TJ Holowaychuk <tj...@vision-media.ca>"
-  ],
-  "description": "visionmedia-debug",
-  "moduleType": [
-    "amd",
-    "es6",
-    "globals",
-    "node"
-  ],
-  "keywords": [
-    "visionmedia",
-    "debug"
-  ],
-  "license": "MIT",
-  "ignore": [
-    "**/.*",
-    "node_modules",
-    "bower_components",
-    "test",
-    "tests"
-  ]
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/browser.js
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/browser.js b/node_modules/mailgun-js/node_modules/debug/browser.js
deleted file mode 100644
index 7c76452..0000000
--- a/node_modules/mailgun-js/node_modules/debug/browser.js
+++ /dev/null
@@ -1,168 +0,0 @@
-
-/**
- * This is the web browser implementation of `debug()`.
- *
- * Expose `debug()` as the module.
- */
-
-exports = module.exports = require('./debug');
-exports.log = log;
-exports.formatArgs = formatArgs;
-exports.save = save;
-exports.load = load;
-exports.useColors = useColors;
-exports.storage = 'undefined' != typeof chrome
-               && 'undefined' != typeof chrome.storage
-                  ? chrome.storage.local
-                  : localstorage();
-
-/**
- * Colors.
- */
-
-exports.colors = [
-  'lightseagreen',
-  'forestgreen',
-  'goldenrod',
-  'dodgerblue',
-  'darkorchid',
-  'crimson'
-];
-
-/**
- * Currently only WebKit-based Web Inspectors, Firefox >= v31,
- * and the Firebug extension (any Firefox version) are known
- * to support "%c" CSS customizations.
- *
- * TODO: add a `localStorage` variable to explicitly enable/disable colors
- */
-
-function useColors() {
-  // is webkit? http://stackoverflow.com/a/16459606/376773
-  return ('WebkitAppearance' in document.documentElement.style) ||
-    // is firebug? http://stackoverflow.com/a/398120/376773
-    (window.console && (console.firebug || (console.exception && console.table))) ||
-    // is firefox >= v31?
-    // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
-    (navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31);
-}
-
-/**
- * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
- */
-
-exports.formatters.j = function(v) {
-  return JSON.stringify(v);
-};
-
-
-/**
- * Colorize log arguments if enabled.
- *
- * @api public
- */
-
-function formatArgs() {
-  var args = arguments;
-  var useColors = this.useColors;
-
-  args[0] = (useColors ? '%c' : '')
-    + this.namespace
-    + (useColors ? ' %c' : ' ')
-    + args[0]
-    + (useColors ? '%c ' : ' ')
-    + '+' + exports.humanize(this.diff);
-
-  if (!useColors) return args;
-
-  var c = 'color: ' + this.color;
-  args = [args[0], c, 'color: inherit'].concat(Array.prototype.slice.call(args, 1));
-
-  // the final "%c" is somewhat tricky, because there could be other
-  // arguments passed either before or after the %c, so we need to
-  // figure out the correct index to insert the CSS into
-  var index = 0;
-  var lastC = 0;
-  args[0].replace(/%[a-z%]/g, function(match) {
-    if ('%%' === match) return;
-    index++;
-    if ('%c' === match) {
-      // we only are interested in the *last* %c
-      // (the user may have provided their own)
-      lastC = index;
-    }
-  });
-
-  args.splice(lastC, 0, c);
-  return args;
-}
-
-/**
- * Invokes `console.log()` when available.
- * No-op when `console.log` is not a "function".
- *
- * @api public
- */
-
-function log() {
-  // this hackery is required for IE8/9, where
-  // the `console.log` function doesn't have 'apply'
-  return 'object' === typeof console
-    && console.log
-    && Function.prototype.apply.call(console.log, console, arguments);
-}
-
-/**
- * Save `namespaces`.
- *
- * @param {String} namespaces
- * @api private
- */
-
-function save(namespaces) {
-  try {
-    if (null == namespaces) {
-      exports.storage.removeItem('debug');
-    } else {
-      exports.storage.debug = namespaces;
-    }
-  } catch(e) {}
-}
-
-/**
- * Load `namespaces`.
- *
- * @return {String} returns the previously persisted debug modes
- * @api private
- */
-
-function load() {
-  var r;
-  try {
-    r = exports.storage.debug;
-  } catch(e) {}
-  return r;
-}
-
-/**
- * Enable namespaces listed in `localStorage.debug` initially.
- */
-
-exports.enable(load());
-
-/**
- * Localstorage attempts to return the localstorage.
- *
- * This is necessary because safari throws
- * when a user disables cookies/localstorage
- * and you attempt to access it.
- *
- * @return {LocalStorage}
- * @api private
- */
-
-function localstorage(){
-  try {
-    return window.localStorage;
-  } catch (e) {}
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/component.json b/node_modules/mailgun-js/node_modules/debug/component.json
deleted file mode 100644
index ca10637..0000000
--- a/node_modules/mailgun-js/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.2.0",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "browser.js",
-  "scripts": [
-    "browser.js",
-    "debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/debug.js
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/debug.js b/node_modules/mailgun-js/node_modules/debug/debug.js
deleted file mode 100644
index 7571a86..0000000
--- a/node_modules/mailgun-js/node_modules/debug/debug.js
+++ /dev/null
@@ -1,197 +0,0 @@
-
-/**
- * This is the common logic for both the Node.js and web browser
- * implementations of `debug()`.
- *
- * Expose `debug()` as the module.
- */
-
-exports = module.exports = debug;
-exports.coerce = coerce;
-exports.disable = disable;
-exports.enable = enable;
-exports.enabled = enabled;
-exports.humanize = require('ms');
-
-/**
- * The currently active debug mode names, and names to skip.
- */
-
-exports.names = [];
-exports.skips = [];
-
-/**
- * Map of special "%n" handling functions, for the debug "format" argument.
- *
- * Valid key names are a single, lowercased letter, i.e. "n".
- */
-
-exports.formatters = {};
-
-/**
- * Previously assigned color.
- */
-
-var prevColor = 0;
-
-/**
- * Previous log timestamp.
- */
-
-var prevTime;
-
-/**
- * Select a color.
- *
- * @return {Number}
- * @api private
- */
-
-function selectColor() {
-  return exports.colors[prevColor++ % exports.colors.length];
-}
-
-/**
- * Create a debugger with the given `namespace`.
- *
- * @param {String} namespace
- * @return {Function}
- * @api public
- */
-
-function debug(namespace) {
-
-  // define the `disabled` version
-  function disabled() {
-  }
-  disabled.enabled = false;
-
-  // define the `enabled` version
-  function enabled() {
-
-    var self = enabled;
-
-    // set `diff` timestamp
-    var curr = +new Date();
-    var ms = curr - (prevTime || curr);
-    self.diff = ms;
-    self.prev = prevTime;
-    self.curr = curr;
-    prevTime = curr;
-
-    // add the `color` if not set
-    if (null == self.useColors) self.useColors = exports.useColors();
-    if (null == self.color && self.useColors) self.color = selectColor();
-
-    var args = Array.prototype.slice.call(arguments);
-
-    args[0] = exports.coerce(args[0]);
-
-    if ('string' !== typeof args[0]) {
-      // anything else let's inspect with %o
-      args = ['%o'].concat(args);
-    }
-
-    // apply any `formatters` transformations
-    var index = 0;
-    args[0] = args[0].replace(/%([a-z%])/g, function(match, format) {
-      // if we encounter an escaped % then don't increase the array index
-      if (match === '%%') return match;
-      index++;
-      var formatter = exports.formatters[format];
-      if ('function' === typeof formatter) {
-        var val = args[index];
-        match = formatter.call(self, val);
-
-        // now we need to remove `args[index]` since it's inlined in the `format`
-        args.splice(index, 1);
-        index--;
-      }
-      return match;
-    });
-
-    if ('function' === typeof exports.formatArgs) {
-      args = exports.formatArgs.apply(self, args);
-    }
-    var logFn = enabled.log || exports.log || console.log.bind(console);
-    logFn.apply(self, args);
-  }
-  enabled.enabled = true;
-
-  var fn = exports.enabled(namespace) ? enabled : disabled;
-
-  fn.namespace = namespace;
-
-  return fn;
-}
-
-/**
- * Enables a debug mode by namespaces. This can include modes
- * separated by a colon and wildcards.
- *
- * @param {String} namespaces
- * @api public
- */
-
-function enable(namespaces) {
-  exports.save(namespaces);
-
-  var split = (namespaces || '').split(/[\s,]+/);
-  var len = split.length;
-
-  for (var i = 0; i < len; i++) {
-    if (!split[i]) continue; // ignore empty strings
-    namespaces = split[i].replace(/\*/g, '.*?');
-    if (namespaces[0] === '-') {
-      exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
-    } else {
-      exports.names.push(new RegExp('^' + namespaces + '$'));
-    }
-  }
-}
-
-/**
- * Disable debug output.
- *
- * @api public
- */
-
-function disable() {
-  exports.enable('');
-}
-
-/**
- * Returns true if the given mode name is enabled, false otherwise.
- *
- * @param {String} name
- * @return {Boolean}
- * @api public
- */
-
-function enabled(name) {
-  var i, len;
-  for (i = 0, len = exports.skips.length; i < len; i++) {
-    if (exports.skips[i].test(name)) {
-      return false;
-    }
-  }
-  for (i = 0, len = exports.names.length; i < len; i++) {
-    if (exports.names[i].test(name)) {
-      return true;
-    }
-  }
-  return false;
-}
-
-/**
- * Coerce `val`.
- *
- * @param {Mixed} val
- * @return {Mixed}
- * @api private
- */
-
-function coerce(val) {
-  if (val instanceof Error) return val.stack || val.message;
-  return val;
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/karma.conf.js
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/karma.conf.js b/node_modules/mailgun-js/node_modules/debug/karma.conf.js
new file mode 100644
index 0000000..103a82d
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/karma.conf.js
@@ -0,0 +1,70 @@
+// Karma configuration
+// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
+
+module.exports = function(config) {
+  config.set({
+
+    // base path that will be used to resolve all patterns (eg. files, exclude)
+    basePath: '',
+
+
+    // frameworks to use
+    // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
+    frameworks: ['mocha', 'chai', 'sinon'],
+
+
+    // list of files / patterns to load in the browser
+    files: [
+      'dist/debug.js',
+      'test/*spec.js'
+    ],
+
+
+    // list of files to exclude
+    exclude: [
+      'src/node.js'
+    ],
+
+
+    // preprocess matching files before serving them to the browser
+    // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
+    preprocessors: {
+    },
+
+    // test results reporter to use
+    // possible values: 'dots', 'progress'
+    // available reporters: https://npmjs.org/browse/keyword/karma-reporter
+    reporters: ['progress'],
+
+
+    // web server port
+    port: 9876,
+
+
+    // enable / disable colors in the output (reporters and logs)
+    colors: true,
+
+
+    // level of logging
+    // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
+    logLevel: config.LOG_INFO,
+
+
+    // enable / disable watching file and executing tests whenever any file changes
+    autoWatch: true,
+
+
+    // start these browsers
+    // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
+    browsers: ['PhantomJS'],
+
+
+    // Continuous Integration mode
+    // if true, Karma captures browsers, runs the tests and exits
+    singleRun: false,
+
+    // Concurrency level
+    // how many browser should be started simultaneous
+    concurrency: Infinity
+  })
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/node.js
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/node.js b/node_modules/mailgun-js/node_modules/debug/node.js
index 1d392a8..7fc36fe 100644
--- a/node_modules/mailgun-js/node_modules/debug/node.js
+++ b/node_modules/mailgun-js/node_modules/debug/node.js
@@ -1,209 +1 @@
-
-/**
- * Module dependencies.
- */
-
-var tty = require('tty');
-var util = require('util');
-
-/**
- * This is the Node.js implementation of `debug()`.
- *
- * Expose `debug()` as the module.
- */
-
-exports = module.exports = require('./debug');
-exports.log = log;
-exports.formatArgs = formatArgs;
-exports.save = save;
-exports.load = load;
-exports.useColors = useColors;
-
-/**
- * Colors.
- */
-
-exports.colors = [6, 2, 3, 4, 5, 1];
-
-/**
- * The file descriptor to write the `debug()` calls to.
- * Set the `DEBUG_FD` env variable to override with another value. i.e.:
- *
- *   $ DEBUG_FD=3 node script.js 3>debug.log
- */
-
-var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
-var stream = 1 === fd ? process.stdout :
-             2 === fd ? process.stderr :
-             createWritableStdioStream(fd);
-
-/**
- * Is stdout a TTY? Colored output is enabled when `true`.
- */
-
-function useColors() {
-  var debugColors = (process.env.DEBUG_COLORS || '').trim().toLowerCase();
-  if (0 === debugColors.length) {
-    return tty.isatty(fd);
-  } else {
-    return '0' !== debugColors
-        && 'no' !== debugColors
-        && 'false' !== debugColors
-        && 'disabled' !== debugColors;
-  }
-}
-
-/**
- * Map %o to `util.inspect()`, since Node doesn't do that out of the box.
- */
-
-var inspect = (4 === util.inspect.length ?
-  // node <= 0.8.x
-  function (v, colors) {
-    return util.inspect(v, void 0, void 0, colors);
-  } :
-  // node > 0.8.x
-  function (v, colors) {
-    return util.inspect(v, { colors: colors });
-  }
-);
-
-exports.formatters.o = function(v) {
-  return inspect(v, this.useColors)
-    .replace(/\s*\n\s*/g, ' ');
-};
-
-/**
- * Adds ANSI color escape codes if enabled.
- *
- * @api public
- */
-
-function formatArgs() {
-  var args = arguments;
-  var useColors = this.useColors;
-  var name = this.namespace;
-
-  if (useColors) {
-    var c = this.color;
-
-    args[0] = '  \u001b[3' + c + ';1m' + name + ' '
-      + '\u001b[0m'
-      + args[0] + '\u001b[3' + c + 'm'
-      + ' +' + exports.humanize(this.diff) + '\u001b[0m';
-  } else {
-    args[0] = new Date().toUTCString()
-      + ' ' + name + ' ' + args[0];
-  }
-  return args;
-}
-
-/**
- * Invokes `console.error()` with the specified arguments.
- */
-
-function log() {
-  return stream.write(util.format.apply(this, arguments) + '\n');
-}
-
-/**
- * Save `namespaces`.
- *
- * @param {String} namespaces
- * @api private
- */
-
-function save(namespaces) {
-  if (null == namespaces) {
-    // If you set a process.env field to null or undefined, it gets cast to the
-    // string 'null' or 'undefined'. Just delete instead.
-    delete process.env.DEBUG;
-  } else {
-    process.env.DEBUG = namespaces;
-  }
-}
-
-/**
- * Load `namespaces`.
- *
- * @return {String} returns the previously persisted debug modes
- * @api private
- */
-
-function load() {
-  return process.env.DEBUG;
-}
-
-/**
- * Copied from `node/src/node.js`.
- *
- * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
- * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
- */
-
-function createWritableStdioStream (fd) {
-  var stream;
-  var tty_wrap = process.binding('tty_wrap');
-
-  // Note stream._type is used for test-module-load-list.js
-
-  switch (tty_wrap.guessHandleType(fd)) {
-    case 'TTY':
-      stream = new tty.WriteStream(fd);
-      stream._type = 'tty';
-
-      // Hack to have stream not keep the event loop alive.
-      // See https://github.com/joyent/node/issues/1726
-      if (stream._handle && stream._handle.unref) {
-        stream._handle.unref();
-      }
-      break;
-
-    case 'FILE':
-      var fs = require('fs');
-      stream = new fs.SyncWriteStream(fd, { autoClose: false });
-      stream._type = 'fs';
-      break;
-
-    case 'PIPE':
-    case 'TCP':
-      var net = require('net');
-      stream = new net.Socket({
-        fd: fd,
-        readable: false,
-        writable: true
-      });
-
-      // FIXME Should probably have an option in net.Socket to create a
-      // stream from an existing fd which is writable only. But for now
-      // we'll just add this hack and set the `readable` member to false.
-      // Test: ./node test/fixtures/echo.js < /etc/passwd
-      stream.readable = false;
-      stream.read = null;
-      stream._type = 'pipe';
-
-      // FIXME Hack to have stream not keep the event loop alive.
-      // See https://github.com/joyent/node/issues/1726
-      if (stream._handle && stream._handle.unref) {
-        stream._handle.unref();
-      }
-      break;
-
-    default:
-      // Probably an error on in uv_guess_handle()
-      throw new Error('Implement me. Unknown stream file type!');
-  }
-
-  // For supporting legacy API we put the FD here.
-  stream.fd = fd;
-
-  stream._isStdio = true;
-
-  return stream;
-}
-
-/**
- * Enable namespaces listed in `process.env.DEBUG` initially.
- */
-
-exports.enable(load());
+module.exports = require('./src/node');

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/node_modules/ms/index.js
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/node_modules/ms/index.js b/node_modules/mailgun-js/node_modules/debug/node_modules/ms/index.js
new file mode 100644
index 0000000..6a522b1
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/node_modules/ms/index.js
@@ -0,0 +1,152 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} [options]
+ * @throws {Error} throw an error if val is not a non-empty string or a number
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options) {
+  options = options || {};
+  var type = typeof val;
+  if (type === 'string' && val.length > 0) {
+    return parse(val);
+  } else if (type === 'number' && isNaN(val) === false) {
+    return options.long ? fmtLong(val) : fmtShort(val);
+  }
+  throw new Error(
+    'val is not a non-empty string or a valid number. val=' +
+      JSON.stringify(val)
+  );
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+  str = String(str);
+  if (str.length > 100) {
+    return;
+  }
+  var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(
+    str
+  );
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'yrs':
+    case 'yr':
+    case 'y':
+      return n * y;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'hrs':
+    case 'hr':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'mins':
+    case 'min':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 'secs':
+    case 'sec':
+    case 's':
+      return n * s;
+    case 'milliseconds':
+    case 'millisecond':
+    case 'msecs':
+    case 'msec':
+    case 'ms':
+      return n;
+    default:
+      return undefined;
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtShort(ms) {
+  if (ms >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (ms >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (ms >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (ms >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtLong(ms) {
+  return plural(ms, d, 'day') ||
+    plural(ms, h, 'hour') ||
+    plural(ms, m, 'minute') ||
+    plural(ms, s, 'second') ||
+    ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, n, name) {
+  if (ms < n) {
+    return;
+  }
+  if (ms < n * 1.5) {
+    return Math.floor(ms / n) + ' ' + name;
+  }
+  return Math.ceil(ms / n) + ' ' + name + 's';
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/node_modules/ms/license.md
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/node_modules/ms/license.md b/node_modules/mailgun-js/node_modules/debug/node_modules/ms/license.md
new file mode 100644
index 0000000..69b6125
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/node_modules/ms/license.md
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 Zeit, Inc.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/node_modules/ms/package.json
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/node_modules/ms/package.json b/node_modules/mailgun-js/node_modules/debug/node_modules/ms/package.json
new file mode 100644
index 0000000..1a22d2a
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/node_modules/ms/package.json
@@ -0,0 +1,74 @@
+{
+  "_args": [
+    [
+      "ms@2.0.0",
+      "/Users/scottyaslan/Development/nifi-fds/target"
+    ]
+  ],
+  "_development": true,
+  "_from": "ms@2.0.0",
+  "_id": "ms@2.0.0",
+  "_inBundle": false,
+  "_integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=",
+  "_location": "/mailgun-js/debug/ms",
+  "_optional": true,
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "ms@2.0.0",
+    "name": "ms",
+    "escapedName": "ms",
+    "rawSpec": "2.0.0",
+    "saveSpec": null,
+    "fetchSpec": "2.0.0"
+  },
+  "_requiredBy": [
+    "/mailgun-js/debug"
+  ],
+  "_resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+  "_spec": "2.0.0",
+  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
+  "bugs": {
+    "url": "https://github.com/zeit/ms/issues"
+  },
+  "description": "Tiny milisecond conversion utility",
+  "devDependencies": {
+    "eslint": "3.19.0",
+    "expect.js": "0.3.1",
+    "husky": "0.13.3",
+    "lint-staged": "3.4.1",
+    "mocha": "3.4.1"
+  },
+  "eslintConfig": {
+    "extends": "eslint:recommended",
+    "env": {
+      "node": true,
+      "es6": true
+    }
+  },
+  "files": [
+    "index.js"
+  ],
+  "homepage": "https://github.com/zeit/ms#readme",
+  "license": "MIT",
+  "lint-staged": {
+    "*.js": [
+      "npm run lint",
+      "prettier --single-quote --write",
+      "git add"
+    ]
+  },
+  "main": "./index",
+  "name": "ms",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/zeit/ms.git"
+  },
+  "scripts": {
+    "lint": "eslint lib/* bin/*",
+    "precommit": "lint-staged",
+    "test": "mocha tests.js"
+  },
+  "version": "2.0.0"
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/node_modules/ms/readme.md
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/node_modules/ms/readme.md b/node_modules/mailgun-js/node_modules/debug/node_modules/ms/readme.md
new file mode 100644
index 0000000..84a9974
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/node_modules/ms/readme.md
@@ -0,0 +1,51 @@
+# ms
+
+[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms)
+[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/)
+
+Use this package to easily convert various time formats to milliseconds.
+
+## Examples
+
+```js
+ms('2 days')  // 172800000
+ms('1d')      // 86400000
+ms('10h')     // 36000000
+ms('2.5 hrs') // 9000000
+ms('2h')      // 7200000
+ms('1m')      // 60000
+ms('5s')      // 5000
+ms('1y')      // 31557600000
+ms('100')     // 100
+```
+
+### Convert from milliseconds
+
+```js
+ms(60000)             // "1m"
+ms(2 * 60000)         // "2m"
+ms(ms('10 hours'))    // "10h"
+```
+
+### Time format written-out
+
+```js
+ms(60000, { long: true })             // "1 minute"
+ms(2 * 60000, { long: true })         // "2 minutes"
+ms(ms('10 hours'), { long: true })    // "10 hours"
+```
+
+## Features
+
+- Works both in [node](https://nodejs.org) and in the browser.
+- If a number is supplied to `ms`, a string with a unit is returned.
+- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`).
+- If you pass a string with a number and a valid unit, the number of equivalent ms is returned.
+
+## Caught a bug?
+
+1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device
+2. Link the package to the global module directory: `npm link`
+3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms!
+
+As always, you can run the tests using: `npm test`

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/package.json b/node_modules/mailgun-js/node_modules/debug/package.json
index 1c8bb97..789e964 100644
--- a/node_modules/mailgun-js/node_modules/debug/package.json
+++ b/node_modules/mailgun-js/node_modules/debug/package.json
@@ -1,62 +1,74 @@
 {
   "_args": [
     [
-      "debug@2.2.0",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.2.0",
-  "_id": "debug@2.2.0",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha1-+HBX6ZWxofauaklgZkE3vFbwOdo=",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/mailgun-js/debug",
   "_optional": true,
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.2.0",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.2.0",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.2.0"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/mailgun-js"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz",
-  "_spec": "2.2.0",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
     "email": "tj@vision-media.ca"
   },
-  "browser": "./browser.js",
+  "browser": "./src/browser.js",
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
       "email": "nathan@tootallnate.net",
       "url": "http://n8.io"
+    },
+    {
+      "name": "Andrew Rhyne",
+      "email": "rhyneandrew@gmail.com"
     }
   ],
   "dependencies": {
-    "ms": "0.7.1"
+    "ms": "2.0.0"
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
-    "mocha": "*"
+    "browserify": "14.4.0",
+    "chai": "^3.5.0",
+    "concurrently": "^3.1.0",
+    "coveralls": "^2.11.15",
+    "eslint": "^3.12.1",
+    "istanbul": "^0.4.5",
+    "karma": "^1.3.0",
+    "karma-chai": "^0.1.0",
+    "karma-mocha": "^1.3.0",
+    "karma-phantomjs-launcher": "^1.0.2",
+    "karma-sinon": "^1.0.5",
+    "mocha": "^3.2.0",
+    "mocha-lcov-reporter": "^1.2.0",
+    "rimraf": "^2.5.4",
+    "sinon": "^1.17.6",
+    "sinon-chai": "^2.8.0"
   },
   "homepage": "https://github.com/visionmedia/debug#readme",
   "keywords": [
@@ -65,11 +77,11 @@
     "debugger"
   ],
   "license": "MIT",
-  "main": "./node.js",
+  "main": "./src/index.js",
   "name": "debug",
   "repository": {
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.2.0"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/ms/package.json
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/ms/package.json b/node_modules/mailgun-js/node_modules/ms/package.json
index 840ce19..9949e92 100644
--- a/node_modules/mailgun-js/node_modules/ms/package.json
+++ b/node_modules/mailgun-js/node_modules/ms/package.json
@@ -5,13 +5,11 @@
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
-  "_development": true,
   "_from": "ms@0.7.1",
   "_id": "ms@0.7.1",
   "_inBundle": false,
   "_integrity": "sha1-nNE8A62/8ltl7/3nzoZO6VIBcJg=",
   "_location": "/mailgun-js/ms",
-  "_optional": true,
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
@@ -23,9 +21,7 @@
     "saveSpec": null,
     "fetchSpec": "0.7.1"
   },
-  "_requiredBy": [
-    "/mailgun-js/debug"
-  ],
+  "_requiredBy": [],
   "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz",
   "_spec": "0.7.1",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/math-random/.npmignore
----------------------------------------------------------------------
diff --git a/node_modules/math-random/.npmignore b/node_modules/math-random/.npmignore
new file mode 100644
index 0000000..8d87b1d
--- /dev/null
+++ b/node_modules/math-random/.npmignore
@@ -0,0 +1 @@
+node_modules/*

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/math-random/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/math-random/.travis.yml b/node_modules/math-random/.travis.yml
new file mode 100644
index 0000000..054c803
--- /dev/null
+++ b/node_modules/math-random/.travis.yml
@@ -0,0 +1,6 @@
+language: node_js
+node_js:
+  - "6"
+  - "4"
+  - "0.12"
+  - "0.10"

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/math-random/browser.js
----------------------------------------------------------------------
diff --git a/node_modules/math-random/browser.js b/node_modules/math-random/browser.js
new file mode 100644
index 0000000..cde412e
--- /dev/null
+++ b/node_modules/math-random/browser.js
@@ -0,0 +1,17 @@
+module.exports = (function (global) {
+  var uint32 = 'Uint32Array' in global
+  var crypto = global.crypto || global.msCrypto
+  var rando = crypto && typeof crypto.getRandomValues === 'function'
+  var good = uint32 && crypto && rando
+  if (!good) return Math.random
+
+  var arr = new Uint32Array(1)
+  var max = Math.pow(2, 32)
+  function random () {
+    crypto.getRandomValues(arr)
+    return arr[0] / max
+  }
+
+  random.cryptographic = true
+  return random
+})(typeof self !== 'undefined' ? self : window)

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/math-random/node.js
----------------------------------------------------------------------
diff --git a/node_modules/math-random/node.js b/node_modules/math-random/node.js
new file mode 100644
index 0000000..da6783e
--- /dev/null
+++ b/node_modules/math-random/node.js
@@ -0,0 +1,13 @@
+var crypto = require('crypto')
+var max = Math.pow(2, 32)
+
+module.exports = random
+module.exports.cryptographic = true
+
+function random () {
+  var buf = crypto
+    .randomBytes(4)
+    .toString('hex')
+
+  return parseInt(buf, 16) / max
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/math-random/package.json
----------------------------------------------------------------------
diff --git a/node_modules/math-random/package.json b/node_modules/math-random/package.json
new file mode 100644
index 0000000..6e6ed4a
--- /dev/null
+++ b/node_modules/math-random/package.json
@@ -0,0 +1,62 @@
+{
+  "_args": [
+    [
+      "math-random@1.0.1",
+      "/Users/scottyaslan/Development/nifi-fds/target"
+    ]
+  ],
+  "_development": true,
+  "_from": "math-random@1.0.1",
+  "_id": "math-random@1.0.1",
+  "_inBundle": false,
+  "_integrity": "sha1-izqsWIuKZuSXXjzepn97sylgH6w=",
+  "_location": "/math-random",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "math-random@1.0.1",
+    "name": "math-random",
+    "escapedName": "math-random",
+    "rawSpec": "1.0.1",
+    "saveSpec": null,
+    "fetchSpec": "1.0.1"
+  },
+  "_requiredBy": [
+    "/randomatic"
+  ],
+  "_resolved": "https://registry.npmjs.org/math-random/-/math-random-1.0.1.tgz",
+  "_spec": "1.0.1",
+  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
+  "author": {
+    "name": "Michael Rhodes"
+  },
+  "browser": "browser.js",
+  "bugs": {
+    "url": "https://github.com/michaelrhodes/math-random/issues"
+  },
+  "description": "a drop-in replacement for Math.random that uses cryptographically secure random number generation, where available",
+  "devDependencies": {
+    "array-unique": "~0.2.1",
+    "tape": "~4.2.2"
+  },
+  "homepage": "https://github.com/michaelrhodes/math-random",
+  "keywords": [
+    "Math.random",
+    "crypto.getRandomValues"
+  ],
+  "license": "MIT",
+  "main": "node.js",
+  "name": "math-random",
+  "repository": {
+    "type": "git",
+    "url": "git+ssh://git@github.com/michaelrhodes/math-random.git"
+  },
+  "scripts": {
+    "test": "tape test.js"
+  },
+  "testling": {
+    "files": "test.js"
+  },
+  "version": "1.0.1"
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/math-random/readme.md
----------------------------------------------------------------------
diff --git a/node_modules/math-random/readme.md b/node_modules/math-random/readme.md
new file mode 100644
index 0000000..17beb70
--- /dev/null
+++ b/node_modules/math-random/readme.md
@@ -0,0 +1,26 @@
+# math-random
+
+math-random is an drop-in replacement for Math.random that uses cryptographically secure random number generation, where available. It works in both browser and node environments.
+
+[![Build status](https://travis-ci.org/michaelrhodes/math-random.svg?branch=master)](https://travis-ci.org/michaelrhodes/math-random)
+
+## Install
+
+```sh
+npm install math-random
+```
+
+### Usage
+
+```js
+var random = require('math-random')
+
+console.log(random())
+=> 0.584293719381094
+
+console.log(random.cryptographic)
+=> true || undefined
+```
+
+### License
+[MIT](http://opensource.org/licenses/MIT)

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/math-random/test.js
----------------------------------------------------------------------
diff --git a/node_modules/math-random/test.js b/node_modules/math-random/test.js
new file mode 100644
index 0000000..b7706b7
--- /dev/null
+++ b/node_modules/math-random/test.js
@@ -0,0 +1,26 @@
+var test = require('tape')
+var unique = require('array-unique')
+var random = require('./')
+
+test('it works', function (assert) {
+  var number, l = 1000, cache = []
+
+  for (var i = 0; i < l; i++) {
+    number = random()
+    if (number <= 0) {
+      assert.fail('a random number was less than or equal to zero')
+      assert.end()
+      return
+    }
+    if (number >= 1) {
+      assert.fail('a random number was greater than or equal to one')
+      assert.end()
+      return
+    }
+    cache.push(number)
+  }
+
+  assert.pass('all ' + l + ' random numbers were greater than zero and less than one')
+  assert.equal(cache.length, unique(cache).length, 'all ' + l + ' random numbers were unique')
+  assert.end()
+})

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/ms/package.json
----------------------------------------------------------------------
diff --git a/node_modules/ms/package.json b/node_modules/ms/package.json
index a318dbf..10a2ae4 100644
--- a/node_modules/ms/package.json
+++ b/node_modules/ms/package.json
@@ -29,8 +29,6 @@
     "/debug",
     "/finalhandler/debug",
     "/get-uri/debug",
-    "/http-proxy-agent/debug",
-    "/https-proxy-agent/debug",
     "/pac-proxy-agent/debug",
     "/portfinder/debug",
     "/proxy-agent/debug",

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/node-sass/node_modules/tunnel-agent/index.js
----------------------------------------------------------------------
diff --git a/node_modules/node-sass/node_modules/tunnel-agent/index.js b/node_modules/node-sass/node_modules/tunnel-agent/index.js
index 68013ac..3ee9abc 100644
--- a/node_modules/node-sass/node_modules/tunnel-agent/index.js
+++ b/node_modules/node-sass/node_modules/tunnel-agent/index.js
@@ -7,6 +7,7 @@ var net = require('net')
   , events = require('events')
   , assert = require('assert')
   , util = require('util')
+  , Buffer = require('safe-buffer').Buffer
   ;
 
 exports.httpOverHttp = httpOverHttp
@@ -118,7 +119,7 @@ TunnelingAgent.prototype.createSocket = function createSocket(options, cb) {
   var placeholder = {}
   self.sockets.push(placeholder)
 
-  var connectOptions = mergeOptions({}, self.proxyOptions, 
+  var connectOptions = mergeOptions({}, self.proxyOptions,
     { method: 'CONNECT'
     , path: options.host + ':' + options.port
     , agent: false
@@ -127,7 +128,7 @@ TunnelingAgent.prototype.createSocket = function createSocket(options, cb) {
   if (connectOptions.proxyAuth) {
     connectOptions.headers = connectOptions.headers || {}
     connectOptions.headers['Proxy-Authorization'] = 'Basic ' +
-        new Buffer(connectOptions.proxyAuth).toString('base64')
+        Buffer.from(connectOptions.proxyAuth).toString('base64')
   }
 
   debug('making CONNECT request')
@@ -183,7 +184,7 @@ TunnelingAgent.prototype.createSocket = function createSocket(options, cb) {
 TunnelingAgent.prototype.removeSocket = function removeSocket(socket) {
   var pos = this.sockets.indexOf(socket)
   if (pos === -1) return
-  
+
   this.sockets.splice(pos, 1)
 
   var pending = this.requests.shift()
@@ -198,7 +199,7 @@ function createSecureSocket(options, cb) {
   var self = this
   TunnelingAgent.prototype.createSocket.call(self, options, function(socket) {
     // 0 is dummy port for v0.6
-    var secureSocket = tls.connect(0, mergeOptions({}, self.options, 
+    var secureSocket = tls.connect(0, mergeOptions({}, self.options,
       { servername: options.host
       , socket: socket
       }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/node-sass/node_modules/tunnel-agent/package.json
----------------------------------------------------------------------
diff --git a/node_modules/node-sass/node_modules/tunnel-agent/package.json b/node_modules/node-sass/node_modules/tunnel-agent/package.json
index 81d1f70..11a1683 100644
--- a/node_modules/node-sass/node_modules/tunnel-agent/package.json
+++ b/node_modules/node-sass/node_modules/tunnel-agent/package.json
@@ -1,32 +1,32 @@
 {
   "_args": [
     [
-      "tunnel-agent@0.4.3",
+      "tunnel-agent@0.6.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "tunnel-agent@0.4.3",
-  "_id": "tunnel-agent@0.4.3",
+  "_from": "tunnel-agent@0.6.0",
+  "_id": "tunnel-agent@0.6.0",
   "_inBundle": false,
-  "_integrity": "sha1-Y3PbdpCf5XDgjXNYM2Xtgop07us=",
+  "_integrity": "sha1-J6XeoGs2sEoKmWZ3SykIaPD8QP0=",
   "_location": "/node-sass/tunnel-agent",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "tunnel-agent@0.4.3",
+    "raw": "tunnel-agent@0.6.0",
     "name": "tunnel-agent",
     "escapedName": "tunnel-agent",
-    "rawSpec": "0.4.3",
+    "rawSpec": "0.6.0",
     "saveSpec": null,
-    "fetchSpec": "0.4.3"
+    "fetchSpec": "0.6.0"
   },
   "_requiredBy": [
     "/node-sass/request"
   ],
-  "_resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.4.3.tgz",
-  "_spec": "0.4.3",
+  "_resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz",
+  "_spec": "0.6.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "Mikeal Rogers",
@@ -36,7 +36,9 @@
   "bugs": {
     "url": "https://github.com/mikeal/tunnel-agent/issues"
   },
-  "dependencies": {},
+  "dependencies": {
+    "safe-buffer": "^5.0.1"
+  },
   "description": "HTTP proxy tunneling agent. Formerly part of mikeal/request, now a standalone module.",
   "devDependencies": {},
   "engines": {
@@ -53,5 +55,5 @@
   "repository": {
     "url": "git+https://github.com/mikeal/tunnel-agent.git"
   },
-  "version": "0.4.3"
+  "version": "0.6.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/node-sass/package.json
----------------------------------------------------------------------
diff --git a/node_modules/node-sass/package.json b/node_modules/node-sass/package.json
index abf5b02..73b2796 100644
--- a/node_modules/node-sass/package.json
+++ b/node_modules/node-sass/package.json
@@ -27,8 +27,9 @@
     "mime-types": "2.1.18",
     "oauth-sign": "0.8.2",
     "pinkie-promise": "2.0.1",
+    "safe-buffer": "5.1.2",
     "sshpk": "1.14.1",
-    "stringstream": "0.0.5",
+    "stringstream": "0.0.6",
     "tough-cookie": "2.3.4",
     "uuid": "3.2.1"
   },

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/pac-proxy-agent/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/pac-proxy-agent/node_modules/debug/.eslintrc b/node_modules/pac-proxy-agent/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/pac-proxy-agent/node_modules/debug/.eslintrc
+++ b/node_modules/pac-proxy-agent/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/pac-proxy-agent/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/pac-proxy-agent/node_modules/debug/.travis.yml b/node_modules/pac-proxy-agent/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/pac-proxy-agent/node_modules/debug/.travis.yml
+++ b/node_modules/pac-proxy-agent/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/pac-proxy-agent/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/pac-proxy-agent/node_modules/debug/CHANGELOG.md b/node_modules/pac-proxy-agent/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/pac-proxy-agent/node_modules/debug/CHANGELOG.md
+++ b/node_modules/pac-proxy-agent/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/pac-proxy-agent/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/pac-proxy-agent/node_modules/debug/Makefile b/node_modules/pac-proxy-agent/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/pac-proxy-agent/node_modules/debug/Makefile
+++ b/node_modules/pac-proxy-agent/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

[09/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.map
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.map b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.map
new file mode 100644
index 0000000..bbe71e4
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.map
@@ -0,0 +1 @@
+{"version":3,"sources":["config/versionTemplate.txt","lib/es6-promise/utils.js","lib/es6-promise/asap.js","lib/es6-promise/then.js","lib/es6-promise/promise/resolve.js","lib/es6-promise/-internal.js","lib/es6-promise/enumerator.js","lib/es6-promise/promise/all.js","lib/es6-promise/promise/race.js","lib/es6-promise/promise/reject.js","lib/es6-promise/promise.js","lib/es6-promise/polyfill.js","lib/es6-promise.js"],"sourcesContent":["/*!\n * @overview es6-promise - a tiny implementation of Promises/A+.\n * @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald)\n * @license   Licensed under MIT license\n *            See https://raw.githubusercontent.com/stefanpenner/es6-promise/master/LICENSE\n * @version   v4.2.4+314e4831\n */\n","export function objectOrFunction(x) {\n  var type = typeof x;\n  return x !== null && (type === 'object' || type === 'function');\n}\n\nexport function isFunction(x) {\n  return typeof x 
 === 'function';\n}\n\nexport function isMaybeThenable(x) {\n  return x !== null && typeof x === 'object';\n}\n\nvar _isArray = void 0;\nif (Array.isArray) {\n  _isArray = Array.isArray;\n} else {\n  _isArray = function (x) {\n    return Object.prototype.toString.call(x) === '[object Array]';\n  };\n}\n\nexport var isArray = _isArray;","var len = 0;\nvar vertxNext = void 0;\nvar customSchedulerFn = void 0;\n\nexport var asap = function asap(callback, arg) {\n  queue[len] = callback;\n  queue[len + 1] = arg;\n  len += 2;\n  if (len === 2) {\n    // If len is 2, that means that we need to schedule an async flush.\n    // If additional callbacks are queued before the queue is flushed, they\n    // will be processed by this flush that we are scheduling.\n    if (customSchedulerFn) {\n      customSchedulerFn(flush);\n    } else {\n      scheduleFlush();\n    }\n  }\n};\n\nexport function setScheduler(scheduleFn) {\n  customSchedulerFn = scheduleFn;\n}\n\nexport function setAsap(asapFn) {\
 n  asap = asapFn;\n}\n\nvar browserWindow = typeof window !== 'undefined' ? window : undefined;\nvar browserGlobal = browserWindow || {};\nvar BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;\nvar isNode = typeof self === 'undefined' && typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n\n// test for web worker but not in IE10\nvar isWorker = typeof Uint8ClampedArray !== 'undefined' && typeof importScripts !== 'undefined' && typeof MessageChannel !== 'undefined';\n\n// node\nfunction useNextTick() {\n  // node version 0.10.x displays a deprecation warning when nextTick is used recursively\n  // see https://github.com/cujojs/when/issues/410 for details\n  return function () {\n    return process.nextTick(flush);\n  };\n}\n\n// vertx\nfunction useVertxTimer() {\n  if (typeof vertxNext !== 'undefined') {\n    return function () {\n      vertxNext(flush);\n    };\n  }\n\n  return useSetTimeout();\n}\n\nfu
 nction useMutationObserver() {\n  var iterations = 0;\n  var observer = new BrowserMutationObserver(flush);\n  var node = document.createTextNode('');\n  observer.observe(node, { characterData: true });\n\n  return function () {\n    node.data = iterations = ++iterations % 2;\n  };\n}\n\n// web worker\nfunction useMessageChannel() {\n  var channel = new MessageChannel();\n  channel.port1.onmessage = flush;\n  return function () {\n    return channel.port2.postMessage(0);\n  };\n}\n\nfunction useSetTimeout() {\n  // Store setTimeout reference so es6-promise will be unaffected by\n  // other code modifying setTimeout (like sinon.useFakeTimers())\n  var globalSetTimeout = setTimeout;\n  return function () {\n    return globalSetTimeout(flush, 1);\n  };\n}\n\nvar queue = new Array(1000);\nfunction flush() {\n  for (var i = 0; i < len; i += 2) {\n    var callback = queue[i];\n    var arg = queue[i + 1];\n\n    callback(arg);\n\n    queue[i] = undefined;\n    queue[i + 1] = undefined;\n  
 }\n\n  len = 0;\n}\n\nfunction attemptVertx() {\n  try {\n    var vertx = Function('return this')().require('vertx');\n    vertxNext = vertx.runOnLoop || vertx.runOnContext;\n    return useVertxTimer();\n  } catch (e) {\n    return useSetTimeout();\n  }\n}\n\nvar scheduleFlush = void 0;\n// Decide what async method to use to triggering processing of queued callbacks:\nif (isNode) {\n  scheduleFlush = useNextTick();\n} else if (BrowserMutationObserver) {\n  scheduleFlush = useMutationObserver();\n} else if (isWorker) {\n  scheduleFlush = useMessageChannel();\n} else if (browserWindow === undefined && typeof require === 'function') {\n  scheduleFlush = attemptVertx();\n} else {\n  scheduleFlush = useSetTimeout();\n}","import { invokeCallback, subscribe, FULFILLED, REJECTED, noop, makePromise, PROMISE_ID } from './-internal';\n\nimport { asap } from './asap';\n\nexport default function then(onFulfillment, onRejection) {\n  var parent = this;\n\n  var child = new this.constructor(noop);
 \n\n  if (child[PROMISE_ID] === undefined) {\n    makePromise(child);\n  }\n\n  var _state = parent._state;\n\n\n  if (_state) {\n    var callback = arguments[_state - 1];\n    asap(function () {\n      return invokeCallback(_state, child, callback, parent._result);\n    });\n  } else {\n    subscribe(parent, child, onFulfillment, onRejection);\n  }\n\n  return child;\n}","import { noop, resolve as _resolve } from '../-internal';\n\n/**\n  `Promise.resolve` returns a promise that will become resolved with the\n  passed `value`. It is shorthand for the following:\n\n  ```javascript\n  let promise = new Promise(function(resolve, reject){\n    resolve(1);\n  });\n\n  promise.then(function(value){\n    // value === 1\n  });\n  ```\n\n  Instead of writing the above, your code now simply becomes the following:\n\n  ```javascript\n  let promise = Promise.resolve(1);\n\n  promise.then(function(value){\n    // value === 1\n  });\n  ```\n\n  @method resolve\n  @static\n  @param {Any} value va
 lue that the returned promise will be resolved with\n  Useful for tooling.\n  @return {Promise} a promise that will become fulfilled with the given\n  `value`\n*/\nexport default function resolve(object) {\n  /*jshint validthis:true */\n  var Constructor = this;\n\n  if (object && typeof object === 'object' && object.constructor === Constructor) {\n    return object;\n  }\n\n  var promise = new Constructor(noop);\n  _resolve(promise, object);\n  return promise;\n}","import { objectOrFunction, isFunction } from './utils';\n\nimport { asap } from './asap';\n\nimport originalThen from './then';\nimport originalResolve from './promise/resolve';\n\nexport var PROMISE_ID = Math.random().toString(36).substring(2);\n\nfunction noop() {}\n\nvar PENDING = void 0;\nvar FULFILLED = 1;\nvar REJECTED = 2;\n\nvar TRY_CATCH_ERROR = { error: null };\n\nfunction selfFulfillment() {\n  return new TypeError(\"You cannot resolve a promise with itself\");\n}\n\nfunction cannotReturnOwn() {\n  return new 
 TypeError('A promises callback cannot return that same promise.');\n}\n\nfunction getThen(promise) {\n  try {\n    return promise.then;\n  } catch (error) {\n    TRY_CATCH_ERROR.error = error;\n    return TRY_CATCH_ERROR;\n  }\n}\n\nfunction tryThen(then, value, fulfillmentHandler, rejectionHandler) {\n  try {\n    then.call(value, fulfillmentHandler, rejectionHandler);\n  } catch (e) {\n    return e;\n  }\n}\n\nfunction handleForeignThenable(promise, thenable, then) {\n  asap(function (promise) {\n    var sealed = false;\n    var error = tryThen(then, thenable, function (value) {\n      if (sealed) {\n        return;\n      }\n      sealed = true;\n      if (thenable !== value) {\n        resolve(promise, value);\n      } else {\n        fulfill(promise, value);\n      }\n    }, function (reason) {\n      if (sealed) {\n        return;\n      }\n      sealed = true;\n\n      reject(promise, reason);\n    }, 'Settle: ' + (promise._label || ' unknown promise'));\n\n    if (!sealed &&
  error) {\n      sealed = true;\n      reject(promise, error);\n    }\n  }, promise);\n}\n\nfunction handleOwnThenable(promise, thenable) {\n  if (thenable._state === FULFILLED) {\n    fulfill(promise, thenable._result);\n  } else if (thenable._state === REJECTED) {\n    reject(promise, thenable._result);\n  } else {\n    subscribe(thenable, undefined, function (value) {\n      return resolve(promise, value);\n    }, function (reason) {\n      return reject(promise, reason);\n    });\n  }\n}\n\nfunction handleMaybeThenable(promise, maybeThenable, then) {\n  if (maybeThenable.constructor === promise.constructor && then === originalThen && maybeThenable.constructor.resolve === originalResolve) {\n    handleOwnThenable(promise, maybeThenable);\n  } else {\n    if (then === TRY_CATCH_ERROR) {\n      reject(promise, TRY_CATCH_ERROR.error);\n      TRY_CATCH_ERROR.error = null;\n    } else if (then === undefined) {\n      fulfill(promise, maybeThenable);\n    } else if (isFunction(then)) {
 \n      handleForeignThenable(promise, maybeThenable, then);\n    } else {\n      fulfill(promise, maybeThenable);\n    }\n  }\n}\n\nfunction resolve(promise, value) {\n  if (promise === value) {\n    reject(promise, selfFulfillment());\n  } else if (objectOrFunction(value)) {\n    handleMaybeThenable(promise, value, getThen(value));\n  } else {\n    fulfill(promise, value);\n  }\n}\n\nfunction publishRejection(promise) {\n  if (promise._onerror) {\n    promise._onerror(promise._result);\n  }\n\n  publish(promise);\n}\n\nfunction fulfill(promise, value) {\n  if (promise._state !== PENDING) {\n    return;\n  }\n\n  promise._result = value;\n  promise._state = FULFILLED;\n\n  if (promise._subscribers.length !== 0) {\n    asap(publish, promise);\n  }\n}\n\nfunction reject(promise, reason) {\n  if (promise._state !== PENDING) {\n    return;\n  }\n  promise._state = REJECTED;\n  promise._result = reason;\n\n  asap(publishRejection, promise);\n}\n\nfunction subscribe(parent, child, onFulf
 illment, onRejection) {\n  var _subscribers = parent._subscribers;\n  var length = _subscribers.length;\n\n\n  parent._onerror = null;\n\n  _subscribers[length] = child;\n  _subscribers[length + FULFILLED] = onFulfillment;\n  _subscribers[length + REJECTED] = onRejection;\n\n  if (length === 0 && parent._state) {\n    asap(publish, parent);\n  }\n}\n\nfunction publish(promise) {\n  var subscribers = promise._subscribers;\n  var settled = promise._state;\n\n  if (subscribers.length === 0) {\n    return;\n  }\n\n  var child = void 0,\n      callback = void 0,\n      detail = promise._result;\n\n  for (var i = 0; i < subscribers.length; i += 3) {\n    child = subscribers[i];\n    callback = subscribers[i + settled];\n\n    if (child) {\n      invokeCallback(settled, child, callback, detail);\n    } else {\n      callback(detail);\n    }\n  }\n\n  promise._subscribers.length = 0;\n}\n\nfunction tryCatch(callback, detail) {\n  try {\n    return callback(detail);\n  } catch (e) {\n    TRY
 _CATCH_ERROR.error = e;\n    return TRY_CATCH_ERROR;\n  }\n}\n\nfunction invokeCallback(settled, promise, callback, detail) {\n  var hasCallback = isFunction(callback),\n      value = void 0,\n      error = void 0,\n      succeeded = void 0,\n      failed = void 0;\n\n  if (hasCallback) {\n    value = tryCatch(callback, detail);\n\n    if (value === TRY_CATCH_ERROR) {\n      failed = true;\n      error = value.error;\n      value.error = null;\n    } else {\n      succeeded = true;\n    }\n\n    if (promise === value) {\n      reject(promise, cannotReturnOwn());\n      return;\n    }\n  } else {\n    value = detail;\n    succeeded = true;\n  }\n\n  if (promise._state !== PENDING) {\n    // noop\n  } else if (hasCallback && succeeded) {\n    resolve(promise, value);\n  } else if (failed) {\n    reject(promise, error);\n  } else if (settled === FULFILLED) {\n    fulfill(promise, value);\n  } else if (settled === REJECTED) {\n    reject(promise, value);\n  }\n}\n\nfunction initializePr
 omise(promise, resolver) {\n  try {\n    resolver(function resolvePromise(value) {\n      resolve(promise, value);\n    }, function rejectPromise(reason) {\n      reject(promise, reason);\n    });\n  } catch (e) {\n    reject(promise, e);\n  }\n}\n\nvar id = 0;\nfunction nextId() {\n  return id++;\n}\n\nfunction makePromise(promise) {\n  promise[PROMISE_ID] = id++;\n  promise._state = undefined;\n  promise._result = undefined;\n  promise._subscribers = [];\n}\n\nexport { nextId, makePromise, getThen, noop, resolve, reject, fulfill, subscribe, publish, publishRejection, initializePromise, invokeCallback, FULFILLED, REJECTED, PENDING, handleMaybeThenable };","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nimport { isArray, isMaybeThenable } from './utils';\nimport { noop, reject, fulfill, subscribe, FULFILLED, REJECTED, PENDING, getThen, handleMaybeThenable } from './-intern
 al';\n\nimport then from './then';\nimport Promise from './promise';\nimport originalResolve from './promise/resolve';\nimport originalThen from './then';\nimport { makePromise, PROMISE_ID } from './-internal';\n\nfunction validationError() {\n  return new Error('Array Methods must be provided an Array');\n};\n\nvar Enumerator = function () {\n  function Enumerator(Constructor, input) {\n    this._instanceConstructor = Constructor;\n    this.promise = new Constructor(noop);\n\n    if (!this.promise[PROMISE_ID]) {\n      makePromise(this.promise);\n    }\n\n    if (isArray(input)) {\n      this.length = input.length;\n      this._remaining = input.length;\n\n      this._result = new Array(this.length);\n\n      if (this.length === 0) {\n        fulfill(this.promise, this._result);\n      } else {\n        this.length = this.length || 0;\n        this._enumerate(input);\n        if (this._remaining === 0) {\n          fulfill(this.promise, this._result);\n        }\n      }\n    } els
 e {\n      reject(this.promise, validationError());\n    }\n  }\n\n  Enumerator.prototype._enumerate = function _enumerate(input) {\n    for (var i = 0; this._state === PENDING && i < input.length; i++) {\n      this._eachEntry(input[i], i);\n    }\n  };\n\n  Enumerator.prototype._eachEntry = function _eachEntry(entry, i) {\n    var c = this._instanceConstructor;\n    var resolve = c.resolve;\n\n\n    if (resolve === originalResolve) {\n      var _then = getThen(entry);\n\n      if (_then === originalThen && entry._state !== PENDING) {\n        this._settledAt(entry._state, i, entry._result);\n      } else if (typeof _then !== 'function') {\n        this._remaining--;\n        this._result[i] = entry;\n      } else if (c === Promise) {\n        var promise = new c(noop);\n        handleMaybeThenable(promise, entry, _then);\n        this._willSettleAt(promise, i);\n      } else {\n        this._willSettleAt(new c(function (resolve) {\n          return resolve(entry);\n        }), i);
 \n      }\n    } else {\n      this._willSettleAt(resolve(entry), i);\n    }\n  };\n\n  Enumerator.prototype._settledAt = function _settledAt(state, i, value) {\n    var promise = this.promise;\n\n\n    if (promise._state === PENDING) {\n      this._remaining--;\n\n      if (state === REJECTED) {\n        reject(promise, value);\n      } else {\n        this._result[i] = value;\n      }\n    }\n\n    if (this._remaining === 0) {\n      fulfill(promise, this._result);\n    }\n  };\n\n  Enumerator.prototype._willSettleAt = function _willSettleAt(promise, i) {\n    var enumerator = this;\n\n    subscribe(promise, undefined, function (value) {\n      return enumerator._settledAt(FULFILLED, i, value);\n    }, function (reason) {\n      return enumerator._settledAt(REJECTED, i, reason);\n    });\n  };\n\n  return Enumerator;\n}();\n\nexport default Enumerator;\n;","import Enumerator from '../enumerator';\n\n/**\n  `Promise.all` accepts an array of promises, and returns a new promise which
 \n  is fulfilled with an array of fulfillment values for the passed promises, or\n  rejected with the reason of the first passed promise to be rejected. It casts all\n  elements of the passed iterable to promises as it runs this algorithm.\n\n  Example:\n\n  ```javascript\n  let promise1 = resolve(1);\n  let promise2 = resolve(2);\n  let promise3 = resolve(3);\n  let promises = [ promise1, promise2, promise3 ];\n\n  Promise.all(promises).then(function(array){\n    // The array here would be [ 1, 2, 3 ];\n  });\n  ```\n\n  If any of the `promises` given to `all` are rejected, the first promise\n  that is rejected will be given as an argument to the returned promises's\n  rejection handler. For example:\n\n  Example:\n\n  ```javascript\n  let promise1 = resolve(1);\n  let promise2 = reject(new Error(\"2\"));\n  let promise3 = reject(new Error(\"3\"));\n  let promises = [ promise1, promise2, promise3 ];\n\n  Promise.all(promises).then(function(array){\n    // Code here never runs becau
 se there are rejected promises!\n  }, function(error) {\n    // error.message === \"2\"\n  });\n  ```\n\n  @method all\n  @static\n  @param {Array} entries array of promises\n  @param {String} label optional string for labeling the promise.\n  Useful for tooling.\n  @return {Promise} promise that is fulfilled when all `promises` have been\n  fulfilled, or rejected if any of them become rejected.\n  @static\n*/\nexport default function all(entries) {\n  return new Enumerator(this, entries).promise;\n}","import { isArray } from \"../utils\";\n\n/**\n  `Promise.race` returns a new promise which is settled in the same way as the\n  first passed promise to settle.\n\n  Example:\n\n  ```javascript\n  let promise1 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 1');\n    }, 200);\n  });\n\n  let promise2 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 2');\n    }, 100);\n  });\n\n  Promise.race([promi
 se1, promise2]).then(function(result){\n    // result === 'promise 2' because it was resolved before promise1\n    // was resolved.\n  });\n  ```\n\n  `Promise.race` is deterministic in that only the state of the first\n  settled promise matters. For example, even if other promises given to the\n  `promises` array argument are resolved, but the first settled promise has\n  become rejected before the other promises became fulfilled, the returned\n  promise will become rejected:\n\n  ```javascript\n  let promise1 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 1');\n    }, 200);\n  });\n\n  let promise2 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      reject(new Error('promise 2'));\n    }, 100);\n  });\n\n  Promise.race([promise1, promise2]).then(function(result){\n    // Code here never runs\n  }, function(reason){\n    // reason.message === 'promise 2' because promise 2 became rejected before\n    // promise 1 
 became fulfilled\n  });\n  ```\n\n  An example real-world use case is implementing timeouts:\n\n  ```javascript\n  Promise.race([ajax('foo.json'), timeout(5000)])\n  ```\n\n  @method race\n  @static\n  @param {Array} promises array of promises to observe\n  Useful for tooling.\n  @return {Promise} a promise which settles in the same way as the first passed\n  promise to settle.\n*/\nexport default function race(entries) {\n  /*jshint validthis:true */\n  var Constructor = this;\n\n  if (!isArray(entries)) {\n    return new Constructor(function (_, reject) {\n      return reject(new TypeError('You must pass an array to race.'));\n    });\n  } else {\n    return new Constructor(function (resolve, reject) {\n      var length = entries.length;\n      for (var i = 0; i < length; i++) {\n        Constructor.resolve(entries[i]).then(resolve, reject);\n      }\n    });\n  }\n}","import { noop, reject as _reject } from '../-internal';\n\n/**\n  `Promise.reject` returns a promise rejected wit
 h the passed `reason`.\n  It is shorthand for the following:\n\n  ```javascript\n  let promise = new Promise(function(resolve, reject){\n    reject(new Error('WHOOPS'));\n  });\n\n  promise.then(function(value){\n    // Code here doesn't run because the promise is rejected!\n  }, function(reason){\n    // reason.message === 'WHOOPS'\n  });\n  ```\n\n  Instead of writing the above, your code now simply becomes the following:\n\n  ```javascript\n  let promise = Promise.reject(new Error('WHOOPS'));\n\n  promise.then(function(value){\n    // Code here doesn't run because the promise is rejected!\n  }, function(reason){\n    // reason.message === 'WHOOPS'\n  });\n  ```\n\n  @method reject\n  @static\n  @param {Any} reason value that the returned promise will be rejected with.\n  Useful for tooling.\n  @return {Promise} a promise rejected with the given `reason`.\n*/\nexport default function reject(reason) {\n  /*jshint validthis:true */\n  var Constructor = this;\n  var promise = new Con
 structor(noop);\n  _reject(promise, reason);\n  return promise;\n}","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nimport { isFunction } from './utils';\nimport { noop, nextId, PROMISE_ID, initializePromise } from './-internal';\nimport { asap, setAsap, setScheduler } from './asap';\n\nimport all from './promise/all';\nimport race from './promise/race';\nimport Resolve from './promise/resolve';\nimport Reject from './promise/reject';\nimport then from './then';\n\nfunction needsResolver() {\n  throw new TypeError('You must pass a resolver function as the first argument to the promise constructor');\n}\n\nfunction needsNew() {\n  throw new TypeError(\"Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.\");\n}\n\n/**\n  Promise objects represent the eventual result of an asynchronous operation. The\n  primary
  way of interacting with a promise is through its `then` method, which\n  registers callbacks to receive either a promise's eventual value or the reason\n  why the promise cannot be fulfilled.\n\n  Terminology\n  -----------\n\n  - `promise` is an object or function with a `then` method whose behavior conforms to this specification.\n  - `thenable` is an object or function that defines a `then` method.\n  - `value` is any legal JavaScript value (including undefined, a thenable, or a promise).\n  - `exception` is a value that is thrown using the throw statement.\n  - `reason` is a value that indicates why a promise was rejected.\n  - `settled` the final resting state of a promise, fulfilled or rejected.\n\n  A promise can be in one of three states: pending, fulfilled, or rejected.\n\n  Promises that are fulfilled have a fulfillment value and are in the fulfilled\n  state.  Promises that are rejected have a rejection reason and are in the\n  rejected state.  A fulfillment value is nev
 er a thenable.\n\n  Promises can also be said to *resolve* a value.  If this value is also a\n  promise, then the original promise's settled state will match the value's\n  settled state.  So a promise that *resolves* a promise that rejects will\n  itself reject, and a promise that *resolves* a promise that fulfills will\n  itself fulfill.\n\n\n  Basic Usage:\n  ------------\n\n  ```js\n  let promise = new Promise(function(resolve, reject) {\n    // on success\n    resolve(value);\n\n    // on failure\n    reject(reason);\n  });\n\n  promise.then(function(value) {\n    // on fulfillment\n  }, function(reason) {\n    // on rejection\n  });\n  ```\n\n  Advanced Usage:\n  ---------------\n\n  Promises shine when abstracting away asynchronous interactions such as\n  `XMLHttpRequest`s.\n\n  ```js\n  function getJSON(url) {\n    return new Promise(function(resolve, reject){\n      let xhr = new XMLHttpRequest();\n\n      xhr.open('GET', url);\n      xhr.onreadystatechange = handler;\n    
   xhr.responseType = 'json';\n      xhr.setRequestHeader('Accept', 'application/json');\n      xhr.send();\n\n      function handler() {\n        if (this.readyState === this.DONE) {\n          if (this.status === 200) {\n            resolve(this.response);\n          } else {\n            reject(new Error('getJSON: `' + url + '` failed with status: [' + this.status + ']'));\n          }\n        }\n      };\n    });\n  }\n\n  getJSON('/posts.json').then(function(json) {\n    // on fulfillment\n  }, function(reason) {\n    // on rejection\n  });\n  ```\n\n  Unlike callbacks, promises are great composable primitives.\n\n  ```js\n  Promise.all([\n    getJSON('/posts'),\n    getJSON('/comments')\n  ]).then(function(values){\n    values[0] // => postsJSON\n    values[1] // => commentsJSON\n\n    return values;\n  });\n  ```\n\n  @class Promise\n  @param {Function} resolver\n  Useful for tooling.\n  @constructor\n*/\n\nvar Promise = function () {\n  function Promise(resolver) {\n    this
 [PROMISE_ID] = nextId();\n    this._result = this._state = undefined;\n    this._subscribers = [];\n\n    if (noop !== resolver) {\n      typeof resolver !== 'function' && needsResolver();\n      this instanceof Promise ? initializePromise(this, resolver) : needsNew();\n    }\n  }\n\n  /**\n  The primary way of interacting with a promise is through its `then` method,\n  which registers callbacks to receive either a promise's eventual value or the\n  reason why the promise cannot be fulfilled.\n   ```js\n  findUser().then(function(user){\n    // user is available\n  }, function(reason){\n    // user is unavailable, and you are given the reason why\n  });\n  ```\n   Chaining\n  --------\n   The return value of `then` is itself a promise.  This second, 'downstream'\n  promise is resolved with the return value of the first promise's fulfillment\n  or rejection handler, or rejected if the handler throws an exception.\n   ```js\n  findUser().then(function (user) {\n    return user.name;\n
   }, function (reason) {\n    return 'default name';\n  }).then(function (userName) {\n    // If `findUser` fulfilled, `userName` will be the user's name, otherwise it\n    // will be `'default name'`\n  });\n   findUser().then(function (user) {\n    throw new Error('Found user, but still unhappy');\n  }, function (reason) {\n    throw new Error('`findUser` rejected and we're unhappy');\n  }).then(function (value) {\n    // never reached\n  }, function (reason) {\n    // if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.\n    // If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.\n  });\n  ```\n  If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.\n   ```js\n  findUser().then(function (user) {\n    throw new PedagogicalException('Upstream error');\n  }).then(function (value) {\n    // never reached\n  }).then(function (value) {\n    // never reached\n  }, functi
 on (reason) {\n    // The `PedgagocialException` is propagated all the way down to here\n  });\n  ```\n   Assimilation\n  ------------\n   Sometimes the value you want to propagate to a downstream promise can only be\n  retrieved asynchronously. This can be achieved by returning a promise in the\n  fulfillment or rejection handler. The downstream promise will then be pending\n  until the returned promise is settled. This is called *assimilation*.\n   ```js\n  findUser().then(function (user) {\n    return findCommentsByAuthor(user);\n  }).then(function (comments) {\n    // The user's comments are now available\n  });\n  ```\n   If the assimliated promise rejects, then the downstream promise will also reject.\n   ```js\n  findUser().then(function (user) {\n    return findCommentsByAuthor(user);\n  }).then(function (comments) {\n    // If `findCommentsByAuthor` fulfills, we'll have the value here\n  }, function (reason) {\n    // If `findCommentsByAuthor` rejects, we'll have the reason
  here\n  });\n  ```\n   Simple Example\n  --------------\n   Synchronous Example\n   ```javascript\n  let result;\n   try {\n    result = findResult();\n    // success\n  } catch(reason) {\n    // failure\n  }\n  ```\n   Errback Example\n   ```js\n  findResult(function(result, err){\n    if (err) {\n      // failure\n    } else {\n      // success\n    }\n  });\n  ```\n   Promise Example;\n   ```javascript\n  findResult().then(function(result){\n    // success\n  }, function(reason){\n    // failure\n  });\n  ```\n   Advanced Example\n  --------------\n   Synchronous Example\n   ```javascript\n  let author, books;\n   try {\n    author = findAuthor();\n    books  = findBooksByAuthor(author);\n    // success\n  } catch(reason) {\n    // failure\n  }\n  ```\n   Errback Example\n   ```js\n   function foundBooks(books) {\n   }\n   function failure(reason) {\n   }\n   findAuthor(function(author, err){\n    if (err) {\n      failure(err);\n      // failure\n    } else {\n      try {\n    
     findBoooksByAuthor(author, function(books, err) {\n          if (err) {\n            failure(err);\n          } else {\n            try {\n              foundBooks(books);\n            } catch(reason) {\n              failure(reason);\n            }\n          }\n        });\n      } catch(error) {\n        failure(err);\n      }\n      // success\n    }\n  });\n  ```\n   Promise Example;\n   ```javascript\n  findAuthor().\n    then(findBooksByAuthor).\n    then(function(books){\n      // found books\n  }).catch(function(reason){\n    // something went wrong\n  });\n  ```\n   @method then\n  @param {Function} onFulfilled\n  @param {Function} onRejected\n  Useful for tooling.\n  @return {Promise}\n  */\n\n  /**\n  `catch` is simply sugar for `then(undefined, onRejection)` which makes it the same\n  as the catch block of a try/catch statement.\n  ```js\n  function findAuthor(){\n  throw new Error('couldn't find that author');\n  }\n  // synchronous\n  try {\n  findAuthor();\n  } c
 atch(reason) {\n  // something went wrong\n  }\n  // async with promises\n  findAuthor().catch(function(reason){\n  // something went wrong\n  });\n  ```\n  @method catch\n  @param {Function} onRejection\n  Useful for tooling.\n  @return {Promise}\n  */\n\n\n  Promise.prototype.catch = function _catch(onRejection) {\n    return this.then(null, onRejection);\n  };\n\n  /**\n    `finally` will be invoked regardless of the promise's fate just as native\n    try/catch/finally behaves\n  \n    Synchronous example:\n  \n    ```js\n    findAuthor() {\n      if (Math.random() > 0.5) {\n        throw new Error();\n      }\n      return new Author();\n    }\n  \n    try {\n      return findAuthor(); // succeed or fail\n    } catch(error) {\n      return findOtherAuther();\n    } finally {\n      // always runs\n      // doesn't affect the return value\n    }\n    ```\n  \n    Asynchronous example:\n  \n    ```js\n    findAuthor().catch(function(reason){\n      return findOtherAuther();\n    }
 ).finally(function(){\n      // author was either found, or not\n    });\n    ```\n  \n    @method finally\n    @param {Function} callback\n    @return {Promise}\n  */\n\n\n  Promise.prototype.finally = function _finally(callback) {\n    var promise = this;\n    var constructor = promise.constructor;\n\n    return promise.then(function (value) {\n      return constructor.resolve(callback()).then(function () {\n        return value;\n      });\n    }, function (reason) {\n      return constructor.resolve(callback()).then(function () {\n        throw reason;\n      });\n    });\n  };\n\n  return Promise;\n}();\n\nPromise.prototype.then = then;\nexport default Promise;\nPromise.all = all;\nPromise.race = race;\nPromise.resolve = Resolve;\nPromise.reject = Reject;\nPromise._setScheduler = setScheduler;\nPromise._setAsap = setAsap;\nPromise._asap = asap;","/*global self*/\nimport Promise from './promise';\n\nexport default function polyfill() {\n  var local = void 0;\n\n  if (typeof glob
 al !== 'undefined') {\n    local = global;\n  } else if (typeof self !== 'undefined') {\n    local = self;\n  } else {\n    try {\n      local = Function('return this')();\n    } catch (e) {\n      throw new Error('polyfill failed because global object is unavailable in this environment');\n    }\n  }\n\n  var P = local.Promise;\n\n  if (P) {\n    var promiseToString = null;\n    try {\n      promiseToString = Object.prototype.toString.call(P.resolve());\n    } catch (e) {\n      // silently ignored\n    }\n\n    if (promiseToString === '[object Promise]' && !P.cast) {\n      return;\n    }\n  }\n\n  local.Promise = Promise;\n}","import Promise from './es6-promise/promise';\nimport polyfill from './es6-promise/polyfill';\n\n// Strange compat..\nPromise.polyfill = polyfill;\nPromise.Promise = Promise;\nexport default Promise;"],"names":["resolve","_resolve","then","originalThen","originalResolve","Promise","reject","_reject","Resolve","Reject"],"mappings":"AAAA;AACA;AACA;AACA;AACA;AA
 CA;AACA;;;;;;;;ACNO,SAAS,gBAAgB,CAAC,CAAC,EAAE;EAClC,IAAI,IAAI,GAAG,OAAO,CAAC,CAAC;EACpB,OAAO,CAAC,KAAK,IAAI,KAAK,IAAI,KAAK,QAAQ,IAAI,IAAI,KAAK,UAAU,CAAC,CAAC;CACjE;;AAED,AAAO,SAAS,UAAU,CAAC,CAAC,EAAE;EAC5B,OAAO,OAAO,CAAC,KAAK,UAAU,CAAC;CAChC;;AAED,AAEC;;AAED,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC;AACtB,IAAI,KAAK,CAAC,OAAO,EAAE;EACjB,QAAQ,GAAG,KAAK,CAAC,OAAO,CAAC;CAC1B,MAAM;EACL,QAAQ,GAAG,UAAU,CAAC,EAAE;IACtB,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC,KAAK,gBAAgB,CAAC;GAC/D,CAAC;CACH;;AAED,AAAO,IAAI,OAAO,GAAG,QAAQ;;ACtB7B,IAAI,GAAG,GAAG,CAAC,CAAC;AACZ,IAAI,SAAS,GAAG,KAAK,CAAC,CAAC;AACvB,IAAI,iBAAiB,GAAG,KAAK,CAAC,CAAC;;AAE/B,AAAO,IAAI,IAAI,GAAG,SAAS,IAAI,CAAC,QAAQ,EAAE,GAAG,EAAE;EAC7C,KAAK,CAAC,GAAG,CAAC,GAAG,QAAQ,CAAC;EACtB,KAAK,CAAC,GAAG,GAAG,CAAC,CAAC,GAAG,GAAG,CAAC;EACrB,GAAG,IAAI,CAAC,CAAC;EACT,IAAI,GAAG,KAAK,CAAC,EAAE;;;;IAIb,IAAI,iBAAiB,EAAE;MACrB,iBAAiB,CAAC,KAAK,CAAC,CAAC;KAC1B,MAAM;MACL,aAAa,EAAE,CAAC;KACjB;GACF;CACF,CAAC;;AAEF,AAAO,SAAS,YAAY,CAAC,UAAU,EAAE;EACvC,iBAAiB
 ,GAAG,UAAU,CAAC;CAChC;;AAED,AAAO,SAAS,OAAO,CAAC,MAAM,EAAE;EAC9B,IAAI,GAAG,MAAM,CAAC;CACf;;AAED,IAAI,aAAa,GAAG,OAAO,MAAM,KAAK,WAAW,GAAG,MAAM,GAAG,SAAS,CAAC;AACvE,IAAI,aAAa,GAAG,aAAa,IAAI,EAAE,CAAC;AACxC,IAAI,uBAAuB,GAAG,aAAa,CAAC,gBAAgB,IAAI,aAAa,CAAC,sBAAsB,CAAC;AACrG,IAAI,MAAM,GAAG,OAAO,IAAI,KAAK,WAAW,IAAI,OAAO,OAAO,KAAK,WAAW,IAAI,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,OAAO,CAAC,KAAK,kBAAkB,CAAC;;;AAG/H,IAAI,QAAQ,GAAG,OAAO,iBAAiB,KAAK,WAAW,IAAI,OAAO,aAAa,KAAK,WAAW,IAAI,OAAO,cAAc,KAAK,WAAW,CAAC;;;AAGzI,SAAS,WAAW,GAAG;;;EAGrB,OAAO,YAAY;IACjB,OAAO,OAAO,CAAC,QAAQ,CAAC,KAAK,CAAC,CAAC;GAChC,CAAC;CACH;;;AAGD,SAAS,aAAa,GAAG;EACvB,IAAI,OAAO,SAAS,KAAK,WAAW,EAAE;IACpC,OAAO,YAAY;MACjB,SAAS,CAAC,KAAK,CAAC,CAAC;KAClB,CAAC;GACH;;EAED,OAAO,aAAa,EAAE,CAAC;CACxB;;AAED,SAAS,mBAAmB,GAAG;EAC7B,IAAI,UAAU,GAAG,CAAC,CAAC;EACnB,IAAI,QAAQ,GAAG,IAAI,uBAAuB,CAAC,KAAK,CAAC,CAAC;EAClD,IAAI,IAAI,GAAG,QAAQ,CAAC,cAAc,CAAC,EAAE,CAAC,CAAC;EACvC,QAAQ,CAAC,OAAO,CAAC,IAAI,EAAE,EAAE,aAAa,EAAE,IAAI,EAAE,CAAC,CAAC;;EAEhD,OAAO,YAAY
 ;IACjB,IAAI,CAAC,IAAI,GAAG,UAAU,GAAG,EAAE,UAAU,GAAG,CAAC,CAAC;GAC3C,CAAC;CACH;;;AAGD,SAAS,iBAAiB,GAAG;EAC3B,IAAI,OAAO,GAAG,IAAI,cAAc,EAAE,CAAC;EACnC,OAAO,CAAC,KAAK,CAAC,SAAS,GAAG,KAAK,CAAC;EAChC,OAAO,YAAY;IACjB,OAAO,OAAO,CAAC,KAAK,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC;GACrC,CAAC;CACH;;AAED,SAAS,aAAa,GAAG;;;EAGvB,IAAI,gBAAgB,GAAG,UAAU,CAAC;EAClC,OAAO,YAAY;IACjB,OAAO,gBAAgB,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;GACnC,CAAC;CACH;;AAED,IAAI,KAAK,GAAG,IAAI,KAAK,CAAC,IAAI,CAAC,CAAC;AAC5B,SAAS,KAAK,GAAG;EACf,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,GAAG,EAAE,CAAC,IAAI,CAAC,EAAE;IAC/B,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC,CAAC,CAAC;IACxB,IAAI,GAAG,GAAG,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC;;IAEvB,QAAQ,CAAC,GAAG,CAAC,CAAC;;IAEd,KAAK,CAAC,CAAC,CAAC,GAAG,SAAS,CAAC;IACrB,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,GAAG,SAAS,CAAC;GAC1B;;EAED,GAAG,GAAG,CAAC,CAAC;CACT;;AAED,SAAS,YAAY,GAAG;EACtB,IAAI;IACF,IAAI,KAAK,GAAG,QAAQ,CAAC,aAAa,CAAC,EAAE,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;IACvD,SAAS,GAAG,KAAK,CAAC,SAAS,IAAI,KAAK,CAAC,YAAY,CAAC;IAClD,OAAO,
 aAAa,EAAE,CAAC;GACxB,CAAC,OAAO,CAAC,EAAE;IACV,OAAO,aAAa,EAAE,CAAC;GACxB;CACF;;AAED,IAAI,aAAa,GAAG,KAAK,CAAC,CAAC;;AAE3B,IAAI,MAAM,EAAE;EACV,aAAa,GAAG,WAAW,EAAE,CAAC;CAC/B,MAAM,IAAI,uBAAuB,EAAE;EAClC,aAAa,GAAG,mBAAmB,EAAE,CAAC;CACvC,MAAM,IAAI,QAAQ,EAAE;EACnB,aAAa,GAAG,iBAAiB,EAAE,CAAC;CACrC,MAAM,IAAI,aAAa,KAAK,SAAS,IAAI,OAAO,OAAO,KAAK,UAAU,EAAE;EACvE,aAAa,GAAG,YAAY,EAAE,CAAC;CAChC,MAAM;EACL,aAAa,GAAG,aAAa,EAAE,CAAC;;;CACjC,DCtHc,SAAS,IAAI,CAAC,aAAa,EAAE,WAAW,EAAE;EACvD,IAAI,MAAM,GAAG,IAAI,CAAC;;EAElB,IAAI,KAAK,GAAG,IAAI,IAAI,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC;;EAEvC,IAAI,KAAK,CAAC,UAAU,CAAC,KAAK,SAAS,EAAE;IACnC,WAAW,CAAC,KAAK,CAAC,CAAC;GACpB;;EAED,IAAI,MAAM,GAAG,MAAM,CAAC,MAAM,CAAC;;;EAG3B,IAAI,MAAM,EAAE;IACV,IAAI,QAAQ,GAAG,SAAS,CAAC,MAAM,GAAG,CAAC,CAAC,CAAC;IACrC,IAAI,CAAC,YAAY;MACf,OAAO,cAAc,CAAC,MAAM,EAAE,KAAK,EAAE,QAAQ,EAAE,MAAM,CAAC,OAAO,CAAC,CAAC;KAChE,CAAC,CAAC;GACJ,MAAM;IACL,SAAS,CAAC,MAAM,EAAE,KAAK,EAAE,aAAa,EAAE,WAAW,CAAC,CAAC;GACtD;;EAED,OAAO,KAAK,CAAC;;;CACd,DCxBD;;;;;;;;;;;;;
 ;;;;;;;;;;;;;;;;;;AA+BA,AAAe,SAASA,SAAO,CAAC,MAAM,EAAE;;EAEtC,IAAI,WAAW,GAAG,IAAI,CAAC;;EAEvB,IAAI,MAAM,IAAI,OAAO,MAAM,KAAK,QAAQ,IAAI,MAAM,CAAC,WAAW,KAAK,WAAW,EAAE;IAC9E,OAAO,MAAM,CAAC;GACf;;EAED,IAAI,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;EACpCC,OAAQ,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;EAC1B,OAAO,OAAO,CAAC;;;CAChB,DCrCM,IAAI,UAAU,GAAG,IAAI,CAAC,MAAM,EAAE,CAAC,QAAQ,CAAC,EAAE,CAAC,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC;;AAEhE,SAAS,IAAI,GAAG,EAAE;;AAElB,IAAI,OAAO,GAAG,KAAK,CAAC,CAAC;AACrB,IAAI,SAAS,GAAG,CAAC,CAAC;AAClB,IAAI,QAAQ,GAAG,CAAC,CAAC;;AAEjB,IAAI,eAAe,GAAG,EAAE,KAAK,EAAE,IAAI,EAAE,CAAC;;AAEtC,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,SAAS,CAAC,0CAA0C,CAAC,CAAC;CAClE;;AAED,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,SAAS,CAAC,sDAAsD,CAAC,CAAC;CAC9E;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE;EACxB,IAAI;IACF,OAAO,OAAO,CAAC,IAAI,CAAC;GACrB,CAAC,OAAO,KAAK,EAAE;IACd,eAAe,CAAC,KAAK,GAAG,KAAK,CAAC;IAC9B,OAAO,eAAe,CAAC;GACxB;CACF;;AAED,SAAS,OAAO,CAACC,OAAI,EAAE,KAAK,EAAE,kBAAkB,EAAE,gBAAgB,EAAE;EAClE,IAAI;IACFA,OAAI,CAAC,IAAI,CAAC,KA
 AK,EAAE,kBAAkB,EAAE,gBAAgB,CAAC,CAAC;GACxD,CAAC,OAAO,CAAC,EAAE;IACV,OAAO,CAAC,CAAC;GACV;CACF;;AAED,SAAS,qBAAqB,CAAC,OAAO,EAAE,QAAQ,EAAEA,OAAI,EAAE;EACtD,IAAI,CAAC,UAAU,OAAO,EAAE;IACtB,IAAI,MAAM,GAAG,KAAK,CAAC;IACnB,IAAI,KAAK,GAAG,OAAO,CAACA,OAAI,EAAE,QAAQ,EAAE,UAAU,KAAK,EAAE;MACnD,IAAI,MAAM,EAAE;QACV,OAAO;OACR;MACD,MAAM,GAAG,IAAI,CAAC;MACd,IAAI,QAAQ,KAAK,KAAK,EAAE;QACtB,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACzB,MAAM;QACL,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACzB;KACF,EAAE,UAAU,MAAM,EAAE;MACnB,IAAI,MAAM,EAAE;QACV,OAAO;OACR;MACD,MAAM,GAAG,IAAI,CAAC;;MAEd,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KACzB,EAAE,UAAU,IAAI,OAAO,CAAC,MAAM,IAAI,kBAAkB,CAAC,CAAC,CAAC;;IAExD,IAAI,CAAC,MAAM,IAAI,KAAK,EAAE;MACpB,MAAM,GAAG,IAAI,CAAC;MACd,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KACxB;GACF,EAAE,OAAO,CAAC,CAAC;CACb;;AAED,SAAS,iBAAiB,CAAC,OAAO,EAAE,QAAQ,EAAE;EAC5C,IAAI,QAAQ,CAAC,MAAM,KAAK,SAAS,EAAE;IACjC,OAAO,CAAC,OAAO,EAAE,QAAQ,CAAC,OAAO,CAAC,CAAC;GACpC,MAAM,IAAI,QAAQ,CAAC,MAAM,KAAK,QAAQ,EAAE;IACvC,MAAM,CAAC,OAAO,E
 AAE,QAAQ,CAAC,OAAO,CAAC,CAAC;GACnC,MAAM;IACL,SAAS,CAAC,QAAQ,EAAE,SAAS,EAAE,UAAU,KAAK,EAAE;MAC9C,OAAO,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KAChC,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KAChC,CAAC,CAAC;GACJ;CACF;;AAED,SAAS,mBAAmB,CAAC,OAAO,EAAE,aAAa,EAAEA,OAAI,EAAE;EACzD,IAAI,aAAa,CAAC,WAAW,KAAK,OAAO,CAAC,WAAW,IAAIA,OAAI,KAAKC,IAAY,IAAI,aAAa,CAAC,WAAW,CAAC,OAAO,KAAKC,SAAe,EAAE;IACvI,iBAAiB,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;GAC3C,MAAM;IACL,IAAIF,OAAI,KAAK,eAAe,EAAE;MAC5B,MAAM,CAAC,OAAO,EAAE,eAAe,CAAC,KAAK,CAAC,CAAC;MACvC,eAAe,CAAC,KAAK,GAAG,IAAI,CAAC;KAC9B,MAAM,IAAIA,OAAI,KAAK,SAAS,EAAE;MAC7B,OAAO,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;KACjC,MAAM,IAAI,UAAU,CAACA,OAAI,CAAC,EAAE;MAC3B,qBAAqB,CAAC,OAAO,EAAE,aAAa,EAAEA,OAAI,CAAC,CAAC;KACrD,MAAM;MACL,OAAO,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;KACjC;GACF;CACF;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE,KAAK,EAAE;EAC/B,IAAI,OAAO,KAAK,KAAK,EAAE;IACrB,MAAM,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;GACpC,MAAM,IAAI,gBAAgB,CAAC,KAAK,CAAC,EAAE;IAClC,mBAAmB,CAAC,OAA
 O,EAAE,KAAK,EAAE,OAAO,CAAC,KAAK,CAAC,CAAC,CAAC;GACrD,MAAM;IACL,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB;CACF;;AAED,SAAS,gBAAgB,CAAC,OAAO,EAAE;EACjC,IAAI,OAAO,CAAC,QAAQ,EAAE;IACpB,OAAO,CAAC,QAAQ,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;GACnC;;EAED,OAAO,CAAC,OAAO,CAAC,CAAC;CAClB;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE,KAAK,EAAE;EAC/B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;IAC9B,OAAO;GACR;;EAED,OAAO,CAAC,OAAO,GAAG,KAAK,CAAC;EACxB,OAAO,CAAC,MAAM,GAAG,SAAS,CAAC;;EAE3B,IAAI,OAAO,CAAC,YAAY,CAAC,MAAM,KAAK,CAAC,EAAE;IACrC,IAAI,CAAC,OAAO,EAAE,OAAO,CAAC,CAAC;GACxB;CACF;;AAED,SAAS,MAAM,CAAC,OAAO,EAAE,MAAM,EAAE;EAC/B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;IAC9B,OAAO;GACR;EACD,OAAO,CAAC,MAAM,GAAG,QAAQ,CAAC;EAC1B,OAAO,CAAC,OAAO,GAAG,MAAM,CAAC;;EAEzB,IAAI,CAAC,gBAAgB,EAAE,OAAO,CAAC,CAAC;CACjC;;AAED,SAAS,SAAS,CAAC,MAAM,EAAE,KAAK,EAAE,aAAa,EAAE,WAAW,EAAE;EAC5D,IAAI,YAAY,GAAG,MAAM,CAAC,YAAY,CAAC;EACvC,IAAI,MAAM,GAAG,YAAY,CAAC,MAAM,CAAC;;;EAGjC,MAAM,CAAC,QAAQ,GAAG,IAAI,CAAC;;EAEvB,YAAY,CAAC,MAAM,CAAC,GAAG,KAAK,CAAC;EAC7B,YAAY,CAA
 C,MAAM,GAAG,SAAS,CAAC,GAAG,aAAa,CAAC;EACjD,YAAY,CAAC,MAAM,GAAG,QAAQ,CAAC,GAAG,WAAW,CAAC;;EAE9C,IAAI,MAAM,KAAK,CAAC,IAAI,MAAM,CAAC,MAAM,EAAE;IACjC,IAAI,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;GACvB;CACF;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE;EACxB,IAAI,WAAW,GAAG,OAAO,CAAC,YAAY,CAAC;EACvC,IAAI,OAAO,GAAG,OAAO,CAAC,MAAM,CAAC;;EAE7B,IAAI,WAAW,CAAC,MAAM,KAAK,CAAC,EAAE;IAC5B,OAAO;GACR;;EAED,IAAI,KAAK,GAAG,KAAK,CAAC;MACd,QAAQ,GAAG,KAAK,CAAC;MACjB,MAAM,GAAG,OAAO,CAAC,OAAO,CAAC;;EAE7B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,WAAW,CAAC,MAAM,EAAE,CAAC,IAAI,CAAC,EAAE;IAC9C,KAAK,GAAG,WAAW,CAAC,CAAC,CAAC,CAAC;IACvB,QAAQ,GAAG,WAAW,CAAC,CAAC,GAAG,OAAO,CAAC,CAAC;;IAEpC,IAAI,KAAK,EAAE;MACT,cAAc,CAAC,OAAO,EAAE,KAAK,EAAE,QAAQ,EAAE,MAAM,CAAC,CAAC;KAClD,MAAM;MACL,QAAQ,CAAC,MAAM,CAAC,CAAC;KAClB;GACF;;EAED,OAAO,CAAC,YAAY,CAAC,MAAM,GAAG,CAAC,CAAC;CACjC;;AAED,SAAS,QAAQ,CAAC,QAAQ,EAAE,MAAM,EAAE;EAClC,IAAI;IACF,OAAO,QAAQ,CAAC,MAAM,CAAC,CAAC;GACzB,CAAC,OAAO,CAAC,EAAE;IACV,eAAe,CAAC,KAAK,GAAG,CAAC,CAAC;IAC1B,OAAO,eAAe,CAAC;GACxB;CA
 CF;;AAED,SAAS,cAAc,CAAC,OAAO,EAAE,OAAO,EAAE,QAAQ,EAAE,MAAM,EAAE;EAC1D,IAAI,WAAW,GAAG,UAAU,CAAC,QAAQ,CAAC;MAClC,KAAK,GAAG,KAAK,CAAC;MACd,KAAK,GAAG,KAAK,CAAC;MACd,SAAS,GAAG,KAAK,CAAC;MAClB,MAAM,GAAG,KAAK,CAAC,CAAC;;EAEpB,IAAI,WAAW,EAAE;IACf,KAAK,GAAG,QAAQ,CAAC,QAAQ,EAAE,MAAM,CAAC,CAAC;;IAEnC,IAAI,KAAK,KAAK,eAAe,EAAE;MAC7B,MAAM,GAAG,IAAI,CAAC;MACd,KAAK,GAAG,KAAK,CAAC,KAAK,CAAC;MACpB,KAAK,CAAC,KAAK,GAAG,IAAI,CAAC;KACpB,MAAM;MACL,SAAS,GAAG,IAAI,CAAC;KAClB;;IAED,IAAI,OAAO,KAAK,KAAK,EAAE;MACrB,MAAM,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;MACnC,OAAO;KACR;GACF,MAAM;IACL,KAAK,GAAG,MAAM,CAAC;IACf,SAAS,GAAG,IAAI,CAAC;GAClB;;EAED,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;;GAE/B,MAAM,IAAI,WAAW,IAAI,SAAS,EAAE;IACnC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB,MAAM,IAAI,MAAM,EAAE;IACjB,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACxB,MAAM,IAAI,OAAO,KAAK,SAAS,EAAE;IAChC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB,MAAM,IAAI,OAAO,KAAK,QAAQ,EAAE;IAC/B,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACxB;CACF;;AAED,SAAS,iBAAiB,CAAC,OAAO,EAAE
 ,QAAQ,EAAE;EAC5C,IAAI;IACF,QAAQ,CAAC,SAAS,cAAc,CAAC,KAAK,EAAE;MACtC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KACzB,EAAE,SAAS,aAAa,CAAC,MAAM,EAAE;MAChC,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KACzB,CAAC,CAAC;GACJ,CAAC,OAAO,CAAC,EAAE;IACV,MAAM,CAAC,OAAO,EAAE,CAAC,CAAC,CAAC;GACpB;CACF;;AAED,IAAI,EAAE,GAAG,CAAC,CAAC;AACX,SAAS,MAAM,GAAG;EAChB,OAAO,EAAE,EAAE,CAAC;CACb;;AAED,SAAS,WAAW,CAAC,OAAO,EAAE;EAC5B,OAAO,CAAC,UAAU,CAAC,GAAG,EAAE,EAAE,CAAC;EAC3B,OAAO,CAAC,MAAM,GAAG,SAAS,CAAC;EAC3B,OAAO,CAAC,OAAO,GAAG,SAAS,CAAC;EAC5B,OAAO,CAAC,YAAY,GAAG,EAAE,CAAC;CAC3B;;ACrPD,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,KAAK,CAAC,yCAAyC,CAAC,CAAC;CAC7D,AAAC;;AAEF,IAAI,UAAU,GAAG,YAAY;EAC3B,SAAS,UAAU,CAAC,WAAW,EAAE,KAAK,EAAE;IACtC,IAAI,CAAC,oBAAoB,GAAG,WAAW,CAAC;IACxC,IAAI,CAAC,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;;IAErC,IAAI,CAAC,IAAI,CAAC,OAAO,CAAC,UAAU,CAAC,EAAE;MAC7B,WAAW,CAAC,IAAI,CAAC,OAAO,CAAC,CAAC;KAC3B;;IAED,IAAI,OAAO,CAAC,KAAK,CAAC,EAAE;MAClB,IAAI,CAAC,MAAM,GAAG,KAAK,CAAC,MAAM,CAAC;MAC3B,IAAI,CAAC,UAAU,GAAG,KAAK,CAA
 C,MAAM,CAAC;;MAE/B,IAAI,CAAC,OAAO,GAAG,IAAI,KAAK,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;;MAEtC,IAAI,IAAI,CAAC,MAAM,KAAK,CAAC,EAAE;QACrB,OAAO,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;OACrC,MAAM;QACL,IAAI,CAAC,MAAM,GAAG,IAAI,CAAC,MAAM,IAAI,CAAC,CAAC;QAC/B,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC;QACvB,IAAI,IAAI,CAAC,UAAU,KAAK,CAAC,EAAE;UACzB,OAAO,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;SACrC;OACF;KACF,MAAM;MACL,MAAM,CAAC,IAAI,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;KACzC;GACF;;EAED,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE;IAC3D,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,IAAI,CAAC,MAAM,KAAK,OAAO,IAAI,CAAC,GAAG,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;MAChE,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC;KAC9B;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE,CAAC,EAAE;IAC9D,IAAI,CAAC,GAAG,IAAI,CAAC,oBAAoB,CAAC;IAClC,IAAIF,UAAO,GAAG,CAAC,CAAC,OAAO,CAAC;;;IAGxB,IAAIA,UAAO,KAAKI,SAAe,EAAE;MAC/B,IAAI,KAAK,GAAG,OAAO,CAAC,KAAK,CAAC,CAAC;;MAE3B,IAAI,KAAK,KAAKD,IAAY,
 IAAI,KAAK,CAAC,MAAM,KAAK,OAAO,EAAE;QACtD,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,KAAK,CAAC,OAAO,CAAC,CAAC;OACjD,MAAM,IAAI,OAAO,KAAK,KAAK,UAAU,EAAE;QACtC,IAAI,CAAC,UAAU,EAAE,CAAC;QAClB,IAAI,CAAC,OAAO,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC;OACzB,MAAM,IAAI,CAAC,KAAKE,SAAO,EAAE;QACxB,IAAI,OAAO,GAAG,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC;QAC1B,mBAAmB,CAAC,OAAO,EAAE,KAAK,EAAE,KAAK,CAAC,CAAC;QAC3C,IAAI,CAAC,aAAa,CAAC,OAAO,EAAE,CAAC,CAAC,CAAC;OAChC,MAAM;QACL,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,CAAC,UAAUL,UAAO,EAAE;UAC1C,OAAOA,UAAO,CAAC,KAAK,CAAC,CAAC;SACvB,CAAC,EAAE,CAAC,CAAC,CAAC;OACR;KACF,MAAM;MACL,IAAI,CAAC,aAAa,CAACA,UAAO,CAAC,KAAK,CAAC,EAAE,CAAC,CAAC,CAAC;KACvC;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE,CAAC,EAAE,KAAK,EAAE;IACrE,IAAI,OAAO,GAAG,IAAI,CAAC,OAAO,CAAC;;;IAG3B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;MAC9B,IAAI,CAAC,UAAU,EAAE,CAAC;;MAElB,IAAI,KAAK,KAAK,QAAQ,EAAE;QACtB,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACxB,MAAM;QACL,IAAI,CAAC,OAAO,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC;OACz
 B;KACF;;IAED,IAAI,IAAI,CAAC,UAAU,KAAK,CAAC,EAAE;MACzB,OAAO,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;KAChC;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,aAAa,GAAG,SAAS,aAAa,CAAC,OAAO,EAAE,CAAC,EAAE;IACtE,IAAI,UAAU,GAAG,IAAI,CAAC;;IAEtB,SAAS,CAAC,OAAO,EAAE,SAAS,EAAE,UAAU,KAAK,EAAE;MAC7C,OAAO,UAAU,CAAC,UAAU,CAAC,SAAS,EAAE,CAAC,EAAE,KAAK,CAAC,CAAC;KACnD,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,UAAU,CAAC,UAAU,CAAC,QAAQ,EAAE,CAAC,EAAE,MAAM,CAAC,CAAC;KACnD,CAAC,CAAC;GACJ,CAAC;;EAEF,OAAO,UAAU,CAAC;CACnB,EAAE;;ACzGH;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA+CA,AAAe,SAAS,GAAG,CAAC,OAAO,EAAE;EACnC,OAAO,IAAI,UAAU,CAAC,IAAI,EAAE,OAAO,CAAC,CAAC,OAAO,CAAC;;;CAC9C,DCjDD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAiEA,AAAe,SAAS,IAAI,CAAC,OAAO,EAAE;;EAEpC,IAAI,WAAW,GAAG,IAAI,CAAC;;EAEvB,IAAI,CAAC,OAAO,CAAC,OAAO,CAAC,EAAE;IACrB,OAAO,IAAI,WAAW,CAAC,UAAU,CAAC,EAAE,MAAM,EAAE;MAC1C,OAAO,MAAM,CAAC,IAAI,SAAS,CAAC,iCAAiC,CAAC,CAAC,CAAC;KACjE,CAAC,CAAC;GACJ,MAAM;IACL,OAAO,IAAI,WAAW,CAAC,UAAU,OAAO,EAAE
 ,MAAM,EAAE;MAChD,IAAI,MAAM,GAAG,OAAO,CAAC,MAAM,CAAC;MAC5B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,MAAM,EAAE,CAAC,EAAE,EAAE;QAC/B,WAAW,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,CAAC,IAAI,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;OACvD;KACF,CAAC,CAAC;GACJ;;;CACF,DCjFD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAkCA,AAAe,SAASM,QAAM,CAAC,MAAM,EAAE;;EAErC,IAAI,WAAW,GAAG,IAAI,CAAC;EACvB,IAAI,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;EACpCC,MAAO,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;EACzB,OAAO,OAAO,CAAC;;;CAChB,DC9BD,SAAS,aAAa,GAAG;EACvB,MAAM,IAAI,SAAS,CAAC,oFAAoF,CAAC,CAAC;CAC3G;;AAED,SAAS,QAAQ,GAAG;EAClB,MAAM,IAAI,SAAS,CAAC,uHAAuH,CAAC,CAAC;CAC9I;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA0GD,IAAIF,SAAO,GAAG,YAAY;EACxB,SAAS,OAAO,CAAC,QAAQ,EAAE;IACzB,IAAI,CAAC,UAAU,CAAC,GAAG,MAAM,EAAE,CAAC;IAC5B,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC,MAAM,GAAG,SAAS,CAAC;IACvC,IAAI,CAAC,YAAY,GAAG,EAAE,CAAC;;IAEvB,IAAI,IAAI,KAAK,QAAQ,EAAE;MACrB,OAAO,QAAQ,KAAK,UAAU,IAAI,aAAa,EAAE,CAAC;M
 AClD,IAAI,YAAY,OAAO,GAAG,iBAAiB,CAAC,IAAI,EAAE,QAAQ,CAAC,GAAG,QAAQ,EAAE,CAAC;KAC1E;GACF;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;EA4LD,OAAO,CAAC,SAAS,CAAC,KAAK,GAAG,SAAS,MAAM,CAAC,WAAW,EAAE;IACrD,OAAO,IAAI,CAAC,IAAI,CAAC,IAAI,EAAE,WAAW,CAAC,CAAC;GACrC,CAAC;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;EA0CF,OAAO,CAAC,SAAS,CAAC,OAAO,GAAG,SAAS,QAAQ,CAAC,QAAQ,EAAE;IACtD,IAAI,OAAO,GAAG,IAAI,CAAC;IACnB,IAAI,WAAW,GAAG,OAAO,CAAC,WAAW,CAAC;;IAEtC,OAAO,OAAO,CAAC,IAAI,CAAC,UAAU,KAAK,EAAE;MACnC,OAAO,WAAW,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,IAAI,CAAC,YAAY;QACtD,OAAO,KAAK,CAAC;OACd,CAAC,CAAC;KACJ,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,WAAW,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,IAAI,CAAC,YAAY;QACtD,MAAM,MAAM,CAAC;OACd,CAAC,CAAC;KACJ,CAAC,CAAC;GACJ,CAAC;;EAEF,OAAO,OAAO,CAAC;CAChB,EAAE,CAAC;;AAEJA,SAAO,CAAC,SAAS,CAAC,IAAI,GAAG,IAAI,CAAC;AAC9B,AACAA,SAAO,CAAC,GAAG,GAAG,GAA
 G,CAAC;AAClBA,SAAO,CAAC,IAAI,GAAG,IAAI,CAAC;AACpBA,SAAO,CAAC,OAAO,GAAGG,SAAO,CAAC;AAC1BH,SAAO,CAAC,MAAM,GAAGI,QAAM,CAAC;AACxBJ,SAAO,CAAC,aAAa,GAAG,YAAY,CAAC;AACrCA,SAAO,CAAC,QAAQ,GAAG,OAAO,CAAC;AAC3BA,SAAO,CAAC,KAAK,GAAG,IAAI;;ACxYpB;AACA,AAEe,SAAS,QAAQ,GAAG;EACjC,IAAI,KAAK,GAAG,KAAK,CAAC,CAAC;;EAEnB,IAAI,OAAO,MAAM,KAAK,WAAW,EAAE;IACjC,KAAK,GAAG,MAAM,CAAC;GAChB,MAAM,IAAI,OAAO,IAAI,KAAK,WAAW,EAAE;IACtC,KAAK,GAAG,IAAI,CAAC;GACd,MAAM;IACL,IAAI;MACF,KAAK,GAAG,QAAQ,CAAC,aAAa,CAAC,EAAE,CAAC;KACnC,CAAC,OAAO,CAAC,EAAE;MACV,MAAM,IAAI,KAAK,CAAC,0EAA0E,CAAC,CAAC;KAC7F;GACF;;EAED,IAAI,CAAC,GAAG,KAAK,CAAC,OAAO,CAAC;;EAEtB,IAAI,CAAC,EAAE;IACL,IAAI,eAAe,GAAG,IAAI,CAAC;IAC3B,IAAI;MACF,eAAe,GAAG,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC,OAAO,EAAE,CAAC,CAAC;KAC/D,CAAC,OAAO,CAAC,EAAE;;KAEX;;IAED,IAAI,eAAe,KAAK,kBAAkB,IAAI,CAAC,CAAC,CAAC,IAAI,EAAE;MACrD,OAAO;KACR;GACF;;EAED,KAAK,CAAC,OAAO,GAAGA,SAAO,CAAC;;;CACzB,DC/BD;AACAA,SAAO,CAAC,QAAQ,GAAG,QAAQ,CAAC;AAC5BA,SAAO,CAAC,OAAO,GAAGA,SAAO,CAAC;;;;
 ;;;;","file":"es6-promise.js"}
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.min.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.min.js b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.min.js
new file mode 100644
index 0000000..1d9dc48
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.min.js
@@ -0,0 +1 @@
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):t.ES6Promise=e()}(this,function(){"use strict";function t(t){var e=typeof t;return null!==t&&("object"===e||"function"===e)}function e(t){return"function"==typeof t}function n(t){B=t}function r(t){G=t}function o(){return function(){return process.nextTick(a)}}function i(){return"undefined"!=typeof z?function(){z(a)}:c()}function s(){var t=0,e=new J(a),n=document.createTextNode("");return e.observe(n,{characterData:!0}),function(){n.data=t=++t%2}}function u(){var t=new MessageChannel;return t.port1.onmessage=a,function(){return t.port2.postMessage(0)}}function c(){var t=setTimeout;return function(){return t(a,1)}}function a(){for(var t=0;t<W;t+=2){var e=V[t],n=V[t+1];e(n),V[t]=void 0,V[t+1]=void 0}W=0}function f(){try{var t=Function("return this")().require("vertx");return z=t.runOnLoop||t.runOnContext,i()}catch(e){return c()}}function l(t,e){var n=th
 is,r=new this.constructor(p);void 0===r[Z]&&O(r);var o=n._state;if(o){var i=arguments[o-1];G(function(){return P(o,r,i,n._result)})}else E(n,r,t,e);return r}function h(t){var e=this;if(t&&"object"==typeof t&&t.constructor===e)return t;var n=new e(p);return g(n,t),n}function p(){}function v(){return new TypeError("You cannot resolve a promise with itself")}function d(){return new TypeError("A promises callback cannot return that same promise.")}function _(t){try{return t.then}catch(e){return nt.error=e,nt}}function y(t,e,n,r){try{t.call(e,n,r)}catch(o){return o}}function m(t,e,n){G(function(t){var r=!1,o=y(n,e,function(n){r||(r=!0,e!==n?g(t,n):S(t,n))},function(e){r||(r=!0,j(t,e))},"Settle: "+(t._label||" unknown promise"));!r&&o&&(r=!0,j(t,o))},t)}function b(t,e){e._state===tt?S(t,e._result):e._state===et?j(t,e._result):E(e,void 0,function(e){return g(t,e)},function(e){return j(t,e)})}function w(t,n,r){n.constructor===t.constructor&&r===l&&n.constructor.resolve===h?b(t,n):r===nt?(j(
 t,nt.error),nt.error=null):void 0===r?S(t,n):e(r)?m(t,n,r):S(t,n)}function g(e,n){e===n?j(e,v()):t(n)?w(e,n,_(n)):S(e,n)}function A(t){t._onerror&&t._onerror(t._result),T(t)}function S(t,e){t._state===$&&(t._result=e,t._state=tt,0!==t._subscribers.length&&G(T,t))}function j(t,e){t._state===$&&(t._state=et,t._result=e,G(A,t))}function E(t,e,n,r){var o=t._subscribers,i=o.length;t._onerror=null,o[i]=e,o[i+tt]=n,o[i+et]=r,0===i&&t._state&&G(T,t)}function T(t){var e=t._subscribers,n=t._state;if(0!==e.length){for(var r=void 0,o=void 0,i=t._result,s=0;s<e.length;s+=3)r=e[s],o=e[s+n],r?P(n,r,o,i):o(i);t._subscribers.length=0}}function M(t,e){try{return t(e)}catch(n){return nt.error=n,nt}}function P(t,n,r,o){var i=e(r),s=void 0,u=void 0,c=void 0,a=void 0;if(i){if(s=M(r,o),s===nt?(a=!0,u=s.error,s.error=null):c=!0,n===s)return void j(n,d())}else s=o,c=!0;n._state!==$||(i&&c?g(n,s):a?j(n,u):t===tt?S(n,s):t===et&&j(n,s))}function x(t,e){try{e(function(e){g(t,e)},function(e){j(t,e)})}catch(n){j(
 t,n)}}function C(){return rt++}function O(t){t[Z]=rt++,t._state=void 0,t._result=void 0,t._subscribers=[]}function k(){return new Error("Array Methods must be provided an Array")}function F(t){return new ot(this,t).promise}function Y(t){var e=this;return new e(U(t)?function(n,r){for(var o=t.length,i=0;i<o;i++)e.resolve(t[i]).then(n,r)}:function(t,e){return e(new TypeError("You must pass an array to race."))})}function q(t){var e=this,n=new e(p);return j(n,t),n}function D(){throw new TypeError("You must pass a resolver function as the first argument to the promise constructor")}function K(){throw new TypeError("Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.")}function L(){var t=void 0;if("undefined"!=typeof global)t=global;else if("undefined"!=typeof self)t=self;else try{t=Function("return this")()}catch(e){throw new Error("polyfill failed because global object is unavailable in this environment")}var n=t.Promise;
 if(n){var r=null;try{r=Object.prototype.toString.call(n.resolve())}catch(e){}if("[object Promise]"===r&&!n.cast)return}t.Promise=it}var N=void 0;N=Array.isArray?Array.isArray:function(t){return"[object Array]"===Object.prototype.toString.call(t)};var U=N,W=0,z=void 0,B=void 0,G=function(t,e){V[W]=t,V[W+1]=e,W+=2,2===W&&(B?B(a):X())},H="undefined"!=typeof window?window:void 0,I=H||{},J=I.MutationObserver||I.WebKitMutationObserver,Q="undefined"==typeof self&&"undefined"!=typeof process&&"[object process]"==={}.toString.call(process),R="undefined"!=typeof Uint8ClampedArray&&"undefined"!=typeof importScripts&&"undefined"!=typeof MessageChannel,V=new Array(1e3),X=void 0;X=Q?o():J?s():R?u():void 0===H&&"function"==typeof require?f():c();var Z=Math.random().toString(36).substring(2),$=void 0,tt=1,et=2,nt={error:null},rt=0,ot=function(){function t(t,e){this._instanceConstructor=t,this.promise=new t(p),this.promise[Z]||O(this.promise),U(e)?(this.length=e.length,this._remaining=e.length,this.
 _result=new Array(this.length),0===this.length?S(this.promise,this._result):(this.length=this.length||0,this._enumerate(e),0===this._remaining&&S(this.promise,this._result))):j(this.promise,k())}return t.prototype._enumerate=function(t){for(var e=0;this._state===$&&e<t.length;e++)this._eachEntry(t[e],e)},t.prototype._eachEntry=function(t,e){var n=this._instanceConstructor,r=n.resolve;if(r===h){var o=_(t);if(o===l&&t._state!==$)this._settledAt(t._state,e,t._result);else if("function"!=typeof o)this._remaining--,this._result[e]=t;else if(n===it){var i=new n(p);w(i,t,o),this._willSettleAt(i,e)}else this._willSettleAt(new n(function(e){return e(t)}),e)}else this._willSettleAt(r(t),e)},t.prototype._settledAt=function(t,e,n){var r=this.promise;r._state===$&&(this._remaining--,t===et?j(r,n):this._result[e]=n),0===this._remaining&&S(r,this._result)},t.prototype._willSettleAt=function(t,e){var n=this;E(t,void 0,function(t){return n._settledAt(tt,e,t)},function(t){return n._settledAt(et,e,t)}
 )},t}(),it=function(){function t(e){this[Z]=C(),this._result=this._state=void 0,this._subscribers=[],p!==e&&("function"!=typeof e&&D(),this instanceof t?x(this,e):K())}return t.prototype["catch"]=function(t){return this.then(null,t)},t.prototype["finally"]=function(t){var e=this,n=e.constructor;return e.then(function(e){return n.resolve(t()).then(function(){return e})},function(e){return n.resolve(t()).then(function(){throw e})})},t}();return it.prototype.then=l,it.all=F,it.race=Y,it.resolve=h,it.reject=q,it._setScheduler=n,it._setAsap=r,it._asap=G,it.polyfill=L,it.Promise=it,it});
\ No newline at end of file

[06/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/index.js
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/index.js b/node_modules/http-proxy-agent/index.js
new file mode 100644
index 0000000..f90a529
--- /dev/null
+++ b/node_modules/http-proxy-agent/index.js
@@ -0,0 +1,111 @@
+
+/**
+ * Module dependencies.
+ */
+
+var net = require('net');
+var tls = require('tls');
+var url = require('url');
+var Agent = require('agent-base');
+var inherits = require('util').inherits;
+var debug = require('debug')('http-proxy-agent');
+
+/**
+ * Module exports.
+ */
+
+module.exports = HttpProxyAgent;
+
+/**
+ * The `HttpProxyAgent` implements an HTTP Agent subclass that connects to the
+ * specified "HTTP proxy server" in order to proxy HTTP requests.
+ *
+ * @api public
+ */
+
+function HttpProxyAgent (opts) {
+  if (!(this instanceof HttpProxyAgent)) return new HttpProxyAgent(opts);
+  if ('string' == typeof opts) opts = url.parse(opts);
+  if (!opts) throw new Error('an HTTP(S) proxy server `host` and `port` must be specified!');
+  debug('creating new HttpProxyAgent instance: %o', opts);
+  Agent.call(this, opts);
+
+  var proxy = Object.assign({}, opts);
+
+  // if `true`, then connect to the proxy server over TLS. defaults to `false`.
+  this.secureProxy = proxy.protocol ? /^https:?$/i.test(proxy.protocol) : false;
+
+  // prefer `hostname` over `host`, and set the `port` if needed
+  proxy.host = proxy.hostname || proxy.host;
+  proxy.port = +proxy.port || (this.secureProxy ? 443 : 80);
+
+  if (proxy.host && proxy.path) {
+    // if both a `host` and `path` are specified then it's most likely the
+    // result of a `url.parse()` call... we need to remove the `path` portion so
+    // that `net.connect()` doesn't attempt to open that as a unix socket file.
+    delete proxy.path;
+    delete proxy.pathname;
+  }
+
+  this.proxy = proxy;
+}
+inherits(HttpProxyAgent, Agent);
+
+/**
+ * Called when the node-core HTTP client library is creating a new HTTP request.
+ *
+ * @api public
+ */
+
+HttpProxyAgent.prototype.callback = function connect (req, opts, fn) {
+  var proxy = this.proxy;
+
+  // change the `http.ClientRequest` instance's "path" field
+  // to the absolute path of the URL that will be requested
+  var parsed = url.parse(req.path);
+  if (null == parsed.protocol) parsed.protocol = 'http:';
+  if (null == parsed.hostname) parsed.hostname = opts.hostname || opts.host;
+  if (null == parsed.port) parsed.port = opts.port;
+  if (parsed.port == 80) {
+    // if port is 80, then we can remove the port so that the
+    // ":80" portion is not on the produced URL
+    delete parsed.port;
+  }
+  var absolute = url.format(parsed);
+  req.path = absolute;
+
+  // inject the `Proxy-Authorization` header if necessary
+  if (proxy.auth) {
+    req.setHeader(
+      'Proxy-Authorization',
+      'Basic ' + Buffer.from(proxy.auth).toString('base64')
+    );
+  }
+
+  // create a socket connection to the proxy server
+  var socket;
+  if (this.secureProxy) {
+    socket = tls.connect(proxy);
+  } else {
+    socket = net.connect(proxy);
+  }
+
+  // at this point, the http ClientRequest's internal `_header` field might have
+  // already been set. If this is the case then we'll need to re-generate the
+  // string since we just changed the `req.path`
+  if (req._header) {
+    debug('regenerating stored HTTP header string for request');
+    req._header = null;
+    req._implicitHeader();
+    if (req.output && req.output.length > 0) {
+      debug('patching connection write() output buffer with updated header');
+      // the _header has already been queued to be written to the socket
+      var first = req.output[0];
+      var endOfHeaders = first.indexOf('\r\n\r\n') + 4;
+      req.output[0] = req._header + first.substring(endOfHeaders);
+      debug('output buffer: %o', req.output);
+    }
+  }
+
+  fn(null, socket);
+};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/agent-base/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/agent-base/.travis.yml b/node_modules/http-proxy-agent/node_modules/agent-base/.travis.yml
new file mode 100644
index 0000000..6ce862c
--- /dev/null
+++ b/node_modules/http-proxy-agent/node_modules/agent-base/.travis.yml
@@ -0,0 +1,23 @@
+sudo: false
+
+language: node_js
+
+node_js:
+  - "4"
+  - "5"
+  - "6"
+  - "7"
+  - "8"
+  - "9"
+
+install:
+  - PATH="`npm bin`:`npm bin -g`:$PATH"
+  # Install dependencies and build
+  - npm install
+
+script:
+  # Output useful info for debugging
+  - node --version
+  - npm --version
+  # Run tests
+  - npm test

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/agent-base/History.md
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/agent-base/History.md b/node_modules/http-proxy-agent/node_modules/agent-base/History.md
new file mode 100644
index 0000000..80c88dc
--- /dev/null
+++ b/node_modules/http-proxy-agent/node_modules/agent-base/History.md
@@ -0,0 +1,113 @@
+
+4.2.0 / 2018-01-15
+==================
+
+  * Add support for returning an `http.Agent` instance
+  * Optimize promisifying logic
+  * Set `timeout` to null for proper cleanup
+  * Remove Node.js <= 0.11.3 special-casing from test case
+
+4.1.2 / 2017-11-20
+==================
+
+  * test Node 9 on Travis
+  * ensure that `https.get()` uses the patched `https.request()`
+
+4.1.1 / 2017-07-20
+==================
+
+  * Correct `https.request()` with a String (#9)
+
+4.1.0 / 2017-06-26
+==================
+
+  * mix in Agent options into Request options
+  * throw when nothing is returned from agent-base callback
+  * do not modify the options object for https requests
+
+4.0.1 / 2017-06-13
+==================
+
+  * add `this` context tests and fixes
+
+4.0.0 / 2017-06-06
+==================
+
+  * drop support for Node.js < 4
+  * drop old versions of Node.js from Travis-CI
+  * specify Node.js >= 4.0.0 in `engines.node`
+  * remove more old code
+  * remove "extend" dependency
+  * remove "semver" dependency
+  * make the Promise logic a bit cleaner
+  * add async function pseudo-example to README
+  * use direct return in README example
+
+3.0.0 / 2017-06-02
+==================
+
+  * drop support for Node.js v0.8 and v0.10
+  * add support for async, Promises, and direct return
+  * add a couple `options` test cases
+  * implement a `"timeout"` option
+  * rename main file to `index.js`
+  * test Node 8 on Travis
+
+2.1.1 / 2017-05-30
+==================
+
+  * Revert [`fe2162e`](https://github.com/TooTallNate/node-agent-base/commit/fe2162e0ba18123f5b301cba4de1e9dd74e437cd) and [`270bdc9`](https://github.com/TooTallNate/node-agent-base/commit/270bdc92eb8e3bd0444d1e5266e8e9390aeb3095) (fixes #7)
+
+2.1.0 / 2017-05-26
+==================
+
+  * unref is not supported for node < 0.9.1 (@pi0)
+  * add tests to dangling socket (@pi0)
+  * check unref() is supported (@pi0)
+  * fix dangling sockets problem (@pi0)
+  * add basic "ws" module tests
+  * make `Agent` be subclassable
+  * turn `addRequest()` into a named function
+  * test: Node.js v4 likes to call `cork` on the stream (#3, @tomhughes)
+  * travis: test node v4, v5, v6 and v7
+
+2.0.1 / 2015-09-10
+==================
+
+  * package: update "semver" to v5.0.1 for WebPack (#1, @vhpoet)
+
+2.0.0 / 2015-07-10
+==================
+
+  * refactor to patch Node.js core for more consistent `opts` values
+  * ensure that HTTP(s) default port numbers are always given
+  * test: use ssl-cert-snakeoil SSL certs
+  * test: add tests for arbitrary options
+  * README: add API section
+  * README: make the Agent HTTP/HTTPS generic in the example
+  * README: use SVG for Travis-CI badge
+
+1.0.2 / 2015-06-27
+==================
+
+  * agent: set `req._hadError` to true after emitting "error"
+  * package: update "mocha" to v2
+  * test: add artificial HTTP GET request test
+  * test: add artificial data events test
+  * test: fix artifical GET response test on node > v0.11.3
+  * test: use a real timeout for the async error test
+
+1.0.1 / 2013-09-09
+==================
+
+  * Fix passing an "error" object to the callback function on the first tick
+
+1.0.0 / 2013-09-09
+==================
+
+  * New API: now you pass a callback function directly
+
+0.0.1 / 2013-07-09
+==================
+
+  * Initial release

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/agent-base/README.md
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/agent-base/README.md b/node_modules/http-proxy-agent/node_modules/agent-base/README.md
new file mode 100644
index 0000000..dbeceab
--- /dev/null
+++ b/node_modules/http-proxy-agent/node_modules/agent-base/README.md
@@ -0,0 +1,145 @@
+agent-base
+==========
+### Turn a function into an [`http.Agent`][http.Agent] instance
+[![Build Status](https://travis-ci.org/TooTallNate/node-agent-base.svg?branch=master)](https://travis-ci.org/TooTallNate/node-agent-base)
+
+This module provides an `http.Agent` generator. That is, you pass it an async
+callback function, and it returns a new `http.Agent` instance that will invoke the
+given callback function when sending outbound HTTP requests.
+
+#### Some subclasses:
+
+Here's some more interesting uses of `agent-base`.
+Send a pull request to list yours!
+
+ * [`http-proxy-agent`][http-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTP endpoints
+ * [`https-proxy-agent`][https-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTPS endpoints
+ * [`pac-proxy-agent`][pac-proxy-agent]: A PAC file proxy `http.Agent` implementation for HTTP and HTTPS
+ * [`socks-proxy-agent`][socks-proxy-agent]: A SOCKS (v4a) proxy `http.Agent` implementation for HTTP and HTTPS
+
+
+Installation
+------------
+
+Install with `npm`:
+
+``` bash
+$ npm install agent-base
+```
+
+
+Example
+-------
+
+Here's a minimal example that creates a new `net.Socket` connection to the server
+for every HTTP request (i.e. the equivalent of `agent: false` option):
+
+```js
+var net = require('net');
+var tls = require('tls');
+var url = require('url');
+var http = require('http');
+var agent = require('agent-base');
+
+var endpoint = 'http://nodejs.org/api/';
+var parsed = url.parse(endpoint);
+
+// This is the important part!
+parsed.agent = agent(function (req, opts) {
+  var socket;
+  // `secureEndpoint` is true when using the https module
+  if (opts.secureEndpoint) {
+    socket = tls.connect(opts);
+  } else {
+    socket = net.connect(opts);
+  }
+  return socket;
+});
+
+// Everything else works just like normal...
+http.get(parsed, function (res) {
+  console.log('"response" event!', res.headers);
+  res.pipe(process.stdout);
+});
+```
+
+Returning a Promise or using an `async` function is also supported:
+
+```js
+agent(async function (req, opts) {
+  await sleep(1000);
+  // etc…
+});
+```
+
+Return another `http.Agent` instance to "pass through" the responsibility
+for that HTTP request to that agent:
+
+```js
+agent(function (req, opts) {
+  return opts.secureEndpoint ? https.globalAgent : http.globalAgent;
+});
+```
+
+
+API
+---
+
+## Agent(Function callback[, Object options]) → [http.Agent][]
+
+Creates a base `http.Agent` that will execute the callback function `callback`
+for every HTTP request that it is used as the `agent` for. The callback function
+is responsible for creating a `stream.Duplex` instance of some kind that will be
+used as the underlying socket in the HTTP request.
+
+The `options` object accepts the following properties:
+
+  * `timeout` - Number - Timeout for the `callback()` function in milliseconds. Defaults to Infinity (optional).
+
+The callback function should have the following signature:
+
+### callback(http.ClientRequest req, Object options, Function cb) → undefined
+
+The ClientRequest `req` can be accessed to read request headers and
+and the path, etc. The `options` object contains the options passed
+to the `http.request()`/`https.request()` function call, and is formatted
+to be directly passed to `net.connect()`/`tls.connect()`, or however
+else you want a Socket to be created. Pass the created socket to
+the callback function `cb` once created, and the HTTP request will
+continue to proceed.
+
+If the `https` module is used to invoke the HTTP request, then the
+`secureEndpoint` property on `options` _will be set to `true`_.
+
+
+License
+-------
+
+(The MIT License)
+
+Copyright (c) 2013 Nathan Rajlich &lt;nathan@tootallnate.net&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+[http-proxy-agent]: https://github.com/TooTallNate/node-http-proxy-agent
+[https-proxy-agent]: https://github.com/TooTallNate/node-https-proxy-agent
+[pac-proxy-agent]: https://github.com/TooTallNate/node-pac-proxy-agent
+[socks-proxy-agent]: https://github.com/TooTallNate/node-socks-proxy-agent
+[http.Agent]: https://nodejs.org/api/http.html#http_class_http_agent

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/agent-base/index.js
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/agent-base/index.js b/node_modules/http-proxy-agent/node_modules/agent-base/index.js
new file mode 100644
index 0000000..b1f42e6
--- /dev/null
+++ b/node_modules/http-proxy-agent/node_modules/agent-base/index.js
@@ -0,0 +1,160 @@
+'use strict';
+require('./patch-core');
+const inherits = require('util').inherits;
+const promisify = require('es6-promisify');
+const EventEmitter = require('events').EventEmitter;
+
+module.exports = Agent;
+
+function isAgent(v) {
+  return v && typeof v.addRequest === 'function';
+}
+
+/**
+ * Base `http.Agent` implementation.
+ * No pooling/keep-alive is implemented by default.
+ *
+ * @param {Function} callback
+ * @api public
+ */
+function Agent(callback, _opts) {
+  if (!(this instanceof Agent)) {
+    return new Agent(callback, _opts);
+  }
+
+  EventEmitter.call(this);
+
+  // The callback gets promisified if it has 3 parameters
+  // (i.e. it has a callback function) lazily
+  this._promisifiedCallback = false;
+
+  let opts = _opts;
+  if ('function' === typeof callback) {
+    this.callback = callback;
+  } else if (callback) {
+    opts = callback;
+  }
+
+  // timeout for the socket to be returned from the callback
+  this.timeout = (opts && opts.timeout) || null;
+
+  this.options = opts;
+}
+inherits(Agent, EventEmitter);
+
+/**
+ * Override this function in your subclass!
+ */
+Agent.prototype.callback = function callback(req, opts) {
+  throw new Error(
+    '"agent-base" has no default implementation, you must subclass and override `callback()`'
+  );
+};
+
+/**
+ * Called by node-core's "_http_client.js" module when creating
+ * a new HTTP request with this Agent instance.
+ *
+ * @api public
+ */
+Agent.prototype.addRequest = function addRequest(req, _opts) {
+  const ownOpts = Object.assign({}, _opts);
+
+  // Set default `host` for HTTP to localhost
+  if (null == ownOpts.host) {
+    ownOpts.host = 'localhost';
+  }
+
+  // Set default `port` for HTTP if none was explicitly specified
+  if (null == ownOpts.port) {
+    ownOpts.port = ownOpts.secureEndpoint ? 443 : 80;
+  }
+
+  const opts = Object.assign({}, this.options, ownOpts);
+
+  if (opts.host && opts.path) {
+    // If both a `host` and `path` are specified then it's most likely the
+    // result of a `url.parse()` call... we need to remove the `path` portion so
+    // that `net.connect()` doesn't attempt to open that as a unix socket file.
+    delete opts.path;
+  }
+
+  delete opts.agent;
+  delete opts.hostname;
+  delete opts._defaultAgent;
+  delete opts.defaultPort;
+  delete opts.createConnection;
+
+  // Hint to use "Connection: close"
+  // XXX: non-documented `http` module API :(
+  req._last = true;
+  req.shouldKeepAlive = false;
+
+  // Create the `stream.Duplex` instance
+  let timeout;
+  let timedOut = false;
+  const timeoutMs = this.timeout;
+
+  function onerror(err) {
+    if (req._hadError) return;
+    req.emit('error', err);
+    // For Safety. Some additional errors might fire later on
+    // and we need to make sure we don't double-fire the error event.
+    req._hadError = true;
+  }
+
+  function ontimeout() {
+    timeout = null;
+    timedOut = true;
+    const err = new Error(
+      'A "socket" was not created for HTTP request before ' + timeoutMs + 'ms'
+    );
+    err.code = 'ETIMEOUT';
+    onerror(err);
+  }
+
+  function callbackError(err) {
+    if (timedOut) return;
+    if (timeout != null) {
+      clearTimeout(timeout);
+      timeout = null;
+    }
+    onerror(err);
+  }
+
+  function onsocket(socket) {
+    if (timedOut) return;
+    if (timeout != null) {
+      clearTimeout(timeout);
+      timeout = null;
+    }
+    if (isAgent(socket)) {
+      // `socket` is actually an http.Agent instance, so relinquish
+      // responsibility for this `req` to the Agent from here on
+      socket.addRequest(req, opts);
+    } else if (socket) {
+      req.onSocket(socket);
+    } else {
+      const err = new Error(
+        `no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\``
+      );
+      onerror(err);
+    }
+  }
+
+  if (!this._promisifiedCallback && this.callback.length >= 3) {
+    // Legacy callback function - convert to a Promise
+    this.callback = promisify(this.callback, this);
+    this._promisifiedCallback = true;
+  }
+
+  if (timeoutMs > 0) {
+    timeout = setTimeout(ontimeout, timeoutMs);
+  }
+
+  try {
+    Promise.resolve(this.callback(req, opts)).then(onsocket, callbackError);
+  } catch (err) {
+    Promise.reject(err).catch(callbackError);
+  }
+};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/agent-base/package.json
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/agent-base/package.json b/node_modules/http-proxy-agent/node_modules/agent-base/package.json
new file mode 100644
index 0000000..6600fc3
--- /dev/null
+++ b/node_modules/http-proxy-agent/node_modules/agent-base/package.json
@@ -0,0 +1,69 @@
+{
+  "_args": [
+    [
+      "agent-base@4.2.0",
+      "/Users/scottyaslan/Development/nifi-fds/target"
+    ]
+  ],
+  "_development": true,
+  "_from": "agent-base@4.2.0",
+  "_id": "agent-base@4.2.0",
+  "_inBundle": false,
+  "_integrity": "sha512-c+R/U5X+2zz2+UCrCFv6odQzJdoqI+YecuhnAJLa1zYaMc13zPfwMwZrr91Pd1DYNo/yPRbiM4WVf9whgwFsIg==",
+  "_location": "/http-proxy-agent/agent-base",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "agent-base@4.2.0",
+    "name": "agent-base",
+    "escapedName": "agent-base",
+    "rawSpec": "4.2.0",
+    "saveSpec": null,
+    "fetchSpec": "4.2.0"
+  },
+  "_requiredBy": [
+    "/http-proxy-agent"
+  ],
+  "_resolved": "https://registry.npmjs.org/agent-base/-/agent-base-4.2.0.tgz",
+  "_spec": "4.2.0",
+  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
+  "author": {
+    "name": "Nathan Rajlich",
+    "email": "nathan@tootallnate.net",
+    "url": "http://n8.io/"
+  },
+  "bugs": {
+    "url": "https://github.com/TooTallNate/node-agent-base/issues"
+  },
+  "dependencies": {
+    "es6-promisify": "^5.0.0"
+  },
+  "description": "Turn a function into an `http.Agent` instance",
+  "devDependencies": {
+    "mocha": "^3.4.2",
+    "ws": "^3.0.0"
+  },
+  "engines": {
+    "node": ">= 4.0.0"
+  },
+  "homepage": "https://github.com/TooTallNate/node-agent-base#readme",
+  "keywords": [
+    "http",
+    "agent",
+    "base",
+    "barebones",
+    "https"
+  ],
+  "license": "MIT",
+  "main": "./index.js",
+  "name": "agent-base",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/TooTallNate/node-agent-base.git"
+  },
+  "scripts": {
+    "test": "mocha --reporter spec"
+  },
+  "version": "4.2.0"
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/agent-base/patch-core.js
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/agent-base/patch-core.js b/node_modules/http-proxy-agent/node_modules/agent-base/patch-core.js
new file mode 100644
index 0000000..47d26a7
--- /dev/null
+++ b/node_modules/http-proxy-agent/node_modules/agent-base/patch-core.js
@@ -0,0 +1,37 @@
+'use strict';
+const url = require('url');
+const https = require('https');
+
+/**
+ * This currently needs to be applied to all Node.js versions
+ * in order to determine if the `req` is an HTTP or HTTPS request.
+ *
+ * There is currently no PR attempting to move this property upstream.
+ */
+https.request = (function(request) {
+  return function(_options, cb) {
+    let options;
+    if (typeof _options === 'string') {
+      options = url.parse(_options);
+    } else {
+      options = Object.assign({}, _options);
+    }
+    if (null == options.port) {
+      options.port = 443;
+    }
+    options.secureEndpoint = true;
+    return request.call(https, options, cb);
+  };
+})(https.request);
+
+/**
+ * This is needed for Node.js >= 9.0.0 to make sure `https.get()` uses the
+ * patched `https.request()`.
+ *
+ * Ref: https://github.com/nodejs/node/commit/5118f31
+ */
+https.get = function(options, cb) {
+  const req = https.request(options, cb);
+  req.end();
+  return req;
+};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/.coveralls.yml
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/.coveralls.yml b/node_modules/http-proxy-agent/node_modules/debug/.coveralls.yml
deleted file mode 100644
index 20a7068..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/.coveralls.yml
+++ /dev/null
@@ -1 +0,0 @@
-repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/.eslintrc b/node_modules/http-proxy-agent/node_modules/debug/.eslintrc
deleted file mode 100644
index 8a37ae2..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/.eslintrc
+++ /dev/null
@@ -1,11 +0,0 @@
-{
-  "env": {
-    "browser": true,
-    "node": true
-  },
-  "rules": {
-    "no-console": 0,
-    "no-empty": [1, { "allowEmptyCatch": true }]
-  },
-  "extends": "eslint:recommended"
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/.npmignore
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/.npmignore b/node_modules/http-proxy-agent/node_modules/debug/.npmignore
deleted file mode 100644
index 5f60eec..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/.npmignore
+++ /dev/null
@@ -1,9 +0,0 @@
-support
-test
-examples
-example
-*.sock
-dist
-yarn.lock
-coverage
-bower.json

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/.travis.yml b/node_modules/http-proxy-agent/node_modules/debug/.travis.yml
deleted file mode 100644
index 6c6090c..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/.travis.yml
+++ /dev/null
@@ -1,14 +0,0 @@
-
-language: node_js
-node_js:
-  - "6"
-  - "5"
-  - "4"
-
-install:
-  - make node_modules
-
-script:
-  - make lint
-  - make test
-  - make coveralls

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/CHANGELOG.md b/node_modules/http-proxy-agent/node_modules/debug/CHANGELOG.md
deleted file mode 100644
index eadaa18..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/CHANGELOG.md
+++ /dev/null
@@ -1,362 +0,0 @@
-
-2.6.9 / 2017-09-22
-==================
-
-  * remove ReDoS regexp in %o formatter (#504)
-
-2.6.8 / 2017-05-18
-==================
-
-  * Fix: Check for undefined on browser globals (#462, @marbemac)
-
-2.6.7 / 2017-05-16
-==================
-
-  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
-  * Fix: Inline extend function in node implementation (#452, @dougwilson)
-  * Docs: Fix typo (#455, @msasad)
-
-2.6.5 / 2017-04-27
-==================
-  
-  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
-  * Misc: clean up browser reference checks (#447, @thebigredgeek)
-  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
-
-
-2.6.4 / 2017-04-20
-==================
-
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
-  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
-  * Misc: update "ms" to v0.7.3 (@tootallnate)
-
-2.6.3 / 2017-03-13
-==================
-
-  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
-  * Docs: Changelog fix (@thebigredgeek)
-
-2.6.2 / 2017-03-10
-==================
-
-  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
-  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
-  * Docs: Add Slackin invite badge (@tootallnate)
-
-2.6.1 / 2017-02-10
-==================
-
-  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
-  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
-  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
-  * Fix: Namespaces would not disable once enabled (#409, @musikov)
-
-2.6.0 / 2016-12-28
-==================
-
-  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
-  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
-  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
-
-2.5.2 / 2016-12-25
-==================
-
-  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
-  * Docs: fixed README typo (#391, @lurch)
-  * Docs: added notice about v3 api discussion (@thebigredgeek)
-
-2.5.1 / 2016-12-20
-==================
-
-  * Fix: babel-core compatibility
-
-2.5.0 / 2016-12-20
-==================
-
-  * Fix: wrong reference in bower file (@thebigredgeek)
-  * Fix: webworker compatibility (@thebigredgeek)
-  * Fix: output formatting issue (#388, @kribblo)
-  * Fix: babel-loader compatibility (#383, @escwald)
-  * Misc: removed built asset from repo and publications (@thebigredgeek)
-  * Misc: moved source files to /src (#378, @yamikuronue)
-  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
-  * Test: coveralls integration (#378, @yamikuronue)
-  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
-
-2.4.5 / 2016-12-17
-==================
-
-  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
-  * Fix: custom log function (#379, @hsiliev)
-  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
-  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
-  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
-
-2.4.4 / 2016-12-14
-==================
-
-  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
-
-2.4.3 / 2016-12-14
-==================
-
-  * Fix: navigation.userAgent error for react native (#364, @escwald)
-
-2.4.2 / 2016-12-14
-==================
-
-  * Fix: browser colors (#367, @tootallnate)
-  * Misc: travis ci integration (@thebigredgeek)
-  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
-
-2.4.1 / 2016-12-13
-==================
-
-  * Fix: typo that broke the package (#356)
-
-2.4.0 / 2016-12-13
-==================
-
-  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
-  * Fix: revert "handle regex special characters" (@tootallnate)
-  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
-  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
-  * Improvement: allow colors in workers (#335, @botverse)
-  * Improvement: use same color for same namespace. (#338, @lchenay)
-
-2.3.3 / 2016-11-09
-==================
-
-  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
-  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
-  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
-
-2.3.2 / 2016-11-09
-==================
-
-  * Fix: be super-safe in index.js as well (@TooTallNate)
-  * Fix: should check whether process exists (Tom Newby)
-
-2.3.1 / 2016-11-09
-==================
-
-  * Fix: Added electron compatibility (#324, @paulcbetts)
-  * Improvement: Added performance optimizations (@tootallnate)
-  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
-  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
-
-2.3.0 / 2016-11-07
-==================
-
-  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
-  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
-  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
-  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
-  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
-  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
-  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
-  * Readme: fix USE_COLORS to DEBUG_COLORS
-  * Readme: Doc fixes for format string sugar (#269, @mlucool)
-  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
-  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
-  * Readme: better docs for browser support (#224, @matthewmueller)
-  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
-  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
-  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
-  * Misc: Updated contributors (@thebigredgeek)
-
-2.2.0 / 2015-05-09
-==================
-
-  * package: update "ms" to v0.7.1 (#202, @dougwilson)
-  * README: add logging to file example (#193, @DanielOchoa)
-  * README: fixed a typo (#191, @amir-s)
-  * browser: expose `storage` (#190, @stephenmathieson)
-  * Makefile: add a `distclean` target (#189, @stephenmathieson)
-
-2.1.3 / 2015-03-13
-==================
-
-  * Updated stdout/stderr example (#186)
-  * Updated example/stdout.js to match debug current behaviour
-  * Renamed example/stderr.js to stdout.js
-  * Update Readme.md (#184)
-  * replace high intensity foreground color for bold (#182, #183)
-
-2.1.2 / 2015-03-01
-==================
-
-  * dist: recompile
-  * update "ms" to v0.7.0
-  * package: update "browserify" to v9.0.3
-  * component: fix "ms.js" repo location
-  * changed bower package name
-  * updated documentation about using debug in a browser
-  * fix: security error on safari (#167, #168, @yields)
-
-2.1.1 / 2014-12-29
-==================
-
-  * browser: use `typeof` to check for `console` existence
-  * browser: check for `console.log` truthiness (fix IE 8/9)
-  * browser: add support for Chrome apps
-  * Readme: added Windows usage remarks
-  * Add `bower.json` to properly support bower install
-
-2.1.0 / 2014-10-15
-==================
-
-  * node: implement `DEBUG_FD` env variable support
-  * package: update "browserify" to v6.1.0
-  * package: add "license" field to package.json (#135, @panuhorsmalahti)
-
-2.0.0 / 2014-09-01
-==================
-
-  * package: update "browserify" to v5.11.0
-  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
-
-1.0.4 / 2014-07-15
-==================
-
-  * dist: recompile
-  * example: remove `console.info()` log usage
-  * example: add "Content-Type" UTF-8 header to browser example
-  * browser: place %c marker after the space character
-  * browser: reset the "content" color via `color: inherit`
-  * browser: add colors support for Firefox >= v31
-  * debug: prefer an instance `log()` function over the global one (#119)
-  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
-
-1.0.3 / 2014-07-09
-==================
-
-  * Add support for multiple wildcards in namespaces (#122, @seegno)
-  * browser: fix lint
-
-1.0.2 / 2014-06-10
-==================
-
-  * browser: update color palette (#113, @gscottolson)
-  * common: make console logging function configurable (#108, @timoxley)
-  * node: fix %o colors on old node <= 0.8.x
-  * Makefile: find node path using shell/which (#109, @timoxley)
-
-1.0.1 / 2014-06-06
-==================
-
-  * browser: use `removeItem()` to clear localStorage
-  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
-  * package: add "contributors" section
-  * node: fix comment typo
-  * README: list authors
-
-1.0.0 / 2014-06-04
-==================
-
-  * make ms diff be global, not be scope
-  * debug: ignore empty strings in enable()
-  * node: make DEBUG_COLORS able to disable coloring
-  * *: export the `colors` array
-  * npmignore: don't publish the `dist` dir
-  * Makefile: refactor to use browserify
-  * package: add "browserify" as a dev dependency
-  * Readme: add Web Inspector Colors section
-  * node: reset terminal color for the debug content
-  * node: map "%o" to `util.inspect()`
-  * browser: map "%j" to `JSON.stringify()`
-  * debug: add custom "formatters"
-  * debug: use "ms" module for humanizing the diff
-  * Readme: add "bash" syntax highlighting
-  * browser: add Firebug color support
-  * browser: add colors for WebKit browsers
-  * node: apply log to `console`
-  * rewrite: abstract common logic for Node & browsers
-  * add .jshintrc file
-
-0.8.1 / 2014-04-14
-==================
-
-  * package: re-add the "component" section
-
-0.8.0 / 2014-03-30
-==================
-
-  * add `enable()` method for nodejs. Closes #27
-  * change from stderr to stdout
-  * remove unnecessary index.js file
-
-0.7.4 / 2013-11-13
-==================
-
-  * remove "browserify" key from package.json (fixes something in browserify)
-
-0.7.3 / 2013-10-30
-==================
-
-  * fix: catch localStorage security error when cookies are blocked (Chrome)
-  * add debug(err) support. Closes #46
-  * add .browser prop to package.json. Closes #42
-
-0.7.2 / 2013-02-06
-==================
-
-  * fix package.json
-  * fix: Mobile Safari (private mode) is broken with debug
-  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
-
-0.7.1 / 2013-02-05
-==================
-
-  * add repository URL to package.json
-  * add DEBUG_COLORED to force colored output
-  * add browserify support
-  * fix component. Closes #24
-
-0.7.0 / 2012-05-04
-==================
-
-  * Added .component to package.json
-  * Added debug.component.js build
-
-0.6.0 / 2012-03-16
-==================
-
-  * Added support for "-" prefix in DEBUG [Vinay Pulim]
-  * Added `.enabled` flag to the node version [TooTallNate]
-
-0.5.0 / 2012-02-02
-==================
-
-  * Added: humanize diffs. Closes #8
-  * Added `debug.disable()` to the CS variant
-  * Removed padding. Closes #10
-  * Fixed: persist client-side variant again. Closes #9
-
-0.4.0 / 2012-02-01
-==================
-
-  * Added browser variant support for older browsers [TooTallNate]
-  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
-  * Added padding to diff (moved it to the right)
-
-0.3.0 / 2012-01-26
-==================
-
-  * Added millisecond diff when isatty, otherwise UTC string
-
-0.2.0 / 2012-01-22
-==================
-
-  * Added wildcard support
-
-0.1.0 / 2011-12-02
-==================
-
-  * Added: remove colors unless stderr isatty [TooTallNate]
-
-0.0.1 / 2010-01-03
-==================
-
-  * Initial release

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/LICENSE
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/LICENSE b/node_modules/http-proxy-agent/node_modules/debug/LICENSE
deleted file mode 100644
index 658c933..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/LICENSE
+++ /dev/null
@@ -1,19 +0,0 @@
-(The MIT License)
-
-Copyright (c) 2014 TJ Holowaychuk <tj...@vision-media.ca>
-
-Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
-and associated documentation files (the 'Software'), to deal in the Software without restriction, 
-including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
-and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
-subject to the following conditions:
-
-The above copyright notice and this permission notice shall be included in all copies or substantial 
-portions of the Software.
-
-THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
-LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
-IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
-WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
-SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
-

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/Makefile b/node_modules/http-proxy-agent/node_modules/debug/Makefile
deleted file mode 100644
index 584da8b..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/Makefile
+++ /dev/null
@@ -1,50 +0,0 @@
-# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
-THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
-THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
-
-# BIN directory
-BIN := $(THIS_DIR)/node_modules/.bin
-
-# Path
-PATH := node_modules/.bin:$(PATH)
-SHELL := /bin/bash
-
-# applications
-NODE ?= $(shell which node)
-YARN ?= $(shell which yarn)
-PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
-BROWSERIFY ?= $(NODE) $(BIN)/browserify
-
-.FORCE:
-
-install: node_modules
-
-node_modules: package.json
-	@NODE_ENV= $(PKG) install
-	@touch node_modules
-
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
-	@$(BROWSERIFY) \
-		--standalone debug \
-		. > dist/debug.js
-
-	karma start --single-run
-	rimraf dist
-
-test: .FORCE
-	concurrently \
-		"make test-node" \
-		"make test-browser"
-
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
-
-.PHONY: all install clean distclean

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/README.md b/node_modules/http-proxy-agent/node_modules/debug/README.md
deleted file mode 100644
index f67be6b..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/README.md
+++ /dev/null
@@ -1,312 +0,0 @@
-# debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
-[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
-
-
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
-
-## Installation
-
-```bash
-$ npm install debug
-```
-
-## Usage
-
-`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
-
-Example _app.js_:
-
-```js
-var debug = require('debug')('http')
-  , http = require('http')
-  , name = 'My App';
-
-// fake app
-
-debug('booting %s', name);
-
-http.createServer(function(req, res){
-  debug(req.method + ' ' + req.url);
-  res.end('hello\n');
-}).listen(3000, function(){
-  debug('listening');
-});
-
-// fake worker of some kind
-
-require('./worker');
-```
-
-Example _worker.js_:
-
-```js
-var debug = require('debug')('worker');
-
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
-```
-
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
-
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
-
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
-
-#### Windows note
-
- On Windows the environment variable is set using the `set` command.
-
- ```cmd
- set DEBUG=*,-not_this
- ```
-
- Note that PowerShell uses different syntax to set environment variables.
-
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
-
-Then, run the program to be debugged as usual.
-
-## Millisecond diff
-
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
-
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
-
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
-
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
-
-## Conventions
-
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
-
-## Wildcards
-
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
-
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
-
-## Environment Variables
-
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
-
-| Name      | Purpose                                         |
-|-----------|-------------------------------------------------|
-| `DEBUG`   | Enables/disables specific debugging namespaces. |
-| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
-| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
-
-
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
-
-## Formatters
-
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
-
-| Formatter | Representation |
-|-----------|----------------|
-| `%O`      | Pretty-print an Object on multiple lines. |
-| `%o`      | Pretty-print an Object all on a single line. |
-| `%s`      | String. |
-| `%d`      | Number (both integer and float). |
-| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
-| `%%`      | Single percent sign ('%'). This does not consume an argument. |
-
-### Custom formatters
-
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
-
-```js
-const createDebug = require('debug')
-createDebug.formatters.h = (v) => {
-  return v.toString('hex')
-}
-
-// …elsewhere
-const debug = createDebug('foo')
-debug('this is hex: %h', new Buffer('hello world'))
-//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
-```
-
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
-
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
-
-```js
-localStorage.debug = 'worker:*'
-```
-
-And then refresh the page.
-
-```js
-a = debug('worker:a');
-b = debug('worker:b');
-
-setInterval(function(){
-  a('doing some work');
-}, 1000);
-
-setInterval(function(){
-  b('doing some work');
-}, 1200);
-```
-
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
-
-## Output streams
-
-  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
-
-Example _stdout.js_:
-
-```js
-var debug = require('debug');
-var error = debug('app:error');
-
-// by default stderr is used
-error('goes to stderr!');
-
-var log = debug('app:log');
-// set this namespace to log via console.log
-log.log = console.log.bind(console); // don't forget to bind to console!
-log('goes to stdout');
-error('still goes to stderr!');
-
-// set all output to go via console.info
-// overrides all per-namespace log settings
-debug.log = console.info.bind(console);
-error('now goes to stdout via console.info');
-log('still goes to stdout, but via console.info now');
-```
-
-
-## Authors
-
- - TJ Holowaychuk
- - Nathan Rajlich
- - Andrew Rhyne
- 
-## Backers
-
-Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
-
-<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
-
-
-## Sponsors
-
-Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
-
-<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
-
-## License
-
-(The MIT License)
-
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
-
-Permission is hereby granted, free of charge, to any person obtaining
-a copy of this software and associated documentation files (the
-'Software'), to deal in the Software without restriction, including
-without limitation the rights to use, copy, modify, merge, publish,
-distribute, sublicense, and/or sell copies of the Software, and to
-permit persons to whom the Software is furnished to do so, subject to
-the following conditions:
-
-The above copyright notice and this permission notice shall be
-included in all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
-EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
-MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
-IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
-CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
-TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
-SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/component.json b/node_modules/http-proxy-agent/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/karma.conf.js
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/karma.conf.js b/node_modules/http-proxy-agent/node_modules/debug/karma.conf.js
deleted file mode 100644
index 103a82d..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/karma.conf.js
+++ /dev/null
@@ -1,70 +0,0 @@
-// Karma configuration
-// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
-
-module.exports = function(config) {
-  config.set({
-
-    // base path that will be used to resolve all patterns (eg. files, exclude)
-    basePath: '',
-
-
-    // frameworks to use
-    // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
-    frameworks: ['mocha', 'chai', 'sinon'],
-
-
-    // list of files / patterns to load in the browser
-    files: [
-      'dist/debug.js',
-      'test/*spec.js'
-    ],
-
-
-    // list of files to exclude
-    exclude: [
-      'src/node.js'
-    ],
-
-
-    // preprocess matching files before serving them to the browser
-    // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
-    preprocessors: {
-    },
-
-    // test results reporter to use
-    // possible values: 'dots', 'progress'
-    // available reporters: https://npmjs.org/browse/keyword/karma-reporter
-    reporters: ['progress'],
-
-
-    // web server port
-    port: 9876,
-
-
-    // enable / disable colors in the output (reporters and logs)
-    colors: true,
-
-
-    // level of logging
-    // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
-    logLevel: config.LOG_INFO,
-
-
-    // enable / disable watching file and executing tests whenever any file changes
-    autoWatch: true,
-
-
-    // start these browsers
-    // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
-    browsers: ['PhantomJS'],
-
-
-    // Continuous Integration mode
-    // if true, Karma captures browsers, runs the tests and exits
-    singleRun: false,
-
-    // Concurrency level
-    // how many browser should be started simultaneous
-    concurrency: Infinity
-  })
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/node.js
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/node.js b/node_modules/http-proxy-agent/node_modules/debug/node.js
deleted file mode 100644
index 7fc36fe..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/node.js
+++ /dev/null
@@ -1 +0,0 @@
-module.exports = require('./src/node');

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/node_modules/debug/package.json b/node_modules/http-proxy-agent/node_modules/debug/package.json
deleted file mode 100644
index 3bdcad1..0000000
--- a/node_modules/http-proxy-agent/node_modules/debug/package.json
+++ /dev/null
@@ -1,92 +0,0 @@
-{
-  "_args": [
-    [
-      "debug@2.6.9",
-      "/Users/scottyaslan/Development/nifi-fds/target"
-    ]
-  ],
-  "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
-  "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
-  "_location": "/http-proxy-agent/debug",
-  "_phantomChildren": {},
-  "_requested": {
-    "type": "version",
-    "registry": true,
-    "raw": "debug@2.6.9",
-    "name": "debug",
-    "escapedName": "debug",
-    "rawSpec": "2.6.9",
-    "saveSpec": null,
-    "fetchSpec": "2.6.9"
-  },
-  "_requiredBy": [
-    "/http-proxy-agent"
-  ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
-  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
-  "author": {
-    "name": "TJ Holowaychuk",
-    "email": "tj@vision-media.ca"
-  },
-  "browser": "./src/browser.js",
-  "bugs": {
-    "url": "https://github.com/visionmedia/debug/issues"
-  },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
-  "contributors": [
-    {
-      "name": "Nathan Rajlich",
-      "email": "nathan@tootallnate.net",
-      "url": "http://n8.io"
-    },
-    {
-      "name": "Andrew Rhyne",
-      "email": "rhyneandrew@gmail.com"
-    }
-  ],
-  "dependencies": {
-    "ms": "2.0.0"
-  },
-  "description": "small debugging utility",
-  "devDependencies": {
-    "browserify": "9.0.3",
-    "chai": "^3.5.0",
-    "concurrently": "^3.1.0",
-    "coveralls": "^2.11.15",
-    "eslint": "^3.12.1",
-    "istanbul": "^0.4.5",
-    "karma": "^1.3.0",
-    "karma-chai": "^0.1.0",
-    "karma-mocha": "^1.3.0",
-    "karma-phantomjs-launcher": "^1.0.2",
-    "karma-sinon": "^1.0.5",
-    "mocha": "^3.2.0",
-    "mocha-lcov-reporter": "^1.2.0",
-    "rimraf": "^2.5.4",
-    "sinon": "^1.17.6",
-    "sinon-chai": "^2.8.0"
-  },
-  "homepage": "https://github.com/visionmedia/debug#readme",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "license": "MIT",
-  "main": "./src/index.js",
-  "name": "debug",
-  "repository": {
-    "type": "git",
-    "url": "git://github.com/visionmedia/debug.git"
-  },
-  "version": "2.6.9"
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/package.json
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/package.json b/node_modules/http-proxy-agent/package.json
index 131214c..0793e31 100644
--- a/node_modules/http-proxy-agent/package.json
+++ b/node_modules/http-proxy-agent/package.json
@@ -1,35 +1,35 @@
 {
   "_args": [
     [
-      "http-proxy-agent@1.0.0",
+      "http-proxy-agent@2.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "http-proxy-agent@1.0.0",
-  "_id": "http-proxy-agent@1.0.0",
+  "_from": "http-proxy-agent@2.1.0",
+  "_id": "http-proxy-agent@2.1.0",
   "_inBundle": false,
-  "_integrity": "sha1-zBzjjkU7+YSg93AtLdWcc9CBKEo=",
+  "_integrity": "sha512-qwHbBLV7WviBl0rQsOzH6o5lwyOIvwp/BdFnvVxXORldu5TmjFfjzBcWUWS5kWAZhmv+JtiDhSuQCp4sBfbIgg==",
   "_location": "/http-proxy-agent",
   "_phantomChildren": {
-    "ms": "2.0.0"
+    "es6-promisify": "5.0.0"
   },
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "http-proxy-agent@1.0.0",
+    "raw": "http-proxy-agent@2.1.0",
     "name": "http-proxy-agent",
     "escapedName": "http-proxy-agent",
-    "rawSpec": "1.0.0",
+    "rawSpec": "2.1.0",
     "saveSpec": null,
-    "fetchSpec": "1.0.0"
+    "fetchSpec": "2.1.0"
   },
   "_requiredBy": [
     "/pac-proxy-agent",
     "/proxy-agent"
   ],
-  "_resolved": "https://registry.npmjs.org/http-proxy-agent/-/http-proxy-agent-1.0.0.tgz",
-  "_spec": "1.0.0",
+  "_resolved": "https://registry.npmjs.org/http-proxy-agent/-/http-proxy-agent-2.1.0.tgz",
+  "_spec": "2.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "Nathan Rajlich",
@@ -40,15 +40,17 @@
     "url": "https://github.com/TooTallNate/node-http-proxy-agent/issues"
   },
   "dependencies": {
-    "agent-base": "2",
-    "debug": "2",
-    "extend": "3"
+    "agent-base": "4",
+    "debug": "3.1.0"
   },
   "description": "An HTTP(s) proxy `http.Agent` implementation for HTTP",
   "devDependencies": {
-    "mocha": "2",
+    "mocha": "3",
     "proxy": "~0.2.3"
   },
+  "engines": {
+    "node": ">= 4.5.0"
+  },
   "homepage": "https://github.com/TooTallNate/node-http-proxy-agent#readme",
   "keywords": [
     "http",
@@ -57,7 +59,7 @@
     "agent"
   ],
   "license": "MIT",
-  "main": "http-proxy-agent.js",
+  "main": "./index.js",
   "name": "http-proxy-agent",
   "repository": {
     "type": "git",
@@ -66,5 +68,5 @@
   "scripts": {
     "test": "mocha --reporter spec"
   },
-  "version": "1.0.0"
+  "version": "2.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/.npmignore
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/.npmignore b/node_modules/https-proxy-agent/.npmignore
deleted file mode 100644
index c12f3a8..0000000
--- a/node_modules/https-proxy-agent/.npmignore
+++ /dev/null
@@ -1,2 +0,0 @@
-/node_modules
-/?.js

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/.travis.yml b/node_modules/https-proxy-agent/.travis.yml
index 85a5012..805d3d5 100644
--- a/node_modules/https-proxy-agent/.travis.yml
+++ b/node_modules/https-proxy-agent/.travis.yml
@@ -1,8 +1,22 @@
+sudo: false
+
 language: node_js
+
 node_js:
-  - "0.8"
-  - "0.10"
-  - "0.12"
-before_install:
-  - '[ "${TRAVIS_NODE_VERSION}" != "0.8" ] || npm install -g npm@1.4.28'
-  - npm install -g npm@latest
+  - "4"
+  - "5"
+  - "6"
+  - "7"
+  - "8"
+
+install:
+  - PATH="`npm bin`:`npm bin -g`:$PATH"
+  # Install dependencies and build
+  - npm install
+
+script:
+  # Output useful info for debugging
+  - node --version
+  - npm --version
+  # Run tests
+  - npm test

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/History.md
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/History.md b/node_modules/https-proxy-agent/History.md
index 0d882d4..f723812 100644
--- a/node_modules/https-proxy-agent/History.md
+++ b/node_modules/https-proxy-agent/History.md
@@ -1,4 +1,38 @@
 
+2.2.0 / 2018-03-03
+==================
+
+  * Add "engines" to package.json - requires Node.js >= 4.5.0
+  * Use `Buffer.from()`
+
+2.1.1 / 2017-11-28
+==================
+
+  * Update `debug` - Security Problems with Previous Version (#38)
+
+2.1.0 / 2017-08-08
+==================
+
+  * only include the port number in the Host header when non-default port (#22)
+  * set ALPN to "http 1.1" by default when using tlsproxy (#25)
+  * only set `ALPNProtocols` when the property does not already exist
+  * support SNI (#14)
+
+2.0.0 / 2017-06-26
+==================
+
+  * rename https-proxy-agent.js to index.js
+  * update dependencies and remove semver-specific test case
+  * update `agent-base` to v4
+  * remove `extend` dependency
+  * :arrow_up: update minimum version of debug dependency
+  * opts/options
+  * drop Node versions < v4 from Travis-CI
+  * test Node.js 5, 6, 7 and 8 on Travis-CI
+  * README: remove outdated `secureEndpoint` reference
+  * README: remove `secureEndpoint` docs, add `headers`
+  * https-proxy-agent: add support for proxy "headers"
+
 1.0.0 / 2015-07-10
 ==================
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/README.md
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/README.md b/node_modules/https-proxy-agent/README.md
index b62d9c8..5e0419c 100644
--- a/node_modules/https-proxy-agent/README.md
+++ b/node_modules/https-proxy-agent/README.md
@@ -42,13 +42,13 @@ console.log('using proxy server %j', proxy);
 // HTTPS endpoint for the proxy to connect to
 var endpoint = process.argv[2] || 'https://graph.facebook.com/tootallnate';
 console.log('attempting to GET %j', endpoint);
-var opts = url.parse(endpoint);
+var options = url.parse(endpoint);
 
 // create an instance of the `HttpsProxyAgent` class with the proxy server information
 var agent = new HttpsProxyAgent(proxy);
-opts.agent = agent;
+options.agent = agent;
 
-https.get(opts, function (res) {
+https.get(options, function (res) {
   console.log('"response" event!', res.headers);
   res.pipe(process.stdout);
 });
@@ -71,13 +71,9 @@ var parsed = url.parse(endpoint);
 console.log('attempting to connect to WebSocket %j', endpoint);
 
 // create an instance of the `HttpsProxyAgent` class with the proxy server information
-var opts = url.parse(proxy);
+var options = url.parse(proxy);
 
-// IMPORTANT! Set the `secureEndpoint` option to `false` when connecting
-//            over "ws://", but `true` when connecting over "wss://"
-opts.secureEndpoint = parsed.protocol ? parsed.protocol == 'wss:' : false;
-
-var agent = new HttpsProxyAgent(opts);
+var agent = new HttpsProxyAgent(options);
 
 // finally, initiate the WebSocket connection
 var socket = new WebSocket(endpoint, { agent: agent });
@@ -96,19 +92,19 @@ socket.on('message', function (data, flags) {
 API
 ---
 
-### new HttpsProxyAgent(opts)
+### new HttpsProxyAgent(Object options)
 
 The `HttpsProxyAgent` class implements an `http.Agent` subclass that connects
 to the specified "HTTP(s) proxy server" in order to proxy HTTPS and/or WebSocket
 requests. This is achieved by using the [HTTP `CONNECT` method][CONNECT].
 
-The `opts` argument may either be a string URI of the proxy server to use, or an
+The `options` argument may either be a string URI of the proxy server to use, or an
 "options" object with more specific properties:
 
   * `host` - String - Proxy host to connect to (may use `hostname` as well). Required.
   * `port` - Number - Proxy port to connect to. Required.
   * `secureProxy` - Boolean - If `true`, then use TLS to connect to the proxy. Defaults to `false`.
-  * `secureEndpoint` - Boolean - If `true` then a TLS connection to the endpoint will be established on top of the proxy socket. Defaults to `true`.
+  * `headers` - Object - Additional HTTP headers to be sent on the HTTP CONNECT method.
   * Any other options given are passed to the `net.connect()`/`tls.connect()` functions.
 
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/https-proxy-agent.js
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/https-proxy-agent.js b/node_modules/https-proxy-agent/https-proxy-agent.js
deleted file mode 100644
index 6baaa9d..0000000
--- a/node_modules/https-proxy-agent/https-proxy-agent.js
+++ /dev/null
@@ -1,202 +0,0 @@
-
-/**
- * Module dependencies.
- */
-
-var net = require('net');
-var tls = require('tls');
-var url = require('url');
-var extend = require('extend');
-var Agent = require('agent-base');
-var inherits = require('util').inherits;
-var debug = require('debug')('https-proxy-agent');
-
-/**
- * Module exports.
- */
-
-module.exports = HttpsProxyAgent;
-
-/**
- * The `HttpsProxyAgent` implements an HTTP Agent subclass that connects to the
- * specified "HTTP(s) proxy server" in order to proxy HTTPS requests.
- *
- * @api public
- */
-
-function HttpsProxyAgent (opts) {
-  if (!(this instanceof HttpsProxyAgent)) return new HttpsProxyAgent(opts);
-  if ('string' == typeof opts) opts = url.parse(opts);
-  if (!opts) throw new Error('an HTTP(S) proxy server `host` and `port` must be specified!');
-  debug('creating new HttpsProxyAgent instance: %o', opts);
-  Agent.call(this, connect);
-
-  var proxy = extend({}, opts);
-
-  // if `true`, then connect to the proxy server over TLS. defaults to `false`.
-  this.secureProxy = proxy.protocol ? /^https:?$/i.test(proxy.protocol) : false;
-
-  // prefer `hostname` over `host`, and set the `port` if needed
-  proxy.host = proxy.hostname || proxy.host;
-  proxy.port = +proxy.port || (this.secureProxy ? 443 : 80);
-
-  if (proxy.host && proxy.path) {
-    // if both a `host` and `path` are specified then it's most likely the
-    // result of a `url.parse()` call... we need to remove the `path` portion so
-    // that `net.connect()` doesn't attempt to open that as a unix socket file.
-    delete proxy.path;
-    delete proxy.pathname;
-  }
-
-  this.proxy = proxy;
-}
-inherits(HttpsProxyAgent, Agent);
-
-/**
- * Called when the node-core HTTP client library is creating a new HTTP request.
- *
- * @api public
- */
-
-function connect (req, opts, fn) {
-
-  var proxy = this.proxy;
-
-  // create a socket connection to the proxy server
-  var socket;
-  if (this.secureProxy) {
-    socket = tls.connect(proxy);
-  } else {
-    socket = net.connect(proxy);
-  }
-
-  // we need to buffer any HTTP traffic that happens with the proxy before we get
-  // the CONNECT response, so that if the response is anything other than an "200"
-  // response code, then we can re-play the "data" events on the socket once the
-  // HTTP parser is hooked up...
-  var buffers = [];
-  var buffersLength = 0;
-
-  function read () {
-    var b = socket.read();
-    if (b) ondata(b);
-    else socket.once('readable', read);
-  }
-
-  function cleanup () {
-    socket.removeListener('data', ondata);
-    socket.removeListener('end', onend);
-    socket.removeListener('error', onerror);
-    socket.removeListener('close', onclose);
-    socket.removeListener('readable', read);
-  }
-
-  function onclose (err) {
-    debug('onclose had error %o', err);
-  }
-
-  function onend () {
-    debug('onend');
-  }
-
-  function onerror (err) {
-    cleanup();
-    fn(err);
-  }
-
-  function ondata (b) {
-    buffers.push(b);
-    buffersLength += b.length;
-    var buffered = Buffer.concat(buffers, buffersLength);
-    var str = buffered.toString('ascii');
-
-    if (!~str.indexOf('\r\n\r\n')) {
-      // keep buffering
-      debug('have not received end of HTTP headers yet...');
-      if (socket.read) {
-        read();
-      } else {
-        socket.once('data', ondata);
-      }
-      return;
-    }
-
-    var firstLine = str.substring(0, str.indexOf('\r\n'));
-    var statusCode = +firstLine.split(' ')[1];
-    debug('got proxy server response: %o', firstLine);
-
-    if (200 == statusCode) {
-      // 200 Connected status code!
-      var sock = socket;
-
-      // nullify the buffered data since we won't be needing it
-      buffers = buffered = null;
-
-      if (opts.secureEndpoint) {
-        // since the proxy is connecting to an SSL server, we have
-        // to upgrade this socket connection to an SSL connection
-        debug('upgrading proxy-connected socket to TLS connection: %o', opts.host);
-        opts.socket = socket;
-        opts.servername = opts.host;
-        opts.host = null;
-        opts.hostname = null;
-        opts.port = null;
-        sock = tls.connect(opts);
-      }
-
-      cleanup();
-      fn(null, sock);
-    } else {
-      // some other status code that's not 200... need to re-play the HTTP header
-      // "data" events onto the socket once the HTTP machinery is attached so that
-      // the user can parse and handle the error status code
-      cleanup();
-
-      // save a reference to the concat'd Buffer for the `onsocket` callback
-      buffers = buffered;
-
-      // need to wait for the "socket" event to re-play the "data" events
-      req.once('socket', onsocket);
-      fn(null, socket);
-    }
-  }
-
-  function onsocket (socket) {
-    // replay the "buffers" Buffer onto the `socket`, since at this point
-    // the HTTP module machinery has been hooked up for the user
-    if ('function' == typeof socket.ondata) {
-      // node <= v0.11.3, the `ondata` function is set on the socket
-      socket.ondata(buffers, 0, buffers.length);
-    } else if (socket.listeners('data').length > 0) {
-      // node > v0.11.3, the "data" event is listened for directly
-      socket.emit('data', buffers);
-    } else {
-      // never?
-      throw new Error('should not happen...');
-    }
-
-    // nullify the cached Buffer instance
-    buffers = null;
-  }
-
-  socket.on('error', onerror);
-  socket.on('close', onclose);
-  socket.on('end', onend);
-
-  if (socket.read) {
-    read();
-  } else {
-    socket.once('data', ondata);
-  }
-
-  var hostname = opts.host + ':' + opts.port;
-  var msg = 'CONNECT ' + hostname + ' HTTP/1.1\r\n';
-  var auth = proxy.auth;
-  if (auth) {
-    msg += 'Proxy-Authorization: Basic ' + new Buffer(auth).toString('base64') + '\r\n';
-  }
-  msg += 'Host: ' + hostname + '\r\n' +
-         'Connection: close\r\n' +
-         '\r\n';
-  socket.write(msg);
-};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/index.js
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/index.js b/node_modules/https-proxy-agent/index.js
new file mode 100644
index 0000000..4e00712
--- /dev/null
+++ b/node_modules/https-proxy-agent/index.js
@@ -0,0 +1,228 @@
+/**
+ * Module dependencies.
+ */
+
+var net = require('net');
+var tls = require('tls');
+var url = require('url');
+var Agent = require('agent-base');
+var inherits = require('util').inherits;
+var debug = require('debug')('https-proxy-agent');
+
+/**
+ * Module exports.
+ */
+
+module.exports = HttpsProxyAgent;
+
+/**
+ * The `HttpsProxyAgent` implements an HTTP Agent subclass that connects to the
+ * specified "HTTP(s) proxy server" in order to proxy HTTPS requests.
+ *
+ * @api public
+ */
+
+function HttpsProxyAgent(opts) {
+  if (!(this instanceof HttpsProxyAgent)) return new HttpsProxyAgent(opts);
+  if ('string' == typeof opts) opts = url.parse(opts);
+  if (!opts)
+    throw new Error(
+      'an HTTP(S) proxy server `host` and `port` must be specified!'
+    );
+  debug('creating new HttpsProxyAgent instance: %o', opts);
+  Agent.call(this, opts);
+
+  var proxy = Object.assign({}, opts);
+
+  // if `true`, then connect to the proxy server over TLS. defaults to `false`.
+  this.secureProxy = proxy.protocol ? /^https:?$/i.test(proxy.protocol) : false;
+
+  // prefer `hostname` over `host`, and set the `port` if needed
+  proxy.host = proxy.hostname || proxy.host;
+  proxy.port = +proxy.port || (this.secureProxy ? 443 : 80);
+
+  // ALPN is supported by Node.js >= v5.
+  // attempt to negotiate http/1.1 for proxy servers that support http/2
+  if (this.secureProxy && !('ALPNProtocols' in proxy)) {
+    proxy.ALPNProtocols = ['http 1.1']
+  }
+
+  if (proxy.host && proxy.path) {
+    // if both a `host` and `path` are specified then it's most likely the
+    // result of a `url.parse()` call... we need to remove the `path` portion so
+    // that `net.connect()` doesn't attempt to open that as a unix socket file.
+    delete proxy.path;
+    delete proxy.pathname;
+  }
+
+  this.proxy = proxy;
+}
+inherits(HttpsProxyAgent, Agent);
+
+/**
+ * Called when the node-core HTTP client library is creating a new HTTP request.
+ *
+ * @api public
+ */
+
+HttpsProxyAgent.prototype.callback = function connect(req, opts, fn) {
+  var proxy = this.proxy;
+
+  // create a socket connection to the proxy server
+  var socket;
+  if (this.secureProxy) {
+    socket = tls.connect(proxy);
+  } else {
+    socket = net.connect(proxy);
+  }
+
+  // we need to buffer any HTTP traffic that happens with the proxy before we get
+  // the CONNECT response, so that if the response is anything other than an "200"
+  // response code, then we can re-play the "data" events on the socket once the
+  // HTTP parser is hooked up...
+  var buffers = [];
+  var buffersLength = 0;
+
+  function read() {
+    var b = socket.read();
+    if (b) ondata(b);
+    else socket.once('readable', read);
+  }
+
+  function cleanup() {
+    socket.removeListener('data', ondata);
+    socket.removeListener('end', onend);
+    socket.removeListener('error', onerror);
+    socket.removeListener('close', onclose);
+    socket.removeListener('readable', read);
+  }
+
+  function onclose(err) {
+    debug('onclose had error %o', err);
+  }
+
+  function onend() {
+    debug('onend');
+  }
+
+  function onerror(err) {
+    cleanup();
+    fn(err);
+  }
+
+  function ondata(b) {
+    buffers.push(b);
+    buffersLength += b.length;
+    var buffered = Buffer.concat(buffers, buffersLength);
+    var str = buffered.toString('ascii');
+
+    if (!~str.indexOf('\r\n\r\n')) {
+      // keep buffering
+      debug('have not received end of HTTP headers yet...');
+      if (socket.read) {
+        read();
+      } else {
+        socket.once('data', ondata);
+      }
+      return;
+    }
+
+    var firstLine = str.substring(0, str.indexOf('\r\n'));
+    var statusCode = +firstLine.split(' ')[1];
+    debug('got proxy server response: %o', firstLine);
+
+    if (200 == statusCode) {
+      // 200 Connected status code!
+      var sock = socket;
+
+      // nullify the buffered data since we won't be needing it
+      buffers = buffered = null;
+
+      if (opts.secureEndpoint) {
+        // since the proxy is connecting to an SSL server, we have
+        // to upgrade this socket connection to an SSL connection
+        debug(
+          'upgrading proxy-connected socket to TLS connection: %o',
+          opts.host
+        );
+        opts.socket = socket;
+        opts.servername = opts.servername || opts.host;
+        opts.host = null;
+        opts.hostname = null;
+        opts.port = null;
+        sock = tls.connect(opts);
+      }
+
+      cleanup();
+      fn(null, sock);
+    } else {
+      // some other status code that's not 200... need to re-play the HTTP header
+      // "data" events onto the socket once the HTTP machinery is attached so that
+      // the user can parse and handle the error status code
+      cleanup();
+
+      // save a reference to the concat'd Buffer for the `onsocket` callback
+      buffers = buffered;
+
+      // need to wait for the "socket" event to re-play the "data" events
+      req.once('socket', onsocket);
+      fn(null, socket);
+    }
+  }
+
+  function onsocket(socket) {
+    // replay the "buffers" Buffer onto the `socket`, since at this point
+    // the HTTP module machinery has been hooked up for the user
+    if ('function' == typeof socket.ondata) {
+      // node <= v0.11.3, the `ondata` function is set on the socket
+      socket.ondata(buffers, 0, buffers.length);
+    } else if (socket.listeners('data').length > 0) {
+      // node > v0.11.3, the "data" event is listened for directly
+      socket.emit('data', buffers);
+    } else {
+      // never?
+      throw new Error('should not happen...');
+    }
+
+    // nullify the cached Buffer instance
+    buffers = null;
+  }
+
+  socket.on('error', onerror);
+  socket.on('close', onclose);
+  socket.on('end', onend);
+
+  if (socket.read) {
+    read();
+  } else {
+    socket.once('data', ondata);
+  }
+
+  var hostname = opts.host + ':' + opts.port;
+  var msg = 'CONNECT ' + hostname + ' HTTP/1.1\r\n';
+
+  var headers = Object.assign({}, proxy.headers);
+  if (proxy.auth) {
+    headers['Proxy-Authorization'] =
+      'Basic ' + Buffer.from(proxy.auth).toString('base64');
+  }
+
+  // the Host header should only include the port
+  // number when it is a non-standard port
+  var host = opts.host;
+  if (!isDefaultPort(opts.port, opts.secureEndpoint)) {
+    host += ':' + opts.port;
+  }
+  headers['Host'] = host;
+
+  headers['Connection'] = 'close';
+  Object.keys(headers).forEach(function(name) {
+    msg += name + ': ' + headers[name] + '\r\n';
+  });
+
+  socket.write(msg + '\r\n');
+};
+
+function isDefaultPort(port, secure) {
+  return Boolean((!secure && port === 80) || (secure && port === 443));
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/agent-base/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/agent-base/.travis.yml b/node_modules/https-proxy-agent/node_modules/agent-base/.travis.yml
new file mode 100644
index 0000000..6ce862c
--- /dev/null
+++ b/node_modules/https-proxy-agent/node_modules/agent-base/.travis.yml
@@ -0,0 +1,23 @@
+sudo: false
+
+language: node_js
+
+node_js:
+  - "4"
+  - "5"
+  - "6"
+  - "7"
+  - "8"
+  - "9"
+
+install:
+  - PATH="`npm bin`:`npm bin -g`:$PATH"
+  # Install dependencies and build
+  - npm install
+
+script:
+  # Output useful info for debugging
+  - node --version
+  - npm --version
+  # Run tests
+  - npm test

[11/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.js b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.js
new file mode 100644
index 0000000..30d0130
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.js
@@ -0,0 +1,1181 @@
+/*!
+ * @overview es6-promise - a tiny implementation of Promises/A+.
+ * @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald)
+ * @license   Licensed under MIT license
+ *            See https://raw.githubusercontent.com/stefanpenner/es6-promise/master/LICENSE
+ * @version   v4.2.4+314e4831
+ */
+
+(function (global, factory) {
+	typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :
+	typeof define === 'function' && define.amd ? define(factory) :
+	(global.ES6Promise = factory());
+}(this, (function () { 'use strict';
+
+function objectOrFunction(x) {
+  var type = typeof x;
+  return x !== null && (type === 'object' || type === 'function');
+}
+
+function isFunction(x) {
+  return typeof x === 'function';
+}
+
+
+
+var _isArray = void 0;
+if (Array.isArray) {
+  _isArray = Array.isArray;
+} else {
+  _isArray = function (x) {
+    return Object.prototype.toString.call(x) === '[object Array]';
+  };
+}
+
+var isArray = _isArray;
+
+var len = 0;
+var vertxNext = void 0;
+var customSchedulerFn = void 0;
+
+var asap = function asap(callback, arg) {
+  queue[len] = callback;
+  queue[len + 1] = arg;
+  len += 2;
+  if (len === 2) {
+    // If len is 2, that means that we need to schedule an async flush.
+    // If additional callbacks are queued before the queue is flushed, they
+    // will be processed by this flush that we are scheduling.
+    if (customSchedulerFn) {
+      customSchedulerFn(flush);
+    } else {
+      scheduleFlush();
+    }
+  }
+};
+
+function setScheduler(scheduleFn) {
+  customSchedulerFn = scheduleFn;
+}
+
+function setAsap(asapFn) {
+  asap = asapFn;
+}
+
+var browserWindow = typeof window !== 'undefined' ? window : undefined;
+var browserGlobal = browserWindow || {};
+var BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;
+var isNode = typeof self === 'undefined' && typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';
+
+// test for web worker but not in IE10
+var isWorker = typeof Uint8ClampedArray !== 'undefined' && typeof importScripts !== 'undefined' && typeof MessageChannel !== 'undefined';
+
+// node
+function useNextTick() {
+  // node version 0.10.x displays a deprecation warning when nextTick is used recursively
+  // see https://github.com/cujojs/when/issues/410 for details
+  return function () {
+    return process.nextTick(flush);
+  };
+}
+
+// vertx
+function useVertxTimer() {
+  if (typeof vertxNext !== 'undefined') {
+    return function () {
+      vertxNext(flush);
+    };
+  }
+
+  return useSetTimeout();
+}
+
+function useMutationObserver() {
+  var iterations = 0;
+  var observer = new BrowserMutationObserver(flush);
+  var node = document.createTextNode('');
+  observer.observe(node, { characterData: true });
+
+  return function () {
+    node.data = iterations = ++iterations % 2;
+  };
+}
+
+// web worker
+function useMessageChannel() {
+  var channel = new MessageChannel();
+  channel.port1.onmessage = flush;
+  return function () {
+    return channel.port2.postMessage(0);
+  };
+}
+
+function useSetTimeout() {
+  // Store setTimeout reference so es6-promise will be unaffected by
+  // other code modifying setTimeout (like sinon.useFakeTimers())
+  var globalSetTimeout = setTimeout;
+  return function () {
+    return globalSetTimeout(flush, 1);
+  };
+}
+
+var queue = new Array(1000);
+function flush() {
+  for (var i = 0; i < len; i += 2) {
+    var callback = queue[i];
+    var arg = queue[i + 1];
+
+    callback(arg);
+
+    queue[i] = undefined;
+    queue[i + 1] = undefined;
+  }
+
+  len = 0;
+}
+
+function attemptVertx() {
+  try {
+    var vertx = Function('return this')().require('vertx');
+    vertxNext = vertx.runOnLoop || vertx.runOnContext;
+    return useVertxTimer();
+  } catch (e) {
+    return useSetTimeout();
+  }
+}
+
+var scheduleFlush = void 0;
+// Decide what async method to use to triggering processing of queued callbacks:
+if (isNode) {
+  scheduleFlush = useNextTick();
+} else if (BrowserMutationObserver) {
+  scheduleFlush = useMutationObserver();
+} else if (isWorker) {
+  scheduleFlush = useMessageChannel();
+} else if (browserWindow === undefined && typeof require === 'function') {
+  scheduleFlush = attemptVertx();
+} else {
+  scheduleFlush = useSetTimeout();
+}
+
+function then(onFulfillment, onRejection) {
+  var parent = this;
+
+  var child = new this.constructor(noop);
+
+  if (child[PROMISE_ID] === undefined) {
+    makePromise(child);
+  }
+
+  var _state = parent._state;
+
+
+  if (_state) {
+    var callback = arguments[_state - 1];
+    asap(function () {
+      return invokeCallback(_state, child, callback, parent._result);
+    });
+  } else {
+    subscribe(parent, child, onFulfillment, onRejection);
+  }
+
+  return child;
+}
+
+/**
+  `Promise.resolve` returns a promise that will become resolved with the
+  passed `value`. It is shorthand for the following:
+
+  ```javascript
+  let promise = new Promise(function(resolve, reject){
+    resolve(1);
+  });
+
+  promise.then(function(value){
+    // value === 1
+  });
+  ```
+
+  Instead of writing the above, your code now simply becomes the following:
+
+  ```javascript
+  let promise = Promise.resolve(1);
+
+  promise.then(function(value){
+    // value === 1
+  });
+  ```
+
+  @method resolve
+  @static
+  @param {Any} value value that the returned promise will be resolved with
+  Useful for tooling.
+  @return {Promise} a promise that will become fulfilled with the given
+  `value`
+*/
+function resolve$1(object) {
+  /*jshint validthis:true */
+  var Constructor = this;
+
+  if (object && typeof object === 'object' && object.constructor === Constructor) {
+    return object;
+  }
+
+  var promise = new Constructor(noop);
+  resolve(promise, object);
+  return promise;
+}
+
+var PROMISE_ID = Math.random().toString(36).substring(2);
+
+function noop() {}
+
+var PENDING = void 0;
+var FULFILLED = 1;
+var REJECTED = 2;
+
+var TRY_CATCH_ERROR = { error: null };
+
+function selfFulfillment() {
+  return new TypeError("You cannot resolve a promise with itself");
+}
+
+function cannotReturnOwn() {
+  return new TypeError('A promises callback cannot return that same promise.');
+}
+
+function getThen(promise) {
+  try {
+    return promise.then;
+  } catch (error) {
+    TRY_CATCH_ERROR.error = error;
+    return TRY_CATCH_ERROR;
+  }
+}
+
+function tryThen(then$$1, value, fulfillmentHandler, rejectionHandler) {
+  try {
+    then$$1.call(value, fulfillmentHandler, rejectionHandler);
+  } catch (e) {
+    return e;
+  }
+}
+
+function handleForeignThenable(promise, thenable, then$$1) {
+  asap(function (promise) {
+    var sealed = false;
+    var error = tryThen(then$$1, thenable, function (value) {
+      if (sealed) {
+        return;
+      }
+      sealed = true;
+      if (thenable !== value) {
+        resolve(promise, value);
+      } else {
+        fulfill(promise, value);
+      }
+    }, function (reason) {
+      if (sealed) {
+        return;
+      }
+      sealed = true;
+
+      reject(promise, reason);
+    }, 'Settle: ' + (promise._label || ' unknown promise'));
+
+    if (!sealed && error) {
+      sealed = true;
+      reject(promise, error);
+    }
+  }, promise);
+}
+
+function handleOwnThenable(promise, thenable) {
+  if (thenable._state === FULFILLED) {
+    fulfill(promise, thenable._result);
+  } else if (thenable._state === REJECTED) {
+    reject(promise, thenable._result);
+  } else {
+    subscribe(thenable, undefined, function (value) {
+      return resolve(promise, value);
+    }, function (reason) {
+      return reject(promise, reason);
+    });
+  }
+}
+
+function handleMaybeThenable(promise, maybeThenable, then$$1) {
+  if (maybeThenable.constructor === promise.constructor && then$$1 === then && maybeThenable.constructor.resolve === resolve$1) {
+    handleOwnThenable(promise, maybeThenable);
+  } else {
+    if (then$$1 === TRY_CATCH_ERROR) {
+      reject(promise, TRY_CATCH_ERROR.error);
+      TRY_CATCH_ERROR.error = null;
+    } else if (then$$1 === undefined) {
+      fulfill(promise, maybeThenable);
+    } else if (isFunction(then$$1)) {
+      handleForeignThenable(promise, maybeThenable, then$$1);
+    } else {
+      fulfill(promise, maybeThenable);
+    }
+  }
+}
+
+function resolve(promise, value) {
+  if (promise === value) {
+    reject(promise, selfFulfillment());
+  } else if (objectOrFunction(value)) {
+    handleMaybeThenable(promise, value, getThen(value));
+  } else {
+    fulfill(promise, value);
+  }
+}
+
+function publishRejection(promise) {
+  if (promise._onerror) {
+    promise._onerror(promise._result);
+  }
+
+  publish(promise);
+}
+
+function fulfill(promise, value) {
+  if (promise._state !== PENDING) {
+    return;
+  }
+
+  promise._result = value;
+  promise._state = FULFILLED;
+
+  if (promise._subscribers.length !== 0) {
+    asap(publish, promise);
+  }
+}
+
+function reject(promise, reason) {
+  if (promise._state !== PENDING) {
+    return;
+  }
+  promise._state = REJECTED;
+  promise._result = reason;
+
+  asap(publishRejection, promise);
+}
+
+function subscribe(parent, child, onFulfillment, onRejection) {
+  var _subscribers = parent._subscribers;
+  var length = _subscribers.length;
+
+
+  parent._onerror = null;
+
+  _subscribers[length] = child;
+  _subscribers[length + FULFILLED] = onFulfillment;
+  _subscribers[length + REJECTED] = onRejection;
+
+  if (length === 0 && parent._state) {
+    asap(publish, parent);
+  }
+}
+
+function publish(promise) {
+  var subscribers = promise._subscribers;
+  var settled = promise._state;
+
+  if (subscribers.length === 0) {
+    return;
+  }
+
+  var child = void 0,
+      callback = void 0,
+      detail = promise._result;
+
+  for (var i = 0; i < subscribers.length; i += 3) {
+    child = subscribers[i];
+    callback = subscribers[i + settled];
+
+    if (child) {
+      invokeCallback(settled, child, callback, detail);
+    } else {
+      callback(detail);
+    }
+  }
+
+  promise._subscribers.length = 0;
+}
+
+function tryCatch(callback, detail) {
+  try {
+    return callback(detail);
+  } catch (e) {
+    TRY_CATCH_ERROR.error = e;
+    return TRY_CATCH_ERROR;
+  }
+}
+
+function invokeCallback(settled, promise, callback, detail) {
+  var hasCallback = isFunction(callback),
+      value = void 0,
+      error = void 0,
+      succeeded = void 0,
+      failed = void 0;
+
+  if (hasCallback) {
+    value = tryCatch(callback, detail);
+
+    if (value === TRY_CATCH_ERROR) {
+      failed = true;
+      error = value.error;
+      value.error = null;
+    } else {
+      succeeded = true;
+    }
+
+    if (promise === value) {
+      reject(promise, cannotReturnOwn());
+      return;
+    }
+  } else {
+    value = detail;
+    succeeded = true;
+  }
+
+  if (promise._state !== PENDING) {
+    // noop
+  } else if (hasCallback && succeeded) {
+    resolve(promise, value);
+  } else if (failed) {
+    reject(promise, error);
+  } else if (settled === FULFILLED) {
+    fulfill(promise, value);
+  } else if (settled === REJECTED) {
+    reject(promise, value);
+  }
+}
+
+function initializePromise(promise, resolver) {
+  try {
+    resolver(function resolvePromise(value) {
+      resolve(promise, value);
+    }, function rejectPromise(reason) {
+      reject(promise, reason);
+    });
+  } catch (e) {
+    reject(promise, e);
+  }
+}
+
+var id = 0;
+function nextId() {
+  return id++;
+}
+
+function makePromise(promise) {
+  promise[PROMISE_ID] = id++;
+  promise._state = undefined;
+  promise._result = undefined;
+  promise._subscribers = [];
+}
+
+function validationError() {
+  return new Error('Array Methods must be provided an Array');
+}
+
+var Enumerator = function () {
+  function Enumerator(Constructor, input) {
+    this._instanceConstructor = Constructor;
+    this.promise = new Constructor(noop);
+
+    if (!this.promise[PROMISE_ID]) {
+      makePromise(this.promise);
+    }
+
+    if (isArray(input)) {
+      this.length = input.length;
+      this._remaining = input.length;
+
+      this._result = new Array(this.length);
+
+      if (this.length === 0) {
+        fulfill(this.promise, this._result);
+      } else {
+        this.length = this.length || 0;
+        this._enumerate(input);
+        if (this._remaining === 0) {
+          fulfill(this.promise, this._result);
+        }
+      }
+    } else {
+      reject(this.promise, validationError());
+    }
+  }
+
+  Enumerator.prototype._enumerate = function _enumerate(input) {
+    for (var i = 0; this._state === PENDING && i < input.length; i++) {
+      this._eachEntry(input[i], i);
+    }
+  };
+
+  Enumerator.prototype._eachEntry = function _eachEntry(entry, i) {
+    var c = this._instanceConstructor;
+    var resolve$$1 = c.resolve;
+
+
+    if (resolve$$1 === resolve$1) {
+      var _then = getThen(entry);
+
+      if (_then === then && entry._state !== PENDING) {
+        this._settledAt(entry._state, i, entry._result);
+      } else if (typeof _then !== 'function') {
+        this._remaining--;
+        this._result[i] = entry;
+      } else if (c === Promise$2) {
+        var promise = new c(noop);
+        handleMaybeThenable(promise, entry, _then);
+        this._willSettleAt(promise, i);
+      } else {
+        this._willSettleAt(new c(function (resolve$$1) {
+          return resolve$$1(entry);
+        }), i);
+      }
+    } else {
+      this._willSettleAt(resolve$$1(entry), i);
+    }
+  };
+
+  Enumerator.prototype._settledAt = function _settledAt(state, i, value) {
+    var promise = this.promise;
+
+
+    if (promise._state === PENDING) {
+      this._remaining--;
+
+      if (state === REJECTED) {
+        reject(promise, value);
+      } else {
+        this._result[i] = value;
+      }
+    }
+
+    if (this._remaining === 0) {
+      fulfill(promise, this._result);
+    }
+  };
+
+  Enumerator.prototype._willSettleAt = function _willSettleAt(promise, i) {
+    var enumerator = this;
+
+    subscribe(promise, undefined, function (value) {
+      return enumerator._settledAt(FULFILLED, i, value);
+    }, function (reason) {
+      return enumerator._settledAt(REJECTED, i, reason);
+    });
+  };
+
+  return Enumerator;
+}();
+
+/**
+  `Promise.all` accepts an array of promises, and returns a new promise which
+  is fulfilled with an array of fulfillment values for the passed promises, or
+  rejected with the reason of the first passed promise to be rejected. It casts all
+  elements of the passed iterable to promises as it runs this algorithm.
+
+  Example:
+
+  ```javascript
+  let promise1 = resolve(1);
+  let promise2 = resolve(2);
+  let promise3 = resolve(3);
+  let promises = [ promise1, promise2, promise3 ];
+
+  Promise.all(promises).then(function(array){
+    // The array here would be [ 1, 2, 3 ];
+  });
+  ```
+
+  If any of the `promises` given to `all` are rejected, the first promise
+  that is rejected will be given as an argument to the returned promises's
+  rejection handler. For example:
+
+  Example:
+
+  ```javascript
+  let promise1 = resolve(1);
+  let promise2 = reject(new Error("2"));
+  let promise3 = reject(new Error("3"));
+  let promises = [ promise1, promise2, promise3 ];
+
+  Promise.all(promises).then(function(array){
+    // Code here never runs because there are rejected promises!
+  }, function(error) {
+    // error.message === "2"
+  });
+  ```
+
+  @method all
+  @static
+  @param {Array} entries array of promises
+  @param {String} label optional string for labeling the promise.
+  Useful for tooling.
+  @return {Promise} promise that is fulfilled when all `promises` have been
+  fulfilled, or rejected if any of them become rejected.
+  @static
+*/
+function all(entries) {
+  return new Enumerator(this, entries).promise;
+}
+
+/**
+  `Promise.race` returns a new promise which is settled in the same way as the
+  first passed promise to settle.
+
+  Example:
+
+  ```javascript
+  let promise1 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 1');
+    }, 200);
+  });
+
+  let promise2 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 2');
+    }, 100);
+  });
+
+  Promise.race([promise1, promise2]).then(function(result){
+    // result === 'promise 2' because it was resolved before promise1
+    // was resolved.
+  });
+  ```
+
+  `Promise.race` is deterministic in that only the state of the first
+  settled promise matters. For example, even if other promises given to the
+  `promises` array argument are resolved, but the first settled promise has
+  become rejected before the other promises became fulfilled, the returned
+  promise will become rejected:
+
+  ```javascript
+  let promise1 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      resolve('promise 1');
+    }, 200);
+  });
+
+  let promise2 = new Promise(function(resolve, reject){
+    setTimeout(function(){
+      reject(new Error('promise 2'));
+    }, 100);
+  });
+
+  Promise.race([promise1, promise2]).then(function(result){
+    // Code here never runs
+  }, function(reason){
+    // reason.message === 'promise 2' because promise 2 became rejected before
+    // promise 1 became fulfilled
+  });
+  ```
+
+  An example real-world use case is implementing timeouts:
+
+  ```javascript
+  Promise.race([ajax('foo.json'), timeout(5000)])
+  ```
+
+  @method race
+  @static
+  @param {Array} promises array of promises to observe
+  Useful for tooling.
+  @return {Promise} a promise which settles in the same way as the first passed
+  promise to settle.
+*/
+function race(entries) {
+  /*jshint validthis:true */
+  var Constructor = this;
+
+  if (!isArray(entries)) {
+    return new Constructor(function (_, reject) {
+      return reject(new TypeError('You must pass an array to race.'));
+    });
+  } else {
+    return new Constructor(function (resolve, reject) {
+      var length = entries.length;
+      for (var i = 0; i < length; i++) {
+        Constructor.resolve(entries[i]).then(resolve, reject);
+      }
+    });
+  }
+}
+
+/**
+  `Promise.reject` returns a promise rejected with the passed `reason`.
+  It is shorthand for the following:
+
+  ```javascript
+  let promise = new Promise(function(resolve, reject){
+    reject(new Error('WHOOPS'));
+  });
+
+  promise.then(function(value){
+    // Code here doesn't run because the promise is rejected!
+  }, function(reason){
+    // reason.message === 'WHOOPS'
+  });
+  ```
+
+  Instead of writing the above, your code now simply becomes the following:
+
+  ```javascript
+  let promise = Promise.reject(new Error('WHOOPS'));
+
+  promise.then(function(value){
+    // Code here doesn't run because the promise is rejected!
+  }, function(reason){
+    // reason.message === 'WHOOPS'
+  });
+  ```
+
+  @method reject
+  @static
+  @param {Any} reason value that the returned promise will be rejected with.
+  Useful for tooling.
+  @return {Promise} a promise rejected with the given `reason`.
+*/
+function reject$1(reason) {
+  /*jshint validthis:true */
+  var Constructor = this;
+  var promise = new Constructor(noop);
+  reject(promise, reason);
+  return promise;
+}
+
+function needsResolver() {
+  throw new TypeError('You must pass a resolver function as the first argument to the promise constructor');
+}
+
+function needsNew() {
+  throw new TypeError("Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.");
+}
+
+/**
+  Promise objects represent the eventual result of an asynchronous operation. The
+  primary way of interacting with a promise is through its `then` method, which
+  registers callbacks to receive either a promise's eventual value or the reason
+  why the promise cannot be fulfilled.
+
+  Terminology
+  -----------
+
+  - `promise` is an object or function with a `then` method whose behavior conforms to this specification.
+  - `thenable` is an object or function that defines a `then` method.
+  - `value` is any legal JavaScript value (including undefined, a thenable, or a promise).
+  - `exception` is a value that is thrown using the throw statement.
+  - `reason` is a value that indicates why a promise was rejected.
+  - `settled` the final resting state of a promise, fulfilled or rejected.
+
+  A promise can be in one of three states: pending, fulfilled, or rejected.
+
+  Promises that are fulfilled have a fulfillment value and are in the fulfilled
+  state.  Promises that are rejected have a rejection reason and are in the
+  rejected state.  A fulfillment value is never a thenable.
+
+  Promises can also be said to *resolve* a value.  If this value is also a
+  promise, then the original promise's settled state will match the value's
+  settled state.  So a promise that *resolves* a promise that rejects will
+  itself reject, and a promise that *resolves* a promise that fulfills will
+  itself fulfill.
+
+
+  Basic Usage:
+  ------------
+
+  ```js
+  let promise = new Promise(function(resolve, reject) {
+    // on success
+    resolve(value);
+
+    // on failure
+    reject(reason);
+  });
+
+  promise.then(function(value) {
+    // on fulfillment
+  }, function(reason) {
+    // on rejection
+  });
+  ```
+
+  Advanced Usage:
+  ---------------
+
+  Promises shine when abstracting away asynchronous interactions such as
+  `XMLHttpRequest`s.
+
+  ```js
+  function getJSON(url) {
+    return new Promise(function(resolve, reject){
+      let xhr = new XMLHttpRequest();
+
+      xhr.open('GET', url);
+      xhr.onreadystatechange = handler;
+      xhr.responseType = 'json';
+      xhr.setRequestHeader('Accept', 'application/json');
+      xhr.send();
+
+      function handler() {
+        if (this.readyState === this.DONE) {
+          if (this.status === 200) {
+            resolve(this.response);
+          } else {
+            reject(new Error('getJSON: `' + url + '` failed with status: [' + this.status + ']'));
+          }
+        }
+      };
+    });
+  }
+
+  getJSON('/posts.json').then(function(json) {
+    // on fulfillment
+  }, function(reason) {
+    // on rejection
+  });
+  ```
+
+  Unlike callbacks, promises are great composable primitives.
+
+  ```js
+  Promise.all([
+    getJSON('/posts'),
+    getJSON('/comments')
+  ]).then(function(values){
+    values[0] // => postsJSON
+    values[1] // => commentsJSON
+
+    return values;
+  });
+  ```
+
+  @class Promise
+  @param {Function} resolver
+  Useful for tooling.
+  @constructor
+*/
+
+var Promise$2 = function () {
+  function Promise(resolver) {
+    this[PROMISE_ID] = nextId();
+    this._result = this._state = undefined;
+    this._subscribers = [];
+
+    if (noop !== resolver) {
+      typeof resolver !== 'function' && needsResolver();
+      this instanceof Promise ? initializePromise(this, resolver) : needsNew();
+    }
+  }
+
+  /**
+  The primary way of interacting with a promise is through its `then` method,
+  which registers callbacks to receive either a promise's eventual value or the
+  reason why the promise cannot be fulfilled.
+   ```js
+  findUser().then(function(user){
+    // user is available
+  }, function(reason){
+    // user is unavailable, and you are given the reason why
+  });
+  ```
+   Chaining
+  --------
+   The return value of `then` is itself a promise.  This second, 'downstream'
+  promise is resolved with the return value of the first promise's fulfillment
+  or rejection handler, or rejected if the handler throws an exception.
+   ```js
+  findUser().then(function (user) {
+    return user.name;
+  }, function (reason) {
+    return 'default name';
+  }).then(function (userName) {
+    // If `findUser` fulfilled, `userName` will be the user's name, otherwise it
+    // will be `'default name'`
+  });
+   findUser().then(function (user) {
+    throw new Error('Found user, but still unhappy');
+  }, function (reason) {
+    throw new Error('`findUser` rejected and we're unhappy');
+  }).then(function (value) {
+    // never reached
+  }, function (reason) {
+    // if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.
+    // If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.
+  });
+  ```
+  If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.
+   ```js
+  findUser().then(function (user) {
+    throw new PedagogicalException('Upstream error');
+  }).then(function (value) {
+    // never reached
+  }).then(function (value) {
+    // never reached
+  }, function (reason) {
+    // The `PedgagocialException` is propagated all the way down to here
+  });
+  ```
+   Assimilation
+  ------------
+   Sometimes the value you want to propagate to a downstream promise can only be
+  retrieved asynchronously. This can be achieved by returning a promise in the
+  fulfillment or rejection handler. The downstream promise will then be pending
+  until the returned promise is settled. This is called *assimilation*.
+   ```js
+  findUser().then(function (user) {
+    return findCommentsByAuthor(user);
+  }).then(function (comments) {
+    // The user's comments are now available
+  });
+  ```
+   If the assimliated promise rejects, then the downstream promise will also reject.
+   ```js
+  findUser().then(function (user) {
+    return findCommentsByAuthor(user);
+  }).then(function (comments) {
+    // If `findCommentsByAuthor` fulfills, we'll have the value here
+  }, function (reason) {
+    // If `findCommentsByAuthor` rejects, we'll have the reason here
+  });
+  ```
+   Simple Example
+  --------------
+   Synchronous Example
+   ```javascript
+  let result;
+   try {
+    result = findResult();
+    // success
+  } catch(reason) {
+    // failure
+  }
+  ```
+   Errback Example
+   ```js
+  findResult(function(result, err){
+    if (err) {
+      // failure
+    } else {
+      // success
+    }
+  });
+  ```
+   Promise Example;
+   ```javascript
+  findResult().then(function(result){
+    // success
+  }, function(reason){
+    // failure
+  });
+  ```
+   Advanced Example
+  --------------
+   Synchronous Example
+   ```javascript
+  let author, books;
+   try {
+    author = findAuthor();
+    books  = findBooksByAuthor(author);
+    // success
+  } catch(reason) {
+    // failure
+  }
+  ```
+   Errback Example
+   ```js
+   function foundBooks(books) {
+   }
+   function failure(reason) {
+   }
+   findAuthor(function(author, err){
+    if (err) {
+      failure(err);
+      // failure
+    } else {
+      try {
+        findBoooksByAuthor(author, function(books, err) {
+          if (err) {
+            failure(err);
+          } else {
+            try {
+              foundBooks(books);
+            } catch(reason) {
+              failure(reason);
+            }
+          }
+        });
+      } catch(error) {
+        failure(err);
+      }
+      // success
+    }
+  });
+  ```
+   Promise Example;
+   ```javascript
+  findAuthor().
+    then(findBooksByAuthor).
+    then(function(books){
+      // found books
+  }).catch(function(reason){
+    // something went wrong
+  });
+  ```
+   @method then
+  @param {Function} onFulfilled
+  @param {Function} onRejected
+  Useful for tooling.
+  @return {Promise}
+  */
+
+  /**
+  `catch` is simply sugar for `then(undefined, onRejection)` which makes it the same
+  as the catch block of a try/catch statement.
+  ```js
+  function findAuthor(){
+  throw new Error('couldn't find that author');
+  }
+  // synchronous
+  try {
+  findAuthor();
+  } catch(reason) {
+  // something went wrong
+  }
+  // async with promises
+  findAuthor().catch(function(reason){
+  // something went wrong
+  });
+  ```
+  @method catch
+  @param {Function} onRejection
+  Useful for tooling.
+  @return {Promise}
+  */
+
+
+  Promise.prototype.catch = function _catch(onRejection) {
+    return this.then(null, onRejection);
+  };
+
+  /**
+    `finally` will be invoked regardless of the promise's fate just as native
+    try/catch/finally behaves
+  
+    Synchronous example:
+  
+    ```js
+    findAuthor() {
+      if (Math.random() > 0.5) {
+        throw new Error();
+      }
+      return new Author();
+    }
+  
+    try {
+      return findAuthor(); // succeed or fail
+    } catch(error) {
+      return findOtherAuther();
+    } finally {
+      // always runs
+      // doesn't affect the return value
+    }
+    ```
+  
+    Asynchronous example:
+  
+    ```js
+    findAuthor().catch(function(reason){
+      return findOtherAuther();
+    }).finally(function(){
+      // author was either found, or not
+    });
+    ```
+  
+    @method finally
+    @param {Function} callback
+    @return {Promise}
+  */
+
+
+  Promise.prototype.finally = function _finally(callback) {
+    var promise = this;
+    var constructor = promise.constructor;
+
+    return promise.then(function (value) {
+      return constructor.resolve(callback()).then(function () {
+        return value;
+      });
+    }, function (reason) {
+      return constructor.resolve(callback()).then(function () {
+        throw reason;
+      });
+    });
+  };
+
+  return Promise;
+}();
+
+Promise$2.prototype.then = then;
+Promise$2.all = all;
+Promise$2.race = race;
+Promise$2.resolve = resolve$1;
+Promise$2.reject = reject$1;
+Promise$2._setScheduler = setScheduler;
+Promise$2._setAsap = setAsap;
+Promise$2._asap = asap;
+
+/*global self*/
+function polyfill() {
+  var local = void 0;
+
+  if (typeof global !== 'undefined') {
+    local = global;
+  } else if (typeof self !== 'undefined') {
+    local = self;
+  } else {
+    try {
+      local = Function('return this')();
+    } catch (e) {
+      throw new Error('polyfill failed because global object is unavailable in this environment');
+    }
+  }
+
+  var P = local.Promise;
+
+  if (P) {
+    var promiseToString = null;
+    try {
+      promiseToString = Object.prototype.toString.call(P.resolve());
+    } catch (e) {
+      // silently ignored
+    }
+
+    if (promiseToString === '[object Promise]' && !P.cast) {
+      return;
+    }
+  }
+
+  local.Promise = Promise$2;
+}
+
+// Strange compat..
+Promise$2.polyfill = polyfill;
+Promise$2.Promise = Promise$2;
+
+Promise$2.polyfill();
+
+return Promise$2;
+
+})));
+
+
+
+//# sourceMappingURL=es6-promise.auto.map

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.map
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.map b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.map
new file mode 100644
index 0000000..bff203c
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.map
@@ -0,0 +1 @@
+{"version":3,"sources":["config/versionTemplate.txt","lib/es6-promise/utils.js","lib/es6-promise/asap.js","lib/es6-promise/then.js","lib/es6-promise/promise/resolve.js","lib/es6-promise/-internal.js","lib/es6-promise/enumerator.js","lib/es6-promise/promise/all.js","lib/es6-promise/promise/race.js","lib/es6-promise/promise/reject.js","lib/es6-promise/promise.js","lib/es6-promise/polyfill.js","lib/es6-promise.js","lib/es6-promise.auto.js"],"sourcesContent":["/*!\n * @overview es6-promise - a tiny implementation of Promises/A+.\n * @copyright Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors (Conversion to ES6 API by Jake Archibald)\n * @license   Licensed under MIT license\n *            See https://raw.githubusercontent.com/stefanpenner/es6-promise/master/LICENSE\n * @version   v4.2.4+314e4831\n */\n","export function objectOrFunction(x) {\n  var type = typeof x;\n  return x !== null && (type === 'object' || type === 'function');\n}\n\nexport function isFunctio
 n(x) {\n  return typeof x === 'function';\n}\n\nexport function isMaybeThenable(x) {\n  return x !== null && typeof x === 'object';\n}\n\nvar _isArray = void 0;\nif (Array.isArray) {\n  _isArray = Array.isArray;\n} else {\n  _isArray = function (x) {\n    return Object.prototype.toString.call(x) === '[object Array]';\n  };\n}\n\nexport var isArray = _isArray;","var len = 0;\nvar vertxNext = void 0;\nvar customSchedulerFn = void 0;\n\nexport var asap = function asap(callback, arg) {\n  queue[len] = callback;\n  queue[len + 1] = arg;\n  len += 2;\n  if (len === 2) {\n    // If len is 2, that means that we need to schedule an async flush.\n    // If additional callbacks are queued before the queue is flushed, they\n    // will be processed by this flush that we are scheduling.\n    if (customSchedulerFn) {\n      customSchedulerFn(flush);\n    } else {\n      scheduleFlush();\n    }\n  }\n};\n\nexport function setScheduler(scheduleFn) {\n  customSchedulerFn = scheduleFn;\n}\n\nexport f
 unction setAsap(asapFn) {\n  asap = asapFn;\n}\n\nvar browserWindow = typeof window !== 'undefined' ? window : undefined;\nvar browserGlobal = browserWindow || {};\nvar BrowserMutationObserver = browserGlobal.MutationObserver || browserGlobal.WebKitMutationObserver;\nvar isNode = typeof self === 'undefined' && typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n\n// test for web worker but not in IE10\nvar isWorker = typeof Uint8ClampedArray !== 'undefined' && typeof importScripts !== 'undefined' && typeof MessageChannel !== 'undefined';\n\n// node\nfunction useNextTick() {\n  // node version 0.10.x displays a deprecation warning when nextTick is used recursively\n  // see https://github.com/cujojs/when/issues/410 for details\n  return function () {\n    return process.nextTick(flush);\n  };\n}\n\n// vertx\nfunction useVertxTimer() {\n  if (typeof vertxNext !== 'undefined') {\n    return function () {\n      vertxNext(flush);\n    };\n  }\n\n  return
  useSetTimeout();\n}\n\nfunction useMutationObserver() {\n  var iterations = 0;\n  var observer = new BrowserMutationObserver(flush);\n  var node = document.createTextNode('');\n  observer.observe(node, { characterData: true });\n\n  return function () {\n    node.data = iterations = ++iterations % 2;\n  };\n}\n\n// web worker\nfunction useMessageChannel() {\n  var channel = new MessageChannel();\n  channel.port1.onmessage = flush;\n  return function () {\n    return channel.port2.postMessage(0);\n  };\n}\n\nfunction useSetTimeout() {\n  // Store setTimeout reference so es6-promise will be unaffected by\n  // other code modifying setTimeout (like sinon.useFakeTimers())\n  var globalSetTimeout = setTimeout;\n  return function () {\n    return globalSetTimeout(flush, 1);\n  };\n}\n\nvar queue = new Array(1000);\nfunction flush() {\n  for (var i = 0; i < len; i += 2) {\n    var callback = queue[i];\n    var arg = queue[i + 1];\n\n    callback(arg);\n\n    queue[i] = undefined;\n    que
 ue[i + 1] = undefined;\n  }\n\n  len = 0;\n}\n\nfunction attemptVertx() {\n  try {\n    var vertx = Function('return this')().require('vertx');\n    vertxNext = vertx.runOnLoop || vertx.runOnContext;\n    return useVertxTimer();\n  } catch (e) {\n    return useSetTimeout();\n  }\n}\n\nvar scheduleFlush = void 0;\n// Decide what async method to use to triggering processing of queued callbacks:\nif (isNode) {\n  scheduleFlush = useNextTick();\n} else if (BrowserMutationObserver) {\n  scheduleFlush = useMutationObserver();\n} else if (isWorker) {\n  scheduleFlush = useMessageChannel();\n} else if (browserWindow === undefined && typeof require === 'function') {\n  scheduleFlush = attemptVertx();\n} else {\n  scheduleFlush = useSetTimeout();\n}","import { invokeCallback, subscribe, FULFILLED, REJECTED, noop, makePromise, PROMISE_ID } from './-internal';\n\nimport { asap } from './asap';\n\nexport default function then(onFulfillment, onRejection) {\n  var parent = this;\n\n  var child = n
 ew this.constructor(noop);\n\n  if (child[PROMISE_ID] === undefined) {\n    makePromise(child);\n  }\n\n  var _state = parent._state;\n\n\n  if (_state) {\n    var callback = arguments[_state - 1];\n    asap(function () {\n      return invokeCallback(_state, child, callback, parent._result);\n    });\n  } else {\n    subscribe(parent, child, onFulfillment, onRejection);\n  }\n\n  return child;\n}","import { noop, resolve as _resolve } from '../-internal';\n\n/**\n  `Promise.resolve` returns a promise that will become resolved with the\n  passed `value`. It is shorthand for the following:\n\n  ```javascript\n  let promise = new Promise(function(resolve, reject){\n    resolve(1);\n  });\n\n  promise.then(function(value){\n    // value === 1\n  });\n  ```\n\n  Instead of writing the above, your code now simply becomes the following:\n\n  ```javascript\n  let promise = Promise.resolve(1);\n\n  promise.then(function(value){\n    // value === 1\n  });\n  ```\n\n  @method resolve\n  @stati
 c\n  @param {Any} value value that the returned promise will be resolved with\n  Useful for tooling.\n  @return {Promise} a promise that will become fulfilled with the given\n  `value`\n*/\nexport default function resolve(object) {\n  /*jshint validthis:true */\n  var Constructor = this;\n\n  if (object && typeof object === 'object' && object.constructor === Constructor) {\n    return object;\n  }\n\n  var promise = new Constructor(noop);\n  _resolve(promise, object);\n  return promise;\n}","import { objectOrFunction, isFunction } from './utils';\n\nimport { asap } from './asap';\n\nimport originalThen from './then';\nimport originalResolve from './promise/resolve';\n\nexport var PROMISE_ID = Math.random().toString(36).substring(2);\n\nfunction noop() {}\n\nvar PENDING = void 0;\nvar FULFILLED = 1;\nvar REJECTED = 2;\n\nvar TRY_CATCH_ERROR = { error: null };\n\nfunction selfFulfillment() {\n  return new TypeError(\"You cannot resolve a promise with itself\");\n}\n\nfunction cannotRe
 turnOwn() {\n  return new TypeError('A promises callback cannot return that same promise.');\n}\n\nfunction getThen(promise) {\n  try {\n    return promise.then;\n  } catch (error) {\n    TRY_CATCH_ERROR.error = error;\n    return TRY_CATCH_ERROR;\n  }\n}\n\nfunction tryThen(then, value, fulfillmentHandler, rejectionHandler) {\n  try {\n    then.call(value, fulfillmentHandler, rejectionHandler);\n  } catch (e) {\n    return e;\n  }\n}\n\nfunction handleForeignThenable(promise, thenable, then) {\n  asap(function (promise) {\n    var sealed = false;\n    var error = tryThen(then, thenable, function (value) {\n      if (sealed) {\n        return;\n      }\n      sealed = true;\n      if (thenable !== value) {\n        resolve(promise, value);\n      } else {\n        fulfill(promise, value);\n      }\n    }, function (reason) {\n      if (sealed) {\n        return;\n      }\n      sealed = true;\n\n      reject(promise, reason);\n    }, 'Settle: ' + (promise._label || ' unknown promise
 '));\n\n    if (!sealed && error) {\n      sealed = true;\n      reject(promise, error);\n    }\n  }, promise);\n}\n\nfunction handleOwnThenable(promise, thenable) {\n  if (thenable._state === FULFILLED) {\n    fulfill(promise, thenable._result);\n  } else if (thenable._state === REJECTED) {\n    reject(promise, thenable._result);\n  } else {\n    subscribe(thenable, undefined, function (value) {\n      return resolve(promise, value);\n    }, function (reason) {\n      return reject(promise, reason);\n    });\n  }\n}\n\nfunction handleMaybeThenable(promise, maybeThenable, then) {\n  if (maybeThenable.constructor === promise.constructor && then === originalThen && maybeThenable.constructor.resolve === originalResolve) {\n    handleOwnThenable(promise, maybeThenable);\n  } else {\n    if (then === TRY_CATCH_ERROR) {\n      reject(promise, TRY_CATCH_ERROR.error);\n      TRY_CATCH_ERROR.error = null;\n    } else if (then === undefined) {\n      fulfill(promise, maybeThenable);\n    } el
 se if (isFunction(then)) {\n      handleForeignThenable(promise, maybeThenable, then);\n    } else {\n      fulfill(promise, maybeThenable);\n    }\n  }\n}\n\nfunction resolve(promise, value) {\n  if (promise === value) {\n    reject(promise, selfFulfillment());\n  } else if (objectOrFunction(value)) {\n    handleMaybeThenable(promise, value, getThen(value));\n  } else {\n    fulfill(promise, value);\n  }\n}\n\nfunction publishRejection(promise) {\n  if (promise._onerror) {\n    promise._onerror(promise._result);\n  }\n\n  publish(promise);\n}\n\nfunction fulfill(promise, value) {\n  if (promise._state !== PENDING) {\n    return;\n  }\n\n  promise._result = value;\n  promise._state = FULFILLED;\n\n  if (promise._subscribers.length !== 0) {\n    asap(publish, promise);\n  }\n}\n\nfunction reject(promise, reason) {\n  if (promise._state !== PENDING) {\n    return;\n  }\n  promise._state = REJECTED;\n  promise._result = reason;\n\n  asap(publishRejection, promise);\n}\n\nfunction subsc
 ribe(parent, child, onFulfillment, onRejection) {\n  var _subscribers = parent._subscribers;\n  var length = _subscribers.length;\n\n\n  parent._onerror = null;\n\n  _subscribers[length] = child;\n  _subscribers[length + FULFILLED] = onFulfillment;\n  _subscribers[length + REJECTED] = onRejection;\n\n  if (length === 0 && parent._state) {\n    asap(publish, parent);\n  }\n}\n\nfunction publish(promise) {\n  var subscribers = promise._subscribers;\n  var settled = promise._state;\n\n  if (subscribers.length === 0) {\n    return;\n  }\n\n  var child = void 0,\n      callback = void 0,\n      detail = promise._result;\n\n  for (var i = 0; i < subscribers.length; i += 3) {\n    child = subscribers[i];\n    callback = subscribers[i + settled];\n\n    if (child) {\n      invokeCallback(settled, child, callback, detail);\n    } else {\n      callback(detail);\n    }\n  }\n\n  promise._subscribers.length = 0;\n}\n\nfunction tryCatch(callback, detail) {\n  try {\n    return callback(detail);
 \n  } catch (e) {\n    TRY_CATCH_ERROR.error = e;\n    return TRY_CATCH_ERROR;\n  }\n}\n\nfunction invokeCallback(settled, promise, callback, detail) {\n  var hasCallback = isFunction(callback),\n      value = void 0,\n      error = void 0,\n      succeeded = void 0,\n      failed = void 0;\n\n  if (hasCallback) {\n    value = tryCatch(callback, detail);\n\n    if (value === TRY_CATCH_ERROR) {\n      failed = true;\n      error = value.error;\n      value.error = null;\n    } else {\n      succeeded = true;\n    }\n\n    if (promise === value) {\n      reject(promise, cannotReturnOwn());\n      return;\n    }\n  } else {\n    value = detail;\n    succeeded = true;\n  }\n\n  if (promise._state !== PENDING) {\n    // noop\n  } else if (hasCallback && succeeded) {\n    resolve(promise, value);\n  } else if (failed) {\n    reject(promise, error);\n  } else if (settled === FULFILLED) {\n    fulfill(promise, value);\n  } else if (settled === REJECTED) {\n    reject(promise, value);\n  }\n
 }\n\nfunction initializePromise(promise, resolver) {\n  try {\n    resolver(function resolvePromise(value) {\n      resolve(promise, value);\n    }, function rejectPromise(reason) {\n      reject(promise, reason);\n    });\n  } catch (e) {\n    reject(promise, e);\n  }\n}\n\nvar id = 0;\nfunction nextId() {\n  return id++;\n}\n\nfunction makePromise(promise) {\n  promise[PROMISE_ID] = id++;\n  promise._state = undefined;\n  promise._result = undefined;\n  promise._subscribers = [];\n}\n\nexport { nextId, makePromise, getThen, noop, resolve, reject, fulfill, subscribe, publish, publishRejection, initializePromise, invokeCallback, FULFILLED, REJECTED, PENDING, handleMaybeThenable };","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nimport { isArray, isMaybeThenable } from './utils';\nimport { noop, reject, fulfill, subscribe, FULFILLED, REJECTED, PENDING, getThen, handleMaybe
 Thenable } from './-internal';\n\nimport then from './then';\nimport Promise from './promise';\nimport originalResolve from './promise/resolve';\nimport originalThen from './then';\nimport { makePromise, PROMISE_ID } from './-internal';\n\nfunction validationError() {\n  return new Error('Array Methods must be provided an Array');\n};\n\nvar Enumerator = function () {\n  function Enumerator(Constructor, input) {\n    this._instanceConstructor = Constructor;\n    this.promise = new Constructor(noop);\n\n    if (!this.promise[PROMISE_ID]) {\n      makePromise(this.promise);\n    }\n\n    if (isArray(input)) {\n      this.length = input.length;\n      this._remaining = input.length;\n\n      this._result = new Array(this.length);\n\n      if (this.length === 0) {\n        fulfill(this.promise, this._result);\n      } else {\n        this.length = this.length || 0;\n        this._enumerate(input);\n        if (this._remaining === 0) {\n          fulfill(this.promise, this._result);\n   
      }\n      }\n    } else {\n      reject(this.promise, validationError());\n    }\n  }\n\n  Enumerator.prototype._enumerate = function _enumerate(input) {\n    for (var i = 0; this._state === PENDING && i < input.length; i++) {\n      this._eachEntry(input[i], i);\n    }\n  };\n\n  Enumerator.prototype._eachEntry = function _eachEntry(entry, i) {\n    var c = this._instanceConstructor;\n    var resolve = c.resolve;\n\n\n    if (resolve === originalResolve) {\n      var _then = getThen(entry);\n\n      if (_then === originalThen && entry._state !== PENDING) {\n        this._settledAt(entry._state, i, entry._result);\n      } else if (typeof _then !== 'function') {\n        this._remaining--;\n        this._result[i] = entry;\n      } else if (c === Promise) {\n        var promise = new c(noop);\n        handleMaybeThenable(promise, entry, _then);\n        this._willSettleAt(promise, i);\n      } else {\n        this._willSettleAt(new c(function (resolve) {\n          return resolv
 e(entry);\n        }), i);\n      }\n    } else {\n      this._willSettleAt(resolve(entry), i);\n    }\n  };\n\n  Enumerator.prototype._settledAt = function _settledAt(state, i, value) {\n    var promise = this.promise;\n\n\n    if (promise._state === PENDING) {\n      this._remaining--;\n\n      if (state === REJECTED) {\n        reject(promise, value);\n      } else {\n        this._result[i] = value;\n      }\n    }\n\n    if (this._remaining === 0) {\n      fulfill(promise, this._result);\n    }\n  };\n\n  Enumerator.prototype._willSettleAt = function _willSettleAt(promise, i) {\n    var enumerator = this;\n\n    subscribe(promise, undefined, function (value) {\n      return enumerator._settledAt(FULFILLED, i, value);\n    }, function (reason) {\n      return enumerator._settledAt(REJECTED, i, reason);\n    });\n  };\n\n  return Enumerator;\n}();\n\nexport default Enumerator;\n;","import Enumerator from '../enumerator';\n\n/**\n  `Promise.all` accepts an array of promises, and r
 eturns a new promise which\n  is fulfilled with an array of fulfillment values for the passed promises, or\n  rejected with the reason of the first passed promise to be rejected. It casts all\n  elements of the passed iterable to promises as it runs this algorithm.\n\n  Example:\n\n  ```javascript\n  let promise1 = resolve(1);\n  let promise2 = resolve(2);\n  let promise3 = resolve(3);\n  let promises = [ promise1, promise2, promise3 ];\n\n  Promise.all(promises).then(function(array){\n    // The array here would be [ 1, 2, 3 ];\n  });\n  ```\n\n  If any of the `promises` given to `all` are rejected, the first promise\n  that is rejected will be given as an argument to the returned promises's\n  rejection handler. For example:\n\n  Example:\n\n  ```javascript\n  let promise1 = resolve(1);\n  let promise2 = reject(new Error(\"2\"));\n  let promise3 = reject(new Error(\"3\"));\n  let promises = [ promise1, promise2, promise3 ];\n\n  Promise.all(promises).then(function(array){\n    // 
 Code here never runs because there are rejected promises!\n  }, function(error) {\n    // error.message === \"2\"\n  });\n  ```\n\n  @method all\n  @static\n  @param {Array} entries array of promises\n  @param {String} label optional string for labeling the promise.\n  Useful for tooling.\n  @return {Promise} promise that is fulfilled when all `promises` have been\n  fulfilled, or rejected if any of them become rejected.\n  @static\n*/\nexport default function all(entries) {\n  return new Enumerator(this, entries).promise;\n}","import { isArray } from \"../utils\";\n\n/**\n  `Promise.race` returns a new promise which is settled in the same way as the\n  first passed promise to settle.\n\n  Example:\n\n  ```javascript\n  let promise1 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 1');\n    }, 200);\n  });\n\n  let promise2 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 2');\n    }, 100);\n  })
 ;\n\n  Promise.race([promise1, promise2]).then(function(result){\n    // result === 'promise 2' because it was resolved before promise1\n    // was resolved.\n  });\n  ```\n\n  `Promise.race` is deterministic in that only the state of the first\n  settled promise matters. For example, even if other promises given to the\n  `promises` array argument are resolved, but the first settled promise has\n  become rejected before the other promises became fulfilled, the returned\n  promise will become rejected:\n\n  ```javascript\n  let promise1 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      resolve('promise 1');\n    }, 200);\n  });\n\n  let promise2 = new Promise(function(resolve, reject){\n    setTimeout(function(){\n      reject(new Error('promise 2'));\n    }, 100);\n  });\n\n  Promise.race([promise1, promise2]).then(function(result){\n    // Code here never runs\n  }, function(reason){\n    // reason.message === 'promise 2' because promise 2 became rejected
  before\n    // promise 1 became fulfilled\n  });\n  ```\n\n  An example real-world use case is implementing timeouts:\n\n  ```javascript\n  Promise.race([ajax('foo.json'), timeout(5000)])\n  ```\n\n  @method race\n  @static\n  @param {Array} promises array of promises to observe\n  Useful for tooling.\n  @return {Promise} a promise which settles in the same way as the first passed\n  promise to settle.\n*/\nexport default function race(entries) {\n  /*jshint validthis:true */\n  var Constructor = this;\n\n  if (!isArray(entries)) {\n    return new Constructor(function (_, reject) {\n      return reject(new TypeError('You must pass an array to race.'));\n    });\n  } else {\n    return new Constructor(function (resolve, reject) {\n      var length = entries.length;\n      for (var i = 0; i < length; i++) {\n        Constructor.resolve(entries[i]).then(resolve, reject);\n      }\n    });\n  }\n}","import { noop, reject as _reject } from '../-internal';\n\n/**\n  `Promise.reject` retu
 rns a promise rejected with the passed `reason`.\n  It is shorthand for the following:\n\n  ```javascript\n  let promise = new Promise(function(resolve, reject){\n    reject(new Error('WHOOPS'));\n  });\n\n  promise.then(function(value){\n    // Code here doesn't run because the promise is rejected!\n  }, function(reason){\n    // reason.message === 'WHOOPS'\n  });\n  ```\n\n  Instead of writing the above, your code now simply becomes the following:\n\n  ```javascript\n  let promise = Promise.reject(new Error('WHOOPS'));\n\n  promise.then(function(value){\n    // Code here doesn't run because the promise is rejected!\n  }, function(reason){\n    // reason.message === 'WHOOPS'\n  });\n  ```\n\n  @method reject\n  @static\n  @param {Any} reason value that the returned promise will be rejected with.\n  Useful for tooling.\n  @return {Promise} a promise rejected with the given `reason`.\n*/\nexport default function reject(reason) {\n  /*jshint validthis:true */\n  var Constructor = this
 ;\n  var promise = new Constructor(noop);\n  _reject(promise, reason);\n  return promise;\n}","function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError(\"Cannot call a class as a function\"); } }\n\nimport { isFunction } from './utils';\nimport { noop, nextId, PROMISE_ID, initializePromise } from './-internal';\nimport { asap, setAsap, setScheduler } from './asap';\n\nimport all from './promise/all';\nimport race from './promise/race';\nimport Resolve from './promise/resolve';\nimport Reject from './promise/reject';\nimport then from './then';\n\nfunction needsResolver() {\n  throw new TypeError('You must pass a resolver function as the first argument to the promise constructor');\n}\n\nfunction needsNew() {\n  throw new TypeError(\"Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.\");\n}\n\n/**\n  Promise objects represent the eventual result of an asynchronous
  operation. The\n  primary way of interacting with a promise is through its `then` method, which\n  registers callbacks to receive either a promise's eventual value or the reason\n  why the promise cannot be fulfilled.\n\n  Terminology\n  -----------\n\n  - `promise` is an object or function with a `then` method whose behavior conforms to this specification.\n  - `thenable` is an object or function that defines a `then` method.\n  - `value` is any legal JavaScript value (including undefined, a thenable, or a promise).\n  - `exception` is a value that is thrown using the throw statement.\n  - `reason` is a value that indicates why a promise was rejected.\n  - `settled` the final resting state of a promise, fulfilled or rejected.\n\n  A promise can be in one of three states: pending, fulfilled, or rejected.\n\n  Promises that are fulfilled have a fulfillment value and are in the fulfilled\n  state.  Promises that are rejected have a rejection reason and are in the\n  rejected state.  
 A fulfillment value is never a thenable.\n\n  Promises can also be said to *resolve* a value.  If this value is also a\n  promise, then the original promise's settled state will match the value's\n  settled state.  So a promise that *resolves* a promise that rejects will\n  itself reject, and a promise that *resolves* a promise that fulfills will\n  itself fulfill.\n\n\n  Basic Usage:\n  ------------\n\n  ```js\n  let promise = new Promise(function(resolve, reject) {\n    // on success\n    resolve(value);\n\n    // on failure\n    reject(reason);\n  });\n\n  promise.then(function(value) {\n    // on fulfillment\n  }, function(reason) {\n    // on rejection\n  });\n  ```\n\n  Advanced Usage:\n  ---------------\n\n  Promises shine when abstracting away asynchronous interactions such as\n  `XMLHttpRequest`s.\n\n  ```js\n  function getJSON(url) {\n    return new Promise(function(resolve, reject){\n      let xhr = new XMLHttpRequest();\n\n      xhr.open('GET', url);\n      xhr.onreadyst
 atechange = handler;\n      xhr.responseType = 'json';\n      xhr.setRequestHeader('Accept', 'application/json');\n      xhr.send();\n\n      function handler() {\n        if (this.readyState === this.DONE) {\n          if (this.status === 200) {\n            resolve(this.response);\n          } else {\n            reject(new Error('getJSON: `' + url + '` failed with status: [' + this.status + ']'));\n          }\n        }\n      };\n    });\n  }\n\n  getJSON('/posts.json').then(function(json) {\n    // on fulfillment\n  }, function(reason) {\n    // on rejection\n  });\n  ```\n\n  Unlike callbacks, promises are great composable primitives.\n\n  ```js\n  Promise.all([\n    getJSON('/posts'),\n    getJSON('/comments')\n  ]).then(function(values){\n    values[0] // => postsJSON\n    values[1] // => commentsJSON\n\n    return values;\n  });\n  ```\n\n  @class Promise\n  @param {Function} resolver\n  Useful for tooling.\n  @constructor\n*/\n\nvar Promise = function () {\n  function Pro
 mise(resolver) {\n    this[PROMISE_ID] = nextId();\n    this._result = this._state = undefined;\n    this._subscribers = [];\n\n    if (noop !== resolver) {\n      typeof resolver !== 'function' && needsResolver();\n      this instanceof Promise ? initializePromise(this, resolver) : needsNew();\n    }\n  }\n\n  /**\n  The primary way of interacting with a promise is through its `then` method,\n  which registers callbacks to receive either a promise's eventual value or the\n  reason why the promise cannot be fulfilled.\n   ```js\n  findUser().then(function(user){\n    // user is available\n  }, function(reason){\n    // user is unavailable, and you are given the reason why\n  });\n  ```\n   Chaining\n  --------\n   The return value of `then` is itself a promise.  This second, 'downstream'\n  promise is resolved with the return value of the first promise's fulfillment\n  or rejection handler, or rejected if the handler throws an exception.\n   ```js\n  findUser().then(function (user) 
 {\n    return user.name;\n  }, function (reason) {\n    return 'default name';\n  }).then(function (userName) {\n    // If `findUser` fulfilled, `userName` will be the user's name, otherwise it\n    // will be `'default name'`\n  });\n   findUser().then(function (user) {\n    throw new Error('Found user, but still unhappy');\n  }, function (reason) {\n    throw new Error('`findUser` rejected and we're unhappy');\n  }).then(function (value) {\n    // never reached\n  }, function (reason) {\n    // if `findUser` fulfilled, `reason` will be 'Found user, but still unhappy'.\n    // If `findUser` rejected, `reason` will be '`findUser` rejected and we're unhappy'.\n  });\n  ```\n  If the downstream promise does not specify a rejection handler, rejection reasons will be propagated further downstream.\n   ```js\n  findUser().then(function (user) {\n    throw new PedagogicalException('Upstream error');\n  }).then(function (value) {\n    // never reached\n  }).then(function (value) {\n    // 
 never reached\n  }, function (reason) {\n    // The `PedgagocialException` is propagated all the way down to here\n  });\n  ```\n   Assimilation\n  ------------\n   Sometimes the value you want to propagate to a downstream promise can only be\n  retrieved asynchronously. This can be achieved by returning a promise in the\n  fulfillment or rejection handler. The downstream promise will then be pending\n  until the returned promise is settled. This is called *assimilation*.\n   ```js\n  findUser().then(function (user) {\n    return findCommentsByAuthor(user);\n  }).then(function (comments) {\n    // The user's comments are now available\n  });\n  ```\n   If the assimliated promise rejects, then the downstream promise will also reject.\n   ```js\n  findUser().then(function (user) {\n    return findCommentsByAuthor(user);\n  }).then(function (comments) {\n    // If `findCommentsByAuthor` fulfills, we'll have the value here\n  }, function (reason) {\n    // If `findCommentsByAuthor` reje
 cts, we'll have the reason here\n  });\n  ```\n   Simple Example\n  --------------\n   Synchronous Example\n   ```javascript\n  let result;\n   try {\n    result = findResult();\n    // success\n  } catch(reason) {\n    // failure\n  }\n  ```\n   Errback Example\n   ```js\n  findResult(function(result, err){\n    if (err) {\n      // failure\n    } else {\n      // success\n    }\n  });\n  ```\n   Promise Example;\n   ```javascript\n  findResult().then(function(result){\n    // success\n  }, function(reason){\n    // failure\n  });\n  ```\n   Advanced Example\n  --------------\n   Synchronous Example\n   ```javascript\n  let author, books;\n   try {\n    author = findAuthor();\n    books  = findBooksByAuthor(author);\n    // success\n  } catch(reason) {\n    // failure\n  }\n  ```\n   Errback Example\n   ```js\n   function foundBooks(books) {\n   }\n   function failure(reason) {\n   }\n   findAuthor(function(author, err){\n    if (err) {\n      failure(err);\n      // failure\n    }
  else {\n      try {\n        findBoooksByAuthor(author, function(books, err) {\n          if (err) {\n            failure(err);\n          } else {\n            try {\n              foundBooks(books);\n            } catch(reason) {\n              failure(reason);\n            }\n          }\n        });\n      } catch(error) {\n        failure(err);\n      }\n      // success\n    }\n  });\n  ```\n   Promise Example;\n   ```javascript\n  findAuthor().\n    then(findBooksByAuthor).\n    then(function(books){\n      // found books\n  }).catch(function(reason){\n    // something went wrong\n  });\n  ```\n   @method then\n  @param {Function} onFulfilled\n  @param {Function} onRejected\n  Useful for tooling.\n  @return {Promise}\n  */\n\n  /**\n  `catch` is simply sugar for `then(undefined, onRejection)` which makes it the same\n  as the catch block of a try/catch statement.\n  ```js\n  function findAuthor(){\n  throw new Error('couldn't find that author');\n  }\n  // synchronous\n  try
  {\n  findAuthor();\n  } catch(reason) {\n  // something went wrong\n  }\n  // async with promises\n  findAuthor().catch(function(reason){\n  // something went wrong\n  });\n  ```\n  @method catch\n  @param {Function} onRejection\n  Useful for tooling.\n  @return {Promise}\n  */\n\n\n  Promise.prototype.catch = function _catch(onRejection) {\n    return this.then(null, onRejection);\n  };\n\n  /**\n    `finally` will be invoked regardless of the promise's fate just as native\n    try/catch/finally behaves\n  \n    Synchronous example:\n  \n    ```js\n    findAuthor() {\n      if (Math.random() > 0.5) {\n        throw new Error();\n      }\n      return new Author();\n    }\n  \n    try {\n      return findAuthor(); // succeed or fail\n    } catch(error) {\n      return findOtherAuther();\n    } finally {\n      // always runs\n      // doesn't affect the return value\n    }\n    ```\n  \n    Asynchronous example:\n  \n    ```js\n    findAuthor().catch(function(reason){\n      return
  findOtherAuther();\n    }).finally(function(){\n      // author was either found, or not\n    });\n    ```\n  \n    @method finally\n    @param {Function} callback\n    @return {Promise}\n  */\n\n\n  Promise.prototype.finally = function _finally(callback) {\n    var promise = this;\n    var constructor = promise.constructor;\n\n    return promise.then(function (value) {\n      return constructor.resolve(callback()).then(function () {\n        return value;\n      });\n    }, function (reason) {\n      return constructor.resolve(callback()).then(function () {\n        throw reason;\n      });\n    });\n  };\n\n  return Promise;\n}();\n\nPromise.prototype.then = then;\nexport default Promise;\nPromise.all = all;\nPromise.race = race;\nPromise.resolve = Resolve;\nPromise.reject = Reject;\nPromise._setScheduler = setScheduler;\nPromise._setAsap = setAsap;\nPromise._asap = asap;","/*global self*/\nimport Promise from './promise';\n\nexport default function polyfill() {\n  var local = vo
 id 0;\n\n  if (typeof global !== 'undefined') {\n    local = global;\n  } else if (typeof self !== 'undefined') {\n    local = self;\n  } else {\n    try {\n      local = Function('return this')();\n    } catch (e) {\n      throw new Error('polyfill failed because global object is unavailable in this environment');\n    }\n  }\n\n  var P = local.Promise;\n\n  if (P) {\n    var promiseToString = null;\n    try {\n      promiseToString = Object.prototype.toString.call(P.resolve());\n    } catch (e) {\n      // silently ignored\n    }\n\n    if (promiseToString === '[object Promise]' && !P.cast) {\n      return;\n    }\n  }\n\n  local.Promise = Promise;\n}","import Promise from './es6-promise/promise';\nimport polyfill from './es6-promise/polyfill';\n\n// Strange compat..\nPromise.polyfill = polyfill;\nPromise.Promise = Promise;\nexport default Promise;","import Promise from './es6-promise';\nPromise.polyfill();\nexport default Promise;"],"names":["resolve","_resolve","then","originalT
 hen","originalResolve","Promise","reject","_reject","Resolve","Reject"],"mappings":"AAAA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;;;;ACNO,SAAS,gBAAgB,CAAC,CAAC,EAAE;EAClC,IAAI,IAAI,GAAG,OAAO,CAAC,CAAC;EACpB,OAAO,CAAC,KAAK,IAAI,KAAK,IAAI,KAAK,QAAQ,IAAI,IAAI,KAAK,UAAU,CAAC,CAAC;CACjE;;AAED,AAAO,SAAS,UAAU,CAAC,CAAC,EAAE;EAC5B,OAAO,OAAO,CAAC,KAAK,UAAU,CAAC;CAChC;;AAED,AAEC;;AAED,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC;AACtB,IAAI,KAAK,CAAC,OAAO,EAAE;EACjB,QAAQ,GAAG,KAAK,CAAC,OAAO,CAAC;CAC1B,MAAM;EACL,QAAQ,GAAG,UAAU,CAAC,EAAE;IACtB,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC,KAAK,gBAAgB,CAAC;GAC/D,CAAC;CACH;;AAED,AAAO,IAAI,OAAO,GAAG,QAAQ;;ACtB7B,IAAI,GAAG,GAAG,CAAC,CAAC;AACZ,IAAI,SAAS,GAAG,KAAK,CAAC,CAAC;AACvB,IAAI,iBAAiB,GAAG,KAAK,CAAC,CAAC;;AAE/B,AAAO,IAAI,IAAI,GAAG,SAAS,IAAI,CAAC,QAAQ,EAAE,GAAG,EAAE;EAC7C,KAAK,CAAC,GAAG,CAAC,GAAG,QAAQ,CAAC;EACtB,KAAK,CAAC,GAAG,GAAG,CAAC,CAAC,GAAG,GAAG,CAAC;EACrB,GAAG,IAAI,CAAC,CAAC;EACT,IAAI,GAAG,KAAK,CAAC,EAAE;;;;IAIb,IAAI,iBAAiB,EAAE;MACrB,iBAAiB,CAAC,KAAK
 ,CAAC,CAAC;KAC1B,MAAM;MACL,aAAa,EAAE,CAAC;KACjB;GACF;CACF,CAAC;;AAEF,AAAO,SAAS,YAAY,CAAC,UAAU,EAAE;EACvC,iBAAiB,GAAG,UAAU,CAAC;CAChC;;AAED,AAAO,SAAS,OAAO,CAAC,MAAM,EAAE;EAC9B,IAAI,GAAG,MAAM,CAAC;CACf;;AAED,IAAI,aAAa,GAAG,OAAO,MAAM,KAAK,WAAW,GAAG,MAAM,GAAG,SAAS,CAAC;AACvE,IAAI,aAAa,GAAG,aAAa,IAAI,EAAE,CAAC;AACxC,IAAI,uBAAuB,GAAG,aAAa,CAAC,gBAAgB,IAAI,aAAa,CAAC,sBAAsB,CAAC;AACrG,IAAI,MAAM,GAAG,OAAO,IAAI,KAAK,WAAW,IAAI,OAAO,OAAO,KAAK,WAAW,IAAI,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,OAAO,CAAC,KAAK,kBAAkB,CAAC;;;AAG/H,IAAI,QAAQ,GAAG,OAAO,iBAAiB,KAAK,WAAW,IAAI,OAAO,aAAa,KAAK,WAAW,IAAI,OAAO,cAAc,KAAK,WAAW,CAAC;;;AAGzI,SAAS,WAAW,GAAG;;;EAGrB,OAAO,YAAY;IACjB,OAAO,OAAO,CAAC,QAAQ,CAAC,KAAK,CAAC,CAAC;GAChC,CAAC;CACH;;;AAGD,SAAS,aAAa,GAAG;EACvB,IAAI,OAAO,SAAS,KAAK,WAAW,EAAE;IACpC,OAAO,YAAY;MACjB,SAAS,CAAC,KAAK,CAAC,CAAC;KAClB,CAAC;GACH;;EAED,OAAO,aAAa,EAAE,CAAC;CACxB;;AAED,SAAS,mBAAmB,GAAG;EAC7B,IAAI,UAAU,GAAG,CAAC,CAAC;EACnB,IAAI,QAAQ,GAAG,IAAI,uBAAuB,CAAC,KAAK,CAAC,CAAC;EAClD,IAAI,IAAI,GAAG,QAAQ,CAAC,c
 AAc,CAAC,EAAE,CAAC,CAAC;EACvC,QAAQ,CAAC,OAAO,CAAC,IAAI,EAAE,EAAE,aAAa,EAAE,IAAI,EAAE,CAAC,CAAC;;EAEhD,OAAO,YAAY;IACjB,IAAI,CAAC,IAAI,GAAG,UAAU,GAAG,EAAE,UAAU,GAAG,CAAC,CAAC;GAC3C,CAAC;CACH;;;AAGD,SAAS,iBAAiB,GAAG;EAC3B,IAAI,OAAO,GAAG,IAAI,cAAc,EAAE,CAAC;EACnC,OAAO,CAAC,KAAK,CAAC,SAAS,GAAG,KAAK,CAAC;EAChC,OAAO,YAAY;IACjB,OAAO,OAAO,CAAC,KAAK,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC;GACrC,CAAC;CACH;;AAED,SAAS,aAAa,GAAG;;;EAGvB,IAAI,gBAAgB,GAAG,UAAU,CAAC;EAClC,OAAO,YAAY;IACjB,OAAO,gBAAgB,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;GACnC,CAAC;CACH;;AAED,IAAI,KAAK,GAAG,IAAI,KAAK,CAAC,IAAI,CAAC,CAAC;AAC5B,SAAS,KAAK,GAAG;EACf,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,GAAG,EAAE,CAAC,IAAI,CAAC,EAAE;IAC/B,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC,CAAC,CAAC;IACxB,IAAI,GAAG,GAAG,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC;;IAEvB,QAAQ,CAAC,GAAG,CAAC,CAAC;;IAEd,KAAK,CAAC,CAAC,CAAC,GAAG,SAAS,CAAC;IACrB,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,GAAG,SAAS,CAAC;GAC1B;;EAED,GAAG,GAAG,CAAC,CAAC;CACT;;AAED,SAAS,YAAY,GAAG;EACtB,IAAI;IACF,IAAI,KAAK,GAAG,QAAQ,CAAC,a
 AAa,CAAC,EAAE,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;IACvD,SAAS,GAAG,KAAK,CAAC,SAAS,IAAI,KAAK,CAAC,YAAY,CAAC;IAClD,OAAO,aAAa,EAAE,CAAC;GACxB,CAAC,OAAO,CAAC,EAAE;IACV,OAAO,aAAa,EAAE,CAAC;GACxB;CACF;;AAED,IAAI,aAAa,GAAG,KAAK,CAAC,CAAC;;AAE3B,IAAI,MAAM,EAAE;EACV,aAAa,GAAG,WAAW,EAAE,CAAC;CAC/B,MAAM,IAAI,uBAAuB,EAAE;EAClC,aAAa,GAAG,mBAAmB,EAAE,CAAC;CACvC,MAAM,IAAI,QAAQ,EAAE;EACnB,aAAa,GAAG,iBAAiB,EAAE,CAAC;CACrC,MAAM,IAAI,aAAa,KAAK,SAAS,IAAI,OAAO,OAAO,KAAK,UAAU,EAAE;EACvE,aAAa,GAAG,YAAY,EAAE,CAAC;CAChC,MAAM;EACL,aAAa,GAAG,aAAa,EAAE,CAAC;;;CACjC,DCtHc,SAAS,IAAI,CAAC,aAAa,EAAE,WAAW,EAAE;EACvD,IAAI,MAAM,GAAG,IAAI,CAAC;;EAElB,IAAI,KAAK,GAAG,IAAI,IAAI,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC;;EAEvC,IAAI,KAAK,CAAC,UAAU,CAAC,KAAK,SAAS,EAAE;IACnC,WAAW,CAAC,KAAK,CAAC,CAAC;GACpB;;EAED,IAAI,MAAM,GAAG,MAAM,CAAC,MAAM,CAAC;;;EAG3B,IAAI,MAAM,EAAE;IACV,IAAI,QAAQ,GAAG,SAAS,CAAC,MAAM,GAAG,CAAC,CAAC,CAAC;IACrC,IAAI,CAAC,YAAY;MACf,OAAO,cAAc,CAAC,MAAM,EAAE,KAAK,EAAE,QAAQ,EAAE,MAAM,CAAC,OAAO,CAAC,CAAC;KAChE,CAAC,CAAC;GACJ,MAAM;I
 ACL,SAAS,CAAC,MAAM,EAAE,KAAK,EAAE,aAAa,EAAE,WAAW,CAAC,CAAC;GACtD;;EAED,OAAO,KAAK,CAAC;;;CACd,DCxBD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA+BA,AAAe,SAASA,SAAO,CAAC,MAAM,EAAE;;EAEtC,IAAI,WAAW,GAAG,IAAI,CAAC;;EAEvB,IAAI,MAAM,IAAI,OAAO,MAAM,KAAK,QAAQ,IAAI,MAAM,CAAC,WAAW,KAAK,WAAW,EAAE;IAC9E,OAAO,MAAM,CAAC;GACf;;EAED,IAAI,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;EACpCC,OAAQ,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;EAC1B,OAAO,OAAO,CAAC;;;CAChB,DCrCM,IAAI,UAAU,GAAG,IAAI,CAAC,MAAM,EAAE,CAAC,QAAQ,CAAC,EAAE,CAAC,CAAC,SAAS,CAAC,CAAC,CAAC,CAAC;;AAEhE,SAAS,IAAI,GAAG,EAAE;;AAElB,IAAI,OAAO,GAAG,KAAK,CAAC,CAAC;AACrB,IAAI,SAAS,GAAG,CAAC,CAAC;AAClB,IAAI,QAAQ,GAAG,CAAC,CAAC;;AAEjB,IAAI,eAAe,GAAG,EAAE,KAAK,EAAE,IAAI,EAAE,CAAC;;AAEtC,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,SAAS,CAAC,0CAA0C,CAAC,CAAC;CAClE;;AAED,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,SAAS,CAAC,sDAAsD,CAAC,CAAC;CAC9E;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE;EACxB,IAAI;IACF,OAAO,OAAO,CAAC,IAAI,CAAC;GACrB,CAAC,OAAO,KAAK,EAAE;IACd,eAAe,CAAC,KAAK,GAAG,KAAK,CAAC;IAC9B,OAAO,eAAe,CAAC;GACxB
 ;CACF;;AAED,SAAS,OAAO,CAACC,OAAI,EAAE,KAAK,EAAE,kBAAkB,EAAE,gBAAgB,EAAE;EAClE,IAAI;IACFA,OAAI,CAAC,IAAI,CAAC,KAAK,EAAE,kBAAkB,EAAE,gBAAgB,CAAC,CAAC;GACxD,CAAC,OAAO,CAAC,EAAE;IACV,OAAO,CAAC,CAAC;GACV;CACF;;AAED,SAAS,qBAAqB,CAAC,OAAO,EAAE,QAAQ,EAAEA,OAAI,EAAE;EACtD,IAAI,CAAC,UAAU,OAAO,EAAE;IACtB,IAAI,MAAM,GAAG,KAAK,CAAC;IACnB,IAAI,KAAK,GAAG,OAAO,CAACA,OAAI,EAAE,QAAQ,EAAE,UAAU,KAAK,EAAE;MACnD,IAAI,MAAM,EAAE;QACV,OAAO;OACR;MACD,MAAM,GAAG,IAAI,CAAC;MACd,IAAI,QAAQ,KAAK,KAAK,EAAE;QACtB,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACzB,MAAM;QACL,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACzB;KACF,EAAE,UAAU,MAAM,EAAE;MACnB,IAAI,MAAM,EAAE;QACV,OAAO;OACR;MACD,MAAM,GAAG,IAAI,CAAC;;MAEd,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KACzB,EAAE,UAAU,IAAI,OAAO,CAAC,MAAM,IAAI,kBAAkB,CAAC,CAAC,CAAC;;IAExD,IAAI,CAAC,MAAM,IAAI,KAAK,EAAE;MACpB,MAAM,GAAG,IAAI,CAAC;MACd,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KACxB;GACF,EAAE,OAAO,CAAC,CAAC;CACb;;AAED,SAAS,iBAAiB,CAAC,OAAO,EAAE,QAAQ,EAAE;EAC5C,IAAI,QAAQ,CAAC,MAAM,KAAK,SAAS,EAAE;IACjC,OA
 AO,CAAC,OAAO,EAAE,QAAQ,CAAC,OAAO,CAAC,CAAC;GACpC,MAAM,IAAI,QAAQ,CAAC,MAAM,KAAK,QAAQ,EAAE;IACvC,MAAM,CAAC,OAAO,EAAE,QAAQ,CAAC,OAAO,CAAC,CAAC;GACnC,MAAM;IACL,SAAS,CAAC,QAAQ,EAAE,SAAS,EAAE,UAAU,KAAK,EAAE;MAC9C,OAAO,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KAChC,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KAChC,CAAC,CAAC;GACJ;CACF;;AAED,SAAS,mBAAmB,CAAC,OAAO,EAAE,aAAa,EAAEA,OAAI,EAAE;EACzD,IAAI,aAAa,CAAC,WAAW,KAAK,OAAO,CAAC,WAAW,IAAIA,OAAI,KAAKC,IAAY,IAAI,aAAa,CAAC,WAAW,CAAC,OAAO,KAAKC,SAAe,EAAE;IACvI,iBAAiB,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;GAC3C,MAAM;IACL,IAAIF,OAAI,KAAK,eAAe,EAAE;MAC5B,MAAM,CAAC,OAAO,EAAE,eAAe,CAAC,KAAK,CAAC,CAAC;MACvC,eAAe,CAAC,KAAK,GAAG,IAAI,CAAC;KAC9B,MAAM,IAAIA,OAAI,KAAK,SAAS,EAAE;MAC7B,OAAO,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;KACjC,MAAM,IAAI,UAAU,CAACA,OAAI,CAAC,EAAE;MAC3B,qBAAqB,CAAC,OAAO,EAAE,aAAa,EAAEA,OAAI,CAAC,CAAC;KACrD,MAAM;MACL,OAAO,CAAC,OAAO,EAAE,aAAa,CAAC,CAAC;KACjC;GACF;CACF;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE,KAAK,EAAE;EAC/B,IAAI,OAAO,KAAK,KAAK,EAAE
 ;IACrB,MAAM,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;GACpC,MAAM,IAAI,gBAAgB,CAAC,KAAK,CAAC,EAAE;IAClC,mBAAmB,CAAC,OAAO,EAAE,KAAK,EAAE,OAAO,CAAC,KAAK,CAAC,CAAC,CAAC;GACrD,MAAM;IACL,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB;CACF;;AAED,SAAS,gBAAgB,CAAC,OAAO,EAAE;EACjC,IAAI,OAAO,CAAC,QAAQ,EAAE;IACpB,OAAO,CAAC,QAAQ,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;GACnC;;EAED,OAAO,CAAC,OAAO,CAAC,CAAC;CAClB;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE,KAAK,EAAE;EAC/B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;IAC9B,OAAO;GACR;;EAED,OAAO,CAAC,OAAO,GAAG,KAAK,CAAC;EACxB,OAAO,CAAC,MAAM,GAAG,SAAS,CAAC;;EAE3B,IAAI,OAAO,CAAC,YAAY,CAAC,MAAM,KAAK,CAAC,EAAE;IACrC,IAAI,CAAC,OAAO,EAAE,OAAO,CAAC,CAAC;GACxB;CACF;;AAED,SAAS,MAAM,CAAC,OAAO,EAAE,MAAM,EAAE;EAC/B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;IAC9B,OAAO;GACR;EACD,OAAO,CAAC,MAAM,GAAG,QAAQ,CAAC;EAC1B,OAAO,CAAC,OAAO,GAAG,MAAM,CAAC;;EAEzB,IAAI,CAAC,gBAAgB,EAAE,OAAO,CAAC,CAAC;CACjC;;AAED,SAAS,SAAS,CAAC,MAAM,EAAE,KAAK,EAAE,aAAa,EAAE,WAAW,EAAE;EAC5D,IAAI,YAAY,GAAG,MAAM,CAAC,YAAY,CAAC;EACvC,IAAI,MAAM,GAAG,YAA
 Y,CAAC,MAAM,CAAC;;;EAGjC,MAAM,CAAC,QAAQ,GAAG,IAAI,CAAC;;EAEvB,YAAY,CAAC,MAAM,CAAC,GAAG,KAAK,CAAC;EAC7B,YAAY,CAAC,MAAM,GAAG,SAAS,CAAC,GAAG,aAAa,CAAC;EACjD,YAAY,CAAC,MAAM,GAAG,QAAQ,CAAC,GAAG,WAAW,CAAC;;EAE9C,IAAI,MAAM,KAAK,CAAC,IAAI,MAAM,CAAC,MAAM,EAAE;IACjC,IAAI,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;GACvB;CACF;;AAED,SAAS,OAAO,CAAC,OAAO,EAAE;EACxB,IAAI,WAAW,GAAG,OAAO,CAAC,YAAY,CAAC;EACvC,IAAI,OAAO,GAAG,OAAO,CAAC,MAAM,CAAC;;EAE7B,IAAI,WAAW,CAAC,MAAM,KAAK,CAAC,EAAE;IAC5B,OAAO;GACR;;EAED,IAAI,KAAK,GAAG,KAAK,CAAC;MACd,QAAQ,GAAG,KAAK,CAAC;MACjB,MAAM,GAAG,OAAO,CAAC,OAAO,CAAC;;EAE7B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,WAAW,CAAC,MAAM,EAAE,CAAC,IAAI,CAAC,EAAE;IAC9C,KAAK,GAAG,WAAW,CAAC,CAAC,CAAC,CAAC;IACvB,QAAQ,GAAG,WAAW,CAAC,CAAC,GAAG,OAAO,CAAC,CAAC;;IAEpC,IAAI,KAAK,EAAE;MACT,cAAc,CAAC,OAAO,EAAE,KAAK,EAAE,QAAQ,EAAE,MAAM,CAAC,CAAC;KAClD,MAAM;MACL,QAAQ,CAAC,MAAM,CAAC,CAAC;KAClB;GACF;;EAED,OAAO,CAAC,YAAY,CAAC,MAAM,GAAG,CAAC,CAAC;CACjC;;AAED,SAAS,QAAQ,CAAC,QAAQ,EAAE,MAAM,EAAE;EAClC,IAAI;IACF,OAAO,QAAQ
 ,CAAC,MAAM,CAAC,CAAC;GACzB,CAAC,OAAO,CAAC,EAAE;IACV,eAAe,CAAC,KAAK,GAAG,CAAC,CAAC;IAC1B,OAAO,eAAe,CAAC;GACxB;CACF;;AAED,SAAS,cAAc,CAAC,OAAO,EAAE,OAAO,EAAE,QAAQ,EAAE,MAAM,EAAE;EAC1D,IAAI,WAAW,GAAG,UAAU,CAAC,QAAQ,CAAC;MAClC,KAAK,GAAG,KAAK,CAAC;MACd,KAAK,GAAG,KAAK,CAAC;MACd,SAAS,GAAG,KAAK,CAAC;MAClB,MAAM,GAAG,KAAK,CAAC,CAAC;;EAEpB,IAAI,WAAW,EAAE;IACf,KAAK,GAAG,QAAQ,CAAC,QAAQ,EAAE,MAAM,CAAC,CAAC;;IAEnC,IAAI,KAAK,KAAK,eAAe,EAAE;MAC7B,MAAM,GAAG,IAAI,CAAC;MACd,KAAK,GAAG,KAAK,CAAC,KAAK,CAAC;MACpB,KAAK,CAAC,KAAK,GAAG,IAAI,CAAC;KACpB,MAAM;MACL,SAAS,GAAG,IAAI,CAAC;KAClB;;IAED,IAAI,OAAO,KAAK,KAAK,EAAE;MACrB,MAAM,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;MACnC,OAAO;KACR;GACF,MAAM;IACL,KAAK,GAAG,MAAM,CAAC;IACf,SAAS,GAAG,IAAI,CAAC;GAClB;;EAED,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;;GAE/B,MAAM,IAAI,WAAW,IAAI,SAAS,EAAE;IACnC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB,MAAM,IAAI,MAAM,EAAE;IACjB,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACxB,MAAM,IAAI,OAAO,KAAK,SAAS,EAAE;IAChC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACzB,MAA
 M,IAAI,OAAO,KAAK,QAAQ,EAAE;IAC/B,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;GACxB;CACF;;AAED,SAAS,iBAAiB,CAAC,OAAO,EAAE,QAAQ,EAAE;EAC5C,IAAI;IACF,QAAQ,CAAC,SAAS,cAAc,CAAC,KAAK,EAAE;MACtC,OAAO,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;KACzB,EAAE,SAAS,aAAa,CAAC,MAAM,EAAE;MAChC,MAAM,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;KACzB,CAAC,CAAC;GACJ,CAAC,OAAO,CAAC,EAAE;IACV,MAAM,CAAC,OAAO,EAAE,CAAC,CAAC,CAAC;GACpB;CACF;;AAED,IAAI,EAAE,GAAG,CAAC,CAAC;AACX,SAAS,MAAM,GAAG;EAChB,OAAO,EAAE,EAAE,CAAC;CACb;;AAED,SAAS,WAAW,CAAC,OAAO,EAAE;EAC5B,OAAO,CAAC,UAAU,CAAC,GAAG,EAAE,EAAE,CAAC;EAC3B,OAAO,CAAC,MAAM,GAAG,SAAS,CAAC;EAC3B,OAAO,CAAC,OAAO,GAAG,SAAS,CAAC;EAC5B,OAAO,CAAC,YAAY,GAAG,EAAE,CAAC;CAC3B;;ACrPD,SAAS,eAAe,GAAG;EACzB,OAAO,IAAI,KAAK,CAAC,yCAAyC,CAAC,CAAC;CAC7D,AAAC;;AAEF,IAAI,UAAU,GAAG,YAAY;EAC3B,SAAS,UAAU,CAAC,WAAW,EAAE,KAAK,EAAE;IACtC,IAAI,CAAC,oBAAoB,GAAG,WAAW,CAAC;IACxC,IAAI,CAAC,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;;IAErC,IAAI,CAAC,IAAI,CAAC,OAAO,CAAC,UAAU,CAAC,EAAE;MAC7B,WAAW,CAAC,IAAI,CAAC,OAAO,CAAC,CAAC;KAC3B;;IAED
 ,IAAI,OAAO,CAAC,KAAK,CAAC,EAAE;MAClB,IAAI,CAAC,MAAM,GAAG,KAAK,CAAC,MAAM,CAAC;MAC3B,IAAI,CAAC,UAAU,GAAG,KAAK,CAAC,MAAM,CAAC;;MAE/B,IAAI,CAAC,OAAO,GAAG,IAAI,KAAK,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;;MAEtC,IAAI,IAAI,CAAC,MAAM,KAAK,CAAC,EAAE;QACrB,OAAO,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;OACrC,MAAM;QACL,IAAI,CAAC,MAAM,GAAG,IAAI,CAAC,MAAM,IAAI,CAAC,CAAC;QAC/B,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC;QACvB,IAAI,IAAI,CAAC,UAAU,KAAK,CAAC,EAAE;UACzB,OAAO,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;SACrC;OACF;KACF,MAAM;MACL,MAAM,CAAC,IAAI,CAAC,OAAO,EAAE,eAAe,EAAE,CAAC,CAAC;KACzC;GACF;;EAED,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE;IAC3D,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,IAAI,CAAC,MAAM,KAAK,OAAO,IAAI,CAAC,GAAG,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;MAChE,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC;KAC9B;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE,CAAC,EAAE;IAC9D,IAAI,CAAC,GAAG,IAAI,CAAC,oBAAoB,CAAC;IAClC,IAAIF,UAAO,GAAG,CAAC,CAAC,OAAO,CAA
 C;;;IAGxB,IAAIA,UAAO,KAAKI,SAAe,EAAE;MAC/B,IAAI,KAAK,GAAG,OAAO,CAAC,KAAK,CAAC,CAAC;;MAE3B,IAAI,KAAK,KAAKD,IAAY,IAAI,KAAK,CAAC,MAAM,KAAK,OAAO,EAAE;QACtD,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,KAAK,CAAC,OAAO,CAAC,CAAC;OACjD,MAAM,IAAI,OAAO,KAAK,KAAK,UAAU,EAAE;QACtC,IAAI,CAAC,UAAU,EAAE,CAAC;QAClB,IAAI,CAAC,OAAO,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC;OACzB,MAAM,IAAI,CAAC,KAAKE,SAAO,EAAE;QACxB,IAAI,OAAO,GAAG,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC;QAC1B,mBAAmB,CAAC,OAAO,EAAE,KAAK,EAAE,KAAK,CAAC,CAAC;QAC3C,IAAI,CAAC,aAAa,CAAC,OAAO,EAAE,CAAC,CAAC,CAAC;OAChC,MAAM;QACL,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,CAAC,UAAUL,UAAO,EAAE;UAC1C,OAAOA,UAAO,CAAC,KAAK,CAAC,CAAC;SACvB,CAAC,EAAE,CAAC,CAAC,CAAC;OACR;KACF,MAAM;MACL,IAAI,CAAC,aAAa,CAACA,UAAO,CAAC,KAAK,CAAC,EAAE,CAAC,CAAC,CAAC;KACvC;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,UAAU,GAAG,SAAS,UAAU,CAAC,KAAK,EAAE,CAAC,EAAE,KAAK,EAAE;IACrE,IAAI,OAAO,GAAG,IAAI,CAAC,OAAO,CAAC;;;IAG3B,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,EAAE;MAC9B,IAAI,CAAC,UAAU,EAAE,CAAC;;MAElB,IAAI,KAAK,KAAK,QAAQ,
 EAAE;QACtB,MAAM,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;OACxB,MAAM;QACL,IAAI,CAAC,OAAO,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC;OACzB;KACF;;IAED,IAAI,IAAI,CAAC,UAAU,KAAK,CAAC,EAAE;MACzB,OAAO,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,CAAC,CAAC;KAChC;GACF,CAAC;;EAEF,UAAU,CAAC,SAAS,CAAC,aAAa,GAAG,SAAS,aAAa,CAAC,OAAO,EAAE,CAAC,EAAE;IACtE,IAAI,UAAU,GAAG,IAAI,CAAC;;IAEtB,SAAS,CAAC,OAAO,EAAE,SAAS,EAAE,UAAU,KAAK,EAAE;MAC7C,OAAO,UAAU,CAAC,UAAU,CAAC,SAAS,EAAE,CAAC,EAAE,KAAK,CAAC,CAAC;KACnD,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,UAAU,CAAC,UAAU,CAAC,QAAQ,EAAE,CAAC,EAAE,MAAM,CAAC,CAAC;KACnD,CAAC,CAAC;GACJ,CAAC;;EAEF,OAAO,UAAU,CAAC;CACnB,EAAE;;ACzGH;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA+CA,AAAe,SAAS,GAAG,CAAC,OAAO,EAAE;EACnC,OAAO,IAAI,UAAU,CAAC,IAAI,EAAE,OAAO,CAAC,CAAC,OAAO,CAAC;;;CAC9C,DCjDD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAiEA,AAAe,SAAS,IAAI,CAAC,OAAO,EAAE;;EAEpC,IAAI,WAAW,GAAG,IAAI,CAAC;;EAEvB,IAAI,CAAC,OAAO,CAAC,OAAO,CAAC,EAAE;IACrB,OAAO,IAAI,WAAW,CAAC,UAAU,CAAC,EAAE,MAAM,EAAE;MAC1C,OAAO,M
 AAM,CAAC,IAAI,SAAS,CAAC,iCAAiC,CAAC,CAAC,CAAC;KACjE,CAAC,CAAC;GACJ,MAAM;IACL,OAAO,IAAI,WAAW,CAAC,UAAU,OAAO,EAAE,MAAM,EAAE;MAChD,IAAI,MAAM,GAAG,OAAO,CAAC,MAAM,CAAC;MAC5B,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,MAAM,EAAE,CAAC,EAAE,EAAE;QAC/B,WAAW,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,CAAC,IAAI,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;OACvD;KACF,CAAC,CAAC;GACJ;;;CACF,DCjFD;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AAkCA,AAAe,SAASM,QAAM,CAAC,MAAM,EAAE;;EAErC,IAAI,WAAW,GAAG,IAAI,CAAC;EACvB,IAAI,OAAO,GAAG,IAAI,WAAW,CAAC,IAAI,CAAC,CAAC;EACpCC,MAAO,CAAC,OAAO,EAAE,MAAM,CAAC,CAAC;EACzB,OAAO,OAAO,CAAC;;;CAChB,DC9BD,SAAS,aAAa,GAAG;EACvB,MAAM,IAAI,SAAS,CAAC,oFAAoF,CAAC,CAAC;CAC3G;;AAED,SAAS,QAAQ,GAAG;EAClB,MAAM,IAAI,SAAS,CAAC,uHAAuH,CAAC,CAAC;CAC9I;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;AA0GD,IAAIF,SAAO,GAAG,YAAY;EACxB,SAAS,OAAO,CAAC,QAAQ,EAAE;IACzB,IAAI,CAAC,UAAU,CAAC,GAAG,MAAM,EAAE,CAAC;IAC5B,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC,MAAM,GAAG,SAAS,CAAC;IACv
 C,IAAI,CAAC,YAAY,GAAG,EAAE,CAAC;;IAEvB,IAAI,IAAI,KAAK,QAAQ,EAAE;MACrB,OAAO,QAAQ,KAAK,UAAU,IAAI,aAAa,EAAE,CAAC;MAClD,IAAI,YAAY,OAAO,GAAG,iBAAiB,CAAC,IAAI,EAAE,QAAQ,CAAC,GAAG,QAAQ,EAAE,CAAC;KAC1E;GACF;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;EA4LD,OAAO,CAAC,SAAS,CAAC,KAAK,GAAG,SAAS,MAAM,CAAC,WAAW,EAAE;IACrD,OAAO,IAAI,CAAC,IAAI,CAAC,IAAI,EAAE,WAAW,CAAC,CAAC;GACrC,CAAC;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;EA0CF,OAAO,CAAC,SAAS,CAAC,OAAO,GAAG,SAAS,QAAQ,CAAC,QAAQ,EAAE;IACtD,IAAI,OAAO,GAAG,IAAI,CAAC;IACnB,IAAI,WAAW,GAAG,OAAO,CAAC,WAAW,CAAC;;IAEtC,OAAO,OAAO,CAAC,IAAI,CAAC,UAAU,KAAK,EAAE;MACnC,OAAO,WAAW,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,IAAI,CAAC,YAAY;QACtD,OAAO,KAAK,CAAC;OACd,CAAC,CAAC;KACJ,EAAE,UAAU,MAAM,EAAE;MACnB,OAAO,WAAW,CAAC,OAAO,CAAC,QAAQ,EAAE,CAAC,CAAC,IAAI,CAAC,YAAY;QACtD,MAAM,MAAM,CAAC;OACd,CAAC,CAAC;KACJ,CAAC,CAAC;GACJ,CAAC;;EAEF,OA
 AO,OAAO,CAAC;CAChB,EAAE,CAAC;;AAEJA,SAAO,CAAC,SAAS,CAAC,IAAI,GAAG,IAAI,CAAC;AAC9B,AACAA,SAAO,CAAC,GAAG,GAAG,GAAG,CAAC;AAClBA,SAAO,CAAC,IAAI,GAAG,IAAI,CAAC;AACpBA,SAAO,CAAC,OAAO,GAAGG,SAAO,CAAC;AAC1BH,SAAO,CAAC,MAAM,GAAGI,QAAM,CAAC;AACxBJ,SAAO,CAAC,aAAa,GAAG,YAAY,CAAC;AACrCA,SAAO,CAAC,QAAQ,GAAG,OAAO,CAAC;AAC3BA,SAAO,CAAC,KAAK,GAAG,IAAI;;ACxYpB;AACA,AAEe,SAAS,QAAQ,GAAG;EACjC,IAAI,KAAK,GAAG,KAAK,CAAC,CAAC;;EAEnB,IAAI,OAAO,MAAM,KAAK,WAAW,EAAE;IACjC,KAAK,GAAG,MAAM,CAAC;GAChB,MAAM,IAAI,OAAO,IAAI,KAAK,WAAW,EAAE;IACtC,KAAK,GAAG,IAAI,CAAC;GACd,MAAM;IACL,IAAI;MACF,KAAK,GAAG,QAAQ,CAAC,aAAa,CAAC,EAAE,CAAC;KACnC,CAAC,OAAO,CAAC,EAAE;MACV,MAAM,IAAI,KAAK,CAAC,0EAA0E,CAAC,CAAC;KAC7F;GACF;;EAED,IAAI,CAAC,GAAG,KAAK,CAAC,OAAO,CAAC;;EAEtB,IAAI,CAAC,EAAE;IACL,IAAI,eAAe,GAAG,IAAI,CAAC;IAC3B,IAAI;MACF,eAAe,GAAG,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,CAAC,OAAO,EAAE,CAAC,CAAC;KAC/D,CAAC,OAAO,CAAC,EAAE;;KAEX;;IAED,IAAI,eAAe,KAAK,kBAAkB,IAAI,CAAC,CAAC,CAAC,IAAI,EAAE;MACrD,OAAO;KACR;GACF;;EAED,KAAK,CAAC,O
 AAO,GAAGA,SAAO,CAAC;;;CACzB,DC/BD;AACAA,SAAO,CAAC,QAAQ,GAAG,QAAQ,CAAC;AAC5BA,SAAO,CAAC,OAAO,GAAGA,SAAO,CAAC;;ACJ1BA,SAAO,CAAC,QAAQ,EAAE,CAAC;;;;;;;;","file":"es6-promise.auto.js"}
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.min.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.min.js b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.min.js
new file mode 100644
index 0000000..fdf8bff
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/dist/es6-promise.auto.min.js
@@ -0,0 +1 @@
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):t.ES6Promise=e()}(this,function(){"use strict";function t(t){var e=typeof t;return null!==t&&("object"===e||"function"===e)}function e(t){return"function"==typeof t}function n(t){B=t}function r(t){G=t}function o(){return function(){return process.nextTick(a)}}function i(){return"undefined"!=typeof z?function(){z(a)}:c()}function s(){var t=0,e=new J(a),n=document.createTextNode("");return e.observe(n,{characterData:!0}),function(){n.data=t=++t%2}}function u(){var t=new MessageChannel;return t.port1.onmessage=a,function(){return t.port2.postMessage(0)}}function c(){var t=setTimeout;return function(){return t(a,1)}}function a(){for(var t=0;t<W;t+=2){var e=V[t],n=V[t+1];e(n),V[t]=void 0,V[t+1]=void 0}W=0}function f(){try{var t=Function("return this")().require("vertx");return z=t.runOnLoop||t.runOnContext,i()}catch(e){return c()}}function l(t,e){var n=th
 is,r=new this.constructor(p);void 0===r[Z]&&O(r);var o=n._state;if(o){var i=arguments[o-1];G(function(){return P(o,r,i,n._result)})}else E(n,r,t,e);return r}function h(t){var e=this;if(t&&"object"==typeof t&&t.constructor===e)return t;var n=new e(p);return g(n,t),n}function p(){}function v(){return new TypeError("You cannot resolve a promise with itself")}function d(){return new TypeError("A promises callback cannot return that same promise.")}function _(t){try{return t.then}catch(e){return nt.error=e,nt}}function y(t,e,n,r){try{t.call(e,n,r)}catch(o){return o}}function m(t,e,n){G(function(t){var r=!1,o=y(n,e,function(n){r||(r=!0,e!==n?g(t,n):S(t,n))},function(e){r||(r=!0,j(t,e))},"Settle: "+(t._label||" unknown promise"));!r&&o&&(r=!0,j(t,o))},t)}function b(t,e){e._state===tt?S(t,e._result):e._state===et?j(t,e._result):E(e,void 0,function(e){return g(t,e)},function(e){return j(t,e)})}function w(t,n,r){n.constructor===t.constructor&&r===l&&n.constructor.resolve===h?b(t,n):r===nt?(j(
 t,nt.error),nt.error=null):void 0===r?S(t,n):e(r)?m(t,n,r):S(t,n)}function g(e,n){e===n?j(e,v()):t(n)?w(e,n,_(n)):S(e,n)}function A(t){t._onerror&&t._onerror(t._result),T(t)}function S(t,e){t._state===$&&(t._result=e,t._state=tt,0!==t._subscribers.length&&G(T,t))}function j(t,e){t._state===$&&(t._state=et,t._result=e,G(A,t))}function E(t,e,n,r){var o=t._subscribers,i=o.length;t._onerror=null,o[i]=e,o[i+tt]=n,o[i+et]=r,0===i&&t._state&&G(T,t)}function T(t){var e=t._subscribers,n=t._state;if(0!==e.length){for(var r=void 0,o=void 0,i=t._result,s=0;s<e.length;s+=3)r=e[s],o=e[s+n],r?P(n,r,o,i):o(i);t._subscribers.length=0}}function M(t,e){try{return t(e)}catch(n){return nt.error=n,nt}}function P(t,n,r,o){var i=e(r),s=void 0,u=void 0,c=void 0,a=void 0;if(i){if(s=M(r,o),s===nt?(a=!0,u=s.error,s.error=null):c=!0,n===s)return void j(n,d())}else s=o,c=!0;n._state!==$||(i&&c?g(n,s):a?j(n,u):t===tt?S(n,s):t===et&&j(n,s))}function x(t,e){try{e(function(e){g(t,e)},function(e){j(t,e)})}catch(n){j(
 t,n)}}function C(){return rt++}function O(t){t[Z]=rt++,t._state=void 0,t._result=void 0,t._subscribers=[]}function k(){return new Error("Array Methods must be provided an Array")}function F(t){return new ot(this,t).promise}function Y(t){var e=this;return new e(U(t)?function(n,r){for(var o=t.length,i=0;i<o;i++)e.resolve(t[i]).then(n,r)}:function(t,e){return e(new TypeError("You must pass an array to race."))})}function q(t){var e=this,n=new e(p);return j(n,t),n}function D(){throw new TypeError("You must pass a resolver function as the first argument to the promise constructor")}function K(){throw new TypeError("Failed to construct 'Promise': Please use the 'new' operator, this object constructor cannot be called as a function.")}function L(){var t=void 0;if("undefined"!=typeof global)t=global;else if("undefined"!=typeof self)t=self;else try{t=Function("return this")()}catch(e){throw new Error("polyfill failed because global object is unavailable in this environment")}var n=t.Promise;
 if(n){var r=null;try{r=Object.prototype.toString.call(n.resolve())}catch(e){}if("[object Promise]"===r&&!n.cast)return}t.Promise=it}var N=void 0;N=Array.isArray?Array.isArray:function(t){return"[object Array]"===Object.prototype.toString.call(t)};var U=N,W=0,z=void 0,B=void 0,G=function(t,e){V[W]=t,V[W+1]=e,W+=2,2===W&&(B?B(a):X())},H="undefined"!=typeof window?window:void 0,I=H||{},J=I.MutationObserver||I.WebKitMutationObserver,Q="undefined"==typeof self&&"undefined"!=typeof process&&"[object process]"==={}.toString.call(process),R="undefined"!=typeof Uint8ClampedArray&&"undefined"!=typeof importScripts&&"undefined"!=typeof MessageChannel,V=new Array(1e3),X=void 0;X=Q?o():J?s():R?u():void 0===H&&"function"==typeof require?f():c();var Z=Math.random().toString(36).substring(2),$=void 0,tt=1,et=2,nt={error:null},rt=0,ot=function(){function t(t,e){this._instanceConstructor=t,this.promise=new t(p),this.promise[Z]||O(this.promise),U(e)?(this.length=e.length,this._remaining=e.length,this.
 _result=new Array(this.length),0===this.length?S(this.promise,this._result):(this.length=this.length||0,this._enumerate(e),0===this._remaining&&S(this.promise,this._result))):j(this.promise,k())}return t.prototype._enumerate=function(t){for(var e=0;this._state===$&&e<t.length;e++)this._eachEntry(t[e],e)},t.prototype._eachEntry=function(t,e){var n=this._instanceConstructor,r=n.resolve;if(r===h){var o=_(t);if(o===l&&t._state!==$)this._settledAt(t._state,e,t._result);else if("function"!=typeof o)this._remaining--,this._result[e]=t;else if(n===it){var i=new n(p);w(i,t,o),this._willSettleAt(i,e)}else this._willSettleAt(new n(function(e){return e(t)}),e)}else this._willSettleAt(r(t),e)},t.prototype._settledAt=function(t,e,n){var r=this.promise;r._state===$&&(this._remaining--,t===et?j(r,n):this._result[e]=n),0===this._remaining&&S(r,this._result)},t.prototype._willSettleAt=function(t,e){var n=this;E(t,void 0,function(t){return n._settledAt(tt,e,t)},function(t){return n._settledAt(et,e,t)}
 )},t}(),it=function(){function t(e){this[Z]=C(),this._result=this._state=void 0,this._subscribers=[],p!==e&&("function"!=typeof e&&D(),this instanceof t?x(this,e):K())}return t.prototype["catch"]=function(t){return this.then(null,t)},t.prototype["finally"]=function(t){var e=this,n=e.constructor;return e.then(function(e){return n.resolve(t()).then(function(){return e})},function(e){return n.resolve(t()).then(function(){throw e})})},t}();return it.prototype.then=l,it.all=F,it.race=Y,it.resolve=h,it.reject=q,it._setScheduler=n,it._setAsap=r,it._asap=G,it.polyfill=L,it.Promise=it,it.polyfill(),it});
\ No newline at end of file

[07/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/reject.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/reject.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/reject.js
new file mode 100644
index 0000000..cd55faa
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/reject.js
@@ -0,0 +1,46 @@
+import {
+  noop,
+  reject as _reject
+} from '../-internal';
+
+/**
+  `Promise.reject` returns a promise rejected with the passed `reason`.
+  It is shorthand for the following:
+
+  ```javascript
+  let promise = new Promise(function(resolve, reject){
+    reject(new Error('WHOOPS'));
+  });
+
+  promise.then(function(value){
+    // Code here doesn't run because the promise is rejected!
+  }, function(reason){
+    // reason.message === 'WHOOPS'
+  });
+  ```
+
+  Instead of writing the above, your code now simply becomes the following:
+
+  ```javascript
+  let promise = Promise.reject(new Error('WHOOPS'));
+
+  promise.then(function(value){
+    // Code here doesn't run because the promise is rejected!
+  }, function(reason){
+    // reason.message === 'WHOOPS'
+  });
+  ```
+
+  @method reject
+  @static
+  @param {Any} reason value that the returned promise will be rejected with.
+  Useful for tooling.
+  @return {Promise} a promise rejected with the given `reason`.
+*/
+export default function reject(reason) {
+  /*jshint validthis:true */
+  let Constructor = this;
+  let promise = new Constructor(noop);
+  _reject(promise, reason);
+  return promise;
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/resolve.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/resolve.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/resolve.js
new file mode 100644
index 0000000..f4642b6
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/promise/resolve.js
@@ -0,0 +1,48 @@
+import {
+  noop,
+  resolve as _resolve
+} from '../-internal';
+
+/**
+  `Promise.resolve` returns a promise that will become resolved with the
+  passed `value`. It is shorthand for the following:
+
+  ```javascript
+  let promise = new Promise(function(resolve, reject){
+    resolve(1);
+  });
+
+  promise.then(function(value){
+    // value === 1
+  });
+  ```
+
+  Instead of writing the above, your code now simply becomes the following:
+
+  ```javascript
+  let promise = Promise.resolve(1);
+
+  promise.then(function(value){
+    // value === 1
+  });
+  ```
+
+  @method resolve
+  @static
+  @param {Any} value value that the returned promise will be resolved with
+  Useful for tooling.
+  @return {Promise} a promise that will become fulfilled with the given
+  `value`
+*/
+export default function resolve(object) {
+  /*jshint validthis:true */
+  let Constructor = this;
+
+  if (object && typeof object === 'object' && object.constructor === Constructor) {
+    return object;
+  }
+
+  let promise = new Constructor(noop);
+  _resolve(promise, object);
+  return promise;
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/then.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/then.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/then.js
new file mode 100644
index 0000000..b2b79f0
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/then.js
@@ -0,0 +1,32 @@
+import {
+  invokeCallback,
+  subscribe,
+  FULFILLED,
+  REJECTED,
+  noop,
+  makePromise,
+  PROMISE_ID
+} from './-internal';
+
+import { asap } from './asap';
+
+export default function then(onFulfillment, onRejection) {
+  const parent = this;
+
+  const child = new this.constructor(noop);
+
+  if (child[PROMISE_ID] === undefined) {
+    makePromise(child);
+  }
+
+  const { _state } = parent;
+
+  if (_state) {
+    const callback = arguments[_state - 1];
+    asap(() => invokeCallback(_state, child, callback, parent._result));
+  } else {
+    subscribe(parent, child, onFulfillment, onRejection);
+  }
+
+  return child;
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/utils.js
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/utils.js b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/utils.js
new file mode 100644
index 0000000..72545c5
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/lib/es6-promise/utils.js
@@ -0,0 +1,21 @@
+export function objectOrFunction(x) {
+  let type = typeof x;
+  return x !== null && (type === 'object' || type === 'function');
+}
+
+export function isFunction(x) {
+  return typeof x === 'function';
+}
+
+export function isMaybeThenable(x) {
+  return x !== null && typeof x === 'object';
+}
+
+let _isArray;
+if (Array.isArray) {
+  _isArray = Array.isArray;
+} else {
+  _isArray = x => Object.prototype.toString.call(x) === '[object Array]';
+}
+
+export const isArray = _isArray;

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/node_modules/es6-promise/package.json
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/node_modules/es6-promise/package.json b/node_modules/es6-promisify/node_modules/es6-promise/package.json
new file mode 100644
index 0000000..ff740fb
--- /dev/null
+++ b/node_modules/es6-promisify/node_modules/es6-promise/package.json
@@ -0,0 +1,108 @@
+{
+  "_args": [
+    [
+      "es6-promise@4.2.4",
+      "/Users/scottyaslan/Development/nifi-fds/target"
+    ]
+  ],
+  "_development": true,
+  "_from": "es6-promise@4.2.4",
+  "_id": "es6-promise@4.2.4",
+  "_inBundle": false,
+  "_integrity": "sha512-/NdNZVJg+uZgtm9eS3O6lrOLYmQag2DjdEXuPaHlZ6RuVqgqaVZfgYCepEIKsLqwdQArOPtC3XzRLqGGfT8KQQ==",
+  "_location": "/es6-promisify/es6-promise",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "es6-promise@4.2.4",
+    "name": "es6-promise",
+    "escapedName": "es6-promise",
+    "rawSpec": "4.2.4",
+    "saveSpec": null,
+    "fetchSpec": "4.2.4"
+  },
+  "_requiredBy": [
+    "/es6-promisify"
+  ],
+  "_resolved": "https://registry.npmjs.org/es6-promise/-/es6-promise-4.2.4.tgz",
+  "_spec": "4.2.4",
+  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
+  "author": {
+    "name": "Yehuda Katz, Tom Dale, Stefan Penner and contributors",
+    "url": "Conversion to ES6 API by Jake Archibald"
+  },
+  "browser": {
+    "vertx": false
+  },
+  "bugs": {
+    "url": "https://github.com/stefanpenner/es6-promise/issues"
+  },
+  "dependencies": {},
+  "description": "A lightweight library that provides tools for organizing asynchronous code",
+  "devDependencies": {
+    "babel-plugin-transform-es2015-arrow-functions": "^6.22.0",
+    "babel-plugin-transform-es2015-block-scoping": "^6.24.1",
+    "babel-plugin-transform-es2015-classes": "^6.24.1",
+    "babel-plugin-transform-es2015-computed-properties": "^6.24.1",
+    "babel-plugin-transform-es2015-constants": "^6.1.4",
+    "babel-plugin-transform-es2015-destructuring": "^6.23.0",
+    "babel-plugin-transform-es2015-parameters": "^6.24.1",
+    "babel-plugin-transform-es2015-shorthand-properties": "^6.24.1",
+    "babel-plugin-transform-es2015-spread": "^6.22.0",
+    "babel-plugin-transform-es2015-template-literals": "^6.22.0",
+    "babel6-plugin-strip-class-callcheck": "^6.0.0",
+    "broccoli-babel-transpiler": "^6.0.0",
+    "broccoli-concat": "^3.1.0",
+    "broccoli-merge-trees": "^2.0.0",
+    "broccoli-rollup": "^2.0.0",
+    "broccoli-stew": "^1.5.0",
+    "broccoli-uglify-js": "^0.2.0",
+    "broccoli-watchify": "^1.0.1",
+    "ember-cli": "2.18.0-beta.2",
+    "ember-cli-dependency-checker": "^2.1.0",
+    "git-repo-version": "1.0.1",
+    "json3": "^3.3.2",
+    "mocha": "^4.0.1",
+    "promises-aplus-tests-phantom": "^2.1.0-revise"
+  },
+  "directories": {
+    "lib": "lib"
+  },
+  "files": [
+    "dist",
+    "lib",
+    "es6-promise.d.ts",
+    "auto.js",
+    "!dist/test"
+  ],
+  "homepage": "https://github.com/stefanpenner/es6-promise#readme",
+  "keywords": [
+    "promises",
+    "promise",
+    "polyfill",
+    "futures"
+  ],
+  "license": "MIT",
+  "main": "dist/es6-promise.js",
+  "name": "es6-promise",
+  "namespace": "es6-promise",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/stefanpenner/es6-promise.git"
+  },
+  "scripts": {
+    "build": "ember build --environment production",
+    "prepublishOnly": "ember build --environment production",
+    "start": "ember s",
+    "test": "ember test",
+    "test:browser": "ember test --launch PhantomJS",
+    "test:node": "ember test --launch Mocha",
+    "test:server": "ember test --server"
+  },
+  "spm": {
+    "main": "dist/es6-promise.js"
+  },
+  "typings": "es6-promise.d.ts",
+  "version": "4.2.4"
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/es6-promisify/package.json
----------------------------------------------------------------------
diff --git a/node_modules/es6-promisify/package.json b/node_modules/es6-promisify/package.json
new file mode 100644
index 0000000..b6d8c54
--- /dev/null
+++ b/node_modules/es6-promisify/package.json
@@ -0,0 +1,77 @@
+{
+  "_args": [
+    [
+      "es6-promisify@5.0.0",
+      "/Users/scottyaslan/Development/nifi-fds/target"
+    ]
+  ],
+  "_development": true,
+  "_from": "es6-promisify@5.0.0",
+  "_id": "es6-promisify@5.0.0",
+  "_inBundle": false,
+  "_integrity": "sha1-UQnWLz5W6pZ8S2NQWu8IKRyKUgM=",
+  "_location": "/es6-promisify",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "es6-promisify@5.0.0",
+    "name": "es6-promisify",
+    "escapedName": "es6-promisify",
+    "rawSpec": "5.0.0",
+    "saveSpec": null,
+    "fetchSpec": "5.0.0"
+  },
+  "_requiredBy": [
+    "/http-proxy-agent/agent-base",
+    "/https-proxy-agent/agent-base"
+  ],
+  "_resolved": "https://registry.npmjs.org/es6-promisify/-/es6-promisify-5.0.0.tgz",
+  "_spec": "5.0.0",
+  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
+  "author": {
+    "name": "Mike Hall",
+    "email": "mikehall314@gmail.com"
+  },
+  "bugs": {
+    "url": "http://github.com/digitaldesignlabs/es6-promisify/issues"
+  },
+  "dependencies": {
+    "es6-promise": "^4.0.3"
+  },
+  "description": "Converts callback-based functions to ES6 Promises",
+  "devDependencies": {
+    "babel-preset-es2015": "^6.9.0",
+    "eslint": "^2.13.1",
+    "gulp": "^3.9.1",
+    "gulp-babel": "^6.1.2",
+    "nodeunit": "^0.10.0"
+  },
+  "files": [
+    "dist/promisify.js",
+    "dist/promise.js"
+  ],
+  "greenkeeper": {
+    "ignore": [
+      "eslint"
+    ]
+  },
+  "homepage": "https://github.com/digitaldesignlabs/es6-promisify#readme",
+  "keywords": [
+    "promises",
+    "es6",
+    "promisify"
+  ],
+  "license": "MIT",
+  "main": "dist/promisify.js",
+  "name": "es6-promisify",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/digitaldesignlabs/es6-promisify.git"
+  },
+  "scripts": {
+    "pretest": "./node_modules/eslint/bin/eslint.js ./lib/*.js ./tests/*.js",
+    "test": "gulp && nodeunit tests"
+  },
+  "version": "5.0.0"
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/extend/package.json
----------------------------------------------------------------------
diff --git a/node_modules/extend/package.json b/node_modules/extend/package.json
index 583d90e..aa4f264 100644
--- a/node_modules/extend/package.json
+++ b/node_modules/extend/package.json
@@ -26,8 +26,6 @@
     "/agent-base",
     "/dom-serialize",
     "/get-uri",
-    "/http-proxy-agent",
-    "/https-proxy-agent",
     "/loggly/request",
     "/node-sass/request",
     "/pac-proxy-agent",

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/finalhandler/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/finalhandler/node_modules/debug/.eslintrc b/node_modules/finalhandler/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/finalhandler/node_modules/debug/.eslintrc
+++ b/node_modules/finalhandler/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/finalhandler/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/finalhandler/node_modules/debug/.travis.yml b/node_modules/finalhandler/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/finalhandler/node_modules/debug/.travis.yml
+++ b/node_modules/finalhandler/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/finalhandler/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/finalhandler/node_modules/debug/CHANGELOG.md b/node_modules/finalhandler/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/finalhandler/node_modules/debug/CHANGELOG.md
+++ b/node_modules/finalhandler/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/finalhandler/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/finalhandler/node_modules/debug/Makefile b/node_modules/finalhandler/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/finalhandler/node_modules/debug/Makefile
+++ b/node_modules/finalhandler/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/finalhandler/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/finalhandler/node_modules/debug/README.md b/node_modules/finalhandler/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/finalhandler/node_modules/debug/README.md
+++ b/node_modules/finalhandler/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/finalhandler/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/finalhandler/node_modules/debug/component.json b/node_modules/finalhandler/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/finalhandler/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/finalhandler/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/finalhandler/node_modules/debug/package.json b/node_modules/finalhandler/node_modules/debug/package.json
index 0f02221..0c6eb36 100644
--- a/node_modules/finalhandler/node_modules/debug/package.json
+++ b/node_modules/finalhandler/node_modules/debug/package.json
@@ -1,32 +1,32 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/finalhandler/debug",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/finalhandler"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -36,12 +36,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -58,7 +52,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -88,5 +82,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/fsevents/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/fsevents/node_modules/debug/.eslintrc b/node_modules/fsevents/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/fsevents/node_modules/debug/.eslintrc
+++ b/node_modules/fsevents/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/fsevents/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/fsevents/node_modules/debug/.travis.yml b/node_modules/fsevents/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/fsevents/node_modules/debug/.travis.yml
+++ b/node_modules/fsevents/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/fsevents/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/fsevents/node_modules/debug/CHANGELOG.md b/node_modules/fsevents/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/fsevents/node_modules/debug/CHANGELOG.md
+++ b/node_modules/fsevents/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/fsevents/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/fsevents/node_modules/debug/Makefile b/node_modules/fsevents/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/fsevents/node_modules/debug/Makefile
+++ b/node_modules/fsevents/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/fsevents/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/fsevents/node_modules/debug/README.md b/node_modules/fsevents/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/fsevents/node_modules/debug/README.md
+++ b/node_modules/fsevents/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/fsevents/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/fsevents/node_modules/debug/component.json b/node_modules/fsevents/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/fsevents/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/fsevents/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/fsevents/node_modules/debug/package.json b/node_modules/fsevents/node_modules/debug/package.json
index 3d9bfc4..e4c95eb 100644
--- a/node_modules/fsevents/node_modules/debug/package.json
+++ b/node_modules/fsevents/node_modules/debug/package.json
@@ -1,33 +1,33 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
-  "_inBundle": true,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
+  "_inBundle": false,
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/fsevents/debug",
   "_optional": true,
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/fsevents/needle"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -37,12 +37,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -59,7 +53,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -89,5 +83,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/get-uri/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/get-uri/node_modules/debug/.eslintrc b/node_modules/get-uri/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/get-uri/node_modules/debug/.eslintrc
+++ b/node_modules/get-uri/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/get-uri/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/get-uri/node_modules/debug/.travis.yml b/node_modules/get-uri/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/get-uri/node_modules/debug/.travis.yml
+++ b/node_modules/get-uri/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/get-uri/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/get-uri/node_modules/debug/CHANGELOG.md b/node_modules/get-uri/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/get-uri/node_modules/debug/CHANGELOG.md
+++ b/node_modules/get-uri/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/get-uri/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/get-uri/node_modules/debug/Makefile b/node_modules/get-uri/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/get-uri/node_modules/debug/Makefile
+++ b/node_modules/get-uri/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/get-uri/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/get-uri/node_modules/debug/README.md b/node_modules/get-uri/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/get-uri/node_modules/debug/README.md
+++ b/node_modules/get-uri/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/get-uri/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/get-uri/node_modules/debug/component.json b/node_modules/get-uri/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/get-uri/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/get-uri/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/get-uri/node_modules/debug/package.json b/node_modules/get-uri/node_modules/debug/package.json
index a63b784..f17f2db 100644
--- a/node_modules/get-uri/node_modules/debug/package.json
+++ b/node_modules/get-uri/node_modules/debug/package.json
@@ -1,33 +1,33 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/get-uri/debug",
   "_optional": true,
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/get-uri"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -37,12 +37,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -59,7 +53,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -89,5 +83,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/.npmignore
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/.npmignore b/node_modules/http-proxy-agent/.npmignore
deleted file mode 100644
index 07e6e47..0000000
--- a/node_modules/http-proxy-agent/.npmignore
+++ /dev/null
@@ -1 +0,0 @@
-/node_modules

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/.travis.yml b/node_modules/http-proxy-agent/.travis.yml
index 85a5012..805d3d5 100644
--- a/node_modules/http-proxy-agent/.travis.yml
+++ b/node_modules/http-proxy-agent/.travis.yml
@@ -1,8 +1,22 @@
+sudo: false
+
 language: node_js
+
 node_js:
-  - "0.8"
-  - "0.10"
-  - "0.12"
-before_install:
-  - '[ "${TRAVIS_NODE_VERSION}" != "0.8" ] || npm install -g npm@1.4.28'
-  - npm install -g npm@latest
+  - "4"
+  - "5"
+  - "6"
+  - "7"
+  - "8"
+
+install:
+  - PATH="`npm bin`:`npm bin -g`:$PATH"
+  # Install dependencies and build
+  - npm install
+
+script:
+  # Output useful info for debugging
+  - node --version
+  - npm --version
+  # Run tests
+  - npm test

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/History.md
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/History.md b/node_modules/http-proxy-agent/History.md
index 6765fce..7e3e1e7 100644
--- a/node_modules/http-proxy-agent/History.md
+++ b/node_modules/http-proxy-agent/History.md
@@ -1,4 +1,21 @@
 
+2.1.0 / 2018-03-03
+==================
+
+  * Add "engines" to package.json
+  * Use `Buffer.from()`
+  * Update package.json - outdated debug version (#7)
+
+2.0.0 / 2017-06-27
+==================
+
+  * drop support for Node.js < v4
+  * update "mocha" to v3
+  * update to "agent-base" v4
+  * rename http-proxy-agent.js to index.js
+  * remove `extend` dependency
+  * test Node.js 4, 5, 6, 7 and 8 on Travis-CI
+
 1.0.0 / 2015-07-10
 ==================
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/http-proxy-agent/http-proxy-agent.js
----------------------------------------------------------------------
diff --git a/node_modules/http-proxy-agent/http-proxy-agent.js b/node_modules/http-proxy-agent/http-proxy-agent.js
deleted file mode 100644
index b70e875..0000000
--- a/node_modules/http-proxy-agent/http-proxy-agent.js
+++ /dev/null
@@ -1,110 +0,0 @@
-
-/**
- * Module dependencies.
- */
-
-var net = require('net');
-var tls = require('tls');
-var url = require('url');
-var extend = require('extend');
-var Agent = require('agent-base');
-var inherits = require('util').inherits;
-var debug = require('debug')('http-proxy-agent');
-
-/**
- * Module exports.
- */
-
-module.exports = HttpProxyAgent;
-
-/**
- * The `HttpProxyAgent` implements an HTTP Agent subclass that connects to the
- * specified "HTTP proxy server" in order to proxy HTTP requests.
- *
- * @api public
- */
-
-function HttpProxyAgent (opts) {
-  if (!(this instanceof HttpProxyAgent)) return new HttpProxyAgent(opts);
-  if ('string' == typeof opts) opts = url.parse(opts);
-  if (!opts) throw new Error('an HTTP(S) proxy server `host` and `port` must be specified!');
-  debug('creating new HttpProxyAgent instance: %o', opts);
-  Agent.call(this, connect);
-
-  var proxy = extend({}, opts);
-
-  // if `true`, then connect to the proxy server over TLS. defaults to `false`.
-  this.secureProxy = proxy.protocol ? /^https:?$/i.test(proxy.protocol) : false;
-
-  // prefer `hostname` over `host`, and set the `port` if needed
-  proxy.host = proxy.hostname || proxy.host;
-  proxy.port = +proxy.port || (this.secureProxy ? 443 : 80);
-
-  if (proxy.host && proxy.path) {
-    // if both a `host` and `path` are specified then it's most likely the
-    // result of a `url.parse()` call... we need to remove the `path` portion so
-    // that `net.connect()` doesn't attempt to open that as a unix socket file.
-    delete proxy.path;
-    delete proxy.pathname;
-  }
-
-  this.proxy = proxy;
-}
-inherits(HttpProxyAgent, Agent);
-
-/**
- * Called when the node-core HTTP client library is creating a new HTTP request.
- *
- * @api public
- */
-
-function connect (req, opts, fn) {
-  var proxy = this.proxy;
-
-  // change the `http.ClientRequest` instance's "path" field
-  // to the absolute path of the URL that will be requested
-  var parsed = url.parse(req.path);
-  if (null == parsed.protocol) parsed.protocol = 'http:';
-  if (null == parsed.hostname) parsed.hostname = opts.hostname || opts.host;
-  if (null == parsed.port) parsed.port = opts.port;
-  if (parsed.port == 80) {
-    // if port is 80, then we can remove the port so that the
-    // ":80" portion is not on the produced URL
-    delete parsed.port;
-  }
-  var absolute = url.format(parsed);
-  req.path = absolute;
-
-  // inject the `Proxy-Authorization` header if necessary
-  var auth = proxy.auth;
-  if (auth) {
-    req.setHeader('Proxy-Authorization', 'Basic ' + new Buffer(auth).toString('base64'));
-  }
-
-  // create a socket connection to the proxy server
-  var socket;
-  if (this.secureProxy) {
-    socket = tls.connect(proxy);
-  } else {
-    socket = net.connect(proxy);
-  }
-
-  // at this point, the http ClientRequest's internal `_header` field might have
-  // already been set. If this is the case then we'll need to re-generate the
-  // string since we just changed the `req.path`
-  if (req._header) {
-    debug('regenerating stored HTTP header string for request');
-    req._header = null;
-    req._implicitHeader();
-    if (req.output && req.output.length > 0) {
-      debug('patching connection write() output buffer with updated header');
-      // the _header has already been queued to be written to the socket
-      var first = req.output[0];
-      var endOfHeaders = first.indexOf('\r\n\r\n') + 4;
-      req.output[0] = req._header + first.substring(endOfHeaders);
-      debug('output buffer: %o', req.output);
-    }
-  }
-
-  fn(null, socket);
-};

[05/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/agent-base/History.md
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/agent-base/History.md b/node_modules/https-proxy-agent/node_modules/agent-base/History.md
new file mode 100644
index 0000000..80c88dc
--- /dev/null
+++ b/node_modules/https-proxy-agent/node_modules/agent-base/History.md
@@ -0,0 +1,113 @@
+
+4.2.0 / 2018-01-15
+==================
+
+  * Add support for returning an `http.Agent` instance
+  * Optimize promisifying logic
+  * Set `timeout` to null for proper cleanup
+  * Remove Node.js <= 0.11.3 special-casing from test case
+
+4.1.2 / 2017-11-20
+==================
+
+  * test Node 9 on Travis
+  * ensure that `https.get()` uses the patched `https.request()`
+
+4.1.1 / 2017-07-20
+==================
+
+  * Correct `https.request()` with a String (#9)
+
+4.1.0 / 2017-06-26
+==================
+
+  * mix in Agent options into Request options
+  * throw when nothing is returned from agent-base callback
+  * do not modify the options object for https requests
+
+4.0.1 / 2017-06-13
+==================
+
+  * add `this` context tests and fixes
+
+4.0.0 / 2017-06-06
+==================
+
+  * drop support for Node.js < 4
+  * drop old versions of Node.js from Travis-CI
+  * specify Node.js >= 4.0.0 in `engines.node`
+  * remove more old code
+  * remove "extend" dependency
+  * remove "semver" dependency
+  * make the Promise logic a bit cleaner
+  * add async function pseudo-example to README
+  * use direct return in README example
+
+3.0.0 / 2017-06-02
+==================
+
+  * drop support for Node.js v0.8 and v0.10
+  * add support for async, Promises, and direct return
+  * add a couple `options` test cases
+  * implement a `"timeout"` option
+  * rename main file to `index.js`
+  * test Node 8 on Travis
+
+2.1.1 / 2017-05-30
+==================
+
+  * Revert [`fe2162e`](https://github.com/TooTallNate/node-agent-base/commit/fe2162e0ba18123f5b301cba4de1e9dd74e437cd) and [`270bdc9`](https://github.com/TooTallNate/node-agent-base/commit/270bdc92eb8e3bd0444d1e5266e8e9390aeb3095) (fixes #7)
+
+2.1.0 / 2017-05-26
+==================
+
+  * unref is not supported for node < 0.9.1 (@pi0)
+  * add tests to dangling socket (@pi0)
+  * check unref() is supported (@pi0)
+  * fix dangling sockets problem (@pi0)
+  * add basic "ws" module tests
+  * make `Agent` be subclassable
+  * turn `addRequest()` into a named function
+  * test: Node.js v4 likes to call `cork` on the stream (#3, @tomhughes)
+  * travis: test node v4, v5, v6 and v7
+
+2.0.1 / 2015-09-10
+==================
+
+  * package: update "semver" to v5.0.1 for WebPack (#1, @vhpoet)
+
+2.0.0 / 2015-07-10
+==================
+
+  * refactor to patch Node.js core for more consistent `opts` values
+  * ensure that HTTP(s) default port numbers are always given
+  * test: use ssl-cert-snakeoil SSL certs
+  * test: add tests for arbitrary options
+  * README: add API section
+  * README: make the Agent HTTP/HTTPS generic in the example
+  * README: use SVG for Travis-CI badge
+
+1.0.2 / 2015-06-27
+==================
+
+  * agent: set `req._hadError` to true after emitting "error"
+  * package: update "mocha" to v2
+  * test: add artificial HTTP GET request test
+  * test: add artificial data events test
+  * test: fix artifical GET response test on node > v0.11.3
+  * test: use a real timeout for the async error test
+
+1.0.1 / 2013-09-09
+==================
+
+  * Fix passing an "error" object to the callback function on the first tick
+
+1.0.0 / 2013-09-09
+==================
+
+  * New API: now you pass a callback function directly
+
+0.0.1 / 2013-07-09
+==================
+
+  * Initial release

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/agent-base/README.md
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/agent-base/README.md b/node_modules/https-proxy-agent/node_modules/agent-base/README.md
new file mode 100644
index 0000000..dbeceab
--- /dev/null
+++ b/node_modules/https-proxy-agent/node_modules/agent-base/README.md
@@ -0,0 +1,145 @@
+agent-base
+==========
+### Turn a function into an [`http.Agent`][http.Agent] instance
+[![Build Status](https://travis-ci.org/TooTallNate/node-agent-base.svg?branch=master)](https://travis-ci.org/TooTallNate/node-agent-base)
+
+This module provides an `http.Agent` generator. That is, you pass it an async
+callback function, and it returns a new `http.Agent` instance that will invoke the
+given callback function when sending outbound HTTP requests.
+
+#### Some subclasses:
+
+Here's some more interesting uses of `agent-base`.
+Send a pull request to list yours!
+
+ * [`http-proxy-agent`][http-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTP endpoints
+ * [`https-proxy-agent`][https-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTPS endpoints
+ * [`pac-proxy-agent`][pac-proxy-agent]: A PAC file proxy `http.Agent` implementation for HTTP and HTTPS
+ * [`socks-proxy-agent`][socks-proxy-agent]: A SOCKS (v4a) proxy `http.Agent` implementation for HTTP and HTTPS
+
+
+Installation
+------------
+
+Install with `npm`:
+
+``` bash
+$ npm install agent-base
+```
+
+
+Example
+-------
+
+Here's a minimal example that creates a new `net.Socket` connection to the server
+for every HTTP request (i.e. the equivalent of `agent: false` option):
+
+```js
+var net = require('net');
+var tls = require('tls');
+var url = require('url');
+var http = require('http');
+var agent = require('agent-base');
+
+var endpoint = 'http://nodejs.org/api/';
+var parsed = url.parse(endpoint);
+
+// This is the important part!
+parsed.agent = agent(function (req, opts) {
+  var socket;
+  // `secureEndpoint` is true when using the https module
+  if (opts.secureEndpoint) {
+    socket = tls.connect(opts);
+  } else {
+    socket = net.connect(opts);
+  }
+  return socket;
+});
+
+// Everything else works just like normal...
+http.get(parsed, function (res) {
+  console.log('"response" event!', res.headers);
+  res.pipe(process.stdout);
+});
+```
+
+Returning a Promise or using an `async` function is also supported:
+
+```js
+agent(async function (req, opts) {
+  await sleep(1000);
+  // etc…
+});
+```
+
+Return another `http.Agent` instance to "pass through" the responsibility
+for that HTTP request to that agent:
+
+```js
+agent(function (req, opts) {
+  return opts.secureEndpoint ? https.globalAgent : http.globalAgent;
+});
+```
+
+
+API
+---
+
+## Agent(Function callback[, Object options]) → [http.Agent][]
+
+Creates a base `http.Agent` that will execute the callback function `callback`
+for every HTTP request that it is used as the `agent` for. The callback function
+is responsible for creating a `stream.Duplex` instance of some kind that will be
+used as the underlying socket in the HTTP request.
+
+The `options` object accepts the following properties:
+
+  * `timeout` - Number - Timeout for the `callback()` function in milliseconds. Defaults to Infinity (optional).
+
+The callback function should have the following signature:
+
+### callback(http.ClientRequest req, Object options, Function cb) → undefined
+
+The ClientRequest `req` can be accessed to read request headers and
+and the path, etc. The `options` object contains the options passed
+to the `http.request()`/`https.request()` function call, and is formatted
+to be directly passed to `net.connect()`/`tls.connect()`, or however
+else you want a Socket to be created. Pass the created socket to
+the callback function `cb` once created, and the HTTP request will
+continue to proceed.
+
+If the `https` module is used to invoke the HTTP request, then the
+`secureEndpoint` property on `options` _will be set to `true`_.
+
+
+License
+-------
+
+(The MIT License)
+
+Copyright (c) 2013 Nathan Rajlich &lt;nathan@tootallnate.net&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+[http-proxy-agent]: https://github.com/TooTallNate/node-http-proxy-agent
+[https-proxy-agent]: https://github.com/TooTallNate/node-https-proxy-agent
+[pac-proxy-agent]: https://github.com/TooTallNate/node-pac-proxy-agent
+[socks-proxy-agent]: https://github.com/TooTallNate/node-socks-proxy-agent
+[http.Agent]: https://nodejs.org/api/http.html#http_class_http_agent

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/agent-base/index.js
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/agent-base/index.js b/node_modules/https-proxy-agent/node_modules/agent-base/index.js
new file mode 100644
index 0000000..b1f42e6
--- /dev/null
+++ b/node_modules/https-proxy-agent/node_modules/agent-base/index.js
@@ -0,0 +1,160 @@
+'use strict';
+require('./patch-core');
+const inherits = require('util').inherits;
+const promisify = require('es6-promisify');
+const EventEmitter = require('events').EventEmitter;
+
+module.exports = Agent;
+
+function isAgent(v) {
+  return v && typeof v.addRequest === 'function';
+}
+
+/**
+ * Base `http.Agent` implementation.
+ * No pooling/keep-alive is implemented by default.
+ *
+ * @param {Function} callback
+ * @api public
+ */
+function Agent(callback, _opts) {
+  if (!(this instanceof Agent)) {
+    return new Agent(callback, _opts);
+  }
+
+  EventEmitter.call(this);
+
+  // The callback gets promisified if it has 3 parameters
+  // (i.e. it has a callback function) lazily
+  this._promisifiedCallback = false;
+
+  let opts = _opts;
+  if ('function' === typeof callback) {
+    this.callback = callback;
+  } else if (callback) {
+    opts = callback;
+  }
+
+  // timeout for the socket to be returned from the callback
+  this.timeout = (opts && opts.timeout) || null;
+
+  this.options = opts;
+}
+inherits(Agent, EventEmitter);
+
+/**
+ * Override this function in your subclass!
+ */
+Agent.prototype.callback = function callback(req, opts) {
+  throw new Error(
+    '"agent-base" has no default implementation, you must subclass and override `callback()`'
+  );
+};
+
+/**
+ * Called by node-core's "_http_client.js" module when creating
+ * a new HTTP request with this Agent instance.
+ *
+ * @api public
+ */
+Agent.prototype.addRequest = function addRequest(req, _opts) {
+  const ownOpts = Object.assign({}, _opts);
+
+  // Set default `host` for HTTP to localhost
+  if (null == ownOpts.host) {
+    ownOpts.host = 'localhost';
+  }
+
+  // Set default `port` for HTTP if none was explicitly specified
+  if (null == ownOpts.port) {
+    ownOpts.port = ownOpts.secureEndpoint ? 443 : 80;
+  }
+
+  const opts = Object.assign({}, this.options, ownOpts);
+
+  if (opts.host && opts.path) {
+    // If both a `host` and `path` are specified then it's most likely the
+    // result of a `url.parse()` call... we need to remove the `path` portion so
+    // that `net.connect()` doesn't attempt to open that as a unix socket file.
+    delete opts.path;
+  }
+
+  delete opts.agent;
+  delete opts.hostname;
+  delete opts._defaultAgent;
+  delete opts.defaultPort;
+  delete opts.createConnection;
+
+  // Hint to use "Connection: close"
+  // XXX: non-documented `http` module API :(
+  req._last = true;
+  req.shouldKeepAlive = false;
+
+  // Create the `stream.Duplex` instance
+  let timeout;
+  let timedOut = false;
+  const timeoutMs = this.timeout;
+
+  function onerror(err) {
+    if (req._hadError) return;
+    req.emit('error', err);
+    // For Safety. Some additional errors might fire later on
+    // and we need to make sure we don't double-fire the error event.
+    req._hadError = true;
+  }
+
+  function ontimeout() {
+    timeout = null;
+    timedOut = true;
+    const err = new Error(
+      'A "socket" was not created for HTTP request before ' + timeoutMs + 'ms'
+    );
+    err.code = 'ETIMEOUT';
+    onerror(err);
+  }
+
+  function callbackError(err) {
+    if (timedOut) return;
+    if (timeout != null) {
+      clearTimeout(timeout);
+      timeout = null;
+    }
+    onerror(err);
+  }
+
+  function onsocket(socket) {
+    if (timedOut) return;
+    if (timeout != null) {
+      clearTimeout(timeout);
+      timeout = null;
+    }
+    if (isAgent(socket)) {
+      // `socket` is actually an http.Agent instance, so relinquish
+      // responsibility for this `req` to the Agent from here on
+      socket.addRequest(req, opts);
+    } else if (socket) {
+      req.onSocket(socket);
+    } else {
+      const err = new Error(
+        `no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\``
+      );
+      onerror(err);
+    }
+  }
+
+  if (!this._promisifiedCallback && this.callback.length >= 3) {
+    // Legacy callback function - convert to a Promise
+    this.callback = promisify(this.callback, this);
+    this._promisifiedCallback = true;
+  }
+
+  if (timeoutMs > 0) {
+    timeout = setTimeout(ontimeout, timeoutMs);
+  }
+
+  try {
+    Promise.resolve(this.callback(req, opts)).then(onsocket, callbackError);
+  } catch (err) {
+    Promise.reject(err).catch(callbackError);
+  }
+};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/agent-base/package.json
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/agent-base/package.json b/node_modules/https-proxy-agent/node_modules/agent-base/package.json
new file mode 100644
index 0000000..b7bc2df
--- /dev/null
+++ b/node_modules/https-proxy-agent/node_modules/agent-base/package.json
@@ -0,0 +1,69 @@
+{
+  "_args": [
+    [
+      "agent-base@4.2.0",
+      "/Users/scottyaslan/Development/nifi-fds/target"
+    ]
+  ],
+  "_development": true,
+  "_from": "agent-base@4.2.0",
+  "_id": "agent-base@4.2.0",
+  "_inBundle": false,
+  "_integrity": "sha512-c+R/U5X+2zz2+UCrCFv6odQzJdoqI+YecuhnAJLa1zYaMc13zPfwMwZrr91Pd1DYNo/yPRbiM4WVf9whgwFsIg==",
+  "_location": "/https-proxy-agent/agent-base",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "agent-base@4.2.0",
+    "name": "agent-base",
+    "escapedName": "agent-base",
+    "rawSpec": "4.2.0",
+    "saveSpec": null,
+    "fetchSpec": "4.2.0"
+  },
+  "_requiredBy": [
+    "/https-proxy-agent"
+  ],
+  "_resolved": "https://registry.npmjs.org/agent-base/-/agent-base-4.2.0.tgz",
+  "_spec": "4.2.0",
+  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
+  "author": {
+    "name": "Nathan Rajlich",
+    "email": "nathan@tootallnate.net",
+    "url": "http://n8.io/"
+  },
+  "bugs": {
+    "url": "https://github.com/TooTallNate/node-agent-base/issues"
+  },
+  "dependencies": {
+    "es6-promisify": "^5.0.0"
+  },
+  "description": "Turn a function into an `http.Agent` instance",
+  "devDependencies": {
+    "mocha": "^3.4.2",
+    "ws": "^3.0.0"
+  },
+  "engines": {
+    "node": ">= 4.0.0"
+  },
+  "homepage": "https://github.com/TooTallNate/node-agent-base#readme",
+  "keywords": [
+    "http",
+    "agent",
+    "base",
+    "barebones",
+    "https"
+  ],
+  "license": "MIT",
+  "main": "./index.js",
+  "name": "agent-base",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/TooTallNate/node-agent-base.git"
+  },
+  "scripts": {
+    "test": "mocha --reporter spec"
+  },
+  "version": "4.2.0"
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/agent-base/patch-core.js
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/agent-base/patch-core.js b/node_modules/https-proxy-agent/node_modules/agent-base/patch-core.js
new file mode 100644
index 0000000..47d26a7
--- /dev/null
+++ b/node_modules/https-proxy-agent/node_modules/agent-base/patch-core.js
@@ -0,0 +1,37 @@
+'use strict';
+const url = require('url');
+const https = require('https');
+
+/**
+ * This currently needs to be applied to all Node.js versions
+ * in order to determine if the `req` is an HTTP or HTTPS request.
+ *
+ * There is currently no PR attempting to move this property upstream.
+ */
+https.request = (function(request) {
+  return function(_options, cb) {
+    let options;
+    if (typeof _options === 'string') {
+      options = url.parse(_options);
+    } else {
+      options = Object.assign({}, _options);
+    }
+    if (null == options.port) {
+      options.port = 443;
+    }
+    options.secureEndpoint = true;
+    return request.call(https, options, cb);
+  };
+})(https.request);
+
+/**
+ * This is needed for Node.js >= 9.0.0 to make sure `https.get()` uses the
+ * patched `https.request()`.
+ *
+ * Ref: https://github.com/nodejs/node/commit/5118f31
+ */
+https.get = function(options, cb) {
+  const req = https.request(options, cb);
+  req.end();
+  return req;
+};

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/.coveralls.yml
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/.coveralls.yml b/node_modules/https-proxy-agent/node_modules/debug/.coveralls.yml
deleted file mode 100644
index 20a7068..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/.coveralls.yml
+++ /dev/null
@@ -1 +0,0 @@
-repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/.eslintrc b/node_modules/https-proxy-agent/node_modules/debug/.eslintrc
deleted file mode 100644
index 8a37ae2..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/.eslintrc
+++ /dev/null
@@ -1,11 +0,0 @@
-{
-  "env": {
-    "browser": true,
-    "node": true
-  },
-  "rules": {
-    "no-console": 0,
-    "no-empty": [1, { "allowEmptyCatch": true }]
-  },
-  "extends": "eslint:recommended"
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/.npmignore
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/.npmignore b/node_modules/https-proxy-agent/node_modules/debug/.npmignore
deleted file mode 100644
index 5f60eec..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/.npmignore
+++ /dev/null
@@ -1,9 +0,0 @@
-support
-test
-examples
-example
-*.sock
-dist
-yarn.lock
-coverage
-bower.json

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/.travis.yml b/node_modules/https-proxy-agent/node_modules/debug/.travis.yml
deleted file mode 100644
index 6c6090c..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/.travis.yml
+++ /dev/null
@@ -1,14 +0,0 @@
-
-language: node_js
-node_js:
-  - "6"
-  - "5"
-  - "4"
-
-install:
-  - make node_modules
-
-script:
-  - make lint
-  - make test
-  - make coveralls

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/CHANGELOG.md b/node_modules/https-proxy-agent/node_modules/debug/CHANGELOG.md
deleted file mode 100644
index eadaa18..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/CHANGELOG.md
+++ /dev/null
@@ -1,362 +0,0 @@
-
-2.6.9 / 2017-09-22
-==================
-
-  * remove ReDoS regexp in %o formatter (#504)
-
-2.6.8 / 2017-05-18
-==================
-
-  * Fix: Check for undefined on browser globals (#462, @marbemac)
-
-2.6.7 / 2017-05-16
-==================
-
-  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
-  * Fix: Inline extend function in node implementation (#452, @dougwilson)
-  * Docs: Fix typo (#455, @msasad)
-
-2.6.5 / 2017-04-27
-==================
-  
-  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
-  * Misc: clean up browser reference checks (#447, @thebigredgeek)
-  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
-
-
-2.6.4 / 2017-04-20
-==================
-
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
-  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
-  * Misc: update "ms" to v0.7.3 (@tootallnate)
-
-2.6.3 / 2017-03-13
-==================
-
-  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
-  * Docs: Changelog fix (@thebigredgeek)
-
-2.6.2 / 2017-03-10
-==================
-
-  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
-  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
-  * Docs: Add Slackin invite badge (@tootallnate)
-
-2.6.1 / 2017-02-10
-==================
-
-  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
-  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
-  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
-  * Fix: Namespaces would not disable once enabled (#409, @musikov)
-
-2.6.0 / 2016-12-28
-==================
-
-  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
-  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
-  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
-
-2.5.2 / 2016-12-25
-==================
-
-  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
-  * Docs: fixed README typo (#391, @lurch)
-  * Docs: added notice about v3 api discussion (@thebigredgeek)
-
-2.5.1 / 2016-12-20
-==================
-
-  * Fix: babel-core compatibility
-
-2.5.0 / 2016-12-20
-==================
-
-  * Fix: wrong reference in bower file (@thebigredgeek)
-  * Fix: webworker compatibility (@thebigredgeek)
-  * Fix: output formatting issue (#388, @kribblo)
-  * Fix: babel-loader compatibility (#383, @escwald)
-  * Misc: removed built asset from repo and publications (@thebigredgeek)
-  * Misc: moved source files to /src (#378, @yamikuronue)
-  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
-  * Test: coveralls integration (#378, @yamikuronue)
-  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
-
-2.4.5 / 2016-12-17
-==================
-
-  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
-  * Fix: custom log function (#379, @hsiliev)
-  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
-  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
-  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
-
-2.4.4 / 2016-12-14
-==================
-
-  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
-
-2.4.3 / 2016-12-14
-==================
-
-  * Fix: navigation.userAgent error for react native (#364, @escwald)
-
-2.4.2 / 2016-12-14
-==================
-
-  * Fix: browser colors (#367, @tootallnate)
-  * Misc: travis ci integration (@thebigredgeek)
-  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
-
-2.4.1 / 2016-12-13
-==================
-
-  * Fix: typo that broke the package (#356)
-
-2.4.0 / 2016-12-13
-==================
-
-  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
-  * Fix: revert "handle regex special characters" (@tootallnate)
-  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
-  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
-  * Improvement: allow colors in workers (#335, @botverse)
-  * Improvement: use same color for same namespace. (#338, @lchenay)
-
-2.3.3 / 2016-11-09
-==================
-
-  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
-  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
-  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
-
-2.3.2 / 2016-11-09
-==================
-
-  * Fix: be super-safe in index.js as well (@TooTallNate)
-  * Fix: should check whether process exists (Tom Newby)
-
-2.3.1 / 2016-11-09
-==================
-
-  * Fix: Added electron compatibility (#324, @paulcbetts)
-  * Improvement: Added performance optimizations (@tootallnate)
-  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
-  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
-
-2.3.0 / 2016-11-07
-==================
-
-  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
-  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
-  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
-  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
-  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
-  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
-  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
-  * Readme: fix USE_COLORS to DEBUG_COLORS
-  * Readme: Doc fixes for format string sugar (#269, @mlucool)
-  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
-  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
-  * Readme: better docs for browser support (#224, @matthewmueller)
-  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
-  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
-  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
-  * Misc: Updated contributors (@thebigredgeek)
-
-2.2.0 / 2015-05-09
-==================
-
-  * package: update "ms" to v0.7.1 (#202, @dougwilson)
-  * README: add logging to file example (#193, @DanielOchoa)
-  * README: fixed a typo (#191, @amir-s)
-  * browser: expose `storage` (#190, @stephenmathieson)
-  * Makefile: add a `distclean` target (#189, @stephenmathieson)
-
-2.1.3 / 2015-03-13
-==================
-
-  * Updated stdout/stderr example (#186)
-  * Updated example/stdout.js to match debug current behaviour
-  * Renamed example/stderr.js to stdout.js
-  * Update Readme.md (#184)
-  * replace high intensity foreground color for bold (#182, #183)
-
-2.1.2 / 2015-03-01
-==================
-
-  * dist: recompile
-  * update "ms" to v0.7.0
-  * package: update "browserify" to v9.0.3
-  * component: fix "ms.js" repo location
-  * changed bower package name
-  * updated documentation about using debug in a browser
-  * fix: security error on safari (#167, #168, @yields)
-
-2.1.1 / 2014-12-29
-==================
-
-  * browser: use `typeof` to check for `console` existence
-  * browser: check for `console.log` truthiness (fix IE 8/9)
-  * browser: add support for Chrome apps
-  * Readme: added Windows usage remarks
-  * Add `bower.json` to properly support bower install
-
-2.1.0 / 2014-10-15
-==================
-
-  * node: implement `DEBUG_FD` env variable support
-  * package: update "browserify" to v6.1.0
-  * package: add "license" field to package.json (#135, @panuhorsmalahti)
-
-2.0.0 / 2014-09-01
-==================
-
-  * package: update "browserify" to v5.11.0
-  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
-
-1.0.4 / 2014-07-15
-==================
-
-  * dist: recompile
-  * example: remove `console.info()` log usage
-  * example: add "Content-Type" UTF-8 header to browser example
-  * browser: place %c marker after the space character
-  * browser: reset the "content" color via `color: inherit`
-  * browser: add colors support for Firefox >= v31
-  * debug: prefer an instance `log()` function over the global one (#119)
-  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
-
-1.0.3 / 2014-07-09
-==================
-
-  * Add support for multiple wildcards in namespaces (#122, @seegno)
-  * browser: fix lint
-
-1.0.2 / 2014-06-10
-==================
-
-  * browser: update color palette (#113, @gscottolson)
-  * common: make console logging function configurable (#108, @timoxley)
-  * node: fix %o colors on old node <= 0.8.x
-  * Makefile: find node path using shell/which (#109, @timoxley)
-
-1.0.1 / 2014-06-06
-==================
-
-  * browser: use `removeItem()` to clear localStorage
-  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
-  * package: add "contributors" section
-  * node: fix comment typo
-  * README: list authors
-
-1.0.0 / 2014-06-04
-==================
-
-  * make ms diff be global, not be scope
-  * debug: ignore empty strings in enable()
-  * node: make DEBUG_COLORS able to disable coloring
-  * *: export the `colors` array
-  * npmignore: don't publish the `dist` dir
-  * Makefile: refactor to use browserify
-  * package: add "browserify" as a dev dependency
-  * Readme: add Web Inspector Colors section
-  * node: reset terminal color for the debug content
-  * node: map "%o" to `util.inspect()`
-  * browser: map "%j" to `JSON.stringify()`
-  * debug: add custom "formatters"
-  * debug: use "ms" module for humanizing the diff
-  * Readme: add "bash" syntax highlighting
-  * browser: add Firebug color support
-  * browser: add colors for WebKit browsers
-  * node: apply log to `console`
-  * rewrite: abstract common logic for Node & browsers
-  * add .jshintrc file
-
-0.8.1 / 2014-04-14
-==================
-
-  * package: re-add the "component" section
-
-0.8.0 / 2014-03-30
-==================
-
-  * add `enable()` method for nodejs. Closes #27
-  * change from stderr to stdout
-  * remove unnecessary index.js file
-
-0.7.4 / 2013-11-13
-==================
-
-  * remove "browserify" key from package.json (fixes something in browserify)
-
-0.7.3 / 2013-10-30
-==================
-
-  * fix: catch localStorage security error when cookies are blocked (Chrome)
-  * add debug(err) support. Closes #46
-  * add .browser prop to package.json. Closes #42
-
-0.7.2 / 2013-02-06
-==================
-
-  * fix package.json
-  * fix: Mobile Safari (private mode) is broken with debug
-  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
-
-0.7.1 / 2013-02-05
-==================
-
-  * add repository URL to package.json
-  * add DEBUG_COLORED to force colored output
-  * add browserify support
-  * fix component. Closes #24
-
-0.7.0 / 2012-05-04
-==================
-
-  * Added .component to package.json
-  * Added debug.component.js build
-
-0.6.0 / 2012-03-16
-==================
-
-  * Added support for "-" prefix in DEBUG [Vinay Pulim]
-  * Added `.enabled` flag to the node version [TooTallNate]
-
-0.5.0 / 2012-02-02
-==================
-
-  * Added: humanize diffs. Closes #8
-  * Added `debug.disable()` to the CS variant
-  * Removed padding. Closes #10
-  * Fixed: persist client-side variant again. Closes #9
-
-0.4.0 / 2012-02-01
-==================
-
-  * Added browser variant support for older browsers [TooTallNate]
-  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
-  * Added padding to diff (moved it to the right)
-
-0.3.0 / 2012-01-26
-==================
-
-  * Added millisecond diff when isatty, otherwise UTC string
-
-0.2.0 / 2012-01-22
-==================
-
-  * Added wildcard support
-
-0.1.0 / 2011-12-02
-==================
-
-  * Added: remove colors unless stderr isatty [TooTallNate]
-
-0.0.1 / 2010-01-03
-==================
-
-  * Initial release

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/LICENSE
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/LICENSE b/node_modules/https-proxy-agent/node_modules/debug/LICENSE
deleted file mode 100644
index 658c933..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/LICENSE
+++ /dev/null
@@ -1,19 +0,0 @@
-(The MIT License)
-
-Copyright (c) 2014 TJ Holowaychuk <tj...@vision-media.ca>
-
-Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
-and associated documentation files (the 'Software'), to deal in the Software without restriction, 
-including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
-and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
-subject to the following conditions:
-
-The above copyright notice and this permission notice shall be included in all copies or substantial 
-portions of the Software.
-
-THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
-LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
-IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
-WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
-SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
-

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/Makefile b/node_modules/https-proxy-agent/node_modules/debug/Makefile
deleted file mode 100644
index 584da8b..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/Makefile
+++ /dev/null
@@ -1,50 +0,0 @@
-# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
-THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
-THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
-
-# BIN directory
-BIN := $(THIS_DIR)/node_modules/.bin
-
-# Path
-PATH := node_modules/.bin:$(PATH)
-SHELL := /bin/bash
-
-# applications
-NODE ?= $(shell which node)
-YARN ?= $(shell which yarn)
-PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
-BROWSERIFY ?= $(NODE) $(BIN)/browserify
-
-.FORCE:
-
-install: node_modules
-
-node_modules: package.json
-	@NODE_ENV= $(PKG) install
-	@touch node_modules
-
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
-	@$(BROWSERIFY) \
-		--standalone debug \
-		. > dist/debug.js
-
-	karma start --single-run
-	rimraf dist
-
-test: .FORCE
-	concurrently \
-		"make test-node" \
-		"make test-browser"
-
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
-
-.PHONY: all install clean distclean

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/README.md b/node_modules/https-proxy-agent/node_modules/debug/README.md
deleted file mode 100644
index f67be6b..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/README.md
+++ /dev/null
@@ -1,312 +0,0 @@
-# debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
-[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
-
-
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
-
-## Installation
-
-```bash
-$ npm install debug
-```
-
-## Usage
-
-`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
-
-Example _app.js_:
-
-```js
-var debug = require('debug')('http')
-  , http = require('http')
-  , name = 'My App';
-
-// fake app
-
-debug('booting %s', name);
-
-http.createServer(function(req, res){
-  debug(req.method + ' ' + req.url);
-  res.end('hello\n');
-}).listen(3000, function(){
-  debug('listening');
-});
-
-// fake worker of some kind
-
-require('./worker');
-```
-
-Example _worker.js_:
-
-```js
-var debug = require('debug')('worker');
-
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
-```
-
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
-
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
-
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
-
-#### Windows note
-
- On Windows the environment variable is set using the `set` command.
-
- ```cmd
- set DEBUG=*,-not_this
- ```
-
- Note that PowerShell uses different syntax to set environment variables.
-
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
-
-Then, run the program to be debugged as usual.
-
-## Millisecond diff
-
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
-
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
-
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
-
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
-
-## Conventions
-
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
-
-## Wildcards
-
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
-
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
-
-## Environment Variables
-
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
-
-| Name      | Purpose                                         |
-|-----------|-------------------------------------------------|
-| `DEBUG`   | Enables/disables specific debugging namespaces. |
-| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
-| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
-
-
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
-
-## Formatters
-
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
-
-| Formatter | Representation |
-|-----------|----------------|
-| `%O`      | Pretty-print an Object on multiple lines. |
-| `%o`      | Pretty-print an Object all on a single line. |
-| `%s`      | String. |
-| `%d`      | Number (both integer and float). |
-| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
-| `%%`      | Single percent sign ('%'). This does not consume an argument. |
-
-### Custom formatters
-
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
-
-```js
-const createDebug = require('debug')
-createDebug.formatters.h = (v) => {
-  return v.toString('hex')
-}
-
-// …elsewhere
-const debug = createDebug('foo')
-debug('this is hex: %h', new Buffer('hello world'))
-//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
-```
-
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
-
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
-
-```js
-localStorage.debug = 'worker:*'
-```
-
-And then refresh the page.
-
-```js
-a = debug('worker:a');
-b = debug('worker:b');
-
-setInterval(function(){
-  a('doing some work');
-}, 1000);
-
-setInterval(function(){
-  b('doing some work');
-}, 1200);
-```
-
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
-
-## Output streams
-
-  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
-
-Example _stdout.js_:
-
-```js
-var debug = require('debug');
-var error = debug('app:error');
-
-// by default stderr is used
-error('goes to stderr!');
-
-var log = debug('app:log');
-// set this namespace to log via console.log
-log.log = console.log.bind(console); // don't forget to bind to console!
-log('goes to stdout');
-error('still goes to stderr!');
-
-// set all output to go via console.info
-// overrides all per-namespace log settings
-debug.log = console.info.bind(console);
-error('now goes to stdout via console.info');
-log('still goes to stdout, but via console.info now');
-```
-
-
-## Authors
-
- - TJ Holowaychuk
- - Nathan Rajlich
- - Andrew Rhyne
- 
-## Backers
-
-Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
-
-<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
-<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
-
-
-## Sponsors
-
-Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
-
-<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
-<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
-
-## License
-
-(The MIT License)
-
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
-
-Permission is hereby granted, free of charge, to any person obtaining
-a copy of this software and associated documentation files (the
-'Software'), to deal in the Software without restriction, including
-without limitation the rights to use, copy, modify, merge, publish,
-distribute, sublicense, and/or sell copies of the Software, and to
-permit persons to whom the Software is furnished to do so, subject to
-the following conditions:
-
-The above copyright notice and this permission notice shall be
-included in all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
-EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
-MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
-IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
-CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
-TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
-SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/component.json b/node_modules/https-proxy-agent/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/karma.conf.js
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/karma.conf.js b/node_modules/https-proxy-agent/node_modules/debug/karma.conf.js
deleted file mode 100644
index 103a82d..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/karma.conf.js
+++ /dev/null
@@ -1,70 +0,0 @@
-// Karma configuration
-// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
-
-module.exports = function(config) {
-  config.set({
-
-    // base path that will be used to resolve all patterns (eg. files, exclude)
-    basePath: '',
-
-
-    // frameworks to use
-    // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
-    frameworks: ['mocha', 'chai', 'sinon'],
-
-
-    // list of files / patterns to load in the browser
-    files: [
-      'dist/debug.js',
-      'test/*spec.js'
-    ],
-
-
-    // list of files to exclude
-    exclude: [
-      'src/node.js'
-    ],
-
-
-    // preprocess matching files before serving them to the browser
-    // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
-    preprocessors: {
-    },
-
-    // test results reporter to use
-    // possible values: 'dots', 'progress'
-    // available reporters: https://npmjs.org/browse/keyword/karma-reporter
-    reporters: ['progress'],
-
-
-    // web server port
-    port: 9876,
-
-
-    // enable / disable colors in the output (reporters and logs)
-    colors: true,
-
-
-    // level of logging
-    // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
-    logLevel: config.LOG_INFO,
-
-
-    // enable / disable watching file and executing tests whenever any file changes
-    autoWatch: true,
-
-
-    // start these browsers
-    // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
-    browsers: ['PhantomJS'],
-
-
-    // Continuous Integration mode
-    // if true, Karma captures browsers, runs the tests and exits
-    singleRun: false,
-
-    // Concurrency level
-    // how many browser should be started simultaneous
-    concurrency: Infinity
-  })
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/node.js
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/node.js b/node_modules/https-proxy-agent/node_modules/debug/node.js
deleted file mode 100644
index 7fc36fe..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/node.js
+++ /dev/null
@@ -1 +0,0 @@
-module.exports = require('./src/node');

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/node_modules/debug/package.json b/node_modules/https-proxy-agent/node_modules/debug/package.json
deleted file mode 100644
index 5dda187..0000000
--- a/node_modules/https-proxy-agent/node_modules/debug/package.json
+++ /dev/null
@@ -1,92 +0,0 @@
-{
-  "_args": [
-    [
-      "debug@2.6.9",
-      "/Users/scottyaslan/Development/nifi-fds/target"
-    ]
-  ],
-  "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
-  "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
-  "_location": "/https-proxy-agent/debug",
-  "_phantomChildren": {},
-  "_requested": {
-    "type": "version",
-    "registry": true,
-    "raw": "debug@2.6.9",
-    "name": "debug",
-    "escapedName": "debug",
-    "rawSpec": "2.6.9",
-    "saveSpec": null,
-    "fetchSpec": "2.6.9"
-  },
-  "_requiredBy": [
-    "/https-proxy-agent"
-  ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
-  "_where": "/Users/scottyaslan/Development/nifi-fds/target",
-  "author": {
-    "name": "TJ Holowaychuk",
-    "email": "tj@vision-media.ca"
-  },
-  "browser": "./src/browser.js",
-  "bugs": {
-    "url": "https://github.com/visionmedia/debug/issues"
-  },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
-  "contributors": [
-    {
-      "name": "Nathan Rajlich",
-      "email": "nathan@tootallnate.net",
-      "url": "http://n8.io"
-    },
-    {
-      "name": "Andrew Rhyne",
-      "email": "rhyneandrew@gmail.com"
-    }
-  ],
-  "dependencies": {
-    "ms": "2.0.0"
-  },
-  "description": "small debugging utility",
-  "devDependencies": {
-    "browserify": "9.0.3",
-    "chai": "^3.5.0",
-    "concurrently": "^3.1.0",
-    "coveralls": "^2.11.15",
-    "eslint": "^3.12.1",
-    "istanbul": "^0.4.5",
-    "karma": "^1.3.0",
-    "karma-chai": "^0.1.0",
-    "karma-mocha": "^1.3.0",
-    "karma-phantomjs-launcher": "^1.0.2",
-    "karma-sinon": "^1.0.5",
-    "mocha": "^3.2.0",
-    "mocha-lcov-reporter": "^1.2.0",
-    "rimraf": "^2.5.4",
-    "sinon": "^1.17.6",
-    "sinon-chai": "^2.8.0"
-  },
-  "homepage": "https://github.com/visionmedia/debug#readme",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "license": "MIT",
-  "main": "./src/index.js",
-  "name": "debug",
-  "repository": {
-    "type": "git",
-    "url": "git://github.com/visionmedia/debug.git"
-  },
-  "version": "2.6.9"
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/https-proxy-agent/package.json
----------------------------------------------------------------------
diff --git a/node_modules/https-proxy-agent/package.json b/node_modules/https-proxy-agent/package.json
index d24c82f..73a531d 100644
--- a/node_modules/https-proxy-agent/package.json
+++ b/node_modules/https-proxy-agent/package.json
@@ -1,36 +1,36 @@
 {
   "_args": [
     [
-      "https-proxy-agent@1.0.0",
+      "https-proxy-agent@2.2.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "https-proxy-agent@1.0.0",
-  "_id": "https-proxy-agent@1.0.0",
+  "_from": "https-proxy-agent@2.2.0",
+  "_id": "https-proxy-agent@2.2.0",
   "_inBundle": false,
-  "_integrity": "sha1-NffabEjOTdv6JkiRrFk+5f+GceY=",
+  "_integrity": "sha512-uUWcfXHvy/dwfM9bqa6AozvAjS32dZSTUYd/4SEpYKRg6LEcPLshksnQYRudM9AyNvUARMfAg5TLjUDyX/K4vA==",
   "_location": "/https-proxy-agent",
   "_phantomChildren": {
-    "ms": "2.0.0"
+    "es6-promisify": "5.0.0"
   },
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "https-proxy-agent@1.0.0",
+    "raw": "https-proxy-agent@2.2.0",
     "name": "https-proxy-agent",
     "escapedName": "https-proxy-agent",
-    "rawSpec": "1.0.0",
+    "rawSpec": "2.2.0",
     "saveSpec": null,
-    "fetchSpec": "1.0.0"
+    "fetchSpec": "2.2.0"
   },
   "_requiredBy": [
     "/pac-proxy-agent",
     "/proxy-agent",
     "/saucelabs"
   ],
-  "_resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-1.0.0.tgz",
-  "_spec": "1.0.0",
+  "_resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-2.2.0.tgz",
+  "_spec": "2.2.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "Nathan Rajlich",
@@ -41,15 +41,16 @@
     "url": "https://github.com/TooTallNate/node-https-proxy-agent/issues"
   },
   "dependencies": {
-    "agent-base": "2",
-    "debug": "2",
-    "extend": "3"
+    "agent-base": "^4.1.0",
+    "debug": "^3.1.0"
   },
   "description": "An HTTP(s) proxy `http.Agent` implementation for HTTPS",
   "devDependencies": {
-    "mocha": "2",
-    "proxy": "~0.2.3",
-    "semver": "~2.2.1"
+    "mocha": "^3.4.2",
+    "proxy": "^0.2.4"
+  },
+  "engines": {
+    "node": ">= 4.5.0"
   },
   "homepage": "https://github.com/TooTallNate/node-https-proxy-agent#readme",
   "keywords": [
@@ -59,7 +60,7 @@
     "agent"
   ],
   "license": "MIT",
-  "main": "https-proxy-agent.js",
+  "main": "./index.js",
   "name": "https-proxy-agent",
   "repository": {
     "type": "git",
@@ -68,5 +69,5 @@
   "scripts": {
     "test": "mocha --reporter spec"
   },
-  "version": "1.0.0"
+  "version": "2.2.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/iltorb/build/Release/iltorb.node
----------------------------------------------------------------------
diff --git a/node_modules/iltorb/build/Release/iltorb.node b/node_modules/iltorb/build/Release/iltorb.node
index bccad72..1844666 100755
Binary files a/node_modules/iltorb/build/Release/iltorb.node and b/node_modules/iltorb/build/Release/iltorb.node differ

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/iltorb/build/bindings/iltorb.node
----------------------------------------------------------------------
diff --git a/node_modules/iltorb/build/bindings/iltorb.node b/node_modules/iltorb/build/bindings/iltorb.node
index bccad72..1844666 100755
Binary files a/node_modules/iltorb/build/bindings/iltorb.node and b/node_modules/iltorb/build/bindings/iltorb.node differ

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/is-buffer/package.json
----------------------------------------------------------------------
diff --git a/node_modules/is-buffer/package.json b/node_modules/is-buffer/package.json
index e2f5ffb..b1a9f88 100644
--- a/node_modules/is-buffer/package.json
+++ b/node_modules/is-buffer/package.json
@@ -23,9 +23,7 @@
     "fetchSpec": "1.1.6"
   },
   "_requiredBy": [
-    "/kind-of",
-    "/randomatic/is-number/kind-of",
-    "/randomatic/kind-of"
+    "/kind-of"
   ],
   "_resolved": "https://registry.npmjs.org/is-buffer/-/is-buffer-1.1.6.tgz",
   "_spec": "1.1.6",

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/loggly/node_modules/tunnel-agent/index.js
----------------------------------------------------------------------
diff --git a/node_modules/loggly/node_modules/tunnel-agent/index.js b/node_modules/loggly/node_modules/tunnel-agent/index.js
index 68013ac..3ee9abc 100644
--- a/node_modules/loggly/node_modules/tunnel-agent/index.js
+++ b/node_modules/loggly/node_modules/tunnel-agent/index.js
@@ -7,6 +7,7 @@ var net = require('net')
   , events = require('events')
   , assert = require('assert')
   , util = require('util')
+  , Buffer = require('safe-buffer').Buffer
   ;
 
 exports.httpOverHttp = httpOverHttp
@@ -118,7 +119,7 @@ TunnelingAgent.prototype.createSocket = function createSocket(options, cb) {
   var placeholder = {}
   self.sockets.push(placeholder)
 
-  var connectOptions = mergeOptions({}, self.proxyOptions, 
+  var connectOptions = mergeOptions({}, self.proxyOptions,
     { method: 'CONNECT'
     , path: options.host + ':' + options.port
     , agent: false
@@ -127,7 +128,7 @@ TunnelingAgent.prototype.createSocket = function createSocket(options, cb) {
   if (connectOptions.proxyAuth) {
     connectOptions.headers = connectOptions.headers || {}
     connectOptions.headers['Proxy-Authorization'] = 'Basic ' +
-        new Buffer(connectOptions.proxyAuth).toString('base64')
+        Buffer.from(connectOptions.proxyAuth).toString('base64')
   }
 
   debug('making CONNECT request')
@@ -183,7 +184,7 @@ TunnelingAgent.prototype.createSocket = function createSocket(options, cb) {
 TunnelingAgent.prototype.removeSocket = function removeSocket(socket) {
   var pos = this.sockets.indexOf(socket)
   if (pos === -1) return
-  
+
   this.sockets.splice(pos, 1)
 
   var pending = this.requests.shift()
@@ -198,7 +199,7 @@ function createSecureSocket(options, cb) {
   var self = this
   TunnelingAgent.prototype.createSocket.call(self, options, function(socket) {
     // 0 is dummy port for v0.6
-    var secureSocket = tls.connect(0, mergeOptions({}, self.options, 
+    var secureSocket = tls.connect(0, mergeOptions({}, self.options,
       { servername: options.host
       , socket: socket
       }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/loggly/node_modules/tunnel-agent/package.json
----------------------------------------------------------------------
diff --git a/node_modules/loggly/node_modules/tunnel-agent/package.json b/node_modules/loggly/node_modules/tunnel-agent/package.json
index 6e6a04e..7748301 100644
--- a/node_modules/loggly/node_modules/tunnel-agent/package.json
+++ b/node_modules/loggly/node_modules/tunnel-agent/package.json
@@ -1,33 +1,33 @@
 {
   "_args": [
     [
-      "tunnel-agent@0.4.3",
+      "tunnel-agent@0.6.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "tunnel-agent@0.4.3",
-  "_id": "tunnel-agent@0.4.3",
+  "_from": "tunnel-agent@0.6.0",
+  "_id": "tunnel-agent@0.6.0",
   "_inBundle": false,
-  "_integrity": "sha1-Y3PbdpCf5XDgjXNYM2Xtgop07us=",
+  "_integrity": "sha1-J6XeoGs2sEoKmWZ3SykIaPD8QP0=",
   "_location": "/loggly/tunnel-agent",
   "_optional": true,
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "tunnel-agent@0.4.3",
+    "raw": "tunnel-agent@0.6.0",
     "name": "tunnel-agent",
     "escapedName": "tunnel-agent",
-    "rawSpec": "0.4.3",
+    "rawSpec": "0.6.0",
     "saveSpec": null,
-    "fetchSpec": "0.4.3"
+    "fetchSpec": "0.6.0"
   },
   "_requiredBy": [
     "/loggly/request"
   ],
-  "_resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.4.3.tgz",
-  "_spec": "0.4.3",
+  "_resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.6.0.tgz",
+  "_spec": "0.6.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "Mikeal Rogers",
@@ -37,7 +37,9 @@
   "bugs": {
     "url": "https://github.com/mikeal/tunnel-agent/issues"
   },
-  "dependencies": {},
+  "dependencies": {
+    "safe-buffer": "^5.0.1"
+  },
   "description": "HTTP proxy tunneling agent. Formerly part of mikeal/request, now a standalone module.",
   "devDependencies": {},
   "engines": {
@@ -54,5 +56,5 @@
   "repository": {
     "url": "git+https://github.com/mikeal/tunnel-agent.git"
   },
-  "version": "0.4.3"
+  "version": "0.6.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/loggly/package.json
----------------------------------------------------------------------
diff --git a/node_modules/loggly/package.json b/node_modules/loggly/package.json
index 3358d15..d90a8d2 100644
--- a/node_modules/loggly/package.json
+++ b/node_modules/loggly/package.json
@@ -31,8 +31,9 @@
     "mime-types": "2.1.18",
     "oauth-sign": "0.8.2",
     "pinkie-promise": "2.0.1",
+    "safe-buffer": "5.1.2",
     "sshpk": "1.14.1",
-    "stringstream": "0.0.5",
+    "stringstream": "0.0.6",
     "tough-cookie": "2.3.4",
     "util-deprecate": "1.0.2"
   },

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/.coveralls.yml
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/.coveralls.yml b/node_modules/mailgun-js/node_modules/debug/.coveralls.yml
new file mode 100644
index 0000000..20a7068
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/.coveralls.yml
@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/.eslintrc b/node_modules/mailgun-js/node_modules/debug/.eslintrc
new file mode 100644
index 0000000..146371e
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/.eslintrc
@@ -0,0 +1,14 @@
+{
+  "env": {
+    "browser": true,
+    "node": true
+  },
+  "globals": {
+    "chrome": true
+  },
+  "rules": {
+    "no-console": 0,
+    "no-empty": [1, { "allowEmptyCatch": true }]
+  },
+  "extends": "eslint:recommended"
+}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/.jshintrc
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/.jshintrc b/node_modules/mailgun-js/node_modules/debug/.jshintrc
deleted file mode 100644
index 299877f..0000000
--- a/node_modules/mailgun-js/node_modules/debug/.jshintrc
+++ /dev/null
@@ -1,3 +0,0 @@
-{
-  "laxbreak": true
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/.npmignore
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/.npmignore b/node_modules/mailgun-js/node_modules/debug/.npmignore
index 7e6163d..5f60eec 100644
--- a/node_modules/mailgun-js/node_modules/debug/.npmignore
+++ b/node_modules/mailgun-js/node_modules/debug/.npmignore
@@ -4,3 +4,6 @@ examples
 example
 *.sock
 dist
+yarn.lock
+coverage
+bower.json

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/.travis.yml b/node_modules/mailgun-js/node_modules/debug/.travis.yml
new file mode 100644
index 0000000..a764300
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/.travis.yml
@@ -0,0 +1,20 @@
+sudo: false
+
+language: node_js
+
+node_js:
+  - "4"
+  - "6"
+  - "8"
+
+install:
+  - make install
+
+script:
+  - make lint
+  - make test
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/mailgun-js/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/mailgun-js/node_modules/debug/CHANGELOG.md b/node_modules/mailgun-js/node_modules/debug/CHANGELOG.md
new file mode 100644
index 0000000..820d21e
--- /dev/null
+++ b/node_modules/mailgun-js/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,395 @@
+
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
+2.6.9 / 2017-09-22
+==================
+
+  * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+  * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+  * Fix: Inline extend function in node implementation (#452, @dougwilson)
+  * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+  
+  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+  * Misc: clean up browser reference checks (#447, @thebigredgeek)
+  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+  * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+  * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+  * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+  * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+  * Docs: fixed README typo (#391, @lurch)
+  * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+  * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+  * Fix: wrong reference in bower file (@thebigredgeek)
+  * Fix: webworker compatibility (@thebigredgeek)
+  * Fix: output formatting issue (#388, @kribblo)
+  * Fix: babel-loader compatibility (#383, @escwald)
+  * Misc: removed built asset from repo and publications (@thebigredgeek)
+  * Misc: moved source files to /src (#378, @yamikuronue)
+  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+  * Test: coveralls integration (#378, @yamikuronue)
+  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+  * Fix: custom log function (#379, @hsiliev)
+  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+  * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+  * Fix: browser colors (#367, @tootallnate)
+  * Misc: travis ci integration (@thebigredgeek)
+  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+  * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+  * Fix: revert "handle regex special characters" (@tootallnate)
+  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+  * Improvement: allow colors in workers (#335, @botverse)
+  * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+  * Fix: be super-safe in index.js as well (@TooTallNate)
+  * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+  * Fix: Added electron compatibility (#324, @paulcbetts)
+  * Improvement: Added performance optimizations (@tootallnate)
+  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+  * Readme: fix USE_COLORS to DEBUG_COLORS
+  * Readme: Doc fixes for format string sugar (#269, @mlucool)
+  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+  * Readme: better docs for browser support (#224, @matthewmueller)
+  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+  * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+  * package: update "ms" to v0.7.1 (#202, @dougwilson)
+  * README: add logging to file example (#193, @DanielOchoa)
+  * README: fixed a typo (#191, @amir-s)
+  * browser: expose `storage` (#190, @stephenmathieson)
+  * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+  * Updated stdout/stderr example (#186)
+  * Updated example/stdout.js to match debug current behaviour
+  * Renamed example/stderr.js to stdout.js
+  * Update Readme.md (#184)
+  * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+  * dist: recompile
+  * update "ms" to v0.7.0
+  * package: update "browserify" to v9.0.3
+  * component: fix "ms.js" repo location
+  * changed bower package name
+  * updated documentation about using debug in a browser
+  * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+  * browser: use `typeof` to check for `console` existence
+  * browser: check for `console.log` truthiness (fix IE 8/9)
+  * browser: add support for Chrome apps
+  * Readme: added Windows usage remarks
+  * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+  * node: implement `DEBUG_FD` env variable support
+  * package: update "browserify" to v6.1.0
+  * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+  * package: update "browserify" to v5.11.0
+  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+  * dist: recompile
+  * example: remove `console.info()` log usage
+  * example: add "Content-Type" UTF-8 header to browser example
+  * browser: place %c marker after the space character
+  * browser: reset the "content" color via `color: inherit`
+  * browser: add colors support for Firefox >= v31
+  * debug: prefer an instance `log()` function over the global one (#119)
+  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+  * Add support for multiple wildcards in namespaces (#122, @seegno)
+  * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+  * browser: update color palette (#113, @gscottolson)
+  * common: make console logging function configurable (#108, @timoxley)
+  * node: fix %o colors on old node <= 0.8.x
+  * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+  * browser: use `removeItem()` to clear localStorage
+  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+  * package: add "contributors" section
+  * node: fix comment typo
+  * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+  * make ms diff be global, not be scope
+  * debug: ignore empty strings in enable()
+  * node: make DEBUG_COLORS able to disable coloring
+  * *: export the `colors` array
+  * npmignore: don't publish the `dist` dir
+  * Makefile: refactor to use browserify
+  * package: add "browserify" as a dev dependency
+  * Readme: add Web Inspector Colors section
+  * node: reset terminal color for the debug content
+  * node: map "%o" to `util.inspect()`
+  * browser: map "%j" to `JSON.stringify()`
+  * debug: add custom "formatters"
+  * debug: use "ms" module for humanizing the diff
+  * Readme: add "bash" syntax highlighting
+  * browser: add Firebug color support
+  * browser: add colors for WebKit browsers
+  * node: apply log to `console`
+  * rewrite: abstract common logic for Node & browsers
+  * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+  * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+  * add `enable()` method for nodejs. Closes #27
+  * change from stderr to stdout
+  * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+  * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+  * fix: catch localStorage security error when cookies are blocked (Chrome)
+  * add debug(err) support. Closes #46
+  * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+  * fix package.json
+  * fix: Mobile Safari (private mode) is broken with debug
+  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+  * add repository URL to package.json
+  * add DEBUG_COLORED to force colored output
+  * add browserify support
+  * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+  * Added .component to package.json
+  * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+  * Added support for "-" prefix in DEBUG [Vinay Pulim]
+  * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+  * Added: humanize diffs. Closes #8
+  * Added `debug.disable()` to the CS variant
+  * Removed padding. Closes #10
+  * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+  * Added browser variant support for older browsers [TooTallNate]
+  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+  * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+  * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+  * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+  * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release

[03/13] nifi-fds git commit: gh-pages update nifi-fds-0.1.0

Posted by sc...@apache.org.
http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/pac-proxy-agent/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/pac-proxy-agent/node_modules/debug/README.md b/node_modules/pac-proxy-agent/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/pac-proxy-agent/node_modules/debug/README.md
+++ b/node_modules/pac-proxy-agent/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/pac-proxy-agent/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/pac-proxy-agent/node_modules/debug/component.json b/node_modules/pac-proxy-agent/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/pac-proxy-agent/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/pac-proxy-agent/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/pac-proxy-agent/node_modules/debug/package.json b/node_modules/pac-proxy-agent/node_modules/debug/package.json
index 509d2ec..77e4b3b 100644
--- a/node_modules/pac-proxy-agent/node_modules/debug/package.json
+++ b/node_modules/pac-proxy-agent/node_modules/debug/package.json
@@ -1,33 +1,33 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/pac-proxy-agent/debug",
   "_optional": true,
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/pac-proxy-agent"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -37,12 +37,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -59,7 +53,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -89,5 +83,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/portfinder/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/portfinder/node_modules/debug/.eslintrc b/node_modules/portfinder/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/portfinder/node_modules/debug/.eslintrc
+++ b/node_modules/portfinder/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/portfinder/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/portfinder/node_modules/debug/.travis.yml b/node_modules/portfinder/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/portfinder/node_modules/debug/.travis.yml
+++ b/node_modules/portfinder/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/portfinder/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/portfinder/node_modules/debug/CHANGELOG.md b/node_modules/portfinder/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/portfinder/node_modules/debug/CHANGELOG.md
+++ b/node_modules/portfinder/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/portfinder/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/portfinder/node_modules/debug/Makefile b/node_modules/portfinder/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/portfinder/node_modules/debug/Makefile
+++ b/node_modules/portfinder/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/portfinder/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/portfinder/node_modules/debug/README.md b/node_modules/portfinder/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/portfinder/node_modules/debug/README.md
+++ b/node_modules/portfinder/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/portfinder/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/portfinder/node_modules/debug/component.json b/node_modules/portfinder/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/portfinder/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/portfinder/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/portfinder/node_modules/debug/package.json b/node_modules/portfinder/node_modules/debug/package.json
index f3f5f89..36ca23f 100644
--- a/node_modules/portfinder/node_modules/debug/package.json
+++ b/node_modules/portfinder/node_modules/debug/package.json
@@ -1,32 +1,32 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/portfinder/debug",
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/portfinder"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -36,12 +36,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -58,7 +52,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -88,5 +82,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/proxy-agent/node_modules/debug/.eslintrc
----------------------------------------------------------------------
diff --git a/node_modules/proxy-agent/node_modules/debug/.eslintrc b/node_modules/proxy-agent/node_modules/debug/.eslintrc
index 8a37ae2..146371e 100644
--- a/node_modules/proxy-agent/node_modules/debug/.eslintrc
+++ b/node_modules/proxy-agent/node_modules/debug/.eslintrc
@@ -3,6 +3,9 @@
     "browser": true,
     "node": true
   },
+  "globals": {
+    "chrome": true
+  },
   "rules": {
     "no-console": 0,
     "no-empty": [1, { "allowEmptyCatch": true }]

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/proxy-agent/node_modules/debug/.travis.yml
----------------------------------------------------------------------
diff --git a/node_modules/proxy-agent/node_modules/debug/.travis.yml b/node_modules/proxy-agent/node_modules/debug/.travis.yml
index 6c6090c..a764300 100644
--- a/node_modules/proxy-agent/node_modules/debug/.travis.yml
+++ b/node_modules/proxy-agent/node_modules/debug/.travis.yml
@@ -1,14 +1,20 @@
+sudo: false
 
 language: node_js
+
 node_js:
-  - "6"
-  - "5"
   - "4"
+  - "6"
+  - "8"
 
 install:
-  - make node_modules
+  - make install
 
 script:
   - make lint
   - make test
-  - make coveralls
+
+matrix:
+  include:
+  - node_js: '8'
+    env: BROWSER=1

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/proxy-agent/node_modules/debug/CHANGELOG.md
----------------------------------------------------------------------
diff --git a/node_modules/proxy-agent/node_modules/debug/CHANGELOG.md b/node_modules/proxy-agent/node_modules/debug/CHANGELOG.md
index eadaa18..820d21e 100644
--- a/node_modules/proxy-agent/node_modules/debug/CHANGELOG.md
+++ b/node_modules/proxy-agent/node_modules/debug/CHANGELOG.md
@@ -1,4 +1,37 @@
 
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
 2.6.9 / 2017-09-22
 ==================
 
@@ -27,7 +60,7 @@
 2.6.4 / 2017-04-20
 ==================
 
-  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
   * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
   * Misc: update "ms" to v0.7.3 (@tootallnate)
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/proxy-agent/node_modules/debug/Makefile
----------------------------------------------------------------------
diff --git a/node_modules/proxy-agent/node_modules/debug/Makefile b/node_modules/proxy-agent/node_modules/debug/Makefile
index 584da8b..3ddd136 100644
--- a/node_modules/proxy-agent/node_modules/debug/Makefile
+++ b/node_modules/proxy-agent/node_modules/debug/Makefile
@@ -15,36 +15,44 @@ YARN ?= $(shell which yarn)
 PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
 BROWSERIFY ?= $(NODE) $(BIN)/browserify
 
-.FORCE:
-
 install: node_modules
 
+browser: dist/debug.js
+
 node_modules: package.json
 	@NODE_ENV= $(PKG) install
 	@touch node_modules
 
-lint: .FORCE
-	eslint browser.js debug.js index.js node.js
-
-test-node: .FORCE
-	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
-
-test-browser: .FORCE
-	mkdir -p dist
-
+dist/debug.js: src/*.js node_modules
+	@mkdir -p dist
 	@$(BROWSERIFY) \
 		--standalone debug \
 		. > dist/debug.js
 
-	karma start --single-run
-	rimraf dist
+lint:
+	@eslint *.js src/*.js
+
+test-node:
+	@istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+	@cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
 
-test: .FORCE
-	concurrently \
+test-browser:
+	@$(MAKE) browser
+	@karma start --single-run
+
+test-all:
+	@concurrently \
 		"make test-node" \
 		"make test-browser"
 
-coveralls:
-	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+test:
+	@if [ "x$(BROWSER)" = "x" ]; then \
+		$(MAKE) test-node; \
+		else \
+		$(MAKE) test-browser; \
+	fi
+
+clean:
+	rimraf dist coverage
 
-.PHONY: all install clean distclean
+.PHONY: browser install clean lint test test-all test-node test-browser

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/proxy-agent/node_modules/debug/README.md
----------------------------------------------------------------------
diff --git a/node_modules/proxy-agent/node_modules/debug/README.md b/node_modules/proxy-agent/node_modules/debug/README.md
index f67be6b..8e754d1 100644
--- a/node_modules/proxy-agent/node_modules/debug/README.md
+++ b/node_modules/proxy-agent/node_modules/debug/README.md
@@ -1,12 +1,11 @@
 # debug
-[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
 [![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
 
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-
-A tiny node.js debugging utility modelled after node core's debugging technique.
-
-**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
 
 ## Installation
 
@@ -18,7 +17,7 @@ $ npm install debug
 
 `debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
 
-Example _app.js_:
+Example [_app.js_](./examples/node/app.js):
 
 ```js
 var debug = require('debug')('http')
@@ -27,7 +26,7 @@ var debug = require('debug')('http')
 
 // fake app
 
-debug('booting %s', name);
+debug('booting %o', name);
 
 http.createServer(function(req, res){
   debug(req.method + ' ' + req.url);
@@ -41,81 +40,128 @@ http.createServer(function(req, res){
 require('./worker');
 ```
 
-Example _worker.js_:
+Example [_worker.js_](./examples/node/worker.js):
 
 ```js
-var debug = require('debug')('worker');
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
 
-setInterval(function(){
-  debug('doing some work');
-}, 1000);
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
 ```
 
- The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
 
-  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+Here are some examples:
 
-  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
 
 #### Windows note
 
- On Windows the environment variable is set using the `set` command.
+On Windows the environment variable is set using the `set` command.
 
- ```cmd
- set DEBUG=*,-not_this
- ```
+```cmd
+set DEBUG=*,-not_this
+```
 
- Note that PowerShell uses different syntax to set environment variables.
+Note that PowerShell uses different syntax to set environment variables.
 
- ```cmd
- $env:DEBUG = "*,-not_this"
-  ```
+```cmd
+$env:DEBUG = "*,-not_this"
+```
 
 Then, run the program to be debugged as usual.
 
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
 ## Millisecond diff
 
-  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
 
-  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
 
-  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
 
-  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
 
 ## Conventions
 
-  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
 
 ## Wildcards
 
-  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
 
-  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
 
 ## Environment Variables
 
-  When running through Node.js, you can set a few environment variables that will
-  change the behavior of the debug logging:
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
 
 | Name      | Purpose                                         |
 |-----------|-------------------------------------------------|
 | `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
 | `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
-| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
 | `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
 
 
-  __Note:__ The environment variables beginning with `DEBUG_` end up being
-  converted into an Options object that gets used with `%o`/`%O` formatters.
-  See the Node.js documentation for
-  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
-  for the complete list.
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
 
 ## Formatters
 
-
-  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
 
 | Formatter | Representation |
 |-----------|----------------|
@@ -126,9 +172,12 @@ Then, run the program to be debugged as usual.
 | `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
 | `%%`      | Single percent sign ('%'). This does not consume an argument. |
 
+
 ### Custom formatters
 
-  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
 
 ```js
 const createDebug = require('debug')
@@ -142,14 +191,16 @@ debug('this is hex: %h', new Buffer('hello world'))
 //   foo this is hex: 68656c6c6f20776f726c6421 +0ms
 ```
 
-## Browser support
-  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
-  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
-  if you don't want to build it yourself.
 
-  Debug's enable state is currently persisted by `localStorage`.
-  Consider the situation shown below where you have `worker:a` and `worker:b`,
-  and wish to debug both. You can enable this using `localStorage.debug`:
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
 
 ```js
 localStorage.debug = 'worker:*'
@@ -170,23 +221,12 @@ setInterval(function(){
 }, 1200);
 ```
 
-#### Web Inspector Colors
-
-  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
-  option. These are WebKit web inspectors, Firefox ([since version
-  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
-  and the Firebug plugin for Firefox (any version).
-
-  Colored output looks something like:
-
-  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
-
 
 ## Output streams
 
   By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
 
-Example _stdout.js_:
+Example [_stdout.js_](./examples/node/stdout.js):
 
 ```js
 var debug = require('debug');
@@ -208,13 +248,29 @@ error('now goes to stdout via console.info');
 log('still goes to stdout, but via console.info now');
 ```
 
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
 
 ## Authors
 
  - TJ Holowaychuk
  - Nathan Rajlich
  - Andrew Rhyne
- 
+
 ## Backers
 
 Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
@@ -290,7 +346,7 @@ Become a sponsor and get your logo on our README on Github with a link to your s
 
 (The MIT License)
 
-Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/proxy-agent/node_modules/debug/component.json
----------------------------------------------------------------------
diff --git a/node_modules/proxy-agent/node_modules/debug/component.json b/node_modules/proxy-agent/node_modules/debug/component.json
deleted file mode 100644
index 9de2641..0000000
--- a/node_modules/proxy-agent/node_modules/debug/component.json
+++ /dev/null
@@ -1,19 +0,0 @@
-{
-  "name": "debug",
-  "repo": "visionmedia/debug",
-  "description": "small debugging utility",
-  "version": "2.6.9",
-  "keywords": [
-    "debug",
-    "log",
-    "debugger"
-  ],
-  "main": "src/browser.js",
-  "scripts": [
-    "src/browser.js",
-    "src/debug.js"
-  ],
-  "dependencies": {
-    "rauchg/ms.js": "0.7.1"
-  }
-}

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/proxy-agent/node_modules/debug/package.json
----------------------------------------------------------------------
diff --git a/node_modules/proxy-agent/node_modules/debug/package.json b/node_modules/proxy-agent/node_modules/debug/package.json
index a007dfb..9ac79c0 100644
--- a/node_modules/proxy-agent/node_modules/debug/package.json
+++ b/node_modules/proxy-agent/node_modules/debug/package.json
@@ -1,33 +1,33 @@
 {
   "_args": [
     [
-      "debug@2.6.9",
+      "debug@3.1.0",
       "/Users/scottyaslan/Development/nifi-fds/target"
     ]
   ],
   "_development": true,
-  "_from": "debug@2.6.9",
-  "_id": "debug@2.6.9",
+  "_from": "debug@3.1.0",
+  "_id": "debug@3.1.0",
   "_inBundle": false,
-  "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+  "_integrity": "sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g==",
   "_location": "/proxy-agent/debug",
   "_optional": true,
   "_phantomChildren": {},
   "_requested": {
     "type": "version",
     "registry": true,
-    "raw": "debug@2.6.9",
+    "raw": "debug@3.1.0",
     "name": "debug",
     "escapedName": "debug",
-    "rawSpec": "2.6.9",
+    "rawSpec": "3.1.0",
     "saveSpec": null,
-    "fetchSpec": "2.6.9"
+    "fetchSpec": "3.1.0"
   },
   "_requiredBy": [
     "/proxy-agent"
   ],
-  "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
-  "_spec": "2.6.9",
+  "_resolved": "https://registry.npmjs.org/debug/-/debug-3.1.0.tgz",
+  "_spec": "3.1.0",
   "_where": "/Users/scottyaslan/Development/nifi-fds/target",
   "author": {
     "name": "TJ Holowaychuk",
@@ -37,12 +37,6 @@
   "bugs": {
     "url": "https://github.com/visionmedia/debug/issues"
   },
-  "component": {
-    "scripts": {
-      "debug/index.js": "browser.js",
-      "debug/debug.js": "debug.js"
-    }
-  },
   "contributors": [
     {
       "name": "Nathan Rajlich",
@@ -59,7 +53,7 @@
   },
   "description": "small debugging utility",
   "devDependencies": {
-    "browserify": "9.0.3",
+    "browserify": "14.4.0",
     "chai": "^3.5.0",
     "concurrently": "^3.1.0",
     "coveralls": "^2.11.15",
@@ -89,5 +83,5 @@
     "type": "git",
     "url": "git://github.com/visionmedia/debug.git"
   },
-  "version": "2.6.9"
+  "version": "3.1.0"
 }

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/LICENSE
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/LICENSE b/node_modules/randomatic/LICENSE
index 3ea7267..38a4a0b 100755
--- a/node_modules/randomatic/LICENSE
+++ b/node_modules/randomatic/LICENSE
@@ -1,6 +1,6 @@
 The MIT License (MIT)
 
-Copyright (c) 2013-2017, Jon Schlinkert
+Copyright (c) 2013-2017, Jon Schlinkert.
 
 Permission is hereby granted, free of charge, to any person obtaining a copy
 of this software and associated documentation files (the "Software"), to deal

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/README.md
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/README.md b/node_modules/randomatic/README.md
index 14485ff..f099587 100644
--- a/node_modules/randomatic/README.md
+++ b/node_modules/randomatic/README.md
@@ -1,6 +1,8 @@
 # randomatic [![NPM version](https://img.shields.io/npm/v/randomatic.svg?style=flat)](https://www.npmjs.com/package/randomatic) [![NPM monthly downloads](https://img.shields.io/npm/dm/randomatic.svg?style=flat)](https://npmjs.org/package/randomatic) [![NPM total downloads](https://img.shields.io/npm/dt/randomatic.svg?style=flat)](https://npmjs.org/package/randomatic) [![Linux Build Status](https://img.shields.io/travis/jonschlinkert/randomatic.svg?style=flat&label=Travis)](https://travis-ci.org/jonschlinkert/randomatic)
 
-> Generate randomized strings of a specified length, fast. Only the length is necessary, but you can optionally generate patterns using any combination of numeric, alpha-numeric, alphabetical, special or custom characters.
+> Generate randomized strings of a specified length using simple character sequences. The original generate-password.
+
+Please consider following this project's author, [Jon Schlinkert](https://github.com/jonschlinkert), and consider starring the project to show your :heart: and support.
 
 ## Install
 
@@ -22,8 +24,9 @@ var randomize = require('randomatic');
 randomize(pattern, length, options);
 ```
 
-* `pattern` **{String}**: The pattern to use for randomizing
-* `length` **{Object}**: The length of the string to generate
+* `pattern` **{String}**: (required) The pattern to use for randomizing
+* `length` **{Number}**: (optional) The length of the string to generate
+* `options` **{Object}**: (optional) See available [options](#options)
 
 ### pattern
 
@@ -37,10 +40,10 @@ To generate a 10-character randomized string using all available characters:
 
 ```js
 randomize('*', 10);
-//=>
+//=> 'x2_^-5_T[$'
 
 randomize('Aa0!', 10);
-//=>
+//=> 'LV3u~BSGhw'
 ```
 
 * `a`: Lowercase alpha characters (`abcdefghijklmnopqrstuvwxyz'`)
@@ -99,27 +102,26 @@ _The order in which the characters are defined is insignificant._
 
 ## About
 
-### Related projects
+<details>
+<summary><strong>Contributing</strong></summary>
 
-* [pad-left](https://www.npmjs.com/package/pad-left): Left pad a string with zeros or a specified string. Fastest implementation. | [homepage](https://github.com/jonschlinkert/pad-left "Left pad a string with zeros or a specified string. Fastest implementation.")
-* [pad-right](https://www.npmjs.com/package/pad-right): Right pad a string with zeros or a specified string. Fastest implementation. | [homepage](https://github.com/jonschlinkert/pad-right "Right pad a string with zeros or a specified string. Fastest implementation.")
-* [repeat-string](https://www.npmjs.com/package/repeat-string): Repeat the given string n times. Fastest implementation for repeating a string. | [homepage](https://github.com/jonschlinkert/repeat-string "Repeat the given string n times. Fastest implementation for repeating a string.")
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
 
-### Contributing
+</details>
 
-Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
+<details>
+<summary><strong>Running Tests</strong></summary>
 
-### Contributors
+Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command:
 
-| **Commits** | **Contributor** | 
-| --- | --- |
-| 41 | [jonschlinkert](https://github.com/jonschlinkert) |
-| 1 | [TrySound](https://github.com/TrySound) |
-| 1 | [Drag0s](https://github.com/Drag0s) |
-| 1 | [paulmillr](https://github.com/paulmillr) |
-| 1 | [sunknudsen](https://github.com/sunknudsen) |
+```sh
+$ npm install && npm test
+```
+
+</details>
 
-### Building docs
+<details>
+<summary><strong>Building docs</strong></summary>
 
 _(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_
 
@@ -129,13 +131,27 @@ To generate the readme, run the following command:
 $ npm install -g verbose/verb#dev verb-generate-readme && verb
 ```
 
-### Running tests
+</details>
 
-Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command:
+### Related projects
 
-```sh
-$ npm install && npm test
-```
+You might also be interested in these projects:
+
+* [pad-left](https://www.npmjs.com/package/pad-left): Left pad a string with zeros or a specified string. Fastest implementation. | [homepage](https://github.com/jonschlinkert/pad-left "Left pad a string with zeros or a specified string. Fastest implementation.")
+* [pad-right](https://www.npmjs.com/package/pad-right): Right pad a string with zeros or a specified string. Fastest implementation. | [homepage](https://github.com/jonschlinkert/pad-right "Right pad a string with zeros or a specified string. Fastest implementation.")
+* [repeat-string](https://www.npmjs.com/package/repeat-string): Repeat the given string n times. Fastest implementation for repeating a string. | [homepage](https://github.com/jonschlinkert/repeat-string "Repeat the given string n times. Fastest implementation for repeating a string.")
+
+### Contributors
+
+| **Commits** | **Contributor** | 
+| --- | --- |
+| 48 | [jonschlinkert](https://github.com/jonschlinkert) |
+| 2 | [realityking](https://github.com/realityking) |
+| 1 | [TrySound](https://github.com/TrySound) |
+| 1 | [Drag0s](https://github.com/Drag0s) |
+| 1 | [paulmillr](https://github.com/paulmillr) |
+| 1 | [sunknudsen](https://github.com/sunknudsen) |
+| 1 | [faizulhaque-tp](https://github.com/faizulhaque-tp) |
 
 ### Author
 
@@ -151,4 +167,4 @@ Released under the [MIT License](LICENSE).
 
 ***
 
-_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.6.0, on June 09, 2017._
\ No newline at end of file
+_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.6.0, on October 19, 2017._
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/index.js
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/index.js b/node_modules/randomatic/index.js
index 4681b03..b6df991 100644
--- a/node_modules/randomatic/index.js
+++ b/node_modules/randomatic/index.js
@@ -9,12 +9,14 @@
 
 var isNumber = require('is-number');
 var typeOf = require('kind-of');
+var mathRandom = require('math-random');
 
 /**
  * Expose `randomatic`
  */
 
 module.exports = randomatic;
+module.exports.isCrypto = !!mathRandom.cryptographic;
 
 /**
  * Available mask characters
@@ -51,7 +53,9 @@ function randomatic(pattern, length, options) {
       length = pattern.length;
 
     } else if (isNumber(pattern)) {
-      options = {}; length = pattern; pattern = '*';
+      options = {};
+      length = pattern;
+      pattern = '*';
     }
   }
 
@@ -76,7 +80,7 @@ function randomatic(pattern, length, options) {
   if (custom) mask += pattern;
 
   while (length--) {
-    res += mask.charAt(parseInt(Math.random() * mask.length, 10));
+    res += mask.charAt(parseInt(mathRandom() * mask.length, 10));
   }
   return res;
 };

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/is-number/LICENSE
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/is-number/LICENSE b/node_modules/randomatic/node_modules/is-number/LICENSE
index 842218c..3f2eca1 100644
--- a/node_modules/randomatic/node_modules/is-number/LICENSE
+++ b/node_modules/randomatic/node_modules/is-number/LICENSE
@@ -1,6 +1,6 @@
 The MIT License (MIT)
 
-Copyright (c) 2014-2016, Jon Schlinkert
+Copyright (c) 2014-2017, Jon Schlinkert.
 
 Permission is hereby granted, free of charge, to any person obtaining a copy
 of this software and associated documentation files (the "Software"), to deal

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/is-number/README.md
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/is-number/README.md b/node_modules/randomatic/node_modules/is-number/README.md
index 281165d..6436992 100644
--- a/node_modules/randomatic/node_modules/is-number/README.md
+++ b/node_modules/randomatic/node_modules/is-number/README.md
@@ -1,7 +1,9 @@
-# is-number [![NPM version](https://img.shields.io/npm/v/is-number.svg?style=flat)](https://www.npmjs.com/package/is-number) [![NPM downloads](https://img.shields.io/npm/dm/is-number.svg?style=flat)](https://npmjs.org/package/is-number) [![Build Status](https://img.shields.io/travis/jonschlinkert/is-number.svg?style=flat)](https://travis-ci.org/jonschlinkert/is-number)
+# is-number [![NPM version](https://img.shields.io/npm/v/is-number.svg?style=flat)](https://www.npmjs.com/package/is-number) [![NPM monthly downloads](https://img.shields.io/npm/dm/is-number.svg?style=flat)](https://npmjs.org/package/is-number) [![NPM total downloads](https://img.shields.io/npm/dt/is-number.svg?style=flat)](https://npmjs.org/package/is-number) [![Linux Build Status](https://img.shields.io/travis/jonschlinkert/is-number.svg?style=flat&label=Travis)](https://travis-ci.org/jonschlinkert/is-number)
 
 > Returns true if the value is a number. comprehensive tests.
 
+Please consider following this project's author, [Jon Schlinkert](https://github.com/jonschlinkert), and consider starring the project to show your :heart: and support.
+
 ## Install
 
 Install with [npm](https://www.npmjs.com/):
@@ -67,49 +69,67 @@ isNumber({abc: 'abc'})      //=> 'false'
 
 ## About
 
-### Related projects
-
-* [even](https://www.npmjs.com/package/even): Get the even numbered items from an array. | [homepage](https://github.com/jonschlinkert/even "Get the even numbered items from an array.")
-* [is-even](https://www.npmjs.com/package/is-even): Return true if the given number is even. | [homepage](https://github.com/jonschlinkert/is-even "Return true if the given number is even.")
-* [is-odd](https://www.npmjs.com/package/is-odd): Returns true if the given number is odd. | [homepage](https://github.com/jonschlinkert/is-odd "Returns true if the given number is odd.")
-* [is-primitive](https://www.npmjs.com/package/is-primitive): Returns `true` if the value is a primitive.  | [homepage](https://github.com/jonschlinkert/is-primitive "Returns `true` if the value is a primitive. ")
-* [kind-of](https://www.npmjs.com/package/kind-of): Get the native type of a value. | [homepage](https://github.com/jonschlinkert/kind-of "Get the native type of a value.")
-* [odd](https://www.npmjs.com/package/odd): Get the odd numbered items from an array. | [homepage](https://github.com/jonschlinkert/odd "Get the odd numbered items from an array.")
-
-### Contributing
+<details>
+<summary><strong>Contributing</strong></summary>
 
 Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
 
-### Building docs
+</details>
 
-_(This document was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme) (a [verb](https://github.com/verbose/verb) generator), please don't edit the readme directly. Any changes to the readme must be made in [.verb.md](.verb.md).)_
+<details>
+<summary><strong>Running Tests</strong></summary>
 
-To generate the readme and API documentation with [verb](https://github.com/verbose/verb):
+Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command:
 
 ```sh
-$ npm install -g verb verb-generate-readme && verb
+$ npm install && npm test
 ```
 
-### Running tests
+</details>
 
-Install dev dependencies:
+<details>
+<summary><strong>Building docs</strong></summary>
+
+_(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_
+
+To generate the readme, run the following command:
 
 ```sh
-$ npm install -d && npm test
+$ npm install -g verbose/verb#dev verb-generate-readme && verb
 ```
 
+</details>
+
+### Related projects
+
+You might also be interested in these projects:
+
+* [even](https://www.npmjs.com/package/even): Get the even numbered items from an array. | [homepage](https://github.com/jonschlinkert/even "Get the even numbered items from an array.")
+* [is-even](https://www.npmjs.com/package/is-even): Return true if the given number is even. | [homepage](https://github.com/jonschlinkert/is-even "Return true if the given number is even.")
+* [is-odd](https://www.npmjs.com/package/is-odd): Returns true if the given number is odd. | [homepage](https://github.com/jonschlinkert/is-odd "Returns true if the given number is odd.")
+* [is-primitive](https://www.npmjs.com/package/is-primitive): Returns `true` if the value is a primitive.  | [homepage](https://github.com/jonschlinkert/is-primitive "Returns `true` if the value is a primitive. ")
+* [kind-of](https://www.npmjs.com/package/kind-of): Get the native type of a value. | [homepage](https://github.com/jonschlinkert/kind-of "Get the native type of a value.")
+* [odd](https://www.npmjs.com/package/odd): Get the odd numbered items from an array. | [homepage](https://github.com/jonschlinkert/odd "Get the odd numbered items from an array.")
+
+### Contributors
+
+| **Commits** | **Contributor** | 
+| --- | --- |
+| 38 | [jonschlinkert](https://github.com/jonschlinkert) |
+| 5 | [charlike](https://github.com/charlike) |
+
 ### Author
 
 **Jon Schlinkert**
 
 * [github/jonschlinkert](https://github.com/jonschlinkert)
-* [twitter/jonschlinkert](http://twitter.com/jonschlinkert)
+* [twitter/jonschlinkert](https://twitter.com/jonschlinkert)
 
 ### License
 
-Copyright © 2016, [Jon Schlinkert](https://github.com/jonschlinkert).
-Released under the [MIT license](https://github.com/jonschlinkert/is-number/blob/master/LICENSE).
+Copyright © 2017, [Jon Schlinkert](https://github.com/jonschlinkert).
+Released under the [MIT License](LICENSE).
 
 ***
 
-_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.1.30, on September 10, 2016._
\ No newline at end of file
+_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.6.0, on October 17, 2017._
\ No newline at end of file

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/is-number/index.js
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/is-number/index.js b/node_modules/randomatic/node_modules/is-number/index.js
index 7a2a45b..5221f40 100644
--- a/node_modules/randomatic/node_modules/is-number/index.js
+++ b/node_modules/randomatic/node_modules/is-number/index.js
@@ -1,20 +1,19 @@
 /*!
  * is-number <https://github.com/jonschlinkert/is-number>
  *
- * Copyright (c) 2014-2015, Jon Schlinkert.
- * Licensed under the MIT License.
+ * Copyright (c) 2014-2017, Jon Schlinkert.
+ * Released under the MIT License.
  */
 
 'use strict';
 
-var typeOf = require('kind-of');
-
 module.exports = function isNumber(num) {
-  var type = typeOf(num);
+  var type = typeof num;
 
-  if (type === 'string') {
+  if (type === 'string' || num instanceof String) {
+    // an empty string would be coerced to true with the below logic
     if (!num.trim()) return false;
-  } else if (type !== 'number') {
+  } else if (type !== 'number' && !(num instanceof Number)) {
     return false;
   }
 

http://git-wip-us.apache.org/repos/asf/nifi-fds/blob/954e729f/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/LICENSE
----------------------------------------------------------------------
diff --git a/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/LICENSE b/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/LICENSE
deleted file mode 100644
index d734237..0000000
--- a/node_modules/randomatic/node_modules/is-number/node_modules/kind-of/LICENSE
+++ /dev/null
@@ -1,21 +0,0 @@
-The MIT License (MIT)
-
-Copyright (c) 2014-2017, Jon Schlinkert
-
-Permission is hereby granted, free of charge, to any person obtaining a copy
-of this software and associated documentation files (the "Software"), to deal
-in the Software without restriction, including without limitation the rights
-to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
-copies of the Software, and to permit persons to whom the Software is
-furnished to do so, subject to the following conditions:
-
-The above copyright notice and this permission notice shall be included in
-all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
-IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
-FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
-AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
-LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
-OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
-THE SOFTWARE.